diff options
| author | Louis Burda <quent.burda@gmail.com> | 2024-03-14 21:30:16 +0100 |
|---|---|---|
| committer | Louis Burda <quent.burda@gmail.com> | 2024-03-14 21:30:16 +0100 |
| commit | 4007ea18f294aefb6128cbe82c5446cd8cb72c50 (patch) | |
| tree | 0d6e38d202ac7be9a59192cd881a4de5d1713a71 /chall/src/js | |
| download | cscg24-lolpython-4007ea18f294aefb6128cbe82c5446cd8cb72c50.tar.gz cscg24-lolpython-4007ea18f294aefb6128cbe82c5446cd8cb72c50.zip | |
Add solution
Diffstat (limited to 'chall/src/js')
| -rw-r--r-- | chall/src/js/bootstrap.bundle.js | 6328 | ||||
| -rw-r--r-- | chall/src/js/bootstrap.bundle.min.js | 7 | ||||
| -rw-r--r-- | chall/src/js/bootstrap.js | 3894 | ||||
| -rw-r--r-- | chall/src/js/bootstrap.min.js | 7 | ||||
| -rw-r--r-- | chall/src/js/rockstar.js | 13 |
5 files changed, 10249 insertions, 0 deletions
diff --git a/chall/src/js/bootstrap.bundle.js b/chall/src/js/bootstrap.bundle.js new file mode 100644 index 0000000..45b357d --- /dev/null +++ b/chall/src/js/bootstrap.bundle.js @@ -0,0 +1,6328 @@ +/*! + * Bootstrap v4.0.0 (https://getbootstrap.com) + * Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors) + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + */ +(function (global, factory) { + typeof exports === 'object' && typeof module !== 'undefined' ? factory(exports, require('jquery')) : + typeof define === 'function' && define.amd ? define(['exports', 'jquery'], factory) : + (factory((global.bootstrap = {}),global.jQuery)); +}(this, (function (exports,$) { 'use strict'; + +$ = $ && $.hasOwnProperty('default') ? $['default'] : $; + +function _defineProperties(target, props) { + for (var i = 0; i < props.length; i++) { + var descriptor = props[i]; + descriptor.enumerable = descriptor.enumerable || false; + descriptor.configurable = true; + if ("value" in descriptor) descriptor.writable = true; + Object.defineProperty(target, descriptor.key, descriptor); + } +} + +function _createClass(Constructor, protoProps, staticProps) { + if (protoProps) _defineProperties(Constructor.prototype, protoProps); + if (staticProps) _defineProperties(Constructor, staticProps); + return Constructor; +} + +function _extends() { + _extends = Object.assign || function (target) { + for (var i = 1; i < arguments.length; i++) { + var source = arguments[i]; + + for (var key in source) { + if (Object.prototype.hasOwnProperty.call(source, key)) { + target[key] = source[key]; + } + } + } + + return target; + }; + + return _extends.apply(this, arguments); +} + +function _inheritsLoose(subClass, superClass) { + subClass.prototype = Object.create(superClass.prototype); + subClass.prototype.constructor = subClass; + subClass.__proto__ = superClass; +} + +/** + * -------------------------------------------------------------------------- + * Bootstrap (v4.0.0): util.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + +var Util = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Private TransitionEnd Helpers + * ------------------------------------------------------------------------ + */ + var transition = false; + var MAX_UID = 1000000; // Shoutout AngusCroll (https://goo.gl/pxwQGp) + + function toType(obj) { + return {}.toString.call(obj).match(/\s([a-zA-Z]+)/)[1].toLowerCase(); + } + + function getSpecialTransitionEndEvent() { + return { + bindType: transition.end, + delegateType: transition.end, + handle: function handle(event) { + if ($$$1(event.target).is(this)) { + return event.handleObj.handler.apply(this, arguments); // eslint-disable-line prefer-rest-params + } + + return undefined; // eslint-disable-line no-undefined + } + }; + } + + function transitionEndTest() { + if (typeof window !== 'undefined' && window.QUnit) { + return false; + } + + return { + end: 'transitionend' + }; + } + + function transitionEndEmulator(duration) { + var _this = this; + + var called = false; + $$$1(this).one(Util.TRANSITION_END, function () { + called = true; + }); + setTimeout(function () { + if (!called) { + Util.triggerTransitionEnd(_this); + } + }, duration); + return this; + } + + function setTransitionEndSupport() { + transition = transitionEndTest(); + $$$1.fn.emulateTransitionEnd = transitionEndEmulator; + + if (Util.supportsTransitionEnd()) { + $$$1.event.special[Util.TRANSITION_END] = getSpecialTransitionEndEvent(); + } + } + + function escapeId(selector) { + // We escape IDs in case of special selectors (selector = '#myId:something') + // $.escapeSelector does not exist in jQuery < 3 + selector = typeof $$$1.escapeSelector === 'function' ? $$$1.escapeSelector(selector).substr(1) : selector.replace(/(:|\.|\[|\]|,|=|@)/g, '\\$1'); + return selector; + } + /** + * -------------------------------------------------------------------------- + * Public Util Api + * -------------------------------------------------------------------------- + */ + + + var Util = { + TRANSITION_END: 'bsTransitionEnd', + getUID: function getUID(prefix) { + do { + // eslint-disable-next-line no-bitwise + prefix += ~~(Math.random() * MAX_UID); // "~~" acts like a faster Math.floor() here + } while (document.getElementById(prefix)); + + return prefix; + }, + getSelectorFromElement: function getSelectorFromElement(element) { + var selector = element.getAttribute('data-target'); + + if (!selector || selector === '#') { + selector = element.getAttribute('href') || ''; + } // If it's an ID + + + if (selector.charAt(0) === '#') { + selector = escapeId(selector); + } + + try { + var $selector = $$$1(document).find(selector); + return $selector.length > 0 ? selector : null; + } catch (err) { + return null; + } + }, + reflow: function reflow(element) { + return element.offsetHeight; + }, + triggerTransitionEnd: function triggerTransitionEnd(element) { + $$$1(element).trigger(transition.end); + }, + supportsTransitionEnd: function supportsTransitionEnd() { + return Boolean(transition); + }, + isElement: function isElement(obj) { + return (obj[0] || obj).nodeType; + }, + typeCheckConfig: function typeCheckConfig(componentName, config, configTypes) { + for (var property in configTypes) { + if (Object.prototype.hasOwnProperty.call(configTypes, property)) { + var expectedTypes = configTypes[property]; + var value = config[property]; + var valueType = value && Util.isElement(value) ? 'element' : toType(value); + + if (!new RegExp(expectedTypes).test(valueType)) { + throw new Error(componentName.toUpperCase() + ": " + ("Option \"" + property + "\" provided type \"" + valueType + "\" ") + ("but expected type \"" + expectedTypes + "\".")); + } + } + } + } + }; + setTransitionEndSupport(); + return Util; +}($); + +/** + * -------------------------------------------------------------------------- + * Bootstrap (v4.0.0): alert.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + +var Alert = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'alert'; + var VERSION = '4.0.0'; + var DATA_KEY = 'bs.alert'; + var EVENT_KEY = "." + DATA_KEY; + var DATA_API_KEY = '.data-api'; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var TRANSITION_DURATION = 150; + var Selector = { + DISMISS: '[data-dismiss="alert"]' + }; + var Event = { + CLOSE: "close" + EVENT_KEY, + CLOSED: "closed" + EVENT_KEY, + CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY + }; + var ClassName = { + ALERT: 'alert', + FADE: 'fade', + SHOW: 'show' + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Alert = + /*#__PURE__*/ + function () { + function Alert(element) { + this._element = element; + } // Getters + + + var _proto = Alert.prototype; + + // Public + _proto.close = function close(element) { + element = element || this._element; + + var rootElement = this._getRootElement(element); + + var customEvent = this._triggerCloseEvent(rootElement); + + if (customEvent.isDefaultPrevented()) { + return; + } + + this._removeElement(rootElement); + }; + + _proto.dispose = function dispose() { + $$$1.removeData(this._element, DATA_KEY); + this._element = null; + }; // Private + + + _proto._getRootElement = function _getRootElement(element) { + var selector = Util.getSelectorFromElement(element); + var parent = false; + + if (selector) { + parent = $$$1(selector)[0]; + } + + if (!parent) { + parent = $$$1(element).closest("." + ClassName.ALERT)[0]; + } + + return parent; + }; + + _proto._triggerCloseEvent = function _triggerCloseEvent(element) { + var closeEvent = $$$1.Event(Event.CLOSE); + $$$1(element).trigger(closeEvent); + return closeEvent; + }; + + _proto._removeElement = function _removeElement(element) { + var _this = this; + + $$$1(element).removeClass(ClassName.SHOW); + + if (!Util.supportsTransitionEnd() || !$$$1(element).hasClass(ClassName.FADE)) { + this._destroyElement(element); + + return; + } + + $$$1(element).one(Util.TRANSITION_END, function (event) { + return _this._destroyElement(element, event); + }).emulateTransitionEnd(TRANSITION_DURATION); + }; + + _proto._destroyElement = function _destroyElement(element) { + $$$1(element).detach().trigger(Event.CLOSED).remove(); + }; // Static + + + Alert._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var $element = $$$1(this); + var data = $element.data(DATA_KEY); + + if (!data) { + data = new Alert(this); + $element.data(DATA_KEY, data); + } + + if (config === 'close') { + data[config](this); + } + }); + }; + + Alert._handleDismiss = function _handleDismiss(alertInstance) { + return function (event) { + if (event) { + event.preventDefault(); + } + + alertInstance.close(this); + }; + }; + + _createClass(Alert, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }]); + return Alert; + }(); + /** + * ------------------------------------------------------------------------ + * Data Api implementation + * ------------------------------------------------------------------------ + */ + + + $$$1(document).on(Event.CLICK_DATA_API, Selector.DISMISS, Alert._handleDismiss(new Alert())); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + $$$1.fn[NAME] = Alert._jQueryInterface; + $$$1.fn[NAME].Constructor = Alert; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Alert._jQueryInterface; + }; + + return Alert; +}($); + +/** + * -------------------------------------------------------------------------- + * Bootstrap (v4.0.0): button.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + +var Button = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'button'; + var VERSION = '4.0.0'; + var DATA_KEY = 'bs.button'; + var EVENT_KEY = "." + DATA_KEY; + var DATA_API_KEY = '.data-api'; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var ClassName = { + ACTIVE: 'active', + BUTTON: 'btn', + FOCUS: 'focus' + }; + var Selector = { + DATA_TOGGLE_CARROT: '[data-toggle^="button"]', + DATA_TOGGLE: '[data-toggle="buttons"]', + INPUT: 'input', + ACTIVE: '.active', + BUTTON: '.btn' + }; + var Event = { + CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY, + FOCUS_BLUR_DATA_API: "focus" + EVENT_KEY + DATA_API_KEY + " " + ("blur" + EVENT_KEY + DATA_API_KEY) + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Button = + /*#__PURE__*/ + function () { + function Button(element) { + this._element = element; + } // Getters + + + var _proto = Button.prototype; + + // Public + _proto.toggle = function toggle() { + var triggerChangeEvent = true; + var addAriaPressed = true; + var rootElement = $$$1(this._element).closest(Selector.DATA_TOGGLE)[0]; + + if (rootElement) { + var input = $$$1(this._element).find(Selector.INPUT)[0]; + + if (input) { + if (input.type === 'radio') { + if (input.checked && $$$1(this._element).hasClass(ClassName.ACTIVE)) { + triggerChangeEvent = false; + } else { + var activeElement = $$$1(rootElement).find(Selector.ACTIVE)[0]; + + if (activeElement) { + $$$1(activeElement).removeClass(ClassName.ACTIVE); + } + } + } + + if (triggerChangeEvent) { + if (input.hasAttribute('disabled') || rootElement.hasAttribute('disabled') || input.classList.contains('disabled') || rootElement.classList.contains('disabled')) { + return; + } + + input.checked = !$$$1(this._element).hasClass(ClassName.ACTIVE); + $$$1(input).trigger('change'); + } + + input.focus(); + addAriaPressed = false; + } + } + + if (addAriaPressed) { + this._element.setAttribute('aria-pressed', !$$$1(this._element).hasClass(ClassName.ACTIVE)); + } + + if (triggerChangeEvent) { + $$$1(this._element).toggleClass(ClassName.ACTIVE); + } + }; + + _proto.dispose = function dispose() { + $$$1.removeData(this._element, DATA_KEY); + this._element = null; + }; // Static + + + Button._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var data = $$$1(this).data(DATA_KEY); + + if (!data) { + data = new Button(this); + $$$1(this).data(DATA_KEY, data); + } + + if (config === 'toggle') { + data[config](); + } + }); + }; + + _createClass(Button, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }]); + return Button; + }(); + /** + * ------------------------------------------------------------------------ + * Data Api implementation + * ------------------------------------------------------------------------ + */ + + + $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE_CARROT, function (event) { + event.preventDefault(); + var button = event.target; + + if (!$$$1(button).hasClass(ClassName.BUTTON)) { + button = $$$1(button).closest(Selector.BUTTON); + } + + Button._jQueryInterface.call($$$1(button), 'toggle'); + }).on(Event.FOCUS_BLUR_DATA_API, Selector.DATA_TOGGLE_CARROT, function (event) { + var button = $$$1(event.target).closest(Selector.BUTTON)[0]; + $$$1(button).toggleClass(ClassName.FOCUS, /^focus(in)?$/.test(event.type)); + }); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + $$$1.fn[NAME] = Button._jQueryInterface; + $$$1.fn[NAME].Constructor = Button; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Button._jQueryInterface; + }; + + return Button; +}($); + +/** + * -------------------------------------------------------------------------- + * Bootstrap (v4.0.0): carousel.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + +var Carousel = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'carousel'; + var VERSION = '4.0.0'; + var DATA_KEY = 'bs.carousel'; + var EVENT_KEY = "." + DATA_KEY; + var DATA_API_KEY = '.data-api'; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var TRANSITION_DURATION = 600; + var ARROW_LEFT_KEYCODE = 37; // KeyboardEvent.which value for left arrow key + + var ARROW_RIGHT_KEYCODE = 39; // KeyboardEvent.which value for right arrow key + + var TOUCHEVENT_COMPAT_WAIT = 500; // Time for mouse compat events to fire after touch + + var Default = { + interval: 5000, + keyboard: true, + slide: false, + pause: 'hover', + wrap: true + }; + var DefaultType = { + interval: '(number|boolean)', + keyboard: 'boolean', + slide: '(boolean|string)', + pause: '(string|boolean)', + wrap: 'boolean' + }; + var Direction = { + NEXT: 'next', + PREV: 'prev', + LEFT: 'left', + RIGHT: 'right' + }; + var Event = { + SLIDE: "slide" + EVENT_KEY, + SLID: "slid" + EVENT_KEY, + KEYDOWN: "keydown" + EVENT_KEY, + MOUSEENTER: "mouseenter" + EVENT_KEY, + MOUSELEAVE: "mouseleave" + EVENT_KEY, + TOUCHEND: "touchend" + EVENT_KEY, + LOAD_DATA_API: "load" + EVENT_KEY + DATA_API_KEY, + CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY + }; + var ClassName = { + CAROUSEL: 'carousel', + ACTIVE: 'active', + SLIDE: 'slide', + RIGHT: 'carousel-item-right', + LEFT: 'carousel-item-left', + NEXT: 'carousel-item-next', + PREV: 'carousel-item-prev', + ITEM: 'carousel-item' + }; + var Selector = { + ACTIVE: '.active', + ACTIVE_ITEM: '.active.carousel-item', + ITEM: '.carousel-item', + NEXT_PREV: '.carousel-item-next, .carousel-item-prev', + INDICATORS: '.carousel-indicators', + DATA_SLIDE: '[data-slide], [data-slide-to]', + DATA_RIDE: '[data-ride="carousel"]' + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Carousel = + /*#__PURE__*/ + function () { + function Carousel(element, config) { + this._items = null; + this._interval = null; + this._activeElement = null; + this._isPaused = false; + this._isSliding = false; + this.touchTimeout = null; + this._config = this._getConfig(config); + this._element = $$$1(element)[0]; + this._indicatorsElement = $$$1(this._element).find(Selector.INDICATORS)[0]; + + this._addEventListeners(); + } // Getters + + + var _proto = Carousel.prototype; + + // Public + _proto.next = function next() { + if (!this._isSliding) { + this._slide(Direction.NEXT); + } + }; + + _proto.nextWhenVisible = function nextWhenVisible() { + // Don't call next when the page isn't visible + // or the carousel or its parent isn't visible + if (!document.hidden && $$$1(this._element).is(':visible') && $$$1(this._element).css('visibility') !== 'hidden') { + this.next(); + } + }; + + _proto.prev = function prev() { + if (!this._isSliding) { + this._slide(Direction.PREV); + } + }; + + _proto.pause = function pause(event) { + if (!event) { + this._isPaused = true; + } + + if ($$$1(this._element).find(Selector.NEXT_PREV)[0] && Util.supportsTransitionEnd()) { + Util.triggerTransitionEnd(this._element); + this.cycle(true); + } + + clearInterval(this._interval); + this._interval = null; + }; + + _proto.cycle = function cycle(event) { + if (!event) { + this._isPaused = false; + } + + if (this._interval) { + clearInterval(this._interval); + this._interval = null; + } + + if (this._config.interval && !this._isPaused) { + this._interval = setInterval((document.visibilityState ? this.nextWhenVisible : this.next).bind(this), this._config.interval); + } + }; + + _proto.to = function to(index) { + var _this = this; + + this._activeElement = $$$1(this._element).find(Selector.ACTIVE_ITEM)[0]; + + var activeIndex = this._getItemIndex(this._activeElement); + + if (index > this._items.length - 1 || index < 0) { + return; + } + + if (this._isSliding) { + $$$1(this._element).one(Event.SLID, function () { + return _this.to(index); + }); + return; + } + + if (activeIndex === index) { + this.pause(); + this.cycle(); + return; + } + + var direction = index > activeIndex ? Direction.NEXT : Direction.PREV; + + this._slide(direction, this._items[index]); + }; + + _proto.dispose = function dispose() { + $$$1(this._element).off(EVENT_KEY); + $$$1.removeData(this._element, DATA_KEY); + this._items = null; + this._config = null; + this._element = null; + this._interval = null; + this._isPaused = null; + this._isSliding = null; + this._activeElement = null; + this._indicatorsElement = null; + }; // Private + + + _proto._getConfig = function _getConfig(config) { + config = _extends({}, Default, config); + Util.typeCheckConfig(NAME, config, DefaultType); + return config; + }; + + _proto._addEventListeners = function _addEventListeners() { + var _this2 = this; + + if (this._config.keyboard) { + $$$1(this._element).on(Event.KEYDOWN, function (event) { + return _this2._keydown(event); + }); + } + + if (this._config.pause === 'hover') { + $$$1(this._element).on(Event.MOUSEENTER, function (event) { + return _this2.pause(event); + }).on(Event.MOUSELEAVE, function (event) { + return _this2.cycle(event); + }); + + if ('ontouchstart' in document.documentElement) { + // If it's a touch-enabled device, mouseenter/leave are fired as + // part of the mouse compatibility events on first tap - the carousel + // would stop cycling until user tapped out of it; + // here, we listen for touchend, explicitly pause the carousel + // (as if it's the second time we tap on it, mouseenter compat event + // is NOT fired) and after a timeout (to allow for mouse compatibility + // events to fire) we explicitly restart cycling + $$$1(this._element).on(Event.TOUCHEND, function () { + _this2.pause(); + + if (_this2.touchTimeout) { + clearTimeout(_this2.touchTimeout); + } + + _this2.touchTimeout = setTimeout(function (event) { + return _this2.cycle(event); + }, TOUCHEVENT_COMPAT_WAIT + _this2._config.interval); + }); + } + } + }; + + _proto._keydown = function _keydown(event) { + if (/input|textarea/i.test(event.target.tagName)) { + return; + } + + switch (event.which) { + case ARROW_LEFT_KEYCODE: + event.preventDefault(); + this.prev(); + break; + + case ARROW_RIGHT_KEYCODE: + event.preventDefault(); + this.next(); + break; + + default: + } + }; + + _proto._getItemIndex = function _getItemIndex(element) { + this._items = $$$1.makeArray($$$1(element).parent().find(Selector.ITEM)); + return this._items.indexOf(element); + }; + + _proto._getItemByDirection = function _getItemByDirection(direction, activeElement) { + var isNextDirection = direction === Direction.NEXT; + var isPrevDirection = direction === Direction.PREV; + + var activeIndex = this._getItemIndex(activeElement); + + var lastItemIndex = this._items.length - 1; + var isGoingToWrap = isPrevDirection && activeIndex === 0 || isNextDirection && activeIndex === lastItemIndex; + + if (isGoingToWrap && !this._config.wrap) { + return activeElement; + } + + var delta = direction === Direction.PREV ? -1 : 1; + var itemIndex = (activeIndex + delta) % this._items.length; + return itemIndex === -1 ? this._items[this._items.length - 1] : this._items[itemIndex]; + }; + + _proto._triggerSlideEvent = function _triggerSlideEvent(relatedTarget, eventDirectionName) { + var targetIndex = this._getItemIndex(relatedTarget); + + var fromIndex = this._getItemIndex($$$1(this._element).find(Selector.ACTIVE_ITEM)[0]); + + var slideEvent = $$$1.Event(Event.SLIDE, { + relatedTarget: relatedTarget, + direction: eventDirectionName, + from: fromIndex, + to: targetIndex + }); + $$$1(this._element).trigger(slideEvent); + return slideEvent; + }; + + _proto._setActiveIndicatorElement = function _setActiveIndicatorElement(element) { + if (this._indicatorsElement) { + $$$1(this._indicatorsElement).find(Selector.ACTIVE).removeClass(ClassName.ACTIVE); + + var nextIndicator = this._indicatorsElement.children[this._getItemIndex(element)]; + + if (nextIndicator) { + $$$1(nextIndicator).addClass(ClassName.ACTIVE); + } + } + }; + + _proto._slide = function _slide(direction, element) { + var _this3 = this; + + var activeElement = $$$1(this._element).find(Selector.ACTIVE_ITEM)[0]; + + var activeElementIndex = this._getItemIndex(activeElement); + + var nextElement = element || activeElement && this._getItemByDirection(direction, activeElement); + + var nextElementIndex = this._getItemIndex(nextElement); + + var isCycling = Boolean(this._interval); + var directionalClassName; + var orderClassName; + var eventDirectionName; + + if (direction === Direction.NEXT) { + directionalClassName = ClassName.LEFT; + orderClassName = ClassName.NEXT; + eventDirectionName = Direction.LEFT; + } else { + directionalClassName = ClassName.RIGHT; + orderClassName = ClassName.PREV; + eventDirectionName = Direction.RIGHT; + } + + if (nextElement && $$$1(nextElement).hasClass(ClassName.ACTIVE)) { + this._isSliding = false; + return; + } + + var slideEvent = this._triggerSlideEvent(nextElement, eventDirectionName); + + if (slideEvent.isDefaultPrevented()) { + return; + } + + if (!activeElement || !nextElement) { + // Some weirdness is happening, so we bail + return; + } + + this._isSliding = true; + + if (isCycling) { + this.pause(); + } + + this._setActiveIndicatorElement(nextElement); + + var slidEvent = $$$1.Event(Event.SLID, { + relatedTarget: nextElement, + direction: eventDirectionName, + from: activeElementIndex, + to: nextElementIndex + }); + + if (Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.SLIDE)) { + $$$1(nextElement).addClass(orderClassName); + Util.reflow(nextElement); + $$$1(activeElement).addClass(directionalClassName); + $$$1(nextElement).addClass(directionalClassName); + $$$1(activeElement).one(Util.TRANSITION_END, function () { + $$$1(nextElement).removeClass(directionalClassName + " " + orderClassName).addClass(ClassName.ACTIVE); + $$$1(activeElement).removeClass(ClassName.ACTIVE + " " + orderClassName + " " + directionalClassName); + _this3._isSliding = false; + setTimeout(function () { + return $$$1(_this3._element).trigger(slidEvent); + }, 0); + }).emulateTransitionEnd(TRANSITION_DURATION); + } else { + $$$1(activeElement).removeClass(ClassName.ACTIVE); + $$$1(nextElement).addClass(ClassName.ACTIVE); + this._isSliding = false; + $$$1(this._element).trigger(slidEvent); + } + + if (isCycling) { + this.cycle(); + } + }; // Static + + + Carousel._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var data = $$$1(this).data(DATA_KEY); + + var _config = _extends({}, Default, $$$1(this).data()); + + if (typeof config === 'object') { + _config = _extends({}, _config, config); + } + + var action = typeof config === 'string' ? config : _config.slide; + + if (!data) { + data = new Carousel(this, _config); + $$$1(this).data(DATA_KEY, data); + } + + if (typeof config === 'number') { + data.to(config); + } else if (typeof action === 'string') { + if (typeof data[action] === 'undefined') { + throw new TypeError("No method named \"" + action + "\""); + } + + data[action](); + } else if (_config.interval) { + data.pause(); + data.cycle(); + } + }); + }; + + Carousel._dataApiClickHandler = function _dataApiClickHandler(event) { + var selector = Util.getSelectorFromElement(this); + + if (!selector) { + return; + } + + var target = $$$1(selector)[0]; + + if (!target || !$$$1(target).hasClass(ClassName.CAROUSEL)) { + return; + } + + var config = _extends({}, $$$1(target).data(), $$$1(this).data()); + var slideIndex = this.getAttribute('data-slide-to'); + + if (slideIndex) { + config.interval = false; + } + + Carousel._jQueryInterface.call($$$1(target), config); + + if (slideIndex) { + $$$1(target).data(DATA_KEY).to(slideIndex); + } + + event.preventDefault(); + }; + + _createClass(Carousel, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }, { + key: "Default", + get: function get() { + return Default; + } + }]); + return Carousel; + }(); + /** + * ------------------------------------------------------------------------ + * Data Api implementation + * ------------------------------------------------------------------------ + */ + + + $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_SLIDE, Carousel._dataApiClickHandler); + $$$1(window).on(Event.LOAD_DATA_API, function () { + $$$1(Selector.DATA_RIDE).each(function () { + var $carousel = $$$1(this); + + Carousel._jQueryInterface.call($carousel, $carousel.data()); + }); + }); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + $$$1.fn[NAME] = Carousel._jQueryInterface; + $$$1.fn[NAME].Constructor = Carousel; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Carousel._jQueryInterface; + }; + + return Carousel; +}($); + +/** + * -------------------------------------------------------------------------- + * Bootstrap (v4.0.0): collapse.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + +var Collapse = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'collapse'; + var VERSION = '4.0.0'; + var DATA_KEY = 'bs.collapse'; + var EVENT_KEY = "." + DATA_KEY; + var DATA_API_KEY = '.data-api'; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var TRANSITION_DURATION = 600; + var Default = { + toggle: true, + parent: '' + }; + var DefaultType = { + toggle: 'boolean', + parent: '(string|element)' + }; + var Event = { + SHOW: "show" + EVENT_KEY, + SHOWN: "shown" + EVENT_KEY, + HIDE: "hide" + EVENT_KEY, + HIDDEN: "hidden" + EVENT_KEY, + CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY + }; + var ClassName = { + SHOW: 'show', + COLLAPSE: 'collapse', + COLLAPSING: 'collapsing', + COLLAPSED: 'collapsed' + }; + var Dimension = { + WIDTH: 'width', + HEIGHT: 'height' + }; + var Selector = { + ACTIVES: '.show, .collapsing', + DATA_TOGGLE: '[data-toggle="collapse"]' + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Collapse = + /*#__PURE__*/ + function () { + function Collapse(element, config) { + this._isTransitioning = false; + this._element = element; + this._config = this._getConfig(config); + this._triggerArray = $$$1.makeArray($$$1("[data-toggle=\"collapse\"][href=\"#" + element.id + "\"]," + ("[data-toggle=\"collapse\"][data-target=\"#" + element.id + "\"]"))); + var tabToggles = $$$1(Selector.DATA_TOGGLE); + + for (var i = 0; i < tabToggles.length; i++) { + var elem = tabToggles[i]; + var selector = Util.getSelectorFromElement(elem); + + if (selector !== null && $$$1(selector).filter(element).length > 0) { + this._selector = selector; + + this._triggerArray.push(elem); + } + } + + this._parent = this._config.parent ? this._getParent() : null; + + if (!this._config.parent) { + this._addAriaAndCollapsedClass(this._element, this._triggerArray); + } + + if (this._config.toggle) { + this.toggle(); + } + } // Getters + + + var _proto = Collapse.prototype; + + // Public + _proto.toggle = function toggle() { + if ($$$1(this._element).hasClass(ClassName.SHOW)) { + this.hide(); + } else { + this.show(); + } + }; + + _proto.show = function show() { + var _this = this; + + if (this._isTransitioning || $$$1(this._element).hasClass(ClassName.SHOW)) { + return; + } + + var actives; + var activesData; + + if (this._parent) { + actives = $$$1.makeArray($$$1(this._parent).find(Selector.ACTIVES).filter("[data-parent=\"" + this._config.parent + "\"]")); + + if (actives.length === 0) { + actives = null; + } + } + + if (actives) { + activesData = $$$1(actives).not(this._selector).data(DATA_KEY); + + if (activesData && activesData._isTransitioning) { + return; + } + } + + var startEvent = $$$1.Event(Event.SHOW); + $$$1(this._element).trigger(startEvent); + + if (startEvent.isDefaultPrevented()) { + return; + } + + if (actives) { + Collapse._jQueryInterface.call($$$1(actives).not(this._selector), 'hide'); + + if (!activesData) { + $$$1(actives).data(DATA_KEY, null); + } + } + + var dimension = this._getDimension(); + + $$$1(this._element).removeClass(ClassName.COLLAPSE).addClass(ClassName.COLLAPSING); + this._element.style[dimension] = 0; + + if (this._triggerArray.length > 0) { + $$$1(this._triggerArray).removeClass(ClassName.COLLAPSED).attr('aria-expanded', true); + } + + this.setTransitioning(true); + + var complete = function complete() { + $$$1(_this._element).removeClass(ClassName.COLLAPSING).addClass(ClassName.COLLAPSE).addClass(ClassName.SHOW); + _this._element.style[dimension] = ''; + + _this.setTransitioning(false); + + $$$1(_this._element).trigger(Event.SHOWN); + }; + + if (!Util.supportsTransitionEnd()) { + complete(); + return; + } + + var capitalizedDimension = dimension[0].toUpperCase() + dimension.slice(1); + var scrollSize = "scroll" + capitalizedDimension; + $$$1(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(TRANSITION_DURATION); + this._element.style[dimension] = this._element[scrollSize] + "px"; + }; + + _proto.hide = function hide() { + var _this2 = this; + + if (this._isTransitioning || !$$$1(this._element).hasClass(ClassName.SHOW)) { + return; + } + + var startEvent = $$$1.Event(Event.HIDE); + $$$1(this._element).trigger(startEvent); + + if (startEvent.isDefaultPrevented()) { + return; + } + + var dimension = this._getDimension(); + + this._element.style[dimension] = this._element.getBoundingClientRect()[dimension] + "px"; + Util.reflow(this._element); + $$$1(this._element).addClass(ClassName.COLLAPSING).removeClass(ClassName.COLLAPSE).removeClass(ClassName.SHOW); + + if (this._triggerArray.length > 0) { + for (var i = 0; i < this._triggerArray.length; i++) { + var trigger = this._triggerArray[i]; + var selector = Util.getSelectorFromElement(trigger); + + if (selector !== null) { + var $elem = $$$1(selector); + + if (!$elem.hasClass(ClassName.SHOW)) { + $$$1(trigger).addClass(ClassName.COLLAPSED).attr('aria-expanded', false); + } + } + } + } + + this.setTransitioning(true); + + var complete = function complete() { + _this2.setTransitioning(false); + + $$$1(_this2._element).removeClass(ClassName.COLLAPSING).addClass(ClassName.COLLAPSE).trigger(Event.HIDDEN); + }; + + this._element.style[dimension] = ''; + + if (!Util.supportsTransitionEnd()) { + complete(); + return; + } + + $$$1(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(TRANSITION_DURATION); + }; + + _proto.setTransitioning = function setTransitioning(isTransitioning) { + this._isTransitioning = isTransitioning; + }; + + _proto.dispose = function dispose() { + $$$1.removeData(this._element, DATA_KEY); + this._config = null; + this._parent = null; + this._element = null; + this._triggerArray = null; + this._isTransitioning = null; + }; // Private + + + _proto._getConfig = function _getConfig(config) { + config = _extends({}, Default, config); + config.toggle = Boolean(config.toggle); // Coerce string values + + Util.typeCheckConfig(NAME, config, DefaultType); + return config; + }; + + _proto._getDimension = function _getDimension() { + var hasWidth = $$$1(this._element).hasClass(Dimension.WIDTH); + return hasWidth ? Dimension.WIDTH : Dimension.HEIGHT; + }; + + _proto._getParent = function _getParent() { + var _this3 = this; + + var parent = null; + + if (Util.isElement(this._config.parent)) { + parent = this._config.parent; // It's a jQuery object + + if (typeof this._config.parent.jquery !== 'undefined') { + parent = this._config.parent[0]; + } + } else { + parent = $$$1(this._config.parent)[0]; + } + + var selector = "[data-toggle=\"collapse\"][data-parent=\"" + this._config.parent + "\"]"; + $$$1(parent).find(selector).each(function (i, element) { + _this3._addAriaAndCollapsedClass(Collapse._getTargetFromElement(element), [element]); + }); + return parent; + }; + + _proto._addAriaAndCollapsedClass = function _addAriaAndCollapsedClass(element, triggerArray) { + if (element) { + var isOpen = $$$1(element).hasClass(ClassName.SHOW); + + if (triggerArray.length > 0) { + $$$1(triggerArray).toggleClass(ClassName.COLLAPSED, !isOpen).attr('aria-expanded', isOpen); + } + } + }; // Static + + + Collapse._getTargetFromElement = function _getTargetFromElement(element) { + var selector = Util.getSelectorFromElement(element); + return selector ? $$$1(selector)[0] : null; + }; + + Collapse._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var $this = $$$1(this); + var data = $this.data(DATA_KEY); + + var _config = _extends({}, Default, $this.data(), typeof config === 'object' && config); + + if (!data && _config.toggle && /show|hide/.test(config)) { + _config.toggle = false; + } + + if (!data) { + data = new Collapse(this, _config); + $this.data(DATA_KEY, data); + } + + if (typeof config === 'string') { + if (typeof data[config] === 'undefined') { + throw new TypeError("No method named \"" + config + "\""); + } + + data[config](); + } + }); + }; + + _createClass(Collapse, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }, { + key: "Default", + get: function get() { + return Default; + } + }]); + return Collapse; + }(); + /** + * ------------------------------------------------------------------------ + * Data Api implementation + * ------------------------------------------------------------------------ + */ + + + $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) { + // preventDefault only for <a> elements (which change the URL) not inside the collapsible element + if (event.currentTarget.tagName === 'A') { + event.preventDefault(); + } + + var $trigger = $$$1(this); + var selector = Util.getSelectorFromElement(this); + $$$1(selector).each(function () { + var $target = $$$1(this); + var data = $target.data(DATA_KEY); + var config = data ? 'toggle' : $trigger.data(); + + Collapse._jQueryInterface.call($target, config); + }); + }); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + $$$1.fn[NAME] = Collapse._jQueryInterface; + $$$1.fn[NAME].Constructor = Collapse; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Collapse._jQueryInterface; + }; + + return Collapse; +}($); + +/**! + * @fileOverview Kickass library to create and place poppers near their reference elements. + * @version 1.12.9 + * @license + * Copyright (c) 2016 Federico Zivolo and contributors + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in all + * copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE + * SOFTWARE. + */ +var isBrowser = typeof window !== 'undefined' && typeof document !== 'undefined'; +var longerTimeoutBrowsers = ['Edge', 'Trident', 'Firefox']; +var timeoutDuration = 0; +for (var i = 0; i < longerTimeoutBrowsers.length; i += 1) { + if (isBrowser && navigator.userAgent.indexOf(longerTimeoutBrowsers[i]) >= 0) { + timeoutDuration = 1; + break; + } +} + +function microtaskDebounce(fn) { + var called = false; + return function () { + if (called) { + return; + } + called = true; + window.Promise.resolve().then(function () { + called = false; + fn(); + }); + }; +} + +function taskDebounce(fn) { + var scheduled = false; + return function () { + if (!scheduled) { + scheduled = true; + setTimeout(function () { + scheduled = false; + fn(); + }, timeoutDuration); + } + }; +} + +var supportsMicroTasks = isBrowser && window.Promise; + +/** +* Create a debounced version of a method, that's asynchronously deferred +* but called in the minimum time possible. +* +* @method +* @memberof Popper.Utils +* @argument {Function} fn +* @returns {Function} +*/ +var debounce = supportsMicroTasks ? microtaskDebounce : taskDebounce; + +/** + * Check if the given variable is a function + * @method + * @memberof Popper.Utils + * @argument {Any} functionToCheck - variable to check + * @returns {Boolean} answer to: is a function? + */ +function isFunction(functionToCheck) { + var getType = {}; + return functionToCheck && getType.toString.call(functionToCheck) === '[object Function]'; +} + +/** + * Get CSS computed property of the given element + * @method + * @memberof Popper.Utils + * @argument {Eement} element + * @argument {String} property + */ +function getStyleComputedProperty(element, property) { + if (element.nodeType !== 1) { + return []; + } + // NOTE: 1 DOM access here + var css = getComputedStyle(element, null); + return property ? css[property] : css; +} + +/** + * Returns the parentNode or the host of the element + * @method + * @memberof Popper.Utils + * @argument {Element} element + * @returns {Element} parent + */ +function getParentNode(element) { + if (element.nodeName === 'HTML') { + return element; + } + return element.parentNode || element.host; +} + +/** + * Returns the scrolling parent of the given element + * @method + * @memberof Popper.Utils + * @argument {Element} element + * @returns {Element} scroll parent + */ +function getScrollParent(element) { + // Return body, `getScroll` will take care to get the correct `scrollTop` from it + if (!element) { + return document.body; + } + + switch (element.nodeName) { + case 'HTML': + case 'BODY': + return element.ownerDocument.body; + case '#document': + return element.body; + } + + // Firefox want us to check `-x` and `-y` variations as well + + var _getStyleComputedProp = getStyleComputedProperty(element), + overflow = _getStyleComputedProp.overflow, + overflowX = _getStyleComputedProp.overflowX, + overflowY = _getStyleComputedProp.overflowY; + + if (/(auto|scroll)/.test(overflow + overflowY + overflowX)) { + return element; + } + + return getScrollParent(getParentNode(element)); +} + +/** + * Returns the offset parent of the given element + * @method + * @memberof Popper.Utils + * @argument {Element} element + * @returns {Element} offset parent + */ +function getOffsetParent(element) { + // NOTE: 1 DOM access here + var offsetParent = element && element.offsetParent; + var nodeName = offsetParent && offsetParent.nodeName; + + if (!nodeName || nodeName === 'BODY' || nodeName === 'HTML') { + if (element) { + return element.ownerDocument.documentElement; + } + + return document.documentElement; + } + + // .offsetParent will return the closest TD or TABLE in case + // no offsetParent is present, I hate this job... + if (['TD', 'TABLE'].indexOf(offsetParent.nodeName) !== -1 && getStyleComputedProperty(offsetParent, 'position') === 'static') { + return getOffsetParent(offsetParent); + } + + return offsetParent; +} + +function isOffsetContainer(element) { + var nodeName = element.nodeName; + + if (nodeName === 'BODY') { + return false; + } + return nodeName === 'HTML' || getOffsetParent(element.firstElementChild) === element; +} + +/** + * Finds the root node (document, shadowDOM root) of the given element + * @method + * @memberof Popper.Utils + * @argument {Element} node + * @returns {Element} root node + */ +function getRoot(node) { + if (node.parentNode !== null) { + return getRoot(node.parentNode); + } + + return node; +} + +/** + * Finds the offset parent common to the two provided nodes + * @method + * @memberof Popper.Utils + * @argument {Element} element1 + * @argument {Element} element2 + * @returns {Element} common offset parent + */ +function findCommonOffsetParent(element1, element2) { + // This check is needed to avoid errors in case one of the elements isn't defined for any reason + if (!element1 || !element1.nodeType || !element2 || !element2.nodeType) { + return document.documentElement; + } + + // Here we make sure to give as "start" the element that comes first in the DOM + var order = element1.compareDocumentPosition(element2) & Node.DOCUMENT_POSITION_FOLLOWING; + var start = order ? element1 : element2; + var end = order ? element2 : element1; + + // Get common ancestor container + var range = document.createRange(); + range.setStart(start, 0); + range.setEnd(end, 0); + var commonAncestorContainer = range.commonAncestorContainer; + + // Both nodes are inside #document + + if (element1 !== commonAncestorContainer && element2 !== commonAncestorContainer || start.contains(end)) { + if (isOffsetContainer(commonAncestorContainer)) { + return commonAncestorContainer; + } + + return getOffsetParent(commonAncestorContainer); + } + + // one of the nodes is inside shadowDOM, find which one + var element1root = getRoot(element1); + if (element1root.host) { + return findCommonOffsetParent(element1root.host, element2); + } else { + return findCommonOffsetParent(element1, getRoot(element2).host); + } +} + +/** + * Gets the scroll value of the given element in the given side (top and left) + * @method + * @memberof Popper.Utils + * @argument {Element} element + * @argument {String} side `top` or `left` + * @returns {number} amount of scrolled pixels + */ +function getScroll(element) { + var side = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'top'; + + var upperSide = side === 'top' ? 'scrollTop' : 'scrollLeft'; + var nodeName = element.nodeName; + + if (nodeName === 'BODY' || nodeName === 'HTML') { + var html = element.ownerDocument.documentElement; + var scrollingElement = element.ownerDocument.scrollingElement || html; + return scrollingElement[upperSide]; + } + + return element[upperSide]; +} + +/* + * Sum or subtract the element scroll values (left and top) from a given rect object + * @method + * @memberof Popper.Utils + * @param {Object} rect - Rect object you want to change + * @param {HTMLElement} element - The element from the function reads the scroll values + * @param {Boolean} subtract - set to true if you want to subtract the scroll values + * @return {Object} rect - The modifier rect object + */ +function includeScroll(rect, element) { + var subtract = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false; + + var scrollTop = getScroll(element, 'top'); + var scrollLeft = getScroll(element, 'left'); + var modifier = subtract ? -1 : 1; + rect.top += scrollTop * modifier; + rect.bottom += scrollTop * modifier; + rect.left += scrollLeft * modifier; + rect.right += scrollLeft * modifier; + return rect; +} + +/* + * Helper to detect borders of a given element + * @method + * @memberof Popper.Utils + * @param {CSSStyleDeclaration} styles + * Result of `getStyleComputedProperty` on the given element + * @param {String} axis - `x` or `y` + * @return {number} borders - The borders size of the given axis + */ + +function getBordersSize(styles, axis) { + var sideA = axis === 'x' ? 'Left' : 'Top'; + var sideB = sideA === 'Left' ? 'Right' : 'Bottom'; + + return parseFloat(styles['border' + sideA + 'Width'], 10) + parseFloat(styles['border' + sideB + 'Width'], 10); +} + +/** + * Tells if you are running Internet Explorer 10 + * @method + * @memberof Popper.Utils + * @returns {Boolean} isIE10 + */ +var isIE10 = undefined; + +var isIE10$1 = function () { + if (isIE10 === undefined) { + isIE10 = navigator.appVersion.indexOf('MSIE 10') !== -1; + } + return isIE10; +}; + +function getSize(axis, body, html, computedStyle) { + return Math.max(body['offset' + axis], body['scroll' + axis], html['client' + axis], html['offset' + axis], html['scroll' + axis], isIE10$1() ? html['offset' + axis] + computedStyle['margin' + (axis === 'Height' ? 'Top' : 'Left')] + computedStyle['margin' + (axis === 'Height' ? 'Bottom' : 'Right')] : 0); +} + +function getWindowSizes() { + var body = document.body; + var html = document.documentElement; + var computedStyle = isIE10$1() && getComputedStyle(html); + + return { + height: getSize('Height', body, html, computedStyle), + width: getSize('Width', body, html, computedStyle) + }; +} + +var classCallCheck = function (instance, Constructor) { + if (!(instance instanceof Constructor)) { + throw new TypeError("Cannot call a class as a function"); + } +}; + +var createClass = function () { + function defineProperties(target, props) { + for (var i = 0; i < props.length; i++) { + var descriptor = props[i]; + descriptor.enumerable = descriptor.enumerable || false; + descriptor.configurable = true; + if ("value" in descriptor) descriptor.writable = true; + Object.defineProperty(target, descriptor.key, descriptor); + } + } + + return function (Constructor, protoProps, staticProps) { + if (protoProps) defineProperties(Constructor.prototype, protoProps); + if (staticProps) defineProperties(Constructor, staticProps); + return Constructor; + }; +}(); + + + + + +var defineProperty = function (obj, key, value) { + if (key in obj) { + Object.defineProperty(obj, key, { + value: value, + enumerable: true, + configurable: true, + writable: true + }); + } else { + obj[key] = value; + } + + return obj; +}; + +var _extends$1 = Object.assign || function (target) { + for (var i = 1; i < arguments.length; i++) { + var source = arguments[i]; + + for (var key in source) { + if (Object.prototype.hasOwnProperty.call(source, key)) { + target[key] = source[key]; + } + } + } + + return target; +}; + +/** + * Given element offsets, generate an output similar to getBoundingClientRect + * @method + * @memberof Popper.Utils + * @argument {Object} offsets + * @returns {Object} ClientRect like output + */ +function getClientRect(offsets) { + return _extends$1({}, offsets, { + right: offsets.left + offsets.width, + bottom: offsets.top + offsets.height + }); +} + +/** + * Get bounding client rect of given element + * @method + * @memberof Popper.Utils + * @param {HTMLElement} element + * @return {Object} client rect + */ +function getBoundingClientRect(element) { + var rect = {}; + + // IE10 10 FIX: Please, don't ask, the element isn't + // considered in DOM in some circumstances... + // This isn't reproducible in IE10 compatibility mode of IE11 + if (isIE10$1()) { + try { + rect = element.getBoundingClientRect(); + var scrollTop = getScroll(element, 'top'); + var scrollLeft = getScroll(element, 'left'); + rect.top += scrollTop; + rect.left += scrollLeft; + rect.bottom += scrollTop; + rect.right += scrollLeft; + } catch (err) {} + } else { + rect = element.getBoundingClientRect(); + } + + var result = { + left: rect.left, + top: rect.top, + width: rect.right - rect.left, + height: rect.bottom - rect.top + }; + + // subtract scrollbar size from sizes + var sizes = element.nodeName === 'HTML' ? getWindowSizes() : {}; + var width = sizes.width || element.clientWidth || result.right - result.left; + var height = sizes.height || element.clientHeight || result.bottom - result.top; + + var horizScrollbar = element.offsetWidth - width; + var vertScrollbar = element.offsetHeight - height; + + // if an hypothetical scrollbar is detected, we must be sure it's not a `border` + // we make this check conditional for performance reasons + if (horizScrollbar || vertScrollbar) { + var styles = getStyleComputedProperty(element); + horizScrollbar -= getBordersSize(styles, 'x'); + vertScrollbar -= getBordersSize(styles, 'y'); + + result.width -= horizScrollbar; + result.height -= vertScrollbar; + } + + return getClientRect(result); +} + +function getOffsetRectRelativeToArbitraryNode(children, parent) { + var isIE10 = isIE10$1(); + var isHTML = parent.nodeName === 'HTML'; + var childrenRect = getBoundingClientRect(children); + var parentRect = getBoundingClientRect(parent); + var scrollParent = getScrollParent(children); + + var styles = getStyleComputedProperty(parent); + var borderTopWidth = parseFloat(styles.borderTopWidth, 10); + var borderLeftWidth = parseFloat(styles.borderLeftWidth, 10); + + var offsets = getClientRect({ + top: childrenRect.top - parentRect.top - borderTopWidth, + left: childrenRect.left - parentRect.left - borderLeftWidth, + width: childrenRect.width, + height: childrenRect.height + }); + offsets.marginTop = 0; + offsets.marginLeft = 0; + + // Subtract margins of documentElement in case it's being used as parent + // we do this only on HTML because it's the only element that behaves + // differently when margins are applied to it. The margins are included in + // the box of the documentElement, in the other cases not. + if (!isIE10 && isHTML) { + var marginTop = parseFloat(styles.marginTop, 10); + var marginLeft = parseFloat(styles.marginLeft, 10); + + offsets.top -= borderTopWidth - marginTop; + offsets.bottom -= borderTopWidth - marginTop; + offsets.left -= borderLeftWidth - marginLeft; + offsets.right -= borderLeftWidth - marginLeft; + + // Attach marginTop and marginLeft because in some circumstances we may need them + offsets.marginTop = marginTop; + offsets.marginLeft = marginLeft; + } + + if (isIE10 ? parent.contains(scrollParent) : parent === scrollParent && scrollParent.nodeName !== 'BODY') { + offsets = includeScroll(offsets, parent); + } + + return offsets; +} + +function getViewportOffsetRectRelativeToArtbitraryNode(element) { + var html = element.ownerDocument.documentElement; + var relativeOffset = getOffsetRectRelativeToArbitraryNode(element, html); + var width = Math.max(html.clientWidth, window.innerWidth || 0); + var height = Math.max(html.clientHeight, window.innerHeight || 0); + + var scrollTop = getScroll(html); + var scrollLeft = getScroll(html, 'left'); + + var offset = { + top: scrollTop - relativeOffset.top + relativeOffset.marginTop, + left: scrollLeft - relativeOffset.left + relativeOffset.marginLeft, + width: width, + height: height + }; + + return getClientRect(offset); +} + +/** + * Check if the given element is fixed or is inside a fixed parent + * @method + * @memberof Popper.Utils + * @argument {Element} element + * @argument {Element} customContainer + * @returns {Boolean} answer to "isFixed?" + */ +function isFixed(element) { + var nodeName = element.nodeName; + if (nodeName === 'BODY' || nodeName === 'HTML') { + return false; + } + if (getStyleComputedProperty(element, 'position') === 'fixed') { + return true; + } + return isFixed(getParentNode(element)); +} + +/** + * Computed the boundaries limits and return them + * @method + * @memberof Popper.Utils + * @param {HTMLElement} popper + * @param {HTMLElement} reference + * @param {number} padding + * @param {HTMLElement} boundariesElement - Element used to define the boundaries + * @returns {Object} Coordinates of the boundaries + */ +function getBoundaries(popper, reference, padding, boundariesElement) { + // NOTE: 1 DOM access here + var boundaries = { top: 0, left: 0 }; + var offsetParent = findCommonOffsetParent(popper, reference); + + // Handle viewport case + if (boundariesElement === 'viewport') { + boundaries = getViewportOffsetRectRelativeToArtbitraryNode(offsetParent); + } else { + // Handle other cases based on DOM element used as boundaries + var boundariesNode = void 0; + if (boundariesElement === 'scrollParent') { + boundariesNode = getScrollParent(getParentNode(reference)); + if (boundariesNode.nodeName === 'BODY') { + boundariesNode = popper.ownerDocument.documentElement; + } + } else if (boundariesElement === 'window') { + boundariesNode = popper.ownerDocument.documentElement; + } else { + boundariesNode = boundariesElement; + } + + var offsets = getOffsetRectRelativeToArbitraryNode(boundariesNode, offsetParent); + + // In case of HTML, we need a different computation + if (boundariesNode.nodeName === 'HTML' && !isFixed(offsetParent)) { + var _getWindowSizes = getWindowSizes(), + height = _getWindowSizes.height, + width = _getWindowSizes.width; + + boundaries.top += offsets.top - offsets.marginTop; + boundaries.bottom = height + offsets.top; + boundaries.left += offsets.left - offsets.marginLeft; + boundaries.right = width + offsets.left; + } else { + // for all the other DOM elements, this one is good + boundaries = offsets; + } + } + + // Add paddings + boundaries.left += padding; + boundaries.top += padding; + boundaries.right -= padding; + boundaries.bottom -= padding; + + return boundaries; +} + +function getArea(_ref) { + var width = _ref.width, + height = _ref.height; + + return width * height; +} + +/** + * Utility used to transform the `auto` placement to the placement with more + * available space. + * @method + * @memberof Popper.Utils + * @argument {Object} data - The data object generated by update method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ +function computeAutoPlacement(placement, refRect, popper, reference, boundariesElement) { + var padding = arguments.length > 5 && arguments[5] !== undefined ? arguments[5] : 0; + + if (placement.indexOf('auto') === -1) { + return placement; + } + + var boundaries = getBoundaries(popper, reference, padding, boundariesElement); + + var rects = { + top: { + width: boundaries.width, + height: refRect.top - boundaries.top + }, + right: { + width: boundaries.right - refRect.right, + height: boundaries.height + }, + bottom: { + width: boundaries.width, + height: boundaries.bottom - refRect.bottom + }, + left: { + width: refRect.left - boundaries.left, + height: boundaries.height + } + }; + + var sortedAreas = Object.keys(rects).map(function (key) { + return _extends$1({ + key: key + }, rects[key], { + area: getArea(rects[key]) + }); + }).sort(function (a, b) { + return b.area - a.area; + }); + + var filteredAreas = sortedAreas.filter(function (_ref2) { + var width = _ref2.width, + height = _ref2.height; + return width >= popper.clientWidth && height >= popper.clientHeight; + }); + + var computedPlacement = filteredAreas.length > 0 ? filteredAreas[0].key : sortedAreas[0].key; + + var variation = placement.split('-')[1]; + + return computedPlacement + (variation ? '-' + variation : ''); +} + +/** + * Get offsets to the reference element + * @method + * @memberof Popper.Utils + * @param {Object} state + * @param {Element} popper - the popper element + * @param {Element} reference - the reference element (the popper will be relative to this) + * @returns {Object} An object containing the offsets which will be applied to the popper + */ +function getReferenceOffsets(state, popper, reference) { + var commonOffsetParent = findCommonOffsetParent(popper, reference); + return getOffsetRectRelativeToArbitraryNode(reference, commonOffsetParent); +} + +/** + * Get the outer sizes of the given element (offset size + margins) + * @method + * @memberof Popper.Utils + * @argument {Element} element + * @returns {Object} object containing width and height properties + */ +function getOuterSizes(element) { + var styles = getComputedStyle(element); + var x = parseFloat(styles.marginTop) + parseFloat(styles.marginBottom); + var y = parseFloat(styles.marginLeft) + parseFloat(styles.marginRight); + var result = { + width: element.offsetWidth + y, + height: element.offsetHeight + x + }; + return result; +} + +/** + * Get the opposite placement of the given one + * @method + * @memberof Popper.Utils + * @argument {String} placement + * @returns {String} flipped placement + */ +function getOppositePlacement(placement) { + var hash = { left: 'right', right: 'left', bottom: 'top', top: 'bottom' }; + return placement.replace(/left|right|bottom|top/g, function (matched) { + return hash[matched]; + }); +} + +/** + * Get offsets to the popper + * @method + * @memberof Popper.Utils + * @param {Object} position - CSS position the Popper will get applied + * @param {HTMLElement} popper - the popper element + * @param {Object} referenceOffsets - the reference offsets (the popper will be relative to this) + * @param {String} placement - one of the valid placement options + * @returns {Object} popperOffsets - An object containing the offsets which will be applied to the popper + */ +function getPopperOffsets(popper, referenceOffsets, placement) { + placement = placement.split('-')[0]; + + // Get popper node sizes + var popperRect = getOuterSizes(popper); + + // Add position, width and height to our offsets object + var popperOffsets = { + width: popperRect.width, + height: popperRect.height + }; + + // depending by the popper placement we have to compute its offsets slightly differently + var isHoriz = ['right', 'left'].indexOf(placement) !== -1; + var mainSide = isHoriz ? 'top' : 'left'; + var secondarySide = isHoriz ? 'left' : 'top'; + var measurement = isHoriz ? 'height' : 'width'; + var secondaryMeasurement = !isHoriz ? 'height' : 'width'; + + popperOffsets[mainSide] = referenceOffsets[mainSide] + referenceOffsets[measurement] / 2 - popperRect[measurement] / 2; + if (placement === secondarySide) { + popperOffsets[secondarySide] = referenceOffsets[secondarySide] - popperRect[secondaryMeasurement]; + } else { + popperOffsets[secondarySide] = referenceOffsets[getOppositePlacement(secondarySide)]; + } + + return popperOffsets; +} + +/** + * Mimics the `find` method of Array + * @method + * @memberof Popper.Utils + * @argument {Array} arr + * @argument prop + * @argument value + * @returns index or -1 + */ +function find(arr, check) { + // use native find if supported + if (Array.prototype.find) { + return arr.find(check); + } + + // use `filter` to obtain the same behavior of `find` + return arr.filter(check)[0]; +} + +/** + * Return the index of the matching object + * @method + * @memberof Popper.Utils + * @argument {Array} arr + * @argument prop + * @argument value + * @returns index or -1 + */ +function findIndex(arr, prop, value) { + // use native findIndex if supported + if (Array.prototype.findIndex) { + return arr.findIndex(function (cur) { + return cur[prop] === value; + }); + } + + // use `find` + `indexOf` if `findIndex` isn't supported + var match = find(arr, function (obj) { + return obj[prop] === value; + }); + return arr.indexOf(match); +} + +/** + * Loop trough the list of modifiers and run them in order, + * each of them will then edit the data object. + * @method + * @memberof Popper.Utils + * @param {dataObject} data + * @param {Array} modifiers + * @param {String} ends - Optional modifier name used as stopper + * @returns {dataObject} + */ +function runModifiers(modifiers, data, ends) { + var modifiersToRun = ends === undefined ? modifiers : modifiers.slice(0, findIndex(modifiers, 'name', ends)); + + modifiersToRun.forEach(function (modifier) { + if (modifier['function']) { + // eslint-disable-line dot-notation + console.warn('`modifier.function` is deprecated, use `modifier.fn`!'); + } + var fn = modifier['function'] || modifier.fn; // eslint-disable-line dot-notation + if (modifier.enabled && isFunction(fn)) { + // Add properties to offsets to make them a complete clientRect object + // we do this before each modifier to make sure the previous one doesn't + // mess with these values + data.offsets.popper = getClientRect(data.offsets.popper); + data.offsets.reference = getClientRect(data.offsets.reference); + + data = fn(data, modifier); + } + }); + + return data; +} + +/** + * Updates the position of the popper, computing the new offsets and applying + * the new style.<br /> + * Prefer `scheduleUpdate` over `update` because of performance reasons. + * @method + * @memberof Popper + */ +function update() { + // if popper is destroyed, don't perform any further update + if (this.state.isDestroyed) { + return; + } + + var data = { + instance: this, + styles: {}, + arrowStyles: {}, + attributes: {}, + flipped: false, + offsets: {} + }; + + // compute reference element offsets + data.offsets.reference = getReferenceOffsets(this.state, this.popper, this.reference); + + // compute auto placement, store placement inside the data object, + // modifiers will be able to edit `placement` if needed + // and refer to originalPlacement to know the original value + data.placement = computeAutoPlacement(this.options.placement, data.offsets.reference, this.popper, this.reference, this.options.modifiers.flip.boundariesElement, this.options.modifiers.flip.padding); + + // store the computed placement inside `originalPlacement` + data.originalPlacement = data.placement; + + // compute the popper offsets + data.offsets.popper = getPopperOffsets(this.popper, data.offsets.reference, data.placement); + data.offsets.popper.position = 'absolute'; + + // run the modifiers + data = runModifiers(this.modifiers, data); + + // the first `update` will call `onCreate` callback + // the other ones will call `onUpdate` callback + if (!this.state.isCreated) { + this.state.isCreated = true; + this.options.onCreate(data); + } else { + this.options.onUpdate(data); + } +} + +/** + * Helper used to know if the given modifier is enabled. + * @method + * @memberof Popper.Utils + * @returns {Boolean} + */ +function isModifierEnabled(modifiers, modifierName) { + return modifiers.some(function (_ref) { + var name = _ref.name, + enabled = _ref.enabled; + return enabled && name === modifierName; + }); +} + +/** + * Get the prefixed supported property name + * @method + * @memberof Popper.Utils + * @argument {String} property (camelCase) + * @returns {String} prefixed property (camelCase or PascalCase, depending on the vendor prefix) + */ +function getSupportedPropertyName(property) { + var prefixes = [false, 'ms', 'Webkit', 'Moz', 'O']; + var upperProp = property.charAt(0).toUpperCase() + property.slice(1); + + for (var i = 0; i < prefixes.length - 1; i++) { + var prefix = prefixes[i]; + var toCheck = prefix ? '' + prefix + upperProp : property; + if (typeof document.body.style[toCheck] !== 'undefined') { + return toCheck; + } + } + return null; +} + +/** + * Destroy the popper + * @method + * @memberof Popper + */ +function destroy() { + this.state.isDestroyed = true; + + // touch DOM only if `applyStyle` modifier is enabled + if (isModifierEnabled(this.modifiers, 'applyStyle')) { + this.popper.removeAttribute('x-placement'); + this.popper.style.left = ''; + this.popper.style.position = ''; + this.popper.style.top = ''; + this.popper.style[getSupportedPropertyName('transform')] = ''; + } + + this.disableEventListeners(); + + // remove the popper if user explicity asked for the deletion on destroy + // do not use `remove` because IE11 doesn't support it + if (this.options.removeOnDestroy) { + this.popper.parentNode.removeChild(this.popper); + } + return this; +} + +/** + * Get the window associated with the element + * @argument {Element} element + * @returns {Window} + */ +function getWindow(element) { + var ownerDocument = element.ownerDocument; + return ownerDocument ? ownerDocument.defaultView : window; +} + +function attachToScrollParents(scrollParent, event, callback, scrollParents) { + var isBody = scrollParent.nodeName === 'BODY'; + var target = isBody ? scrollParent.ownerDocument.defaultView : scrollParent; + target.addEventListener(event, callback, { passive: true }); + + if (!isBody) { + attachToScrollParents(getScrollParent(target.parentNode), event, callback, scrollParents); + } + scrollParents.push(target); +} + +/** + * Setup needed event listeners used to update the popper position + * @method + * @memberof Popper.Utils + * @private + */ +function setupEventListeners(reference, options, state, updateBound) { + // Resize event listener on window + state.updateBound = updateBound; + getWindow(reference).addEventListener('resize', state.updateBound, { passive: true }); + + // Scroll event listener on scroll parents + var scrollElement = getScrollParent(reference); + attachToScrollParents(scrollElement, 'scroll', state.updateBound, state.scrollParents); + state.scrollElement = scrollElement; + state.eventsEnabled = true; + + return state; +} + +/** + * It will add resize/scroll events and start recalculating + * position of the popper element when they are triggered. + * @method + * @memberof Popper + */ +function enableEventListeners() { + if (!this.state.eventsEnabled) { + this.state = setupEventListeners(this.reference, this.options, this.state, this.scheduleUpdate); + } +} + +/** + * Remove event listeners used to update the popper position + * @method + * @memberof Popper.Utils + * @private + */ +function removeEventListeners(reference, state) { + // Remove resize event listener on window + getWindow(reference).removeEventListener('resize', state.updateBound); + + // Remove scroll event listener on scroll parents + state.scrollParents.forEach(function (target) { + target.removeEventListener('scroll', state.updateBound); + }); + + // Reset state + state.updateBound = null; + state.scrollParents = []; + state.scrollElement = null; + state.eventsEnabled = false; + return state; +} + +/** + * It will remove resize/scroll events and won't recalculate popper position + * when they are triggered. It also won't trigger onUpdate callback anymore, + * unless you call `update` method manually. + * @method + * @memberof Popper + */ +function disableEventListeners() { + if (this.state.eventsEnabled) { + cancelAnimationFrame(this.scheduleUpdate); + this.state = removeEventListeners(this.reference, this.state); + } +} + +/** + * Tells if a given input is a number + * @method + * @memberof Popper.Utils + * @param {*} input to check + * @return {Boolean} + */ +function isNumeric(n) { + return n !== '' && !isNaN(parseFloat(n)) && isFinite(n); +} + +/** + * Set the style to the given popper + * @method + * @memberof Popper.Utils + * @argument {Element} element - Element to apply the style to + * @argument {Object} styles + * Object with a list of properties and values which will be applied to the element + */ +function setStyles(element, styles) { + Object.keys(styles).forEach(function (prop) { + var unit = ''; + // add unit if the value is numeric and is one of the following + if (['width', 'height', 'top', 'right', 'bottom', 'left'].indexOf(prop) !== -1 && isNumeric(styles[prop])) { + unit = 'px'; + } + element.style[prop] = styles[prop] + unit; + }); +} + +/** + * Set the attributes to the given popper + * @method + * @memberof Popper.Utils + * @argument {Element} element - Element to apply the attributes to + * @argument {Object} styles + * Object with a list of properties and values which will be applied to the element + */ +function setAttributes(element, attributes) { + Object.keys(attributes).forEach(function (prop) { + var value = attributes[prop]; + if (value !== false) { + element.setAttribute(prop, attributes[prop]); + } else { + element.removeAttribute(prop); + } + }); +} + +/** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by `update` method + * @argument {Object} data.styles - List of style properties - values to apply to popper element + * @argument {Object} data.attributes - List of attribute properties - values to apply to popper element + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The same data object + */ +function applyStyle(data) { + // any property present in `data.styles` will be applied to the popper, + // in this way we can make the 3rd party modifiers add custom styles to it + // Be aware, modifiers could override the properties defined in the previous + // lines of this modifier! + setStyles(data.instance.popper, data.styles); + + // any property present in `data.attributes` will be applied to the popper, + // they will be set as HTML attributes of the element + setAttributes(data.instance.popper, data.attributes); + + // if arrowElement is defined and arrowStyles has some properties + if (data.arrowElement && Object.keys(data.arrowStyles).length) { + setStyles(data.arrowElement, data.arrowStyles); + } + + return data; +} + +/** + * Set the x-placement attribute before everything else because it could be used + * to add margins to the popper margins needs to be calculated to get the + * correct popper offsets. + * @method + * @memberof Popper.modifiers + * @param {HTMLElement} reference - The reference element used to position the popper + * @param {HTMLElement} popper - The HTML element used as popper. + * @param {Object} options - Popper.js options + */ +function applyStyleOnLoad(reference, popper, options, modifierOptions, state) { + // compute reference element offsets + var referenceOffsets = getReferenceOffsets(state, popper, reference); + + // compute auto placement, store placement inside the data object, + // modifiers will be able to edit `placement` if needed + // and refer to originalPlacement to know the original value + var placement = computeAutoPlacement(options.placement, referenceOffsets, popper, reference, options.modifiers.flip.boundariesElement, options.modifiers.flip.padding); + + popper.setAttribute('x-placement', placement); + + // Apply `position` to popper before anything else because + // without the position applied we can't guarantee correct computations + setStyles(popper, { position: 'absolute' }); + + return options; +} + +/** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by `update` method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ +function computeStyle(data, options) { + var x = options.x, + y = options.y; + var popper = data.offsets.popper; + + // Remove this legacy support in Popper.js v2 + + var legacyGpuAccelerationOption = find(data.instance.modifiers, function (modifier) { + return modifier.name === 'applyStyle'; + }).gpuAcceleration; + if (legacyGpuAccelerationOption !== undefined) { + console.warn('WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!'); + } + var gpuAcceleration = legacyGpuAccelerationOption !== undefined ? legacyGpuAccelerationOption : options.gpuAcceleration; + + var offsetParent = getOffsetParent(data.instance.popper); + var offsetParentRect = getBoundingClientRect(offsetParent); + + // Styles + var styles = { + position: popper.position + }; + + // floor sides to avoid blurry text + var offsets = { + left: Math.floor(popper.left), + top: Math.floor(popper.top), + bottom: Math.floor(popper.bottom), + right: Math.floor(popper.right) + }; + + var sideA = x === 'bottom' ? 'top' : 'bottom'; + var sideB = y === 'right' ? 'left' : 'right'; + + // if gpuAcceleration is set to `true` and transform is supported, + // we use `translate3d` to apply the position to the popper we + // automatically use the supported prefixed version if needed + var prefixedProperty = getSupportedPropertyName('transform'); + + // now, let's make a step back and look at this code closely (wtf?) + // If the content of the popper grows once it's been positioned, it + // may happen that the popper gets misplaced because of the new content + // overflowing its reference element + // To avoid this problem, we provide two options (x and y), which allow + // the consumer to define the offset origin. + // If we position a popper on top of a reference element, we can set + // `x` to `top` to make the popper grow towards its top instead of + // its bottom. + var left = void 0, + top = void 0; + if (sideA === 'bottom') { + top = -offsetParentRect.height + offsets.bottom; + } else { + top = offsets.top; + } + if (sideB === 'right') { + left = -offsetParentRect.width + offsets.right; + } else { + left = offsets.left; + } + if (gpuAcceleration && prefixedProperty) { + styles[prefixedProperty] = 'translate3d(' + left + 'px, ' + top + 'px, 0)'; + styles[sideA] = 0; + styles[sideB] = 0; + styles.willChange = 'transform'; + } else { + // othwerise, we use the standard `top`, `left`, `bottom` and `right` properties + var invertTop = sideA === 'bottom' ? -1 : 1; + var invertLeft = sideB === 'right' ? -1 : 1; + styles[sideA] = top * invertTop; + styles[sideB] = left * invertLeft; + styles.willChange = sideA + ', ' + sideB; + } + + // Attributes + var attributes = { + 'x-placement': data.placement + }; + + // Update `data` attributes, styles and arrowStyles + data.attributes = _extends$1({}, attributes, data.attributes); + data.styles = _extends$1({}, styles, data.styles); + data.arrowStyles = _extends$1({}, data.offsets.arrow, data.arrowStyles); + + return data; +} + +/** + * Helper used to know if the given modifier depends from another one.<br /> + * It checks if the needed modifier is listed and enabled. + * @method + * @memberof Popper.Utils + * @param {Array} modifiers - list of modifiers + * @param {String} requestingName - name of requesting modifier + * @param {String} requestedName - name of requested modifier + * @returns {Boolean} + */ +function isModifierRequired(modifiers, requestingName, requestedName) { + var requesting = find(modifiers, function (_ref) { + var name = _ref.name; + return name === requestingName; + }); + + var isRequired = !!requesting && modifiers.some(function (modifier) { + return modifier.name === requestedName && modifier.enabled && modifier.order < requesting.order; + }); + + if (!isRequired) { + var _requesting = '`' + requestingName + '`'; + var requested = '`' + requestedName + '`'; + console.warn(requested + ' modifier is required by ' + _requesting + ' modifier in order to work, be sure to include it before ' + _requesting + '!'); + } + return isRequired; +} + +/** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by update method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ +function arrow(data, options) { + var _data$offsets$arrow; + + // arrow depends on keepTogether in order to work + if (!isModifierRequired(data.instance.modifiers, 'arrow', 'keepTogether')) { + return data; + } + + var arrowElement = options.element; + + // if arrowElement is a string, suppose it's a CSS selector + if (typeof arrowElement === 'string') { + arrowElement = data.instance.popper.querySelector(arrowElement); + + // if arrowElement is not found, don't run the modifier + if (!arrowElement) { + return data; + } + } else { + // if the arrowElement isn't a query selector we must check that the + // provided DOM node is child of its popper node + if (!data.instance.popper.contains(arrowElement)) { + console.warn('WARNING: `arrow.element` must be child of its popper element!'); + return data; + } + } + + var placement = data.placement.split('-')[0]; + var _data$offsets = data.offsets, + popper = _data$offsets.popper, + reference = _data$offsets.reference; + + var isVertical = ['left', 'right'].indexOf(placement) !== -1; + + var len = isVertical ? 'height' : 'width'; + var sideCapitalized = isVertical ? 'Top' : 'Left'; + var side = sideCapitalized.toLowerCase(); + var altSide = isVertical ? 'left' : 'top'; + var opSide = isVertical ? 'bottom' : 'right'; + var arrowElementSize = getOuterSizes(arrowElement)[len]; + + // + // extends keepTogether behavior making sure the popper and its + // reference have enough pixels in conjuction + // + + // top/left side + if (reference[opSide] - arrowElementSize < popper[side]) { + data.offsets.popper[side] -= popper[side] - (reference[opSide] - arrowElementSize); + } + // bottom/right side + if (reference[side] + arrowElementSize > popper[opSide]) { + data.offsets.popper[side] += reference[side] + arrowElementSize - popper[opSide]; + } + data.offsets.popper = getClientRect(data.offsets.popper); + + // compute center of the popper + var center = reference[side] + reference[len] / 2 - arrowElementSize / 2; + + // Compute the sideValue using the updated popper offsets + // take popper margin in account because we don't have this info available + var css = getStyleComputedProperty(data.instance.popper); + var popperMarginSide = parseFloat(css['margin' + sideCapitalized], 10); + var popperBorderSide = parseFloat(css['border' + sideCapitalized + 'Width'], 10); + var sideValue = center - data.offsets.popper[side] - popperMarginSide - popperBorderSide; + + // prevent arrowElement from being placed not contiguously to its popper + sideValue = Math.max(Math.min(popper[len] - arrowElementSize, sideValue), 0); + + data.arrowElement = arrowElement; + data.offsets.arrow = (_data$offsets$arrow = {}, defineProperty(_data$offsets$arrow, side, Math.round(sideValue)), defineProperty(_data$offsets$arrow, altSide, ''), _data$offsets$arrow); + + return data; +} + +/** + * Get the opposite placement variation of the given one + * @method + * @memberof Popper.Utils + * @argument {String} placement variation + * @returns {String} flipped placement variation + */ +function getOppositeVariation(variation) { + if (variation === 'end') { + return 'start'; + } else if (variation === 'start') { + return 'end'; + } + return variation; +} + +/** + * List of accepted placements to use as values of the `placement` option.<br /> + * Valid placements are: + * - `auto` + * - `top` + * - `right` + * - `bottom` + * - `left` + * + * Each placement can have a variation from this list: + * - `-start` + * - `-end` + * + * Variations are interpreted easily if you think of them as the left to right + * written languages. Horizontally (`top` and `bottom`), `start` is left and `end` + * is right.<br /> + * Vertically (`left` and `right`), `start` is top and `end` is bottom. + * + * Some valid examples are: + * - `top-end` (on top of reference, right aligned) + * - `right-start` (on right of reference, top aligned) + * - `bottom` (on bottom, centered) + * - `auto-right` (on the side with more space available, alignment depends by placement) + * + * @static + * @type {Array} + * @enum {String} + * @readonly + * @method placements + * @memberof Popper + */ +var placements = ['auto-start', 'auto', 'auto-end', 'top-start', 'top', 'top-end', 'right-start', 'right', 'right-end', 'bottom-end', 'bottom', 'bottom-start', 'left-end', 'left', 'left-start']; + +// Get rid of `auto` `auto-start` and `auto-end` +var validPlacements = placements.slice(3); + +/** + * Given an initial placement, returns all the subsequent placements + * clockwise (or counter-clockwise). + * + * @method + * @memberof Popper.Utils + * @argument {String} placement - A valid placement (it accepts variations) + * @argument {Boolean} counter - Set to true to walk the placements counterclockwise + * @returns {Array} placements including their variations + */ +function clockwise(placement) { + var counter = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; + + var index = validPlacements.indexOf(placement); + var arr = validPlacements.slice(index + 1).concat(validPlacements.slice(0, index)); + return counter ? arr.reverse() : arr; +} + +var BEHAVIORS = { + FLIP: 'flip', + CLOCKWISE: 'clockwise', + COUNTERCLOCKWISE: 'counterclockwise' +}; + +/** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by update method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ +function flip(data, options) { + // if `inner` modifier is enabled, we can't use the `flip` modifier + if (isModifierEnabled(data.instance.modifiers, 'inner')) { + return data; + } + + if (data.flipped && data.placement === data.originalPlacement) { + // seems like flip is trying to loop, probably there's not enough space on any of the flippable sides + return data; + } + + var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options.padding, options.boundariesElement); + + var placement = data.placement.split('-')[0]; + var placementOpposite = getOppositePlacement(placement); + var variation = data.placement.split('-')[1] || ''; + + var flipOrder = []; + + switch (options.behavior) { + case BEHAVIORS.FLIP: + flipOrder = [placement, placementOpposite]; + break; + case BEHAVIORS.CLOCKWISE: + flipOrder = clockwise(placement); + break; + case BEHAVIORS.COUNTERCLOCKWISE: + flipOrder = clockwise(placement, true); + break; + default: + flipOrder = options.behavior; + } + + flipOrder.forEach(function (step, index) { + if (placement !== step || flipOrder.length === index + 1) { + return data; + } + + placement = data.placement.split('-')[0]; + placementOpposite = getOppositePlacement(placement); + + var popperOffsets = data.offsets.popper; + var refOffsets = data.offsets.reference; + + // using floor because the reference offsets may contain decimals we are not going to consider here + var floor = Math.floor; + var overlapsRef = placement === 'left' && floor(popperOffsets.right) > floor(refOffsets.left) || placement === 'right' && floor(popperOffsets.left) < floor(refOffsets.right) || placement === 'top' && floor(popperOffsets.bottom) > floor(refOffsets.top) || placement === 'bottom' && floor(popperOffsets.top) < floor(refOffsets.bottom); + + var overflowsLeft = floor(popperOffsets.left) < floor(boundaries.left); + var overflowsRight = floor(popperOffsets.right) > floor(boundaries.right); + var overflowsTop = floor(popperOffsets.top) < floor(boundaries.top); + var overflowsBottom = floor(popperOffsets.bottom) > floor(boundaries.bottom); + + var overflowsBoundaries = placement === 'left' && overflowsLeft || placement === 'right' && overflowsRight || placement === 'top' && overflowsTop || placement === 'bottom' && overflowsBottom; + + // flip the variation if required + var isVertical = ['top', 'bottom'].indexOf(placement) !== -1; + var flippedVariation = !!options.flipVariations && (isVertical && variation === 'start' && overflowsLeft || isVertical && variation === 'end' && overflowsRight || !isVertical && variation === 'start' && overflowsTop || !isVertical && variation === 'end' && overflowsBottom); + + if (overlapsRef || overflowsBoundaries || flippedVariation) { + // this boolean to detect any flip loop + data.flipped = true; + + if (overlapsRef || overflowsBoundaries) { + placement = flipOrder[index + 1]; + } + + if (flippedVariation) { + variation = getOppositeVariation(variation); + } + + data.placement = placement + (variation ? '-' + variation : ''); + + // this object contains `position`, we want to preserve it along with + // any additional property we may add in the future + data.offsets.popper = _extends$1({}, data.offsets.popper, getPopperOffsets(data.instance.popper, data.offsets.reference, data.placement)); + + data = runModifiers(data.instance.modifiers, data, 'flip'); + } + }); + return data; +} + +/** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by update method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ +function keepTogether(data) { + var _data$offsets = data.offsets, + popper = _data$offsets.popper, + reference = _data$offsets.reference; + + var placement = data.placement.split('-')[0]; + var floor = Math.floor; + var isVertical = ['top', 'bottom'].indexOf(placement) !== -1; + var side = isVertical ? 'right' : 'bottom'; + var opSide = isVertical ? 'left' : 'top'; + var measurement = isVertical ? 'width' : 'height'; + + if (popper[side] < floor(reference[opSide])) { + data.offsets.popper[opSide] = floor(reference[opSide]) - popper[measurement]; + } + if (popper[opSide] > floor(reference[side])) { + data.offsets.popper[opSide] = floor(reference[side]); + } + + return data; +} + +/** + * Converts a string containing value + unit into a px value number + * @function + * @memberof {modifiers~offset} + * @private + * @argument {String} str - Value + unit string + * @argument {String} measurement - `height` or `width` + * @argument {Object} popperOffsets + * @argument {Object} referenceOffsets + * @returns {Number|String} + * Value in pixels, or original string if no values were extracted + */ +function toValue(str, measurement, popperOffsets, referenceOffsets) { + // separate value from unit + var split = str.match(/((?:\-|\+)?\d*\.?\d*)(.*)/); + var value = +split[1]; + var unit = split[2]; + + // If it's not a number it's an operator, I guess + if (!value) { + return str; + } + + if (unit.indexOf('%') === 0) { + var element = void 0; + switch (unit) { + case '%p': + element = popperOffsets; + break; + case '%': + case '%r': + default: + element = referenceOffsets; + } + + var rect = getClientRect(element); + return rect[measurement] / 100 * value; + } else if (unit === 'vh' || unit === 'vw') { + // if is a vh or vw, we calculate the size based on the viewport + var size = void 0; + if (unit === 'vh') { + size = Math.max(document.documentElement.clientHeight, window.innerHeight || 0); + } else { + size = Math.max(document.documentElement.clientWidth, window.innerWidth || 0); + } + return size / 100 * value; + } else { + // if is an explicit pixel unit, we get rid of the unit and keep the value + // if is an implicit unit, it's px, and we return just the value + return value; + } +} + +/** + * Parse an `offset` string to extrapolate `x` and `y` numeric offsets. + * @function + * @memberof {modifiers~offset} + * @private + * @argument {String} offset + * @argument {Object} popperOffsets + * @argument {Object} referenceOffsets + * @argument {String} basePlacement + * @returns {Array} a two cells array with x and y offsets in numbers + */ +function parseOffset(offset, popperOffsets, referenceOffsets, basePlacement) { + var offsets = [0, 0]; + + // Use height if placement is left or right and index is 0 otherwise use width + // in this way the first offset will use an axis and the second one + // will use the other one + var useHeight = ['right', 'left'].indexOf(basePlacement) !== -1; + + // Split the offset string to obtain a list of values and operands + // The regex addresses values with the plus or minus sign in front (+10, -20, etc) + var fragments = offset.split(/(\+|\-)/).map(function (frag) { + return frag.trim(); + }); + + // Detect if the offset string contains a pair of values or a single one + // they could be separated by comma or space + var divider = fragments.indexOf(find(fragments, function (frag) { + return frag.search(/,|\s/) !== -1; + })); + + if (fragments[divider] && fragments[divider].indexOf(',') === -1) { + console.warn('Offsets separated by white space(s) are deprecated, use a comma (,) instead.'); + } + + // If divider is found, we divide the list of values and operands to divide + // them by ofset X and Y. + var splitRegex = /\s*,\s*|\s+/; + var ops = divider !== -1 ? [fragments.slice(0, divider).concat([fragments[divider].split(splitRegex)[0]]), [fragments[divider].split(splitRegex)[1]].concat(fragments.slice(divider + 1))] : [fragments]; + + // Convert the values with units to absolute pixels to allow our computations + ops = ops.map(function (op, index) { + // Most of the units rely on the orientation of the popper + var measurement = (index === 1 ? !useHeight : useHeight) ? 'height' : 'width'; + var mergeWithPrevious = false; + return op + // This aggregates any `+` or `-` sign that aren't considered operators + // e.g.: 10 + +5 => [10, +, +5] + .reduce(function (a, b) { + if (a[a.length - 1] === '' && ['+', '-'].indexOf(b) !== -1) { + a[a.length - 1] = b; + mergeWithPrevious = true; + return a; + } else if (mergeWithPrevious) { + a[a.length - 1] += b; + mergeWithPrevious = false; + return a; + } else { + return a.concat(b); + } + }, []) + // Here we convert the string values into number values (in px) + .map(function (str) { + return toValue(str, measurement, popperOffsets, referenceOffsets); + }); + }); + + // Loop trough the offsets arrays and execute the operations + ops.forEach(function (op, index) { + op.forEach(function (frag, index2) { + if (isNumeric(frag)) { + offsets[index] += frag * (op[index2 - 1] === '-' ? -1 : 1); + } + }); + }); + return offsets; +} + +/** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by update method + * @argument {Object} options - Modifiers configuration and options + * @argument {Number|String} options.offset=0 + * The offset value as described in the modifier description + * @returns {Object} The data object, properly modified + */ +function offset(data, _ref) { + var offset = _ref.offset; + var placement = data.placement, + _data$offsets = data.offsets, + popper = _data$offsets.popper, + reference = _data$offsets.reference; + + var basePlacement = placement.split('-')[0]; + + var offsets = void 0; + if (isNumeric(+offset)) { + offsets = [+offset, 0]; + } else { + offsets = parseOffset(offset, popper, reference, basePlacement); + } + + if (basePlacement === 'left') { + popper.top += offsets[0]; + popper.left -= offsets[1]; + } else if (basePlacement === 'right') { + popper.top += offsets[0]; + popper.left += offsets[1]; + } else if (basePlacement === 'top') { + popper.left += offsets[0]; + popper.top -= offsets[1]; + } else if (basePlacement === 'bottom') { + popper.left += offsets[0]; + popper.top += offsets[1]; + } + + data.popper = popper; + return data; +} + +/** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by `update` method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ +function preventOverflow(data, options) { + var boundariesElement = options.boundariesElement || getOffsetParent(data.instance.popper); + + // If offsetParent is the reference element, we really want to + // go one step up and use the next offsetParent as reference to + // avoid to make this modifier completely useless and look like broken + if (data.instance.reference === boundariesElement) { + boundariesElement = getOffsetParent(boundariesElement); + } + + var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options.padding, boundariesElement); + options.boundaries = boundaries; + + var order = options.priority; + var popper = data.offsets.popper; + + var check = { + primary: function primary(placement) { + var value = popper[placement]; + if (popper[placement] < boundaries[placement] && !options.escapeWithReference) { + value = Math.max(popper[placement], boundaries[placement]); + } + return defineProperty({}, placement, value); + }, + secondary: function secondary(placement) { + var mainSide = placement === 'right' ? 'left' : 'top'; + var value = popper[mainSide]; + if (popper[placement] > boundaries[placement] && !options.escapeWithReference) { + value = Math.min(popper[mainSide], boundaries[placement] - (placement === 'right' ? popper.width : popper.height)); + } + return defineProperty({}, mainSide, value); + } + }; + + order.forEach(function (placement) { + var side = ['left', 'top'].indexOf(placement) !== -1 ? 'primary' : 'secondary'; + popper = _extends$1({}, popper, check[side](placement)); + }); + + data.offsets.popper = popper; + + return data; +} + +/** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by `update` method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ +function shift(data) { + var placement = data.placement; + var basePlacement = placement.split('-')[0]; + var shiftvariation = placement.split('-')[1]; + + // if shift shiftvariation is specified, run the modifier + if (shiftvariation) { + var _data$offsets = data.offsets, + reference = _data$offsets.reference, + popper = _data$offsets.popper; + + var isVertical = ['bottom', 'top'].indexOf(basePlacement) !== -1; + var side = isVertical ? 'left' : 'top'; + var measurement = isVertical ? 'width' : 'height'; + + var shiftOffsets = { + start: defineProperty({}, side, reference[side]), + end: defineProperty({}, side, reference[side] + reference[measurement] - popper[measurement]) + }; + + data.offsets.popper = _extends$1({}, popper, shiftOffsets[shiftvariation]); + } + + return data; +} + +/** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by update method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ +function hide(data) { + if (!isModifierRequired(data.instance.modifiers, 'hide', 'preventOverflow')) { + return data; + } + + var refRect = data.offsets.reference; + var bound = find(data.instance.modifiers, function (modifier) { + return modifier.name === 'preventOverflow'; + }).boundaries; + + if (refRect.bottom < bound.top || refRect.left > bound.right || refRect.top > bound.bottom || refRect.right < bound.left) { + // Avoid unnecessary DOM access if visibility hasn't changed + if (data.hide === true) { + return data; + } + + data.hide = true; + data.attributes['x-out-of-boundaries'] = ''; + } else { + // Avoid unnecessary DOM access if visibility hasn't changed + if (data.hide === false) { + return data; + } + + data.hide = false; + data.attributes['x-out-of-boundaries'] = false; + } + + return data; +} + +/** + * @function + * @memberof Modifiers + * @argument {Object} data - The data object generated by `update` method + * @argument {Object} options - Modifiers configuration and options + * @returns {Object} The data object, properly modified + */ +function inner(data) { + var placement = data.placement; + var basePlacement = placement.split('-')[0]; + var _data$offsets = data.offsets, + popper = _data$offsets.popper, + reference = _data$offsets.reference; + + var isHoriz = ['left', 'right'].indexOf(basePlacement) !== -1; + + var subtractLength = ['top', 'left'].indexOf(basePlacement) === -1; + + popper[isHoriz ? 'left' : 'top'] = reference[basePlacement] - (subtractLength ? popper[isHoriz ? 'width' : 'height'] : 0); + + data.placement = getOppositePlacement(placement); + data.offsets.popper = getClientRect(popper); + + return data; +} + +/** + * Modifier function, each modifier can have a function of this type assigned + * to its `fn` property.<br /> + * These functions will be called on each update, this means that you must + * make sure they are performant enough to avoid performance bottlenecks. + * + * @function ModifierFn + * @argument {dataObject} data - The data object generated by `update` method + * @argument {Object} options - Modifiers configuration and options + * @returns {dataObject} The data object, properly modified + */ + +/** + * Modifiers are plugins used to alter the behavior of your poppers.<br /> + * Popper.js uses a set of 9 modifiers to provide all the basic functionalities + * needed by the library. + * + * Usually you don't want to override the `order`, `fn` and `onLoad` props. + * All the other properties are configurations that could be tweaked. + * @namespace modifiers + */ +var modifiers = { + /** + * Modifier used to shift the popper on the start or end of its reference + * element.<br /> + * It will read the variation of the `placement` property.<br /> + * It can be one either `-end` or `-start`. + * @memberof modifiers + * @inner + */ + shift: { + /** @prop {number} order=100 - Index used to define the order of execution */ + order: 100, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: shift + }, + + /** + * The `offset` modifier can shift your popper on both its axis. + * + * It accepts the following units: + * - `px` or unitless, interpreted as pixels + * - `%` or `%r`, percentage relative to the length of the reference element + * - `%p`, percentage relative to the length of the popper element + * - `vw`, CSS viewport width unit + * - `vh`, CSS viewport height unit + * + * For length is intended the main axis relative to the placement of the popper.<br /> + * This means that if the placement is `top` or `bottom`, the length will be the + * `width`. In case of `left` or `right`, it will be the height. + * + * You can provide a single value (as `Number` or `String`), or a pair of values + * as `String` divided by a comma or one (or more) white spaces.<br /> + * The latter is a deprecated method because it leads to confusion and will be + * removed in v2.<br /> + * Additionally, it accepts additions and subtractions between different units. + * Note that multiplications and divisions aren't supported. + * + * Valid examples are: + * ``` + * 10 + * '10%' + * '10, 10' + * '10%, 10' + * '10 + 10%' + * '10 - 5vh + 3%' + * '-10px + 5vh, 5px - 6%' + * ``` + * > **NB**: If you desire to apply offsets to your poppers in a way that may make them overlap + * > with their reference element, unfortunately, you will have to disable the `flip` modifier. + * > More on this [reading this issue](https://github.com/FezVrasta/popper.js/issues/373) + * + * @memberof modifiers + * @inner + */ + offset: { + /** @prop {number} order=200 - Index used to define the order of execution */ + order: 200, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: offset, + /** @prop {Number|String} offset=0 + * The offset value as described in the modifier description + */ + offset: 0 + }, + + /** + * Modifier used to prevent the popper from being positioned outside the boundary. + * + * An scenario exists where the reference itself is not within the boundaries.<br /> + * We can say it has "escaped the boundaries" — or just "escaped".<br /> + * In this case we need to decide whether the popper should either: + * + * - detach from the reference and remain "trapped" in the boundaries, or + * - if it should ignore the boundary and "escape with its reference" + * + * When `escapeWithReference` is set to`true` and reference is completely + * outside its boundaries, the popper will overflow (or completely leave) + * the boundaries in order to remain attached to the edge of the reference. + * + * @memberof modifiers + * @inner + */ + preventOverflow: { + /** @prop {number} order=300 - Index used to define the order of execution */ + order: 300, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: preventOverflow, + /** + * @prop {Array} [priority=['left','right','top','bottom']] + * Popper will try to prevent overflow following these priorities by default, + * then, it could overflow on the left and on top of the `boundariesElement` + */ + priority: ['left', 'right', 'top', 'bottom'], + /** + * @prop {number} padding=5 + * Amount of pixel used to define a minimum distance between the boundaries + * and the popper this makes sure the popper has always a little padding + * between the edges of its container + */ + padding: 5, + /** + * @prop {String|HTMLElement} boundariesElement='scrollParent' + * Boundaries used by the modifier, can be `scrollParent`, `window`, + * `viewport` or any DOM element. + */ + boundariesElement: 'scrollParent' + }, + + /** + * Modifier used to make sure the reference and its popper stay near eachothers + * without leaving any gap between the two. Expecially useful when the arrow is + * enabled and you want to assure it to point to its reference element. + * It cares only about the first axis, you can still have poppers with margin + * between the popper and its reference element. + * @memberof modifiers + * @inner + */ + keepTogether: { + /** @prop {number} order=400 - Index used to define the order of execution */ + order: 400, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: keepTogether + }, + + /** + * This modifier is used to move the `arrowElement` of the popper to make + * sure it is positioned between the reference element and its popper element. + * It will read the outer size of the `arrowElement` node to detect how many + * pixels of conjuction are needed. + * + * It has no effect if no `arrowElement` is provided. + * @memberof modifiers + * @inner + */ + arrow: { + /** @prop {number} order=500 - Index used to define the order of execution */ + order: 500, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: arrow, + /** @prop {String|HTMLElement} element='[x-arrow]' - Selector or node used as arrow */ + element: '[x-arrow]' + }, + + /** + * Modifier used to flip the popper's placement when it starts to overlap its + * reference element. + * + * Requires the `preventOverflow` modifier before it in order to work. + * + * **NOTE:** this modifier will interrupt the current update cycle and will + * restart it if it detects the need to flip the placement. + * @memberof modifiers + * @inner + */ + flip: { + /** @prop {number} order=600 - Index used to define the order of execution */ + order: 600, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: flip, + /** + * @prop {String|Array} behavior='flip' + * The behavior used to change the popper's placement. It can be one of + * `flip`, `clockwise`, `counterclockwise` or an array with a list of valid + * placements (with optional variations). + */ + behavior: 'flip', + /** + * @prop {number} padding=5 + * The popper will flip if it hits the edges of the `boundariesElement` + */ + padding: 5, + /** + * @prop {String|HTMLElement} boundariesElement='viewport' + * The element which will define the boundaries of the popper position, + * the popper will never be placed outside of the defined boundaries + * (except if keepTogether is enabled) + */ + boundariesElement: 'viewport' + }, + + /** + * Modifier used to make the popper flow toward the inner of the reference element. + * By default, when this modifier is disabled, the popper will be placed outside + * the reference element. + * @memberof modifiers + * @inner + */ + inner: { + /** @prop {number} order=700 - Index used to define the order of execution */ + order: 700, + /** @prop {Boolean} enabled=false - Whether the modifier is enabled or not */ + enabled: false, + /** @prop {ModifierFn} */ + fn: inner + }, + + /** + * Modifier used to hide the popper when its reference element is outside of the + * popper boundaries. It will set a `x-out-of-boundaries` attribute which can + * be used to hide with a CSS selector the popper when its reference is + * out of boundaries. + * + * Requires the `preventOverflow` modifier before it in order to work. + * @memberof modifiers + * @inner + */ + hide: { + /** @prop {number} order=800 - Index used to define the order of execution */ + order: 800, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: hide + }, + + /** + * Computes the style that will be applied to the popper element to gets + * properly positioned. + * + * Note that this modifier will not touch the DOM, it just prepares the styles + * so that `applyStyle` modifier can apply it. This separation is useful + * in case you need to replace `applyStyle` with a custom implementation. + * + * This modifier has `850` as `order` value to maintain backward compatibility + * with previous versions of Popper.js. Expect the modifiers ordering method + * to change in future major versions of the library. + * + * @memberof modifiers + * @inner + */ + computeStyle: { + /** @prop {number} order=850 - Index used to define the order of execution */ + order: 850, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: computeStyle, + /** + * @prop {Boolean} gpuAcceleration=true + * If true, it uses the CSS 3d transformation to position the popper. + * Otherwise, it will use the `top` and `left` properties. + */ + gpuAcceleration: true, + /** + * @prop {string} [x='bottom'] + * Where to anchor the X axis (`bottom` or `top`). AKA X offset origin. + * Change this if your popper should grow in a direction different from `bottom` + */ + x: 'bottom', + /** + * @prop {string} [x='left'] + * Where to anchor the Y axis (`left` or `right`). AKA Y offset origin. + * Change this if your popper should grow in a direction different from `right` + */ + y: 'right' + }, + + /** + * Applies the computed styles to the popper element. + * + * All the DOM manipulations are limited to this modifier. This is useful in case + * you want to integrate Popper.js inside a framework or view library and you + * want to delegate all the DOM manipulations to it. + * + * Note that if you disable this modifier, you must make sure the popper element + * has its position set to `absolute` before Popper.js can do its work! + * + * Just disable this modifier and define you own to achieve the desired effect. + * + * @memberof modifiers + * @inner + */ + applyStyle: { + /** @prop {number} order=900 - Index used to define the order of execution */ + order: 900, + /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ + enabled: true, + /** @prop {ModifierFn} */ + fn: applyStyle, + /** @prop {Function} */ + onLoad: applyStyleOnLoad, + /** + * @deprecated since version 1.10.0, the property moved to `computeStyle` modifier + * @prop {Boolean} gpuAcceleration=true + * If true, it uses the CSS 3d transformation to position the popper. + * Otherwise, it will use the `top` and `left` properties. + */ + gpuAcceleration: undefined + } +}; + +/** + * The `dataObject` is an object containing all the informations used by Popper.js + * this object get passed to modifiers and to the `onCreate` and `onUpdate` callbacks. + * @name dataObject + * @property {Object} data.instance The Popper.js instance + * @property {String} data.placement Placement applied to popper + * @property {String} data.originalPlacement Placement originally defined on init + * @property {Boolean} data.flipped True if popper has been flipped by flip modifier + * @property {Boolean} data.hide True if the reference element is out of boundaries, useful to know when to hide the popper. + * @property {HTMLElement} data.arrowElement Node used as arrow by arrow modifier + * @property {Object} data.styles Any CSS property defined here will be applied to the popper, it expects the JavaScript nomenclature (eg. `marginBottom`) + * @property {Object} data.arrowStyles Any CSS property defined here will be applied to the popper arrow, it expects the JavaScript nomenclature (eg. `marginBottom`) + * @property {Object} data.boundaries Offsets of the popper boundaries + * @property {Object} data.offsets The measurements of popper, reference and arrow elements. + * @property {Object} data.offsets.popper `top`, `left`, `width`, `height` values + * @property {Object} data.offsets.reference `top`, `left`, `width`, `height` values + * @property {Object} data.offsets.arrow] `top` and `left` offsets, only one of them will be different from 0 + */ + +/** + * Default options provided to Popper.js constructor.<br /> + * These can be overriden using the `options` argument of Popper.js.<br /> + * To override an option, simply pass as 3rd argument an object with the same + * structure of this object, example: + * ``` + * new Popper(ref, pop, { + * modifiers: { + * preventOverflow: { enabled: false } + * } + * }) + * ``` + * @type {Object} + * @static + * @memberof Popper + */ +var Defaults = { + /** + * Popper's placement + * @prop {Popper.placements} placement='bottom' + */ + placement: 'bottom', + + /** + * Whether events (resize, scroll) are initially enabled + * @prop {Boolean} eventsEnabled=true + */ + eventsEnabled: true, + + /** + * Set to true if you want to automatically remove the popper when + * you call the `destroy` method. + * @prop {Boolean} removeOnDestroy=false + */ + removeOnDestroy: false, + + /** + * Callback called when the popper is created.<br /> + * By default, is set to no-op.<br /> + * Access Popper.js instance with `data.instance`. + * @prop {onCreate} + */ + onCreate: function onCreate() {}, + + /** + * Callback called when the popper is updated, this callback is not called + * on the initialization/creation of the popper, but only on subsequent + * updates.<br /> + * By default, is set to no-op.<br /> + * Access Popper.js instance with `data.instance`. + * @prop {onUpdate} + */ + onUpdate: function onUpdate() {}, + + /** + * List of modifiers used to modify the offsets before they are applied to the popper. + * They provide most of the functionalities of Popper.js + * @prop {modifiers} + */ + modifiers: modifiers +}; + +/** + * @callback onCreate + * @param {dataObject} data + */ + +/** + * @callback onUpdate + * @param {dataObject} data + */ + +// Utils +// Methods +var Popper = function () { + /** + * Create a new Popper.js instance + * @class Popper + * @param {HTMLElement|referenceObject} reference - The reference element used to position the popper + * @param {HTMLElement} popper - The HTML element used as popper. + * @param {Object} options - Your custom options to override the ones defined in [Defaults](#defaults) + * @return {Object} instance - The generated Popper.js instance + */ + function Popper(reference, popper) { + var _this = this; + + var options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {}; + classCallCheck(this, Popper); + + this.scheduleUpdate = function () { + return requestAnimationFrame(_this.update); + }; + + // make update() debounced, so that it only runs at most once-per-tick + this.update = debounce(this.update.bind(this)); + + // with {} we create a new object with the options inside it + this.options = _extends$1({}, Popper.Defaults, options); + + // init state + this.state = { + isDestroyed: false, + isCreated: false, + scrollParents: [] + }; + + // get reference and popper elements (allow jQuery wrappers) + this.reference = reference && reference.jquery ? reference[0] : reference; + this.popper = popper && popper.jquery ? popper[0] : popper; + + // Deep merge modifiers options + this.options.modifiers = {}; + Object.keys(_extends$1({}, Popper.Defaults.modifiers, options.modifiers)).forEach(function (name) { + _this.options.modifiers[name] = _extends$1({}, Popper.Defaults.modifiers[name] || {}, options.modifiers ? options.modifiers[name] : {}); + }); + + // Refactoring modifiers' list (Object => Array) + this.modifiers = Object.keys(this.options.modifiers).map(function (name) { + return _extends$1({ + name: name + }, _this.options.modifiers[name]); + }) + // sort the modifiers by order + .sort(function (a, b) { + return a.order - b.order; + }); + + // modifiers have the ability to execute arbitrary code when Popper.js get inited + // such code is executed in the same order of its modifier + // they could add new properties to their options configuration + // BE AWARE: don't add options to `options.modifiers.name` but to `modifierOptions`! + this.modifiers.forEach(function (modifierOptions) { + if (modifierOptions.enabled && isFunction(modifierOptions.onLoad)) { + modifierOptions.onLoad(_this.reference, _this.popper, _this.options, modifierOptions, _this.state); + } + }); + + // fire the first update to position the popper in the right place + this.update(); + + var eventsEnabled = this.options.eventsEnabled; + if (eventsEnabled) { + // setup event listeners, they will take care of update the position in specific situations + this.enableEventListeners(); + } + + this.state.eventsEnabled = eventsEnabled; + } + + // We can't use class properties because they don't get listed in the + // class prototype and break stuff like Sinon stubs + + + createClass(Popper, [{ + key: 'update', + value: function update$$1() { + return update.call(this); + } + }, { + key: 'destroy', + value: function destroy$$1() { + return destroy.call(this); + } + }, { + key: 'enableEventListeners', + value: function enableEventListeners$$1() { + return enableEventListeners.call(this); + } + }, { + key: 'disableEventListeners', + value: function disableEventListeners$$1() { + return disableEventListeners.call(this); + } + + /** + * Schedule an update, it will run on the next UI update available + * @method scheduleUpdate + * @memberof Popper + */ + + + /** + * Collection of utilities useful when writing custom modifiers. + * Starting from version 1.7, this method is available only if you + * include `popper-utils.js` before `popper.js`. + * + * **DEPRECATION**: This way to access PopperUtils is deprecated + * and will be removed in v2! Use the PopperUtils module directly instead. + * Due to the high instability of the methods contained in Utils, we can't + * guarantee them to follow semver. Use them at your own risk! + * @static + * @private + * @type {Object} + * @deprecated since version 1.8 + * @member Utils + * @memberof Popper + */ + + }]); + return Popper; +}(); + +/** + * The `referenceObject` is an object that provides an interface compatible with Popper.js + * and lets you use it as replacement of a real DOM node.<br /> + * You can use this method to position a popper relatively to a set of coordinates + * in case you don't have a DOM node to use as reference. + * + * ``` + * new Popper(referenceObject, popperNode); + * ``` + * + * NB: This feature isn't supported in Internet Explorer 10 + * @name referenceObject + * @property {Function} data.getBoundingClientRect + * A function that returns a set of coordinates compatible with the native `getBoundingClientRect` method. + * @property {number} data.clientWidth + * An ES6 getter that will return the width of the virtual reference element. + * @property {number} data.clientHeight + * An ES6 getter that will return the height of the virtual reference element. + */ + + +Popper.Utils = (typeof window !== 'undefined' ? window : global).PopperUtils; +Popper.placements = placements; +Popper.Defaults = Defaults; + +/** + * -------------------------------------------------------------------------- + * Bootstrap (v4.0.0): dropdown.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + +var Dropdown = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'dropdown'; + var VERSION = '4.0.0'; + var DATA_KEY = 'bs.dropdown'; + var EVENT_KEY = "." + DATA_KEY; + var DATA_API_KEY = '.data-api'; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var ESCAPE_KEYCODE = 27; // KeyboardEvent.which value for Escape (Esc) key + + var SPACE_KEYCODE = 32; // KeyboardEvent.which value for space key + + var TAB_KEYCODE = 9; // KeyboardEvent.which value for tab key + + var ARROW_UP_KEYCODE = 38; // KeyboardEvent.which value for up arrow key + + var ARROW_DOWN_KEYCODE = 40; // KeyboardEvent.which value for down arrow key + + var RIGHT_MOUSE_BUTTON_WHICH = 3; // MouseEvent.which value for the right button (assuming a right-handed mouse) + + var REGEXP_KEYDOWN = new RegExp(ARROW_UP_KEYCODE + "|" + ARROW_DOWN_KEYCODE + "|" + ESCAPE_KEYCODE); + var Event = { + HIDE: "hide" + EVENT_KEY, + HIDDEN: "hidden" + EVENT_KEY, + SHOW: "show" + EVENT_KEY, + SHOWN: "shown" + EVENT_KEY, + CLICK: "click" + EVENT_KEY, + CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY, + KEYDOWN_DATA_API: "keydown" + EVENT_KEY + DATA_API_KEY, + KEYUP_DATA_API: "keyup" + EVENT_KEY + DATA_API_KEY + }; + var ClassName = { + DISABLED: 'disabled', + SHOW: 'show', + DROPUP: 'dropup', + DROPRIGHT: 'dropright', + DROPLEFT: 'dropleft', + MENURIGHT: 'dropdown-menu-right', + MENULEFT: 'dropdown-menu-left', + POSITION_STATIC: 'position-static' + }; + var Selector = { + DATA_TOGGLE: '[data-toggle="dropdown"]', + FORM_CHILD: '.dropdown form', + MENU: '.dropdown-menu', + NAVBAR_NAV: '.navbar-nav', + VISIBLE_ITEMS: '.dropdown-menu .dropdown-item:not(.disabled)' + }; + var AttachmentMap = { + TOP: 'top-start', + TOPEND: 'top-end', + BOTTOM: 'bottom-start', + BOTTOMEND: 'bottom-end', + RIGHT: 'right-start', + RIGHTEND: 'right-end', + LEFT: 'left-start', + LEFTEND: 'left-end' + }; + var Default = { + offset: 0, + flip: true, + boundary: 'scrollParent' + }; + var DefaultType = { + offset: '(number|string|function)', + flip: 'boolean', + boundary: '(string|element)' + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Dropdown = + /*#__PURE__*/ + function () { + function Dropdown(element, config) { + this._element = element; + this._popper = null; + this._config = this._getConfig(config); + this._menu = this._getMenuElement(); + this._inNavbar = this._detectNavbar(); + + this._addEventListeners(); + } // Getters + + + var _proto = Dropdown.prototype; + + // Public + _proto.toggle = function toggle() { + if (this._element.disabled || $$$1(this._element).hasClass(ClassName.DISABLED)) { + return; + } + + var parent = Dropdown._getParentFromElement(this._element); + + var isActive = $$$1(this._menu).hasClass(ClassName.SHOW); + + Dropdown._clearMenus(); + + if (isActive) { + return; + } + + var relatedTarget = { + relatedTarget: this._element + }; + var showEvent = $$$1.Event(Event.SHOW, relatedTarget); + $$$1(parent).trigger(showEvent); + + if (showEvent.isDefaultPrevented()) { + return; + } // Disable totally Popper.js for Dropdown in Navbar + + + if (!this._inNavbar) { + /** + * Check for Popper dependency + * Popper - https://popper.js.org + */ + if (typeof Popper === 'undefined') { + throw new TypeError('Bootstrap dropdown require Popper.js (https://popper.js.org)'); + } + + var element = this._element; // For dropup with alignment we use the parent as popper container + + if ($$$1(parent).hasClass(ClassName.DROPUP)) { + if ($$$1(this._menu).hasClass(ClassName.MENULEFT) || $$$1(this._menu).hasClass(ClassName.MENURIGHT)) { + element = parent; + } + } // If boundary is not `scrollParent`, then set position to `static` + // to allow the menu to "escape" the scroll parent's boundaries + // https://github.com/twbs/bootstrap/issues/24251 + + + if (this._config.boundary !== 'scrollParent') { + $$$1(parent).addClass(ClassName.POSITION_STATIC); + } + + this._popper = new Popper(element, this._menu, this._getPopperConfig()); + } // If this is a touch-enabled device we add extra + // empty mouseover listeners to the body's immediate children; + // only needed because of broken event delegation on iOS + // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html + + + if ('ontouchstart' in document.documentElement && $$$1(parent).closest(Selector.NAVBAR_NAV).length === 0) { + $$$1('body').children().on('mouseover', null, $$$1.noop); + } + + this._element.focus(); + + this._element.setAttribute('aria-expanded', true); + + $$$1(this._menu).toggleClass(ClassName.SHOW); + $$$1(parent).toggleClass(ClassName.SHOW).trigger($$$1.Event(Event.SHOWN, relatedTarget)); + }; + + _proto.dispose = function dispose() { + $$$1.removeData(this._element, DATA_KEY); + $$$1(this._element).off(EVENT_KEY); + this._element = null; + this._menu = null; + + if (this._popper !== null) { + this._popper.destroy(); + + this._popper = null; + } + }; + + _proto.update = function update() { + this._inNavbar = this._detectNavbar(); + + if (this._popper !== null) { + this._popper.scheduleUpdate(); + } + }; // Private + + + _proto._addEventListeners = function _addEventListeners() { + var _this = this; + + $$$1(this._element).on(Event.CLICK, function (event) { + event.preventDefault(); + event.stopPropagation(); + + _this.toggle(); + }); + }; + + _proto._getConfig = function _getConfig(config) { + config = _extends({}, this.constructor.Default, $$$1(this._element).data(), config); + Util.typeCheckConfig(NAME, config, this.constructor.DefaultType); + return config; + }; + + _proto._getMenuElement = function _getMenuElement() { + if (!this._menu) { + var parent = Dropdown._getParentFromElement(this._element); + + this._menu = $$$1(parent).find(Selector.MENU)[0]; + } + + return this._menu; + }; + + _proto._getPlacement = function _getPlacement() { + var $parentDropdown = $$$1(this._element).parent(); + var placement = AttachmentMap.BOTTOM; // Handle dropup + + if ($parentDropdown.hasClass(ClassName.DROPUP)) { + placement = AttachmentMap.TOP; + + if ($$$1(this._menu).hasClass(ClassName.MENURIGHT)) { + placement = AttachmentMap.TOPEND; + } + } else if ($parentDropdown.hasClass(ClassName.DROPRIGHT)) { + placement = AttachmentMap.RIGHT; + } else if ($parentDropdown.hasClass(ClassName.DROPLEFT)) { + placement = AttachmentMap.LEFT; + } else if ($$$1(this._menu).hasClass(ClassName.MENURIGHT)) { + placement = AttachmentMap.BOTTOMEND; + } + + return placement; + }; + + _proto._detectNavbar = function _detectNavbar() { + return $$$1(this._element).closest('.navbar').length > 0; + }; + + _proto._getPopperConfig = function _getPopperConfig() { + var _this2 = this; + + var offsetConf = {}; + + if (typeof this._config.offset === 'function') { + offsetConf.fn = function (data) { + data.offsets = _extends({}, data.offsets, _this2._config.offset(data.offsets) || {}); + return data; + }; + } else { + offsetConf.offset = this._config.offset; + } + + var popperConfig = { + placement: this._getPlacement(), + modifiers: { + offset: offsetConf, + flip: { + enabled: this._config.flip + }, + preventOverflow: { + boundariesElement: this._config.boundary + } + } + }; + return popperConfig; + }; // Static + + + Dropdown._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var data = $$$1(this).data(DATA_KEY); + + var _config = typeof config === 'object' ? config : null; + + if (!data) { + data = new Dropdown(this, _config); + $$$1(this).data(DATA_KEY, data); + } + + if (typeof config === 'string') { + if (typeof data[config] === 'undefined') { + throw new TypeError("No method named \"" + config + "\""); + } + + data[config](); + } + }); + }; + + Dropdown._clearMenus = function _clearMenus(event) { + if (event && (event.which === RIGHT_MOUSE_BUTTON_WHICH || event.type === 'keyup' && event.which !== TAB_KEYCODE)) { + return; + } + + var toggles = $$$1.makeArray($$$1(Selector.DATA_TOGGLE)); + + for (var i = 0; i < toggles.length; i++) { + var parent = Dropdown._getParentFromElement(toggles[i]); + + var context = $$$1(toggles[i]).data(DATA_KEY); + var relatedTarget = { + relatedTarget: toggles[i] + }; + + if (!context) { + continue; + } + + var dropdownMenu = context._menu; + + if (!$$$1(parent).hasClass(ClassName.SHOW)) { + continue; + } + + if (event && (event.type === 'click' && /input|textarea/i.test(event.target.tagName) || event.type === 'keyup' && event.which === TAB_KEYCODE) && $$$1.contains(parent, event.target)) { + continue; + } + + var hideEvent = $$$1.Event(Event.HIDE, relatedTarget); + $$$1(parent).trigger(hideEvent); + + if (hideEvent.isDefaultPrevented()) { + continue; + } // If this is a touch-enabled device we remove the extra + // empty mouseover listeners we added for iOS support + + + if ('ontouchstart' in document.documentElement) { + $$$1('body').children().off('mouseover', null, $$$1.noop); + } + + toggles[i].setAttribute('aria-expanded', 'false'); + $$$1(dropdownMenu).removeClass(ClassName.SHOW); + $$$1(parent).removeClass(ClassName.SHOW).trigger($$$1.Event(Event.HIDDEN, relatedTarget)); + } + }; + + Dropdown._getParentFromElement = function _getParentFromElement(element) { + var parent; + var selector = Util.getSelectorFromElement(element); + + if (selector) { + parent = $$$1(selector)[0]; + } + + return parent || element.parentNode; + }; // eslint-disable-next-line complexity + + + Dropdown._dataApiKeydownHandler = function _dataApiKeydownHandler(event) { + // If not input/textarea: + // - And not a key in REGEXP_KEYDOWN => not a dropdown command + // If input/textarea: + // - If space key => not a dropdown command + // - If key is other than escape + // - If key is not up or down => not a dropdown command + // - If trigger inside the menu => not a dropdown command + if (/input|textarea/i.test(event.target.tagName) ? event.which === SPACE_KEYCODE || event.which !== ESCAPE_KEYCODE && (event.which !== ARROW_DOWN_KEYCODE && event.which !== ARROW_UP_KEYCODE || $$$1(event.target).closest(Selector.MENU).length) : !REGEXP_KEYDOWN.test(event.which)) { + return; + } + + event.preventDefault(); + event.stopPropagation(); + + if (this.disabled || $$$1(this).hasClass(ClassName.DISABLED)) { + return; + } + + var parent = Dropdown._getParentFromElement(this); + + var isActive = $$$1(parent).hasClass(ClassName.SHOW); + + if (!isActive && (event.which !== ESCAPE_KEYCODE || event.which !== SPACE_KEYCODE) || isActive && (event.which === ESCAPE_KEYCODE || event.which === SPACE_KEYCODE)) { + if (event.which === ESCAPE_KEYCODE) { + var toggle = $$$1(parent).find(Selector.DATA_TOGGLE)[0]; + $$$1(toggle).trigger('focus'); + } + + $$$1(this).trigger('click'); + return; + } + + var items = $$$1(parent).find(Selector.VISIBLE_ITEMS).get(); + + if (items.length === 0) { + return; + } + + var index = items.indexOf(event.target); + + if (event.which === ARROW_UP_KEYCODE && index > 0) { + // Up + index--; + } + + if (event.which === ARROW_DOWN_KEYCODE && index < items.length - 1) { + // Down + index++; + } + + if (index < 0) { + index = 0; + } + + items[index].focus(); + }; + + _createClass(Dropdown, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }, { + key: "Default", + get: function get() { + return Default; + } + }, { + key: "DefaultType", + get: function get() { + return DefaultType; + } + }]); + return Dropdown; + }(); + /** + * ------------------------------------------------------------------------ + * Data Api implementation + * ------------------------------------------------------------------------ + */ + + + $$$1(document).on(Event.KEYDOWN_DATA_API, Selector.DATA_TOGGLE, Dropdown._dataApiKeydownHandler).on(Event.KEYDOWN_DATA_API, Selector.MENU, Dropdown._dataApiKeydownHandler).on(Event.CLICK_DATA_API + " " + Event.KEYUP_DATA_API, Dropdown._clearMenus).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) { + event.preventDefault(); + event.stopPropagation(); + + Dropdown._jQueryInterface.call($$$1(this), 'toggle'); + }).on(Event.CLICK_DATA_API, Selector.FORM_CHILD, function (e) { + e.stopPropagation(); + }); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + $$$1.fn[NAME] = Dropdown._jQueryInterface; + $$$1.fn[NAME].Constructor = Dropdown; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Dropdown._jQueryInterface; + }; + + return Dropdown; +}($, Popper); + +/** + * -------------------------------------------------------------------------- + * Bootstrap (v4.0.0): modal.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + +var Modal = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'modal'; + var VERSION = '4.0.0'; + var DATA_KEY = 'bs.modal'; + var EVENT_KEY = "." + DATA_KEY; + var DATA_API_KEY = '.data-api'; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var TRANSITION_DURATION = 300; + var BACKDROP_TRANSITION_DURATION = 150; + var ESCAPE_KEYCODE = 27; // KeyboardEvent.which value for Escape (Esc) key + + var Default = { + backdrop: true, + keyboard: true, + focus: true, + show: true + }; + var DefaultType = { + backdrop: '(boolean|string)', + keyboard: 'boolean', + focus: 'boolean', + show: 'boolean' + }; + var Event = { + HIDE: "hide" + EVENT_KEY, + HIDDEN: "hidden" + EVENT_KEY, + SHOW: "show" + EVENT_KEY, + SHOWN: "shown" + EVENT_KEY, + FOCUSIN: "focusin" + EVENT_KEY, + RESIZE: "resize" + EVENT_KEY, + CLICK_DISMISS: "click.dismiss" + EVENT_KEY, + KEYDOWN_DISMISS: "keydown.dismiss" + EVENT_KEY, + MOUSEUP_DISMISS: "mouseup.dismiss" + EVENT_KEY, + MOUSEDOWN_DISMISS: "mousedown.dismiss" + EVENT_KEY, + CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY + }; + var ClassName = { + SCROLLBAR_MEASURER: 'modal-scrollbar-measure', + BACKDROP: 'modal-backdrop', + OPEN: 'modal-open', + FADE: 'fade', + SHOW: 'show' + }; + var Selector = { + DIALOG: '.modal-dialog', + DATA_TOGGLE: '[data-toggle="modal"]', + DATA_DISMISS: '[data-dismiss="modal"]', + FIXED_CONTENT: '.fixed-top, .fixed-bottom, .is-fixed, .sticky-top', + STICKY_CONTENT: '.sticky-top', + NAVBAR_TOGGLER: '.navbar-toggler' + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Modal = + /*#__PURE__*/ + function () { + function Modal(element, config) { + this._config = this._getConfig(config); + this._element = element; + this._dialog = $$$1(element).find(Selector.DIALOG)[0]; + this._backdrop = null; + this._isShown = false; + this._isBodyOverflowing = false; + this._ignoreBackdropClick = false; + this._originalBodyPadding = 0; + this._scrollbarWidth = 0; + } // Getters + + + var _proto = Modal.prototype; + + // Public + _proto.toggle = function toggle(relatedTarget) { + return this._isShown ? this.hide() : this.show(relatedTarget); + }; + + _proto.show = function show(relatedTarget) { + var _this = this; + + if (this._isTransitioning || this._isShown) { + return; + } + + if (Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.FADE)) { + this._isTransitioning = true; + } + + var showEvent = $$$1.Event(Event.SHOW, { + relatedTarget: relatedTarget + }); + $$$1(this._element).trigger(showEvent); + + if (this._isShown || showEvent.isDefaultPrevented()) { + return; + } + + this._isShown = true; + + this._checkScrollbar(); + + this._setScrollbar(); + + this._adjustDialog(); + + $$$1(document.body).addClass(ClassName.OPEN); + + this._setEscapeEvent(); + + this._setResizeEvent(); + + $$$1(this._element).on(Event.CLICK_DISMISS, Selector.DATA_DISMISS, function (event) { + return _this.hide(event); + }); + $$$1(this._dialog).on(Event.MOUSEDOWN_DISMISS, function () { + $$$1(_this._element).one(Event.MOUSEUP_DISMISS, function (event) { + if ($$$1(event.target).is(_this._element)) { + _this._ignoreBackdropClick = true; + } + }); + }); + + this._showBackdrop(function () { + return _this._showElement(relatedTarget); + }); + }; + + _proto.hide = function hide(event) { + var _this2 = this; + + if (event) { + event.preventDefault(); + } + + if (this._isTransitioning || !this._isShown) { + return; + } + + var hideEvent = $$$1.Event(Event.HIDE); + $$$1(this._element).trigger(hideEvent); + + if (!this._isShown || hideEvent.isDefaultPrevented()) { + return; + } + + this._isShown = false; + var transition = Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.FADE); + + if (transition) { + this._isTransitioning = true; + } + + this._setEscapeEvent(); + + this._setResizeEvent(); + + $$$1(document).off(Event.FOCUSIN); + $$$1(this._element).removeClass(ClassName.SHOW); + $$$1(this._element).off(Event.CLICK_DISMISS); + $$$1(this._dialog).off(Event.MOUSEDOWN_DISMISS); + + if (transition) { + $$$1(this._element).one(Util.TRANSITION_END, function (event) { + return _this2._hideModal(event); + }).emulateTransitionEnd(TRANSITION_DURATION); + } else { + this._hideModal(); + } + }; + + _proto.dispose = function dispose() { + $$$1.removeData(this._element, DATA_KEY); + $$$1(window, document, this._element, this._backdrop).off(EVENT_KEY); + this._config = null; + this._element = null; + this._dialog = null; + this._backdrop = null; + this._isShown = null; + this._isBodyOverflowing = null; + this._ignoreBackdropClick = null; + this._scrollbarWidth = null; + }; + + _proto.handleUpdate = function handleUpdate() { + this._adjustDialog(); + }; // Private + + + _proto._getConfig = function _getConfig(config) { + config = _extends({}, Default, config); + Util.typeCheckConfig(NAME, config, DefaultType); + return config; + }; + + _proto._showElement = function _showElement(relatedTarget) { + var _this3 = this; + + var transition = Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.FADE); + + if (!this._element.parentNode || this._element.parentNode.nodeType !== Node.ELEMENT_NODE) { + // Don't move modal's DOM position + document.body.appendChild(this._element); + } + + this._element.style.display = 'block'; + + this._element.removeAttribute('aria-hidden'); + + this._element.scrollTop = 0; + + if (transition) { + Util.reflow(this._element); + } + + $$$1(this._element).addClass(ClassName.SHOW); + + if (this._config.focus) { + this._enforceFocus(); + } + + var shownEvent = $$$1.Event(Event.SHOWN, { + relatedTarget: relatedTarget + }); + + var transitionComplete = function transitionComplete() { + if (_this3._config.focus) { + _this3._element.focus(); + } + + _this3._isTransitioning = false; + $$$1(_this3._element).trigger(shownEvent); + }; + + if (transition) { + $$$1(this._dialog).one(Util.TRANSITION_END, transitionComplete).emulateTransitionEnd(TRANSITION_DURATION); + } else { + transitionComplete(); + } + }; + + _proto._enforceFocus = function _enforceFocus() { + var _this4 = this; + + $$$1(document).off(Event.FOCUSIN) // Guard against infinite focus loop + .on(Event.FOCUSIN, function (event) { + if (document !== event.target && _this4._element !== event.target && $$$1(_this4._element).has(event.target).length === 0) { + _this4._element.focus(); + } + }); + }; + + _proto._setEscapeEvent = function _setEscapeEvent() { + var _this5 = this; + + if (this._isShown && this._config.keyboard) { + $$$1(this._element).on(Event.KEYDOWN_DISMISS, function (event) { + if (event.which === ESCAPE_KEYCODE) { + event.preventDefault(); + + _this5.hide(); + } + }); + } else if (!this._isShown) { + $$$1(this._element).off(Event.KEYDOWN_DISMISS); + } + }; + + _proto._setResizeEvent = function _setResizeEvent() { + var _this6 = this; + + if (this._isShown) { + $$$1(window).on(Event.RESIZE, function (event) { + return _this6.handleUpdate(event); + }); + } else { + $$$1(window).off(Event.RESIZE); + } + }; + + _proto._hideModal = function _hideModal() { + var _this7 = this; + + this._element.style.display = 'none'; + + this._element.setAttribute('aria-hidden', true); + + this._isTransitioning = false; + + this._showBackdrop(function () { + $$$1(document.body).removeClass(ClassName.OPEN); + + _this7._resetAdjustments(); + + _this7._resetScrollbar(); + + $$$1(_this7._element).trigger(Event.HIDDEN); + }); + }; + + _proto._removeBackdrop = function _removeBackdrop() { + if (this._backdrop) { + $$$1(this._backdrop).remove(); + this._backdrop = null; + } + }; + + _proto._showBackdrop = function _showBackdrop(callback) { + var _this8 = this; + + var animate = $$$1(this._element).hasClass(ClassName.FADE) ? ClassName.FADE : ''; + + if (this._isShown && this._config.backdrop) { + var doAnimate = Util.supportsTransitionEnd() && animate; + this._backdrop = document.createElement('div'); + this._backdrop.className = ClassName.BACKDROP; + + if (animate) { + $$$1(this._backdrop).addClass(animate); + } + + $$$1(this._backdrop).appendTo(document.body); + $$$1(this._element).on(Event.CLICK_DISMISS, function (event) { + if (_this8._ignoreBackdropClick) { + _this8._ignoreBackdropClick = false; + return; + } + + if (event.target !== event.currentTarget) { + return; + } + + if (_this8._config.backdrop === 'static') { + _this8._element.focus(); + } else { + _this8.hide(); + } + }); + + if (doAnimate) { + Util.reflow(this._backdrop); + } + + $$$1(this._backdrop).addClass(ClassName.SHOW); + + if (!callback) { + return; + } + + if (!doAnimate) { + callback(); + return; + } + + $$$1(this._backdrop).one(Util.TRANSITION_END, callback).emulateTransitionEnd(BACKDROP_TRANSITION_DURATION); + } else if (!this._isShown && this._backdrop) { + $$$1(this._backdrop).removeClass(ClassName.SHOW); + + var callbackRemove = function callbackRemove() { + _this8._removeBackdrop(); + + if (callback) { + callback(); + } + }; + + if (Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.FADE)) { + $$$1(this._backdrop).one(Util.TRANSITION_END, callbackRemove).emulateTransitionEnd(BACKDROP_TRANSITION_DURATION); + } else { + callbackRemove(); + } + } else if (callback) { + callback(); + } + }; // ---------------------------------------------------------------------- + // the following methods are used to handle overflowing modals + // todo (fat): these should probably be refactored out of modal.js + // ---------------------------------------------------------------------- + + + _proto._adjustDialog = function _adjustDialog() { + var isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight; + + if (!this._isBodyOverflowing && isModalOverflowing) { + this._element.style.paddingLeft = this._scrollbarWidth + "px"; + } + + if (this._isBodyOverflowing && !isModalOverflowing) { + this._element.style.paddingRight = this._scrollbarWidth + "px"; + } + }; + + _proto._resetAdjustments = function _resetAdjustments() { + this._element.style.paddingLeft = ''; + this._element.style.paddingRight = ''; + }; + + _proto._checkScrollbar = function _checkScrollbar() { + var rect = document.body.getBoundingClientRect(); + this._isBodyOverflowing = rect.left + rect.right < window.innerWidth; + this._scrollbarWidth = this._getScrollbarWidth(); + }; + + _proto._setScrollbar = function _setScrollbar() { + var _this9 = this; + + if (this._isBodyOverflowing) { + // Note: DOMNode.style.paddingRight returns the actual value or '' if not set + // while $(DOMNode).css('padding-right') returns the calculated value or 0 if not set + // Adjust fixed content padding + $$$1(Selector.FIXED_CONTENT).each(function (index, element) { + var actualPadding = $$$1(element)[0].style.paddingRight; + var calculatedPadding = $$$1(element).css('padding-right'); + $$$1(element).data('padding-right', actualPadding).css('padding-right', parseFloat(calculatedPadding) + _this9._scrollbarWidth + "px"); + }); // Adjust sticky content margin + + $$$1(Selector.STICKY_CONTENT).each(function (index, element) { + var actualMargin = $$$1(element)[0].style.marginRight; + var calculatedMargin = $$$1(element).css('margin-right'); + $$$1(element).data('margin-right', actualMargin).css('margin-right', parseFloat(calculatedMargin) - _this9._scrollbarWidth + "px"); + }); // Adjust navbar-toggler margin + + $$$1(Selector.NAVBAR_TOGGLER).each(function (index, element) { + var actualMargin = $$$1(element)[0].style.marginRight; + var calculatedMargin = $$$1(element).css('margin-right'); + $$$1(element).data('margin-right', actualMargin).css('margin-right', parseFloat(calculatedMargin) + _this9._scrollbarWidth + "px"); + }); // Adjust body padding + + var actualPadding = document.body.style.paddingRight; + var calculatedPadding = $$$1('body').css('padding-right'); + $$$1('body').data('padding-right', actualPadding).css('padding-right', parseFloat(calculatedPadding) + this._scrollbarWidth + "px"); + } + }; + + _proto._resetScrollbar = function _resetScrollbar() { + // Restore fixed content padding + $$$1(Selector.FIXED_CONTENT).each(function (index, element) { + var padding = $$$1(element).data('padding-right'); + + if (typeof padding !== 'undefined') { + $$$1(element).css('padding-right', padding).removeData('padding-right'); + } + }); // Restore sticky content and navbar-toggler margin + + $$$1(Selector.STICKY_CONTENT + ", " + Selector.NAVBAR_TOGGLER).each(function (index, element) { + var margin = $$$1(element).data('margin-right'); + + if (typeof margin !== 'undefined') { + $$$1(element).css('margin-right', margin).removeData('margin-right'); + } + }); // Restore body padding + + var padding = $$$1('body').data('padding-right'); + + if (typeof padding !== 'undefined') { + $$$1('body').css('padding-right', padding).removeData('padding-right'); + } + }; + + _proto._getScrollbarWidth = function _getScrollbarWidth() { + // thx d.walsh + var scrollDiv = document.createElement('div'); + scrollDiv.className = ClassName.SCROLLBAR_MEASURER; + document.body.appendChild(scrollDiv); + var scrollbarWidth = scrollDiv.getBoundingClientRect().width - scrollDiv.clientWidth; + document.body.removeChild(scrollDiv); + return scrollbarWidth; + }; // Static + + + Modal._jQueryInterface = function _jQueryInterface(config, relatedTarget) { + return this.each(function () { + var data = $$$1(this).data(DATA_KEY); + + var _config = _extends({}, Modal.Default, $$$1(this).data(), typeof config === 'object' && config); + + if (!data) { + data = new Modal(this, _config); + $$$1(this).data(DATA_KEY, data); + } + + if (typeof config === 'string') { + if (typeof data[config] === 'undefined') { + throw new TypeError("No method named \"" + config + "\""); + } + + data[config](relatedTarget); + } else if (_config.show) { + data.show(relatedTarget); + } + }); + }; + + _createClass(Modal, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }, { + key: "Default", + get: function get() { + return Default; + } + }]); + return Modal; + }(); + /** + * ------------------------------------------------------------------------ + * Data Api implementation + * ------------------------------------------------------------------------ + */ + + + $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) { + var _this10 = this; + + var target; + var selector = Util.getSelectorFromElement(this); + + if (selector) { + target = $$$1(selector)[0]; + } + + var config = $$$1(target).data(DATA_KEY) ? 'toggle' : _extends({}, $$$1(target).data(), $$$1(this).data()); + + if (this.tagName === 'A' || this.tagName === 'AREA') { + event.preventDefault(); + } + + var $target = $$$1(target).one(Event.SHOW, function (showEvent) { + if (showEvent.isDefaultPrevented()) { + // Only register focus restorer if modal will actually get shown + return; + } + + $target.one(Event.HIDDEN, function () { + if ($$$1(_this10).is(':visible')) { + _this10.focus(); + } + }); + }); + + Modal._jQueryInterface.call($$$1(target), config, this); + }); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + $$$1.fn[NAME] = Modal._jQueryInterface; + $$$1.fn[NAME].Constructor = Modal; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Modal._jQueryInterface; + }; + + return Modal; +}($); + +/** + * -------------------------------------------------------------------------- + * Bootstrap (v4.0.0): tooltip.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + +var Tooltip = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'tooltip'; + var VERSION = '4.0.0'; + var DATA_KEY = 'bs.tooltip'; + var EVENT_KEY = "." + DATA_KEY; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var TRANSITION_DURATION = 150; + var CLASS_PREFIX = 'bs-tooltip'; + var BSCLS_PREFIX_REGEX = new RegExp("(^|\\s)" + CLASS_PREFIX + "\\S+", 'g'); + var DefaultType = { + animation: 'boolean', + template: 'string', + title: '(string|element|function)', + trigger: 'string', + delay: '(number|object)', + html: 'boolean', + selector: '(string|boolean)', + placement: '(string|function)', + offset: '(number|string)', + container: '(string|element|boolean)', + fallbackPlacement: '(string|array)', + boundary: '(string|element)' + }; + var AttachmentMap = { + AUTO: 'auto', + TOP: 'top', + RIGHT: 'right', + BOTTOM: 'bottom', + LEFT: 'left' + }; + var Default = { + animation: true, + template: '<div class="tooltip" role="tooltip">' + '<div class="arrow"></div>' + '<div class="tooltip-inner"></div></div>', + trigger: 'hover focus', + title: '', + delay: 0, + html: false, + selector: false, + placement: 'top', + offset: 0, + container: false, + fallbackPlacement: 'flip', + boundary: 'scrollParent' + }; + var HoverState = { + SHOW: 'show', + OUT: 'out' + }; + var Event = { + HIDE: "hide" + EVENT_KEY, + HIDDEN: "hidden" + EVENT_KEY, + SHOW: "show" + EVENT_KEY, + SHOWN: "shown" + EVENT_KEY, + INSERTED: "inserted" + EVENT_KEY, + CLICK: "click" + EVENT_KEY, + FOCUSIN: "focusin" + EVENT_KEY, + FOCUSOUT: "focusout" + EVENT_KEY, + MOUSEENTER: "mouseenter" + EVENT_KEY, + MOUSELEAVE: "mouseleave" + EVENT_KEY + }; + var ClassName = { + FADE: 'fade', + SHOW: 'show' + }; + var Selector = { + TOOLTIP: '.tooltip', + TOOLTIP_INNER: '.tooltip-inner', + ARROW: '.arrow' + }; + var Trigger = { + HOVER: 'hover', + FOCUS: 'focus', + CLICK: 'click', + MANUAL: 'manual' + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Tooltip = + /*#__PURE__*/ + function () { + function Tooltip(element, config) { + /** + * Check for Popper dependency + * Popper - https://popper.js.org + */ + if (typeof Popper === 'undefined') { + throw new TypeError('Bootstrap tooltips require Popper.js (https://popper.js.org)'); + } // private + + + this._isEnabled = true; + this._timeout = 0; + this._hoverState = ''; + this._activeTrigger = {}; + this._popper = null; // Protected + + this.element = element; + this.config = this._getConfig(config); + this.tip = null; + + this._setListeners(); + } // Getters + + + var _proto = Tooltip.prototype; + + // Public + _proto.enable = function enable() { + this._isEnabled = true; + }; + + _proto.disable = function disable() { + this._isEnabled = false; + }; + + _proto.toggleEnabled = function toggleEnabled() { + this._isEnabled = !this._isEnabled; + }; + + _proto.toggle = function toggle(event) { + if (!this._isEnabled) { + return; + } + + if (event) { + var dataKey = this.constructor.DATA_KEY; + var context = $$$1(event.currentTarget).data(dataKey); + + if (!context) { + context = new this.constructor(event.currentTarget, this._getDelegateConfig()); + $$$1(event.currentTarget).data(dataKey, context); + } + + context._activeTrigger.click = !context._activeTrigger.click; + + if (context._isWithActiveTrigger()) { + context._enter(null, context); + } else { + context._leave(null, context); + } + } else { + if ($$$1(this.getTipElement()).hasClass(ClassName.SHOW)) { + this._leave(null, this); + + return; + } + + this._enter(null, this); + } + }; + + _proto.dispose = function dispose() { + clearTimeout(this._timeout); + $$$1.removeData(this.element, this.constructor.DATA_KEY); + $$$1(this.element).off(this.constructor.EVENT_KEY); + $$$1(this.element).closest('.modal').off('hide.bs.modal'); + + if (this.tip) { + $$$1(this.tip).remove(); + } + + this._isEnabled = null; + this._timeout = null; + this._hoverState = null; + this._activeTrigger = null; + + if (this._popper !== null) { + this._popper.destroy(); + } + + this._popper = null; + this.element = null; + this.config = null; + this.tip = null; + }; + + _proto.show = function show() { + var _this = this; + + if ($$$1(this.element).css('display') === 'none') { + throw new Error('Please use show on visible elements'); + } + + var showEvent = $$$1.Event(this.constructor.Event.SHOW); + + if (this.isWithContent() && this._isEnabled) { + $$$1(this.element).trigger(showEvent); + var isInTheDom = $$$1.contains(this.element.ownerDocument.documentElement, this.element); + + if (showEvent.isDefaultPrevented() || !isInTheDom) { + return; + } + + var tip = this.getTipElement(); + var tipId = Util.getUID(this.constructor.NAME); + tip.setAttribute('id', tipId); + this.element.setAttribute('aria-describedby', tipId); + this.setContent(); + + if (this.config.animation) { + $$$1(tip).addClass(ClassName.FADE); + } + + var placement = typeof this.config.placement === 'function' ? this.config.placement.call(this, tip, this.element) : this.config.placement; + + var attachment = this._getAttachment(placement); + + this.addAttachmentClass(attachment); + var container = this.config.container === false ? document.body : $$$1(this.config.container); + $$$1(tip).data(this.constructor.DATA_KEY, this); + + if (!$$$1.contains(this.element.ownerDocument.documentElement, this.tip)) { + $$$1(tip).appendTo(container); + } + + $$$1(this.element).trigger(this.constructor.Event.INSERTED); + this._popper = new Popper(this.element, tip, { + placement: attachment, + modifiers: { + offset: { + offset: this.config.offset + }, + flip: { + behavior: this.config.fallbackPlacement + }, + arrow: { + element: Selector.ARROW + }, + preventOverflow: { + boundariesElement: this.config.boundary + } + }, + onCreate: function onCreate(data) { + if (data.originalPlacement !== data.placement) { + _this._handlePopperPlacementChange(data); + } + }, + onUpdate: function onUpdate(data) { + _this._handlePopperPlacementChange(data); + } + }); + $$$1(tip).addClass(ClassName.SHOW); // If this is a touch-enabled device we add extra + // empty mouseover listeners to the body's immediate children; + // only needed because of broken event delegation on iOS + // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html + + if ('ontouchstart' in document.documentElement) { + $$$1('body').children().on('mouseover', null, $$$1.noop); + } + + var complete = function complete() { + if (_this.config.animation) { + _this._fixTransition(); + } + + var prevHoverState = _this._hoverState; + _this._hoverState = null; + $$$1(_this.element).trigger(_this.constructor.Event.SHOWN); + + if (prevHoverState === HoverState.OUT) { + _this._leave(null, _this); + } + }; + + if (Util.supportsTransitionEnd() && $$$1(this.tip).hasClass(ClassName.FADE)) { + $$$1(this.tip).one(Util.TRANSITION_END, complete).emulateTransitionEnd(Tooltip._TRANSITION_DURATION); + } else { + complete(); + } + } + }; + + _proto.hide = function hide(callback) { + var _this2 = this; + + var tip = this.getTipElement(); + var hideEvent = $$$1.Event(this.constructor.Event.HIDE); + + var complete = function complete() { + if (_this2._hoverState !== HoverState.SHOW && tip.parentNode) { + tip.parentNode.removeChild(tip); + } + + _this2._cleanTipClass(); + + _this2.element.removeAttribute('aria-describedby'); + + $$$1(_this2.element).trigger(_this2.constructor.Event.HIDDEN); + + if (_this2._popper !== null) { + _this2._popper.destroy(); + } + + if (callback) { + callback(); + } + }; + + $$$1(this.element).trigger(hideEvent); + + if (hideEvent.isDefaultPrevented()) { + return; + } + + $$$1(tip).removeClass(ClassName.SHOW); // If this is a touch-enabled device we remove the extra + // empty mouseover listeners we added for iOS support + + if ('ontouchstart' in document.documentElement) { + $$$1('body').children().off('mouseover', null, $$$1.noop); + } + + this._activeTrigger[Trigger.CLICK] = false; + this._activeTrigger[Trigger.FOCUS] = false; + this._activeTrigger[Trigger.HOVER] = false; + + if (Util.supportsTransitionEnd() && $$$1(this.tip).hasClass(ClassName.FADE)) { + $$$1(tip).one(Util.TRANSITION_END, complete).emulateTransitionEnd(TRANSITION_DURATION); + } else { + complete(); + } + + this._hoverState = ''; + }; + + _proto.update = function update() { + if (this._popper !== null) { + this._popper.scheduleUpdate(); + } + }; // Protected + + + _proto.isWithContent = function isWithContent() { + return Boolean(this.getTitle()); + }; + + _proto.addAttachmentClass = function addAttachmentClass(attachment) { + $$$1(this.getTipElement()).addClass(CLASS_PREFIX + "-" + attachment); + }; + + _proto.getTipElement = function getTipElement() { + this.tip = this.tip || $$$1(this.config.template)[0]; + return this.tip; + }; + + _proto.setContent = function setContent() { + var $tip = $$$1(this.getTipElement()); + this.setElementContent($tip.find(Selector.TOOLTIP_INNER), this.getTitle()); + $tip.removeClass(ClassName.FADE + " " + ClassName.SHOW); + }; + + _proto.setElementContent = function setElementContent($element, content) { + var html = this.config.html; + + if (typeof content === 'object' && (content.nodeType || content.jquery)) { + // Content is a DOM node or a jQuery + if (html) { + if (!$$$1(content).parent().is($element)) { + $element.empty().append(content); + } + } else { + $element.text($$$1(content).text()); + } + } else { + $element[html ? 'html' : 'text'](content); + } + }; + + _proto.getTitle = function getTitle() { + var title = this.element.getAttribute('data-original-title'); + + if (!title) { + title = typeof this.config.title === 'function' ? this.config.title.call(this.element) : this.config.title; + } + + return title; + }; // Private + + + _proto._getAttachment = function _getAttachment(placement) { + return AttachmentMap[placement.toUpperCase()]; + }; + + _proto._setListeners = function _setListeners() { + var _this3 = this; + + var triggers = this.config.trigger.split(' '); + triggers.forEach(function (trigger) { + if (trigger === 'click') { + $$$1(_this3.element).on(_this3.constructor.Event.CLICK, _this3.config.selector, function (event) { + return _this3.toggle(event); + }); + } else if (trigger !== Trigger.MANUAL) { + var eventIn = trigger === Trigger.HOVER ? _this3.constructor.Event.MOUSEENTER : _this3.constructor.Event.FOCUSIN; + var eventOut = trigger === Trigger.HOVER ? _this3.constructor.Event.MOUSELEAVE : _this3.constructor.Event.FOCUSOUT; + $$$1(_this3.element).on(eventIn, _this3.config.selector, function (event) { + return _this3._enter(event); + }).on(eventOut, _this3.config.selector, function (event) { + return _this3._leave(event); + }); + } + + $$$1(_this3.element).closest('.modal').on('hide.bs.modal', function () { + return _this3.hide(); + }); + }); + + if (this.config.selector) { + this.config = _extends({}, this.config, { + trigger: 'manual', + selector: '' + }); + } else { + this._fixTitle(); + } + }; + + _proto._fixTitle = function _fixTitle() { + var titleType = typeof this.element.getAttribute('data-original-title'); + + if (this.element.getAttribute('title') || titleType !== 'string') { + this.element.setAttribute('data-original-title', this.element.getAttribute('title') || ''); + this.element.setAttribute('title', ''); + } + }; + + _proto._enter = function _enter(event, context) { + var dataKey = this.constructor.DATA_KEY; + context = context || $$$1(event.currentTarget).data(dataKey); + + if (!context) { + context = new this.constructor(event.currentTarget, this._getDelegateConfig()); + $$$1(event.currentTarget).data(dataKey, context); + } + + if (event) { + context._activeTrigger[event.type === 'focusin' ? Trigger.FOCUS : Trigger.HOVER] = true; + } + + if ($$$1(context.getTipElement()).hasClass(ClassName.SHOW) || context._hoverState === HoverState.SHOW) { + context._hoverState = HoverState.SHOW; + return; + } + + clearTimeout(context._timeout); + context._hoverState = HoverState.SHOW; + + if (!context.config.delay || !context.config.delay.show) { + context.show(); + return; + } + + context._timeout = setTimeout(function () { + if (context._hoverState === HoverState.SHOW) { + context.show(); + } + }, context.config.delay.show); + }; + + _proto._leave = function _leave(event, context) { + var dataKey = this.constructor.DATA_KEY; + context = context || $$$1(event.currentTarget).data(dataKey); + + if (!context) { + context = new this.constructor(event.currentTarget, this._getDelegateConfig()); + $$$1(event.currentTarget).data(dataKey, context); + } + + if (event) { + context._activeTrigger[event.type === 'focusout' ? Trigger.FOCUS : Trigger.HOVER] = false; + } + + if (context._isWithActiveTrigger()) { + return; + } + + clearTimeout(context._timeout); + context._hoverState = HoverState.OUT; + + if (!context.config.delay || !context.config.delay.hide) { + context.hide(); + return; + } + + context._timeout = setTimeout(function () { + if (context._hoverState === HoverState.OUT) { + context.hide(); + } + }, context.config.delay.hide); + }; + + _proto._isWithActiveTrigger = function _isWithActiveTrigger() { + for (var trigger in this._activeTrigger) { + if (this._activeTrigger[trigger]) { + return true; + } + } + + return false; + }; + + _proto._getConfig = function _getConfig(config) { + config = _extends({}, this.constructor.Default, $$$1(this.element).data(), config); + + if (typeof config.delay === 'number') { + config.delay = { + show: config.delay, + hide: config.delay + }; + } + + if (typeof config.title === 'number') { + config.title = config.title.toString(); + } + + if (typeof config.content === 'number') { + config.content = config.content.toString(); + } + + Util.typeCheckConfig(NAME, config, this.constructor.DefaultType); + return config; + }; + + _proto._getDelegateConfig = function _getDelegateConfig() { + var config = {}; + + if (this.config) { + for (var key in this.config) { + if (this.constructor.Default[key] !== this.config[key]) { + config[key] = this.config[key]; + } + } + } + + return config; + }; + + _proto._cleanTipClass = function _cleanTipClass() { + var $tip = $$$1(this.getTipElement()); + var tabClass = $tip.attr('class').match(BSCLS_PREFIX_REGEX); + + if (tabClass !== null && tabClass.length > 0) { + $tip.removeClass(tabClass.join('')); + } + }; + + _proto._handlePopperPlacementChange = function _handlePopperPlacementChange(data) { + this._cleanTipClass(); + + this.addAttachmentClass(this._getAttachment(data.placement)); + }; + + _proto._fixTransition = function _fixTransition() { + var tip = this.getTipElement(); + var initConfigAnimation = this.config.animation; + + if (tip.getAttribute('x-placement') !== null) { + return; + } + + $$$1(tip).removeClass(ClassName.FADE); + this.config.animation = false; + this.hide(); + this.show(); + this.config.animation = initConfigAnimation; + }; // Static + + + Tooltip._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var data = $$$1(this).data(DATA_KEY); + + var _config = typeof config === 'object' && config; + + if (!data && /dispose|hide/.test(config)) { + return; + } + + if (!data) { + data = new Tooltip(this, _config); + $$$1(this).data(DATA_KEY, data); + } + + if (typeof config === 'string') { + if (typeof data[config] === 'undefined') { + throw new TypeError("No method named \"" + config + "\""); + } + + data[config](); + } + }); + }; + + _createClass(Tooltip, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }, { + key: "Default", + get: function get() { + return Default; + } + }, { + key: "NAME", + get: function get() { + return NAME; + } + }, { + key: "DATA_KEY", + get: function get() { + return DATA_KEY; + } + }, { + key: "Event", + get: function get() { + return Event; + } + }, { + key: "EVENT_KEY", + get: function get() { + return EVENT_KEY; + } + }, { + key: "DefaultType", + get: function get() { + return DefaultType; + } + }]); + return Tooltip; + }(); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + + $$$1.fn[NAME] = Tooltip._jQueryInterface; + $$$1.fn[NAME].Constructor = Tooltip; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Tooltip._jQueryInterface; + }; + + return Tooltip; +}($, Popper); + +/** + * -------------------------------------------------------------------------- + * Bootstrap (v4.0.0): popover.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + +var Popover = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'popover'; + var VERSION = '4.0.0'; + var DATA_KEY = 'bs.popover'; + var EVENT_KEY = "." + DATA_KEY; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var CLASS_PREFIX = 'bs-popover'; + var BSCLS_PREFIX_REGEX = new RegExp("(^|\\s)" + CLASS_PREFIX + "\\S+", 'g'); + var Default = _extends({}, Tooltip.Default, { + placement: 'right', + trigger: 'click', + content: '', + template: '<div class="popover" role="tooltip">' + '<div class="arrow"></div>' + '<h3 class="popover-header"></h3>' + '<div class="popover-body"></div></div>' + }); + var DefaultType = _extends({}, Tooltip.DefaultType, { + content: '(string|element|function)' + }); + var ClassName = { + FADE: 'fade', + SHOW: 'show' + }; + var Selector = { + TITLE: '.popover-header', + CONTENT: '.popover-body' + }; + var Event = { + HIDE: "hide" + EVENT_KEY, + HIDDEN: "hidden" + EVENT_KEY, + SHOW: "show" + EVENT_KEY, + SHOWN: "shown" + EVENT_KEY, + INSERTED: "inserted" + EVENT_KEY, + CLICK: "click" + EVENT_KEY, + FOCUSIN: "focusin" + EVENT_KEY, + FOCUSOUT: "focusout" + EVENT_KEY, + MOUSEENTER: "mouseenter" + EVENT_KEY, + MOUSELEAVE: "mouseleave" + EVENT_KEY + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Popover = + /*#__PURE__*/ + function (_Tooltip) { + _inheritsLoose(Popover, _Tooltip); + + function Popover() { + return _Tooltip.apply(this, arguments) || this; + } + + var _proto = Popover.prototype; + + // Overrides + _proto.isWithContent = function isWithContent() { + return this.getTitle() || this._getContent(); + }; + + _proto.addAttachmentClass = function addAttachmentClass(attachment) { + $$$1(this.getTipElement()).addClass(CLASS_PREFIX + "-" + attachment); + }; + + _proto.getTipElement = function getTipElement() { + this.tip = this.tip || $$$1(this.config.template)[0]; + return this.tip; + }; + + _proto.setContent = function setContent() { + var $tip = $$$1(this.getTipElement()); // We use append for html objects to maintain js events + + this.setElementContent($tip.find(Selector.TITLE), this.getTitle()); + + var content = this._getContent(); + + if (typeof content === 'function') { + content = content.call(this.element); + } + + this.setElementContent($tip.find(Selector.CONTENT), content); + $tip.removeClass(ClassName.FADE + " " + ClassName.SHOW); + }; // Private + + + _proto._getContent = function _getContent() { + return this.element.getAttribute('data-content') || this.config.content; + }; + + _proto._cleanTipClass = function _cleanTipClass() { + var $tip = $$$1(this.getTipElement()); + var tabClass = $tip.attr('class').match(BSCLS_PREFIX_REGEX); + + if (tabClass !== null && tabClass.length > 0) { + $tip.removeClass(tabClass.join('')); + } + }; // Static + + + Popover._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var data = $$$1(this).data(DATA_KEY); + + var _config = typeof config === 'object' ? config : null; + + if (!data && /destroy|hide/.test(config)) { + return; + } + + if (!data) { + data = new Popover(this, _config); + $$$1(this).data(DATA_KEY, data); + } + + if (typeof config === 'string') { + if (typeof data[config] === 'undefined') { + throw new TypeError("No method named \"" + config + "\""); + } + + data[config](); + } + }); + }; + + _createClass(Popover, null, [{ + key: "VERSION", + // Getters + get: function get() { + return VERSION; + } + }, { + key: "Default", + get: function get() { + return Default; + } + }, { + key: "NAME", + get: function get() { + return NAME; + } + }, { + key: "DATA_KEY", + get: function get() { + return DATA_KEY; + } + }, { + key: "Event", + get: function get() { + return Event; + } + }, { + key: "EVENT_KEY", + get: function get() { + return EVENT_KEY; + } + }, { + key: "DefaultType", + get: function get() { + return DefaultType; + } + }]); + return Popover; + }(Tooltip); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + + $$$1.fn[NAME] = Popover._jQueryInterface; + $$$1.fn[NAME].Constructor = Popover; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Popover._jQueryInterface; + }; + + return Popover; +}($); + +/** + * -------------------------------------------------------------------------- + * Bootstrap (v4.0.0): scrollspy.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + +var ScrollSpy = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'scrollspy'; + var VERSION = '4.0.0'; + var DATA_KEY = 'bs.scrollspy'; + var EVENT_KEY = "." + DATA_KEY; + var DATA_API_KEY = '.data-api'; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var Default = { + offset: 10, + method: 'auto', + target: '' + }; + var DefaultType = { + offset: 'number', + method: 'string', + target: '(string|element)' + }; + var Event = { + ACTIVATE: "activate" + EVENT_KEY, + SCROLL: "scroll" + EVENT_KEY, + LOAD_DATA_API: "load" + EVENT_KEY + DATA_API_KEY + }; + var ClassName = { + DROPDOWN_ITEM: 'dropdown-item', + DROPDOWN_MENU: 'dropdown-menu', + ACTIVE: 'active' + }; + var Selector = { + DATA_SPY: '[data-spy="scroll"]', + ACTIVE: '.active', + NAV_LIST_GROUP: '.nav, .list-group', + NAV_LINKS: '.nav-link', + NAV_ITEMS: '.nav-item', + LIST_ITEMS: '.list-group-item', + DROPDOWN: '.dropdown', + DROPDOWN_ITEMS: '.dropdown-item', + DROPDOWN_TOGGLE: '.dropdown-toggle' + }; + var OffsetMethod = { + OFFSET: 'offset', + POSITION: 'position' + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var ScrollSpy = + /*#__PURE__*/ + function () { + function ScrollSpy(element, config) { + var _this = this; + + this._element = element; + this._scrollElement = element.tagName === 'BODY' ? window : element; + this._config = this._getConfig(config); + this._selector = this._config.target + " " + Selector.NAV_LINKS + "," + (this._config.target + " " + Selector.LIST_ITEMS + ",") + (this._config.target + " " + Selector.DROPDOWN_ITEMS); + this._offsets = []; + this._targets = []; + this._activeTarget = null; + this._scrollHeight = 0; + $$$1(this._scrollElement).on(Event.SCROLL, function (event) { + return _this._process(event); + }); + this.refresh(); + + this._process(); + } // Getters + + + var _proto = ScrollSpy.prototype; + + // Public + _proto.refresh = function refresh() { + var _this2 = this; + + var autoMethod = this._scrollElement === this._scrollElement.window ? OffsetMethod.OFFSET : OffsetMethod.POSITION; + var offsetMethod = this._config.method === 'auto' ? autoMethod : this._config.method; + var offsetBase = offsetMethod === OffsetMethod.POSITION ? this._getScrollTop() : 0; + this._offsets = []; + this._targets = []; + this._scrollHeight = this._getScrollHeight(); + var targets = $$$1.makeArray($$$1(this._selector)); + targets.map(function (element) { + var target; + var targetSelector = Util.getSelectorFromElement(element); + + if (targetSelector) { + target = $$$1(targetSelector)[0]; + } + + if (target) { + var targetBCR = target.getBoundingClientRect(); + + if (targetBCR.width || targetBCR.height) { + // TODO (fat): remove sketch reliance on jQuery position/offset + return [$$$1(target)[offsetMethod]().top + offsetBase, targetSelector]; + } + } + + return null; + }).filter(function (item) { + return item; + }).sort(function (a, b) { + return a[0] - b[0]; + }).forEach(function (item) { + _this2._offsets.push(item[0]); + + _this2._targets.push(item[1]); + }); + }; + + _proto.dispose = function dispose() { + $$$1.removeData(this._element, DATA_KEY); + $$$1(this._scrollElement).off(EVENT_KEY); + this._element = null; + this._scrollElement = null; + this._config = null; + this._selector = null; + this._offsets = null; + this._targets = null; + this._activeTarget = null; + this._scrollHeight = null; + }; // Private + + + _proto._getConfig = function _getConfig(config) { + config = _extends({}, Default, config); + + if (typeof config.target !== 'string') { + var id = $$$1(config.target).attr('id'); + + if (!id) { + id = Util.getUID(NAME); + $$$1(config.target).attr('id', id); + } + + config.target = "#" + id; + } + + Util.typeCheckConfig(NAME, config, DefaultType); + return config; + }; + + _proto._getScrollTop = function _getScrollTop() { + return this._scrollElement === window ? this._scrollElement.pageYOffset : this._scrollElement.scrollTop; + }; + + _proto._getScrollHeight = function _getScrollHeight() { + return this._scrollElement.scrollHeight || Math.max(document.body.scrollHeight, document.documentElement.scrollHeight); + }; + + _proto._getOffsetHeight = function _getOffsetHeight() { + return this._scrollElement === window ? window.innerHeight : this._scrollElement.getBoundingClientRect().height; + }; + + _proto._process = function _process() { + var scrollTop = this._getScrollTop() + this._config.offset; + + var scrollHeight = this._getScrollHeight(); + + var maxScroll = this._config.offset + scrollHeight - this._getOffsetHeight(); + + if (this._scrollHeight !== scrollHeight) { + this.refresh(); + } + + if (scrollTop >= maxScroll) { + var target = this._targets[this._targets.length - 1]; + + if (this._activeTarget !== target) { + this._activate(target); + } + + return; + } + + if (this._activeTarget && scrollTop < this._offsets[0] && this._offsets[0] > 0) { + this._activeTarget = null; + + this._clear(); + + return; + } + + for (var i = this._offsets.length; i--;) { + var isActiveTarget = this._activeTarget !== this._targets[i] && scrollTop >= this._offsets[i] && (typeof this._offsets[i + 1] === 'undefined' || scrollTop < this._offsets[i + 1]); + + if (isActiveTarget) { + this._activate(this._targets[i]); + } + } + }; + + _proto._activate = function _activate(target) { + this._activeTarget = target; + + this._clear(); + + var queries = this._selector.split(','); // eslint-disable-next-line arrow-body-style + + + queries = queries.map(function (selector) { + return selector + "[data-target=\"" + target + "\"]," + (selector + "[href=\"" + target + "\"]"); + }); + var $link = $$$1(queries.join(',')); + + if ($link.hasClass(ClassName.DROPDOWN_ITEM)) { + $link.closest(Selector.DROPDOWN).find(Selector.DROPDOWN_TOGGLE).addClass(ClassName.ACTIVE); + $link.addClass(ClassName.ACTIVE); + } else { + // Set triggered link as active + $link.addClass(ClassName.ACTIVE); // Set triggered links parents as active + // With both <ul> and <nav> markup a parent is the previous sibling of any nav ancestor + + $link.parents(Selector.NAV_LIST_GROUP).prev(Selector.NAV_LINKS + ", " + Selector.LIST_ITEMS).addClass(ClassName.ACTIVE); // Handle special case when .nav-link is inside .nav-item + + $link.parents(Selector.NAV_LIST_GROUP).prev(Selector.NAV_ITEMS).children(Selector.NAV_LINKS).addClass(ClassName.ACTIVE); + } + + $$$1(this._scrollElement).trigger(Event.ACTIVATE, { + relatedTarget: target + }); + }; + + _proto._clear = function _clear() { + $$$1(this._selector).filter(Selector.ACTIVE).removeClass(ClassName.ACTIVE); + }; // Static + + + ScrollSpy._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var data = $$$1(this).data(DATA_KEY); + + var _config = typeof config === 'object' && config; + + if (!data) { + data = new ScrollSpy(this, _config); + $$$1(this).data(DATA_KEY, data); + } + + if (typeof config === 'string') { + if (typeof data[config] === 'undefined') { + throw new TypeError("No method named \"" + config + "\""); + } + + data[config](); + } + }); + }; + + _createClass(ScrollSpy, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }, { + key: "Default", + get: function get() { + return Default; + } + }]); + return ScrollSpy; + }(); + /** + * ------------------------------------------------------------------------ + * Data Api implementation + * ------------------------------------------------------------------------ + */ + + + $$$1(window).on(Event.LOAD_DATA_API, function () { + var scrollSpys = $$$1.makeArray($$$1(Selector.DATA_SPY)); + + for (var i = scrollSpys.length; i--;) { + var $spy = $$$1(scrollSpys[i]); + + ScrollSpy._jQueryInterface.call($spy, $spy.data()); + } + }); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + $$$1.fn[NAME] = ScrollSpy._jQueryInterface; + $$$1.fn[NAME].Constructor = ScrollSpy; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return ScrollSpy._jQueryInterface; + }; + + return ScrollSpy; +}($); + +/** + * -------------------------------------------------------------------------- + * Bootstrap (v4.0.0): tab.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + +var Tab = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'tab'; + var VERSION = '4.0.0'; + var DATA_KEY = 'bs.tab'; + var EVENT_KEY = "." + DATA_KEY; + var DATA_API_KEY = '.data-api'; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var TRANSITION_DURATION = 150; + var Event = { + HIDE: "hide" + EVENT_KEY, + HIDDEN: "hidden" + EVENT_KEY, + SHOW: "show" + EVENT_KEY, + SHOWN: "shown" + EVENT_KEY, + CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY + }; + var ClassName = { + DROPDOWN_MENU: 'dropdown-menu', + ACTIVE: 'active', + DISABLED: 'disabled', + FADE: 'fade', + SHOW: 'show' + }; + var Selector = { + DROPDOWN: '.dropdown', + NAV_LIST_GROUP: '.nav, .list-group', + ACTIVE: '.active', + ACTIVE_UL: '> li > .active', + DATA_TOGGLE: '[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]', + DROPDOWN_TOGGLE: '.dropdown-toggle', + DROPDOWN_ACTIVE_CHILD: '> .dropdown-menu .active' + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Tab = + /*#__PURE__*/ + function () { + function Tab(element) { + this._element = element; + } // Getters + + + var _proto = Tab.prototype; + + // Public + _proto.show = function show() { + var _this = this; + + if (this._element.parentNode && this._element.parentNode.nodeType === Node.ELEMENT_NODE && $$$1(this._element).hasClass(ClassName.ACTIVE) || $$$1(this._element).hasClass(ClassName.DISABLED)) { + return; + } + + var target; + var previous; + var listElement = $$$1(this._element).closest(Selector.NAV_LIST_GROUP)[0]; + var selector = Util.getSelectorFromElement(this._element); + + if (listElement) { + var itemSelector = listElement.nodeName === 'UL' ? Selector.ACTIVE_UL : Selector.ACTIVE; + previous = $$$1.makeArray($$$1(listElement).find(itemSelector)); + previous = previous[previous.length - 1]; + } + + var hideEvent = $$$1.Event(Event.HIDE, { + relatedTarget: this._element + }); + var showEvent = $$$1.Event(Event.SHOW, { + relatedTarget: previous + }); + + if (previous) { + $$$1(previous).trigger(hideEvent); + } + + $$$1(this._element).trigger(showEvent); + + if (showEvent.isDefaultPrevented() || hideEvent.isDefaultPrevented()) { + return; + } + + if (selector) { + target = $$$1(selector)[0]; + } + + this._activate(this._element, listElement); + + var complete = function complete() { + var hiddenEvent = $$$1.Event(Event.HIDDEN, { + relatedTarget: _this._element + }); + var shownEvent = $$$1.Event(Event.SHOWN, { + relatedTarget: previous + }); + $$$1(previous).trigger(hiddenEvent); + $$$1(_this._element).trigger(shownEvent); + }; + + if (target) { + this._activate(target, target.parentNode, complete); + } else { + complete(); + } + }; + + _proto.dispose = function dispose() { + $$$1.removeData(this._element, DATA_KEY); + this._element = null; + }; // Private + + + _proto._activate = function _activate(element, container, callback) { + var _this2 = this; + + var activeElements; + + if (container.nodeName === 'UL') { + activeElements = $$$1(container).find(Selector.ACTIVE_UL); + } else { + activeElements = $$$1(container).children(Selector.ACTIVE); + } + + var active = activeElements[0]; + var isTransitioning = callback && Util.supportsTransitionEnd() && active && $$$1(active).hasClass(ClassName.FADE); + + var complete = function complete() { + return _this2._transitionComplete(element, active, callback); + }; + + if (active && isTransitioning) { + $$$1(active).one(Util.TRANSITION_END, complete).emulateTransitionEnd(TRANSITION_DURATION); + } else { + complete(); + } + }; + + _proto._transitionComplete = function _transitionComplete(element, active, callback) { + if (active) { + $$$1(active).removeClass(ClassName.SHOW + " " + ClassName.ACTIVE); + var dropdownChild = $$$1(active.parentNode).find(Selector.DROPDOWN_ACTIVE_CHILD)[0]; + + if (dropdownChild) { + $$$1(dropdownChild).removeClass(ClassName.ACTIVE); + } + + if (active.getAttribute('role') === 'tab') { + active.setAttribute('aria-selected', false); + } + } + + $$$1(element).addClass(ClassName.ACTIVE); + + if (element.getAttribute('role') === 'tab') { + element.setAttribute('aria-selected', true); + } + + Util.reflow(element); + $$$1(element).addClass(ClassName.SHOW); + + if (element.parentNode && $$$1(element.parentNode).hasClass(ClassName.DROPDOWN_MENU)) { + var dropdownElement = $$$1(element).closest(Selector.DROPDOWN)[0]; + + if (dropdownElement) { + $$$1(dropdownElement).find(Selector.DROPDOWN_TOGGLE).addClass(ClassName.ACTIVE); + } + + element.setAttribute('aria-expanded', true); + } + + if (callback) { + callback(); + } + }; // Static + + + Tab._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var $this = $$$1(this); + var data = $this.data(DATA_KEY); + + if (!data) { + data = new Tab(this); + $this.data(DATA_KEY, data); + } + + if (typeof config === 'string') { + if (typeof data[config] === 'undefined') { + throw new TypeError("No method named \"" + config + "\""); + } + + data[config](); + } + }); + }; + + _createClass(Tab, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }]); + return Tab; + }(); + /** + * ------------------------------------------------------------------------ + * Data Api implementation + * ------------------------------------------------------------------------ + */ + + + $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) { + event.preventDefault(); + + Tab._jQueryInterface.call($$$1(this), 'show'); + }); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + $$$1.fn[NAME] = Tab._jQueryInterface; + $$$1.fn[NAME].Constructor = Tab; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Tab._jQueryInterface; + }; + + return Tab; +}($); + +/** + * -------------------------------------------------------------------------- + * Bootstrap (v4.0.0-alpha.6): index.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + +(function ($$$1) { + if (typeof $$$1 === 'undefined') { + throw new TypeError('Bootstrap\'s JavaScript requires jQuery. jQuery must be included before Bootstrap\'s JavaScript.'); + } + + var version = $$$1.fn.jquery.split(' ')[0].split('.'); + var minMajor = 1; + var ltMajor = 2; + var minMinor = 9; + var minPatch = 1; + var maxMajor = 4; + + if (version[0] < ltMajor && version[1] < minMinor || version[0] === minMajor && version[1] === minMinor && version[2] < minPatch || version[0] >= maxMajor) { + throw new Error('Bootstrap\'s JavaScript requires at least jQuery v1.9.1 but less than v4.0.0'); + } +})($); + +exports.Util = Util; +exports.Alert = Alert; +exports.Button = Button; +exports.Carousel = Carousel; +exports.Collapse = Collapse; +exports.Dropdown = Dropdown; +exports.Modal = Modal; +exports.Popover = Popover; +exports.Scrollspy = ScrollSpy; +exports.Tab = Tab; +exports.Tooltip = Tooltip; + +Object.defineProperty(exports, '__esModule', { value: true }); + +}))); +//# sourceMappingURL=bootstrap.bundle.js.map diff --git a/chall/src/js/bootstrap.bundle.min.js b/chall/src/js/bootstrap.bundle.min.js new file mode 100644 index 0000000..7d50e87 --- /dev/null +++ b/chall/src/js/bootstrap.bundle.min.js @@ -0,0 +1,7 @@ +/*! + * Bootstrap v4.0.0 (https://getbootstrap.com) + * Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors) + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + */ +!function(t,e){"object"==typeof exports&&"undefined"!=typeof module?e(exports,require("jquery")):"function"==typeof define&&define.amd?define(["exports","jquery"],e):e(t.bootstrap={},t.jQuery)}(this,function(t,e){"use strict";function n(t,e){for(var n=0;n<e.length;n++){var i=e[n];i.enumerable=i.enumerable||!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(t,i.key,i)}}function i(t,e,i){return e&&n(t.prototype,e),i&&n(t,i),t}function r(){return(r=Object.assign||function(t){for(var e=1;e<arguments.length;e++){var n=arguments[e];for(var i in n)Object.prototype.hasOwnProperty.call(n,i)&&(t[i]=n[i])}return t}).apply(this,arguments)}for(var o,s,a,l,c,h,f,u,d,p,g,m,_,v,E,y,b,T,C,w,I,A,D,S,O,N,k=function(t){var e=!1;function n(e){var n=this,r=!1;return t(this).one(i.TRANSITION_END,function(){r=!0}),setTimeout(function(){r||i.triggerTransitionEnd(n)},e),this}var i={TRANSITION_END:"bsTransitionEnd",getUID:function(t){do{t+=~~(1e6*Math.random())}while(document.getElementById(t));return t},getSelectorFromElement:function(e){var n,i=e.getAttribute("data-target");i&&"#"!==i||(i=e.getAttribute("href")||""),"#"===i.charAt(0)&&(n=i,i=n="function"==typeof t.escapeSelector?t.escapeSelector(n).substr(1):n.replace(/(:|\.|\[|\]|,|=|@)/g,"\\$1"));try{return t(document).find(i).length>0?i:null}catch(t){return null}},reflow:function(t){return t.offsetHeight},triggerTransitionEnd:function(n){t(n).trigger(e.end)},supportsTransitionEnd:function(){return Boolean(e)},isElement:function(t){return(t[0]||t).nodeType},typeCheckConfig:function(t,e,n){for(var r in n)if(Object.prototype.hasOwnProperty.call(n,r)){var o=n[r],s=e[r],a=s&&i.isElement(s)?"element":(l=s,{}.toString.call(l).match(/\s([a-zA-Z]+)/)[1].toLowerCase());if(!new RegExp(o).test(a))throw new Error(t.toUpperCase()+': Option "'+r+'" provided type "'+a+'" but expected type "'+o+'".')}var l}};return e=("undefined"==typeof window||!window.QUnit)&&{end:"transitionend"},t.fn.emulateTransitionEnd=n,i.supportsTransitionEnd()&&(t.event.special[i.TRANSITION_END]={bindType:e.end,delegateType:e.end,handle:function(e){if(t(e.target).is(this))return e.handleObj.handler.apply(this,arguments)}}),i}(e=e&&e.hasOwnProperty("default")?e.default:e),L=(s="alert",l="."+(a="bs.alert"),c=(o=e).fn[s],h={CLOSE:"close"+l,CLOSED:"closed"+l,CLICK_DATA_API:"click"+l+".data-api"},f="alert",u="fade",d="show",p=function(){function t(t){this._element=t}var e=t.prototype;return e.close=function(t){t=t||this._element;var e=this._getRootElement(t);this._triggerCloseEvent(e).isDefaultPrevented()||this._removeElement(e)},e.dispose=function(){o.removeData(this._element,a),this._element=null},e._getRootElement=function(t){var e=k.getSelectorFromElement(t),n=!1;return e&&(n=o(e)[0]),n||(n=o(t).closest("."+f)[0]),n},e._triggerCloseEvent=function(t){var e=o.Event(h.CLOSE);return o(t).trigger(e),e},e._removeElement=function(t){var e=this;o(t).removeClass(d),k.supportsTransitionEnd()&&o(t).hasClass(u)?o(t).one(k.TRANSITION_END,function(n){return e._destroyElement(t,n)}).emulateTransitionEnd(150):this._destroyElement(t)},e._destroyElement=function(t){o(t).detach().trigger(h.CLOSED).remove()},t._jQueryInterface=function(e){return this.each(function(){var n=o(this),i=n.data(a);i||(i=new t(this),n.data(a,i)),"close"===e&&i[e](this)})},t._handleDismiss=function(t){return function(e){e&&e.preventDefault(),t.close(this)}},i(t,null,[{key:"VERSION",get:function(){return"4.0.0"}}]),t}(),o(document).on(h.CLICK_DATA_API,'[data-dismiss="alert"]',p._handleDismiss(new p)),o.fn[s]=p._jQueryInterface,o.fn[s].Constructor=p,o.fn[s].noConflict=function(){return o.fn[s]=c,p._jQueryInterface},p),P=(m="button",v="."+(_="bs.button"),E=".data-api",y=(g=e).fn[m],b="active",T="btn",C="focus",w='[data-toggle^="button"]',I='[data-toggle="buttons"]',A="input",D=".active",S=".btn",O={CLICK_DATA_API:"click"+v+E,FOCUS_BLUR_DATA_API:"focus"+v+E+" blur"+v+E},N=function(){function t(t){this._element=t}var e=t.prototype;return e.toggle=function(){var t=!0,e=!0,n=g(this._element).closest(I)[0];if(n){var i=g(this._element).find(A)[0];if(i){if("radio"===i.type)if(i.checked&&g(this._element).hasClass(b))t=!1;else{var r=g(n).find(D)[0];r&&g(r).removeClass(b)}if(t){if(i.hasAttribute("disabled")||n.hasAttribute("disabled")||i.classList.contains("disabled")||n.classList.contains("disabled"))return;i.checked=!g(this._element).hasClass(b),g(i).trigger("change")}i.focus(),e=!1}}e&&this._element.setAttribute("aria-pressed",!g(this._element).hasClass(b)),t&&g(this._element).toggleClass(b)},e.dispose=function(){g.removeData(this._element,_),this._element=null},t._jQueryInterface=function(e){return this.each(function(){var n=g(this).data(_);n||(n=new t(this),g(this).data(_,n)),"toggle"===e&&n[e]()})},i(t,null,[{key:"VERSION",get:function(){return"4.0.0"}}]),t}(),g(document).on(O.CLICK_DATA_API,w,function(t){t.preventDefault();var e=t.target;g(e).hasClass(T)||(e=g(e).closest(S)),N._jQueryInterface.call(g(e),"toggle")}).on(O.FOCUS_BLUR_DATA_API,w,function(t){var e=g(t.target).closest(S)[0];g(e).toggleClass(C,/^focus(in)?$/.test(t.type))}),g.fn[m]=N._jQueryInterface,g.fn[m].Constructor=N,g.fn[m].noConflict=function(){return g.fn[m]=y,N._jQueryInterface},N),x=function(t){var e="carousel",n="bs.carousel",o="."+n,s=t.fn[e],a={interval:5e3,keyboard:!0,slide:!1,pause:"hover",wrap:!0},l={interval:"(number|boolean)",keyboard:"boolean",slide:"(boolean|string)",pause:"(string|boolean)",wrap:"boolean"},c="next",h="prev",f="left",u="right",d={SLIDE:"slide"+o,SLID:"slid"+o,KEYDOWN:"keydown"+o,MOUSEENTER:"mouseenter"+o,MOUSELEAVE:"mouseleave"+o,TOUCHEND:"touchend"+o,LOAD_DATA_API:"load"+o+".data-api",CLICK_DATA_API:"click"+o+".data-api"},p="carousel",g="active",m="slide",_="carousel-item-right",v="carousel-item-left",E="carousel-item-next",y="carousel-item-prev",b={ACTIVE:".active",ACTIVE_ITEM:".active.carousel-item",ITEM:".carousel-item",NEXT_PREV:".carousel-item-next, .carousel-item-prev",INDICATORS:".carousel-indicators",DATA_SLIDE:"[data-slide], [data-slide-to]",DATA_RIDE:'[data-ride="carousel"]'},T=function(){function s(e,n){this._items=null,this._interval=null,this._activeElement=null,this._isPaused=!1,this._isSliding=!1,this.touchTimeout=null,this._config=this._getConfig(n),this._element=t(e)[0],this._indicatorsElement=t(this._element).find(b.INDICATORS)[0],this._addEventListeners()}var T=s.prototype;return T.next=function(){this._isSliding||this._slide(c)},T.nextWhenVisible=function(){!document.hidden&&t(this._element).is(":visible")&&"hidden"!==t(this._element).css("visibility")&&this.next()},T.prev=function(){this._isSliding||this._slide(h)},T.pause=function(e){e||(this._isPaused=!0),t(this._element).find(b.NEXT_PREV)[0]&&k.supportsTransitionEnd()&&(k.triggerTransitionEnd(this._element),this.cycle(!0)),clearInterval(this._interval),this._interval=null},T.cycle=function(t){t||(this._isPaused=!1),this._interval&&(clearInterval(this._interval),this._interval=null),this._config.interval&&!this._isPaused&&(this._interval=setInterval((document.visibilityState?this.nextWhenVisible:this.next).bind(this),this._config.interval))},T.to=function(e){var n=this;this._activeElement=t(this._element).find(b.ACTIVE_ITEM)[0];var i=this._getItemIndex(this._activeElement);if(!(e>this._items.length-1||e<0))if(this._isSliding)t(this._element).one(d.SLID,function(){return n.to(e)});else{if(i===e)return this.pause(),void this.cycle();var r=e>i?c:h;this._slide(r,this._items[e])}},T.dispose=function(){t(this._element).off(o),t.removeData(this._element,n),this._items=null,this._config=null,this._element=null,this._interval=null,this._isPaused=null,this._isSliding=null,this._activeElement=null,this._indicatorsElement=null},T._getConfig=function(t){return t=r({},a,t),k.typeCheckConfig(e,t,l),t},T._addEventListeners=function(){var e=this;this._config.keyboard&&t(this._element).on(d.KEYDOWN,function(t){return e._keydown(t)}),"hover"===this._config.pause&&(t(this._element).on(d.MOUSEENTER,function(t){return e.pause(t)}).on(d.MOUSELEAVE,function(t){return e.cycle(t)}),"ontouchstart"in document.documentElement&&t(this._element).on(d.TOUCHEND,function(){e.pause(),e.touchTimeout&&clearTimeout(e.touchTimeout),e.touchTimeout=setTimeout(function(t){return e.cycle(t)},500+e._config.interval)}))},T._keydown=function(t){if(!/input|textarea/i.test(t.target.tagName))switch(t.which){case 37:t.preventDefault(),this.prev();break;case 39:t.preventDefault(),this.next()}},T._getItemIndex=function(e){return this._items=t.makeArray(t(e).parent().find(b.ITEM)),this._items.indexOf(e)},T._getItemByDirection=function(t,e){var n=t===c,i=t===h,r=this._getItemIndex(e),o=this._items.length-1;if((i&&0===r||n&&r===o)&&!this._config.wrap)return e;var s=(r+(t===h?-1:1))%this._items.length;return-1===s?this._items[this._items.length-1]:this._items[s]},T._triggerSlideEvent=function(e,n){var i=this._getItemIndex(e),r=this._getItemIndex(t(this._element).find(b.ACTIVE_ITEM)[0]),o=t.Event(d.SLIDE,{relatedTarget:e,direction:n,from:r,to:i});return t(this._element).trigger(o),o},T._setActiveIndicatorElement=function(e){if(this._indicatorsElement){t(this._indicatorsElement).find(b.ACTIVE).removeClass(g);var n=this._indicatorsElement.children[this._getItemIndex(e)];n&&t(n).addClass(g)}},T._slide=function(e,n){var i,r,o,s=this,a=t(this._element).find(b.ACTIVE_ITEM)[0],l=this._getItemIndex(a),h=n||a&&this._getItemByDirection(e,a),p=this._getItemIndex(h),T=Boolean(this._interval);if(e===c?(i=v,r=E,o=f):(i=_,r=y,o=u),h&&t(h).hasClass(g))this._isSliding=!1;else if(!this._triggerSlideEvent(h,o).isDefaultPrevented()&&a&&h){this._isSliding=!0,T&&this.pause(),this._setActiveIndicatorElement(h);var C=t.Event(d.SLID,{relatedTarget:h,direction:o,from:l,to:p});k.supportsTransitionEnd()&&t(this._element).hasClass(m)?(t(h).addClass(r),k.reflow(h),t(a).addClass(i),t(h).addClass(i),t(a).one(k.TRANSITION_END,function(){t(h).removeClass(i+" "+r).addClass(g),t(a).removeClass(g+" "+r+" "+i),s._isSliding=!1,setTimeout(function(){return t(s._element).trigger(C)},0)}).emulateTransitionEnd(600)):(t(a).removeClass(g),t(h).addClass(g),this._isSliding=!1,t(this._element).trigger(C)),T&&this.cycle()}},s._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n),o=r({},a,t(this).data());"object"==typeof e&&(o=r({},o,e));var l="string"==typeof e?e:o.slide;if(i||(i=new s(this,o),t(this).data(n,i)),"number"==typeof e)i.to(e);else if("string"==typeof l){if("undefined"==typeof i[l])throw new TypeError('No method named "'+l+'"');i[l]()}else o.interval&&(i.pause(),i.cycle())})},s._dataApiClickHandler=function(e){var i=k.getSelectorFromElement(this);if(i){var o=t(i)[0];if(o&&t(o).hasClass(p)){var a=r({},t(o).data(),t(this).data()),l=this.getAttribute("data-slide-to");l&&(a.interval=!1),s._jQueryInterface.call(t(o),a),l&&t(o).data(n).to(l),e.preventDefault()}}},i(s,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return a}}]),s}();return t(document).on(d.CLICK_DATA_API,b.DATA_SLIDE,T._dataApiClickHandler),t(window).on(d.LOAD_DATA_API,function(){t(b.DATA_RIDE).each(function(){var e=t(this);T._jQueryInterface.call(e,e.data())})}),t.fn[e]=T._jQueryInterface,t.fn[e].Constructor=T,t.fn[e].noConflict=function(){return t.fn[e]=s,T._jQueryInterface},T}(e),R=function(t){var e="collapse",n="bs.collapse",o="."+n,s=t.fn[e],a={toggle:!0,parent:""},l={toggle:"boolean",parent:"(string|element)"},c={SHOW:"show"+o,SHOWN:"shown"+o,HIDE:"hide"+o,HIDDEN:"hidden"+o,CLICK_DATA_API:"click"+o+".data-api"},h="show",f="collapse",u="collapsing",d="collapsed",p="width",g="height",m={ACTIVES:".show, .collapsing",DATA_TOGGLE:'[data-toggle="collapse"]'},_=function(){function o(e,n){this._isTransitioning=!1,this._element=e,this._config=this._getConfig(n),this._triggerArray=t.makeArray(t('[data-toggle="collapse"][href="#'+e.id+'"],[data-toggle="collapse"][data-target="#'+e.id+'"]'));for(var i=t(m.DATA_TOGGLE),r=0;r<i.length;r++){var o=i[r],s=k.getSelectorFromElement(o);null!==s&&t(s).filter(e).length>0&&(this._selector=s,this._triggerArray.push(o))}this._parent=this._config.parent?this._getParent():null,this._config.parent||this._addAriaAndCollapsedClass(this._element,this._triggerArray),this._config.toggle&&this.toggle()}var s=o.prototype;return s.toggle=function(){t(this._element).hasClass(h)?this.hide():this.show()},s.show=function(){var e,i,r=this;if(!this._isTransitioning&&!t(this._element).hasClass(h)&&(this._parent&&0===(e=t.makeArray(t(this._parent).find(m.ACTIVES).filter('[data-parent="'+this._config.parent+'"]'))).length&&(e=null),!(e&&(i=t(e).not(this._selector).data(n))&&i._isTransitioning))){var s=t.Event(c.SHOW);if(t(this._element).trigger(s),!s.isDefaultPrevented()){e&&(o._jQueryInterface.call(t(e).not(this._selector),"hide"),i||t(e).data(n,null));var a=this._getDimension();t(this._element).removeClass(f).addClass(u),this._element.style[a]=0,this._triggerArray.length>0&&t(this._triggerArray).removeClass(d).attr("aria-expanded",!0),this.setTransitioning(!0);var l=function(){t(r._element).removeClass(u).addClass(f).addClass(h),r._element.style[a]="",r.setTransitioning(!1),t(r._element).trigger(c.SHOWN)};if(k.supportsTransitionEnd()){var p="scroll"+(a[0].toUpperCase()+a.slice(1));t(this._element).one(k.TRANSITION_END,l).emulateTransitionEnd(600),this._element.style[a]=this._element[p]+"px"}else l()}}},s.hide=function(){var e=this;if(!this._isTransitioning&&t(this._element).hasClass(h)){var n=t.Event(c.HIDE);if(t(this._element).trigger(n),!n.isDefaultPrevented()){var i=this._getDimension();if(this._element.style[i]=this._element.getBoundingClientRect()[i]+"px",k.reflow(this._element),t(this._element).addClass(u).removeClass(f).removeClass(h),this._triggerArray.length>0)for(var r=0;r<this._triggerArray.length;r++){var o=this._triggerArray[r],s=k.getSelectorFromElement(o);if(null!==s)t(s).hasClass(h)||t(o).addClass(d).attr("aria-expanded",!1)}this.setTransitioning(!0);var a=function(){e.setTransitioning(!1),t(e._element).removeClass(u).addClass(f).trigger(c.HIDDEN)};this._element.style[i]="",k.supportsTransitionEnd()?t(this._element).one(k.TRANSITION_END,a).emulateTransitionEnd(600):a()}}},s.setTransitioning=function(t){this._isTransitioning=t},s.dispose=function(){t.removeData(this._element,n),this._config=null,this._parent=null,this._element=null,this._triggerArray=null,this._isTransitioning=null},s._getConfig=function(t){return(t=r({},a,t)).toggle=Boolean(t.toggle),k.typeCheckConfig(e,t,l),t},s._getDimension=function(){return t(this._element).hasClass(p)?p:g},s._getParent=function(){var e=this,n=null;k.isElement(this._config.parent)?(n=this._config.parent,"undefined"!=typeof this._config.parent.jquery&&(n=this._config.parent[0])):n=t(this._config.parent)[0];var i='[data-toggle="collapse"][data-parent="'+this._config.parent+'"]';return t(n).find(i).each(function(t,n){e._addAriaAndCollapsedClass(o._getTargetFromElement(n),[n])}),n},s._addAriaAndCollapsedClass=function(e,n){if(e){var i=t(e).hasClass(h);n.length>0&&t(n).toggleClass(d,!i).attr("aria-expanded",i)}},o._getTargetFromElement=function(e){var n=k.getSelectorFromElement(e);return n?t(n)[0]:null},o._jQueryInterface=function(e){return this.each(function(){var i=t(this),s=i.data(n),l=r({},a,i.data(),"object"==typeof e&&e);if(!s&&l.toggle&&/show|hide/.test(e)&&(l.toggle=!1),s||(s=new o(this,l),i.data(n,s)),"string"==typeof e){if("undefined"==typeof s[e])throw new TypeError('No method named "'+e+'"');s[e]()}})},i(o,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return a}}]),o}();return t(document).on(c.CLICK_DATA_API,m.DATA_TOGGLE,function(e){"A"===e.currentTarget.tagName&&e.preventDefault();var i=t(this),r=k.getSelectorFromElement(this);t(r).each(function(){var e=t(this),r=e.data(n)?"toggle":i.data();_._jQueryInterface.call(e,r)})}),t.fn[e]=_._jQueryInterface,t.fn[e].Constructor=_,t.fn[e].noConflict=function(){return t.fn[e]=s,_._jQueryInterface},_}(e),j="undefined"!=typeof window&&"undefined"!=typeof document,H=["Edge","Trident","Firefox"],M=0,W=0;W<H.length;W+=1)if(j&&navigator.userAgent.indexOf(H[W])>=0){M=1;break}var U=j&&window.Promise?function(t){var e=!1;return function(){e||(e=!0,window.Promise.resolve().then(function(){e=!1,t()}))}}:function(t){var e=!1;return function(){e||(e=!0,setTimeout(function(){e=!1,t()},M))}};function B(t){return t&&"[object Function]"==={}.toString.call(t)}function F(t,e){if(1!==t.nodeType)return[];var n=getComputedStyle(t,null);return e?n[e]:n}function K(t){return"HTML"===t.nodeName?t:t.parentNode||t.host}function V(t){if(!t)return document.body;switch(t.nodeName){case"HTML":case"BODY":return t.ownerDocument.body;case"#document":return t.body}var e=F(t),n=e.overflow,i=e.overflowX,r=e.overflowY;return/(auto|scroll)/.test(n+r+i)?t:V(K(t))}function Q(t){var e=t&&t.offsetParent,n=e&&e.nodeName;return n&&"BODY"!==n&&"HTML"!==n?-1!==["TD","TABLE"].indexOf(e.nodeName)&&"static"===F(e,"position")?Q(e):e:t?t.ownerDocument.documentElement:document.documentElement}function Y(t){return null!==t.parentNode?Y(t.parentNode):t}function G(t,e){if(!(t&&t.nodeType&&e&&e.nodeType))return document.documentElement;var n=t.compareDocumentPosition(e)&Node.DOCUMENT_POSITION_FOLLOWING,i=n?t:e,r=n?e:t,o=document.createRange();o.setStart(i,0),o.setEnd(r,0);var s,a,l=o.commonAncestorContainer;if(t!==l&&e!==l||i.contains(r))return"BODY"===(a=(s=l).nodeName)||"HTML"!==a&&Q(s.firstElementChild)!==s?Q(l):l;var c=Y(t);return c.host?G(c.host,e):G(t,Y(e).host)}function q(t){var e="top"===(arguments.length>1&&void 0!==arguments[1]?arguments[1]:"top")?"scrollTop":"scrollLeft",n=t.nodeName;if("BODY"===n||"HTML"===n){var i=t.ownerDocument.documentElement;return(t.ownerDocument.scrollingElement||i)[e]}return t[e]}function z(t,e){var n="x"===e?"Left":"Top",i="Left"===n?"Right":"Bottom";return parseFloat(t["border"+n+"Width"],10)+parseFloat(t["border"+i+"Width"],10)}var X=void 0,Z=function(){return void 0===X&&(X=-1!==navigator.appVersion.indexOf("MSIE 10")),X};function J(t,e,n,i){return Math.max(e["offset"+t],e["scroll"+t],n["client"+t],n["offset"+t],n["scroll"+t],Z()?n["offset"+t]+i["margin"+("Height"===t?"Top":"Left")]+i["margin"+("Height"===t?"Bottom":"Right")]:0)}function $(){var t=document.body,e=document.documentElement,n=Z()&&getComputedStyle(e);return{height:J("Height",t,e,n),width:J("Width",t,e,n)}}var tt=function(t,e){if(!(t instanceof e))throw new TypeError("Cannot call a class as a function")},et=function(){function t(t,e){for(var n=0;n<e.length;n++){var i=e[n];i.enumerable=i.enumerable||!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(t,i.key,i)}}return function(e,n,i){return n&&t(e.prototype,n),i&&t(e,i),e}}(),nt=function(t,e,n){return e in t?Object.defineProperty(t,e,{value:n,enumerable:!0,configurable:!0,writable:!0}):t[e]=n,t},it=Object.assign||function(t){for(var e=1;e<arguments.length;e++){var n=arguments[e];for(var i in n)Object.prototype.hasOwnProperty.call(n,i)&&(t[i]=n[i])}return t};function rt(t){return it({},t,{right:t.left+t.width,bottom:t.top+t.height})}function ot(t){var e={};if(Z())try{e=t.getBoundingClientRect();var n=q(t,"top"),i=q(t,"left");e.top+=n,e.left+=i,e.bottom+=n,e.right+=i}catch(t){}else e=t.getBoundingClientRect();var r={left:e.left,top:e.top,width:e.right-e.left,height:e.bottom-e.top},o="HTML"===t.nodeName?$():{},s=o.width||t.clientWidth||r.right-r.left,a=o.height||t.clientHeight||r.bottom-r.top,l=t.offsetWidth-s,c=t.offsetHeight-a;if(l||c){var h=F(t);l-=z(h,"x"),c-=z(h,"y"),r.width-=l,r.height-=c}return rt(r)}function st(t,e){var n=Z(),i="HTML"===e.nodeName,r=ot(t),o=ot(e),s=V(t),a=F(e),l=parseFloat(a.borderTopWidth,10),c=parseFloat(a.borderLeftWidth,10),h=rt({top:r.top-o.top-l,left:r.left-o.left-c,width:r.width,height:r.height});if(h.marginTop=0,h.marginLeft=0,!n&&i){var f=parseFloat(a.marginTop,10),u=parseFloat(a.marginLeft,10);h.top-=l-f,h.bottom-=l-f,h.left-=c-u,h.right-=c-u,h.marginTop=f,h.marginLeft=u}return(n?e.contains(s):e===s&&"BODY"!==s.nodeName)&&(h=function(t,e){var n=arguments.length>2&&void 0!==arguments[2]&&arguments[2],i=q(e,"top"),r=q(e,"left"),o=n?-1:1;return t.top+=i*o,t.bottom+=i*o,t.left+=r*o,t.right+=r*o,t}(h,e)),h}function at(t,e,n,i){var r,o,s,a,l,c,h,f={top:0,left:0},u=G(t,e);if("viewport"===i)o=(r=u).ownerDocument.documentElement,s=st(r,o),a=Math.max(o.clientWidth,window.innerWidth||0),l=Math.max(o.clientHeight,window.innerHeight||0),c=q(o),h=q(o,"left"),f=rt({top:c-s.top+s.marginTop,left:h-s.left+s.marginLeft,width:a,height:l});else{var d=void 0;"scrollParent"===i?"BODY"===(d=V(K(e))).nodeName&&(d=t.ownerDocument.documentElement):d="window"===i?t.ownerDocument.documentElement:i;var p=st(d,u);if("HTML"!==d.nodeName||function t(e){var n=e.nodeName;return"BODY"!==n&&"HTML"!==n&&("fixed"===F(e,"position")||t(K(e)))}(u))f=p;else{var g=$(),m=g.height,_=g.width;f.top+=p.top-p.marginTop,f.bottom=m+p.top,f.left+=p.left-p.marginLeft,f.right=_+p.left}}return f.left+=n,f.top+=n,f.right-=n,f.bottom-=n,f}function lt(t,e,n,i,r){var o=arguments.length>5&&void 0!==arguments[5]?arguments[5]:0;if(-1===t.indexOf("auto"))return t;var s=at(n,i,o,r),a={top:{width:s.width,height:e.top-s.top},right:{width:s.right-e.right,height:s.height},bottom:{width:s.width,height:s.bottom-e.bottom},left:{width:e.left-s.left,height:s.height}},l=Object.keys(a).map(function(t){return it({key:t},a[t],{area:(e=a[t],e.width*e.height)});var e}).sort(function(t,e){return e.area-t.area}),c=l.filter(function(t){var e=t.width,i=t.height;return e>=n.clientWidth&&i>=n.clientHeight}),h=c.length>0?c[0].key:l[0].key,f=t.split("-")[1];return h+(f?"-"+f:"")}function ct(t,e,n){return st(n,G(e,n))}function ht(t){var e=getComputedStyle(t),n=parseFloat(e.marginTop)+parseFloat(e.marginBottom),i=parseFloat(e.marginLeft)+parseFloat(e.marginRight);return{width:t.offsetWidth+i,height:t.offsetHeight+n}}function ft(t){var e={left:"right",right:"left",bottom:"top",top:"bottom"};return t.replace(/left|right|bottom|top/g,function(t){return e[t]})}function ut(t,e,n){n=n.split("-")[0];var i=ht(t),r={width:i.width,height:i.height},o=-1!==["right","left"].indexOf(n),s=o?"top":"left",a=o?"left":"top",l=o?"height":"width",c=o?"width":"height";return r[s]=e[s]+e[l]/2-i[l]/2,r[a]=n===a?e[a]-i[c]:e[ft(a)],r}function dt(t,e){return Array.prototype.find?t.find(e):t.filter(e)[0]}function pt(t,e,n){return(void 0===n?t:t.slice(0,function(t,e,n){if(Array.prototype.findIndex)return t.findIndex(function(t){return t[e]===n});var i=dt(t,function(t){return t[e]===n});return t.indexOf(i)}(t,"name",n))).forEach(function(t){t.function&&console.warn("`modifier.function` is deprecated, use `modifier.fn`!");var n=t.function||t.fn;t.enabled&&B(n)&&(e.offsets.popper=rt(e.offsets.popper),e.offsets.reference=rt(e.offsets.reference),e=n(e,t))}),e}function gt(t,e){return t.some(function(t){var n=t.name;return t.enabled&&n===e})}function mt(t){for(var e=[!1,"ms","Webkit","Moz","O"],n=t.charAt(0).toUpperCase()+t.slice(1),i=0;i<e.length-1;i++){var r=e[i],o=r?""+r+n:t;if("undefined"!=typeof document.body.style[o])return o}return null}function _t(t){var e=t.ownerDocument;return e?e.defaultView:window}function vt(t,e,n,i){n.updateBound=i,_t(t).addEventListener("resize",n.updateBound,{passive:!0});var r=V(t);return function t(e,n,i,r){var o="BODY"===e.nodeName,s=o?e.ownerDocument.defaultView:e;s.addEventListener(n,i,{passive:!0}),o||t(V(s.parentNode),n,i,r),r.push(s)}(r,"scroll",n.updateBound,n.scrollParents),n.scrollElement=r,n.eventsEnabled=!0,n}function Et(){var t,e;this.state.eventsEnabled&&(cancelAnimationFrame(this.scheduleUpdate),this.state=(t=this.reference,e=this.state,_t(t).removeEventListener("resize",e.updateBound),e.scrollParents.forEach(function(t){t.removeEventListener("scroll",e.updateBound)}),e.updateBound=null,e.scrollParents=[],e.scrollElement=null,e.eventsEnabled=!1,e))}function yt(t){return""!==t&&!isNaN(parseFloat(t))&&isFinite(t)}function bt(t,e){Object.keys(e).forEach(function(n){var i="";-1!==["width","height","top","right","bottom","left"].indexOf(n)&&yt(e[n])&&(i="px"),t.style[n]=e[n]+i})}function Tt(t,e,n){var i=dt(t,function(t){return t.name===e}),r=!!i&&t.some(function(t){return t.name===n&&t.enabled&&t.order<i.order});if(!r){var o="`"+e+"`",s="`"+n+"`";console.warn(s+" modifier is required by "+o+" modifier in order to work, be sure to include it before "+o+"!")}return r}var Ct=["auto-start","auto","auto-end","top-start","top","top-end","right-start","right","right-end","bottom-end","bottom","bottom-start","left-end","left","left-start"],wt=Ct.slice(3);function It(t){var e=arguments.length>1&&void 0!==arguments[1]&&arguments[1],n=wt.indexOf(t),i=wt.slice(n+1).concat(wt.slice(0,n));return e?i.reverse():i}var At={FLIP:"flip",CLOCKWISE:"clockwise",COUNTERCLOCKWISE:"counterclockwise"};function Dt(t,e,n,i){var r=[0,0],o=-1!==["right","left"].indexOf(i),s=t.split(/(\+|\-)/).map(function(t){return t.trim()}),a=s.indexOf(dt(s,function(t){return-1!==t.search(/,|\s/)}));s[a]&&-1===s[a].indexOf(",")&&console.warn("Offsets separated by white space(s) are deprecated, use a comma (,) instead.");var l=/\s*,\s*|\s+/,c=-1!==a?[s.slice(0,a).concat([s[a].split(l)[0]]),[s[a].split(l)[1]].concat(s.slice(a+1))]:[s];return(c=c.map(function(t,i){var r=(1===i?!o:o)?"height":"width",s=!1;return t.reduce(function(t,e){return""===t[t.length-1]&&-1!==["+","-"].indexOf(e)?(t[t.length-1]=e,s=!0,t):s?(t[t.length-1]+=e,s=!1,t):t.concat(e)},[]).map(function(t){return function(t,e,n,i){var r=t.match(/((?:\-|\+)?\d*\.?\d*)(.*)/),o=+r[1],s=r[2];if(!o)return t;if(0===s.indexOf("%")){var a=void 0;switch(s){case"%p":a=n;break;case"%":case"%r":default:a=i}return rt(a)[e]/100*o}if("vh"===s||"vw"===s)return("vh"===s?Math.max(document.documentElement.clientHeight,window.innerHeight||0):Math.max(document.documentElement.clientWidth,window.innerWidth||0))/100*o;return o}(t,r,e,n)})})).forEach(function(t,e){t.forEach(function(n,i){yt(n)&&(r[e]+=n*("-"===t[i-1]?-1:1))})}),r}var St={placement:"bottom",eventsEnabled:!0,removeOnDestroy:!1,onCreate:function(){},onUpdate:function(){},modifiers:{shift:{order:100,enabled:!0,fn:function(t){var e=t.placement,n=e.split("-")[0],i=e.split("-")[1];if(i){var r=t.offsets,o=r.reference,s=r.popper,a=-1!==["bottom","top"].indexOf(n),l=a?"left":"top",c=a?"width":"height",h={start:nt({},l,o[l]),end:nt({},l,o[l]+o[c]-s[c])};t.offsets.popper=it({},s,h[i])}return t}},offset:{order:200,enabled:!0,fn:function(t,e){var n=e.offset,i=t.placement,r=t.offsets,o=r.popper,s=r.reference,a=i.split("-")[0],l=void 0;return l=yt(+n)?[+n,0]:Dt(n,o,s,a),"left"===a?(o.top+=l[0],o.left-=l[1]):"right"===a?(o.top+=l[0],o.left+=l[1]):"top"===a?(o.left+=l[0],o.top-=l[1]):"bottom"===a&&(o.left+=l[0],o.top+=l[1]),t.popper=o,t},offset:0},preventOverflow:{order:300,enabled:!0,fn:function(t,e){var n=e.boundariesElement||Q(t.instance.popper);t.instance.reference===n&&(n=Q(n));var i=at(t.instance.popper,t.instance.reference,e.padding,n);e.boundaries=i;var r=e.priority,o=t.offsets.popper,s={primary:function(t){var n=o[t];return o[t]<i[t]&&!e.escapeWithReference&&(n=Math.max(o[t],i[t])),nt({},t,n)},secondary:function(t){var n="right"===t?"left":"top",r=o[n];return o[t]>i[t]&&!e.escapeWithReference&&(r=Math.min(o[n],i[t]-("right"===t?o.width:o.height))),nt({},n,r)}};return r.forEach(function(t){var e=-1!==["left","top"].indexOf(t)?"primary":"secondary";o=it({},o,s[e](t))}),t.offsets.popper=o,t},priority:["left","right","top","bottom"],padding:5,boundariesElement:"scrollParent"},keepTogether:{order:400,enabled:!0,fn:function(t){var e=t.offsets,n=e.popper,i=e.reference,r=t.placement.split("-")[0],o=Math.floor,s=-1!==["top","bottom"].indexOf(r),a=s?"right":"bottom",l=s?"left":"top",c=s?"width":"height";return n[a]<o(i[l])&&(t.offsets.popper[l]=o(i[l])-n[c]),n[l]>o(i[a])&&(t.offsets.popper[l]=o(i[a])),t}},arrow:{order:500,enabled:!0,fn:function(t,e){var n;if(!Tt(t.instance.modifiers,"arrow","keepTogether"))return t;var i=e.element;if("string"==typeof i){if(!(i=t.instance.popper.querySelector(i)))return t}else if(!t.instance.popper.contains(i))return console.warn("WARNING: `arrow.element` must be child of its popper element!"),t;var r=t.placement.split("-")[0],o=t.offsets,s=o.popper,a=o.reference,l=-1!==["left","right"].indexOf(r),c=l?"height":"width",h=l?"Top":"Left",f=h.toLowerCase(),u=l?"left":"top",d=l?"bottom":"right",p=ht(i)[c];a[d]-p<s[f]&&(t.offsets.popper[f]-=s[f]-(a[d]-p)),a[f]+p>s[d]&&(t.offsets.popper[f]+=a[f]+p-s[d]),t.offsets.popper=rt(t.offsets.popper);var g=a[f]+a[c]/2-p/2,m=F(t.instance.popper),_=parseFloat(m["margin"+h],10),v=parseFloat(m["border"+h+"Width"],10),E=g-t.offsets.popper[f]-_-v;return E=Math.max(Math.min(s[c]-p,E),0),t.arrowElement=i,t.offsets.arrow=(nt(n={},f,Math.round(E)),nt(n,u,""),n),t},element:"[x-arrow]"},flip:{order:600,enabled:!0,fn:function(t,e){if(gt(t.instance.modifiers,"inner"))return t;if(t.flipped&&t.placement===t.originalPlacement)return t;var n=at(t.instance.popper,t.instance.reference,e.padding,e.boundariesElement),i=t.placement.split("-")[0],r=ft(i),o=t.placement.split("-")[1]||"",s=[];switch(e.behavior){case At.FLIP:s=[i,r];break;case At.CLOCKWISE:s=It(i);break;case At.COUNTERCLOCKWISE:s=It(i,!0);break;default:s=e.behavior}return s.forEach(function(a,l){if(i!==a||s.length===l+1)return t;i=t.placement.split("-")[0],r=ft(i);var c,h=t.offsets.popper,f=t.offsets.reference,u=Math.floor,d="left"===i&&u(h.right)>u(f.left)||"right"===i&&u(h.left)<u(f.right)||"top"===i&&u(h.bottom)>u(f.top)||"bottom"===i&&u(h.top)<u(f.bottom),p=u(h.left)<u(n.left),g=u(h.right)>u(n.right),m=u(h.top)<u(n.top),_=u(h.bottom)>u(n.bottom),v="left"===i&&p||"right"===i&&g||"top"===i&&m||"bottom"===i&&_,E=-1!==["top","bottom"].indexOf(i),y=!!e.flipVariations&&(E&&"start"===o&&p||E&&"end"===o&&g||!E&&"start"===o&&m||!E&&"end"===o&&_);(d||v||y)&&(t.flipped=!0,(d||v)&&(i=s[l+1]),y&&(o="end"===(c=o)?"start":"start"===c?"end":c),t.placement=i+(o?"-"+o:""),t.offsets.popper=it({},t.offsets.popper,ut(t.instance.popper,t.offsets.reference,t.placement)),t=pt(t.instance.modifiers,t,"flip"))}),t},behavior:"flip",padding:5,boundariesElement:"viewport"},inner:{order:700,enabled:!1,fn:function(t){var e=t.placement,n=e.split("-")[0],i=t.offsets,r=i.popper,o=i.reference,s=-1!==["left","right"].indexOf(n),a=-1===["top","left"].indexOf(n);return r[s?"left":"top"]=o[n]-(a?r[s?"width":"height"]:0),t.placement=ft(e),t.offsets.popper=rt(r),t}},hide:{order:800,enabled:!0,fn:function(t){if(!Tt(t.instance.modifiers,"hide","preventOverflow"))return t;var e=t.offsets.reference,n=dt(t.instance.modifiers,function(t){return"preventOverflow"===t.name}).boundaries;if(e.bottom<n.top||e.left>n.right||e.top>n.bottom||e.right<n.left){if(!0===t.hide)return t;t.hide=!0,t.attributes["x-out-of-boundaries"]=""}else{if(!1===t.hide)return t;t.hide=!1,t.attributes["x-out-of-boundaries"]=!1}return t}},computeStyle:{order:850,enabled:!0,fn:function(t,e){var n=e.x,i=e.y,r=t.offsets.popper,o=dt(t.instance.modifiers,function(t){return"applyStyle"===t.name}).gpuAcceleration;void 0!==o&&console.warn("WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!");var s=void 0!==o?o:e.gpuAcceleration,a=ot(Q(t.instance.popper)),l={position:r.position},c={left:Math.floor(r.left),top:Math.floor(r.top),bottom:Math.floor(r.bottom),right:Math.floor(r.right)},h="bottom"===n?"top":"bottom",f="right"===i?"left":"right",u=mt("transform"),d=void 0,p=void 0;if(p="bottom"===h?-a.height+c.bottom:c.top,d="right"===f?-a.width+c.right:c.left,s&&u)l[u]="translate3d("+d+"px, "+p+"px, 0)",l[h]=0,l[f]=0,l.willChange="transform";else{var g="bottom"===h?-1:1,m="right"===f?-1:1;l[h]=p*g,l[f]=d*m,l.willChange=h+", "+f}var _={"x-placement":t.placement};return t.attributes=it({},_,t.attributes),t.styles=it({},l,t.styles),t.arrowStyles=it({},t.offsets.arrow,t.arrowStyles),t},gpuAcceleration:!0,x:"bottom",y:"right"},applyStyle:{order:900,enabled:!0,fn:function(t){var e,n;return bt(t.instance.popper,t.styles),e=t.instance.popper,n=t.attributes,Object.keys(n).forEach(function(t){!1!==n[t]?e.setAttribute(t,n[t]):e.removeAttribute(t)}),t.arrowElement&&Object.keys(t.arrowStyles).length&&bt(t.arrowElement,t.arrowStyles),t},onLoad:function(t,e,n,i,r){var o=ct(0,e,t),s=lt(n.placement,o,e,t,n.modifiers.flip.boundariesElement,n.modifiers.flip.padding);return e.setAttribute("x-placement",s),bt(e,{position:"absolute"}),n},gpuAcceleration:void 0}}},Ot=function(){function t(e,n){var i=this,r=arguments.length>2&&void 0!==arguments[2]?arguments[2]:{};tt(this,t),this.scheduleUpdate=function(){return requestAnimationFrame(i.update)},this.update=U(this.update.bind(this)),this.options=it({},t.Defaults,r),this.state={isDestroyed:!1,isCreated:!1,scrollParents:[]},this.reference=e&&e.jquery?e[0]:e,this.popper=n&&n.jquery?n[0]:n,this.options.modifiers={},Object.keys(it({},t.Defaults.modifiers,r.modifiers)).forEach(function(e){i.options.modifiers[e]=it({},t.Defaults.modifiers[e]||{},r.modifiers?r.modifiers[e]:{})}),this.modifiers=Object.keys(this.options.modifiers).map(function(t){return it({name:t},i.options.modifiers[t])}).sort(function(t,e){return t.order-e.order}),this.modifiers.forEach(function(t){t.enabled&&B(t.onLoad)&&t.onLoad(i.reference,i.popper,i.options,t,i.state)}),this.update();var o=this.options.eventsEnabled;o&&this.enableEventListeners(),this.state.eventsEnabled=o}return et(t,[{key:"update",value:function(){return function(){if(!this.state.isDestroyed){var t={instance:this,styles:{},arrowStyles:{},attributes:{},flipped:!1,offsets:{}};t.offsets.reference=ct(this.state,this.popper,this.reference),t.placement=lt(this.options.placement,t.offsets.reference,this.popper,this.reference,this.options.modifiers.flip.boundariesElement,this.options.modifiers.flip.padding),t.originalPlacement=t.placement,t.offsets.popper=ut(this.popper,t.offsets.reference,t.placement),t.offsets.popper.position="absolute",t=pt(this.modifiers,t),this.state.isCreated?this.options.onUpdate(t):(this.state.isCreated=!0,this.options.onCreate(t))}}.call(this)}},{key:"destroy",value:function(){return function(){return this.state.isDestroyed=!0,gt(this.modifiers,"applyStyle")&&(this.popper.removeAttribute("x-placement"),this.popper.style.left="",this.popper.style.position="",this.popper.style.top="",this.popper.style[mt("transform")]=""),this.disableEventListeners(),this.options.removeOnDestroy&&this.popper.parentNode.removeChild(this.popper),this}.call(this)}},{key:"enableEventListeners",value:function(){return function(){this.state.eventsEnabled||(this.state=vt(this.reference,this.options,this.state,this.scheduleUpdate))}.call(this)}},{key:"disableEventListeners",value:function(){return Et.call(this)}}]),t}();Ot.Utils=("undefined"!=typeof window?window:global).PopperUtils,Ot.placements=Ct,Ot.Defaults=St;var Nt=function(t){var e="dropdown",n="bs.dropdown",o="."+n,s=t.fn[e],a=new RegExp("38|40|27"),l={HIDE:"hide"+o,HIDDEN:"hidden"+o,SHOW:"show"+o,SHOWN:"shown"+o,CLICK:"click"+o,CLICK_DATA_API:"click"+o+".data-api",KEYDOWN_DATA_API:"keydown"+o+".data-api",KEYUP_DATA_API:"keyup"+o+".data-api"},c="disabled",h="show",f="dropup",u="dropright",d="dropleft",p="dropdown-menu-right",g="dropdown-menu-left",m="position-static",_='[data-toggle="dropdown"]',v=".dropdown form",E=".dropdown-menu",y=".navbar-nav",b=".dropdown-menu .dropdown-item:not(.disabled)",T="top-start",C="top-end",w="bottom-start",I="bottom-end",A="right-start",D="left-start",S={offset:0,flip:!0,boundary:"scrollParent"},O={offset:"(number|string|function)",flip:"boolean",boundary:"(string|element)"},N=function(){function s(t,e){this._element=t,this._popper=null,this._config=this._getConfig(e),this._menu=this._getMenuElement(),this._inNavbar=this._detectNavbar(),this._addEventListeners()}var v=s.prototype;return v.toggle=function(){if(!this._element.disabled&&!t(this._element).hasClass(c)){var e=s._getParentFromElement(this._element),n=t(this._menu).hasClass(h);if(s._clearMenus(),!n){var i={relatedTarget:this._element},r=t.Event(l.SHOW,i);if(t(e).trigger(r),!r.isDefaultPrevented()){if(!this._inNavbar){if("undefined"==typeof Ot)throw new TypeError("Bootstrap dropdown require Popper.js (https://popper.js.org)");var o=this._element;t(e).hasClass(f)&&(t(this._menu).hasClass(g)||t(this._menu).hasClass(p))&&(o=e),"scrollParent"!==this._config.boundary&&t(e).addClass(m),this._popper=new Ot(o,this._menu,this._getPopperConfig())}"ontouchstart"in document.documentElement&&0===t(e).closest(y).length&&t("body").children().on("mouseover",null,t.noop),this._element.focus(),this._element.setAttribute("aria-expanded",!0),t(this._menu).toggleClass(h),t(e).toggleClass(h).trigger(t.Event(l.SHOWN,i))}}}},v.dispose=function(){t.removeData(this._element,n),t(this._element).off(o),this._element=null,this._menu=null,null!==this._popper&&(this._popper.destroy(),this._popper=null)},v.update=function(){this._inNavbar=this._detectNavbar(),null!==this._popper&&this._popper.scheduleUpdate()},v._addEventListeners=function(){var e=this;t(this._element).on(l.CLICK,function(t){t.preventDefault(),t.stopPropagation(),e.toggle()})},v._getConfig=function(n){return n=r({},this.constructor.Default,t(this._element).data(),n),k.typeCheckConfig(e,n,this.constructor.DefaultType),n},v._getMenuElement=function(){if(!this._menu){var e=s._getParentFromElement(this._element);this._menu=t(e).find(E)[0]}return this._menu},v._getPlacement=function(){var e=t(this._element).parent(),n=w;return e.hasClass(f)?(n=T,t(this._menu).hasClass(p)&&(n=C)):e.hasClass(u)?n=A:e.hasClass(d)?n=D:t(this._menu).hasClass(p)&&(n=I),n},v._detectNavbar=function(){return t(this._element).closest(".navbar").length>0},v._getPopperConfig=function(){var t=this,e={};return"function"==typeof this._config.offset?e.fn=function(e){return e.offsets=r({},e.offsets,t._config.offset(e.offsets)||{}),e}:e.offset=this._config.offset,{placement:this._getPlacement(),modifiers:{offset:e,flip:{enabled:this._config.flip},preventOverflow:{boundariesElement:this._config.boundary}}}},s._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n);if(i||(i=new s(this,"object"==typeof e?e:null),t(this).data(n,i)),"string"==typeof e){if("undefined"==typeof i[e])throw new TypeError('No method named "'+e+'"');i[e]()}})},s._clearMenus=function(e){if(!e||3!==e.which&&("keyup"!==e.type||9===e.which))for(var i=t.makeArray(t(_)),r=0;r<i.length;r++){var o=s._getParentFromElement(i[r]),a=t(i[r]).data(n),c={relatedTarget:i[r]};if(a){var f=a._menu;if(t(o).hasClass(h)&&!(e&&("click"===e.type&&/input|textarea/i.test(e.target.tagName)||"keyup"===e.type&&9===e.which)&&t.contains(o,e.target))){var u=t.Event(l.HIDE,c);t(o).trigger(u),u.isDefaultPrevented()||("ontouchstart"in document.documentElement&&t("body").children().off("mouseover",null,t.noop),i[r].setAttribute("aria-expanded","false"),t(f).removeClass(h),t(o).removeClass(h).trigger(t.Event(l.HIDDEN,c)))}}}},s._getParentFromElement=function(e){var n,i=k.getSelectorFromElement(e);return i&&(n=t(i)[0]),n||e.parentNode},s._dataApiKeydownHandler=function(e){if((/input|textarea/i.test(e.target.tagName)?!(32===e.which||27!==e.which&&(40!==e.which&&38!==e.which||t(e.target).closest(E).length)):a.test(e.which))&&(e.preventDefault(),e.stopPropagation(),!this.disabled&&!t(this).hasClass(c))){var n=s._getParentFromElement(this),i=t(n).hasClass(h);if((i||27===e.which&&32===e.which)&&(!i||27!==e.which&&32!==e.which)){var r=t(n).find(b).get();if(0!==r.length){var o=r.indexOf(e.target);38===e.which&&o>0&&o--,40===e.which&&o<r.length-1&&o++,o<0&&(o=0),r[o].focus()}}else{if(27===e.which){var l=t(n).find(_)[0];t(l).trigger("focus")}t(this).trigger("click")}}},i(s,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return S}},{key:"DefaultType",get:function(){return O}}]),s}();return t(document).on(l.KEYDOWN_DATA_API,_,N._dataApiKeydownHandler).on(l.KEYDOWN_DATA_API,E,N._dataApiKeydownHandler).on(l.CLICK_DATA_API+" "+l.KEYUP_DATA_API,N._clearMenus).on(l.CLICK_DATA_API,_,function(e){e.preventDefault(),e.stopPropagation(),N._jQueryInterface.call(t(this),"toggle")}).on(l.CLICK_DATA_API,v,function(t){t.stopPropagation()}),t.fn[e]=N._jQueryInterface,t.fn[e].Constructor=N,t.fn[e].noConflict=function(){return t.fn[e]=s,N._jQueryInterface},N}(e),kt=function(t){var e="bs.modal",n="."+e,o=t.fn.modal,s={backdrop:!0,keyboard:!0,focus:!0,show:!0},a={backdrop:"(boolean|string)",keyboard:"boolean",focus:"boolean",show:"boolean"},l={HIDE:"hide"+n,HIDDEN:"hidden"+n,SHOW:"show"+n,SHOWN:"shown"+n,FOCUSIN:"focusin"+n,RESIZE:"resize"+n,CLICK_DISMISS:"click.dismiss"+n,KEYDOWN_DISMISS:"keydown.dismiss"+n,MOUSEUP_DISMISS:"mouseup.dismiss"+n,MOUSEDOWN_DISMISS:"mousedown.dismiss"+n,CLICK_DATA_API:"click.bs.modal.data-api"},c="modal-scrollbar-measure",h="modal-backdrop",f="modal-open",u="fade",d="show",p={DIALOG:".modal-dialog",DATA_TOGGLE:'[data-toggle="modal"]',DATA_DISMISS:'[data-dismiss="modal"]',FIXED_CONTENT:".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",STICKY_CONTENT:".sticky-top",NAVBAR_TOGGLER:".navbar-toggler"},g=function(){function o(e,n){this._config=this._getConfig(n),this._element=e,this._dialog=t(e).find(p.DIALOG)[0],this._backdrop=null,this._isShown=!1,this._isBodyOverflowing=!1,this._ignoreBackdropClick=!1,this._originalBodyPadding=0,this._scrollbarWidth=0}var g=o.prototype;return g.toggle=function(t){return this._isShown?this.hide():this.show(t)},g.show=function(e){var n=this;if(!this._isTransitioning&&!this._isShown){k.supportsTransitionEnd()&&t(this._element).hasClass(u)&&(this._isTransitioning=!0);var i=t.Event(l.SHOW,{relatedTarget:e});t(this._element).trigger(i),this._isShown||i.isDefaultPrevented()||(this._isShown=!0,this._checkScrollbar(),this._setScrollbar(),this._adjustDialog(),t(document.body).addClass(f),this._setEscapeEvent(),this._setResizeEvent(),t(this._element).on(l.CLICK_DISMISS,p.DATA_DISMISS,function(t){return n.hide(t)}),t(this._dialog).on(l.MOUSEDOWN_DISMISS,function(){t(n._element).one(l.MOUSEUP_DISMISS,function(e){t(e.target).is(n._element)&&(n._ignoreBackdropClick=!0)})}),this._showBackdrop(function(){return n._showElement(e)}))}},g.hide=function(e){var n=this;if(e&&e.preventDefault(),!this._isTransitioning&&this._isShown){var i=t.Event(l.HIDE);if(t(this._element).trigger(i),this._isShown&&!i.isDefaultPrevented()){this._isShown=!1;var r=k.supportsTransitionEnd()&&t(this._element).hasClass(u);r&&(this._isTransitioning=!0),this._setEscapeEvent(),this._setResizeEvent(),t(document).off(l.FOCUSIN),t(this._element).removeClass(d),t(this._element).off(l.CLICK_DISMISS),t(this._dialog).off(l.MOUSEDOWN_DISMISS),r?t(this._element).one(k.TRANSITION_END,function(t){return n._hideModal(t)}).emulateTransitionEnd(300):this._hideModal()}}},g.dispose=function(){t.removeData(this._element,e),t(window,document,this._element,this._backdrop).off(n),this._config=null,this._element=null,this._dialog=null,this._backdrop=null,this._isShown=null,this._isBodyOverflowing=null,this._ignoreBackdropClick=null,this._scrollbarWidth=null},g.handleUpdate=function(){this._adjustDialog()},g._getConfig=function(t){return t=r({},s,t),k.typeCheckConfig("modal",t,a),t},g._showElement=function(e){var n=this,i=k.supportsTransitionEnd()&&t(this._element).hasClass(u);this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE||document.body.appendChild(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.scrollTop=0,i&&k.reflow(this._element),t(this._element).addClass(d),this._config.focus&&this._enforceFocus();var r=t.Event(l.SHOWN,{relatedTarget:e}),o=function(){n._config.focus&&n._element.focus(),n._isTransitioning=!1,t(n._element).trigger(r)};i?t(this._dialog).one(k.TRANSITION_END,o).emulateTransitionEnd(300):o()},g._enforceFocus=function(){var e=this;t(document).off(l.FOCUSIN).on(l.FOCUSIN,function(n){document!==n.target&&e._element!==n.target&&0===t(e._element).has(n.target).length&&e._element.focus()})},g._setEscapeEvent=function(){var e=this;this._isShown&&this._config.keyboard?t(this._element).on(l.KEYDOWN_DISMISS,function(t){27===t.which&&(t.preventDefault(),e.hide())}):this._isShown||t(this._element).off(l.KEYDOWN_DISMISS)},g._setResizeEvent=function(){var e=this;this._isShown?t(window).on(l.RESIZE,function(t){return e.handleUpdate(t)}):t(window).off(l.RESIZE)},g._hideModal=function(){var e=this;this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._isTransitioning=!1,this._showBackdrop(function(){t(document.body).removeClass(f),e._resetAdjustments(),e._resetScrollbar(),t(e._element).trigger(l.HIDDEN)})},g._removeBackdrop=function(){this._backdrop&&(t(this._backdrop).remove(),this._backdrop=null)},g._showBackdrop=function(e){var n=this,i=t(this._element).hasClass(u)?u:"";if(this._isShown&&this._config.backdrop){var r=k.supportsTransitionEnd()&&i;if(this._backdrop=document.createElement("div"),this._backdrop.className=h,i&&t(this._backdrop).addClass(i),t(this._backdrop).appendTo(document.body),t(this._element).on(l.CLICK_DISMISS,function(t){n._ignoreBackdropClick?n._ignoreBackdropClick=!1:t.target===t.currentTarget&&("static"===n._config.backdrop?n._element.focus():n.hide())}),r&&k.reflow(this._backdrop),t(this._backdrop).addClass(d),!e)return;if(!r)return void e();t(this._backdrop).one(k.TRANSITION_END,e).emulateTransitionEnd(150)}else if(!this._isShown&&this._backdrop){t(this._backdrop).removeClass(d);var o=function(){n._removeBackdrop(),e&&e()};k.supportsTransitionEnd()&&t(this._element).hasClass(u)?t(this._backdrop).one(k.TRANSITION_END,o).emulateTransitionEnd(150):o()}else e&&e()},g._adjustDialog=function(){var t=this._element.scrollHeight>document.documentElement.clientHeight;!this._isBodyOverflowing&&t&&(this._element.style.paddingLeft=this._scrollbarWidth+"px"),this._isBodyOverflowing&&!t&&(this._element.style.paddingRight=this._scrollbarWidth+"px")},g._resetAdjustments=function(){this._element.style.paddingLeft="",this._element.style.paddingRight=""},g._checkScrollbar=function(){var t=document.body.getBoundingClientRect();this._isBodyOverflowing=t.left+t.right<window.innerWidth,this._scrollbarWidth=this._getScrollbarWidth()},g._setScrollbar=function(){var e=this;if(this._isBodyOverflowing){t(p.FIXED_CONTENT).each(function(n,i){var r=t(i)[0].style.paddingRight,o=t(i).css("padding-right");t(i).data("padding-right",r).css("padding-right",parseFloat(o)+e._scrollbarWidth+"px")}),t(p.STICKY_CONTENT).each(function(n,i){var r=t(i)[0].style.marginRight,o=t(i).css("margin-right");t(i).data("margin-right",r).css("margin-right",parseFloat(o)-e._scrollbarWidth+"px")}),t(p.NAVBAR_TOGGLER).each(function(n,i){var r=t(i)[0].style.marginRight,o=t(i).css("margin-right");t(i).data("margin-right",r).css("margin-right",parseFloat(o)+e._scrollbarWidth+"px")});var n=document.body.style.paddingRight,i=t("body").css("padding-right");t("body").data("padding-right",n).css("padding-right",parseFloat(i)+this._scrollbarWidth+"px")}},g._resetScrollbar=function(){t(p.FIXED_CONTENT).each(function(e,n){var i=t(n).data("padding-right");"undefined"!=typeof i&&t(n).css("padding-right",i).removeData("padding-right")}),t(p.STICKY_CONTENT+", "+p.NAVBAR_TOGGLER).each(function(e,n){var i=t(n).data("margin-right");"undefined"!=typeof i&&t(n).css("margin-right",i).removeData("margin-right")});var e=t("body").data("padding-right");"undefined"!=typeof e&&t("body").css("padding-right",e).removeData("padding-right")},g._getScrollbarWidth=function(){var t=document.createElement("div");t.className=c,document.body.appendChild(t);var e=t.getBoundingClientRect().width-t.clientWidth;return document.body.removeChild(t),e},o._jQueryInterface=function(n,i){return this.each(function(){var s=t(this).data(e),a=r({},o.Default,t(this).data(),"object"==typeof n&&n);if(s||(s=new o(this,a),t(this).data(e,s)),"string"==typeof n){if("undefined"==typeof s[n])throw new TypeError('No method named "'+n+'"');s[n](i)}else a.show&&s.show(i)})},i(o,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return s}}]),o}();return t(document).on(l.CLICK_DATA_API,p.DATA_TOGGLE,function(n){var i,o=this,s=k.getSelectorFromElement(this);s&&(i=t(s)[0]);var a=t(i).data(e)?"toggle":r({},t(i).data(),t(this).data());"A"!==this.tagName&&"AREA"!==this.tagName||n.preventDefault();var c=t(i).one(l.SHOW,function(e){e.isDefaultPrevented()||c.one(l.HIDDEN,function(){t(o).is(":visible")&&o.focus()})});g._jQueryInterface.call(t(i),a,this)}),t.fn.modal=g._jQueryInterface,t.fn.modal.Constructor=g,t.fn.modal.noConflict=function(){return t.fn.modal=o,g._jQueryInterface},g}(e),Lt=function(t){var e="tooltip",n="bs.tooltip",o="."+n,s=t.fn[e],a=new RegExp("(^|\\s)bs-tooltip\\S+","g"),l={animation:"boolean",template:"string",title:"(string|element|function)",trigger:"string",delay:"(number|object)",html:"boolean",selector:"(string|boolean)",placement:"(string|function)",offset:"(number|string)",container:"(string|element|boolean)",fallbackPlacement:"(string|array)",boundary:"(string|element)"},c={AUTO:"auto",TOP:"top",RIGHT:"right",BOTTOM:"bottom",LEFT:"left"},h={animation:!0,template:'<div class="tooltip" role="tooltip"><div class="arrow"></div><div class="tooltip-inner"></div></div>',trigger:"hover focus",title:"",delay:0,html:!1,selector:!1,placement:"top",offset:0,container:!1,fallbackPlacement:"flip",boundary:"scrollParent"},f="show",u="out",d={HIDE:"hide"+o,HIDDEN:"hidden"+o,SHOW:"show"+o,SHOWN:"shown"+o,INSERTED:"inserted"+o,CLICK:"click"+o,FOCUSIN:"focusin"+o,FOCUSOUT:"focusout"+o,MOUSEENTER:"mouseenter"+o,MOUSELEAVE:"mouseleave"+o},p="fade",g="show",m=".tooltip-inner",_=".arrow",v="hover",E="focus",y="click",b="manual",T=function(){function s(t,e){if("undefined"==typeof Ot)throw new TypeError("Bootstrap tooltips require Popper.js (https://popper.js.org)");this._isEnabled=!0,this._timeout=0,this._hoverState="",this._activeTrigger={},this._popper=null,this.element=t,this.config=this._getConfig(e),this.tip=null,this._setListeners()}var T=s.prototype;return T.enable=function(){this._isEnabled=!0},T.disable=function(){this._isEnabled=!1},T.toggleEnabled=function(){this._isEnabled=!this._isEnabled},T.toggle=function(e){if(this._isEnabled)if(e){var n=this.constructor.DATA_KEY,i=t(e.currentTarget).data(n);i||(i=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(n,i)),i._activeTrigger.click=!i._activeTrigger.click,i._isWithActiveTrigger()?i._enter(null,i):i._leave(null,i)}else{if(t(this.getTipElement()).hasClass(g))return void this._leave(null,this);this._enter(null,this)}},T.dispose=function(){clearTimeout(this._timeout),t.removeData(this.element,this.constructor.DATA_KEY),t(this.element).off(this.constructor.EVENT_KEY),t(this.element).closest(".modal").off("hide.bs.modal"),this.tip&&t(this.tip).remove(),this._isEnabled=null,this._timeout=null,this._hoverState=null,this._activeTrigger=null,null!==this._popper&&this._popper.destroy(),this._popper=null,this.element=null,this.config=null,this.tip=null},T.show=function(){var e=this;if("none"===t(this.element).css("display"))throw new Error("Please use show on visible elements");var n=t.Event(this.constructor.Event.SHOW);if(this.isWithContent()&&this._isEnabled){t(this.element).trigger(n);var i=t.contains(this.element.ownerDocument.documentElement,this.element);if(n.isDefaultPrevented()||!i)return;var r=this.getTipElement(),o=k.getUID(this.constructor.NAME);r.setAttribute("id",o),this.element.setAttribute("aria-describedby",o),this.setContent(),this.config.animation&&t(r).addClass(p);var a="function"==typeof this.config.placement?this.config.placement.call(this,r,this.element):this.config.placement,l=this._getAttachment(a);this.addAttachmentClass(l);var c=!1===this.config.container?document.body:t(this.config.container);t(r).data(this.constructor.DATA_KEY,this),t.contains(this.element.ownerDocument.documentElement,this.tip)||t(r).appendTo(c),t(this.element).trigger(this.constructor.Event.INSERTED),this._popper=new Ot(this.element,r,{placement:l,modifiers:{offset:{offset:this.config.offset},flip:{behavior:this.config.fallbackPlacement},arrow:{element:_},preventOverflow:{boundariesElement:this.config.boundary}},onCreate:function(t){t.originalPlacement!==t.placement&&e._handlePopperPlacementChange(t)},onUpdate:function(t){e._handlePopperPlacementChange(t)}}),t(r).addClass(g),"ontouchstart"in document.documentElement&&t("body").children().on("mouseover",null,t.noop);var h=function(){e.config.animation&&e._fixTransition();var n=e._hoverState;e._hoverState=null,t(e.element).trigger(e.constructor.Event.SHOWN),n===u&&e._leave(null,e)};k.supportsTransitionEnd()&&t(this.tip).hasClass(p)?t(this.tip).one(k.TRANSITION_END,h).emulateTransitionEnd(s._TRANSITION_DURATION):h()}},T.hide=function(e){var n=this,i=this.getTipElement(),r=t.Event(this.constructor.Event.HIDE),o=function(){n._hoverState!==f&&i.parentNode&&i.parentNode.removeChild(i),n._cleanTipClass(),n.element.removeAttribute("aria-describedby"),t(n.element).trigger(n.constructor.Event.HIDDEN),null!==n._popper&&n._popper.destroy(),e&&e()};t(this.element).trigger(r),r.isDefaultPrevented()||(t(i).removeClass(g),"ontouchstart"in document.documentElement&&t("body").children().off("mouseover",null,t.noop),this._activeTrigger[y]=!1,this._activeTrigger[E]=!1,this._activeTrigger[v]=!1,k.supportsTransitionEnd()&&t(this.tip).hasClass(p)?t(i).one(k.TRANSITION_END,o).emulateTransitionEnd(150):o(),this._hoverState="")},T.update=function(){null!==this._popper&&this._popper.scheduleUpdate()},T.isWithContent=function(){return Boolean(this.getTitle())},T.addAttachmentClass=function(e){t(this.getTipElement()).addClass("bs-tooltip-"+e)},T.getTipElement=function(){return this.tip=this.tip||t(this.config.template)[0],this.tip},T.setContent=function(){var e=t(this.getTipElement());this.setElementContent(e.find(m),this.getTitle()),e.removeClass(p+" "+g)},T.setElementContent=function(e,n){var i=this.config.html;"object"==typeof n&&(n.nodeType||n.jquery)?i?t(n).parent().is(e)||e.empty().append(n):e.text(t(n).text()):e[i?"html":"text"](n)},T.getTitle=function(){var t=this.element.getAttribute("data-original-title");return t||(t="function"==typeof this.config.title?this.config.title.call(this.element):this.config.title),t},T._getAttachment=function(t){return c[t.toUpperCase()]},T._setListeners=function(){var e=this;this.config.trigger.split(" ").forEach(function(n){if("click"===n)t(e.element).on(e.constructor.Event.CLICK,e.config.selector,function(t){return e.toggle(t)});else if(n!==b){var i=n===v?e.constructor.Event.MOUSEENTER:e.constructor.Event.FOCUSIN,r=n===v?e.constructor.Event.MOUSELEAVE:e.constructor.Event.FOCUSOUT;t(e.element).on(i,e.config.selector,function(t){return e._enter(t)}).on(r,e.config.selector,function(t){return e._leave(t)})}t(e.element).closest(".modal").on("hide.bs.modal",function(){return e.hide()})}),this.config.selector?this.config=r({},this.config,{trigger:"manual",selector:""}):this._fixTitle()},T._fixTitle=function(){var t=typeof this.element.getAttribute("data-original-title");(this.element.getAttribute("title")||"string"!==t)&&(this.element.setAttribute("data-original-title",this.element.getAttribute("title")||""),this.element.setAttribute("title",""))},T._enter=function(e,n){var i=this.constructor.DATA_KEY;(n=n||t(e.currentTarget).data(i))||(n=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(i,n)),e&&(n._activeTrigger["focusin"===e.type?E:v]=!0),t(n.getTipElement()).hasClass(g)||n._hoverState===f?n._hoverState=f:(clearTimeout(n._timeout),n._hoverState=f,n.config.delay&&n.config.delay.show?n._timeout=setTimeout(function(){n._hoverState===f&&n.show()},n.config.delay.show):n.show())},T._leave=function(e,n){var i=this.constructor.DATA_KEY;(n=n||t(e.currentTarget).data(i))||(n=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(i,n)),e&&(n._activeTrigger["focusout"===e.type?E:v]=!1),n._isWithActiveTrigger()||(clearTimeout(n._timeout),n._hoverState=u,n.config.delay&&n.config.delay.hide?n._timeout=setTimeout(function(){n._hoverState===u&&n.hide()},n.config.delay.hide):n.hide())},T._isWithActiveTrigger=function(){for(var t in this._activeTrigger)if(this._activeTrigger[t])return!0;return!1},T._getConfig=function(n){return"number"==typeof(n=r({},this.constructor.Default,t(this.element).data(),n)).delay&&(n.delay={show:n.delay,hide:n.delay}),"number"==typeof n.title&&(n.title=n.title.toString()),"number"==typeof n.content&&(n.content=n.content.toString()),k.typeCheckConfig(e,n,this.constructor.DefaultType),n},T._getDelegateConfig=function(){var t={};if(this.config)for(var e in this.config)this.constructor.Default[e]!==this.config[e]&&(t[e]=this.config[e]);return t},T._cleanTipClass=function(){var e=t(this.getTipElement()),n=e.attr("class").match(a);null!==n&&n.length>0&&e.removeClass(n.join(""))},T._handlePopperPlacementChange=function(t){this._cleanTipClass(),this.addAttachmentClass(this._getAttachment(t.placement))},T._fixTransition=function(){var e=this.getTipElement(),n=this.config.animation;null===e.getAttribute("x-placement")&&(t(e).removeClass(p),this.config.animation=!1,this.hide(),this.show(),this.config.animation=n)},s._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n),r="object"==typeof e&&e;if((i||!/dispose|hide/.test(e))&&(i||(i=new s(this,r),t(this).data(n,i)),"string"==typeof e)){if("undefined"==typeof i[e])throw new TypeError('No method named "'+e+'"');i[e]()}})},i(s,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return h}},{key:"NAME",get:function(){return e}},{key:"DATA_KEY",get:function(){return n}},{key:"Event",get:function(){return d}},{key:"EVENT_KEY",get:function(){return o}},{key:"DefaultType",get:function(){return l}}]),s}();return t.fn[e]=T._jQueryInterface,t.fn[e].Constructor=T,t.fn[e].noConflict=function(){return t.fn[e]=s,T._jQueryInterface},T}(e),Pt=function(t){var e="popover",n="bs.popover",o="."+n,s=t.fn[e],a=new RegExp("(^|\\s)bs-popover\\S+","g"),l=r({},Lt.Default,{placement:"right",trigger:"click",content:"",template:'<div class="popover" role="tooltip"><div class="arrow"></div><h3 class="popover-header"></h3><div class="popover-body"></div></div>'}),c=r({},Lt.DefaultType,{content:"(string|element|function)"}),h="fade",f="show",u=".popover-header",d=".popover-body",p={HIDE:"hide"+o,HIDDEN:"hidden"+o,SHOW:"show"+o,SHOWN:"shown"+o,INSERTED:"inserted"+o,CLICK:"click"+o,FOCUSIN:"focusin"+o,FOCUSOUT:"focusout"+o,MOUSEENTER:"mouseenter"+o,MOUSELEAVE:"mouseleave"+o},g=function(r){var s,g;function m(){return r.apply(this,arguments)||this}g=r,(s=m).prototype=Object.create(g.prototype),s.prototype.constructor=s,s.__proto__=g;var _=m.prototype;return _.isWithContent=function(){return this.getTitle()||this._getContent()},_.addAttachmentClass=function(e){t(this.getTipElement()).addClass("bs-popover-"+e)},_.getTipElement=function(){return this.tip=this.tip||t(this.config.template)[0],this.tip},_.setContent=function(){var e=t(this.getTipElement());this.setElementContent(e.find(u),this.getTitle());var n=this._getContent();"function"==typeof n&&(n=n.call(this.element)),this.setElementContent(e.find(d),n),e.removeClass(h+" "+f)},_._getContent=function(){return this.element.getAttribute("data-content")||this.config.content},_._cleanTipClass=function(){var e=t(this.getTipElement()),n=e.attr("class").match(a);null!==n&&n.length>0&&e.removeClass(n.join(""))},m._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n),r="object"==typeof e?e:null;if((i||!/destroy|hide/.test(e))&&(i||(i=new m(this,r),t(this).data(n,i)),"string"==typeof e)){if("undefined"==typeof i[e])throw new TypeError('No method named "'+e+'"');i[e]()}})},i(m,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return l}},{key:"NAME",get:function(){return e}},{key:"DATA_KEY",get:function(){return n}},{key:"Event",get:function(){return p}},{key:"EVENT_KEY",get:function(){return o}},{key:"DefaultType",get:function(){return c}}]),m}(Lt);return t.fn[e]=g._jQueryInterface,t.fn[e].Constructor=g,t.fn[e].noConflict=function(){return t.fn[e]=s,g._jQueryInterface},g}(e),xt=function(t){var e="scrollspy",n="bs.scrollspy",o="."+n,s=t.fn[e],a={offset:10,method:"auto",target:""},l={offset:"number",method:"string",target:"(string|element)"},c={ACTIVATE:"activate"+o,SCROLL:"scroll"+o,LOAD_DATA_API:"load"+o+".data-api"},h="dropdown-item",f="active",u={DATA_SPY:'[data-spy="scroll"]',ACTIVE:".active",NAV_LIST_GROUP:".nav, .list-group",NAV_LINKS:".nav-link",NAV_ITEMS:".nav-item",LIST_ITEMS:".list-group-item",DROPDOWN:".dropdown",DROPDOWN_ITEMS:".dropdown-item",DROPDOWN_TOGGLE:".dropdown-toggle"},d="offset",p="position",g=function(){function s(e,n){var i=this;this._element=e,this._scrollElement="BODY"===e.tagName?window:e,this._config=this._getConfig(n),this._selector=this._config.target+" "+u.NAV_LINKS+","+this._config.target+" "+u.LIST_ITEMS+","+this._config.target+" "+u.DROPDOWN_ITEMS,this._offsets=[],this._targets=[],this._activeTarget=null,this._scrollHeight=0,t(this._scrollElement).on(c.SCROLL,function(t){return i._process(t)}),this.refresh(),this._process()}var g=s.prototype;return g.refresh=function(){var e=this,n=this._scrollElement===this._scrollElement.window?d:p,i="auto"===this._config.method?n:this._config.method,r=i===p?this._getScrollTop():0;this._offsets=[],this._targets=[],this._scrollHeight=this._getScrollHeight(),t.makeArray(t(this._selector)).map(function(e){var n,o=k.getSelectorFromElement(e);if(o&&(n=t(o)[0]),n){var s=n.getBoundingClientRect();if(s.width||s.height)return[t(n)[i]().top+r,o]}return null}).filter(function(t){return t}).sort(function(t,e){return t[0]-e[0]}).forEach(function(t){e._offsets.push(t[0]),e._targets.push(t[1])})},g.dispose=function(){t.removeData(this._element,n),t(this._scrollElement).off(o),this._element=null,this._scrollElement=null,this._config=null,this._selector=null,this._offsets=null,this._targets=null,this._activeTarget=null,this._scrollHeight=null},g._getConfig=function(n){if("string"!=typeof(n=r({},a,n)).target){var i=t(n.target).attr("id");i||(i=k.getUID(e),t(n.target).attr("id",i)),n.target="#"+i}return k.typeCheckConfig(e,n,l),n},g._getScrollTop=function(){return this._scrollElement===window?this._scrollElement.pageYOffset:this._scrollElement.scrollTop},g._getScrollHeight=function(){return this._scrollElement.scrollHeight||Math.max(document.body.scrollHeight,document.documentElement.scrollHeight)},g._getOffsetHeight=function(){return this._scrollElement===window?window.innerHeight:this._scrollElement.getBoundingClientRect().height},g._process=function(){var t=this._getScrollTop()+this._config.offset,e=this._getScrollHeight(),n=this._config.offset+e-this._getOffsetHeight();if(this._scrollHeight!==e&&this.refresh(),t>=n){var i=this._targets[this._targets.length-1];this._activeTarget!==i&&this._activate(i)}else{if(this._activeTarget&&t<this._offsets[0]&&this._offsets[0]>0)return this._activeTarget=null,void this._clear();for(var r=this._offsets.length;r--;){this._activeTarget!==this._targets[r]&&t>=this._offsets[r]&&("undefined"==typeof this._offsets[r+1]||t<this._offsets[r+1])&&this._activate(this._targets[r])}}},g._activate=function(e){this._activeTarget=e,this._clear();var n=this._selector.split(",");n=n.map(function(t){return t+'[data-target="'+e+'"],'+t+'[href="'+e+'"]'});var i=t(n.join(","));i.hasClass(h)?(i.closest(u.DROPDOWN).find(u.DROPDOWN_TOGGLE).addClass(f),i.addClass(f)):(i.addClass(f),i.parents(u.NAV_LIST_GROUP).prev(u.NAV_LINKS+", "+u.LIST_ITEMS).addClass(f),i.parents(u.NAV_LIST_GROUP).prev(u.NAV_ITEMS).children(u.NAV_LINKS).addClass(f)),t(this._scrollElement).trigger(c.ACTIVATE,{relatedTarget:e})},g._clear=function(){t(this._selector).filter(u.ACTIVE).removeClass(f)},s._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n);if(i||(i=new s(this,"object"==typeof e&&e),t(this).data(n,i)),"string"==typeof e){if("undefined"==typeof i[e])throw new TypeError('No method named "'+e+'"');i[e]()}})},i(s,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return a}}]),s}();return t(window).on(c.LOAD_DATA_API,function(){for(var e=t.makeArray(t(u.DATA_SPY)),n=e.length;n--;){var i=t(e[n]);g._jQueryInterface.call(i,i.data())}}),t.fn[e]=g._jQueryInterface,t.fn[e].Constructor=g,t.fn[e].noConflict=function(){return t.fn[e]=s,g._jQueryInterface},g}(e),Rt=function(t){var e=".bs.tab",n=t.fn.tab,r={HIDE:"hide"+e,HIDDEN:"hidden"+e,SHOW:"show"+e,SHOWN:"shown"+e,CLICK_DATA_API:"click.bs.tab.data-api"},o="dropdown-menu",s="active",a="disabled",l="fade",c="show",h=".dropdown",f=".nav, .list-group",u=".active",d="> li > .active",p='[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]',g=".dropdown-toggle",m="> .dropdown-menu .active",_=function(){function e(t){this._element=t}var n=e.prototype;return n.show=function(){var e=this;if(!(this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE&&t(this._element).hasClass(s)||t(this._element).hasClass(a))){var n,i,o=t(this._element).closest(f)[0],l=k.getSelectorFromElement(this._element);if(o){var c="UL"===o.nodeName?d:u;i=(i=t.makeArray(t(o).find(c)))[i.length-1]}var h=t.Event(r.HIDE,{relatedTarget:this._element}),p=t.Event(r.SHOW,{relatedTarget:i});if(i&&t(i).trigger(h),t(this._element).trigger(p),!p.isDefaultPrevented()&&!h.isDefaultPrevented()){l&&(n=t(l)[0]),this._activate(this._element,o);var g=function(){var n=t.Event(r.HIDDEN,{relatedTarget:e._element}),o=t.Event(r.SHOWN,{relatedTarget:i});t(i).trigger(n),t(e._element).trigger(o)};n?this._activate(n,n.parentNode,g):g()}}},n.dispose=function(){t.removeData(this._element,"bs.tab"),this._element=null},n._activate=function(e,n,i){var r=this,o=("UL"===n.nodeName?t(n).find(d):t(n).children(u))[0],s=i&&k.supportsTransitionEnd()&&o&&t(o).hasClass(l),a=function(){return r._transitionComplete(e,o,i)};o&&s?t(o).one(k.TRANSITION_END,a).emulateTransitionEnd(150):a()},n._transitionComplete=function(e,n,i){if(n){t(n).removeClass(c+" "+s);var r=t(n.parentNode).find(m)[0];r&&t(r).removeClass(s),"tab"===n.getAttribute("role")&&n.setAttribute("aria-selected",!1)}if(t(e).addClass(s),"tab"===e.getAttribute("role")&&e.setAttribute("aria-selected",!0),k.reflow(e),t(e).addClass(c),e.parentNode&&t(e.parentNode).hasClass(o)){var a=t(e).closest(h)[0];a&&t(a).find(g).addClass(s),e.setAttribute("aria-expanded",!0)}i&&i()},e._jQueryInterface=function(n){return this.each(function(){var i=t(this),r=i.data("bs.tab");if(r||(r=new e(this),i.data("bs.tab",r)),"string"==typeof n){if("undefined"==typeof r[n])throw new TypeError('No method named "'+n+'"');r[n]()}})},i(e,null,[{key:"VERSION",get:function(){return"4.0.0"}}]),e}();return t(document).on(r.CLICK_DATA_API,p,function(e){e.preventDefault(),_._jQueryInterface.call(t(this),"show")}),t.fn.tab=_._jQueryInterface,t.fn.tab.Constructor=_,t.fn.tab.noConflict=function(){return t.fn.tab=n,_._jQueryInterface},_}(e);!function(t){if("undefined"==typeof t)throw new TypeError("Bootstrap's JavaScript requires jQuery. jQuery must be included before Bootstrap's JavaScript.");var e=t.fn.jquery.split(" ")[0].split(".");if(e[0]<2&&e[1]<9||1===e[0]&&9===e[1]&&e[2]<1||e[0]>=4)throw new Error("Bootstrap's JavaScript requires at least jQuery v1.9.1 but less than v4.0.0")}(e),t.Util=k,t.Alert=L,t.Button=P,t.Carousel=x,t.Collapse=R,t.Dropdown=Nt,t.Modal=kt,t.Popover=Pt,t.Scrollspy=xt,t.Tab=Rt,t.Tooltip=Lt,Object.defineProperty(t,"__esModule",{value:!0})}); +//# sourceMappingURL=bootstrap.bundle.min.js.map
\ No newline at end of file diff --git a/chall/src/js/bootstrap.js b/chall/src/js/bootstrap.js new file mode 100644 index 0000000..6d9549d --- /dev/null +++ b/chall/src/js/bootstrap.js @@ -0,0 +1,3894 @@ +/*! + * Bootstrap v4.0.0 (https://getbootstrap.com) + * Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors) + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + */ +(function (global, factory) { + typeof exports === 'object' && typeof module !== 'undefined' ? factory(exports, require('jquery'), require('popper.js')) : + typeof define === 'function' && define.amd ? define(['exports', 'jquery', 'popper.js'], factory) : + (factory((global.bootstrap = {}),global.jQuery,global.Popper)); +}(this, (function (exports,$,Popper) { 'use strict'; + +$ = $ && $.hasOwnProperty('default') ? $['default'] : $; +Popper = Popper && Popper.hasOwnProperty('default') ? Popper['default'] : Popper; + +function _defineProperties(target, props) { + for (var i = 0; i < props.length; i++) { + var descriptor = props[i]; + descriptor.enumerable = descriptor.enumerable || false; + descriptor.configurable = true; + if ("value" in descriptor) descriptor.writable = true; + Object.defineProperty(target, descriptor.key, descriptor); + } +} + +function _createClass(Constructor, protoProps, staticProps) { + if (protoProps) _defineProperties(Constructor.prototype, protoProps); + if (staticProps) _defineProperties(Constructor, staticProps); + return Constructor; +} + +function _extends() { + _extends = Object.assign || function (target) { + for (var i = 1; i < arguments.length; i++) { + var source = arguments[i]; + + for (var key in source) { + if (Object.prototype.hasOwnProperty.call(source, key)) { + target[key] = source[key]; + } + } + } + + return target; + }; + + return _extends.apply(this, arguments); +} + +function _inheritsLoose(subClass, superClass) { + subClass.prototype = Object.create(superClass.prototype); + subClass.prototype.constructor = subClass; + subClass.__proto__ = superClass; +} + +/** + * -------------------------------------------------------------------------- + * Bootstrap (v4.0.0): util.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + +var Util = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Private TransitionEnd Helpers + * ------------------------------------------------------------------------ + */ + var transition = false; + var MAX_UID = 1000000; // Shoutout AngusCroll (https://goo.gl/pxwQGp) + + function toType(obj) { + return {}.toString.call(obj).match(/\s([a-zA-Z]+)/)[1].toLowerCase(); + } + + function getSpecialTransitionEndEvent() { + return { + bindType: transition.end, + delegateType: transition.end, + handle: function handle(event) { + if ($$$1(event.target).is(this)) { + return event.handleObj.handler.apply(this, arguments); // eslint-disable-line prefer-rest-params + } + + return undefined; // eslint-disable-line no-undefined + } + }; + } + + function transitionEndTest() { + if (typeof window !== 'undefined' && window.QUnit) { + return false; + } + + return { + end: 'transitionend' + }; + } + + function transitionEndEmulator(duration) { + var _this = this; + + var called = false; + $$$1(this).one(Util.TRANSITION_END, function () { + called = true; + }); + setTimeout(function () { + if (!called) { + Util.triggerTransitionEnd(_this); + } + }, duration); + return this; + } + + function setTransitionEndSupport() { + transition = transitionEndTest(); + $$$1.fn.emulateTransitionEnd = transitionEndEmulator; + + if (Util.supportsTransitionEnd()) { + $$$1.event.special[Util.TRANSITION_END] = getSpecialTransitionEndEvent(); + } + } + + function escapeId(selector) { + // We escape IDs in case of special selectors (selector = '#myId:something') + // $.escapeSelector does not exist in jQuery < 3 + selector = typeof $$$1.escapeSelector === 'function' ? $$$1.escapeSelector(selector).substr(1) : selector.replace(/(:|\.|\[|\]|,|=|@)/g, '\\$1'); + return selector; + } + /** + * -------------------------------------------------------------------------- + * Public Util Api + * -------------------------------------------------------------------------- + */ + + + var Util = { + TRANSITION_END: 'bsTransitionEnd', + getUID: function getUID(prefix) { + do { + // eslint-disable-next-line no-bitwise + prefix += ~~(Math.random() * MAX_UID); // "~~" acts like a faster Math.floor() here + } while (document.getElementById(prefix)); + + return prefix; + }, + getSelectorFromElement: function getSelectorFromElement(element) { + var selector = element.getAttribute('data-target'); + + if (!selector || selector === '#') { + selector = element.getAttribute('href') || ''; + } // If it's an ID + + + if (selector.charAt(0) === '#') { + selector = escapeId(selector); + } + + try { + var $selector = $$$1(document).find(selector); + return $selector.length > 0 ? selector : null; + } catch (err) { + return null; + } + }, + reflow: function reflow(element) { + return element.offsetHeight; + }, + triggerTransitionEnd: function triggerTransitionEnd(element) { + $$$1(element).trigger(transition.end); + }, + supportsTransitionEnd: function supportsTransitionEnd() { + return Boolean(transition); + }, + isElement: function isElement(obj) { + return (obj[0] || obj).nodeType; + }, + typeCheckConfig: function typeCheckConfig(componentName, config, configTypes) { + for (var property in configTypes) { + if (Object.prototype.hasOwnProperty.call(configTypes, property)) { + var expectedTypes = configTypes[property]; + var value = config[property]; + var valueType = value && Util.isElement(value) ? 'element' : toType(value); + + if (!new RegExp(expectedTypes).test(valueType)) { + throw new Error(componentName.toUpperCase() + ": " + ("Option \"" + property + "\" provided type \"" + valueType + "\" ") + ("but expected type \"" + expectedTypes + "\".")); + } + } + } + } + }; + setTransitionEndSupport(); + return Util; +}($); + +/** + * -------------------------------------------------------------------------- + * Bootstrap (v4.0.0): alert.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + +var Alert = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'alert'; + var VERSION = '4.0.0'; + var DATA_KEY = 'bs.alert'; + var EVENT_KEY = "." + DATA_KEY; + var DATA_API_KEY = '.data-api'; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var TRANSITION_DURATION = 150; + var Selector = { + DISMISS: '[data-dismiss="alert"]' + }; + var Event = { + CLOSE: "close" + EVENT_KEY, + CLOSED: "closed" + EVENT_KEY, + CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY + }; + var ClassName = { + ALERT: 'alert', + FADE: 'fade', + SHOW: 'show' + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Alert = + /*#__PURE__*/ + function () { + function Alert(element) { + this._element = element; + } // Getters + + + var _proto = Alert.prototype; + + // Public + _proto.close = function close(element) { + element = element || this._element; + + var rootElement = this._getRootElement(element); + + var customEvent = this._triggerCloseEvent(rootElement); + + if (customEvent.isDefaultPrevented()) { + return; + } + + this._removeElement(rootElement); + }; + + _proto.dispose = function dispose() { + $$$1.removeData(this._element, DATA_KEY); + this._element = null; + }; // Private + + + _proto._getRootElement = function _getRootElement(element) { + var selector = Util.getSelectorFromElement(element); + var parent = false; + + if (selector) { + parent = $$$1(selector)[0]; + } + + if (!parent) { + parent = $$$1(element).closest("." + ClassName.ALERT)[0]; + } + + return parent; + }; + + _proto._triggerCloseEvent = function _triggerCloseEvent(element) { + var closeEvent = $$$1.Event(Event.CLOSE); + $$$1(element).trigger(closeEvent); + return closeEvent; + }; + + _proto._removeElement = function _removeElement(element) { + var _this = this; + + $$$1(element).removeClass(ClassName.SHOW); + + if (!Util.supportsTransitionEnd() || !$$$1(element).hasClass(ClassName.FADE)) { + this._destroyElement(element); + + return; + } + + $$$1(element).one(Util.TRANSITION_END, function (event) { + return _this._destroyElement(element, event); + }).emulateTransitionEnd(TRANSITION_DURATION); + }; + + _proto._destroyElement = function _destroyElement(element) { + $$$1(element).detach().trigger(Event.CLOSED).remove(); + }; // Static + + + Alert._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var $element = $$$1(this); + var data = $element.data(DATA_KEY); + + if (!data) { + data = new Alert(this); + $element.data(DATA_KEY, data); + } + + if (config === 'close') { + data[config](this); + } + }); + }; + + Alert._handleDismiss = function _handleDismiss(alertInstance) { + return function (event) { + if (event) { + event.preventDefault(); + } + + alertInstance.close(this); + }; + }; + + _createClass(Alert, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }]); + return Alert; + }(); + /** + * ------------------------------------------------------------------------ + * Data Api implementation + * ------------------------------------------------------------------------ + */ + + + $$$1(document).on(Event.CLICK_DATA_API, Selector.DISMISS, Alert._handleDismiss(new Alert())); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + $$$1.fn[NAME] = Alert._jQueryInterface; + $$$1.fn[NAME].Constructor = Alert; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Alert._jQueryInterface; + }; + + return Alert; +}($); + +/** + * -------------------------------------------------------------------------- + * Bootstrap (v4.0.0): button.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + +var Button = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'button'; + var VERSION = '4.0.0'; + var DATA_KEY = 'bs.button'; + var EVENT_KEY = "." + DATA_KEY; + var DATA_API_KEY = '.data-api'; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var ClassName = { + ACTIVE: 'active', + BUTTON: 'btn', + FOCUS: 'focus' + }; + var Selector = { + DATA_TOGGLE_CARROT: '[data-toggle^="button"]', + DATA_TOGGLE: '[data-toggle="buttons"]', + INPUT: 'input', + ACTIVE: '.active', + BUTTON: '.btn' + }; + var Event = { + CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY, + FOCUS_BLUR_DATA_API: "focus" + EVENT_KEY + DATA_API_KEY + " " + ("blur" + EVENT_KEY + DATA_API_KEY) + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Button = + /*#__PURE__*/ + function () { + function Button(element) { + this._element = element; + } // Getters + + + var _proto = Button.prototype; + + // Public + _proto.toggle = function toggle() { + var triggerChangeEvent = true; + var addAriaPressed = true; + var rootElement = $$$1(this._element).closest(Selector.DATA_TOGGLE)[0]; + + if (rootElement) { + var input = $$$1(this._element).find(Selector.INPUT)[0]; + + if (input) { + if (input.type === 'radio') { + if (input.checked && $$$1(this._element).hasClass(ClassName.ACTIVE)) { + triggerChangeEvent = false; + } else { + var activeElement = $$$1(rootElement).find(Selector.ACTIVE)[0]; + + if (activeElement) { + $$$1(activeElement).removeClass(ClassName.ACTIVE); + } + } + } + + if (triggerChangeEvent) { + if (input.hasAttribute('disabled') || rootElement.hasAttribute('disabled') || input.classList.contains('disabled') || rootElement.classList.contains('disabled')) { + return; + } + + input.checked = !$$$1(this._element).hasClass(ClassName.ACTIVE); + $$$1(input).trigger('change'); + } + + input.focus(); + addAriaPressed = false; + } + } + + if (addAriaPressed) { + this._element.setAttribute('aria-pressed', !$$$1(this._element).hasClass(ClassName.ACTIVE)); + } + + if (triggerChangeEvent) { + $$$1(this._element).toggleClass(ClassName.ACTIVE); + } + }; + + _proto.dispose = function dispose() { + $$$1.removeData(this._element, DATA_KEY); + this._element = null; + }; // Static + + + Button._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var data = $$$1(this).data(DATA_KEY); + + if (!data) { + data = new Button(this); + $$$1(this).data(DATA_KEY, data); + } + + if (config === 'toggle') { + data[config](); + } + }); + }; + + _createClass(Button, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }]); + return Button; + }(); + /** + * ------------------------------------------------------------------------ + * Data Api implementation + * ------------------------------------------------------------------------ + */ + + + $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE_CARROT, function (event) { + event.preventDefault(); + var button = event.target; + + if (!$$$1(button).hasClass(ClassName.BUTTON)) { + button = $$$1(button).closest(Selector.BUTTON); + } + + Button._jQueryInterface.call($$$1(button), 'toggle'); + }).on(Event.FOCUS_BLUR_DATA_API, Selector.DATA_TOGGLE_CARROT, function (event) { + var button = $$$1(event.target).closest(Selector.BUTTON)[0]; + $$$1(button).toggleClass(ClassName.FOCUS, /^focus(in)?$/.test(event.type)); + }); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + $$$1.fn[NAME] = Button._jQueryInterface; + $$$1.fn[NAME].Constructor = Button; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Button._jQueryInterface; + }; + + return Button; +}($); + +/** + * -------------------------------------------------------------------------- + * Bootstrap (v4.0.0): carousel.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + +var Carousel = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'carousel'; + var VERSION = '4.0.0'; + var DATA_KEY = 'bs.carousel'; + var EVENT_KEY = "." + DATA_KEY; + var DATA_API_KEY = '.data-api'; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var TRANSITION_DURATION = 600; + var ARROW_LEFT_KEYCODE = 37; // KeyboardEvent.which value for left arrow key + + var ARROW_RIGHT_KEYCODE = 39; // KeyboardEvent.which value for right arrow key + + var TOUCHEVENT_COMPAT_WAIT = 500; // Time for mouse compat events to fire after touch + + var Default = { + interval: 5000, + keyboard: true, + slide: false, + pause: 'hover', + wrap: true + }; + var DefaultType = { + interval: '(number|boolean)', + keyboard: 'boolean', + slide: '(boolean|string)', + pause: '(string|boolean)', + wrap: 'boolean' + }; + var Direction = { + NEXT: 'next', + PREV: 'prev', + LEFT: 'left', + RIGHT: 'right' + }; + var Event = { + SLIDE: "slide" + EVENT_KEY, + SLID: "slid" + EVENT_KEY, + KEYDOWN: "keydown" + EVENT_KEY, + MOUSEENTER: "mouseenter" + EVENT_KEY, + MOUSELEAVE: "mouseleave" + EVENT_KEY, + TOUCHEND: "touchend" + EVENT_KEY, + LOAD_DATA_API: "load" + EVENT_KEY + DATA_API_KEY, + CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY + }; + var ClassName = { + CAROUSEL: 'carousel', + ACTIVE: 'active', + SLIDE: 'slide', + RIGHT: 'carousel-item-right', + LEFT: 'carousel-item-left', + NEXT: 'carousel-item-next', + PREV: 'carousel-item-prev', + ITEM: 'carousel-item' + }; + var Selector = { + ACTIVE: '.active', + ACTIVE_ITEM: '.active.carousel-item', + ITEM: '.carousel-item', + NEXT_PREV: '.carousel-item-next, .carousel-item-prev', + INDICATORS: '.carousel-indicators', + DATA_SLIDE: '[data-slide], [data-slide-to]', + DATA_RIDE: '[data-ride="carousel"]' + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Carousel = + /*#__PURE__*/ + function () { + function Carousel(element, config) { + this._items = null; + this._interval = null; + this._activeElement = null; + this._isPaused = false; + this._isSliding = false; + this.touchTimeout = null; + this._config = this._getConfig(config); + this._element = $$$1(element)[0]; + this._indicatorsElement = $$$1(this._element).find(Selector.INDICATORS)[0]; + + this._addEventListeners(); + } // Getters + + + var _proto = Carousel.prototype; + + // Public + _proto.next = function next() { + if (!this._isSliding) { + this._slide(Direction.NEXT); + } + }; + + _proto.nextWhenVisible = function nextWhenVisible() { + // Don't call next when the page isn't visible + // or the carousel or its parent isn't visible + if (!document.hidden && $$$1(this._element).is(':visible') && $$$1(this._element).css('visibility') !== 'hidden') { + this.next(); + } + }; + + _proto.prev = function prev() { + if (!this._isSliding) { + this._slide(Direction.PREV); + } + }; + + _proto.pause = function pause(event) { + if (!event) { + this._isPaused = true; + } + + if ($$$1(this._element).find(Selector.NEXT_PREV)[0] && Util.supportsTransitionEnd()) { + Util.triggerTransitionEnd(this._element); + this.cycle(true); + } + + clearInterval(this._interval); + this._interval = null; + }; + + _proto.cycle = function cycle(event) { + if (!event) { + this._isPaused = false; + } + + if (this._interval) { + clearInterval(this._interval); + this._interval = null; + } + + if (this._config.interval && !this._isPaused) { + this._interval = setInterval((document.visibilityState ? this.nextWhenVisible : this.next).bind(this), this._config.interval); + } + }; + + _proto.to = function to(index) { + var _this = this; + + this._activeElement = $$$1(this._element).find(Selector.ACTIVE_ITEM)[0]; + + var activeIndex = this._getItemIndex(this._activeElement); + + if (index > this._items.length - 1 || index < 0) { + return; + } + + if (this._isSliding) { + $$$1(this._element).one(Event.SLID, function () { + return _this.to(index); + }); + return; + } + + if (activeIndex === index) { + this.pause(); + this.cycle(); + return; + } + + var direction = index > activeIndex ? Direction.NEXT : Direction.PREV; + + this._slide(direction, this._items[index]); + }; + + _proto.dispose = function dispose() { + $$$1(this._element).off(EVENT_KEY); + $$$1.removeData(this._element, DATA_KEY); + this._items = null; + this._config = null; + this._element = null; + this._interval = null; + this._isPaused = null; + this._isSliding = null; + this._activeElement = null; + this._indicatorsElement = null; + }; // Private + + + _proto._getConfig = function _getConfig(config) { + config = _extends({}, Default, config); + Util.typeCheckConfig(NAME, config, DefaultType); + return config; + }; + + _proto._addEventListeners = function _addEventListeners() { + var _this2 = this; + + if (this._config.keyboard) { + $$$1(this._element).on(Event.KEYDOWN, function (event) { + return _this2._keydown(event); + }); + } + + if (this._config.pause === 'hover') { + $$$1(this._element).on(Event.MOUSEENTER, function (event) { + return _this2.pause(event); + }).on(Event.MOUSELEAVE, function (event) { + return _this2.cycle(event); + }); + + if ('ontouchstart' in document.documentElement) { + // If it's a touch-enabled device, mouseenter/leave are fired as + // part of the mouse compatibility events on first tap - the carousel + // would stop cycling until user tapped out of it; + // here, we listen for touchend, explicitly pause the carousel + // (as if it's the second time we tap on it, mouseenter compat event + // is NOT fired) and after a timeout (to allow for mouse compatibility + // events to fire) we explicitly restart cycling + $$$1(this._element).on(Event.TOUCHEND, function () { + _this2.pause(); + + if (_this2.touchTimeout) { + clearTimeout(_this2.touchTimeout); + } + + _this2.touchTimeout = setTimeout(function (event) { + return _this2.cycle(event); + }, TOUCHEVENT_COMPAT_WAIT + _this2._config.interval); + }); + } + } + }; + + _proto._keydown = function _keydown(event) { + if (/input|textarea/i.test(event.target.tagName)) { + return; + } + + switch (event.which) { + case ARROW_LEFT_KEYCODE: + event.preventDefault(); + this.prev(); + break; + + case ARROW_RIGHT_KEYCODE: + event.preventDefault(); + this.next(); + break; + + default: + } + }; + + _proto._getItemIndex = function _getItemIndex(element) { + this._items = $$$1.makeArray($$$1(element).parent().find(Selector.ITEM)); + return this._items.indexOf(element); + }; + + _proto._getItemByDirection = function _getItemByDirection(direction, activeElement) { + var isNextDirection = direction === Direction.NEXT; + var isPrevDirection = direction === Direction.PREV; + + var activeIndex = this._getItemIndex(activeElement); + + var lastItemIndex = this._items.length - 1; + var isGoingToWrap = isPrevDirection && activeIndex === 0 || isNextDirection && activeIndex === lastItemIndex; + + if (isGoingToWrap && !this._config.wrap) { + return activeElement; + } + + var delta = direction === Direction.PREV ? -1 : 1; + var itemIndex = (activeIndex + delta) % this._items.length; + return itemIndex === -1 ? this._items[this._items.length - 1] : this._items[itemIndex]; + }; + + _proto._triggerSlideEvent = function _triggerSlideEvent(relatedTarget, eventDirectionName) { + var targetIndex = this._getItemIndex(relatedTarget); + + var fromIndex = this._getItemIndex($$$1(this._element).find(Selector.ACTIVE_ITEM)[0]); + + var slideEvent = $$$1.Event(Event.SLIDE, { + relatedTarget: relatedTarget, + direction: eventDirectionName, + from: fromIndex, + to: targetIndex + }); + $$$1(this._element).trigger(slideEvent); + return slideEvent; + }; + + _proto._setActiveIndicatorElement = function _setActiveIndicatorElement(element) { + if (this._indicatorsElement) { + $$$1(this._indicatorsElement).find(Selector.ACTIVE).removeClass(ClassName.ACTIVE); + + var nextIndicator = this._indicatorsElement.children[this._getItemIndex(element)]; + + if (nextIndicator) { + $$$1(nextIndicator).addClass(ClassName.ACTIVE); + } + } + }; + + _proto._slide = function _slide(direction, element) { + var _this3 = this; + + var activeElement = $$$1(this._element).find(Selector.ACTIVE_ITEM)[0]; + + var activeElementIndex = this._getItemIndex(activeElement); + + var nextElement = element || activeElement && this._getItemByDirection(direction, activeElement); + + var nextElementIndex = this._getItemIndex(nextElement); + + var isCycling = Boolean(this._interval); + var directionalClassName; + var orderClassName; + var eventDirectionName; + + if (direction === Direction.NEXT) { + directionalClassName = ClassName.LEFT; + orderClassName = ClassName.NEXT; + eventDirectionName = Direction.LEFT; + } else { + directionalClassName = ClassName.RIGHT; + orderClassName = ClassName.PREV; + eventDirectionName = Direction.RIGHT; + } + + if (nextElement && $$$1(nextElement).hasClass(ClassName.ACTIVE)) { + this._isSliding = false; + return; + } + + var slideEvent = this._triggerSlideEvent(nextElement, eventDirectionName); + + if (slideEvent.isDefaultPrevented()) { + return; + } + + if (!activeElement || !nextElement) { + // Some weirdness is happening, so we bail + return; + } + + this._isSliding = true; + + if (isCycling) { + this.pause(); + } + + this._setActiveIndicatorElement(nextElement); + + var slidEvent = $$$1.Event(Event.SLID, { + relatedTarget: nextElement, + direction: eventDirectionName, + from: activeElementIndex, + to: nextElementIndex + }); + + if (Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.SLIDE)) { + $$$1(nextElement).addClass(orderClassName); + Util.reflow(nextElement); + $$$1(activeElement).addClass(directionalClassName); + $$$1(nextElement).addClass(directionalClassName); + $$$1(activeElement).one(Util.TRANSITION_END, function () { + $$$1(nextElement).removeClass(directionalClassName + " " + orderClassName).addClass(ClassName.ACTIVE); + $$$1(activeElement).removeClass(ClassName.ACTIVE + " " + orderClassName + " " + directionalClassName); + _this3._isSliding = false; + setTimeout(function () { + return $$$1(_this3._element).trigger(slidEvent); + }, 0); + }).emulateTransitionEnd(TRANSITION_DURATION); + } else { + $$$1(activeElement).removeClass(ClassName.ACTIVE); + $$$1(nextElement).addClass(ClassName.ACTIVE); + this._isSliding = false; + $$$1(this._element).trigger(slidEvent); + } + + if (isCycling) { + this.cycle(); + } + }; // Static + + + Carousel._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var data = $$$1(this).data(DATA_KEY); + + var _config = _extends({}, Default, $$$1(this).data()); + + if (typeof config === 'object') { + _config = _extends({}, _config, config); + } + + var action = typeof config === 'string' ? config : _config.slide; + + if (!data) { + data = new Carousel(this, _config); + $$$1(this).data(DATA_KEY, data); + } + + if (typeof config === 'number') { + data.to(config); + } else if (typeof action === 'string') { + if (typeof data[action] === 'undefined') { + throw new TypeError("No method named \"" + action + "\""); + } + + data[action](); + } else if (_config.interval) { + data.pause(); + data.cycle(); + } + }); + }; + + Carousel._dataApiClickHandler = function _dataApiClickHandler(event) { + var selector = Util.getSelectorFromElement(this); + + if (!selector) { + return; + } + + var target = $$$1(selector)[0]; + + if (!target || !$$$1(target).hasClass(ClassName.CAROUSEL)) { + return; + } + + var config = _extends({}, $$$1(target).data(), $$$1(this).data()); + var slideIndex = this.getAttribute('data-slide-to'); + + if (slideIndex) { + config.interval = false; + } + + Carousel._jQueryInterface.call($$$1(target), config); + + if (slideIndex) { + $$$1(target).data(DATA_KEY).to(slideIndex); + } + + event.preventDefault(); + }; + + _createClass(Carousel, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }, { + key: "Default", + get: function get() { + return Default; + } + }]); + return Carousel; + }(); + /** + * ------------------------------------------------------------------------ + * Data Api implementation + * ------------------------------------------------------------------------ + */ + + + $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_SLIDE, Carousel._dataApiClickHandler); + $$$1(window).on(Event.LOAD_DATA_API, function () { + $$$1(Selector.DATA_RIDE).each(function () { + var $carousel = $$$1(this); + + Carousel._jQueryInterface.call($carousel, $carousel.data()); + }); + }); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + $$$1.fn[NAME] = Carousel._jQueryInterface; + $$$1.fn[NAME].Constructor = Carousel; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Carousel._jQueryInterface; + }; + + return Carousel; +}($); + +/** + * -------------------------------------------------------------------------- + * Bootstrap (v4.0.0): collapse.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + +var Collapse = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'collapse'; + var VERSION = '4.0.0'; + var DATA_KEY = 'bs.collapse'; + var EVENT_KEY = "." + DATA_KEY; + var DATA_API_KEY = '.data-api'; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var TRANSITION_DURATION = 600; + var Default = { + toggle: true, + parent: '' + }; + var DefaultType = { + toggle: 'boolean', + parent: '(string|element)' + }; + var Event = { + SHOW: "show" + EVENT_KEY, + SHOWN: "shown" + EVENT_KEY, + HIDE: "hide" + EVENT_KEY, + HIDDEN: "hidden" + EVENT_KEY, + CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY + }; + var ClassName = { + SHOW: 'show', + COLLAPSE: 'collapse', + COLLAPSING: 'collapsing', + COLLAPSED: 'collapsed' + }; + var Dimension = { + WIDTH: 'width', + HEIGHT: 'height' + }; + var Selector = { + ACTIVES: '.show, .collapsing', + DATA_TOGGLE: '[data-toggle="collapse"]' + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Collapse = + /*#__PURE__*/ + function () { + function Collapse(element, config) { + this._isTransitioning = false; + this._element = element; + this._config = this._getConfig(config); + this._triggerArray = $$$1.makeArray($$$1("[data-toggle=\"collapse\"][href=\"#" + element.id + "\"]," + ("[data-toggle=\"collapse\"][data-target=\"#" + element.id + "\"]"))); + var tabToggles = $$$1(Selector.DATA_TOGGLE); + + for (var i = 0; i < tabToggles.length; i++) { + var elem = tabToggles[i]; + var selector = Util.getSelectorFromElement(elem); + + if (selector !== null && $$$1(selector).filter(element).length > 0) { + this._selector = selector; + + this._triggerArray.push(elem); + } + } + + this._parent = this._config.parent ? this._getParent() : null; + + if (!this._config.parent) { + this._addAriaAndCollapsedClass(this._element, this._triggerArray); + } + + if (this._config.toggle) { + this.toggle(); + } + } // Getters + + + var _proto = Collapse.prototype; + + // Public + _proto.toggle = function toggle() { + if ($$$1(this._element).hasClass(ClassName.SHOW)) { + this.hide(); + } else { + this.show(); + } + }; + + _proto.show = function show() { + var _this = this; + + if (this._isTransitioning || $$$1(this._element).hasClass(ClassName.SHOW)) { + return; + } + + var actives; + var activesData; + + if (this._parent) { + actives = $$$1.makeArray($$$1(this._parent).find(Selector.ACTIVES).filter("[data-parent=\"" + this._config.parent + "\"]")); + + if (actives.length === 0) { + actives = null; + } + } + + if (actives) { + activesData = $$$1(actives).not(this._selector).data(DATA_KEY); + + if (activesData && activesData._isTransitioning) { + return; + } + } + + var startEvent = $$$1.Event(Event.SHOW); + $$$1(this._element).trigger(startEvent); + + if (startEvent.isDefaultPrevented()) { + return; + } + + if (actives) { + Collapse._jQueryInterface.call($$$1(actives).not(this._selector), 'hide'); + + if (!activesData) { + $$$1(actives).data(DATA_KEY, null); + } + } + + var dimension = this._getDimension(); + + $$$1(this._element).removeClass(ClassName.COLLAPSE).addClass(ClassName.COLLAPSING); + this._element.style[dimension] = 0; + + if (this._triggerArray.length > 0) { + $$$1(this._triggerArray).removeClass(ClassName.COLLAPSED).attr('aria-expanded', true); + } + + this.setTransitioning(true); + + var complete = function complete() { + $$$1(_this._element).removeClass(ClassName.COLLAPSING).addClass(ClassName.COLLAPSE).addClass(ClassName.SHOW); + _this._element.style[dimension] = ''; + + _this.setTransitioning(false); + + $$$1(_this._element).trigger(Event.SHOWN); + }; + + if (!Util.supportsTransitionEnd()) { + complete(); + return; + } + + var capitalizedDimension = dimension[0].toUpperCase() + dimension.slice(1); + var scrollSize = "scroll" + capitalizedDimension; + $$$1(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(TRANSITION_DURATION); + this._element.style[dimension] = this._element[scrollSize] + "px"; + }; + + _proto.hide = function hide() { + var _this2 = this; + + if (this._isTransitioning || !$$$1(this._element).hasClass(ClassName.SHOW)) { + return; + } + + var startEvent = $$$1.Event(Event.HIDE); + $$$1(this._element).trigger(startEvent); + + if (startEvent.isDefaultPrevented()) { + return; + } + + var dimension = this._getDimension(); + + this._element.style[dimension] = this._element.getBoundingClientRect()[dimension] + "px"; + Util.reflow(this._element); + $$$1(this._element).addClass(ClassName.COLLAPSING).removeClass(ClassName.COLLAPSE).removeClass(ClassName.SHOW); + + if (this._triggerArray.length > 0) { + for (var i = 0; i < this._triggerArray.length; i++) { + var trigger = this._triggerArray[i]; + var selector = Util.getSelectorFromElement(trigger); + + if (selector !== null) { + var $elem = $$$1(selector); + + if (!$elem.hasClass(ClassName.SHOW)) { + $$$1(trigger).addClass(ClassName.COLLAPSED).attr('aria-expanded', false); + } + } + } + } + + this.setTransitioning(true); + + var complete = function complete() { + _this2.setTransitioning(false); + + $$$1(_this2._element).removeClass(ClassName.COLLAPSING).addClass(ClassName.COLLAPSE).trigger(Event.HIDDEN); + }; + + this._element.style[dimension] = ''; + + if (!Util.supportsTransitionEnd()) { + complete(); + return; + } + + $$$1(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(TRANSITION_DURATION); + }; + + _proto.setTransitioning = function setTransitioning(isTransitioning) { + this._isTransitioning = isTransitioning; + }; + + _proto.dispose = function dispose() { + $$$1.removeData(this._element, DATA_KEY); + this._config = null; + this._parent = null; + this._element = null; + this._triggerArray = null; + this._isTransitioning = null; + }; // Private + + + _proto._getConfig = function _getConfig(config) { + config = _extends({}, Default, config); + config.toggle = Boolean(config.toggle); // Coerce string values + + Util.typeCheckConfig(NAME, config, DefaultType); + return config; + }; + + _proto._getDimension = function _getDimension() { + var hasWidth = $$$1(this._element).hasClass(Dimension.WIDTH); + return hasWidth ? Dimension.WIDTH : Dimension.HEIGHT; + }; + + _proto._getParent = function _getParent() { + var _this3 = this; + + var parent = null; + + if (Util.isElement(this._config.parent)) { + parent = this._config.parent; // It's a jQuery object + + if (typeof this._config.parent.jquery !== 'undefined') { + parent = this._config.parent[0]; + } + } else { + parent = $$$1(this._config.parent)[0]; + } + + var selector = "[data-toggle=\"collapse\"][data-parent=\"" + this._config.parent + "\"]"; + $$$1(parent).find(selector).each(function (i, element) { + _this3._addAriaAndCollapsedClass(Collapse._getTargetFromElement(element), [element]); + }); + return parent; + }; + + _proto._addAriaAndCollapsedClass = function _addAriaAndCollapsedClass(element, triggerArray) { + if (element) { + var isOpen = $$$1(element).hasClass(ClassName.SHOW); + + if (triggerArray.length > 0) { + $$$1(triggerArray).toggleClass(ClassName.COLLAPSED, !isOpen).attr('aria-expanded', isOpen); + } + } + }; // Static + + + Collapse._getTargetFromElement = function _getTargetFromElement(element) { + var selector = Util.getSelectorFromElement(element); + return selector ? $$$1(selector)[0] : null; + }; + + Collapse._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var $this = $$$1(this); + var data = $this.data(DATA_KEY); + + var _config = _extends({}, Default, $this.data(), typeof config === 'object' && config); + + if (!data && _config.toggle && /show|hide/.test(config)) { + _config.toggle = false; + } + + if (!data) { + data = new Collapse(this, _config); + $this.data(DATA_KEY, data); + } + + if (typeof config === 'string') { + if (typeof data[config] === 'undefined') { + throw new TypeError("No method named \"" + config + "\""); + } + + data[config](); + } + }); + }; + + _createClass(Collapse, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }, { + key: "Default", + get: function get() { + return Default; + } + }]); + return Collapse; + }(); + /** + * ------------------------------------------------------------------------ + * Data Api implementation + * ------------------------------------------------------------------------ + */ + + + $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) { + // preventDefault only for <a> elements (which change the URL) not inside the collapsible element + if (event.currentTarget.tagName === 'A') { + event.preventDefault(); + } + + var $trigger = $$$1(this); + var selector = Util.getSelectorFromElement(this); + $$$1(selector).each(function () { + var $target = $$$1(this); + var data = $target.data(DATA_KEY); + var config = data ? 'toggle' : $trigger.data(); + + Collapse._jQueryInterface.call($target, config); + }); + }); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + $$$1.fn[NAME] = Collapse._jQueryInterface; + $$$1.fn[NAME].Constructor = Collapse; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Collapse._jQueryInterface; + }; + + return Collapse; +}($); + +/** + * -------------------------------------------------------------------------- + * Bootstrap (v4.0.0): dropdown.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + +var Dropdown = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'dropdown'; + var VERSION = '4.0.0'; + var DATA_KEY = 'bs.dropdown'; + var EVENT_KEY = "." + DATA_KEY; + var DATA_API_KEY = '.data-api'; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var ESCAPE_KEYCODE = 27; // KeyboardEvent.which value for Escape (Esc) key + + var SPACE_KEYCODE = 32; // KeyboardEvent.which value for space key + + var TAB_KEYCODE = 9; // KeyboardEvent.which value for tab key + + var ARROW_UP_KEYCODE = 38; // KeyboardEvent.which value for up arrow key + + var ARROW_DOWN_KEYCODE = 40; // KeyboardEvent.which value for down arrow key + + var RIGHT_MOUSE_BUTTON_WHICH = 3; // MouseEvent.which value for the right button (assuming a right-handed mouse) + + var REGEXP_KEYDOWN = new RegExp(ARROW_UP_KEYCODE + "|" + ARROW_DOWN_KEYCODE + "|" + ESCAPE_KEYCODE); + var Event = { + HIDE: "hide" + EVENT_KEY, + HIDDEN: "hidden" + EVENT_KEY, + SHOW: "show" + EVENT_KEY, + SHOWN: "shown" + EVENT_KEY, + CLICK: "click" + EVENT_KEY, + CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY, + KEYDOWN_DATA_API: "keydown" + EVENT_KEY + DATA_API_KEY, + KEYUP_DATA_API: "keyup" + EVENT_KEY + DATA_API_KEY + }; + var ClassName = { + DISABLED: 'disabled', + SHOW: 'show', + DROPUP: 'dropup', + DROPRIGHT: 'dropright', + DROPLEFT: 'dropleft', + MENURIGHT: 'dropdown-menu-right', + MENULEFT: 'dropdown-menu-left', + POSITION_STATIC: 'position-static' + }; + var Selector = { + DATA_TOGGLE: '[data-toggle="dropdown"]', + FORM_CHILD: '.dropdown form', + MENU: '.dropdown-menu', + NAVBAR_NAV: '.navbar-nav', + VISIBLE_ITEMS: '.dropdown-menu .dropdown-item:not(.disabled)' + }; + var AttachmentMap = { + TOP: 'top-start', + TOPEND: 'top-end', + BOTTOM: 'bottom-start', + BOTTOMEND: 'bottom-end', + RIGHT: 'right-start', + RIGHTEND: 'right-end', + LEFT: 'left-start', + LEFTEND: 'left-end' + }; + var Default = { + offset: 0, + flip: true, + boundary: 'scrollParent' + }; + var DefaultType = { + offset: '(number|string|function)', + flip: 'boolean', + boundary: '(string|element)' + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Dropdown = + /*#__PURE__*/ + function () { + function Dropdown(element, config) { + this._element = element; + this._popper = null; + this._config = this._getConfig(config); + this._menu = this._getMenuElement(); + this._inNavbar = this._detectNavbar(); + + this._addEventListeners(); + } // Getters + + + var _proto = Dropdown.prototype; + + // Public + _proto.toggle = function toggle() { + if (this._element.disabled || $$$1(this._element).hasClass(ClassName.DISABLED)) { + return; + } + + var parent = Dropdown._getParentFromElement(this._element); + + var isActive = $$$1(this._menu).hasClass(ClassName.SHOW); + + Dropdown._clearMenus(); + + if (isActive) { + return; + } + + var relatedTarget = { + relatedTarget: this._element + }; + var showEvent = $$$1.Event(Event.SHOW, relatedTarget); + $$$1(parent).trigger(showEvent); + + if (showEvent.isDefaultPrevented()) { + return; + } // Disable totally Popper.js for Dropdown in Navbar + + + if (!this._inNavbar) { + /** + * Check for Popper dependency + * Popper - https://popper.js.org + */ + if (typeof Popper === 'undefined') { + throw new TypeError('Bootstrap dropdown require Popper.js (https://popper.js.org)'); + } + + var element = this._element; // For dropup with alignment we use the parent as popper container + + if ($$$1(parent).hasClass(ClassName.DROPUP)) { + if ($$$1(this._menu).hasClass(ClassName.MENULEFT) || $$$1(this._menu).hasClass(ClassName.MENURIGHT)) { + element = parent; + } + } // If boundary is not `scrollParent`, then set position to `static` + // to allow the menu to "escape" the scroll parent's boundaries + // https://github.com/twbs/bootstrap/issues/24251 + + + if (this._config.boundary !== 'scrollParent') { + $$$1(parent).addClass(ClassName.POSITION_STATIC); + } + + this._popper = new Popper(element, this._menu, this._getPopperConfig()); + } // If this is a touch-enabled device we add extra + // empty mouseover listeners to the body's immediate children; + // only needed because of broken event delegation on iOS + // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html + + + if ('ontouchstart' in document.documentElement && $$$1(parent).closest(Selector.NAVBAR_NAV).length === 0) { + $$$1('body').children().on('mouseover', null, $$$1.noop); + } + + this._element.focus(); + + this._element.setAttribute('aria-expanded', true); + + $$$1(this._menu).toggleClass(ClassName.SHOW); + $$$1(parent).toggleClass(ClassName.SHOW).trigger($$$1.Event(Event.SHOWN, relatedTarget)); + }; + + _proto.dispose = function dispose() { + $$$1.removeData(this._element, DATA_KEY); + $$$1(this._element).off(EVENT_KEY); + this._element = null; + this._menu = null; + + if (this._popper !== null) { + this._popper.destroy(); + + this._popper = null; + } + }; + + _proto.update = function update() { + this._inNavbar = this._detectNavbar(); + + if (this._popper !== null) { + this._popper.scheduleUpdate(); + } + }; // Private + + + _proto._addEventListeners = function _addEventListeners() { + var _this = this; + + $$$1(this._element).on(Event.CLICK, function (event) { + event.preventDefault(); + event.stopPropagation(); + + _this.toggle(); + }); + }; + + _proto._getConfig = function _getConfig(config) { + config = _extends({}, this.constructor.Default, $$$1(this._element).data(), config); + Util.typeCheckConfig(NAME, config, this.constructor.DefaultType); + return config; + }; + + _proto._getMenuElement = function _getMenuElement() { + if (!this._menu) { + var parent = Dropdown._getParentFromElement(this._element); + + this._menu = $$$1(parent).find(Selector.MENU)[0]; + } + + return this._menu; + }; + + _proto._getPlacement = function _getPlacement() { + var $parentDropdown = $$$1(this._element).parent(); + var placement = AttachmentMap.BOTTOM; // Handle dropup + + if ($parentDropdown.hasClass(ClassName.DROPUP)) { + placement = AttachmentMap.TOP; + + if ($$$1(this._menu).hasClass(ClassName.MENURIGHT)) { + placement = AttachmentMap.TOPEND; + } + } else if ($parentDropdown.hasClass(ClassName.DROPRIGHT)) { + placement = AttachmentMap.RIGHT; + } else if ($parentDropdown.hasClass(ClassName.DROPLEFT)) { + placement = AttachmentMap.LEFT; + } else if ($$$1(this._menu).hasClass(ClassName.MENURIGHT)) { + placement = AttachmentMap.BOTTOMEND; + } + + return placement; + }; + + _proto._detectNavbar = function _detectNavbar() { + return $$$1(this._element).closest('.navbar').length > 0; + }; + + _proto._getPopperConfig = function _getPopperConfig() { + var _this2 = this; + + var offsetConf = {}; + + if (typeof this._config.offset === 'function') { + offsetConf.fn = function (data) { + data.offsets = _extends({}, data.offsets, _this2._config.offset(data.offsets) || {}); + return data; + }; + } else { + offsetConf.offset = this._config.offset; + } + + var popperConfig = { + placement: this._getPlacement(), + modifiers: { + offset: offsetConf, + flip: { + enabled: this._config.flip + }, + preventOverflow: { + boundariesElement: this._config.boundary + } + } + }; + return popperConfig; + }; // Static + + + Dropdown._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var data = $$$1(this).data(DATA_KEY); + + var _config = typeof config === 'object' ? config : null; + + if (!data) { + data = new Dropdown(this, _config); + $$$1(this).data(DATA_KEY, data); + } + + if (typeof config === 'string') { + if (typeof data[config] === 'undefined') { + throw new TypeError("No method named \"" + config + "\""); + } + + data[config](); + } + }); + }; + + Dropdown._clearMenus = function _clearMenus(event) { + if (event && (event.which === RIGHT_MOUSE_BUTTON_WHICH || event.type === 'keyup' && event.which !== TAB_KEYCODE)) { + return; + } + + var toggles = $$$1.makeArray($$$1(Selector.DATA_TOGGLE)); + + for (var i = 0; i < toggles.length; i++) { + var parent = Dropdown._getParentFromElement(toggles[i]); + + var context = $$$1(toggles[i]).data(DATA_KEY); + var relatedTarget = { + relatedTarget: toggles[i] + }; + + if (!context) { + continue; + } + + var dropdownMenu = context._menu; + + if (!$$$1(parent).hasClass(ClassName.SHOW)) { + continue; + } + + if (event && (event.type === 'click' && /input|textarea/i.test(event.target.tagName) || event.type === 'keyup' && event.which === TAB_KEYCODE) && $$$1.contains(parent, event.target)) { + continue; + } + + var hideEvent = $$$1.Event(Event.HIDE, relatedTarget); + $$$1(parent).trigger(hideEvent); + + if (hideEvent.isDefaultPrevented()) { + continue; + } // If this is a touch-enabled device we remove the extra + // empty mouseover listeners we added for iOS support + + + if ('ontouchstart' in document.documentElement) { + $$$1('body').children().off('mouseover', null, $$$1.noop); + } + + toggles[i].setAttribute('aria-expanded', 'false'); + $$$1(dropdownMenu).removeClass(ClassName.SHOW); + $$$1(parent).removeClass(ClassName.SHOW).trigger($$$1.Event(Event.HIDDEN, relatedTarget)); + } + }; + + Dropdown._getParentFromElement = function _getParentFromElement(element) { + var parent; + var selector = Util.getSelectorFromElement(element); + + if (selector) { + parent = $$$1(selector)[0]; + } + + return parent || element.parentNode; + }; // eslint-disable-next-line complexity + + + Dropdown._dataApiKeydownHandler = function _dataApiKeydownHandler(event) { + // If not input/textarea: + // - And not a key in REGEXP_KEYDOWN => not a dropdown command + // If input/textarea: + // - If space key => not a dropdown command + // - If key is other than escape + // - If key is not up or down => not a dropdown command + // - If trigger inside the menu => not a dropdown command + if (/input|textarea/i.test(event.target.tagName) ? event.which === SPACE_KEYCODE || event.which !== ESCAPE_KEYCODE && (event.which !== ARROW_DOWN_KEYCODE && event.which !== ARROW_UP_KEYCODE || $$$1(event.target).closest(Selector.MENU).length) : !REGEXP_KEYDOWN.test(event.which)) { + return; + } + + event.preventDefault(); + event.stopPropagation(); + + if (this.disabled || $$$1(this).hasClass(ClassName.DISABLED)) { + return; + } + + var parent = Dropdown._getParentFromElement(this); + + var isActive = $$$1(parent).hasClass(ClassName.SHOW); + + if (!isActive && (event.which !== ESCAPE_KEYCODE || event.which !== SPACE_KEYCODE) || isActive && (event.which === ESCAPE_KEYCODE || event.which === SPACE_KEYCODE)) { + if (event.which === ESCAPE_KEYCODE) { + var toggle = $$$1(parent).find(Selector.DATA_TOGGLE)[0]; + $$$1(toggle).trigger('focus'); + } + + $$$1(this).trigger('click'); + return; + } + + var items = $$$1(parent).find(Selector.VISIBLE_ITEMS).get(); + + if (items.length === 0) { + return; + } + + var index = items.indexOf(event.target); + + if (event.which === ARROW_UP_KEYCODE && index > 0) { + // Up + index--; + } + + if (event.which === ARROW_DOWN_KEYCODE && index < items.length - 1) { + // Down + index++; + } + + if (index < 0) { + index = 0; + } + + items[index].focus(); + }; + + _createClass(Dropdown, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }, { + key: "Default", + get: function get() { + return Default; + } + }, { + key: "DefaultType", + get: function get() { + return DefaultType; + } + }]); + return Dropdown; + }(); + /** + * ------------------------------------------------------------------------ + * Data Api implementation + * ------------------------------------------------------------------------ + */ + + + $$$1(document).on(Event.KEYDOWN_DATA_API, Selector.DATA_TOGGLE, Dropdown._dataApiKeydownHandler).on(Event.KEYDOWN_DATA_API, Selector.MENU, Dropdown._dataApiKeydownHandler).on(Event.CLICK_DATA_API + " " + Event.KEYUP_DATA_API, Dropdown._clearMenus).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) { + event.preventDefault(); + event.stopPropagation(); + + Dropdown._jQueryInterface.call($$$1(this), 'toggle'); + }).on(Event.CLICK_DATA_API, Selector.FORM_CHILD, function (e) { + e.stopPropagation(); + }); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + $$$1.fn[NAME] = Dropdown._jQueryInterface; + $$$1.fn[NAME].Constructor = Dropdown; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Dropdown._jQueryInterface; + }; + + return Dropdown; +}($, Popper); + +/** + * -------------------------------------------------------------------------- + * Bootstrap (v4.0.0): modal.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + +var Modal = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'modal'; + var VERSION = '4.0.0'; + var DATA_KEY = 'bs.modal'; + var EVENT_KEY = "." + DATA_KEY; + var DATA_API_KEY = '.data-api'; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var TRANSITION_DURATION = 300; + var BACKDROP_TRANSITION_DURATION = 150; + var ESCAPE_KEYCODE = 27; // KeyboardEvent.which value for Escape (Esc) key + + var Default = { + backdrop: true, + keyboard: true, + focus: true, + show: true + }; + var DefaultType = { + backdrop: '(boolean|string)', + keyboard: 'boolean', + focus: 'boolean', + show: 'boolean' + }; + var Event = { + HIDE: "hide" + EVENT_KEY, + HIDDEN: "hidden" + EVENT_KEY, + SHOW: "show" + EVENT_KEY, + SHOWN: "shown" + EVENT_KEY, + FOCUSIN: "focusin" + EVENT_KEY, + RESIZE: "resize" + EVENT_KEY, + CLICK_DISMISS: "click.dismiss" + EVENT_KEY, + KEYDOWN_DISMISS: "keydown.dismiss" + EVENT_KEY, + MOUSEUP_DISMISS: "mouseup.dismiss" + EVENT_KEY, + MOUSEDOWN_DISMISS: "mousedown.dismiss" + EVENT_KEY, + CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY + }; + var ClassName = { + SCROLLBAR_MEASURER: 'modal-scrollbar-measure', + BACKDROP: 'modal-backdrop', + OPEN: 'modal-open', + FADE: 'fade', + SHOW: 'show' + }; + var Selector = { + DIALOG: '.modal-dialog', + DATA_TOGGLE: '[data-toggle="modal"]', + DATA_DISMISS: '[data-dismiss="modal"]', + FIXED_CONTENT: '.fixed-top, .fixed-bottom, .is-fixed, .sticky-top', + STICKY_CONTENT: '.sticky-top', + NAVBAR_TOGGLER: '.navbar-toggler' + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Modal = + /*#__PURE__*/ + function () { + function Modal(element, config) { + this._config = this._getConfig(config); + this._element = element; + this._dialog = $$$1(element).find(Selector.DIALOG)[0]; + this._backdrop = null; + this._isShown = false; + this._isBodyOverflowing = false; + this._ignoreBackdropClick = false; + this._originalBodyPadding = 0; + this._scrollbarWidth = 0; + } // Getters + + + var _proto = Modal.prototype; + + // Public + _proto.toggle = function toggle(relatedTarget) { + return this._isShown ? this.hide() : this.show(relatedTarget); + }; + + _proto.show = function show(relatedTarget) { + var _this = this; + + if (this._isTransitioning || this._isShown) { + return; + } + + if (Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.FADE)) { + this._isTransitioning = true; + } + + var showEvent = $$$1.Event(Event.SHOW, { + relatedTarget: relatedTarget + }); + $$$1(this._element).trigger(showEvent); + + if (this._isShown || showEvent.isDefaultPrevented()) { + return; + } + + this._isShown = true; + + this._checkScrollbar(); + + this._setScrollbar(); + + this._adjustDialog(); + + $$$1(document.body).addClass(ClassName.OPEN); + + this._setEscapeEvent(); + + this._setResizeEvent(); + + $$$1(this._element).on(Event.CLICK_DISMISS, Selector.DATA_DISMISS, function (event) { + return _this.hide(event); + }); + $$$1(this._dialog).on(Event.MOUSEDOWN_DISMISS, function () { + $$$1(_this._element).one(Event.MOUSEUP_DISMISS, function (event) { + if ($$$1(event.target).is(_this._element)) { + _this._ignoreBackdropClick = true; + } + }); + }); + + this._showBackdrop(function () { + return _this._showElement(relatedTarget); + }); + }; + + _proto.hide = function hide(event) { + var _this2 = this; + + if (event) { + event.preventDefault(); + } + + if (this._isTransitioning || !this._isShown) { + return; + } + + var hideEvent = $$$1.Event(Event.HIDE); + $$$1(this._element).trigger(hideEvent); + + if (!this._isShown || hideEvent.isDefaultPrevented()) { + return; + } + + this._isShown = false; + var transition = Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.FADE); + + if (transition) { + this._isTransitioning = true; + } + + this._setEscapeEvent(); + + this._setResizeEvent(); + + $$$1(document).off(Event.FOCUSIN); + $$$1(this._element).removeClass(ClassName.SHOW); + $$$1(this._element).off(Event.CLICK_DISMISS); + $$$1(this._dialog).off(Event.MOUSEDOWN_DISMISS); + + if (transition) { + $$$1(this._element).one(Util.TRANSITION_END, function (event) { + return _this2._hideModal(event); + }).emulateTransitionEnd(TRANSITION_DURATION); + } else { + this._hideModal(); + } + }; + + _proto.dispose = function dispose() { + $$$1.removeData(this._element, DATA_KEY); + $$$1(window, document, this._element, this._backdrop).off(EVENT_KEY); + this._config = null; + this._element = null; + this._dialog = null; + this._backdrop = null; + this._isShown = null; + this._isBodyOverflowing = null; + this._ignoreBackdropClick = null; + this._scrollbarWidth = null; + }; + + _proto.handleUpdate = function handleUpdate() { + this._adjustDialog(); + }; // Private + + + _proto._getConfig = function _getConfig(config) { + config = _extends({}, Default, config); + Util.typeCheckConfig(NAME, config, DefaultType); + return config; + }; + + _proto._showElement = function _showElement(relatedTarget) { + var _this3 = this; + + var transition = Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.FADE); + + if (!this._element.parentNode || this._element.parentNode.nodeType !== Node.ELEMENT_NODE) { + // Don't move modal's DOM position + document.body.appendChild(this._element); + } + + this._element.style.display = 'block'; + + this._element.removeAttribute('aria-hidden'); + + this._element.scrollTop = 0; + + if (transition) { + Util.reflow(this._element); + } + + $$$1(this._element).addClass(ClassName.SHOW); + + if (this._config.focus) { + this._enforceFocus(); + } + + var shownEvent = $$$1.Event(Event.SHOWN, { + relatedTarget: relatedTarget + }); + + var transitionComplete = function transitionComplete() { + if (_this3._config.focus) { + _this3._element.focus(); + } + + _this3._isTransitioning = false; + $$$1(_this3._element).trigger(shownEvent); + }; + + if (transition) { + $$$1(this._dialog).one(Util.TRANSITION_END, transitionComplete).emulateTransitionEnd(TRANSITION_DURATION); + } else { + transitionComplete(); + } + }; + + _proto._enforceFocus = function _enforceFocus() { + var _this4 = this; + + $$$1(document).off(Event.FOCUSIN) // Guard against infinite focus loop + .on(Event.FOCUSIN, function (event) { + if (document !== event.target && _this4._element !== event.target && $$$1(_this4._element).has(event.target).length === 0) { + _this4._element.focus(); + } + }); + }; + + _proto._setEscapeEvent = function _setEscapeEvent() { + var _this5 = this; + + if (this._isShown && this._config.keyboard) { + $$$1(this._element).on(Event.KEYDOWN_DISMISS, function (event) { + if (event.which === ESCAPE_KEYCODE) { + event.preventDefault(); + + _this5.hide(); + } + }); + } else if (!this._isShown) { + $$$1(this._element).off(Event.KEYDOWN_DISMISS); + } + }; + + _proto._setResizeEvent = function _setResizeEvent() { + var _this6 = this; + + if (this._isShown) { + $$$1(window).on(Event.RESIZE, function (event) { + return _this6.handleUpdate(event); + }); + } else { + $$$1(window).off(Event.RESIZE); + } + }; + + _proto._hideModal = function _hideModal() { + var _this7 = this; + + this._element.style.display = 'none'; + + this._element.setAttribute('aria-hidden', true); + + this._isTransitioning = false; + + this._showBackdrop(function () { + $$$1(document.body).removeClass(ClassName.OPEN); + + _this7._resetAdjustments(); + + _this7._resetScrollbar(); + + $$$1(_this7._element).trigger(Event.HIDDEN); + }); + }; + + _proto._removeBackdrop = function _removeBackdrop() { + if (this._backdrop) { + $$$1(this._backdrop).remove(); + this._backdrop = null; + } + }; + + _proto._showBackdrop = function _showBackdrop(callback) { + var _this8 = this; + + var animate = $$$1(this._element).hasClass(ClassName.FADE) ? ClassName.FADE : ''; + + if (this._isShown && this._config.backdrop) { + var doAnimate = Util.supportsTransitionEnd() && animate; + this._backdrop = document.createElement('div'); + this._backdrop.className = ClassName.BACKDROP; + + if (animate) { + $$$1(this._backdrop).addClass(animate); + } + + $$$1(this._backdrop).appendTo(document.body); + $$$1(this._element).on(Event.CLICK_DISMISS, function (event) { + if (_this8._ignoreBackdropClick) { + _this8._ignoreBackdropClick = false; + return; + } + + if (event.target !== event.currentTarget) { + return; + } + + if (_this8._config.backdrop === 'static') { + _this8._element.focus(); + } else { + _this8.hide(); + } + }); + + if (doAnimate) { + Util.reflow(this._backdrop); + } + + $$$1(this._backdrop).addClass(ClassName.SHOW); + + if (!callback) { + return; + } + + if (!doAnimate) { + callback(); + return; + } + + $$$1(this._backdrop).one(Util.TRANSITION_END, callback).emulateTransitionEnd(BACKDROP_TRANSITION_DURATION); + } else if (!this._isShown && this._backdrop) { + $$$1(this._backdrop).removeClass(ClassName.SHOW); + + var callbackRemove = function callbackRemove() { + _this8._removeBackdrop(); + + if (callback) { + callback(); + } + }; + + if (Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.FADE)) { + $$$1(this._backdrop).one(Util.TRANSITION_END, callbackRemove).emulateTransitionEnd(BACKDROP_TRANSITION_DURATION); + } else { + callbackRemove(); + } + } else if (callback) { + callback(); + } + }; // ---------------------------------------------------------------------- + // the following methods are used to handle overflowing modals + // todo (fat): these should probably be refactored out of modal.js + // ---------------------------------------------------------------------- + + + _proto._adjustDialog = function _adjustDialog() { + var isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight; + + if (!this._isBodyOverflowing && isModalOverflowing) { + this._element.style.paddingLeft = this._scrollbarWidth + "px"; + } + + if (this._isBodyOverflowing && !isModalOverflowing) { + this._element.style.paddingRight = this._scrollbarWidth + "px"; + } + }; + + _proto._resetAdjustments = function _resetAdjustments() { + this._element.style.paddingLeft = ''; + this._element.style.paddingRight = ''; + }; + + _proto._checkScrollbar = function _checkScrollbar() { + var rect = document.body.getBoundingClientRect(); + this._isBodyOverflowing = rect.left + rect.right < window.innerWidth; + this._scrollbarWidth = this._getScrollbarWidth(); + }; + + _proto._setScrollbar = function _setScrollbar() { + var _this9 = this; + + if (this._isBodyOverflowing) { + // Note: DOMNode.style.paddingRight returns the actual value or '' if not set + // while $(DOMNode).css('padding-right') returns the calculated value or 0 if not set + // Adjust fixed content padding + $$$1(Selector.FIXED_CONTENT).each(function (index, element) { + var actualPadding = $$$1(element)[0].style.paddingRight; + var calculatedPadding = $$$1(element).css('padding-right'); + $$$1(element).data('padding-right', actualPadding).css('padding-right', parseFloat(calculatedPadding) + _this9._scrollbarWidth + "px"); + }); // Adjust sticky content margin + + $$$1(Selector.STICKY_CONTENT).each(function (index, element) { + var actualMargin = $$$1(element)[0].style.marginRight; + var calculatedMargin = $$$1(element).css('margin-right'); + $$$1(element).data('margin-right', actualMargin).css('margin-right', parseFloat(calculatedMargin) - _this9._scrollbarWidth + "px"); + }); // Adjust navbar-toggler margin + + $$$1(Selector.NAVBAR_TOGGLER).each(function (index, element) { + var actualMargin = $$$1(element)[0].style.marginRight; + var calculatedMargin = $$$1(element).css('margin-right'); + $$$1(element).data('margin-right', actualMargin).css('margin-right', parseFloat(calculatedMargin) + _this9._scrollbarWidth + "px"); + }); // Adjust body padding + + var actualPadding = document.body.style.paddingRight; + var calculatedPadding = $$$1('body').css('padding-right'); + $$$1('body').data('padding-right', actualPadding).css('padding-right', parseFloat(calculatedPadding) + this._scrollbarWidth + "px"); + } + }; + + _proto._resetScrollbar = function _resetScrollbar() { + // Restore fixed content padding + $$$1(Selector.FIXED_CONTENT).each(function (index, element) { + var padding = $$$1(element).data('padding-right'); + + if (typeof padding !== 'undefined') { + $$$1(element).css('padding-right', padding).removeData('padding-right'); + } + }); // Restore sticky content and navbar-toggler margin + + $$$1(Selector.STICKY_CONTENT + ", " + Selector.NAVBAR_TOGGLER).each(function (index, element) { + var margin = $$$1(element).data('margin-right'); + + if (typeof margin !== 'undefined') { + $$$1(element).css('margin-right', margin).removeData('margin-right'); + } + }); // Restore body padding + + var padding = $$$1('body').data('padding-right'); + + if (typeof padding !== 'undefined') { + $$$1('body').css('padding-right', padding).removeData('padding-right'); + } + }; + + _proto._getScrollbarWidth = function _getScrollbarWidth() { + // thx d.walsh + var scrollDiv = document.createElement('div'); + scrollDiv.className = ClassName.SCROLLBAR_MEASURER; + document.body.appendChild(scrollDiv); + var scrollbarWidth = scrollDiv.getBoundingClientRect().width - scrollDiv.clientWidth; + document.body.removeChild(scrollDiv); + return scrollbarWidth; + }; // Static + + + Modal._jQueryInterface = function _jQueryInterface(config, relatedTarget) { + return this.each(function () { + var data = $$$1(this).data(DATA_KEY); + + var _config = _extends({}, Modal.Default, $$$1(this).data(), typeof config === 'object' && config); + + if (!data) { + data = new Modal(this, _config); + $$$1(this).data(DATA_KEY, data); + } + + if (typeof config === 'string') { + if (typeof data[config] === 'undefined') { + throw new TypeError("No method named \"" + config + "\""); + } + + data[config](relatedTarget); + } else if (_config.show) { + data.show(relatedTarget); + } + }); + }; + + _createClass(Modal, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }, { + key: "Default", + get: function get() { + return Default; + } + }]); + return Modal; + }(); + /** + * ------------------------------------------------------------------------ + * Data Api implementation + * ------------------------------------------------------------------------ + */ + + + $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) { + var _this10 = this; + + var target; + var selector = Util.getSelectorFromElement(this); + + if (selector) { + target = $$$1(selector)[0]; + } + + var config = $$$1(target).data(DATA_KEY) ? 'toggle' : _extends({}, $$$1(target).data(), $$$1(this).data()); + + if (this.tagName === 'A' || this.tagName === 'AREA') { + event.preventDefault(); + } + + var $target = $$$1(target).one(Event.SHOW, function (showEvent) { + if (showEvent.isDefaultPrevented()) { + // Only register focus restorer if modal will actually get shown + return; + } + + $target.one(Event.HIDDEN, function () { + if ($$$1(_this10).is(':visible')) { + _this10.focus(); + } + }); + }); + + Modal._jQueryInterface.call($$$1(target), config, this); + }); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + $$$1.fn[NAME] = Modal._jQueryInterface; + $$$1.fn[NAME].Constructor = Modal; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Modal._jQueryInterface; + }; + + return Modal; +}($); + +/** + * -------------------------------------------------------------------------- + * Bootstrap (v4.0.0): tooltip.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + +var Tooltip = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'tooltip'; + var VERSION = '4.0.0'; + var DATA_KEY = 'bs.tooltip'; + var EVENT_KEY = "." + DATA_KEY; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var TRANSITION_DURATION = 150; + var CLASS_PREFIX = 'bs-tooltip'; + var BSCLS_PREFIX_REGEX = new RegExp("(^|\\s)" + CLASS_PREFIX + "\\S+", 'g'); + var DefaultType = { + animation: 'boolean', + template: 'string', + title: '(string|element|function)', + trigger: 'string', + delay: '(number|object)', + html: 'boolean', + selector: '(string|boolean)', + placement: '(string|function)', + offset: '(number|string)', + container: '(string|element|boolean)', + fallbackPlacement: '(string|array)', + boundary: '(string|element)' + }; + var AttachmentMap = { + AUTO: 'auto', + TOP: 'top', + RIGHT: 'right', + BOTTOM: 'bottom', + LEFT: 'left' + }; + var Default = { + animation: true, + template: '<div class="tooltip" role="tooltip">' + '<div class="arrow"></div>' + '<div class="tooltip-inner"></div></div>', + trigger: 'hover focus', + title: '', + delay: 0, + html: false, + selector: false, + placement: 'top', + offset: 0, + container: false, + fallbackPlacement: 'flip', + boundary: 'scrollParent' + }; + var HoverState = { + SHOW: 'show', + OUT: 'out' + }; + var Event = { + HIDE: "hide" + EVENT_KEY, + HIDDEN: "hidden" + EVENT_KEY, + SHOW: "show" + EVENT_KEY, + SHOWN: "shown" + EVENT_KEY, + INSERTED: "inserted" + EVENT_KEY, + CLICK: "click" + EVENT_KEY, + FOCUSIN: "focusin" + EVENT_KEY, + FOCUSOUT: "focusout" + EVENT_KEY, + MOUSEENTER: "mouseenter" + EVENT_KEY, + MOUSELEAVE: "mouseleave" + EVENT_KEY + }; + var ClassName = { + FADE: 'fade', + SHOW: 'show' + }; + var Selector = { + TOOLTIP: '.tooltip', + TOOLTIP_INNER: '.tooltip-inner', + ARROW: '.arrow' + }; + var Trigger = { + HOVER: 'hover', + FOCUS: 'focus', + CLICK: 'click', + MANUAL: 'manual' + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Tooltip = + /*#__PURE__*/ + function () { + function Tooltip(element, config) { + /** + * Check for Popper dependency + * Popper - https://popper.js.org + */ + if (typeof Popper === 'undefined') { + throw new TypeError('Bootstrap tooltips require Popper.js (https://popper.js.org)'); + } // private + + + this._isEnabled = true; + this._timeout = 0; + this._hoverState = ''; + this._activeTrigger = {}; + this._popper = null; // Protected + + this.element = element; + this.config = this._getConfig(config); + this.tip = null; + + this._setListeners(); + } // Getters + + + var _proto = Tooltip.prototype; + + // Public + _proto.enable = function enable() { + this._isEnabled = true; + }; + + _proto.disable = function disable() { + this._isEnabled = false; + }; + + _proto.toggleEnabled = function toggleEnabled() { + this._isEnabled = !this._isEnabled; + }; + + _proto.toggle = function toggle(event) { + if (!this._isEnabled) { + return; + } + + if (event) { + var dataKey = this.constructor.DATA_KEY; + var context = $$$1(event.currentTarget).data(dataKey); + + if (!context) { + context = new this.constructor(event.currentTarget, this._getDelegateConfig()); + $$$1(event.currentTarget).data(dataKey, context); + } + + context._activeTrigger.click = !context._activeTrigger.click; + + if (context._isWithActiveTrigger()) { + context._enter(null, context); + } else { + context._leave(null, context); + } + } else { + if ($$$1(this.getTipElement()).hasClass(ClassName.SHOW)) { + this._leave(null, this); + + return; + } + + this._enter(null, this); + } + }; + + _proto.dispose = function dispose() { + clearTimeout(this._timeout); + $$$1.removeData(this.element, this.constructor.DATA_KEY); + $$$1(this.element).off(this.constructor.EVENT_KEY); + $$$1(this.element).closest('.modal').off('hide.bs.modal'); + + if (this.tip) { + $$$1(this.tip).remove(); + } + + this._isEnabled = null; + this._timeout = null; + this._hoverState = null; + this._activeTrigger = null; + + if (this._popper !== null) { + this._popper.destroy(); + } + + this._popper = null; + this.element = null; + this.config = null; + this.tip = null; + }; + + _proto.show = function show() { + var _this = this; + + if ($$$1(this.element).css('display') === 'none') { + throw new Error('Please use show on visible elements'); + } + + var showEvent = $$$1.Event(this.constructor.Event.SHOW); + + if (this.isWithContent() && this._isEnabled) { + $$$1(this.element).trigger(showEvent); + var isInTheDom = $$$1.contains(this.element.ownerDocument.documentElement, this.element); + + if (showEvent.isDefaultPrevented() || !isInTheDom) { + return; + } + + var tip = this.getTipElement(); + var tipId = Util.getUID(this.constructor.NAME); + tip.setAttribute('id', tipId); + this.element.setAttribute('aria-describedby', tipId); + this.setContent(); + + if (this.config.animation) { + $$$1(tip).addClass(ClassName.FADE); + } + + var placement = typeof this.config.placement === 'function' ? this.config.placement.call(this, tip, this.element) : this.config.placement; + + var attachment = this._getAttachment(placement); + + this.addAttachmentClass(attachment); + var container = this.config.container === false ? document.body : $$$1(this.config.container); + $$$1(tip).data(this.constructor.DATA_KEY, this); + + if (!$$$1.contains(this.element.ownerDocument.documentElement, this.tip)) { + $$$1(tip).appendTo(container); + } + + $$$1(this.element).trigger(this.constructor.Event.INSERTED); + this._popper = new Popper(this.element, tip, { + placement: attachment, + modifiers: { + offset: { + offset: this.config.offset + }, + flip: { + behavior: this.config.fallbackPlacement + }, + arrow: { + element: Selector.ARROW + }, + preventOverflow: { + boundariesElement: this.config.boundary + } + }, + onCreate: function onCreate(data) { + if (data.originalPlacement !== data.placement) { + _this._handlePopperPlacementChange(data); + } + }, + onUpdate: function onUpdate(data) { + _this._handlePopperPlacementChange(data); + } + }); + $$$1(tip).addClass(ClassName.SHOW); // If this is a touch-enabled device we add extra + // empty mouseover listeners to the body's immediate children; + // only needed because of broken event delegation on iOS + // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html + + if ('ontouchstart' in document.documentElement) { + $$$1('body').children().on('mouseover', null, $$$1.noop); + } + + var complete = function complete() { + if (_this.config.animation) { + _this._fixTransition(); + } + + var prevHoverState = _this._hoverState; + _this._hoverState = null; + $$$1(_this.element).trigger(_this.constructor.Event.SHOWN); + + if (prevHoverState === HoverState.OUT) { + _this._leave(null, _this); + } + }; + + if (Util.supportsTransitionEnd() && $$$1(this.tip).hasClass(ClassName.FADE)) { + $$$1(this.tip).one(Util.TRANSITION_END, complete).emulateTransitionEnd(Tooltip._TRANSITION_DURATION); + } else { + complete(); + } + } + }; + + _proto.hide = function hide(callback) { + var _this2 = this; + + var tip = this.getTipElement(); + var hideEvent = $$$1.Event(this.constructor.Event.HIDE); + + var complete = function complete() { + if (_this2._hoverState !== HoverState.SHOW && tip.parentNode) { + tip.parentNode.removeChild(tip); + } + + _this2._cleanTipClass(); + + _this2.element.removeAttribute('aria-describedby'); + + $$$1(_this2.element).trigger(_this2.constructor.Event.HIDDEN); + + if (_this2._popper !== null) { + _this2._popper.destroy(); + } + + if (callback) { + callback(); + } + }; + + $$$1(this.element).trigger(hideEvent); + + if (hideEvent.isDefaultPrevented()) { + return; + } + + $$$1(tip).removeClass(ClassName.SHOW); // If this is a touch-enabled device we remove the extra + // empty mouseover listeners we added for iOS support + + if ('ontouchstart' in document.documentElement) { + $$$1('body').children().off('mouseover', null, $$$1.noop); + } + + this._activeTrigger[Trigger.CLICK] = false; + this._activeTrigger[Trigger.FOCUS] = false; + this._activeTrigger[Trigger.HOVER] = false; + + if (Util.supportsTransitionEnd() && $$$1(this.tip).hasClass(ClassName.FADE)) { + $$$1(tip).one(Util.TRANSITION_END, complete).emulateTransitionEnd(TRANSITION_DURATION); + } else { + complete(); + } + + this._hoverState = ''; + }; + + _proto.update = function update() { + if (this._popper !== null) { + this._popper.scheduleUpdate(); + } + }; // Protected + + + _proto.isWithContent = function isWithContent() { + return Boolean(this.getTitle()); + }; + + _proto.addAttachmentClass = function addAttachmentClass(attachment) { + $$$1(this.getTipElement()).addClass(CLASS_PREFIX + "-" + attachment); + }; + + _proto.getTipElement = function getTipElement() { + this.tip = this.tip || $$$1(this.config.template)[0]; + return this.tip; + }; + + _proto.setContent = function setContent() { + var $tip = $$$1(this.getTipElement()); + this.setElementContent($tip.find(Selector.TOOLTIP_INNER), this.getTitle()); + $tip.removeClass(ClassName.FADE + " " + ClassName.SHOW); + }; + + _proto.setElementContent = function setElementContent($element, content) { + var html = this.config.html; + + if (typeof content === 'object' && (content.nodeType || content.jquery)) { + // Content is a DOM node or a jQuery + if (html) { + if (!$$$1(content).parent().is($element)) { + $element.empty().append(content); + } + } else { + $element.text($$$1(content).text()); + } + } else { + $element[html ? 'html' : 'text'](content); + } + }; + + _proto.getTitle = function getTitle() { + var title = this.element.getAttribute('data-original-title'); + + if (!title) { + title = typeof this.config.title === 'function' ? this.config.title.call(this.element) : this.config.title; + } + + return title; + }; // Private + + + _proto._getAttachment = function _getAttachment(placement) { + return AttachmentMap[placement.toUpperCase()]; + }; + + _proto._setListeners = function _setListeners() { + var _this3 = this; + + var triggers = this.config.trigger.split(' '); + triggers.forEach(function (trigger) { + if (trigger === 'click') { + $$$1(_this3.element).on(_this3.constructor.Event.CLICK, _this3.config.selector, function (event) { + return _this3.toggle(event); + }); + } else if (trigger !== Trigger.MANUAL) { + var eventIn = trigger === Trigger.HOVER ? _this3.constructor.Event.MOUSEENTER : _this3.constructor.Event.FOCUSIN; + var eventOut = trigger === Trigger.HOVER ? _this3.constructor.Event.MOUSELEAVE : _this3.constructor.Event.FOCUSOUT; + $$$1(_this3.element).on(eventIn, _this3.config.selector, function (event) { + return _this3._enter(event); + }).on(eventOut, _this3.config.selector, function (event) { + return _this3._leave(event); + }); + } + + $$$1(_this3.element).closest('.modal').on('hide.bs.modal', function () { + return _this3.hide(); + }); + }); + + if (this.config.selector) { + this.config = _extends({}, this.config, { + trigger: 'manual', + selector: '' + }); + } else { + this._fixTitle(); + } + }; + + _proto._fixTitle = function _fixTitle() { + var titleType = typeof this.element.getAttribute('data-original-title'); + + if (this.element.getAttribute('title') || titleType !== 'string') { + this.element.setAttribute('data-original-title', this.element.getAttribute('title') || ''); + this.element.setAttribute('title', ''); + } + }; + + _proto._enter = function _enter(event, context) { + var dataKey = this.constructor.DATA_KEY; + context = context || $$$1(event.currentTarget).data(dataKey); + + if (!context) { + context = new this.constructor(event.currentTarget, this._getDelegateConfig()); + $$$1(event.currentTarget).data(dataKey, context); + } + + if (event) { + context._activeTrigger[event.type === 'focusin' ? Trigger.FOCUS : Trigger.HOVER] = true; + } + + if ($$$1(context.getTipElement()).hasClass(ClassName.SHOW) || context._hoverState === HoverState.SHOW) { + context._hoverState = HoverState.SHOW; + return; + } + + clearTimeout(context._timeout); + context._hoverState = HoverState.SHOW; + + if (!context.config.delay || !context.config.delay.show) { + context.show(); + return; + } + + context._timeout = setTimeout(function () { + if (context._hoverState === HoverState.SHOW) { + context.show(); + } + }, context.config.delay.show); + }; + + _proto._leave = function _leave(event, context) { + var dataKey = this.constructor.DATA_KEY; + context = context || $$$1(event.currentTarget).data(dataKey); + + if (!context) { + context = new this.constructor(event.currentTarget, this._getDelegateConfig()); + $$$1(event.currentTarget).data(dataKey, context); + } + + if (event) { + context._activeTrigger[event.type === 'focusout' ? Trigger.FOCUS : Trigger.HOVER] = false; + } + + if (context._isWithActiveTrigger()) { + return; + } + + clearTimeout(context._timeout); + context._hoverState = HoverState.OUT; + + if (!context.config.delay || !context.config.delay.hide) { + context.hide(); + return; + } + + context._timeout = setTimeout(function () { + if (context._hoverState === HoverState.OUT) { + context.hide(); + } + }, context.config.delay.hide); + }; + + _proto._isWithActiveTrigger = function _isWithActiveTrigger() { + for (var trigger in this._activeTrigger) { + if (this._activeTrigger[trigger]) { + return true; + } + } + + return false; + }; + + _proto._getConfig = function _getConfig(config) { + config = _extends({}, this.constructor.Default, $$$1(this.element).data(), config); + + if (typeof config.delay === 'number') { + config.delay = { + show: config.delay, + hide: config.delay + }; + } + + if (typeof config.title === 'number') { + config.title = config.title.toString(); + } + + if (typeof config.content === 'number') { + config.content = config.content.toString(); + } + + Util.typeCheckConfig(NAME, config, this.constructor.DefaultType); + return config; + }; + + _proto._getDelegateConfig = function _getDelegateConfig() { + var config = {}; + + if (this.config) { + for (var key in this.config) { + if (this.constructor.Default[key] !== this.config[key]) { + config[key] = this.config[key]; + } + } + } + + return config; + }; + + _proto._cleanTipClass = function _cleanTipClass() { + var $tip = $$$1(this.getTipElement()); + var tabClass = $tip.attr('class').match(BSCLS_PREFIX_REGEX); + + if (tabClass !== null && tabClass.length > 0) { + $tip.removeClass(tabClass.join('')); + } + }; + + _proto._handlePopperPlacementChange = function _handlePopperPlacementChange(data) { + this._cleanTipClass(); + + this.addAttachmentClass(this._getAttachment(data.placement)); + }; + + _proto._fixTransition = function _fixTransition() { + var tip = this.getTipElement(); + var initConfigAnimation = this.config.animation; + + if (tip.getAttribute('x-placement') !== null) { + return; + } + + $$$1(tip).removeClass(ClassName.FADE); + this.config.animation = false; + this.hide(); + this.show(); + this.config.animation = initConfigAnimation; + }; // Static + + + Tooltip._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var data = $$$1(this).data(DATA_KEY); + + var _config = typeof config === 'object' && config; + + if (!data && /dispose|hide/.test(config)) { + return; + } + + if (!data) { + data = new Tooltip(this, _config); + $$$1(this).data(DATA_KEY, data); + } + + if (typeof config === 'string') { + if (typeof data[config] === 'undefined') { + throw new TypeError("No method named \"" + config + "\""); + } + + data[config](); + } + }); + }; + + _createClass(Tooltip, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }, { + key: "Default", + get: function get() { + return Default; + } + }, { + key: "NAME", + get: function get() { + return NAME; + } + }, { + key: "DATA_KEY", + get: function get() { + return DATA_KEY; + } + }, { + key: "Event", + get: function get() { + return Event; + } + }, { + key: "EVENT_KEY", + get: function get() { + return EVENT_KEY; + } + }, { + key: "DefaultType", + get: function get() { + return DefaultType; + } + }]); + return Tooltip; + }(); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + + $$$1.fn[NAME] = Tooltip._jQueryInterface; + $$$1.fn[NAME].Constructor = Tooltip; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Tooltip._jQueryInterface; + }; + + return Tooltip; +}($, Popper); + +/** + * -------------------------------------------------------------------------- + * Bootstrap (v4.0.0): popover.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + +var Popover = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'popover'; + var VERSION = '4.0.0'; + var DATA_KEY = 'bs.popover'; + var EVENT_KEY = "." + DATA_KEY; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var CLASS_PREFIX = 'bs-popover'; + var BSCLS_PREFIX_REGEX = new RegExp("(^|\\s)" + CLASS_PREFIX + "\\S+", 'g'); + var Default = _extends({}, Tooltip.Default, { + placement: 'right', + trigger: 'click', + content: '', + template: '<div class="popover" role="tooltip">' + '<div class="arrow"></div>' + '<h3 class="popover-header"></h3>' + '<div class="popover-body"></div></div>' + }); + var DefaultType = _extends({}, Tooltip.DefaultType, { + content: '(string|element|function)' + }); + var ClassName = { + FADE: 'fade', + SHOW: 'show' + }; + var Selector = { + TITLE: '.popover-header', + CONTENT: '.popover-body' + }; + var Event = { + HIDE: "hide" + EVENT_KEY, + HIDDEN: "hidden" + EVENT_KEY, + SHOW: "show" + EVENT_KEY, + SHOWN: "shown" + EVENT_KEY, + INSERTED: "inserted" + EVENT_KEY, + CLICK: "click" + EVENT_KEY, + FOCUSIN: "focusin" + EVENT_KEY, + FOCUSOUT: "focusout" + EVENT_KEY, + MOUSEENTER: "mouseenter" + EVENT_KEY, + MOUSELEAVE: "mouseleave" + EVENT_KEY + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Popover = + /*#__PURE__*/ + function (_Tooltip) { + _inheritsLoose(Popover, _Tooltip); + + function Popover() { + return _Tooltip.apply(this, arguments) || this; + } + + var _proto = Popover.prototype; + + // Overrides + _proto.isWithContent = function isWithContent() { + return this.getTitle() || this._getContent(); + }; + + _proto.addAttachmentClass = function addAttachmentClass(attachment) { + $$$1(this.getTipElement()).addClass(CLASS_PREFIX + "-" + attachment); + }; + + _proto.getTipElement = function getTipElement() { + this.tip = this.tip || $$$1(this.config.template)[0]; + return this.tip; + }; + + _proto.setContent = function setContent() { + var $tip = $$$1(this.getTipElement()); // We use append for html objects to maintain js events + + this.setElementContent($tip.find(Selector.TITLE), this.getTitle()); + + var content = this._getContent(); + + if (typeof content === 'function') { + content = content.call(this.element); + } + + this.setElementContent($tip.find(Selector.CONTENT), content); + $tip.removeClass(ClassName.FADE + " " + ClassName.SHOW); + }; // Private + + + _proto._getContent = function _getContent() { + return this.element.getAttribute('data-content') || this.config.content; + }; + + _proto._cleanTipClass = function _cleanTipClass() { + var $tip = $$$1(this.getTipElement()); + var tabClass = $tip.attr('class').match(BSCLS_PREFIX_REGEX); + + if (tabClass !== null && tabClass.length > 0) { + $tip.removeClass(tabClass.join('')); + } + }; // Static + + + Popover._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var data = $$$1(this).data(DATA_KEY); + + var _config = typeof config === 'object' ? config : null; + + if (!data && /destroy|hide/.test(config)) { + return; + } + + if (!data) { + data = new Popover(this, _config); + $$$1(this).data(DATA_KEY, data); + } + + if (typeof config === 'string') { + if (typeof data[config] === 'undefined') { + throw new TypeError("No method named \"" + config + "\""); + } + + data[config](); + } + }); + }; + + _createClass(Popover, null, [{ + key: "VERSION", + // Getters + get: function get() { + return VERSION; + } + }, { + key: "Default", + get: function get() { + return Default; + } + }, { + key: "NAME", + get: function get() { + return NAME; + } + }, { + key: "DATA_KEY", + get: function get() { + return DATA_KEY; + } + }, { + key: "Event", + get: function get() { + return Event; + } + }, { + key: "EVENT_KEY", + get: function get() { + return EVENT_KEY; + } + }, { + key: "DefaultType", + get: function get() { + return DefaultType; + } + }]); + return Popover; + }(Tooltip); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + + $$$1.fn[NAME] = Popover._jQueryInterface; + $$$1.fn[NAME].Constructor = Popover; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Popover._jQueryInterface; + }; + + return Popover; +}($); + +/** + * -------------------------------------------------------------------------- + * Bootstrap (v4.0.0): scrollspy.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + +var ScrollSpy = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'scrollspy'; + var VERSION = '4.0.0'; + var DATA_KEY = 'bs.scrollspy'; + var EVENT_KEY = "." + DATA_KEY; + var DATA_API_KEY = '.data-api'; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var Default = { + offset: 10, + method: 'auto', + target: '' + }; + var DefaultType = { + offset: 'number', + method: 'string', + target: '(string|element)' + }; + var Event = { + ACTIVATE: "activate" + EVENT_KEY, + SCROLL: "scroll" + EVENT_KEY, + LOAD_DATA_API: "load" + EVENT_KEY + DATA_API_KEY + }; + var ClassName = { + DROPDOWN_ITEM: 'dropdown-item', + DROPDOWN_MENU: 'dropdown-menu', + ACTIVE: 'active' + }; + var Selector = { + DATA_SPY: '[data-spy="scroll"]', + ACTIVE: '.active', + NAV_LIST_GROUP: '.nav, .list-group', + NAV_LINKS: '.nav-link', + NAV_ITEMS: '.nav-item', + LIST_ITEMS: '.list-group-item', + DROPDOWN: '.dropdown', + DROPDOWN_ITEMS: '.dropdown-item', + DROPDOWN_TOGGLE: '.dropdown-toggle' + }; + var OffsetMethod = { + OFFSET: 'offset', + POSITION: 'position' + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var ScrollSpy = + /*#__PURE__*/ + function () { + function ScrollSpy(element, config) { + var _this = this; + + this._element = element; + this._scrollElement = element.tagName === 'BODY' ? window : element; + this._config = this._getConfig(config); + this._selector = this._config.target + " " + Selector.NAV_LINKS + "," + (this._config.target + " " + Selector.LIST_ITEMS + ",") + (this._config.target + " " + Selector.DROPDOWN_ITEMS); + this._offsets = []; + this._targets = []; + this._activeTarget = null; + this._scrollHeight = 0; + $$$1(this._scrollElement).on(Event.SCROLL, function (event) { + return _this._process(event); + }); + this.refresh(); + + this._process(); + } // Getters + + + var _proto = ScrollSpy.prototype; + + // Public + _proto.refresh = function refresh() { + var _this2 = this; + + var autoMethod = this._scrollElement === this._scrollElement.window ? OffsetMethod.OFFSET : OffsetMethod.POSITION; + var offsetMethod = this._config.method === 'auto' ? autoMethod : this._config.method; + var offsetBase = offsetMethod === OffsetMethod.POSITION ? this._getScrollTop() : 0; + this._offsets = []; + this._targets = []; + this._scrollHeight = this._getScrollHeight(); + var targets = $$$1.makeArray($$$1(this._selector)); + targets.map(function (element) { + var target; + var targetSelector = Util.getSelectorFromElement(element); + + if (targetSelector) { + target = $$$1(targetSelector)[0]; + } + + if (target) { + var targetBCR = target.getBoundingClientRect(); + + if (targetBCR.width || targetBCR.height) { + // TODO (fat): remove sketch reliance on jQuery position/offset + return [$$$1(target)[offsetMethod]().top + offsetBase, targetSelector]; + } + } + + return null; + }).filter(function (item) { + return item; + }).sort(function (a, b) { + return a[0] - b[0]; + }).forEach(function (item) { + _this2._offsets.push(item[0]); + + _this2._targets.push(item[1]); + }); + }; + + _proto.dispose = function dispose() { + $$$1.removeData(this._element, DATA_KEY); + $$$1(this._scrollElement).off(EVENT_KEY); + this._element = null; + this._scrollElement = null; + this._config = null; + this._selector = null; + this._offsets = null; + this._targets = null; + this._activeTarget = null; + this._scrollHeight = null; + }; // Private + + + _proto._getConfig = function _getConfig(config) { + config = _extends({}, Default, config); + + if (typeof config.target !== 'string') { + var id = $$$1(config.target).attr('id'); + + if (!id) { + id = Util.getUID(NAME); + $$$1(config.target).attr('id', id); + } + + config.target = "#" + id; + } + + Util.typeCheckConfig(NAME, config, DefaultType); + return config; + }; + + _proto._getScrollTop = function _getScrollTop() { + return this._scrollElement === window ? this._scrollElement.pageYOffset : this._scrollElement.scrollTop; + }; + + _proto._getScrollHeight = function _getScrollHeight() { + return this._scrollElement.scrollHeight || Math.max(document.body.scrollHeight, document.documentElement.scrollHeight); + }; + + _proto._getOffsetHeight = function _getOffsetHeight() { + return this._scrollElement === window ? window.innerHeight : this._scrollElement.getBoundingClientRect().height; + }; + + _proto._process = function _process() { + var scrollTop = this._getScrollTop() + this._config.offset; + + var scrollHeight = this._getScrollHeight(); + + var maxScroll = this._config.offset + scrollHeight - this._getOffsetHeight(); + + if (this._scrollHeight !== scrollHeight) { + this.refresh(); + } + + if (scrollTop >= maxScroll) { + var target = this._targets[this._targets.length - 1]; + + if (this._activeTarget !== target) { + this._activate(target); + } + + return; + } + + if (this._activeTarget && scrollTop < this._offsets[0] && this._offsets[0] > 0) { + this._activeTarget = null; + + this._clear(); + + return; + } + + for (var i = this._offsets.length; i--;) { + var isActiveTarget = this._activeTarget !== this._targets[i] && scrollTop >= this._offsets[i] && (typeof this._offsets[i + 1] === 'undefined' || scrollTop < this._offsets[i + 1]); + + if (isActiveTarget) { + this._activate(this._targets[i]); + } + } + }; + + _proto._activate = function _activate(target) { + this._activeTarget = target; + + this._clear(); + + var queries = this._selector.split(','); // eslint-disable-next-line arrow-body-style + + + queries = queries.map(function (selector) { + return selector + "[data-target=\"" + target + "\"]," + (selector + "[href=\"" + target + "\"]"); + }); + var $link = $$$1(queries.join(',')); + + if ($link.hasClass(ClassName.DROPDOWN_ITEM)) { + $link.closest(Selector.DROPDOWN).find(Selector.DROPDOWN_TOGGLE).addClass(ClassName.ACTIVE); + $link.addClass(ClassName.ACTIVE); + } else { + // Set triggered link as active + $link.addClass(ClassName.ACTIVE); // Set triggered links parents as active + // With both <ul> and <nav> markup a parent is the previous sibling of any nav ancestor + + $link.parents(Selector.NAV_LIST_GROUP).prev(Selector.NAV_LINKS + ", " + Selector.LIST_ITEMS).addClass(ClassName.ACTIVE); // Handle special case when .nav-link is inside .nav-item + + $link.parents(Selector.NAV_LIST_GROUP).prev(Selector.NAV_ITEMS).children(Selector.NAV_LINKS).addClass(ClassName.ACTIVE); + } + + $$$1(this._scrollElement).trigger(Event.ACTIVATE, { + relatedTarget: target + }); + }; + + _proto._clear = function _clear() { + $$$1(this._selector).filter(Selector.ACTIVE).removeClass(ClassName.ACTIVE); + }; // Static + + + ScrollSpy._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var data = $$$1(this).data(DATA_KEY); + + var _config = typeof config === 'object' && config; + + if (!data) { + data = new ScrollSpy(this, _config); + $$$1(this).data(DATA_KEY, data); + } + + if (typeof config === 'string') { + if (typeof data[config] === 'undefined') { + throw new TypeError("No method named \"" + config + "\""); + } + + data[config](); + } + }); + }; + + _createClass(ScrollSpy, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }, { + key: "Default", + get: function get() { + return Default; + } + }]); + return ScrollSpy; + }(); + /** + * ------------------------------------------------------------------------ + * Data Api implementation + * ------------------------------------------------------------------------ + */ + + + $$$1(window).on(Event.LOAD_DATA_API, function () { + var scrollSpys = $$$1.makeArray($$$1(Selector.DATA_SPY)); + + for (var i = scrollSpys.length; i--;) { + var $spy = $$$1(scrollSpys[i]); + + ScrollSpy._jQueryInterface.call($spy, $spy.data()); + } + }); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + $$$1.fn[NAME] = ScrollSpy._jQueryInterface; + $$$1.fn[NAME].Constructor = ScrollSpy; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return ScrollSpy._jQueryInterface; + }; + + return ScrollSpy; +}($); + +/** + * -------------------------------------------------------------------------- + * Bootstrap (v4.0.0): tab.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + +var Tab = function ($$$1) { + /** + * ------------------------------------------------------------------------ + * Constants + * ------------------------------------------------------------------------ + */ + var NAME = 'tab'; + var VERSION = '4.0.0'; + var DATA_KEY = 'bs.tab'; + var EVENT_KEY = "." + DATA_KEY; + var DATA_API_KEY = '.data-api'; + var JQUERY_NO_CONFLICT = $$$1.fn[NAME]; + var TRANSITION_DURATION = 150; + var Event = { + HIDE: "hide" + EVENT_KEY, + HIDDEN: "hidden" + EVENT_KEY, + SHOW: "show" + EVENT_KEY, + SHOWN: "shown" + EVENT_KEY, + CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY + }; + var ClassName = { + DROPDOWN_MENU: 'dropdown-menu', + ACTIVE: 'active', + DISABLED: 'disabled', + FADE: 'fade', + SHOW: 'show' + }; + var Selector = { + DROPDOWN: '.dropdown', + NAV_LIST_GROUP: '.nav, .list-group', + ACTIVE: '.active', + ACTIVE_UL: '> li > .active', + DATA_TOGGLE: '[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]', + DROPDOWN_TOGGLE: '.dropdown-toggle', + DROPDOWN_ACTIVE_CHILD: '> .dropdown-menu .active' + /** + * ------------------------------------------------------------------------ + * Class Definition + * ------------------------------------------------------------------------ + */ + + }; + + var Tab = + /*#__PURE__*/ + function () { + function Tab(element) { + this._element = element; + } // Getters + + + var _proto = Tab.prototype; + + // Public + _proto.show = function show() { + var _this = this; + + if (this._element.parentNode && this._element.parentNode.nodeType === Node.ELEMENT_NODE && $$$1(this._element).hasClass(ClassName.ACTIVE) || $$$1(this._element).hasClass(ClassName.DISABLED)) { + return; + } + + var target; + var previous; + var listElement = $$$1(this._element).closest(Selector.NAV_LIST_GROUP)[0]; + var selector = Util.getSelectorFromElement(this._element); + + if (listElement) { + var itemSelector = listElement.nodeName === 'UL' ? Selector.ACTIVE_UL : Selector.ACTIVE; + previous = $$$1.makeArray($$$1(listElement).find(itemSelector)); + previous = previous[previous.length - 1]; + } + + var hideEvent = $$$1.Event(Event.HIDE, { + relatedTarget: this._element + }); + var showEvent = $$$1.Event(Event.SHOW, { + relatedTarget: previous + }); + + if (previous) { + $$$1(previous).trigger(hideEvent); + } + + $$$1(this._element).trigger(showEvent); + + if (showEvent.isDefaultPrevented() || hideEvent.isDefaultPrevented()) { + return; + } + + if (selector) { + target = $$$1(selector)[0]; + } + + this._activate(this._element, listElement); + + var complete = function complete() { + var hiddenEvent = $$$1.Event(Event.HIDDEN, { + relatedTarget: _this._element + }); + var shownEvent = $$$1.Event(Event.SHOWN, { + relatedTarget: previous + }); + $$$1(previous).trigger(hiddenEvent); + $$$1(_this._element).trigger(shownEvent); + }; + + if (target) { + this._activate(target, target.parentNode, complete); + } else { + complete(); + } + }; + + _proto.dispose = function dispose() { + $$$1.removeData(this._element, DATA_KEY); + this._element = null; + }; // Private + + + _proto._activate = function _activate(element, container, callback) { + var _this2 = this; + + var activeElements; + + if (container.nodeName === 'UL') { + activeElements = $$$1(container).find(Selector.ACTIVE_UL); + } else { + activeElements = $$$1(container).children(Selector.ACTIVE); + } + + var active = activeElements[0]; + var isTransitioning = callback && Util.supportsTransitionEnd() && active && $$$1(active).hasClass(ClassName.FADE); + + var complete = function complete() { + return _this2._transitionComplete(element, active, callback); + }; + + if (active && isTransitioning) { + $$$1(active).one(Util.TRANSITION_END, complete).emulateTransitionEnd(TRANSITION_DURATION); + } else { + complete(); + } + }; + + _proto._transitionComplete = function _transitionComplete(element, active, callback) { + if (active) { + $$$1(active).removeClass(ClassName.SHOW + " " + ClassName.ACTIVE); + var dropdownChild = $$$1(active.parentNode).find(Selector.DROPDOWN_ACTIVE_CHILD)[0]; + + if (dropdownChild) { + $$$1(dropdownChild).removeClass(ClassName.ACTIVE); + } + + if (active.getAttribute('role') === 'tab') { + active.setAttribute('aria-selected', false); + } + } + + $$$1(element).addClass(ClassName.ACTIVE); + + if (element.getAttribute('role') === 'tab') { + element.setAttribute('aria-selected', true); + } + + Util.reflow(element); + $$$1(element).addClass(ClassName.SHOW); + + if (element.parentNode && $$$1(element.parentNode).hasClass(ClassName.DROPDOWN_MENU)) { + var dropdownElement = $$$1(element).closest(Selector.DROPDOWN)[0]; + + if (dropdownElement) { + $$$1(dropdownElement).find(Selector.DROPDOWN_TOGGLE).addClass(ClassName.ACTIVE); + } + + element.setAttribute('aria-expanded', true); + } + + if (callback) { + callback(); + } + }; // Static + + + Tab._jQueryInterface = function _jQueryInterface(config) { + return this.each(function () { + var $this = $$$1(this); + var data = $this.data(DATA_KEY); + + if (!data) { + data = new Tab(this); + $this.data(DATA_KEY, data); + } + + if (typeof config === 'string') { + if (typeof data[config] === 'undefined') { + throw new TypeError("No method named \"" + config + "\""); + } + + data[config](); + } + }); + }; + + _createClass(Tab, null, [{ + key: "VERSION", + get: function get() { + return VERSION; + } + }]); + return Tab; + }(); + /** + * ------------------------------------------------------------------------ + * Data Api implementation + * ------------------------------------------------------------------------ + */ + + + $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) { + event.preventDefault(); + + Tab._jQueryInterface.call($$$1(this), 'show'); + }); + /** + * ------------------------------------------------------------------------ + * jQuery + * ------------------------------------------------------------------------ + */ + + $$$1.fn[NAME] = Tab._jQueryInterface; + $$$1.fn[NAME].Constructor = Tab; + + $$$1.fn[NAME].noConflict = function () { + $$$1.fn[NAME] = JQUERY_NO_CONFLICT; + return Tab._jQueryInterface; + }; + + return Tab; +}($); + +/** + * -------------------------------------------------------------------------- + * Bootstrap (v4.0.0-alpha.6): index.js + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + * -------------------------------------------------------------------------- + */ + +(function ($$$1) { + if (typeof $$$1 === 'undefined') { + throw new TypeError('Bootstrap\'s JavaScript requires jQuery. jQuery must be included before Bootstrap\'s JavaScript.'); + } + + var version = $$$1.fn.jquery.split(' ')[0].split('.'); + var minMajor = 1; + var ltMajor = 2; + var minMinor = 9; + var minPatch = 1; + var maxMajor = 4; + + if (version[0] < ltMajor && version[1] < minMinor || version[0] === minMajor && version[1] === minMinor && version[2] < minPatch || version[0] >= maxMajor) { + throw new Error('Bootstrap\'s JavaScript requires at least jQuery v1.9.1 but less than v4.0.0'); + } +})($); + +exports.Util = Util; +exports.Alert = Alert; +exports.Button = Button; +exports.Carousel = Carousel; +exports.Collapse = Collapse; +exports.Dropdown = Dropdown; +exports.Modal = Modal; +exports.Popover = Popover; +exports.Scrollspy = ScrollSpy; +exports.Tab = Tab; +exports.Tooltip = Tooltip; + +Object.defineProperty(exports, '__esModule', { value: true }); + +}))); +//# sourceMappingURL=bootstrap.js.map diff --git a/chall/src/js/bootstrap.min.js b/chall/src/js/bootstrap.min.js new file mode 100644 index 0000000..534d533 --- /dev/null +++ b/chall/src/js/bootstrap.min.js @@ -0,0 +1,7 @@ +/*! + * Bootstrap v4.0.0 (https://getbootstrap.com) + * Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors) + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + */ +!function(t,e){"object"==typeof exports&&"undefined"!=typeof module?e(exports,require("jquery"),require("popper.js")):"function"==typeof define&&define.amd?define(["exports","jquery","popper.js"],e):e(t.bootstrap={},t.jQuery,t.Popper)}(this,function(t,e,n){"use strict";function i(t,e){for(var n=0;n<e.length;n++){var i=e[n];i.enumerable=i.enumerable||!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(t,i.key,i)}}function s(t,e,n){return e&&i(t.prototype,e),n&&i(t,n),t}function r(){return(r=Object.assign||function(t){for(var e=1;e<arguments.length;e++){var n=arguments[e];for(var i in n)Object.prototype.hasOwnProperty.call(n,i)&&(t[i]=n[i])}return t}).apply(this,arguments)}e=e&&e.hasOwnProperty("default")?e.default:e,n=n&&n.hasOwnProperty("default")?n.default:n;var o,a,l,h,c,u,f,d,_,g,p,m,v,E,T,y,C,I,A,b,D,S,w,N,O,k,P=function(t){var e=!1;function n(e){var n=this,s=!1;return t(this).one(i.TRANSITION_END,function(){s=!0}),setTimeout(function(){s||i.triggerTransitionEnd(n)},e),this}var i={TRANSITION_END:"bsTransitionEnd",getUID:function(t){do{t+=~~(1e6*Math.random())}while(document.getElementById(t));return t},getSelectorFromElement:function(e){var n,i=e.getAttribute("data-target");i&&"#"!==i||(i=e.getAttribute("href")||""),"#"===i.charAt(0)&&(n=i,i=n="function"==typeof t.escapeSelector?t.escapeSelector(n).substr(1):n.replace(/(:|\.|\[|\]|,|=|@)/g,"\\$1"));try{return t(document).find(i).length>0?i:null}catch(t){return null}},reflow:function(t){return t.offsetHeight},triggerTransitionEnd:function(n){t(n).trigger(e.end)},supportsTransitionEnd:function(){return Boolean(e)},isElement:function(t){return(t[0]||t).nodeType},typeCheckConfig:function(t,e,n){for(var s in n)if(Object.prototype.hasOwnProperty.call(n,s)){var r=n[s],o=e[s],a=o&&i.isElement(o)?"element":(l=o,{}.toString.call(l).match(/\s([a-zA-Z]+)/)[1].toLowerCase());if(!new RegExp(r).test(a))throw new Error(t.toUpperCase()+': Option "'+s+'" provided type "'+a+'" but expected type "'+r+'".')}var l}};return e=("undefined"==typeof window||!window.QUnit)&&{end:"transitionend"},t.fn.emulateTransitionEnd=n,i.supportsTransitionEnd()&&(t.event.special[i.TRANSITION_END]={bindType:e.end,delegateType:e.end,handle:function(e){if(t(e.target).is(this))return e.handleObj.handler.apply(this,arguments)}}),i}(e),L=(a="alert",h="."+(l="bs.alert"),c=(o=e).fn[a],u={CLOSE:"close"+h,CLOSED:"closed"+h,CLICK_DATA_API:"click"+h+".data-api"},f="alert",d="fade",_="show",g=function(){function t(t){this._element=t}var e=t.prototype;return e.close=function(t){t=t||this._element;var e=this._getRootElement(t);this._triggerCloseEvent(e).isDefaultPrevented()||this._removeElement(e)},e.dispose=function(){o.removeData(this._element,l),this._element=null},e._getRootElement=function(t){var e=P.getSelectorFromElement(t),n=!1;return e&&(n=o(e)[0]),n||(n=o(t).closest("."+f)[0]),n},e._triggerCloseEvent=function(t){var e=o.Event(u.CLOSE);return o(t).trigger(e),e},e._removeElement=function(t){var e=this;o(t).removeClass(_),P.supportsTransitionEnd()&&o(t).hasClass(d)?o(t).one(P.TRANSITION_END,function(n){return e._destroyElement(t,n)}).emulateTransitionEnd(150):this._destroyElement(t)},e._destroyElement=function(t){o(t).detach().trigger(u.CLOSED).remove()},t._jQueryInterface=function(e){return this.each(function(){var n=o(this),i=n.data(l);i||(i=new t(this),n.data(l,i)),"close"===e&&i[e](this)})},t._handleDismiss=function(t){return function(e){e&&e.preventDefault(),t.close(this)}},s(t,null,[{key:"VERSION",get:function(){return"4.0.0"}}]),t}(),o(document).on(u.CLICK_DATA_API,'[data-dismiss="alert"]',g._handleDismiss(new g)),o.fn[a]=g._jQueryInterface,o.fn[a].Constructor=g,o.fn[a].noConflict=function(){return o.fn[a]=c,g._jQueryInterface},g),R=(m="button",E="."+(v="bs.button"),T=".data-api",y=(p=e).fn[m],C="active",I="btn",A="focus",b='[data-toggle^="button"]',D='[data-toggle="buttons"]',S="input",w=".active",N=".btn",O={CLICK_DATA_API:"click"+E+T,FOCUS_BLUR_DATA_API:"focus"+E+T+" blur"+E+T},k=function(){function t(t){this._element=t}var e=t.prototype;return e.toggle=function(){var t=!0,e=!0,n=p(this._element).closest(D)[0];if(n){var i=p(this._element).find(S)[0];if(i){if("radio"===i.type)if(i.checked&&p(this._element).hasClass(C))t=!1;else{var s=p(n).find(w)[0];s&&p(s).removeClass(C)}if(t){if(i.hasAttribute("disabled")||n.hasAttribute("disabled")||i.classList.contains("disabled")||n.classList.contains("disabled"))return;i.checked=!p(this._element).hasClass(C),p(i).trigger("change")}i.focus(),e=!1}}e&&this._element.setAttribute("aria-pressed",!p(this._element).hasClass(C)),t&&p(this._element).toggleClass(C)},e.dispose=function(){p.removeData(this._element,v),this._element=null},t._jQueryInterface=function(e){return this.each(function(){var n=p(this).data(v);n||(n=new t(this),p(this).data(v,n)),"toggle"===e&&n[e]()})},s(t,null,[{key:"VERSION",get:function(){return"4.0.0"}}]),t}(),p(document).on(O.CLICK_DATA_API,b,function(t){t.preventDefault();var e=t.target;p(e).hasClass(I)||(e=p(e).closest(N)),k._jQueryInterface.call(p(e),"toggle")}).on(O.FOCUS_BLUR_DATA_API,b,function(t){var e=p(t.target).closest(N)[0];p(e).toggleClass(A,/^focus(in)?$/.test(t.type))}),p.fn[m]=k._jQueryInterface,p.fn[m].Constructor=k,p.fn[m].noConflict=function(){return p.fn[m]=y,k._jQueryInterface},k),j=function(t){var e="carousel",n="bs.carousel",i="."+n,o=t.fn[e],a={interval:5e3,keyboard:!0,slide:!1,pause:"hover",wrap:!0},l={interval:"(number|boolean)",keyboard:"boolean",slide:"(boolean|string)",pause:"(string|boolean)",wrap:"boolean"},h="next",c="prev",u="left",f="right",d={SLIDE:"slide"+i,SLID:"slid"+i,KEYDOWN:"keydown"+i,MOUSEENTER:"mouseenter"+i,MOUSELEAVE:"mouseleave"+i,TOUCHEND:"touchend"+i,LOAD_DATA_API:"load"+i+".data-api",CLICK_DATA_API:"click"+i+".data-api"},_="carousel",g="active",p="slide",m="carousel-item-right",v="carousel-item-left",E="carousel-item-next",T="carousel-item-prev",y={ACTIVE:".active",ACTIVE_ITEM:".active.carousel-item",ITEM:".carousel-item",NEXT_PREV:".carousel-item-next, .carousel-item-prev",INDICATORS:".carousel-indicators",DATA_SLIDE:"[data-slide], [data-slide-to]",DATA_RIDE:'[data-ride="carousel"]'},C=function(){function o(e,n){this._items=null,this._interval=null,this._activeElement=null,this._isPaused=!1,this._isSliding=!1,this.touchTimeout=null,this._config=this._getConfig(n),this._element=t(e)[0],this._indicatorsElement=t(this._element).find(y.INDICATORS)[0],this._addEventListeners()}var C=o.prototype;return C.next=function(){this._isSliding||this._slide(h)},C.nextWhenVisible=function(){!document.hidden&&t(this._element).is(":visible")&&"hidden"!==t(this._element).css("visibility")&&this.next()},C.prev=function(){this._isSliding||this._slide(c)},C.pause=function(e){e||(this._isPaused=!0),t(this._element).find(y.NEXT_PREV)[0]&&P.supportsTransitionEnd()&&(P.triggerTransitionEnd(this._element),this.cycle(!0)),clearInterval(this._interval),this._interval=null},C.cycle=function(t){t||(this._isPaused=!1),this._interval&&(clearInterval(this._interval),this._interval=null),this._config.interval&&!this._isPaused&&(this._interval=setInterval((document.visibilityState?this.nextWhenVisible:this.next).bind(this),this._config.interval))},C.to=function(e){var n=this;this._activeElement=t(this._element).find(y.ACTIVE_ITEM)[0];var i=this._getItemIndex(this._activeElement);if(!(e>this._items.length-1||e<0))if(this._isSliding)t(this._element).one(d.SLID,function(){return n.to(e)});else{if(i===e)return this.pause(),void this.cycle();var s=e>i?h:c;this._slide(s,this._items[e])}},C.dispose=function(){t(this._element).off(i),t.removeData(this._element,n),this._items=null,this._config=null,this._element=null,this._interval=null,this._isPaused=null,this._isSliding=null,this._activeElement=null,this._indicatorsElement=null},C._getConfig=function(t){return t=r({},a,t),P.typeCheckConfig(e,t,l),t},C._addEventListeners=function(){var e=this;this._config.keyboard&&t(this._element).on(d.KEYDOWN,function(t){return e._keydown(t)}),"hover"===this._config.pause&&(t(this._element).on(d.MOUSEENTER,function(t){return e.pause(t)}).on(d.MOUSELEAVE,function(t){return e.cycle(t)}),"ontouchstart"in document.documentElement&&t(this._element).on(d.TOUCHEND,function(){e.pause(),e.touchTimeout&&clearTimeout(e.touchTimeout),e.touchTimeout=setTimeout(function(t){return e.cycle(t)},500+e._config.interval)}))},C._keydown=function(t){if(!/input|textarea/i.test(t.target.tagName))switch(t.which){case 37:t.preventDefault(),this.prev();break;case 39:t.preventDefault(),this.next()}},C._getItemIndex=function(e){return this._items=t.makeArray(t(e).parent().find(y.ITEM)),this._items.indexOf(e)},C._getItemByDirection=function(t,e){var n=t===h,i=t===c,s=this._getItemIndex(e),r=this._items.length-1;if((i&&0===s||n&&s===r)&&!this._config.wrap)return e;var o=(s+(t===c?-1:1))%this._items.length;return-1===o?this._items[this._items.length-1]:this._items[o]},C._triggerSlideEvent=function(e,n){var i=this._getItemIndex(e),s=this._getItemIndex(t(this._element).find(y.ACTIVE_ITEM)[0]),r=t.Event(d.SLIDE,{relatedTarget:e,direction:n,from:s,to:i});return t(this._element).trigger(r),r},C._setActiveIndicatorElement=function(e){if(this._indicatorsElement){t(this._indicatorsElement).find(y.ACTIVE).removeClass(g);var n=this._indicatorsElement.children[this._getItemIndex(e)];n&&t(n).addClass(g)}},C._slide=function(e,n){var i,s,r,o=this,a=t(this._element).find(y.ACTIVE_ITEM)[0],l=this._getItemIndex(a),c=n||a&&this._getItemByDirection(e,a),_=this._getItemIndex(c),C=Boolean(this._interval);if(e===h?(i=v,s=E,r=u):(i=m,s=T,r=f),c&&t(c).hasClass(g))this._isSliding=!1;else if(!this._triggerSlideEvent(c,r).isDefaultPrevented()&&a&&c){this._isSliding=!0,C&&this.pause(),this._setActiveIndicatorElement(c);var I=t.Event(d.SLID,{relatedTarget:c,direction:r,from:l,to:_});P.supportsTransitionEnd()&&t(this._element).hasClass(p)?(t(c).addClass(s),P.reflow(c),t(a).addClass(i),t(c).addClass(i),t(a).one(P.TRANSITION_END,function(){t(c).removeClass(i+" "+s).addClass(g),t(a).removeClass(g+" "+s+" "+i),o._isSliding=!1,setTimeout(function(){return t(o._element).trigger(I)},0)}).emulateTransitionEnd(600)):(t(a).removeClass(g),t(c).addClass(g),this._isSliding=!1,t(this._element).trigger(I)),C&&this.cycle()}},o._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n),s=r({},a,t(this).data());"object"==typeof e&&(s=r({},s,e));var l="string"==typeof e?e:s.slide;if(i||(i=new o(this,s),t(this).data(n,i)),"number"==typeof e)i.to(e);else if("string"==typeof l){if("undefined"==typeof i[l])throw new TypeError('No method named "'+l+'"');i[l]()}else s.interval&&(i.pause(),i.cycle())})},o._dataApiClickHandler=function(e){var i=P.getSelectorFromElement(this);if(i){var s=t(i)[0];if(s&&t(s).hasClass(_)){var a=r({},t(s).data(),t(this).data()),l=this.getAttribute("data-slide-to");l&&(a.interval=!1),o._jQueryInterface.call(t(s),a),l&&t(s).data(n).to(l),e.preventDefault()}}},s(o,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return a}}]),o}();return t(document).on(d.CLICK_DATA_API,y.DATA_SLIDE,C._dataApiClickHandler),t(window).on(d.LOAD_DATA_API,function(){t(y.DATA_RIDE).each(function(){var e=t(this);C._jQueryInterface.call(e,e.data())})}),t.fn[e]=C._jQueryInterface,t.fn[e].Constructor=C,t.fn[e].noConflict=function(){return t.fn[e]=o,C._jQueryInterface},C}(e),H=function(t){var e="collapse",n="bs.collapse",i="."+n,o=t.fn[e],a={toggle:!0,parent:""},l={toggle:"boolean",parent:"(string|element)"},h={SHOW:"show"+i,SHOWN:"shown"+i,HIDE:"hide"+i,HIDDEN:"hidden"+i,CLICK_DATA_API:"click"+i+".data-api"},c="show",u="collapse",f="collapsing",d="collapsed",_="width",g="height",p={ACTIVES:".show, .collapsing",DATA_TOGGLE:'[data-toggle="collapse"]'},m=function(){function i(e,n){this._isTransitioning=!1,this._element=e,this._config=this._getConfig(n),this._triggerArray=t.makeArray(t('[data-toggle="collapse"][href="#'+e.id+'"],[data-toggle="collapse"][data-target="#'+e.id+'"]'));for(var i=t(p.DATA_TOGGLE),s=0;s<i.length;s++){var r=i[s],o=P.getSelectorFromElement(r);null!==o&&t(o).filter(e).length>0&&(this._selector=o,this._triggerArray.push(r))}this._parent=this._config.parent?this._getParent():null,this._config.parent||this._addAriaAndCollapsedClass(this._element,this._triggerArray),this._config.toggle&&this.toggle()}var o=i.prototype;return o.toggle=function(){t(this._element).hasClass(c)?this.hide():this.show()},o.show=function(){var e,s,r=this;if(!this._isTransitioning&&!t(this._element).hasClass(c)&&(this._parent&&0===(e=t.makeArray(t(this._parent).find(p.ACTIVES).filter('[data-parent="'+this._config.parent+'"]'))).length&&(e=null),!(e&&(s=t(e).not(this._selector).data(n))&&s._isTransitioning))){var o=t.Event(h.SHOW);if(t(this._element).trigger(o),!o.isDefaultPrevented()){e&&(i._jQueryInterface.call(t(e).not(this._selector),"hide"),s||t(e).data(n,null));var a=this._getDimension();t(this._element).removeClass(u).addClass(f),this._element.style[a]=0,this._triggerArray.length>0&&t(this._triggerArray).removeClass(d).attr("aria-expanded",!0),this.setTransitioning(!0);var l=function(){t(r._element).removeClass(f).addClass(u).addClass(c),r._element.style[a]="",r.setTransitioning(!1),t(r._element).trigger(h.SHOWN)};if(P.supportsTransitionEnd()){var _="scroll"+(a[0].toUpperCase()+a.slice(1));t(this._element).one(P.TRANSITION_END,l).emulateTransitionEnd(600),this._element.style[a]=this._element[_]+"px"}else l()}}},o.hide=function(){var e=this;if(!this._isTransitioning&&t(this._element).hasClass(c)){var n=t.Event(h.HIDE);if(t(this._element).trigger(n),!n.isDefaultPrevented()){var i=this._getDimension();if(this._element.style[i]=this._element.getBoundingClientRect()[i]+"px",P.reflow(this._element),t(this._element).addClass(f).removeClass(u).removeClass(c),this._triggerArray.length>0)for(var s=0;s<this._triggerArray.length;s++){var r=this._triggerArray[s],o=P.getSelectorFromElement(r);if(null!==o)t(o).hasClass(c)||t(r).addClass(d).attr("aria-expanded",!1)}this.setTransitioning(!0);var a=function(){e.setTransitioning(!1),t(e._element).removeClass(f).addClass(u).trigger(h.HIDDEN)};this._element.style[i]="",P.supportsTransitionEnd()?t(this._element).one(P.TRANSITION_END,a).emulateTransitionEnd(600):a()}}},o.setTransitioning=function(t){this._isTransitioning=t},o.dispose=function(){t.removeData(this._element,n),this._config=null,this._parent=null,this._element=null,this._triggerArray=null,this._isTransitioning=null},o._getConfig=function(t){return(t=r({},a,t)).toggle=Boolean(t.toggle),P.typeCheckConfig(e,t,l),t},o._getDimension=function(){return t(this._element).hasClass(_)?_:g},o._getParent=function(){var e=this,n=null;P.isElement(this._config.parent)?(n=this._config.parent,"undefined"!=typeof this._config.parent.jquery&&(n=this._config.parent[0])):n=t(this._config.parent)[0];var s='[data-toggle="collapse"][data-parent="'+this._config.parent+'"]';return t(n).find(s).each(function(t,n){e._addAriaAndCollapsedClass(i._getTargetFromElement(n),[n])}),n},o._addAriaAndCollapsedClass=function(e,n){if(e){var i=t(e).hasClass(c);n.length>0&&t(n).toggleClass(d,!i).attr("aria-expanded",i)}},i._getTargetFromElement=function(e){var n=P.getSelectorFromElement(e);return n?t(n)[0]:null},i._jQueryInterface=function(e){return this.each(function(){var s=t(this),o=s.data(n),l=r({},a,s.data(),"object"==typeof e&&e);if(!o&&l.toggle&&/show|hide/.test(e)&&(l.toggle=!1),o||(o=new i(this,l),s.data(n,o)),"string"==typeof e){if("undefined"==typeof o[e])throw new TypeError('No method named "'+e+'"');o[e]()}})},s(i,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return a}}]),i}();return t(document).on(h.CLICK_DATA_API,p.DATA_TOGGLE,function(e){"A"===e.currentTarget.tagName&&e.preventDefault();var i=t(this),s=P.getSelectorFromElement(this);t(s).each(function(){var e=t(this),s=e.data(n)?"toggle":i.data();m._jQueryInterface.call(e,s)})}),t.fn[e]=m._jQueryInterface,t.fn[e].Constructor=m,t.fn[e].noConflict=function(){return t.fn[e]=o,m._jQueryInterface},m}(e),W=function(t){var e="dropdown",i="bs.dropdown",o="."+i,a=".data-api",l=t.fn[e],h=new RegExp("38|40|27"),c={HIDE:"hide"+o,HIDDEN:"hidden"+o,SHOW:"show"+o,SHOWN:"shown"+o,CLICK:"click"+o,CLICK_DATA_API:"click"+o+a,KEYDOWN_DATA_API:"keydown"+o+a,KEYUP_DATA_API:"keyup"+o+a},u="disabled",f="show",d="dropup",_="dropright",g="dropleft",p="dropdown-menu-right",m="dropdown-menu-left",v="position-static",E='[data-toggle="dropdown"]',T=".dropdown form",y=".dropdown-menu",C=".navbar-nav",I=".dropdown-menu .dropdown-item:not(.disabled)",A="top-start",b="top-end",D="bottom-start",S="bottom-end",w="right-start",N="left-start",O={offset:0,flip:!0,boundary:"scrollParent"},k={offset:"(number|string|function)",flip:"boolean",boundary:"(string|element)"},L=function(){function a(t,e){this._element=t,this._popper=null,this._config=this._getConfig(e),this._menu=this._getMenuElement(),this._inNavbar=this._detectNavbar(),this._addEventListeners()}var l=a.prototype;return l.toggle=function(){if(!this._element.disabled&&!t(this._element).hasClass(u)){var e=a._getParentFromElement(this._element),i=t(this._menu).hasClass(f);if(a._clearMenus(),!i){var s={relatedTarget:this._element},r=t.Event(c.SHOW,s);if(t(e).trigger(r),!r.isDefaultPrevented()){if(!this._inNavbar){if("undefined"==typeof n)throw new TypeError("Bootstrap dropdown require Popper.js (https://popper.js.org)");var o=this._element;t(e).hasClass(d)&&(t(this._menu).hasClass(m)||t(this._menu).hasClass(p))&&(o=e),"scrollParent"!==this._config.boundary&&t(e).addClass(v),this._popper=new n(o,this._menu,this._getPopperConfig())}"ontouchstart"in document.documentElement&&0===t(e).closest(C).length&&t("body").children().on("mouseover",null,t.noop),this._element.focus(),this._element.setAttribute("aria-expanded",!0),t(this._menu).toggleClass(f),t(e).toggleClass(f).trigger(t.Event(c.SHOWN,s))}}}},l.dispose=function(){t.removeData(this._element,i),t(this._element).off(o),this._element=null,this._menu=null,null!==this._popper&&(this._popper.destroy(),this._popper=null)},l.update=function(){this._inNavbar=this._detectNavbar(),null!==this._popper&&this._popper.scheduleUpdate()},l._addEventListeners=function(){var e=this;t(this._element).on(c.CLICK,function(t){t.preventDefault(),t.stopPropagation(),e.toggle()})},l._getConfig=function(n){return n=r({},this.constructor.Default,t(this._element).data(),n),P.typeCheckConfig(e,n,this.constructor.DefaultType),n},l._getMenuElement=function(){if(!this._menu){var e=a._getParentFromElement(this._element);this._menu=t(e).find(y)[0]}return this._menu},l._getPlacement=function(){var e=t(this._element).parent(),n=D;return e.hasClass(d)?(n=A,t(this._menu).hasClass(p)&&(n=b)):e.hasClass(_)?n=w:e.hasClass(g)?n=N:t(this._menu).hasClass(p)&&(n=S),n},l._detectNavbar=function(){return t(this._element).closest(".navbar").length>0},l._getPopperConfig=function(){var t=this,e={};return"function"==typeof this._config.offset?e.fn=function(e){return e.offsets=r({},e.offsets,t._config.offset(e.offsets)||{}),e}:e.offset=this._config.offset,{placement:this._getPlacement(),modifiers:{offset:e,flip:{enabled:this._config.flip},preventOverflow:{boundariesElement:this._config.boundary}}}},a._jQueryInterface=function(e){return this.each(function(){var n=t(this).data(i);if(n||(n=new a(this,"object"==typeof e?e:null),t(this).data(i,n)),"string"==typeof e){if("undefined"==typeof n[e])throw new TypeError('No method named "'+e+'"');n[e]()}})},a._clearMenus=function(e){if(!e||3!==e.which&&("keyup"!==e.type||9===e.which))for(var n=t.makeArray(t(E)),s=0;s<n.length;s++){var r=a._getParentFromElement(n[s]),o=t(n[s]).data(i),l={relatedTarget:n[s]};if(o){var h=o._menu;if(t(r).hasClass(f)&&!(e&&("click"===e.type&&/input|textarea/i.test(e.target.tagName)||"keyup"===e.type&&9===e.which)&&t.contains(r,e.target))){var u=t.Event(c.HIDE,l);t(r).trigger(u),u.isDefaultPrevented()||("ontouchstart"in document.documentElement&&t("body").children().off("mouseover",null,t.noop),n[s].setAttribute("aria-expanded","false"),t(h).removeClass(f),t(r).removeClass(f).trigger(t.Event(c.HIDDEN,l)))}}}},a._getParentFromElement=function(e){var n,i=P.getSelectorFromElement(e);return i&&(n=t(i)[0]),n||e.parentNode},a._dataApiKeydownHandler=function(e){if((/input|textarea/i.test(e.target.tagName)?!(32===e.which||27!==e.which&&(40!==e.which&&38!==e.which||t(e.target).closest(y).length)):h.test(e.which))&&(e.preventDefault(),e.stopPropagation(),!this.disabled&&!t(this).hasClass(u))){var n=a._getParentFromElement(this),i=t(n).hasClass(f);if((i||27===e.which&&32===e.which)&&(!i||27!==e.which&&32!==e.which)){var s=t(n).find(I).get();if(0!==s.length){var r=s.indexOf(e.target);38===e.which&&r>0&&r--,40===e.which&&r<s.length-1&&r++,r<0&&(r=0),s[r].focus()}}else{if(27===e.which){var o=t(n).find(E)[0];t(o).trigger("focus")}t(this).trigger("click")}}},s(a,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return O}},{key:"DefaultType",get:function(){return k}}]),a}();return t(document).on(c.KEYDOWN_DATA_API,E,L._dataApiKeydownHandler).on(c.KEYDOWN_DATA_API,y,L._dataApiKeydownHandler).on(c.CLICK_DATA_API+" "+c.KEYUP_DATA_API,L._clearMenus).on(c.CLICK_DATA_API,E,function(e){e.preventDefault(),e.stopPropagation(),L._jQueryInterface.call(t(this),"toggle")}).on(c.CLICK_DATA_API,T,function(t){t.stopPropagation()}),t.fn[e]=L._jQueryInterface,t.fn[e].Constructor=L,t.fn[e].noConflict=function(){return t.fn[e]=l,L._jQueryInterface},L}(e),M=function(t){var e="modal",n="bs.modal",i="."+n,o=t.fn.modal,a={backdrop:!0,keyboard:!0,focus:!0,show:!0},l={backdrop:"(boolean|string)",keyboard:"boolean",focus:"boolean",show:"boolean"},h={HIDE:"hide"+i,HIDDEN:"hidden"+i,SHOW:"show"+i,SHOWN:"shown"+i,FOCUSIN:"focusin"+i,RESIZE:"resize"+i,CLICK_DISMISS:"click.dismiss"+i,KEYDOWN_DISMISS:"keydown.dismiss"+i,MOUSEUP_DISMISS:"mouseup.dismiss"+i,MOUSEDOWN_DISMISS:"mousedown.dismiss"+i,CLICK_DATA_API:"click"+i+".data-api"},c="modal-scrollbar-measure",u="modal-backdrop",f="modal-open",d="fade",_="show",g={DIALOG:".modal-dialog",DATA_TOGGLE:'[data-toggle="modal"]',DATA_DISMISS:'[data-dismiss="modal"]',FIXED_CONTENT:".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",STICKY_CONTENT:".sticky-top",NAVBAR_TOGGLER:".navbar-toggler"},p=function(){function o(e,n){this._config=this._getConfig(n),this._element=e,this._dialog=t(e).find(g.DIALOG)[0],this._backdrop=null,this._isShown=!1,this._isBodyOverflowing=!1,this._ignoreBackdropClick=!1,this._originalBodyPadding=0,this._scrollbarWidth=0}var p=o.prototype;return p.toggle=function(t){return this._isShown?this.hide():this.show(t)},p.show=function(e){var n=this;if(!this._isTransitioning&&!this._isShown){P.supportsTransitionEnd()&&t(this._element).hasClass(d)&&(this._isTransitioning=!0);var i=t.Event(h.SHOW,{relatedTarget:e});t(this._element).trigger(i),this._isShown||i.isDefaultPrevented()||(this._isShown=!0,this._checkScrollbar(),this._setScrollbar(),this._adjustDialog(),t(document.body).addClass(f),this._setEscapeEvent(),this._setResizeEvent(),t(this._element).on(h.CLICK_DISMISS,g.DATA_DISMISS,function(t){return n.hide(t)}),t(this._dialog).on(h.MOUSEDOWN_DISMISS,function(){t(n._element).one(h.MOUSEUP_DISMISS,function(e){t(e.target).is(n._element)&&(n._ignoreBackdropClick=!0)})}),this._showBackdrop(function(){return n._showElement(e)}))}},p.hide=function(e){var n=this;if(e&&e.preventDefault(),!this._isTransitioning&&this._isShown){var i=t.Event(h.HIDE);if(t(this._element).trigger(i),this._isShown&&!i.isDefaultPrevented()){this._isShown=!1;var s=P.supportsTransitionEnd()&&t(this._element).hasClass(d);s&&(this._isTransitioning=!0),this._setEscapeEvent(),this._setResizeEvent(),t(document).off(h.FOCUSIN),t(this._element).removeClass(_),t(this._element).off(h.CLICK_DISMISS),t(this._dialog).off(h.MOUSEDOWN_DISMISS),s?t(this._element).one(P.TRANSITION_END,function(t){return n._hideModal(t)}).emulateTransitionEnd(300):this._hideModal()}}},p.dispose=function(){t.removeData(this._element,n),t(window,document,this._element,this._backdrop).off(i),this._config=null,this._element=null,this._dialog=null,this._backdrop=null,this._isShown=null,this._isBodyOverflowing=null,this._ignoreBackdropClick=null,this._scrollbarWidth=null},p.handleUpdate=function(){this._adjustDialog()},p._getConfig=function(t){return t=r({},a,t),P.typeCheckConfig(e,t,l),t},p._showElement=function(e){var n=this,i=P.supportsTransitionEnd()&&t(this._element).hasClass(d);this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE||document.body.appendChild(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.scrollTop=0,i&&P.reflow(this._element),t(this._element).addClass(_),this._config.focus&&this._enforceFocus();var s=t.Event(h.SHOWN,{relatedTarget:e}),r=function(){n._config.focus&&n._element.focus(),n._isTransitioning=!1,t(n._element).trigger(s)};i?t(this._dialog).one(P.TRANSITION_END,r).emulateTransitionEnd(300):r()},p._enforceFocus=function(){var e=this;t(document).off(h.FOCUSIN).on(h.FOCUSIN,function(n){document!==n.target&&e._element!==n.target&&0===t(e._element).has(n.target).length&&e._element.focus()})},p._setEscapeEvent=function(){var e=this;this._isShown&&this._config.keyboard?t(this._element).on(h.KEYDOWN_DISMISS,function(t){27===t.which&&(t.preventDefault(),e.hide())}):this._isShown||t(this._element).off(h.KEYDOWN_DISMISS)},p._setResizeEvent=function(){var e=this;this._isShown?t(window).on(h.RESIZE,function(t){return e.handleUpdate(t)}):t(window).off(h.RESIZE)},p._hideModal=function(){var e=this;this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._isTransitioning=!1,this._showBackdrop(function(){t(document.body).removeClass(f),e._resetAdjustments(),e._resetScrollbar(),t(e._element).trigger(h.HIDDEN)})},p._removeBackdrop=function(){this._backdrop&&(t(this._backdrop).remove(),this._backdrop=null)},p._showBackdrop=function(e){var n=this,i=t(this._element).hasClass(d)?d:"";if(this._isShown&&this._config.backdrop){var s=P.supportsTransitionEnd()&&i;if(this._backdrop=document.createElement("div"),this._backdrop.className=u,i&&t(this._backdrop).addClass(i),t(this._backdrop).appendTo(document.body),t(this._element).on(h.CLICK_DISMISS,function(t){n._ignoreBackdropClick?n._ignoreBackdropClick=!1:t.target===t.currentTarget&&("static"===n._config.backdrop?n._element.focus():n.hide())}),s&&P.reflow(this._backdrop),t(this._backdrop).addClass(_),!e)return;if(!s)return void e();t(this._backdrop).one(P.TRANSITION_END,e).emulateTransitionEnd(150)}else if(!this._isShown&&this._backdrop){t(this._backdrop).removeClass(_);var r=function(){n._removeBackdrop(),e&&e()};P.supportsTransitionEnd()&&t(this._element).hasClass(d)?t(this._backdrop).one(P.TRANSITION_END,r).emulateTransitionEnd(150):r()}else e&&e()},p._adjustDialog=function(){var t=this._element.scrollHeight>document.documentElement.clientHeight;!this._isBodyOverflowing&&t&&(this._element.style.paddingLeft=this._scrollbarWidth+"px"),this._isBodyOverflowing&&!t&&(this._element.style.paddingRight=this._scrollbarWidth+"px")},p._resetAdjustments=function(){this._element.style.paddingLeft="",this._element.style.paddingRight=""},p._checkScrollbar=function(){var t=document.body.getBoundingClientRect();this._isBodyOverflowing=t.left+t.right<window.innerWidth,this._scrollbarWidth=this._getScrollbarWidth()},p._setScrollbar=function(){var e=this;if(this._isBodyOverflowing){t(g.FIXED_CONTENT).each(function(n,i){var s=t(i)[0].style.paddingRight,r=t(i).css("padding-right");t(i).data("padding-right",s).css("padding-right",parseFloat(r)+e._scrollbarWidth+"px")}),t(g.STICKY_CONTENT).each(function(n,i){var s=t(i)[0].style.marginRight,r=t(i).css("margin-right");t(i).data("margin-right",s).css("margin-right",parseFloat(r)-e._scrollbarWidth+"px")}),t(g.NAVBAR_TOGGLER).each(function(n,i){var s=t(i)[0].style.marginRight,r=t(i).css("margin-right");t(i).data("margin-right",s).css("margin-right",parseFloat(r)+e._scrollbarWidth+"px")});var n=document.body.style.paddingRight,i=t("body").css("padding-right");t("body").data("padding-right",n).css("padding-right",parseFloat(i)+this._scrollbarWidth+"px")}},p._resetScrollbar=function(){t(g.FIXED_CONTENT).each(function(e,n){var i=t(n).data("padding-right");"undefined"!=typeof i&&t(n).css("padding-right",i).removeData("padding-right")}),t(g.STICKY_CONTENT+", "+g.NAVBAR_TOGGLER).each(function(e,n){var i=t(n).data("margin-right");"undefined"!=typeof i&&t(n).css("margin-right",i).removeData("margin-right")});var e=t("body").data("padding-right");"undefined"!=typeof e&&t("body").css("padding-right",e).removeData("padding-right")},p._getScrollbarWidth=function(){var t=document.createElement("div");t.className=c,document.body.appendChild(t);var e=t.getBoundingClientRect().width-t.clientWidth;return document.body.removeChild(t),e},o._jQueryInterface=function(e,i){return this.each(function(){var s=t(this).data(n),a=r({},o.Default,t(this).data(),"object"==typeof e&&e);if(s||(s=new o(this,a),t(this).data(n,s)),"string"==typeof e){if("undefined"==typeof s[e])throw new TypeError('No method named "'+e+'"');s[e](i)}else a.show&&s.show(i)})},s(o,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return a}}]),o}();return t(document).on(h.CLICK_DATA_API,g.DATA_TOGGLE,function(e){var i,s=this,o=P.getSelectorFromElement(this);o&&(i=t(o)[0]);var a=t(i).data(n)?"toggle":r({},t(i).data(),t(this).data());"A"!==this.tagName&&"AREA"!==this.tagName||e.preventDefault();var l=t(i).one(h.SHOW,function(e){e.isDefaultPrevented()||l.one(h.HIDDEN,function(){t(s).is(":visible")&&s.focus()})});p._jQueryInterface.call(t(i),a,this)}),t.fn.modal=p._jQueryInterface,t.fn.modal.Constructor=p,t.fn.modal.noConflict=function(){return t.fn.modal=o,p._jQueryInterface},p}(e),U=function(t){var e="tooltip",i="bs.tooltip",o="."+i,a=t.fn[e],l=new RegExp("(^|\\s)bs-tooltip\\S+","g"),h={animation:"boolean",template:"string",title:"(string|element|function)",trigger:"string",delay:"(number|object)",html:"boolean",selector:"(string|boolean)",placement:"(string|function)",offset:"(number|string)",container:"(string|element|boolean)",fallbackPlacement:"(string|array)",boundary:"(string|element)"},c={AUTO:"auto",TOP:"top",RIGHT:"right",BOTTOM:"bottom",LEFT:"left"},u={animation:!0,template:'<div class="tooltip" role="tooltip"><div class="arrow"></div><div class="tooltip-inner"></div></div>',trigger:"hover focus",title:"",delay:0,html:!1,selector:!1,placement:"top",offset:0,container:!1,fallbackPlacement:"flip",boundary:"scrollParent"},f="show",d="out",_={HIDE:"hide"+o,HIDDEN:"hidden"+o,SHOW:"show"+o,SHOWN:"shown"+o,INSERTED:"inserted"+o,CLICK:"click"+o,FOCUSIN:"focusin"+o,FOCUSOUT:"focusout"+o,MOUSEENTER:"mouseenter"+o,MOUSELEAVE:"mouseleave"+o},g="fade",p="show",m=".tooltip-inner",v=".arrow",E="hover",T="focus",y="click",C="manual",I=function(){function a(t,e){if("undefined"==typeof n)throw new TypeError("Bootstrap tooltips require Popper.js (https://popper.js.org)");this._isEnabled=!0,this._timeout=0,this._hoverState="",this._activeTrigger={},this._popper=null,this.element=t,this.config=this._getConfig(e),this.tip=null,this._setListeners()}var I=a.prototype;return I.enable=function(){this._isEnabled=!0},I.disable=function(){this._isEnabled=!1},I.toggleEnabled=function(){this._isEnabled=!this._isEnabled},I.toggle=function(e){if(this._isEnabled)if(e){var n=this.constructor.DATA_KEY,i=t(e.currentTarget).data(n);i||(i=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(n,i)),i._activeTrigger.click=!i._activeTrigger.click,i._isWithActiveTrigger()?i._enter(null,i):i._leave(null,i)}else{if(t(this.getTipElement()).hasClass(p))return void this._leave(null,this);this._enter(null,this)}},I.dispose=function(){clearTimeout(this._timeout),t.removeData(this.element,this.constructor.DATA_KEY),t(this.element).off(this.constructor.EVENT_KEY),t(this.element).closest(".modal").off("hide.bs.modal"),this.tip&&t(this.tip).remove(),this._isEnabled=null,this._timeout=null,this._hoverState=null,this._activeTrigger=null,null!==this._popper&&this._popper.destroy(),this._popper=null,this.element=null,this.config=null,this.tip=null},I.show=function(){var e=this;if("none"===t(this.element).css("display"))throw new Error("Please use show on visible elements");var i=t.Event(this.constructor.Event.SHOW);if(this.isWithContent()&&this._isEnabled){t(this.element).trigger(i);var s=t.contains(this.element.ownerDocument.documentElement,this.element);if(i.isDefaultPrevented()||!s)return;var r=this.getTipElement(),o=P.getUID(this.constructor.NAME);r.setAttribute("id",o),this.element.setAttribute("aria-describedby",o),this.setContent(),this.config.animation&&t(r).addClass(g);var l="function"==typeof this.config.placement?this.config.placement.call(this,r,this.element):this.config.placement,h=this._getAttachment(l);this.addAttachmentClass(h);var c=!1===this.config.container?document.body:t(this.config.container);t(r).data(this.constructor.DATA_KEY,this),t.contains(this.element.ownerDocument.documentElement,this.tip)||t(r).appendTo(c),t(this.element).trigger(this.constructor.Event.INSERTED),this._popper=new n(this.element,r,{placement:h,modifiers:{offset:{offset:this.config.offset},flip:{behavior:this.config.fallbackPlacement},arrow:{element:v},preventOverflow:{boundariesElement:this.config.boundary}},onCreate:function(t){t.originalPlacement!==t.placement&&e._handlePopperPlacementChange(t)},onUpdate:function(t){e._handlePopperPlacementChange(t)}}),t(r).addClass(p),"ontouchstart"in document.documentElement&&t("body").children().on("mouseover",null,t.noop);var u=function(){e.config.animation&&e._fixTransition();var n=e._hoverState;e._hoverState=null,t(e.element).trigger(e.constructor.Event.SHOWN),n===d&&e._leave(null,e)};P.supportsTransitionEnd()&&t(this.tip).hasClass(g)?t(this.tip).one(P.TRANSITION_END,u).emulateTransitionEnd(a._TRANSITION_DURATION):u()}},I.hide=function(e){var n=this,i=this.getTipElement(),s=t.Event(this.constructor.Event.HIDE),r=function(){n._hoverState!==f&&i.parentNode&&i.parentNode.removeChild(i),n._cleanTipClass(),n.element.removeAttribute("aria-describedby"),t(n.element).trigger(n.constructor.Event.HIDDEN),null!==n._popper&&n._popper.destroy(),e&&e()};t(this.element).trigger(s),s.isDefaultPrevented()||(t(i).removeClass(p),"ontouchstart"in document.documentElement&&t("body").children().off("mouseover",null,t.noop),this._activeTrigger[y]=!1,this._activeTrigger[T]=!1,this._activeTrigger[E]=!1,P.supportsTransitionEnd()&&t(this.tip).hasClass(g)?t(i).one(P.TRANSITION_END,r).emulateTransitionEnd(150):r(),this._hoverState="")},I.update=function(){null!==this._popper&&this._popper.scheduleUpdate()},I.isWithContent=function(){return Boolean(this.getTitle())},I.addAttachmentClass=function(e){t(this.getTipElement()).addClass("bs-tooltip-"+e)},I.getTipElement=function(){return this.tip=this.tip||t(this.config.template)[0],this.tip},I.setContent=function(){var e=t(this.getTipElement());this.setElementContent(e.find(m),this.getTitle()),e.removeClass(g+" "+p)},I.setElementContent=function(e,n){var i=this.config.html;"object"==typeof n&&(n.nodeType||n.jquery)?i?t(n).parent().is(e)||e.empty().append(n):e.text(t(n).text()):e[i?"html":"text"](n)},I.getTitle=function(){var t=this.element.getAttribute("data-original-title");return t||(t="function"==typeof this.config.title?this.config.title.call(this.element):this.config.title),t},I._getAttachment=function(t){return c[t.toUpperCase()]},I._setListeners=function(){var e=this;this.config.trigger.split(" ").forEach(function(n){if("click"===n)t(e.element).on(e.constructor.Event.CLICK,e.config.selector,function(t){return e.toggle(t)});else if(n!==C){var i=n===E?e.constructor.Event.MOUSEENTER:e.constructor.Event.FOCUSIN,s=n===E?e.constructor.Event.MOUSELEAVE:e.constructor.Event.FOCUSOUT;t(e.element).on(i,e.config.selector,function(t){return e._enter(t)}).on(s,e.config.selector,function(t){return e._leave(t)})}t(e.element).closest(".modal").on("hide.bs.modal",function(){return e.hide()})}),this.config.selector?this.config=r({},this.config,{trigger:"manual",selector:""}):this._fixTitle()},I._fixTitle=function(){var t=typeof this.element.getAttribute("data-original-title");(this.element.getAttribute("title")||"string"!==t)&&(this.element.setAttribute("data-original-title",this.element.getAttribute("title")||""),this.element.setAttribute("title",""))},I._enter=function(e,n){var i=this.constructor.DATA_KEY;(n=n||t(e.currentTarget).data(i))||(n=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(i,n)),e&&(n._activeTrigger["focusin"===e.type?T:E]=!0),t(n.getTipElement()).hasClass(p)||n._hoverState===f?n._hoverState=f:(clearTimeout(n._timeout),n._hoverState=f,n.config.delay&&n.config.delay.show?n._timeout=setTimeout(function(){n._hoverState===f&&n.show()},n.config.delay.show):n.show())},I._leave=function(e,n){var i=this.constructor.DATA_KEY;(n=n||t(e.currentTarget).data(i))||(n=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(i,n)),e&&(n._activeTrigger["focusout"===e.type?T:E]=!1),n._isWithActiveTrigger()||(clearTimeout(n._timeout),n._hoverState=d,n.config.delay&&n.config.delay.hide?n._timeout=setTimeout(function(){n._hoverState===d&&n.hide()},n.config.delay.hide):n.hide())},I._isWithActiveTrigger=function(){for(var t in this._activeTrigger)if(this._activeTrigger[t])return!0;return!1},I._getConfig=function(n){return"number"==typeof(n=r({},this.constructor.Default,t(this.element).data(),n)).delay&&(n.delay={show:n.delay,hide:n.delay}),"number"==typeof n.title&&(n.title=n.title.toString()),"number"==typeof n.content&&(n.content=n.content.toString()),P.typeCheckConfig(e,n,this.constructor.DefaultType),n},I._getDelegateConfig=function(){var t={};if(this.config)for(var e in this.config)this.constructor.Default[e]!==this.config[e]&&(t[e]=this.config[e]);return t},I._cleanTipClass=function(){var e=t(this.getTipElement()),n=e.attr("class").match(l);null!==n&&n.length>0&&e.removeClass(n.join(""))},I._handlePopperPlacementChange=function(t){this._cleanTipClass(),this.addAttachmentClass(this._getAttachment(t.placement))},I._fixTransition=function(){var e=this.getTipElement(),n=this.config.animation;null===e.getAttribute("x-placement")&&(t(e).removeClass(g),this.config.animation=!1,this.hide(),this.show(),this.config.animation=n)},a._jQueryInterface=function(e){return this.each(function(){var n=t(this).data(i),s="object"==typeof e&&e;if((n||!/dispose|hide/.test(e))&&(n||(n=new a(this,s),t(this).data(i,n)),"string"==typeof e)){if("undefined"==typeof n[e])throw new TypeError('No method named "'+e+'"');n[e]()}})},s(a,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return u}},{key:"NAME",get:function(){return e}},{key:"DATA_KEY",get:function(){return i}},{key:"Event",get:function(){return _}},{key:"EVENT_KEY",get:function(){return o}},{key:"DefaultType",get:function(){return h}}]),a}();return t.fn[e]=I._jQueryInterface,t.fn[e].Constructor=I,t.fn[e].noConflict=function(){return t.fn[e]=a,I._jQueryInterface},I}(e),x=function(t){var e="popover",n="bs.popover",i="."+n,o=t.fn[e],a=new RegExp("(^|\\s)bs-popover\\S+","g"),l=r({},U.Default,{placement:"right",trigger:"click",content:"",template:'<div class="popover" role="tooltip"><div class="arrow"></div><h3 class="popover-header"></h3><div class="popover-body"></div></div>'}),h=r({},U.DefaultType,{content:"(string|element|function)"}),c="fade",u="show",f=".popover-header",d=".popover-body",_={HIDE:"hide"+i,HIDDEN:"hidden"+i,SHOW:"show"+i,SHOWN:"shown"+i,INSERTED:"inserted"+i,CLICK:"click"+i,FOCUSIN:"focusin"+i,FOCUSOUT:"focusout"+i,MOUSEENTER:"mouseenter"+i,MOUSELEAVE:"mouseleave"+i},g=function(r){var o,g;function p(){return r.apply(this,arguments)||this}g=r,(o=p).prototype=Object.create(g.prototype),o.prototype.constructor=o,o.__proto__=g;var m=p.prototype;return m.isWithContent=function(){return this.getTitle()||this._getContent()},m.addAttachmentClass=function(e){t(this.getTipElement()).addClass("bs-popover-"+e)},m.getTipElement=function(){return this.tip=this.tip||t(this.config.template)[0],this.tip},m.setContent=function(){var e=t(this.getTipElement());this.setElementContent(e.find(f),this.getTitle());var n=this._getContent();"function"==typeof n&&(n=n.call(this.element)),this.setElementContent(e.find(d),n),e.removeClass(c+" "+u)},m._getContent=function(){return this.element.getAttribute("data-content")||this.config.content},m._cleanTipClass=function(){var e=t(this.getTipElement()),n=e.attr("class").match(a);null!==n&&n.length>0&&e.removeClass(n.join(""))},p._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n),s="object"==typeof e?e:null;if((i||!/destroy|hide/.test(e))&&(i||(i=new p(this,s),t(this).data(n,i)),"string"==typeof e)){if("undefined"==typeof i[e])throw new TypeError('No method named "'+e+'"');i[e]()}})},s(p,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return l}},{key:"NAME",get:function(){return e}},{key:"DATA_KEY",get:function(){return n}},{key:"Event",get:function(){return _}},{key:"EVENT_KEY",get:function(){return i}},{key:"DefaultType",get:function(){return h}}]),p}(U);return t.fn[e]=g._jQueryInterface,t.fn[e].Constructor=g,t.fn[e].noConflict=function(){return t.fn[e]=o,g._jQueryInterface},g}(e),K=function(t){var e="scrollspy",n="bs.scrollspy",i="."+n,o=t.fn[e],a={offset:10,method:"auto",target:""},l={offset:"number",method:"string",target:"(string|element)"},h={ACTIVATE:"activate"+i,SCROLL:"scroll"+i,LOAD_DATA_API:"load"+i+".data-api"},c="dropdown-item",u="active",f={DATA_SPY:'[data-spy="scroll"]',ACTIVE:".active",NAV_LIST_GROUP:".nav, .list-group",NAV_LINKS:".nav-link",NAV_ITEMS:".nav-item",LIST_ITEMS:".list-group-item",DROPDOWN:".dropdown",DROPDOWN_ITEMS:".dropdown-item",DROPDOWN_TOGGLE:".dropdown-toggle"},d="offset",_="position",g=function(){function o(e,n){var i=this;this._element=e,this._scrollElement="BODY"===e.tagName?window:e,this._config=this._getConfig(n),this._selector=this._config.target+" "+f.NAV_LINKS+","+this._config.target+" "+f.LIST_ITEMS+","+this._config.target+" "+f.DROPDOWN_ITEMS,this._offsets=[],this._targets=[],this._activeTarget=null,this._scrollHeight=0,t(this._scrollElement).on(h.SCROLL,function(t){return i._process(t)}),this.refresh(),this._process()}var g=o.prototype;return g.refresh=function(){var e=this,n=this._scrollElement===this._scrollElement.window?d:_,i="auto"===this._config.method?n:this._config.method,s=i===_?this._getScrollTop():0;this._offsets=[],this._targets=[],this._scrollHeight=this._getScrollHeight(),t.makeArray(t(this._selector)).map(function(e){var n,r=P.getSelectorFromElement(e);if(r&&(n=t(r)[0]),n){var o=n.getBoundingClientRect();if(o.width||o.height)return[t(n)[i]().top+s,r]}return null}).filter(function(t){return t}).sort(function(t,e){return t[0]-e[0]}).forEach(function(t){e._offsets.push(t[0]),e._targets.push(t[1])})},g.dispose=function(){t.removeData(this._element,n),t(this._scrollElement).off(i),this._element=null,this._scrollElement=null,this._config=null,this._selector=null,this._offsets=null,this._targets=null,this._activeTarget=null,this._scrollHeight=null},g._getConfig=function(n){if("string"!=typeof(n=r({},a,n)).target){var i=t(n.target).attr("id");i||(i=P.getUID(e),t(n.target).attr("id",i)),n.target="#"+i}return P.typeCheckConfig(e,n,l),n},g._getScrollTop=function(){return this._scrollElement===window?this._scrollElement.pageYOffset:this._scrollElement.scrollTop},g._getScrollHeight=function(){return this._scrollElement.scrollHeight||Math.max(document.body.scrollHeight,document.documentElement.scrollHeight)},g._getOffsetHeight=function(){return this._scrollElement===window?window.innerHeight:this._scrollElement.getBoundingClientRect().height},g._process=function(){var t=this._getScrollTop()+this._config.offset,e=this._getScrollHeight(),n=this._config.offset+e-this._getOffsetHeight();if(this._scrollHeight!==e&&this.refresh(),t>=n){var i=this._targets[this._targets.length-1];this._activeTarget!==i&&this._activate(i)}else{if(this._activeTarget&&t<this._offsets[0]&&this._offsets[0]>0)return this._activeTarget=null,void this._clear();for(var s=this._offsets.length;s--;){this._activeTarget!==this._targets[s]&&t>=this._offsets[s]&&("undefined"==typeof this._offsets[s+1]||t<this._offsets[s+1])&&this._activate(this._targets[s])}}},g._activate=function(e){this._activeTarget=e,this._clear();var n=this._selector.split(",");n=n.map(function(t){return t+'[data-target="'+e+'"],'+t+'[href="'+e+'"]'});var i=t(n.join(","));i.hasClass(c)?(i.closest(f.DROPDOWN).find(f.DROPDOWN_TOGGLE).addClass(u),i.addClass(u)):(i.addClass(u),i.parents(f.NAV_LIST_GROUP).prev(f.NAV_LINKS+", "+f.LIST_ITEMS).addClass(u),i.parents(f.NAV_LIST_GROUP).prev(f.NAV_ITEMS).children(f.NAV_LINKS).addClass(u)),t(this._scrollElement).trigger(h.ACTIVATE,{relatedTarget:e})},g._clear=function(){t(this._selector).filter(f.ACTIVE).removeClass(u)},o._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n);if(i||(i=new o(this,"object"==typeof e&&e),t(this).data(n,i)),"string"==typeof e){if("undefined"==typeof i[e])throw new TypeError('No method named "'+e+'"');i[e]()}})},s(o,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return a}}]),o}();return t(window).on(h.LOAD_DATA_API,function(){for(var e=t.makeArray(t(f.DATA_SPY)),n=e.length;n--;){var i=t(e[n]);g._jQueryInterface.call(i,i.data())}}),t.fn[e]=g._jQueryInterface,t.fn[e].Constructor=g,t.fn[e].noConflict=function(){return t.fn[e]=o,g._jQueryInterface},g}(e),V=function(t){var e="bs.tab",n="."+e,i=t.fn.tab,r={HIDE:"hide"+n,HIDDEN:"hidden"+n,SHOW:"show"+n,SHOWN:"shown"+n,CLICK_DATA_API:"click.bs.tab.data-api"},o="dropdown-menu",a="active",l="disabled",h="fade",c="show",u=".dropdown",f=".nav, .list-group",d=".active",_="> li > .active",g='[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]',p=".dropdown-toggle",m="> .dropdown-menu .active",v=function(){function n(t){this._element=t}var i=n.prototype;return i.show=function(){var e=this;if(!(this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE&&t(this._element).hasClass(a)||t(this._element).hasClass(l))){var n,i,s=t(this._element).closest(f)[0],o=P.getSelectorFromElement(this._element);if(s){var h="UL"===s.nodeName?_:d;i=(i=t.makeArray(t(s).find(h)))[i.length-1]}var c=t.Event(r.HIDE,{relatedTarget:this._element}),u=t.Event(r.SHOW,{relatedTarget:i});if(i&&t(i).trigger(c),t(this._element).trigger(u),!u.isDefaultPrevented()&&!c.isDefaultPrevented()){o&&(n=t(o)[0]),this._activate(this._element,s);var g=function(){var n=t.Event(r.HIDDEN,{relatedTarget:e._element}),s=t.Event(r.SHOWN,{relatedTarget:i});t(i).trigger(n),t(e._element).trigger(s)};n?this._activate(n,n.parentNode,g):g()}}},i.dispose=function(){t.removeData(this._element,e),this._element=null},i._activate=function(e,n,i){var s=this,r=("UL"===n.nodeName?t(n).find(_):t(n).children(d))[0],o=i&&P.supportsTransitionEnd()&&r&&t(r).hasClass(h),a=function(){return s._transitionComplete(e,r,i)};r&&o?t(r).one(P.TRANSITION_END,a).emulateTransitionEnd(150):a()},i._transitionComplete=function(e,n,i){if(n){t(n).removeClass(c+" "+a);var s=t(n.parentNode).find(m)[0];s&&t(s).removeClass(a),"tab"===n.getAttribute("role")&&n.setAttribute("aria-selected",!1)}if(t(e).addClass(a),"tab"===e.getAttribute("role")&&e.setAttribute("aria-selected",!0),P.reflow(e),t(e).addClass(c),e.parentNode&&t(e.parentNode).hasClass(o)){var r=t(e).closest(u)[0];r&&t(r).find(p).addClass(a),e.setAttribute("aria-expanded",!0)}i&&i()},n._jQueryInterface=function(i){return this.each(function(){var s=t(this),r=s.data(e);if(r||(r=new n(this),s.data(e,r)),"string"==typeof i){if("undefined"==typeof r[i])throw new TypeError('No method named "'+i+'"');r[i]()}})},s(n,null,[{key:"VERSION",get:function(){return"4.0.0"}}]),n}();return t(document).on(r.CLICK_DATA_API,g,function(e){e.preventDefault(),v._jQueryInterface.call(t(this),"show")}),t.fn.tab=v._jQueryInterface,t.fn.tab.Constructor=v,t.fn.tab.noConflict=function(){return t.fn.tab=i,v._jQueryInterface},v}(e);!function(t){if("undefined"==typeof t)throw new TypeError("Bootstrap's JavaScript requires jQuery. jQuery must be included before Bootstrap's JavaScript.");var e=t.fn.jquery.split(" ")[0].split(".");if(e[0]<2&&e[1]<9||1===e[0]&&9===e[1]&&e[2]<1||e[0]>=4)throw new Error("Bootstrap's JavaScript requires at least jQuery v1.9.1 but less than v4.0.0")}(e),t.Util=P,t.Alert=L,t.Button=R,t.Carousel=j,t.Collapse=H,t.Dropdown=W,t.Modal=M,t.Popover=x,t.Scrollspy=K,t.Tab=V,t.Tooltip=U,Object.defineProperty(t,"__esModule",{value:!0})}); +//# sourceMappingURL=bootstrap.min.js.map
\ No newline at end of file diff --git a/chall/src/js/rockstar.js b/chall/src/js/rockstar.js new file mode 100644 index 0000000..ab22942 --- /dev/null +++ b/chall/src/js/rockstar.js @@ -0,0 +1,13 @@ +function transpile() { + + var data = {"code": document.getElementById("in").value}; + console.log(data); + +$.post({ + url: "transpile.php", + data: JSON.stringify(data) + }).done(function( data ) { + var json_data = JSON.parse(data) + document.getElementById("output").value = json_data["result"]; + }); +}
\ No newline at end of file |
