summaryrefslogtreecommitdiffstats
path: root/chall
diff options
context:
space:
mode:
Diffstat (limited to 'chall')
-rw-r--r--chall/Dockerfile33
-rw-r--r--chall/apache-config.conf15
-rw-r--r--chall/flag1
-rw-r--r--chall/lolpython.py768
-rw-r--r--chall/notes41
-rw-r--r--chall/ply-2.2/ANNOUNCE48
-rw-r--r--chall/ply-2.2/CHANGES680
-rw-r--r--chall/ply-2.2/COPYING504
-rw-r--r--chall/ply-2.2/README277
-rw-r--r--chall/ply-2.2/TODO14
-rw-r--r--chall/ply-2.2/build/lib.linux-x86_64-2.7/ply/__init__.py4
-rw-r--r--chall/ply-2.2/build/lib.linux-x86_64-2.7/ply/lex.py866
-rw-r--r--chall/ply-2.2/build/lib.linux-x86_64-2.7/ply/yacc.py2209
-rw-r--r--chall/ply-2.2/doc/makedoc.py194
-rw-r--r--chall/ply-2.2/doc/ply.html2874
-rw-r--r--chall/ply-2.2/example/BASIC/README79
-rw-r--r--chall/ply-2.2/example/BASIC/basic.py68
-rw-r--r--chall/ply-2.2/example/BASIC/basiclex.py74
-rw-r--r--chall/ply-2.2/example/BASIC/basinterp.py440
-rw-r--r--chall/ply-2.2/example/BASIC/basparse.py424
-rw-r--r--chall/ply-2.2/example/BASIC/dim.bas14
-rw-r--r--chall/ply-2.2/example/BASIC/func.bas5
-rw-r--r--chall/ply-2.2/example/BASIC/gcd.bas22
-rw-r--r--chall/ply-2.2/example/BASIC/gosub.bas13
-rw-r--r--chall/ply-2.2/example/BASIC/hello.bas4
-rw-r--r--chall/ply-2.2/example/BASIC/linear.bas17
-rw-r--r--chall/ply-2.2/example/BASIC/maxsin.bas12
-rw-r--r--chall/ply-2.2/example/BASIC/powers.bas13
-rw-r--r--chall/ply-2.2/example/BASIC/rand.bas4
-rw-r--r--chall/ply-2.2/example/BASIC/sales.bas20
-rw-r--r--chall/ply-2.2/example/BASIC/sears.bas18
-rw-r--r--chall/ply-2.2/example/BASIC/sqrt1.bas5
-rw-r--r--chall/ply-2.2/example/BASIC/sqrt2.bas4
-rw-r--r--chall/ply-2.2/example/GardenSnake/GardenSnake.py709
-rw-r--r--chall/ply-2.2/example/GardenSnake/README5
-rw-r--r--chall/ply-2.2/example/README10
-rw-r--r--chall/ply-2.2/example/ansic/README2
-rw-r--r--chall/ply-2.2/example/ansic/clex.py164
-rw-r--r--chall/ply-2.2/example/ansic/cparse.py863
-rw-r--r--chall/ply-2.2/example/ansic/lextab.py8
-rw-r--r--chall/ply-2.2/example/calc/calc.py105
-rwxr-xr-xchall/ply-2.2/example/classcalc/calc.py152
-rwxr-xr-xchall/ply-2.2/example/cleanup.sh2
-rw-r--r--chall/ply-2.2/example/hedit/hedit.py48
-rwxr-xr-xchall/ply-2.2/example/newclasscalc/calc.py155
-rw-r--r--chall/ply-2.2/example/optcalc/README9
-rw-r--r--chall/ply-2.2/example/optcalc/calc.py113
-rw-r--r--chall/ply-2.2/example/unicalc/calc.py114
-rw-r--r--chall/ply-2.2/example/yply/README41
-rw-r--r--chall/ply-2.2/example/yply/ylex.py112
-rw-r--r--chall/ply-2.2/example/yply/yparse.py217
-rwxr-xr-xchall/ply-2.2/example/yply/yply.py53
-rw-r--r--chall/ply-2.2/ply/__init__.py4
-rw-r--r--chall/ply-2.2/ply/__init__.pycbin0 -> 144 bytes
-rw-r--r--chall/ply-2.2/ply/lex.py866
-rw-r--r--chall/ply-2.2/ply/lex.pycbin0 -> 19470 bytes
-rw-r--r--chall/ply-2.2/ply/yacc.py2209
-rw-r--r--chall/ply-2.2/ply/yacc.pycbin0 -> 41996 bytes
-rw-r--r--chall/ply-2.2/setup.py27
-rw-r--r--chall/ply-2.2/test/README11
-rw-r--r--chall/ply-2.2/test/calclex.py49
-rwxr-xr-xchall/ply-2.2/test/cleanup.sh4
-rw-r--r--chall/ply-2.2/test/lex_doc1.exp1
-rw-r--r--chall/ply-2.2/test/lex_doc1.py30
-rw-r--r--chall/ply-2.2/test/lex_dup1.exp2
-rw-r--r--chall/ply-2.2/test/lex_dup1.py29
-rw-r--r--chall/ply-2.2/test/lex_dup2.exp2
-rw-r--r--chall/ply-2.2/test/lex_dup2.py33
-rw-r--r--chall/ply-2.2/test/lex_dup3.exp2
-rw-r--r--chall/ply-2.2/test/lex_dup3.py31
-rw-r--r--chall/ply-2.2/test/lex_empty.exp1
-rw-r--r--chall/ply-2.2/test/lex_empty.py20
-rw-r--r--chall/ply-2.2/test/lex_error1.exp1
-rw-r--r--chall/ply-2.2/test/lex_error1.py24
-rw-r--r--chall/ply-2.2/test/lex_error2.exp1
-rw-r--r--chall/ply-2.2/test/lex_error2.py26
-rw-r--r--chall/ply-2.2/test/lex_error3.exp2
-rw-r--r--chall/ply-2.2/test/lex_error3.py27
-rw-r--r--chall/ply-2.2/test/lex_error4.exp2
-rw-r--r--chall/ply-2.2/test/lex_error4.py27
-rw-r--r--chall/ply-2.2/test/lex_hedit.exp3
-rw-r--r--chall/ply-2.2/test/lex_hedit.py47
-rw-r--r--chall/ply-2.2/test/lex_ignore.exp7
-rw-r--r--chall/ply-2.2/test/lex_ignore.py31
-rw-r--r--chall/ply-2.2/test/lex_nowarn.exp0
-rw-r--r--chall/ply-2.2/test/lex_nowarn.py30
-rw-r--r--chall/ply-2.2/test/lex_re1.exp7
-rw-r--r--chall/ply-2.2/test/lex_re1.py27
-rw-r--r--chall/ply-2.2/test/lex_re2.exp7
-rw-r--r--chall/ply-2.2/test/lex_re2.py27
-rw-r--r--chall/ply-2.2/test/lex_re3.exp8
-rw-r--r--chall/ply-2.2/test/lex_re3.py29
-rw-r--r--chall/ply-2.2/test/lex_rule1.exp2
-rw-r--r--chall/ply-2.2/test/lex_rule1.py27
-rw-r--r--chall/ply-2.2/test/lex_state1.exp7
-rw-r--r--chall/ply-2.2/test/lex_state1.py40
-rw-r--r--chall/ply-2.2/test/lex_state2.exp8
-rw-r--r--chall/ply-2.2/test/lex_state2.py40
-rw-r--r--chall/ply-2.2/test/lex_state3.exp8
-rw-r--r--chall/ply-2.2/test/lex_state3.py42
-rw-r--r--chall/ply-2.2/test/lex_state4.exp7
-rw-r--r--chall/ply-2.2/test/lex_state4.py41
-rw-r--r--chall/ply-2.2/test/lex_state5.exp7
-rw-r--r--chall/ply-2.2/test/lex_state5.py42
-rw-r--r--chall/ply-2.2/test/lex_state_noerror.exp1
-rw-r--r--chall/ply-2.2/test/lex_state_noerror.py41
-rw-r--r--chall/ply-2.2/test/lex_state_norule.exp7
-rw-r--r--chall/ply-2.2/test/lex_state_norule.py42
-rw-r--r--chall/ply-2.2/test/lex_state_try.exp7
-rw-r--r--chall/ply-2.2/test/lex_state_try.py48
-rw-r--r--chall/ply-2.2/test/lex_token1.exp1
-rw-r--r--chall/ply-2.2/test/lex_token1.py21
-rw-r--r--chall/ply-2.2/test/lex_token2.exp1
-rw-r--r--chall/ply-2.2/test/lex_token2.py23
-rw-r--r--chall/ply-2.2/test/lex_token3.exp2
-rw-r--r--chall/ply-2.2/test/lex_token3.py27
-rw-r--r--chall/ply-2.2/test/lex_token4.exp2
-rw-r--r--chall/ply-2.2/test/lex_token4.py28
-rw-r--r--chall/ply-2.2/test/lex_token5.exp1
-rw-r--r--chall/ply-2.2/test/lex_token5.py33
-rw-r--r--chall/ply-2.2/test/rununit.py62
-rwxr-xr-xchall/ply-2.2/test/testlex.py57
-rw-r--r--chall/ply-2.2/test/testyacc.py58
-rw-r--r--chall/ply-2.2/test/yacc_badargs.exp3
-rw-r--r--chall/ply-2.2/test/yacc_badargs.py68
-rw-r--r--chall/ply-2.2/test/yacc_badprec.exp1
-rw-r--r--chall/ply-2.2/test/yacc_badprec.py65
-rw-r--r--chall/ply-2.2/test/yacc_badprec2.exp3
-rw-r--r--chall/ply-2.2/test/yacc_badprec2.py69
-rw-r--r--chall/ply-2.2/test/yacc_badrule.exp5
-rw-r--r--chall/ply-2.2/test/yacc_badrule.py69
-rw-r--r--chall/ply-2.2/test/yacc_badtok.exp1
-rw-r--r--chall/ply-2.2/test/yacc_badtok.py70
-rw-r--r--chall/ply-2.2/test/yacc_dup.exp4
-rw-r--r--chall/ply-2.2/test/yacc_dup.py69
-rw-r--r--chall/ply-2.2/test/yacc_error1.exp1
-rw-r--r--chall/ply-2.2/test/yacc_error1.py69
-rw-r--r--chall/ply-2.2/test/yacc_error2.exp1
-rw-r--r--chall/ply-2.2/test/yacc_error2.py69
-rw-r--r--chall/ply-2.2/test/yacc_error3.exp1
-rw-r--r--chall/ply-2.2/test/yacc_error3.py68
-rw-r--r--chall/ply-2.2/test/yacc_inf.exp5
-rw-r--r--chall/ply-2.2/test/yacc_inf.py57
-rw-r--r--chall/ply-2.2/test/yacc_missing1.exp2
-rw-r--r--chall/ply-2.2/test/yacc_missing1.py69
-rw-r--r--chall/ply-2.2/test/yacc_nodoc.exp2
-rw-r--r--chall/ply-2.2/test/yacc_nodoc.py68
-rw-r--r--chall/ply-2.2/test/yacc_noerror.exp2
-rw-r--r--chall/ply-2.2/test/yacc_noerror.py67
-rw-r--r--chall/ply-2.2/test/yacc_nop.exp2
-rw-r--r--chall/ply-2.2/test/yacc_nop.py69
-rw-r--r--chall/ply-2.2/test/yacc_notfunc.exp4
-rw-r--r--chall/ply-2.2/test/yacc_notfunc.py67
-rw-r--r--chall/ply-2.2/test/yacc_notok.exp1
-rw-r--r--chall/ply-2.2/test/yacc_notok.py68
-rw-r--r--chall/ply-2.2/test/yacc_rr.exp2
-rw-r--r--chall/ply-2.2/test/yacc_rr.py73
-rw-r--r--chall/ply-2.2/test/yacc_simple.exp1
-rw-r--r--chall/ply-2.2/test/yacc_simple.py69
-rw-r--r--chall/ply-2.2/test/yacc_sr.exp2
-rw-r--r--chall/ply-2.2/test/yacc_sr.py64
-rw-r--r--chall/ply-2.2/test/yacc_term1.exp2
-rw-r--r--chall/ply-2.2/test/yacc_term1.py69
-rw-r--r--chall/ply-2.2/test/yacc_unused.exp4
-rw-r--r--chall/ply-2.2/test/yacc_unused.py78
-rw-r--r--chall/ply-2.2/test/yacc_uprec.exp2
-rw-r--r--chall/ply-2.2/test/yacc_uprec.py64
-rw-r--r--chall/src/css/bootstrap-grid.css2050
-rw-r--r--chall/src/css/bootstrap-grid.min.css7
-rw-r--r--chall/src/css/bootstrap-reboot.css330
-rw-r--r--chall/src/css/bootstrap-reboot.min.css8
-rw-r--r--chall/src/css/bootstrap.css8975
-rw-r--r--chall/src/css/bootstrap.min.css7
-rw-r--r--chall/src/css/custom.css66
-rw-r--r--chall/src/form.php24
-rw-r--r--chall/src/index.php58
-rw-r--r--chall/src/js/bootstrap.bundle.js6328
-rw-r--r--chall/src/js/bootstrap.bundle.min.js7
-rw-r--r--chall/src/js/bootstrap.js3894
-rw-r--r--chall/src/js/bootstrap.min.js7
-rw-r--r--chall/src/js/rockstar.js13
-rw-r--r--chall/src/transpile.php18
182 files changed, 40374 insertions, 0 deletions
diff --git a/chall/Dockerfile b/chall/Dockerfile
new file mode 100644
index 0000000..4ca733e
--- /dev/null
+++ b/chall/Dockerfile
@@ -0,0 +1,33 @@
+FROM php:7.3-apache
+
+ADD --chmod=0755 \
+ https://raw.githubusercontent.com/reproducible-containers/repro-sources-list.sh/v0.1.0/repro-sources-list.sh \
+ /usr/local/bin/repro-sources-list.sh
+
+#RUN bash /usr/local/bin/repro-sources-list.sh && apt-get update && apt-get -y install python2 curl tar
+RUN apt-get update && apt-get -y install python2 curl tar
+
+# Expose apache.
+EXPOSE 1024
+
+ADD src/ /var/www/site/
+
+RUN chmod -R 755 /var/www/
+RUN chown -R www-data:www-data /var/www
+
+COPY flag /flag
+RUN chmod 777 /flag
+
+RUN mkdir -p /var/www/site/uploads
+RUN chmod -R 777 /var/www/site/uploads
+
+# Update the default apache site with the config we created.
+ADD apache-config.conf /etc/apache2/sites-enabled/000-default.conf
+
+RUN sed -i 's/Listen 80/Listen 1024/' /etc/apache2/ports.conf
+
+
+# Install ply and lolcode1337
+WORKDIR /opt/
+RUN curl https://www.dabeaz.com/ply/ply-2.2.tar.gz -k -o ply-2.2.tar.gz && curl http://dalkescientific.com/writings/diary/lolpython.py -k -o lolcode.py && \
+ tar -xvf ply-2.2.tar.gz && cd ply-2.2 && python2 setup.py install \ No newline at end of file
diff --git a/chall/apache-config.conf b/chall/apache-config.conf
new file mode 100644
index 0000000..42b6468
--- /dev/null
+++ b/chall/apache-config.conf
@@ -0,0 +1,15 @@
+<VirtualHost *:1024>
+ ServerAdmin me@mydomain.com
+ DocumentRoot /var/www/site
+
+ <Directory /var/www/site/>
+ Options -Indexes +FollowSymLinks +MultiViews
+ AllowOverride All
+ Order deny,allow
+ Allow from all
+ </Directory>
+
+ ErrorLog ${APACHE_LOG_DIR}/error.log
+ CustomLog ${APACHE_LOG_DIR}/access.log combined
+
+</VirtualHost>
diff --git a/chall/flag b/chall/flag
new file mode 100644
index 0000000..446584c
--- /dev/null
+++ b/chall/flag
@@ -0,0 +1 @@
+CSCG{GZ!H4rd3st_p4rt_of_this_chall3nge_was_python2_and_ply_bug_f1xing:D}
diff --git a/chall/lolpython.py b/chall/lolpython.py
new file mode 100644
index 0000000..6337124
--- /dev/null
+++ b/chall/lolpython.py
@@ -0,0 +1,768 @@
+#!/usr/bin/env python
+# Implementation of the LOLPython language.
+# Converts from LOLPython to Python then optionally runs the Python.
+
+# This package depends on PLY -- http://www.dabeaz.com/ply/
+
+# Written by Andrew Dalke <dalke@dalkescientific.com>
+# Dalke Scientific Software, LLC
+# 1 June 2007, Gothenburg, Sweden
+#
+# This software is in the public domain. For details see:
+# http://creativecommons.org/licenses/publicdomain/
+
+
+import sys
+import keyword
+import os
+import types
+from cStringIO import StringIO
+from ply import *
+
+
+__NAME__ = "lolpython"
+__VERSION__ = "1.0"
+
+# Translating LOLPython tokens to Python tokens
+# This could be cleaned up. For example, some of
+# these tokens could be merged into one.
+tokens = (
+ "NAME", # variable names
+ "RESERVED", # Used for Python reserved names
+ "NUMBER", # Integers and floats
+ "STRING",
+ "OP", # Like the Python OP
+ "CLOSE", # Don't really need this..
+
+ "COMMENT",
+ "AUTOCALL", # write t.value then add '('
+ "INLINE", # write t.value directly
+ "FUTURE", # for the "I FUTURE CAT WITH" statement
+ "PRINT", # VISIBLE -> stdout or COMPLAIN -> stderr
+
+ "ENDMARKER",
+ "COLON",
+ "WS",
+ "NEWLINE",
+)
+
+# Helper functions for making given token types
+def OP(t, value):
+ t.type = "OP"
+ t.value = value
+ return t
+
+def RESERVED(t, value):
+ t.type = "RESERVED"
+ t.value = value
+ return t
+
+def AUTOCALL(t, value):
+ t.type = "AUTOCALL"
+ t.value = "tuple"
+ t.lexer.paren_stack.append(")")
+ return t
+
+def INLINE(t, value):
+ t.type = "INLINE"
+ t.value = value
+ return t
+
+#####
+
+# ply uses a large regex for token detection, and sre is limited to
+# 100 groups. This grammar pushes the limit. I use (?:non-grouping)
+# parens to keep the count down.
+
+
+def t_ASSIGN(t): # cannot be a simple pattern because it must
+ r'CAN[ ]+HA[SZ]\b' # come before the t_NAME definition
+ return OP(t, "=")
+
+def t_SINGLE_QUOTE_STRING(t):
+ r"'([^\\']+|\\'|\\\\)*'" # I think this is right ...
+ t.type = "STRING"
+ t.value = t.value[1:-1].decode("string-escape")
+ return t
+
+def t_DOUBLE_QUOTE_STRING(t):
+ r'"([^\\"]+|\\"|\\\\)*"'
+ t.type = "STRING"
+ t.value = t.value[1:-1].decode("string-escape")
+ print(t.value)
+ return t
+
+# and LOL quoted strings! They end with /LOL
+# No way to have "/LOL" in the string.
+def t_LOL_STRING(t):
+ r"LOL[ ]*((?!/LOL).|\n)*[ ]*/LOL"
+ t.type = "STRING"
+ t.value = t.value[3:-4].strip(" ")
+ return t
+
+# Aliases for the same thing - for extra cuteness
+def t_LSQUARE(t):
+ r"(?:SOME|LOOK[ ]AT|LET[ ]+THE)\b"
+ t.lexer.paren_stack.append(']')
+ return OP(t, "[")
+
+def t_LPAREN(t):
+ r"(?:WIT|THEZ)\b"
+ t.lexer.paren_stack.append(')')
+ return OP(t, "(")
+
+def t_LBRACE(t):
+ r"BUCKET\b"
+ t.lexer.paren_stack.append("}")
+ return OP(t, "{")
+
+def t_CLOSE(t):
+ r"(?:OK(!+|\b)|!+)"
+ stack = t.lexer.paren_stack
+ if t.value.startswith("OK"):
+ num_closes = len(t.value)-1 # OK -> 1, OK! -> 2, OK!!->3
+ else:
+ num_closes = len(t.value) # ! -> 1, !! -> 2
+ # Which close is this? I use "OK" to match (, [ and {
+ if len(stack) < num_closes:
+ raise AssertionError("not enough opens on the stack: line %d"
+ % (t.lineno,))
+ t.value = "".join(stack[-num_closes:][::-1])
+ del stack[-num_closes:]
+ return t
+
+def t_EQ(t):
+ r"KINDA[ ]+LIKE\b"
+ return OP(t, "==")
+
+def t_NE(t):
+ r"(?:KINDA[ ]+)?NOT[ ]+LIKE\b"
+ return OP(t, "!=")
+
+def t_is(t):
+ r"KINDA[ ]+IS\b"
+ return RESERVED(t, "is")
+
+def t_GT(t):
+ r"ATE[ ]+MORE[ ]+CHEEZBURGERS?[ ]+THAN\b"
+ return OP(t, ">")
+
+def t_LT(t):
+ r"ATE[ ]+FEWER[ ]+CHEEZBURGERS?[ ]+THAN\b"
+ return OP(t, "<")
+
+def t_GTE(t):
+ r"BIG[ ]+LIKE\b"
+ return OP(t, ">=")
+
+def t_LTE(t):
+ r"SMALL[ ]+LIKE\b"
+ return OP(t, "<=")
+
+def t_RETURN(t):
+ r"U[ ]+TAKE\b"
+ return RESERVED(t, "return")
+
+def t_yield(t):
+ r"U[ ]+BORROW\b"
+ return RESERVED(t, "yield")
+
+def t_ELIF(t):
+ r"OR[ ]+IZ\b"
+ return RESERVED(t, "elif")
+
+def t_ELSE(t):
+ r"(?:(?:I[ ]+GIVE[ ]+UP|IZ[ ]+KEWL|ALL[ ]+DONE)|NOPE)\b"
+ return RESERVED(t, "else")
+
+def t_COLON(t):
+ r"\?"
+ t.value = ":"
+ return t
+
+def t_FROM(t):
+ r"IN[ ]+MAI\b"
+ return RESERVED(t, "from")
+
+def t_EXCEPT(t):
+ r"O[ ]+NOES\b"
+ return RESERVED(t, "except")
+
+def t_PLUS(t):
+ r"ALONG[ ]+WITH\b"
+ return OP(t, "+")
+def t_MINUS(t):
+ r"TAKE[ ]+AWAY\b"
+ return OP(t, "-")
+
+def t_PLUS_EQUAL(t):
+ r"GETZ[ ]+ANOTHR\b"
+ return OP(t, "+=")
+
+def t_MINUS_EQUAL(t):
+ r"THROW[SZ]?[ ]+AWAY\b"
+ return OP(t, "-=")
+
+def t_DIV(t):
+ r"SMASHES[ ]+INTO\b"
+ return OP(t, "/")
+def t_DIV_EQUAL(t):
+ r"SMASHES[ ]+INTO[ ]+HAS\b"
+ return OP(t, "/=")
+def t_TRUEDIV(t):
+ r"SMASHES[ ]+NICELY[ ]+INTO\b"
+ return OP(t, "//")
+def t_MUL(t):
+ r"OF[ ]THOSE\b"
+ return OP(t, "*")
+def t_MUL_EQUAL(t):
+ r"COPIES[ ]+(?:HIM|HER|IT)SELF[ ]+BY\b"
+ return OP(t, "*=")
+def t_POW(t):
+ r"BY[ ]+GRAYSKULL[ ]+POWER"
+ return OP(t, "**")
+def t_IN(t):
+ r"IN[ ]+(?:UR|THE|THIS)\b"
+ return OP(t, "in")
+def t_del(t):
+ r"DO[ ]+NOT[ ]+WANT\b"
+ return RESERVED(t, "del")
+def t_and(t):
+ r"\&"
+ return RESERVED(t, "and")
+def t_or(t):
+ r"OR[ ]+MABEE\b"
+ return RESERVED(t, "or")
+
+def t_pass(t):
+ r"I[ ]+IZ[ ]+CUTE\b"
+ return RESERVED(t, "pass")
+
+def t_forever(t):
+ r"WHILE[ ]+I[ ]+CUTE\b"
+ return INLINE(t, "while 1")
+
+def t_def(t):
+ r"SO[ ]+IM[ ]+LIKE\b"
+ return RESERVED(t, "def")
+
+def t_class(t):
+ r"ME[ ]+MAKE[ ]\b"
+ return RESERVED(t, "class")
+
+def t_future(t):
+ r"I[ ]+FUTURE[ ]+CAT[ ]+WITH\b"
+ t.type = "FUTURE"
+ return t
+
+def t_assert(t):
+ r"SO[ ]+GOOD\b"
+ return RESERVED(t, "assert")
+
+def t_assert_not(t):
+ r"AINT[ ]+GOOD\b"
+ return INLINE(t, "assert not ")
+
+def t_for(t):
+ r"GIMME[ ]+EACH\b"
+ return RESERVED(t, "for")
+
+def t_list(t):
+ r"ALL[ ]+OF\b"
+ return AUTOCALL(t, "tuple")
+
+RESERVED_VALUES = {
+ "EASTERBUNNY": ("NUMBER", "0"),
+ "CHEEZBURGER": ("NUMBER", "1"),
+ "CHOKOLET": ("NUMBER", "-1"),
+ "TWIN": ("NUMBER", "2"),
+ "TWINZ": ("NUMBER", "2"),
+ "TWINS": ("NUMBER", "2"),
+ "EVILTWIN": ("NUMBER", "-2"),
+ "EVILTWINZ": ("NUMBER", "-2"),
+ "EVILTWINS": ("NUMBER", "-2"),
+ "ALLFINGERZ": ("NUMBER", "10"),
+ "TOEZ": ("NUMBER", "-10"),
+ "ONE": ("NUMBER", "1"),
+ "ONCE": ("NUMBER", "1"),
+ "TWO": ("NUMBER", "2"),
+ "TWICE": ("NUMBER", "2"),
+ "THR33": ("NUMBER", "3"),
+ "FOUR": ("NUMBER", "4"),
+ "FIV": ("NUMBER", "5"),
+ "SIKS": ("NUMBER", "6"),
+ "SEVN": ("NUMBER", "7"),
+ "ATE": ("NUMBER", "8"),
+ "NINE": ("NUMBER", "9"),
+ "MEH": ("NAME", "False"),
+ "YEAH": ("NAME", "True"),
+ "VISIBLE": ("PRINT", "stdout"),
+ "COMPLAIN": ("PRINT", "stderr"),
+ "AND": ("OP", ","),
+ "BLACKHOLE": ("RESERVED", "ZeroDivisionError"),
+ "DONOTLIKE": ("AUTOCALL", "AssertionError"),
+
+ "ANTI": ("OP", "-"),
+ "IZ": ("RESERVED", "if"),
+ "GIMME": ("RESERVED", "import"),
+ "LIKE": ("RESERVED", "as"),
+ "OWN": ("OP", "."),
+
+ "PLZ": ("RESERVED", "try"),
+ "HALP": ("RESERVED", "raise"),
+ "WHATEVER": ("RESERVED", "finally"),
+ "KTHX": ("RESERVED", "continue"),
+ "KTHXBYE": ("RESERVED", "break"),
+
+ "OVER": ("OP", "/"),
+
+ "AINT": ("RESERVED", "not"),
+ "ME": ("RESERVED", "self"),
+
+ "STRING": ("AUTOCALL", "str"),
+ "NUMBR": ("AUTOCALL", "int"),
+ "BIGNESS": ("AUTOCALL", "len"),
+ "NUMBRZ": ("AUTOCALL", "range"),
+ "ADDED": ("AUTOCALL", ".append"),
+
+ "ARGZ": ("INLINE", "_lol_sys.argv"),
+ "THINGZ": ("INLINE", "()"), # invisible tuple didn't sound right
+ "THING": ("INLINE", "()"), # sometimes it's better in singular form
+ "MY": ("INLINE", "self."),
+ "MYSELF": ("INLINE", "(self)"),
+
+ "EVEN": ("INLINE", "% 2 == 0"),
+ "ODD": ("INLINE", "% 2 == 1"),
+ "WIF": ("RESERVED", "with"),
+ }
+
+def t_FLOAT(t):
+ r"""(?:\d+(?:\.\d*)?|\.\d+)(?:[eE][-+]? \d+)?"""
+ t.value = t.value
+ t.type = "NUMBER"
+ return t
+
+def t_INT(t):
+ r"\d+"
+ t.type = "NUMBER"
+ return t
+
+def t_INVISIBLE(t):
+ r"INVISIBLE([ ]+(LIST|STRING|BUCKET))?\b"
+ if "LIST" in t.value:
+ t.type = "INLINE"
+ t.value = "[]"
+ elif "STRING" in t.value:
+ t.type = "INLINE"
+ t.value = '""'
+ elif "BUCKET" in t.value:
+ t.type = "INLINE"
+ t.value = "{}"
+ else:
+ RESERVED(t, "None")
+ return t
+
+# Not consuming the newline. Needed for "IZ EASTERBUNNY? BTW comment"
+def t_COMMENT(t):
+ r"[ ]*(?:BTW|WTF)[^\n]*"
+ return t
+
+def t_NAME(t):
+ r'[a-zA-Z_][a-zA-Z0-9_]*'
+ if t.value in RESERVED_VALUES:
+ type, value = RESERVED_VALUES[t.value]
+ t.type = type
+ t.value = value
+ if t.type == "AUTOCALL":
+ t.lexer.paren_stack.append(")")
+ return t
+
+def t_WS(t):
+ r' [ ]+ '
+ if t.lexer.at_line_start and not t.lexer.paren_stack:
+ return t
+
+
+# Don't generate newline tokens when inside of parens
+def t_newline(t):
+ r'\n+'
+ t.lexer.lineno += len(t.value)
+ t.type = "NEWLINE"
+ if not t.lexer.paren_stack:
+ return t
+
+
+def t_error(t):
+ raise SyntaxError("Unknown symbol %r" % (t.value[0],))
+ print "Skipping", repr(t.value[0])
+ t.lexer.skip(1)
+
+
+## I implemented INDENT / DEDENT generation as a post-processing filter
+
+# The original lex token stream contains WS and NEWLINE characters.
+# WS will only occur before any other tokens on a line.
+
+# I have three filters. One tags tokens by adding two attributes.
+# "must_indent" is True if the token must be indented from the
+# previous code. The other is "at_line_start" which is True for WS
+# and the first non-WS/non-NEWLINE on a line. It flags the check so
+# see if the new line has changed indication level.
+
+# Python's syntax has three INDENT states
+# 0) no colon hence no need to indent
+# 1) "if 1: go()" - simple statements have a COLON but no need for an indent
+# 2) "if 1:\n go()" - complex statements have a COLON NEWLINE and must indent
+NO_INDENT = 0
+MAY_INDENT = 1
+MUST_INDENT = 2
+
+# only care about whitespace at the start of a line
+def track_tokens_filter(lexer, tokens):
+ lexer.at_line_start = at_line_start = True
+ indent = NO_INDENT
+ for token in tokens:
+ token.at_line_start = at_line_start
+
+ if token.type == "COLON":
+ at_line_start = False
+ indent = MAY_INDENT
+ token.must_indent = False
+
+ elif token.type == "NEWLINE":
+ at_line_start = True
+ if indent == MAY_INDENT:
+ indent = MUST_INDENT
+ token.must_indent = False
+
+ elif token.type == "WS":
+ assert token.at_line_start == True
+ at_line_start = True
+ token.must_indent = False
+
+ elif token.type == "COMMENT":
+ pass
+
+ else:
+ # A real token; only indent after COLON NEWLINE
+ if indent == MUST_INDENT:
+ token.must_indent = True
+ else:
+ token.must_indent = False
+ at_line_start = False
+
+ indent = NO_INDENT
+
+ yield token
+ lexer.at_line_start = at_line_start
+
+def _new_token(type, lineno):
+ tok = lex.LexToken()
+ tok.type = type
+ tok.value = None
+ tok.lineno = lineno
+ tok.lexpos = -1
+ return tok
+
+# Synthesize a DEDENT tag
+def DEDENT(lineno):
+ return _new_token("DEDENT", lineno)
+
+# Synthesize an INDENT tag
+def INDENT(lineno):
+ return _new_token("INDENT", lineno)
+
+
+# Track the indentation level and emit the right INDENT / DEDENT events.
+def indentation_filter(tokens):
+ # A stack of indentation levels; will never pop item 0
+ levels = [0]
+ token = None
+ depth = 0
+ prev_was_ws = False
+ for token in tokens:
+## if 1:
+## print "Process", token,
+## if token.at_line_start:
+## print "at_line_start",
+## if token.must_indent:
+## print "must_indent",
+## print
+
+ # WS only occurs at the start of the line
+ # There may be WS followed by NEWLINE so
+ # only track the depth here. Don't indent/dedent
+ # until there's something real.
+ if token.type == "WS":
+ assert depth == 0
+ depth = len(token.value)
+ prev_was_ws = True
+ # Don't forward WS to the parser
+ continue
+
+ if token.type == "NEWLINE":
+ depth = 0
+ if prev_was_ws or token.at_line_start:
+ # ignore blank lines
+ continue
+ # pass the other cases on through
+ yield token
+ continue
+
+ if token.type == "COMMENT":
+ yield token
+ continue
+
+ # then it must be a real token (not WS, not NEWLINE)
+ # which can affect the indentation level
+
+ prev_was_ws = False
+ if token.must_indent:
+ # The current depth must be larger than the previous level
+ if not (depth > levels[-1]):
+ raise IndentationError("expected an indented block")
+
+ levels.append(depth)
+ yield INDENT(token.lineno)
+
+ elif token.at_line_start:
+ # Must be on the same level or one of the previous levels
+ if depth == levels[-1]:
+ # At the same level
+ pass
+ elif depth > levels[-1]:
+ raise IndentationError("indentation increase but not in new block")
+ else:
+ # Back up; but only if it matches a previous level
+ try:
+ i = levels.index(depth)
+ except ValueError:
+ raise IndentationError("inconsistent indentation")
+ for _ in range(i+1, len(levels)):
+ yield DEDENT(token.lineno)
+ levels.pop()
+
+ yield token
+
+ ### Finished processing ###
+
+ # Must dedent any remaining levels
+ if len(levels) > 1:
+ assert token is not None
+ for _ in range(1, len(levels)):
+ yield DEDENT(token.lineno)
+
+
+# The top-level filter adds an ENDMARKER, if requested.
+# Python's grammar uses it.
+def token_filter(lexer, add_endmarker = True):
+ token = None
+ tokens = iter(lexer.token, None)
+ tokens = track_tokens_filter(lexer, tokens)
+ for token in indentation_filter(tokens):
+ yield token
+
+ if add_endmarker:
+ lineno = 1
+ if token is not None:
+ lineno = token.lineno
+ yield _new_token("ENDMARKER", lineno)
+
+class LOLLexer(object):
+ def __init__(self, debug=0, optimize=0, lextab='lextab', reflags=0):
+ self.lexer = lex.lex(debug=debug, optimize=optimize,
+ lextab=lextab, reflags=reflags)
+ self.token_stream = None
+ def input(self, s, add_endmarker=True):
+ self.lexer.paren_stack = []
+ self.lexer.input(s)
+ self.token_stream = token_filter(self.lexer, add_endmarker)
+ def token(self):
+ try:
+ return self.token_stream.next()
+ except StopIteration:
+ return None
+
+# Helper class to generate logically correct indented Python code
+class IndentWriter(object):
+ def __init__(self, outfile):
+ self.outfile = outfile
+ self.at_first_column = True
+ self.indent = 0
+ def write(self, text):
+ if self.at_first_column:
+ self.outfile.write(" "*self.indent)
+ self.at_first_column = False
+ self.outfile.write(text)
+
+# Split things up because the from __future__ statements must
+# go before any other code.
+HEADER = """# LOLPython to Python converter version 1.0
+# Written by Andrew Dalke, who should have been working on better things.
+
+"""
+
+BODY = """
+# sys is used for COMPLAIN and ARGZ
+import sys as _lol_sys
+
+"""
+
+def to_python(s):
+ L = LOLLexer()
+ L.input(s)
+
+ header = StringIO()
+ header.write(HEADER)
+ header_output = IndentWriter(header)
+
+ body = StringIO()
+ body.write(BODY)
+ body_output = IndentWriter(body)
+
+ write = body_output.write
+ output = body_output
+
+ for t in iter(L.token_stream):
+ if t.type == "NAME":
+ # Need to escape names which are Python variables Do that
+ # by appending an "_". But then I also need to make sure
+ # that "yield_" does not collide with "yield". And you
+ # thought you were being clever trying to use a Python
+ # variable. :)
+ name = t.value.rstrip("_")
+ if name in keyword.kwlist:
+ write(t.value + "_ ")
+ else:
+ write(t.value + " ")
+
+ elif t.type in ("RESERVED", "OP", "NUMBER", "CLOSE"):
+ # While not pretty, I'll put a space after each
+ # term because it's the simplest solution. Otherwise
+ # I'll need to track the amount of whitespace between
+ # the tokens in the original text.
+ write(t.value+" ")
+
+ # XXX escape names which are special in Python!
+ elif t.type == "STRING":
+ write(repr(t.value) + " ")
+
+ elif t.type == "COMMENT":
+ # Not enough information to keep comments on the correct
+ # indentation level. This is good enough. Ugly though.
+ # Maybe I need to fix the tokenizer.
+ write("#"+ t.value[3:]+"\n")
+ output.at_first_column = True
+
+ elif t.type == "COLON":
+ write(":")
+
+ elif t.type == "INDENT":
+ output.indent += 1
+ pass
+ elif t.type == "DEDENT":
+ output.indent -= 1
+ pass
+ elif t.type == "NEWLINE":
+ write(t.value)
+ output.at_first_column = True
+ output = body_output
+ write = output.write
+ elif t.type == "PRINT":
+ if t.value == "stdout":
+ write("print ")
+ elif t.value == "stderr":
+ write("print >>_lol_sys.stderr, ")
+ else:
+ raise AssertionError(t.value)
+ elif t.type == "AUTOCALL":
+ write(t.value + "(")
+ elif t.type == "INLINE":
+ write(t.value)
+ elif t.type == "ENDMARKER":
+ write("\n# The end.\n")
+ elif t.type == "WS":
+ output.leading_ws = t.value
+ elif t.type == "FUTURE":
+ # Write to the header. This is a hack. Err, a hairball.
+ output = header_output
+ write = output.write
+ write("from __future__ import ")
+
+ else:
+ raise AssertionError(t.type)
+
+ return header.getvalue() + body.getvalue()
+
+
+# API code for doing the translation and exec'ing the result
+
+def execfile(infile, module_name="__lolmain__"):
+ "file, module_name -- exec the lolpython file in a newly created module"
+ if not hasattr(infile, "read"):
+ s = open(infile).read()
+ else:
+ s = infile.read()
+ return execstring(s, module_name)
+
+def execstring(s, module_name="__lolmain__"):
+ "s, module_name -- exec the lolpython string in a newly created module"
+ python_s = to_python(s)
+ # Doing this bit of trickiness so I can have LOLPython code act
+ # like __main__. This fix is enough to fool unittest.
+ m = types.ModuleType(module_name)
+ sys.modules[module_name] = m
+ exec python_s in m.__dict__
+ return m
+
+def convert_file(infile, outfile):
+ "read LOLPython code from infile, write converted Python code to outfile"
+ if not hasattr(outfile, "write"):
+ outfile = open(outfile, "w")
+ outfile.write(to_python(infile.read()))
+
+def convert(filenames):
+ "convert LOLPython filenames into corresponding Python '.py' files"
+ if not filenames:
+ convert_file(sys.stdin, sys.stdout)
+ else:
+ for filename in filenames:
+ base, ext = os.path.splitext(filename)
+ convert_file(open(filename), open(base+".py", "w"))
+
+def help():
+ print """convert and run a lolpython program
+Commands are:
+ lolpython Read a lolpython program from stdin and execute it
+ lolpython --convert Convert a lolpython program from stdin
+ and generate python to stdout
+ lolpython --convert filename1 [filename....]
+ Convert a list of lolpython files into Python files
+ lolpython filename [arg1 [arg2 ...]]
+ Run a lolpython program using optional arguments
+"""
+
+def main(argv):
+ if len(argv) >= 2:
+ if argv[1] == "--convert":
+ convert(argv[2:])
+ return
+ if argv[1] == "--help":
+ help()
+ return
+ if argv[1] == "--version":
+ print __NAME__ + " " + __VERSION__
+ return
+
+ # otherwise, run the lolpython program
+ sys.argv = sys.argv[1:]
+ filename = sys.argv[0]
+ execfile(filename, "__main__")
+ else:
+ # commands from stdin
+ execfile(sys.stdin)
+
+
+
+if __name__ == "__main__":
+ main(sys.argv)
diff --git a/chall/notes b/chall/notes
new file mode 100644
index 0000000..c6410c5
--- /dev/null
+++ b/chall/notes
@@ -0,0 +1,41 @@
+Setup a quick docker container with python2 and ply installed to test..
+
+Check out the source code..
+
+First thing we want to find is how the tokens are turned
+into python, since we ideally just want to write python.
+
+We find that tokens of type INLINE are directly injected.
+
+Looking at INLINE tokens we find some which are useful
+for calling functions:
+
+ "ARGZ": ("INLINE", "_lol_sys.argv"),
+ "THINGZ": ("INLINE", "()"), # invisible tuple didn't sound right
+ "THING": ("INLINE", "()"), # sometimes it's better in singular form
+ "MY": ("INLINE", "self."),
+ "MYSELF": ("INLINE", "(self)"),
+
+Looks like the sys module was imported as _lol_sys.
+The other tokens allow us to call functions.
+
+Varibles are injected directly too.. this allows us to call
+builtins by specifying the builtin name, followed by THING.
+
+Since we just want to run python code directly we'd
+like to call `eval` with a string. Strings are
+injected directly after some escape character checks.
+
+In the inline tokens we saw there is one that allows
+us to pass an argument.. MYSELF. For that we need
+to define self.. Lets do that as a simple variable
+instead of the normal definition of self.
+
+We find we can define self using CAN HAS..
+We can print the result of the eval using VISIBLE..
+
+Thus our payload becomes:
+
+ self CAN HAS '<PYTHON-CODE>'
+ VISIBLE eval MYSELF
+
diff --git a/chall/ply-2.2/ANNOUNCE b/chall/ply-2.2/ANNOUNCE
new file mode 100644
index 0000000..ba96215
--- /dev/null
+++ b/chall/ply-2.2/ANNOUNCE
@@ -0,0 +1,48 @@
+November 1, 2006
+
+ Announcing : PLY-2.2 (Python Lex-Yacc)
+
+ http://www.dabeaz.com/ply
+
+I'm pleased to announce a significant new update to PLY---a 100% Python
+implementation of the common parsing tools lex and yacc. PLY-2.2 is
+a minor update that fixes a few bugs and adds some new capabilities.
+
+If you are new to PLY, here are a few highlights:
+
+- PLY is closely modeled after traditional lex/yacc. If you know how
+ to use these or similar tools in other languages, you will find
+ PLY to be comparable.
+
+- PLY provides very extensive error reporting and diagnostic
+ information to assist in parser construction. The original
+ implementation was developed for instructional purposes. As
+ a result, the system tries to identify the most common types
+ of errors made by novice users.
+
+- PLY provides full support for empty productions, error recovery,
+ precedence rules, and ambiguous grammars.
+
+- Parsing is based on LR-parsing which is fast, memory efficient,
+ better suited to large grammars, and which has a number of nice
+ properties when dealing with syntax errors and other parsing
+ problems. Currently, PLY can build its parsing tables using
+ either SLR or LALR(1) algorithms.
+
+- PLY can be used to build parsers for large programming languages.
+ Although it is not ultra-fast due to its Python implementation,
+ PLY can be used to parse grammars consisting of several hundred
+ rules (as might be found for a language like C). The lexer and LR
+ parser are also reasonably efficient when parsing normal
+ sized programs.
+
+More information about PLY can be obtained on the PLY webpage at:
+
+ http://www.dabeaz.com/ply
+
+PLY is freely available and is licensed under the terms of the Lesser
+GNU Public License (LGPL).
+
+Cheers,
+
+David Beazley (http://www.dabeaz.com) \ No newline at end of file
diff --git a/chall/ply-2.2/CHANGES b/chall/ply-2.2/CHANGES
new file mode 100644
index 0000000..bd0894d
--- /dev/null
+++ b/chall/ply-2.2/CHANGES
@@ -0,0 +1,680 @@
+Version 2.2
+------------------------------
+11/01/06: beazley
+ Added lexpos() and lexspan() methods to grammar symbols. These
+ mirror the same functionality of lineno() and linespan(). For
+ example:
+
+ def p_expr(p):
+ 'expr : expr PLUS expr'
+ p.lexpos(1) # Lexing position of left-hand-expression
+ p.lexpos(1) # Lexing position of PLUS
+ start,end = p.lexspan(3) # Lexing range of right hand expression
+
+11/01/06: beazley
+ Minor change to error handling. The recommended way to skip characters
+ in the input is to use t.lexer.skip() as shown here:
+
+ def t_error(t):
+ print "Illegal character '%s'" % t.value[0]
+ t.lexer.skip(1)
+
+ The old approach of just using t.skip(1) will still work, but won't
+ be documented.
+
+10/31/06: beazley
+ Discarded tokens can now be specified as simple strings instead of
+ functions. To do this, simply include the text "ignore_" in the
+ token declaration. For example:
+
+ t_ignore_cppcomment = r'//.*'
+
+ Previously, this had to be done with a function. For example:
+
+ def t_ignore_cppcomment(t):
+ r'//.*'
+ pass
+
+ If start conditions/states are being used, state names should appear
+ before the "ignore_" text.
+
+10/19/06: beazley
+ The Lex module now provides support for flex-style start conditions
+ as described at http://www.gnu.org/software/flex/manual/html_chapter/flex_11.html.
+ Please refer to this document to understand this change note. Refer to
+ the PLY documentation for PLY-specific explanation of how this works.
+
+ To use start conditions, you first need to declare a set of states in
+ your lexer file:
+
+ states = (
+ ('foo','exclusive'),
+ ('bar','inclusive')
+ )
+
+ This serves the same role as the %s and %x specifiers in flex.
+
+ One a state has been declared, tokens for that state can be
+ declared by defining rules of the form t_state_TOK. For example:
+
+ t_PLUS = '\+' # Rule defined in INITIAL state
+ t_foo_NUM = '\d+' # Rule defined in foo state
+ t_bar_NUM = '\d+' # Rule defined in bar state
+
+ t_foo_bar_NUM = '\d+' # Rule defined in both foo and bar
+ t_ANY_NUM = '\d+' # Rule defined in all states
+
+ In addition to defining tokens for each state, the t_ignore and t_error
+ specifications can be customized for specific states. For example:
+
+ t_foo_ignore = " " # Ignored characters for foo state
+ def t_bar_error(t):
+ # Handle errors in bar state
+
+ With token rules, the following methods can be used to change states
+
+ def t_TOKNAME(t):
+ t.lexer.begin('foo') # Begin state 'foo'
+ t.lexer.push_state('foo') # Begin state 'foo', push old state
+ # onto a stack
+ t.lexer.pop_state() # Restore previous state
+ t.lexer.current_state() # Returns name of current state
+
+ These methods mirror the BEGIN(), yy_push_state(), yy_pop_state(), and
+ yy_top_state() functions in flex.
+
+ The use of start states can be used as one way to write sub-lexers.
+ For example, the lexer or parser might instruct the lexer to start
+ generating a different set of tokens depending on the context.
+
+ example/yply/ylex.py shows the use of start states to grab C/C++
+ code fragments out of traditional yacc specification files.
+
+ *** NEW FEATURE *** Suggested by Daniel Larraz with whom I also
+ discussed various aspects of the design.
+
+10/19/06: beazley
+ Minor change to the way in which yacc.py was reporting shift/reduce
+ conflicts. Although the underlying LALR(1) algorithm was correct,
+ PLY was under-reporting the number of conflicts compared to yacc/bison
+ when precedence rules were in effect. This change should make PLY
+ report the same number of conflicts as yacc.
+
+10/19/06: beazley
+ Modified yacc so that grammar rules could also include the '-'
+ character. For example:
+
+ def p_expr_list(p):
+ 'expression-list : expression-list expression'
+
+ Suggested by Oldrich Jedlicka.
+
+10/18/06: beazley
+ Attribute lexer.lexmatch added so that token rules can access the re
+ match object that was generated. For example:
+
+ def t_FOO(t):
+ r'some regex'
+ m = t.lexer.lexmatch
+ # Do something with m
+
+
+ This may be useful if you want to access named groups specified within
+ the regex for a specific token. Suggested by Oldrich Jedlicka.
+
+10/16/06: beazley
+ Changed the error message that results if an illegal character
+ is encountered and no default error function is defined in lex.
+ The exception is now more informative about the actual cause of
+ the error.
+
+Version 2.1
+------------------------------
+10/02/06: beazley
+ The last Lexer object built by lex() can be found in lex.lexer.
+ The last Parser object built by yacc() can be found in yacc.parser.
+
+10/02/06: beazley
+ New example added: examples/yply
+
+ This example uses PLY to convert Unix-yacc specification files to
+ PLY programs with the same grammar. This may be useful if you
+ want to convert a grammar from bison/yacc to use with PLY.
+
+10/02/06: beazley
+ Added support for a start symbol to be specified in the yacc
+ input file itself. Just do this:
+
+ start = 'name'
+
+ where 'name' matches some grammar rule. For example:
+
+ def p_name(p):
+ 'name : A B C'
+ ...
+
+ This mirrors the functionality of the yacc %start specifier.
+
+09/30/06: beazley
+ Some new examples added.:
+
+ examples/GardenSnake : A simple indentation based language similar
+ to Python. Shows how you might handle
+ whitespace. Contributed by Andrew Dalke.
+
+ examples/BASIC : An implementation of 1964 Dartmouth BASIC.
+ Contributed by Dave against his better
+ judgement.
+
+09/28/06: beazley
+ Minor patch to allow named groups to be used in lex regular
+ expression rules. For example:
+
+ t_QSTRING = r'''(?P<quote>['"]).*?(?P=quote)'''
+
+ Patch submitted by Adam Ring.
+
+09/28/06: beazley
+ LALR(1) is now the default parsing method. To use SLR, use
+ yacc.yacc(method="SLR"). Note: there is no performance impact
+ on parsing when using LALR(1) instead of SLR. However, constructing
+ the parsing tables will take a little longer.
+
+09/26/06: beazley
+ Change to line number tracking. To modify line numbers, modify
+ the line number of the lexer itself. For example:
+
+ def t_NEWLINE(t):
+ r'\n'
+ t.lexer.lineno += 1
+
+ This modification is both cleanup and a performance optimization.
+ In past versions, lex was monitoring every token for changes in
+ the line number. This extra processing is unnecessary for a vast
+ majority of tokens. Thus, this new approach cleans it up a bit.
+
+ *** POTENTIAL INCOMPATIBILITY ***
+ You will need to change code in your lexer that updates the line
+ number. For example, "t.lineno += 1" becomes "t.lexer.lineno += 1"
+
+09/26/06: beazley
+ Added the lexing position to tokens as an attribute lexpos. This
+ is the raw index into the input text at which a token appears.
+ This information can be used to compute column numbers and other
+ details (e.g., scan backwards from lexpos to the first newline
+ to get a column position).
+
+09/25/06: beazley
+ Changed the name of the __copy__() method on the Lexer class
+ to clone(). This is used to clone a Lexer object (e.g., if
+ you're running different lexers at the same time).
+
+09/21/06: beazley
+ Limitations related to the use of the re module have been eliminated.
+ Several users reported problems with regular expressions exceeding
+ more than 100 named groups. To solve this, lex.py is now capable
+ of automatically splitting its master regular regular expression into
+ smaller expressions as needed. This should, in theory, make it
+ possible to specify an arbitrarily large number of tokens.
+
+09/21/06: beazley
+ Improved error checking in lex.py. Rules that match the empty string
+ are now rejected (otherwise they cause the lexer to enter an infinite
+ loop). An extra check for rules containing '#' has also been added.
+ Since lex compiles regular expressions in verbose mode, '#' is interpreted
+ as a regex comment, it is critical to use '\#' instead.
+
+09/18/06: beazley
+ Added a @TOKEN decorator function to lex.py that can be used to
+ define token rules where the documentation string might be computed
+ in some way.
+
+ digit = r'([0-9])'
+ nondigit = r'([_A-Za-z])'
+ identifier = r'(' + nondigit + r'(' + digit + r'|' + nondigit + r')*)'
+
+ from ply.lex import TOKEN
+
+ @TOKEN(identifier)
+ def t_ID(t):
+ # Do whatever
+
+ The @TOKEN decorator merely sets the documentation string of the
+ associated token function as needed for lex to work.
+
+ Note: An alternative solution is the following:
+
+ def t_ID(t):
+ # Do whatever
+
+ t_ID.__doc__ = identifier
+
+ Note: Decorators require the use of Python 2.4 or later. If compatibility
+ with old versions is needed, use the latter solution.
+
+ The need for this feature was suggested by Cem Karan.
+
+09/14/06: beazley
+ Support for single-character literal tokens has been added to yacc.
+ These literals must be enclosed in quotes. For example:
+
+ def p_expr(p):
+ "expr : expr '+' expr"
+ ...
+
+ def p_expr(p):
+ 'expr : expr "-" expr'
+ ...
+
+ In addition to this, it is necessary to tell the lexer module about
+ literal characters. This is done by defining the variable 'literals'
+ as a list of characters. This should be defined in the module that
+ invokes the lex.lex() function. For example:
+
+ literals = ['+','-','*','/','(',')','=']
+
+ or simply
+
+ literals = '+=*/()='
+
+ It is important to note that literals can only be a single character.
+ When the lexer fails to match a token using its normal regular expression
+ rules, it will check the current character against the literal list.
+ If found, it will be returned with a token type set to match the literal
+ character. Otherwise, an illegal character will be signalled.
+
+
+09/14/06: beazley
+ Modified PLY to install itself as a proper Python package called 'ply'.
+ This will make it a little more friendly to other modules. This
+ changes the usage of PLY only slightly. Just do this to import the
+ modules
+
+ import ply.lex as lex
+ import ply.yacc as yacc
+
+ Alternatively, you can do this:
+
+ from ply import *
+
+ Which imports both the lex and yacc modules.
+ Change suggested by Lee June.
+
+09/13/06: beazley
+ Changed the handling of negative indices when used in production rules.
+ A negative production index now accesses already parsed symbols on the
+ parsing stack. For example,
+
+ def p_foo(p):
+ "foo: A B C D"
+ print p[1] # Value of 'A' symbol
+ print p[2] # Value of 'B' symbol
+ print p[-1] # Value of whatever symbol appears before A
+ # on the parsing stack.
+
+ p[0] = some_val # Sets the value of the 'foo' grammer symbol
+
+ This behavior makes it easier to work with embedded actions within the
+ parsing rules. For example, in C-yacc, it is possible to write code like
+ this:
+
+ bar: A { printf("seen an A = %d\n", $1); } B { do_stuff; }
+
+ In this example, the printf() code executes immediately after A has been
+ parsed. Within the embedded action code, $1 refers to the A symbol on
+ the stack.
+
+ To perform this equivalent action in PLY, you need to write a pair
+ of rules like this:
+
+ def p_bar(p):
+ "bar : A seen_A B"
+ do_stuff
+
+ def p_seen_A(p):
+ "seen_A :"
+ print "seen an A =", p[-1]
+
+ The second rule "seen_A" is merely a empty production which should be
+ reduced as soon as A is parsed in the "bar" rule above. The use
+ of the negative index p[-1] is used to access whatever symbol appeared
+ before the seen_A symbol.
+
+ This feature also makes it possible to support inherited attributes.
+ For example:
+
+ def p_decl(p):
+ "decl : scope name"
+
+ def p_scope(p):
+ """scope : GLOBAL
+ | LOCAL"""
+ p[0] = p[1]
+
+ def p_name(p):
+ "name : ID"
+ if p[-1] == "GLOBAL":
+ # ...
+ else if p[-1] == "LOCAL":
+ #...
+
+ In this case, the name rule is inheriting an attribute from the
+ scope declaration that precedes it.
+
+ *** POTENTIAL INCOMPATIBILITY ***
+ If you are currently using negative indices within existing grammar rules,
+ your code will break. This should be extremely rare if non-existent in
+ most cases. The argument to various grammar rules is not usually not
+ processed in the same way as a list of items.
+
+Version 2.0
+------------------------------
+09/07/06: beazley
+ Major cleanup and refactoring of the LR table generation code. Both SLR
+ and LALR(1) table generation is now performed by the same code base with
+ only minor extensions for extra LALR(1) processing.
+
+09/07/06: beazley
+ Completely reimplemented the entire LALR(1) parsing engine to use the
+ DeRemer and Pennello algorithm for calculating lookahead sets. This
+ significantly improves the performance of generating LALR(1) tables
+ and has the added feature of actually working correctly! If you
+ experienced weird behavior with LALR(1) in prior releases, this should
+ hopefully resolve all of those problems. Many thanks to
+ Andrew Waters and Markus Schoepflin for submitting bug reports
+ and helping me test out the revised LALR(1) support.
+
+Version 1.8
+------------------------------
+08/02/06: beazley
+ Fixed a problem related to the handling of default actions in LALR(1)
+ parsing. If you experienced subtle and/or bizarre behavior when trying
+ to use the LALR(1) engine, this may correct those problems. Patch
+ contributed by Russ Cox. Note: This patch has been superceded by
+ revisions for LALR(1) parsing in Ply-2.0.
+
+08/02/06: beazley
+ Added support for slicing of productions in yacc.
+ Patch contributed by Patrick Mezard.
+
+Version 1.7
+------------------------------
+03/02/06: beazley
+ Fixed infinite recursion problem ReduceToTerminals() function that
+ would sometimes come up in LALR(1) table generation. Reported by
+ Markus Schoepflin.
+
+03/01/06: beazley
+ Added "reflags" argument to lex(). For example:
+
+ lex.lex(reflags=re.UNICODE)
+
+ This can be used to specify optional flags to the re.compile() function
+ used inside the lexer. This may be necessary for special situations such
+ as processing Unicode (e.g., if you want escapes like \w and \b to consult
+ the Unicode character property database). The need for this suggested by
+ Andreas Jung.
+
+03/01/06: beazley
+ Fixed a bug with an uninitialized variable on repeated instantiations of parser
+ objects when the write_tables=0 argument was used. Reported by Michael Brown.
+
+03/01/06: beazley
+ Modified lex.py to accept Unicode strings both as the regular expressions for
+ tokens and as input. Hopefully this is the only change needed for Unicode support.
+ Patch contributed by Johan Dahl.
+
+03/01/06: beazley
+ Modified the class-based interface to work with new-style or old-style classes.
+ Patch contributed by Michael Brown (although I tweaked it slightly so it would work
+ with older versions of Python).
+
+Version 1.6
+------------------------------
+05/27/05: beazley
+ Incorporated patch contributed by Christopher Stawarz to fix an extremely
+ devious bug in LALR(1) parser generation. This patch should fix problems
+ numerous people reported with LALR parsing.
+
+05/27/05: beazley
+ Fixed problem with lex.py copy constructor. Reported by Dave Aitel, Aaron Lav,
+ and Thad Austin.
+
+05/27/05: beazley
+ Added outputdir option to yacc() to control output directory. Contributed
+ by Christopher Stawarz.
+
+05/27/05: beazley
+ Added rununit.py test script to run tests using the Python unittest module.
+ Contributed by Miki Tebeka.
+
+Version 1.5
+------------------------------
+05/26/04: beazley
+ Major enhancement. LALR(1) parsing support is now working.
+ This feature was implemented by Elias Ioup (ezioup@alumni.uchicago.edu)
+ and optimized by David Beazley. To use LALR(1) parsing do
+ the following:
+
+ yacc.yacc(method="LALR")
+
+ Computing LALR(1) parsing tables takes about twice as long as
+ the default SLR method. However, LALR(1) allows you to handle
+ more complex grammars. For example, the ANSI C grammar
+ (in example/ansic) has 13 shift-reduce conflicts with SLR, but
+ only has 1 shift-reduce conflict with LALR(1).
+
+05/20/04: beazley
+ Added a __len__ method to parser production lists. Can
+ be used in parser rules like this:
+
+ def p_somerule(p):
+ """a : B C D
+ | E F"
+ if (len(p) == 3):
+ # Must have been first rule
+ elif (len(p) == 2):
+ # Must be second rule
+
+ Suggested by Joshua Gerth and others.
+
+Version 1.4
+------------------------------
+04/23/04: beazley
+ Incorporated a variety of patches contributed by Eric Raymond.
+ These include:
+
+ 0. Cleans up some comments so they don't wrap on an 80-column display.
+ 1. Directs compiler errors to stderr where they belong.
+ 2. Implements and documents automatic line counting when \n is ignored.
+ 3. Changes the way progress messages are dumped when debugging is on.
+ The new format is both less verbose and conveys more information than
+ the old, including shift and reduce actions.
+
+04/23/04: beazley
+ Added a Python setup.py file to simply installation. Contributed
+ by Adam Kerrison.
+
+04/23/04: beazley
+ Added patches contributed by Adam Kerrison.
+
+ - Some output is now only shown when debugging is enabled. This
+ means that PLY will be completely silent when not in debugging mode.
+
+ - An optional parameter "write_tables" can be passed to yacc() to
+ control whether or not parsing tables are written. By default,
+ it is true, but it can be turned off if you don't want the yacc
+ table file. Note: disabling this will cause yacc() to regenerate
+ the parsing table each time.
+
+04/23/04: beazley
+ Added patches contributed by David McNab. This patch addes two
+ features:
+
+ - The parser can be supplied as a class instead of a module.
+ For an example of this, see the example/classcalc directory.
+
+ - Debugging output can be directed to a filename of the user's
+ choice. Use
+
+ yacc(debugfile="somefile.out")
+
+
+Version 1.3
+------------------------------
+12/10/02: jmdyck
+ Various minor adjustments to the code that Dave checked in today.
+ Updated test/yacc_{inf,unused}.exp to reflect today's changes.
+
+12/10/02: beazley
+ Incorporated a variety of minor bug fixes to empty production
+ handling and infinite recursion checking. Contributed by
+ Michael Dyck.
+
+12/10/02: beazley
+ Removed bogus recover() method call in yacc.restart()
+
+Version 1.2
+------------------------------
+11/27/02: beazley
+ Lexer and parser objects are now available as an attribute
+ of tokens and slices respectively. For example:
+
+ def t_NUMBER(t):
+ r'\d+'
+ print t.lexer
+
+ def p_expr_plus(t):
+ 'expr: expr PLUS expr'
+ print t.lexer
+ print t.parser
+
+ This can be used for state management (if needed).
+
+10/31/02: beazley
+ Modified yacc.py to work with Python optimize mode. To make
+ this work, you need to use
+
+ yacc.yacc(optimize=1)
+
+ Furthermore, you need to first run Python in normal mode
+ to generate the necessary parsetab.py files. After that,
+ you can use python -O or python -OO.
+
+ Note: optimized mode turns off a lot of error checking.
+ Only use when you are sure that your grammar is working.
+ Make sure parsetab.py is up to date!
+
+10/30/02: beazley
+ Added cloning of Lexer objects. For example:
+
+ import copy
+ l = lex.lex()
+ lc = copy.copy(l)
+
+ l.input("Some text")
+ lc.input("Some other text")
+ ...
+
+ This might be useful if the same "lexer" is meant to
+ be used in different contexts---or if multiple lexers
+ are running concurrently.
+
+10/30/02: beazley
+ Fixed subtle bug with first set computation and empty productions.
+ Patch submitted by Michael Dyck.
+
+10/30/02: beazley
+ Fixed error messages to use "filename:line: message" instead
+ of "filename:line. message". This makes error reporting more
+ friendly to emacs. Patch submitted by François Pinard.
+
+10/30/02: beazley
+ Improvements to parser.out file. Terminals and nonterminals
+ are sorted instead of being printed in random order.
+ Patch submitted by François Pinard.
+
+10/30/02: beazley
+ Improvements to parser.out file output. Rules are now printed
+ in a way that's easier to understand. Contributed by Russ Cox.
+
+10/30/02: beazley
+ Added 'nonassoc' associativity support. This can be used
+ to disable the chaining of operators like a < b < c.
+ To use, simply specify 'nonassoc' in the precedence table
+
+ precedence = (
+ ('nonassoc', 'LESSTHAN', 'GREATERTHAN'), # Nonassociative operators
+ ('left', 'PLUS', 'MINUS'),
+ ('left', 'TIMES', 'DIVIDE'),
+ ('right', 'UMINUS'), # Unary minus operator
+ )
+
+ Patch contributed by Russ Cox.
+
+10/30/02: beazley
+ Modified the lexer to provide optional support for Python -O and -OO
+ modes. To make this work, Python *first* needs to be run in
+ unoptimized mode. This reads the lexing information and creates a
+ file "lextab.py". Then, run lex like this:
+
+ # module foo.py
+ ...
+ ...
+ lex.lex(optimize=1)
+
+ Once the lextab file has been created, subsequent calls to
+ lex.lex() will read data from the lextab file instead of using
+ introspection. In optimized mode (-O, -OO) everything should
+ work normally despite the loss of doc strings.
+
+ To change the name of the file 'lextab.py' use the following:
+
+ lex.lex(lextab="footab")
+
+ (this creates a file footab.py)
+
+
+Version 1.1 October 25, 2001
+------------------------------
+
+10/25/01: beazley
+ Modified the table generator to produce much more compact data.
+ This should greatly reduce the size of the parsetab.py[c] file.
+ Caveat: the tables still need to be constructed so a little more
+ work is done in parsetab on import.
+
+10/25/01: beazley
+ There may be a possible bug in the cycle detector that reports errors
+ about infinite recursion. I'm having a little trouble tracking it
+ down, but if you get this problem, you can disable the cycle
+ detector as follows:
+
+ yacc.yacc(check_recursion = 0)
+
+10/25/01: beazley
+ Fixed a bug in lex.py that sometimes caused illegal characters to be
+ reported incorrectly. Reported by Sverre Jørgensen.
+
+7/8/01 : beazley
+ Added a reference to the underlying lexer object when tokens are handled by
+ functions. The lexer is available as the 'lexer' attribute. This
+ was added to provide better lexing support for languages such as Fortran
+ where certain types of tokens can't be conveniently expressed as regular
+ expressions (and where the tokenizing function may want to perform a
+ little backtracking). Suggested by Pearu Peterson.
+
+6/20/01 : beazley
+ Modified yacc() function so that an optional starting symbol can be specified.
+ For example:
+
+ yacc.yacc(start="statement")
+
+ Normally yacc always treats the first production rule as the starting symbol.
+ However, if you are debugging your grammar it may be useful to specify
+ an alternative starting symbol. Idea suggested by Rich Salz.
+
+Version 1.0 June 18, 2001
+--------------------------
+Initial public offering
+
diff --git a/chall/ply-2.2/COPYING b/chall/ply-2.2/COPYING
new file mode 100644
index 0000000..b1e3f5a
--- /dev/null
+++ b/chall/ply-2.2/COPYING
@@ -0,0 +1,504 @@
+ GNU LESSER GENERAL PUBLIC LICENSE
+ Version 2.1, February 1999
+
+ Copyright (C) 1991, 1999 Free Software Foundation, Inc.
+ 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+ Everyone is permitted to copy and distribute verbatim copies
+ of this license document, but changing it is not allowed.
+
+[This is the first released version of the Lesser GPL. It also counts
+ as the successor of the GNU Library Public License, version 2, hence
+ the version number 2.1.]
+
+ Preamble
+
+ The licenses for most software are designed to take away your
+freedom to share and change it. By contrast, the GNU General Public
+Licenses are intended to guarantee your freedom to share and change
+free software--to make sure the software is free for all its users.
+
+ This license, the Lesser General Public License, applies to some
+specially designated software packages--typically libraries--of the
+Free Software Foundation and other authors who decide to use it. You
+can use it too, but we suggest you first think carefully about whether
+this license or the ordinary General Public License is the better
+strategy to use in any particular case, based on the explanations below.
+
+ When we speak of free software, we are referring to freedom of use,
+not price. Our General Public Licenses are designed to make sure that
+you have the freedom to distribute copies of free software (and charge
+for this service if you wish); that you receive source code or can get
+it if you want it; that you can change the software and use pieces of
+it in new free programs; and that you are informed that you can do
+these things.
+
+ To protect your rights, we need to make restrictions that forbid
+distributors to deny you these rights or to ask you to surrender these
+rights. These restrictions translate to certain responsibilities for
+you if you distribute copies of the library or if you modify it.
+
+ For example, if you distribute copies of the library, whether gratis
+or for a fee, you must give the recipients all the rights that we gave
+you. You must make sure that they, too, receive or can get the source
+code. If you link other code with the library, you must provide
+complete object files to the recipients, so that they can relink them
+with the library after making changes to the library and recompiling
+it. And you must show them these terms so they know their rights.
+
+ We protect your rights with a two-step method: (1) we copyright the
+library, and (2) we offer you this license, which gives you legal
+permission to copy, distribute and/or modify the library.
+
+ To protect each distributor, we want to make it very clear that
+there is no warranty for the free library. Also, if the library is
+modified by someone else and passed on, the recipients should know
+that what they have is not the original version, so that the original
+author's reputation will not be affected by problems that might be
+introduced by others.
+
+ Finally, software patents pose a constant threat to the existence of
+any free program. We wish to make sure that a company cannot
+effectively restrict the users of a free program by obtaining a
+restrictive license from a patent holder. Therefore, we insist that
+any patent license obtained for a version of the library must be
+consistent with the full freedom of use specified in this license.
+
+ Most GNU software, including some libraries, is covered by the
+ordinary GNU General Public License. This license, the GNU Lesser
+General Public License, applies to certain designated libraries, and
+is quite different from the ordinary General Public License. We use
+this license for certain libraries in order to permit linking those
+libraries into non-free programs.
+
+ When a program is linked with a library, whether statically or using
+a shared library, the combination of the two is legally speaking a
+combined work, a derivative of the original library. The ordinary
+General Public License therefore permits such linking only if the
+entire combination fits its criteria of freedom. The Lesser General
+Public License permits more lax criteria for linking other code with
+the library.
+
+ We call this license the "Lesser" General Public License because it
+does Less to protect the user's freedom than the ordinary General
+Public License. It also provides other free software developers Less
+of an advantage over competing non-free programs. These disadvantages
+are the reason we use the ordinary General Public License for many
+libraries. However, the Lesser license provides advantages in certain
+special circumstances.
+
+ For example, on rare occasions, there may be a special need to
+encourage the widest possible use of a certain library, so that it becomes
+a de-facto standard. To achieve this, non-free programs must be
+allowed to use the library. A more frequent case is that a free
+library does the same job as widely used non-free libraries. In this
+case, there is little to gain by limiting the free library to free
+software only, so we use the Lesser General Public License.
+
+ In other cases, permission to use a particular library in non-free
+programs enables a greater number of people to use a large body of
+free software. For example, permission to use the GNU C Library in
+non-free programs enables many more people to use the whole GNU
+operating system, as well as its variant, the GNU/Linux operating
+system.
+
+ Although the Lesser General Public License is Less protective of the
+users' freedom, it does ensure that the user of a program that is
+linked with the Library has the freedom and the wherewithal to run
+that program using a modified version of the Library.
+
+ The precise terms and conditions for copying, distribution and
+modification follow. Pay close attention to the difference between a
+"work based on the library" and a "work that uses the library". The
+former contains code derived from the library, whereas the latter must
+be combined with the library in order to run.
+
+ GNU LESSER GENERAL PUBLIC LICENSE
+ TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION
+
+ 0. This License Agreement applies to any software library or other
+program which contains a notice placed by the copyright holder or
+other authorized party saying it may be distributed under the terms of
+this Lesser General Public License (also called "this License").
+Each licensee is addressed as "you".
+
+ A "library" means a collection of software functions and/or data
+prepared so as to be conveniently linked with application programs
+(which use some of those functions and data) to form executables.
+
+ The "Library", below, refers to any such software library or work
+which has been distributed under these terms. A "work based on the
+Library" means either the Library or any derivative work under
+copyright law: that is to say, a work containing the Library or a
+portion of it, either verbatim or with modifications and/or translated
+straightforwardly into another language. (Hereinafter, translation is
+included without limitation in the term "modification".)
+
+ "Source code" for a work means the preferred form of the work for
+making modifications to it. For a library, complete source code means
+all the source code for all modules it contains, plus any associated
+interface definition files, plus the scripts used to control compilation
+and installation of the library.
+
+ Activities other than copying, distribution and modification are not
+covered by this License; they are outside its scope. The act of
+running a program using the Library is not restricted, and output from
+such a program is covered only if its contents constitute a work based
+on the Library (independent of the use of the Library in a tool for
+writing it). Whether that is true depends on what the Library does
+and what the program that uses the Library does.
+
+ 1. You may copy and distribute verbatim copies of the Library's
+complete source code as you receive it, in any medium, provided that
+you conspicuously and appropriately publish on each copy an
+appropriate copyright notice and disclaimer of warranty; keep intact
+all the notices that refer to this License and to the absence of any
+warranty; and distribute a copy of this License along with the
+Library.
+
+ You may charge a fee for the physical act of transferring a copy,
+and you may at your option offer warranty protection in exchange for a
+fee.
+
+ 2. You may modify your copy or copies of the Library or any portion
+of it, thus forming a work based on the Library, and copy and
+distribute such modifications or work under the terms of Section 1
+above, provided that you also meet all of these conditions:
+
+ a) The modified work must itself be a software library.
+
+ b) You must cause the files modified to carry prominent notices
+ stating that you changed the files and the date of any change.
+
+ c) You must cause the whole of the work to be licensed at no
+ charge to all third parties under the terms of this License.
+
+ d) If a facility in the modified Library refers to a function or a
+ table of data to be supplied by an application program that uses
+ the facility, other than as an argument passed when the facility
+ is invoked, then you must make a good faith effort to ensure that,
+ in the event an application does not supply such function or
+ table, the facility still operates, and performs whatever part of
+ its purpose remains meaningful.
+
+ (For example, a function in a library to compute square roots has
+ a purpose that is entirely well-defined independent of the
+ application. Therefore, Subsection 2d requires that any
+ application-supplied function or table used by this function must
+ be optional: if the application does not supply it, the square
+ root function must still compute square roots.)
+
+These requirements apply to the modified work as a whole. If
+identifiable sections of that work are not derived from the Library,
+and can be reasonably considered independent and separate works in
+themselves, then this License, and its terms, do not apply to those
+sections when you distribute them as separate works. But when you
+distribute the same sections as part of a whole which is a work based
+on the Library, the distribution of the whole must be on the terms of
+this License, whose permissions for other licensees extend to the
+entire whole, and thus to each and every part regardless of who wrote
+it.
+
+Thus, it is not the intent of this section to claim rights or contest
+your rights to work written entirely by you; rather, the intent is to
+exercise the right to control the distribution of derivative or
+collective works based on the Library.
+
+In addition, mere aggregation of another work not based on the Library
+with the Library (or with a work based on the Library) on a volume of
+a storage or distribution medium does not bring the other work under
+the scope of this License.
+
+ 3. You may opt to apply the terms of the ordinary GNU General Public
+License instead of this License to a given copy of the Library. To do
+this, you must alter all the notices that refer to this License, so
+that they refer to the ordinary GNU General Public License, version 2,
+instead of to this License. (If a newer version than version 2 of the
+ordinary GNU General Public License has appeared, then you can specify
+that version instead if you wish.) Do not make any other change in
+these notices.
+
+ Once this change is made in a given copy, it is irreversible for
+that copy, so the ordinary GNU General Public License applies to all
+subsequent copies and derivative works made from that copy.
+
+ This option is useful when you wish to copy part of the code of
+the Library into a program that is not a library.
+
+ 4. You may copy and distribute the Library (or a portion or
+derivative of it, under Section 2) in object code or executable form
+under the terms of Sections 1 and 2 above provided that you accompany
+it with the complete corresponding machine-readable source code, which
+must be distributed under the terms of Sections 1 and 2 above on a
+medium customarily used for software interchange.
+
+ If distribution of object code is made by offering access to copy
+from a designated place, then offering equivalent access to copy the
+source code from the same place satisfies the requirement to
+distribute the source code, even though third parties are not
+compelled to copy the source along with the object code.
+
+ 5. A program that contains no derivative of any portion of the
+Library, but is designed to work with the Library by being compiled or
+linked with it, is called a "work that uses the Library". Such a
+work, in isolation, is not a derivative work of the Library, and
+therefore falls outside the scope of this License.
+
+ However, linking a "work that uses the Library" with the Library
+creates an executable that is a derivative of the Library (because it
+contains portions of the Library), rather than a "work that uses the
+library". The executable is therefore covered by this License.
+Section 6 states terms for distribution of such executables.
+
+ When a "work that uses the Library" uses material from a header file
+that is part of the Library, the object code for the work may be a
+derivative work of the Library even though the source code is not.
+Whether this is true is especially significant if the work can be
+linked without the Library, or if the work is itself a library. The
+threshold for this to be true is not precisely defined by law.
+
+ If such an object file uses only numerical parameters, data
+structure layouts and accessors, and small macros and small inline
+functions (ten lines or less in length), then the use of the object
+file is unrestricted, regardless of whether it is legally a derivative
+work. (Executables containing this object code plus portions of the
+Library will still fall under Section 6.)
+
+ Otherwise, if the work is a derivative of the Library, you may
+distribute the object code for the work under the terms of Section 6.
+Any executables containing that work also fall under Section 6,
+whether or not they are linked directly with the Library itself.
+
+ 6. As an exception to the Sections above, you may also combine or
+link a "work that uses the Library" with the Library to produce a
+work containing portions of the Library, and distribute that work
+under terms of your choice, provided that the terms permit
+modification of the work for the customer's own use and reverse
+engineering for debugging such modifications.
+
+ You must give prominent notice with each copy of the work that the
+Library is used in it and that the Library and its use are covered by
+this License. You must supply a copy of this License. If the work
+during execution displays copyright notices, you must include the
+copyright notice for the Library among them, as well as a reference
+directing the user to the copy of this License. Also, you must do one
+of these things:
+
+ a) Accompany the work with the complete corresponding
+ machine-readable source code for the Library including whatever
+ changes were used in the work (which must be distributed under
+ Sections 1 and 2 above); and, if the work is an executable linked
+ with the Library, with the complete machine-readable "work that
+ uses the Library", as object code and/or source code, so that the
+ user can modify the Library and then relink to produce a modified
+ executable containing the modified Library. (It is understood
+ that the user who changes the contents of definitions files in the
+ Library will not necessarily be able to recompile the application
+ to use the modified definitions.)
+
+ b) Use a suitable shared library mechanism for linking with the
+ Library. A suitable mechanism is one that (1) uses at run time a
+ copy of the library already present on the user's computer system,
+ rather than copying library functions into the executable, and (2)
+ will operate properly with a modified version of the library, if
+ the user installs one, as long as the modified version is
+ interface-compatible with the version that the work was made with.
+
+ c) Accompany the work with a written offer, valid for at
+ least three years, to give the same user the materials
+ specified in Subsection 6a, above, for a charge no more
+ than the cost of performing this distribution.
+
+ d) If distribution of the work is made by offering access to copy
+ from a designated place, offer equivalent access to copy the above
+ specified materials from the same place.
+
+ e) Verify that the user has already received a copy of these
+ materials or that you have already sent this user a copy.
+
+ For an executable, the required form of the "work that uses the
+Library" must include any data and utility programs needed for
+reproducing the executable from it. However, as a special exception,
+the materials to be distributed need not include anything that is
+normally distributed (in either source or binary form) with the major
+components (compiler, kernel, and so on) of the operating system on
+which the executable runs, unless that component itself accompanies
+the executable.
+
+ It may happen that this requirement contradicts the license
+restrictions of other proprietary libraries that do not normally
+accompany the operating system. Such a contradiction means you cannot
+use both them and the Library together in an executable that you
+distribute.
+
+ 7. You may place library facilities that are a work based on the
+Library side-by-side in a single library together with other library
+facilities not covered by this License, and distribute such a combined
+library, provided that the separate distribution of the work based on
+the Library and of the other library facilities is otherwise
+permitted, and provided that you do these two things:
+
+ a) Accompany the combined library with a copy of the same work
+ based on the Library, uncombined with any other library
+ facilities. This must be distributed under the terms of the
+ Sections above.
+
+ b) Give prominent notice with the combined library of the fact
+ that part of it is a work based on the Library, and explaining
+ where to find the accompanying uncombined form of the same work.
+
+ 8. You may not copy, modify, sublicense, link with, or distribute
+the Library except as expressly provided under this License. Any
+attempt otherwise to copy, modify, sublicense, link with, or
+distribute the Library is void, and will automatically terminate your
+rights under this License. However, parties who have received copies,
+or rights, from you under this License will not have their licenses
+terminated so long as such parties remain in full compliance.
+
+ 9. You are not required to accept this License, since you have not
+signed it. However, nothing else grants you permission to modify or
+distribute the Library or its derivative works. These actions are
+prohibited by law if you do not accept this License. Therefore, by
+modifying or distributing the Library (or any work based on the
+Library), you indicate your acceptance of this License to do so, and
+all its terms and conditions for copying, distributing or modifying
+the Library or works based on it.
+
+ 10. Each time you redistribute the Library (or any work based on the
+Library), the recipient automatically receives a license from the
+original licensor to copy, distribute, link with or modify the Library
+subject to these terms and conditions. You may not impose any further
+restrictions on the recipients' exercise of the rights granted herein.
+You are not responsible for enforcing compliance by third parties with
+this License.
+
+ 11. If, as a consequence of a court judgment or allegation of patent
+infringement or for any other reason (not limited to patent issues),
+conditions are imposed on you (whether by court order, agreement or
+otherwise) that contradict the conditions of this License, they do not
+excuse you from the conditions of this License. If you cannot
+distribute so as to satisfy simultaneously your obligations under this
+License and any other pertinent obligations, then as a consequence you
+may not distribute the Library at all. For example, if a patent
+license would not permit royalty-free redistribution of the Library by
+all those who receive copies directly or indirectly through you, then
+the only way you could satisfy both it and this License would be to
+refrain entirely from distribution of the Library.
+
+If any portion of this section is held invalid or unenforceable under any
+particular circumstance, the balance of the section is intended to apply,
+and the section as a whole is intended to apply in other circumstances.
+
+It is not the purpose of this section to induce you to infringe any
+patents or other property right claims or to contest validity of any
+such claims; this section has the sole purpose of protecting the
+integrity of the free software distribution system which is
+implemented by public license practices. Many people have made
+generous contributions to the wide range of software distributed
+through that system in reliance on consistent application of that
+system; it is up to the author/donor to decide if he or she is willing
+to distribute software through any other system and a licensee cannot
+impose that choice.
+
+This section is intended to make thoroughly clear what is believed to
+be a consequence of the rest of this License.
+
+ 12. If the distribution and/or use of the Library is restricted in
+certain countries either by patents or by copyrighted interfaces, the
+original copyright holder who places the Library under this License may add
+an explicit geographical distribution limitation excluding those countries,
+so that distribution is permitted only in or among countries not thus
+excluded. In such case, this License incorporates the limitation as if
+written in the body of this License.
+
+ 13. The Free Software Foundation may publish revised and/or new
+versions of the Lesser General Public License from time to time.
+Such new versions will be similar in spirit to the present version,
+but may differ in detail to address new problems or concerns.
+
+Each version is given a distinguishing version number. If the Library
+specifies a version number of this License which applies to it and
+"any later version", you have the option of following the terms and
+conditions either of that version or of any later version published by
+the Free Software Foundation. If the Library does not specify a
+license version number, you may choose any version ever published by
+the Free Software Foundation.
+
+ 14. If you wish to incorporate parts of the Library into other free
+programs whose distribution conditions are incompatible with these,
+write to the author to ask for permission. For software which is
+copyrighted by the Free Software Foundation, write to the Free
+Software Foundation; we sometimes make exceptions for this. Our
+decision will be guided by the two goals of preserving the free status
+of all derivatives of our free software and of promoting the sharing
+and reuse of software generally.
+
+ NO WARRANTY
+
+ 15. BECAUSE THE LIBRARY IS LICENSED FREE OF CHARGE, THERE IS NO
+WARRANTY FOR THE LIBRARY, TO THE EXTENT PERMITTED BY APPLICABLE LAW.
+EXCEPT WHEN OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR
+OTHER PARTIES PROVIDE THE LIBRARY "AS IS" WITHOUT WARRANTY OF ANY
+KIND, EITHER EXPRESSED OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE
+IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR
+PURPOSE. THE ENTIRE RISK AS TO THE QUALITY AND PERFORMANCE OF THE
+LIBRARY IS WITH YOU. SHOULD THE LIBRARY PROVE DEFECTIVE, YOU ASSUME
+THE COST OF ALL NECESSARY SERVICING, REPAIR OR CORRECTION.
+
+ 16. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN
+WRITING WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY
+AND/OR REDISTRIBUTE THE LIBRARY AS PERMITTED ABOVE, BE LIABLE TO YOU
+FOR DAMAGES, INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR
+CONSEQUENTIAL DAMAGES ARISING OUT OF THE USE OR INABILITY TO USE THE
+LIBRARY (INCLUDING BUT NOT LIMITED TO LOSS OF DATA OR DATA BEING
+RENDERED INACCURATE OR LOSSES SUSTAINED BY YOU OR THIRD PARTIES OR A
+FAILURE OF THE LIBRARY TO OPERATE WITH ANY OTHER SOFTWARE), EVEN IF
+SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE POSSIBILITY OF SUCH
+DAMAGES.
+
+ END OF TERMS AND CONDITIONS
+
+ How to Apply These Terms to Your New Libraries
+
+ If you develop a new library, and you want it to be of the greatest
+possible use to the public, we recommend making it free software that
+everyone can redistribute and change. You can do so by permitting
+redistribution under these terms (or, alternatively, under the terms of the
+ordinary General Public License).
+
+ To apply these terms, attach the following notices to the library. It is
+safest to attach them to the start of each source file to most effectively
+convey the exclusion of warranty; and each file should have at least the
+"copyright" line and a pointer to where the full notice is found.
+
+ <one line to give the library's name and a brief idea of what it does.>
+ Copyright (C) <year> <name of author>
+
+ This library is free software; you can redistribute it and/or
+ modify it under the terms of the GNU Lesser General Public
+ License as published by the Free Software Foundation; either
+ version 2.1 of the License, or (at your option) any later version.
+
+ This library is distributed in the hope that it will be useful,
+ but WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ Lesser General Public License for more details.
+
+ You should have received a copy of the GNU Lesser General Public
+ License along with this library; if not, write to the Free Software
+ Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+
+Also add information on how to contact you by electronic and paper mail.
+
+You should also get your employer (if you work as a programmer) or your
+school, if any, to sign a "copyright disclaimer" for the library, if
+necessary. Here is a sample; alter the names:
+
+ Yoyodyne, Inc., hereby disclaims all copyright interest in the
+ library `Frob' (a library for tweaking knobs) written by James Random Hacker.
+
+ <signature of Ty Coon>, 1 April 1990
+ Ty Coon, President of Vice
+
+That's all there is to it!
+
+
diff --git a/chall/ply-2.2/README b/chall/ply-2.2/README
new file mode 100644
index 0000000..d91e26c
--- /dev/null
+++ b/chall/ply-2.2/README
@@ -0,0 +1,277 @@
+PLY (Python Lex-Yacc) Version 2.2 (November 1, 2006)
+
+David M. Beazley (dave@dabeaz.com)
+
+Copyright (C) 2001-2006 David M. Beazley
+
+This library is free software; you can redistribute it and/or
+modify it under the terms of the GNU Lesser General Public
+License as published by the Free Software Foundation; either
+version 2.1 of the License, or (at your option) any later version.
+
+This library is distributed in the hope that it will be useful,
+but WITHOUT ANY WARRANTY; without even the implied warranty of
+MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+Lesser General Public License for more details.
+
+You should have received a copy of the GNU Lesser General Public
+License along with this library; if not, write to the Free Software
+Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+
+See the file COPYING for a complete copy of the LGPL.
+
+Introduction
+============
+
+PLY is a 100% Python implementation of the common parsing tools lex
+and yacc. Although several other parsing tools are available for
+Python, there are several reasons why you might want to consider PLY:
+
+ - The tools are very closely modeled after traditional lex/yacc.
+ If you know how to use these tools in C, you will find PLY
+ to be similar.
+
+ - PLY provides *very* extensive error reporting and diagnostic
+ information to assist in parser construction. The original
+ implementation was developed for instructional purposes. As
+ a result, the system tries to identify the most common types
+ of errors made by novice users.
+
+ - PLY provides full support for empty productions, error recovery,
+ precedence specifiers, and moderately ambiguous grammars.
+
+ - Parsing is based on LR-parsing which is fast, memory efficient,
+ better suited to large grammars, and which has a number of nice
+ properties when dealing with syntax errors and other parsing problems.
+ Currently, PLY builds its parsing tables using the SLR algorithm which
+ is slightly weaker than LALR(1) used in traditional yacc.
+
+ - PLY uses Python introspection features to build lexers and parsers.
+ This greatly simplifies the task of parser construction since it reduces
+ the number of files and eliminates the need to run a separate lex/yacc
+ tool before running your program.
+
+ - PLY can be used to build parsers for "real" programming languages.
+ Although it is not ultra-fast due to its Python implementation,
+ PLY can be used to parse grammars consisting of several hundred
+ rules (as might be found for a language like C). The lexer and LR
+ parser are also reasonably efficient when parsing typically
+ sized programs.
+
+The original version of PLY was developed for an Introduction to
+Compilers course where students used it to build a compiler for a
+simple Pascal-like language. Their compiler had to include lexical
+analysis, parsing, type checking, type inference, and generation of
+assembly code for the SPARC processor. Because of this, the current
+implementation has been extensively tested and debugged. In addition,
+most of the API and error checking steps have been adapted to address
+common usability problems.
+
+How to Use
+==========
+
+PLY consists of two files : lex.py and yacc.py. These are contained
+within the 'ply' directory which may also be used as a Python package.
+To use PLY, simply copy the 'ply' directory to your project and import
+lex and yacc from the associated 'ply' package. For example:
+
+ import ply.lex as lex
+ import ply.yacc as yacc
+
+Alternatively, you can copy just the files lex.py and yacc.py
+individually and use them as modules. For example:
+
+ import lex
+ import yacc
+
+The file setup.py can be used to install ply using distutils.
+
+The file doc/ply.html contains complete documentation on how to use
+the system.
+
+The example directory contains several different examples including a
+PLY specification for ANSI C as given in K&R 2nd Ed.
+
+A simple example is found at the end of this document
+
+Requirements
+============
+PLY requires the use of Python 2.0 or greater. It should work on
+just about any platform. PLY has been tested with both CPython and
+Jython. However, it does not work with IronPython.
+
+Resources
+=========
+More information about PLY can be obtained on the PLY webpage at:
+
+ http://www.dabeaz.com/ply
+
+For a detailed overview of parsing theory, consult the excellent
+book "Compilers : Principles, Techniques, and Tools" by Aho, Sethi, and
+Ullman. The topics found in "Lex & Yacc" by Levine, Mason, and Brown
+may also be useful.
+
+A Google group for PLY can be found at
+
+ http://groups.google.com/group/ply-hack
+
+Acknowledgments
+===============
+A special thanks is in order for all of the students in CS326 who
+suffered through about 25 different versions of these tools :-).
+
+The CHANGES file acknowledges those who have contributed patches.
+
+Elias Ioup did the first implementation of LALR(1) parsing in PLY-1.x.
+Andrew Waters and Markus Schoepflin were instrumental in reporting bugs
+and testing a revised LALR(1) implementation for PLY-2.0.
+
+Special Note for PLY-2.x
+========================
+PLY-2.0 is the first in a series of PLY releases that will be adding a
+variety of significant new features. The first release in this series
+(Ply-2.0) should be 100% compatible with all previous Ply-1.x releases
+except for the fact that Ply-2.0 features a correct implementation of
+LALR(1) table generation.
+
+If you have suggestions for improving PLY in future 2.x releases, please
+contact me. - Dave
+
+Example
+=======
+
+Here is a simple example showing a PLY implementation of a calculator
+with variables.
+
+# -----------------------------------------------------------------------------
+# calc.py
+#
+# A simple calculator with variables.
+# -----------------------------------------------------------------------------
+
+tokens = (
+ 'NAME','NUMBER',
+ 'PLUS','MINUS','TIMES','DIVIDE','EQUALS',
+ 'LPAREN','RPAREN',
+ )
+
+# Tokens
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_TIMES = r'\*'
+t_DIVIDE = r'/'
+t_EQUALS = r'='
+t_LPAREN = r'\('
+t_RPAREN = r'\)'
+t_NAME = r'[a-zA-Z_][a-zA-Z0-9_]*'
+
+def t_NUMBER(t):
+ r'\d+'
+ try:
+ t.value = int(t.value)
+ except ValueError:
+ print "Integer value too large", t.value
+ t.value = 0
+ return t
+
+# Ignored characters
+t_ignore = " \t"
+
+def t_newline(t):
+ r'\n+'
+ t.lexer.lineno += t.value.count("\n")
+
+def t_error(t):
+ print "Illegal character '%s'" % t.value[0]
+ t.lexer.skip(1)
+
+# Build the lexer
+import ply.lex as lex
+lex.lex()
+
+# Precedence rules for the arithmetic operators
+precedence = (
+ ('left','PLUS','MINUS'),
+ ('left','TIMES','DIVIDE'),
+ ('right','UMINUS'),
+ )
+
+# dictionary of names (for storing variables)
+names = { }
+
+def p_statement_assign(p):
+ 'statement : NAME EQUALS expression'
+ names[p[1]] = p[3]
+
+def p_statement_expr(p):
+ 'statement : expression'
+ print p[1]
+
+def p_expression_binop(p):
+ '''expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+ if p[2] == '+' : p[0] = p[1] + p[3]
+ elif p[2] == '-': p[0] = p[1] - p[3]
+ elif p[2] == '*': p[0] = p[1] * p[3]
+ elif p[2] == '/': p[0] = p[1] / p[3]
+
+def p_expression_uminus(p):
+ 'expression : MINUS expression %prec UMINUS'
+ p[0] = -p[2]
+
+def p_expression_group(p):
+ 'expression : LPAREN expression RPAREN'
+ p[0] = p[2]
+
+def p_expression_number(p):
+ 'expression : NUMBER'
+ p[0] = p[1]
+
+def p_expression_name(p):
+ 'expression : NAME'
+ try:
+ p[0] = names[p[1]]
+ except LookupError:
+ print "Undefined name '%s'" % p[1]
+ p[0] = 0
+
+def p_error(p):
+ print "Syntax error at '%s'" % p.value
+
+import ply.yacc as yacc
+yacc.yacc()
+
+while 1:
+ try:
+ s = raw_input('calc > ')
+ except EOFError:
+ break
+ yacc.parse(s)
+
+
+Bug Reports and Patches
+=======================
+Because of the extremely specialized and advanced nature of PLY, I
+rarely spend much time working on it unless I receive very specific
+bug-reports and/or patches to fix problems. I also try to incorporate
+submitted feature requests and enhancements into each new version. To
+contact me about bugs and/or new features, please send email to
+dave@dabeaz.com.
+
+In addition there is a Google group for discussing PLY related issues at
+
+ http://groups.google.com/group/ply-hack
+
+-- Dave
+
+
+
+
+
+
+
+
+
diff --git a/chall/ply-2.2/TODO b/chall/ply-2.2/TODO
new file mode 100644
index 0000000..7139d53
--- /dev/null
+++ b/chall/ply-2.2/TODO
@@ -0,0 +1,14 @@
+The PLY to-do list:
+
+1. More interesting parsing examples.
+
+2. Work on the ANSI C grammar so that it can actually parse C programs. To do this,
+ some extra code needs to be added to the lexer to deal with typedef names and enumeration
+ constants.
+
+3. More tests in the test directory.
+
+4. Performance improvements and cleanup in yacc.py.
+
+5. More documentation (?).
+
diff --git a/chall/ply-2.2/build/lib.linux-x86_64-2.7/ply/__init__.py b/chall/ply-2.2/build/lib.linux-x86_64-2.7/ply/__init__.py
new file mode 100644
index 0000000..853a985
--- /dev/null
+++ b/chall/ply-2.2/build/lib.linux-x86_64-2.7/ply/__init__.py
@@ -0,0 +1,4 @@
+# PLY package
+# Author: David Beazley (dave@dabeaz.com)
+
+__all__ = ['lex','yacc']
diff --git a/chall/ply-2.2/build/lib.linux-x86_64-2.7/ply/lex.py b/chall/ply-2.2/build/lib.linux-x86_64-2.7/ply/lex.py
new file mode 100644
index 0000000..c149366
--- /dev/null
+++ b/chall/ply-2.2/build/lib.linux-x86_64-2.7/ply/lex.py
@@ -0,0 +1,866 @@
+#-----------------------------------------------------------------------------
+# ply: lex.py
+#
+# Author: David M. Beazley (dave@dabeaz.com)
+#
+# Copyright (C) 2001-2006, David M. Beazley
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+#
+# See the file COPYING for a complete copy of the LGPL.
+#-----------------------------------------------------------------------------
+
+__version__ = "2.2"
+
+import re, sys, types
+
+# Regular expression used to match valid token names
+_is_identifier = re.compile(r'^[a-zA-Z0-9_]+$')
+
+# Available instance types. This is used when lexers are defined by a class.
+# It's a little funky because I want to preserve backwards compatibility
+# with Python 2.0 where types.ObjectType is undefined.
+
+try:
+ _INSTANCETYPE = (types.InstanceType, types.ObjectType)
+except AttributeError:
+ _INSTANCETYPE = types.InstanceType
+ class object: pass # Note: needed if no new-style classes present
+
+# Exception thrown when invalid token encountered and no default error
+# handler is defined.
+class LexError(Exception):
+ def __init__(self,message,s):
+ self.args = (message,)
+ self.text = s
+
+# Token class
+class LexToken(object):
+ def __str__(self):
+ return "LexToken(%s,%r,%d,%d)" % (self.type,self.value,self.lineno,self.lexpos)
+ def __repr__(self):
+ return str(self)
+ def skip(self,n):
+ self.lexer.skip(n)
+
+# -----------------------------------------------------------------------------
+# Lexer class
+#
+# This class encapsulates all of the methods and data associated with a lexer.
+#
+# input() - Store a new string in the lexer
+# token() - Get the next token
+# -----------------------------------------------------------------------------
+
+class Lexer:
+ def __init__(self):
+ self.lexre = None # Master regular expression. This is a list of
+ # tuples (re,findex) where re is a compiled
+ # regular expression and findex is a list
+ # mapping regex group numbers to rules
+ self.lexretext = None # Current regular expression strings
+ self.lexstatere = {} # Dictionary mapping lexer states to master regexs
+ self.lexstateretext = {} # Dictionary mapping lexer states to regex strings
+ self.lexstate = "INITIAL" # Current lexer state
+ self.lexstatestack = [] # Stack of lexer states
+ self.lexstateinfo = None # State information
+ self.lexstateignore = {} # Dictionary of ignored characters for each state
+ self.lexstateerrorf = {} # Dictionary of error functions for each state
+ self.lexreflags = 0 # Optional re compile flags
+ self.lexdata = None # Actual input data (as a string)
+ self.lexpos = 0 # Current position in input text
+ self.lexlen = 0 # Length of the input text
+ self.lexerrorf = None # Error rule (if any)
+ self.lextokens = None # List of valid tokens
+ self.lexignore = "" # Ignored characters
+ self.lexliterals = "" # Literal characters that can be passed through
+ self.lexmodule = None # Module
+ self.lineno = 1 # Current line number
+ self.lexdebug = 0 # Debugging mode
+ self.lexoptimize = 0 # Optimized mode
+
+ def clone(self,object=None):
+ c = Lexer()
+ c.lexstatere = self.lexstatere
+ c.lexstateinfo = self.lexstateinfo
+ c.lexstateretext = self.lexstateretext
+ c.lexstate = self.lexstate
+ c.lexstatestack = self.lexstatestack
+ c.lexstateignore = self.lexstateignore
+ c.lexstateerrorf = self.lexstateerrorf
+ c.lexreflags = self.lexreflags
+ c.lexdata = self.lexdata
+ c.lexpos = self.lexpos
+ c.lexlen = self.lexlen
+ c.lextokens = self.lextokens
+ c.lexdebug = self.lexdebug
+ c.lineno = self.lineno
+ c.lexoptimize = self.lexoptimize
+ c.lexliterals = self.lexliterals
+ c.lexmodule = self.lexmodule
+
+ # If the object parameter has been supplied, it means we are attaching the
+ # lexer to a new object. In this case, we have to rebind all methods in
+ # the lexstatere and lexstateerrorf tables.
+
+ if object:
+ newtab = { }
+ for key, ritem in self.lexstatere.items():
+ newre = []
+ for cre, findex in ritem:
+ newfindex = []
+ for f in findex:
+ if not f or not f[0]:
+ newfindex.append(f)
+ continue
+ newfindex.append((getattr(object,f[0].__name__),f[1]))
+ newre.append((cre,newfindex))
+ newtab[key] = newre
+ c.lexstatere = newtab
+ c.lexstateerrorf = { }
+ for key, ef in self.lexstateerrorf.items():
+ c.lexstateerrorf[key] = getattr(object,ef.__name__)
+ c.lexmodule = object
+
+ # Set up other attributes
+ c.begin(c.lexstate)
+ return c
+
+ # ------------------------------------------------------------
+ # writetab() - Write lexer information to a table file
+ # ------------------------------------------------------------
+ def writetab(self,tabfile):
+ tf = open(tabfile+".py","w")
+ tf.write("# %s.py. This file automatically created by PLY (version %s). Don't edit!\n" % (tabfile,__version__))
+ tf.write("_lextokens = %s\n" % repr(self.lextokens))
+ tf.write("_lexreflags = %s\n" % repr(self.lexreflags))
+ tf.write("_lexliterals = %s\n" % repr(self.lexliterals))
+ tf.write("_lexstateinfo = %s\n" % repr(self.lexstateinfo))
+
+ tabre = { }
+ for key, lre in self.lexstatere.items():
+ titem = []
+ for i in range(len(lre)):
+ titem.append((self.lexstateretext[key][i],_funcs_to_names(lre[i][1])))
+ tabre[key] = titem
+
+ tf.write("_lexstatere = %s\n" % repr(tabre))
+ tf.write("_lexstateignore = %s\n" % repr(self.lexstateignore))
+
+ taberr = { }
+ for key, ef in self.lexstateerrorf.items():
+ if ef:
+ taberr[key] = ef.__name__
+ else:
+ taberr[key] = None
+ tf.write("_lexstateerrorf = %s\n" % repr(taberr))
+ tf.close()
+
+ # ------------------------------------------------------------
+ # readtab() - Read lexer information from a tab file
+ # ------------------------------------------------------------
+ def readtab(self,tabfile,fdict):
+ exec "import %s as lextab" % tabfile
+ self.lextokens = lextab._lextokens
+ self.lexreflags = lextab._lexreflags
+ self.lexliterals = lextab._lexliterals
+ self.lexstateinfo = lextab._lexstateinfo
+ self.lexstateignore = lextab._lexstateignore
+ self.lexstatere = { }
+ self.lexstateretext = { }
+ for key,lre in lextab._lexstatere.items():
+ titem = []
+ txtitem = []
+ for i in range(len(lre)):
+ titem.append((re.compile(lre[i][0],lextab._lexreflags),_names_to_funcs(lre[i][1],fdict)))
+ txtitem.append(lre[i][0])
+ self.lexstatere[key] = titem
+ self.lexstateretext[key] = txtitem
+ self.lexstateerrorf = { }
+ for key,ef in lextab._lexstateerrorf.items():
+ self.lexstateerrorf[key] = fdict[ef]
+ self.begin('INITIAL')
+
+ # ------------------------------------------------------------
+ # input() - Push a new string into the lexer
+ # ------------------------------------------------------------
+ def input(self,s):
+ if not (isinstance(s,types.StringType) or isinstance(s,types.UnicodeType)):
+ raise ValueError, "Expected a string"
+ self.lexdata = s
+ self.lexpos = 0
+ self.lexlen = len(s)
+
+ # ------------------------------------------------------------
+ # begin() - Changes the lexing state
+ # ------------------------------------------------------------
+ def begin(self,state):
+ if not self.lexstatere.has_key(state):
+ raise ValueError, "Undefined state"
+ self.lexre = self.lexstatere[state]
+ self.lexretext = self.lexstateretext[state]
+ self.lexignore = self.lexstateignore.get(state,"")
+ self.lexerrorf = self.lexstateerrorf.get(state,None)
+ self.lexstate = state
+
+ # ------------------------------------------------------------
+ # push_state() - Changes the lexing state and saves old on stack
+ # ------------------------------------------------------------
+ def push_state(self,state):
+ self.lexstatestack.append(self.lexstate)
+ self.begin(state)
+
+ # ------------------------------------------------------------
+ # pop_state() - Restores the previous state
+ # ------------------------------------------------------------
+ def pop_state(self):
+ self.begin(self.lexstatestack.pop())
+
+ # ------------------------------------------------------------
+ # current_state() - Returns the current lexing state
+ # ------------------------------------------------------------
+ def current_state(self):
+ return self.lexstate
+
+ # ------------------------------------------------------------
+ # skip() - Skip ahead n characters
+ # ------------------------------------------------------------
+ def skip(self,n):
+ self.lexpos += n
+
+ # ------------------------------------------------------------
+ # token() - Return the next token from the Lexer
+ #
+ # Note: This function has been carefully implemented to be as fast
+ # as possible. Don't make changes unless you really know what
+ # you are doing
+ # ------------------------------------------------------------
+ def token(self):
+ # Make local copies of frequently referenced attributes
+ lexpos = self.lexpos
+ lexlen = self.lexlen
+ lexignore = self.lexignore
+ lexdata = self.lexdata
+
+ while lexpos < lexlen:
+ # This code provides some short-circuit code for whitespace, tabs, and other ignored characters
+ if lexdata[lexpos] in lexignore:
+ lexpos += 1
+ continue
+
+ # Look for a regular expression match
+ for lexre,lexindexfunc in self.lexre:
+ m = lexre.match(lexdata,lexpos)
+ if not m: continue
+
+ # Set last match in lexer so that rules can access it if they want
+ self.lexmatch = m
+
+ # Create a token for return
+ tok = LexToken()
+ tok.value = m.group()
+ tok.lineno = self.lineno
+ tok.lexpos = lexpos
+ tok.lexer = self
+
+ lexpos = m.end()
+ i = m.lastindex
+ func,tok.type = lexindexfunc[i]
+ self.lexpos = lexpos
+
+ if not func:
+ # If no token type was set, it's an ignored token
+ if tok.type: return tok
+ break
+
+ # if func not callable, it means it's an ignored token
+ if not callable(func):
+ break
+
+ # If token is processed by a function, call it
+ newtok = func(tok)
+
+ # Every function must return a token, if nothing, we just move to next token
+ if not newtok:
+ lexpos = self.lexpos # This is here in case user has updated lexpos.
+ break
+
+ # Verify type of the token. If not in the token map, raise an error
+ if not self.lexoptimize:
+ if not self.lextokens.has_key(newtok.type):
+ raise LexError, ("%s:%d: Rule '%s' returned an unknown token type '%s'" % (
+ func.func_code.co_filename, func.func_code.co_firstlineno,
+ func.__name__, newtok.type),lexdata[lexpos:])
+
+ return newtok
+ else:
+ # No match, see if in literals
+ if lexdata[lexpos] in self.lexliterals:
+ tok = LexToken()
+ tok.value = lexdata[lexpos]
+ tok.lineno = self.lineno
+ tok.lexer = self
+ tok.type = tok.value
+ tok.lexpos = lexpos
+ self.lexpos = lexpos + 1
+ return tok
+
+ # No match. Call t_error() if defined.
+ if self.lexerrorf:
+ tok = LexToken()
+ tok.value = self.lexdata[lexpos:]
+ tok.lineno = self.lineno
+ tok.type = "error"
+ tok.lexer = self
+ tok.lexpos = lexpos
+ self.lexpos = lexpos
+ newtok = self.lexerrorf(tok)
+ if lexpos == self.lexpos:
+ # Error method didn't change text position at all. This is an error.
+ raise LexError, ("Scanning error. Illegal character '%s'" % (lexdata[lexpos]), lexdata[lexpos:])
+ lexpos = self.lexpos
+ if not newtok: continue
+ return newtok
+
+ self.lexpos = lexpos
+ raise LexError, ("Illegal character '%s' at index %d" % (lexdata[lexpos],lexpos), lexdata[lexpos:])
+
+ self.lexpos = lexpos + 1
+ if self.lexdata is None:
+ raise RuntimeError, "No input string given with input()"
+ return None
+
+# -----------------------------------------------------------------------------
+# _validate_file()
+#
+# This checks to see if there are duplicated t_rulename() functions or strings
+# in the parser input file. This is done using a simple regular expression
+# match on each line in the filename.
+# -----------------------------------------------------------------------------
+
+def _validate_file(filename):
+ import os.path
+ base,ext = os.path.splitext(filename)
+ if ext != '.py': return 1 # No idea what the file is. Return OK
+
+ try:
+ f = open(filename)
+ lines = f.readlines()
+ f.close()
+ except IOError:
+ return 1 # Oh well
+
+ fre = re.compile(r'\s*def\s+(t_[a-zA-Z_0-9]*)\(')
+ sre = re.compile(r'\s*(t_[a-zA-Z_0-9]*)\s*=')
+ counthash = { }
+ linen = 1
+ noerror = 1
+ for l in lines:
+ m = fre.match(l)
+ if not m:
+ m = sre.match(l)
+ if m:
+ name = m.group(1)
+ prev = counthash.get(name)
+ if not prev:
+ counthash[name] = linen
+ else:
+ print "%s:%d: Rule %s redefined. Previously defined on line %d" % (filename,linen,name,prev)
+ noerror = 0
+ linen += 1
+ return noerror
+
+# -----------------------------------------------------------------------------
+# _funcs_to_names()
+#
+# Given a list of regular expression functions, this converts it to a list
+# suitable for output to a table file
+# -----------------------------------------------------------------------------
+
+def _funcs_to_names(funclist):
+ result = []
+ for f in funclist:
+ if f and f[0]:
+ result.append((f[0].__name__,f[1]))
+ else:
+ result.append(f)
+ return result
+
+# -----------------------------------------------------------------------------
+# _names_to_funcs()
+#
+# Given a list of regular expression function names, this converts it back to
+# functions.
+# -----------------------------------------------------------------------------
+
+def _names_to_funcs(namelist,fdict):
+ result = []
+ for n in namelist:
+ if n and n[0]:
+ result.append((fdict[n[0]],n[1]))
+ else:
+ result.append(n)
+ return result
+
+# -----------------------------------------------------------------------------
+# _form_master_re()
+#
+# This function takes a list of all of the regex components and attempts to
+# form the master regular expression. Given limitations in the Python re
+# module, it may be necessary to break the master regex into separate expressions.
+# -----------------------------------------------------------------------------
+
+def _form_master_re(relist,reflags,ldict):
+ if not relist: return []
+ regex = "|".join(relist)
+ try:
+ lexre = re.compile(regex,re.VERBOSE | reflags)
+
+ # Build the index to function map for the matching engine
+ lexindexfunc = [ None ] * (max(lexre.groupindex.values())+1)
+ for f,i in lexre.groupindex.items():
+ handle = ldict.get(f,None)
+ if type(handle) in (types.FunctionType, types.MethodType):
+ lexindexfunc[i] = (handle,handle.__name__[2:])
+ elif handle is not None:
+ # If rule was specified as a string, we build an anonymous
+ # callback function to carry out the action
+ if f.find("ignore_") > 0:
+ lexindexfunc[i] = (None,None)
+ print "IGNORE", f
+ else:
+ lexindexfunc[i] = (None, f[2:])
+
+ return [(lexre,lexindexfunc)],[regex]
+ except Exception,e:
+ m = int(len(relist)/2)
+ if m == 0: m = 1
+ llist, lre = _form_master_re(relist[:m],reflags,ldict)
+ rlist, rre = _form_master_re(relist[m:],reflags,ldict)
+ return llist+rlist, lre+rre
+
+# -----------------------------------------------------------------------------
+# def _statetoken(s,names)
+#
+# Given a declaration name s of the form "t_" and a dictionary whose keys are
+# state names, this function returns a tuple (states,tokenname) where states
+# is a tuple of state names and tokenname is the name of the token. For example,
+# calling this with s = "t_foo_bar_SPAM" might return (('foo','bar'),'SPAM')
+# -----------------------------------------------------------------------------
+
+def _statetoken(s,names):
+ nonstate = 1
+ parts = s.split("_")
+ for i in range(1,len(parts)):
+ if not names.has_key(parts[i]) and parts[i] != 'ANY': break
+ if i > 1:
+ states = tuple(parts[1:i])
+ else:
+ states = ('INITIAL',)
+
+ if 'ANY' in states:
+ states = tuple(names.keys())
+
+ tokenname = "_".join(parts[i:])
+ return (states,tokenname)
+
+# -----------------------------------------------------------------------------
+# lex(module)
+#
+# Build all of the regular expression rules from definitions in the supplied module
+# -----------------------------------------------------------------------------
+def lex(module=None,object=None,debug=0,optimize=0,lextab="lextab",reflags=0,nowarn=0):
+ global lexer
+ ldict = None
+ stateinfo = { 'INITIAL' : 'inclusive'}
+ error = 0
+ files = { }
+ lexobj = Lexer()
+ lexobj.lexdebug = debug
+ lexobj.lexoptimize = optimize
+ global token,input
+
+ if nowarn: warn = 0
+ else: warn = 1
+
+ if object: module = object
+
+ if module:
+ # User supplied a module object.
+ if isinstance(module, types.ModuleType):
+ ldict = module.__dict__
+ elif isinstance(module, _INSTANCETYPE):
+ _items = [(k,getattr(module,k)) for k in dir(module)]
+ ldict = { }
+ for (i,v) in _items:
+ ldict[i] = v
+ else:
+ raise ValueError,"Expected a module or instance"
+ lexobj.lexmodule = module
+
+ else:
+ # No module given. We might be able to get information from the caller.
+ try:
+ raise RuntimeError
+ except RuntimeError:
+ e,b,t = sys.exc_info()
+ f = t.tb_frame
+ f = f.f_back # Walk out to our calling function
+ ldict = f.f_globals # Grab its globals dictionary
+
+ if optimize and lextab:
+ try:
+ lexobj.readtab(lextab,ldict)
+ token = lexobj.token
+ input = lexobj.input
+ lexer = lexobj
+ return lexobj
+
+ except ImportError:
+ pass
+
+ # Get the tokens, states, and literals variables (if any)
+ if (module and isinstance(module,_INSTANCETYPE)):
+ tokens = getattr(module,"tokens",None)
+ states = getattr(module,"states",None)
+ literals = getattr(module,"literals","")
+ else:
+ tokens = ldict.get("tokens",None)
+ states = ldict.get("states",None)
+ literals = ldict.get("literals","")
+
+ if not tokens:
+ raise SyntaxError,"lex: module does not define 'tokens'"
+ if not (isinstance(tokens,types.ListType) or isinstance(tokens,types.TupleType)):
+ raise SyntaxError,"lex: tokens must be a list or tuple."
+
+ # Build a dictionary of valid token names
+ lexobj.lextokens = { }
+ if not optimize:
+ for n in tokens:
+ if not _is_identifier.match(n):
+ print "lex: Bad token name '%s'" % n
+ error = 1
+ if warn and lexobj.lextokens.has_key(n):
+ print "lex: Warning. Token '%s' multiply defined." % n
+ lexobj.lextokens[n] = None
+ else:
+ for n in tokens: lexobj.lextokens[n] = None
+
+ if debug:
+ print "lex: tokens = '%s'" % lexobj.lextokens.keys()
+
+ try:
+ for c in literals:
+ if not (isinstance(c,types.StringType) or isinstance(c,types.UnicodeType)) or len(c) > 1:
+ print "lex: Invalid literal %s. Must be a single character" % repr(c)
+ error = 1
+ continue
+
+ except TypeError:
+ print "lex: Invalid literals specification. literals must be a sequence of characters."
+ error = 1
+
+ lexobj.lexliterals = literals
+
+ # Build statemap
+ if states:
+ if not (isinstance(states,types.TupleType) or isinstance(states,types.ListType)):
+ print "lex: states must be defined as a tuple or list."
+ error = 1
+ else:
+ for s in states:
+ if not isinstance(s,types.TupleType) or len(s) != 2:
+ print "lex: invalid state specifier %s. Must be a tuple (statename,'exclusive|inclusive')" % repr(s)
+ error = 1
+ continue
+ name, statetype = s
+ if not isinstance(name,types.StringType):
+ print "lex: state name %s must be a string" % repr(name)
+ error = 1
+ continue
+ if not (statetype == 'inclusive' or statetype == 'exclusive'):
+ print "lex: state type for state %s must be 'inclusive' or 'exclusive'" % name
+ error = 1
+ continue
+ if stateinfo.has_key(name):
+ print "lex: state '%s' already defined." % name
+ error = 1
+ continue
+ stateinfo[name] = statetype
+
+ # Get a list of symbols with the t_ or s_ prefix
+ tsymbols = [f for f in ldict.keys() if f[:2] == 't_' ]
+
+ # Now build up a list of functions and a list of strings
+
+ funcsym = { } # Symbols defined as functions
+ strsym = { } # Symbols defined as strings
+ toknames = { } # Mapping of symbols to token names
+
+ for s in stateinfo.keys():
+ funcsym[s] = []
+ strsym[s] = []
+
+ ignore = { } # Ignore strings by state
+ errorf = { } # Error functions by state
+
+ if len(tsymbols) == 0:
+ raise SyntaxError,"lex: no rules of the form t_rulename are defined."
+
+ for f in tsymbols:
+ t = ldict[f]
+ states, tokname = _statetoken(f,stateinfo)
+ toknames[f] = tokname
+
+ if callable(t):
+ for s in states: funcsym[s].append((f,t))
+ elif (isinstance(t, types.StringType) or isinstance(t,types.UnicodeType)):
+ for s in states: strsym[s].append((f,t))
+ else:
+ print "lex: %s not defined as a function or string" % f
+ error = 1
+
+ # Sort the functions by line number
+ for f in funcsym.values():
+ f.sort(lambda x,y: cmp(x[1].func_code.co_firstlineno,y[1].func_code.co_firstlineno))
+
+ # Sort the strings by regular expression length
+ for s in strsym.values():
+ s.sort(lambda x,y: (len(x[1]) < len(y[1])) - (len(x[1]) > len(y[1])))
+
+ regexs = { }
+
+ # Build the master regular expressions
+ for state in stateinfo.keys():
+ regex_list = []
+
+ # Add rules defined by functions first
+ for fname, f in funcsym[state]:
+ line = f.func_code.co_firstlineno
+ file = f.func_code.co_filename
+ files[file] = None
+ tokname = toknames[fname]
+
+ ismethod = isinstance(f, types.MethodType)
+
+ if not optimize:
+ nargs = f.func_code.co_argcount
+ if ismethod:
+ reqargs = 2
+ else:
+ reqargs = 1
+ if nargs > reqargs:
+ print "%s:%d: Rule '%s' has too many arguments." % (file,line,f.__name__)
+ error = 1
+ continue
+
+ if nargs < reqargs:
+ print "%s:%d: Rule '%s' requires an argument." % (file,line,f.__name__)
+ error = 1
+ continue
+
+ if tokname == 'ignore':
+ print "%s:%d: Rule '%s' must be defined as a string." % (file,line,f.__name__)
+ error = 1
+ continue
+
+ if tokname == 'error':
+ errorf[state] = f
+ continue
+
+ if f.__doc__:
+ if not optimize:
+ try:
+ c = re.compile("(?P<%s>%s)" % (f.__name__,f.__doc__), re.VERBOSE | reflags)
+ if c.match(""):
+ print "%s:%d: Regular expression for rule '%s' matches empty string." % (file,line,f.__name__)
+ error = 1
+ continue
+ except re.error,e:
+ print "%s:%d: Invalid regular expression for rule '%s'. %s" % (file,line,f.__name__,e)
+ if '#' in f.__doc__:
+ print "%s:%d. Make sure '#' in rule '%s' is escaped with '\\#'." % (file,line, f.__name__)
+ error = 1
+ continue
+
+ if debug:
+ print "lex: Adding rule %s -> '%s' (state '%s')" % (f.__name__,f.__doc__, state)
+
+ # Okay. The regular expression seemed okay. Let's append it to the master regular
+ # expression we're building
+
+ regex_list.append("(?P<%s>%s)" % (f.__name__,f.__doc__))
+ else:
+ print "%s:%d: No regular expression defined for rule '%s'" % (file,line,f.__name__)
+
+ # Now add all of the simple rules
+ for name,r in strsym[state]:
+ tokname = toknames[name]
+
+ if tokname == 'ignore':
+ ignore[state] = r
+ continue
+
+ if not optimize:
+ if tokname == 'error':
+ raise SyntaxError,"lex: Rule '%s' must be defined as a function" % name
+ error = 1
+ continue
+
+ if not lexobj.lextokens.has_key(tokname) and tokname.find("ignore_") < 0:
+ print "lex: Rule '%s' defined for an unspecified token %s." % (name,tokname)
+ error = 1
+ continue
+ try:
+ c = re.compile("(?P<%s>%s)" % (name,r),re.VERBOSE | reflags)
+ if (c.match("")):
+ print "lex: Regular expression for rule '%s' matches empty string." % name
+ error = 1
+ continue
+ except re.error,e:
+ print "lex: Invalid regular expression for rule '%s'. %s" % (name,e)
+ if '#' in r:
+ print "lex: Make sure '#' in rule '%s' is escaped with '\\#'." % name
+
+ error = 1
+ continue
+ if debug:
+ print "lex: Adding rule %s -> '%s' (state '%s')" % (name,r,state)
+
+ regex_list.append("(?P<%s>%s)" % (name,r))
+
+ if not regex_list:
+ print "lex: No rules defined for state '%s'" % state
+ error = 1
+
+ regexs[state] = regex_list
+
+
+ if not optimize:
+ for f in files.keys():
+ if not _validate_file(f):
+ error = 1
+
+ if error:
+ raise SyntaxError,"lex: Unable to build lexer."
+
+ # From this point forward, we're reasonably confident that we can build the lexer.
+ # No more errors will be generated, but there might be some warning messages.
+
+ # Build the master regular expressions
+
+ for state in regexs.keys():
+ lexre, re_text = _form_master_re(regexs[state],reflags,ldict)
+ lexobj.lexstatere[state] = lexre
+ lexobj.lexstateretext[state] = re_text
+ if debug:
+ for i in range(len(re_text)):
+ print "lex: state '%s'. regex[%d] = '%s'" % (state, i, re_text[i])
+
+ # For inclusive states, we need to add the INITIAL state
+ for state,type in stateinfo.items():
+ if state != "INITIAL" and type == 'inclusive':
+ lexobj.lexstatere[state].extend(lexobj.lexstatere['INITIAL'])
+ lexobj.lexstateretext[state].extend(lexobj.lexstateretext['INITIAL'])
+
+ lexobj.lexstateinfo = stateinfo
+ lexobj.lexre = lexobj.lexstatere["INITIAL"]
+ lexobj.lexretext = lexobj.lexstateretext["INITIAL"]
+
+ # Set up ignore variables
+ lexobj.lexstateignore = ignore
+ lexobj.lexignore = lexobj.lexstateignore.get("INITIAL","")
+
+ # Set up error functions
+ lexobj.lexstateerrorf = errorf
+ lexobj.lexerrorf = errorf.get("INITIAL",None)
+ if warn and not lexobj.lexerrorf:
+ print "lex: Warning. no t_error rule is defined."
+
+ # Check state information for ignore and error rules
+ for s,stype in stateinfo.items():
+ if stype == 'exclusive':
+ if warn and not errorf.has_key(s):
+ print "lex: Warning. no error rule is defined for exclusive state '%s'" % s
+ if warn and not ignore.has_key(s) and lexobj.lexignore:
+ print "lex: Warning. no ignore rule is defined for exclusive state '%s'" % s
+ elif stype == 'inclusive':
+ if not errorf.has_key(s):
+ errorf[s] = errorf.get("INITIAL",None)
+ if not ignore.has_key(s):
+ ignore[s] = ignore.get("INITIAL","")
+
+
+ # Create global versions of the token() and input() functions
+ token = lexobj.token
+ input = lexobj.input
+ lexer = lexobj
+
+ # If in optimize mode, we write the lextab
+ if lextab and optimize:
+ lexobj.writetab(lextab)
+
+ return lexobj
+
+# -----------------------------------------------------------------------------
+# runmain()
+#
+# This runs the lexer as a main program
+# -----------------------------------------------------------------------------
+
+def runmain(lexer=None,data=None):
+ if not data:
+ try:
+ filename = sys.argv[1]
+ f = open(filename)
+ data = f.read()
+ f.close()
+ except IndexError:
+ print "Reading from standard input (type EOF to end):"
+ data = sys.stdin.read()
+
+ if lexer:
+ _input = lexer.input
+ else:
+ _input = input
+ _input(data)
+ if lexer:
+ _token = lexer.token
+ else:
+ _token = token
+
+ while 1:
+ tok = _token()
+ if not tok: break
+ print "(%s,%r,%d,%d)" % (tok.type, tok.value, tok.lineno,tok.lexpos)
+
+
+# -----------------------------------------------------------------------------
+# @TOKEN(regex)
+#
+# This decorator function can be used to set the regex expression on a function
+# when its docstring might need to be set in an alternative way
+# -----------------------------------------------------------------------------
+
+def TOKEN(r):
+ def set_doc(f):
+ f.__doc__ = r
+ return f
+ return set_doc
+
+# Alternative spelling of the TOKEN decorator
+Token = TOKEN
+
diff --git a/chall/ply-2.2/build/lib.linux-x86_64-2.7/ply/yacc.py b/chall/ply-2.2/build/lib.linux-x86_64-2.7/ply/yacc.py
new file mode 100644
index 0000000..caf98af
--- /dev/null
+++ b/chall/ply-2.2/build/lib.linux-x86_64-2.7/ply/yacc.py
@@ -0,0 +1,2209 @@
+#-----------------------------------------------------------------------------
+# ply: yacc.py
+#
+# Author(s): David M. Beazley (dave@dabeaz.com)
+#
+# Copyright (C) 2001-2006, David M. Beazley
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+#
+# See the file COPYING for a complete copy of the LGPL.
+#
+#
+# This implements an LR parser that is constructed from grammar rules defined
+# as Python functions. The grammer is specified by supplying the BNF inside
+# Python documentation strings. The inspiration for this technique was borrowed
+# from John Aycock's Spark parsing system. PLY might be viewed as cross between
+# Spark and the GNU bison utility.
+#
+# The current implementation is only somewhat object-oriented. The
+# LR parser itself is defined in terms of an object (which allows multiple
+# parsers to co-exist). However, most of the variables used during table
+# construction are defined in terms of global variables. Users shouldn't
+# notice unless they are trying to define multiple parsers at the same
+# time using threads (in which case they should have their head examined).
+#
+# This implementation supports both SLR and LALR(1) parsing. LALR(1)
+# support was originally implemented by Elias Ioup (ezioup@alumni.uchicago.edu),
+# using the algorithm found in Aho, Sethi, and Ullman "Compilers: Principles,
+# Techniques, and Tools" (The Dragon Book). LALR(1) has since been replaced
+# by the more efficient DeRemer and Pennello algorithm.
+#
+# :::::::: WARNING :::::::
+#
+# Construction of LR parsing tables is fairly complicated and expensive.
+# To make this module run fast, a *LOT* of work has been put into
+# optimization---often at the expensive of readability and what might
+# consider to be good Python "coding style." Modify the code at your
+# own risk!
+# ----------------------------------------------------------------------------
+
+__version__ = "2.2"
+
+#-----------------------------------------------------------------------------
+# === User configurable parameters ===
+#
+# Change these to modify the default behavior of yacc (if you wish)
+#-----------------------------------------------------------------------------
+
+yaccdebug = 1 # Debugging mode. If set, yacc generates a
+ # a 'parser.out' file in the current directory
+
+debug_file = 'parser.out' # Default name of the debugging file
+tab_module = 'parsetab' # Default name of the table module
+default_lr = 'LALR' # Default LR table generation method
+
+error_count = 3 # Number of symbols that must be shifted to leave recovery mode
+
+import re, types, sys, cStringIO, md5, os.path
+
+# Exception raised for yacc-related errors
+class YaccError(Exception): pass
+
+#-----------------------------------------------------------------------------
+# === LR Parsing Engine ===
+#
+# The following classes are used for the LR parser itself. These are not
+# used during table construction and are independent of the actual LR
+# table generation algorithm
+#-----------------------------------------------------------------------------
+
+# This class is used to hold non-terminal grammar symbols during parsing.
+# It normally has the following attributes set:
+# .type = Grammar symbol type
+# .value = Symbol value
+# .lineno = Starting line number
+# .endlineno = Ending line number (optional, set automatically)
+# .lexpos = Starting lex position
+# .endlexpos = Ending lex position (optional, set automatically)
+
+class YaccSymbol:
+ def __str__(self): return self.type
+ def __repr__(self): return str(self)
+
+# This class is a wrapper around the objects actually passed to each
+# grammar rule. Index lookup and assignment actually assign the
+# .value attribute of the underlying YaccSymbol object.
+# The lineno() method returns the line number of a given
+# item (or 0 if not defined). The linespan() method returns
+# a tuple of (startline,endline) representing the range of lines
+# for a symbol. The lexspan() method returns a tuple (lexpos,endlexpos)
+# representing the range of positional information for a symbol.
+
+class YaccProduction:
+ def __init__(self,s,stack=None):
+ self.slice = s
+ self.pbstack = []
+ self.stack = stack
+
+ def __getitem__(self,n):
+ if type(n) == types.IntType:
+ if n >= 0: return self.slice[n].value
+ else: return self.stack[n].value
+ else:
+ return [s.value for s in self.slice[n.start:n.stop:n.step]]
+
+ def __setitem__(self,n,v):
+ self.slice[n].value = v
+
+ def __len__(self):
+ return len(self.slice)
+
+ def lineno(self,n):
+ return getattr(self.slice[n],"lineno",0)
+
+ def linespan(self,n):
+ startline = getattr(self.slice[n],"lineno",0)
+ endline = getattr(self.slice[n],"endlineno",startline)
+ return startline,endline
+
+ def lexpos(self,n):
+ return getattr(self.slice[n],"lexpos",0)
+
+ def lexspan(self,n):
+ startpos = getattr(self.slice[n],"lexpos",0)
+ endpos = getattr(self.slice[n],"endlexpos",startpos)
+ return startpos,endpos
+
+ def pushback(self,n):
+ if n <= 0:
+ raise ValueError, "Expected a positive value"
+ if n > (len(self.slice)-1):
+ raise ValueError, "Can't push %d tokens. Only %d are available." % (n,len(self.slice)-1)
+ for i in range(0,n):
+ self.pbstack.append(self.slice[-i-1])
+
+# The LR Parsing engine. This is defined as a class so that multiple parsers
+# can exist in the same process. A user never instantiates this directly.
+# Instead, the global yacc() function should be used to create a suitable Parser
+# object.
+
+class Parser:
+ def __init__(self,magic=None):
+
+ # This is a hack to keep users from trying to instantiate a Parser
+ # object directly.
+
+ if magic != "xyzzy":
+ raise YaccError, "Can't instantiate Parser. Use yacc() instead."
+
+ # Reset internal state
+ self.productions = None # List of productions
+ self.errorfunc = None # Error handling function
+ self.action = { } # LR Action table
+ self.goto = { } # LR goto table
+ self.require = { } # Attribute require table
+ self.method = "Unknown LR" # Table construction method used
+
+ def errok(self):
+ self.errorcount = 0
+
+ def restart(self):
+ del self.statestack[:]
+ del self.symstack[:]
+ sym = YaccSymbol()
+ sym.type = '$end'
+ self.symstack.append(sym)
+ self.statestack.append(0)
+
+ def parse(self,input=None,lexer=None,debug=0):
+ lookahead = None # Current lookahead symbol
+ lookaheadstack = [ ] # Stack of lookahead symbols
+ actions = self.action # Local reference to action table
+ goto = self.goto # Local reference to goto table
+ prod = self.productions # Local reference to production list
+ pslice = YaccProduction(None) # Production object passed to grammar rules
+ pslice.parser = self # Parser object
+ self.errorcount = 0 # Used during error recovery
+
+ # If no lexer was given, we will try to use the lex module
+ if not lexer:
+ import lex
+ lexer = lex.lexer
+
+ pslice.lexer = lexer
+
+ # If input was supplied, pass to lexer
+ if input:
+ lexer.input(input)
+
+ # Tokenize function
+ get_token = lexer.token
+
+ statestack = [ ] # Stack of parsing states
+ self.statestack = statestack
+ symstack = [ ] # Stack of grammar symbols
+ self.symstack = symstack
+
+ pslice.stack = symstack # Put in the production
+ errtoken = None # Err token
+
+ # The start state is assumed to be (0,$end)
+ statestack.append(0)
+ sym = YaccSymbol()
+ sym.type = '$end'
+ symstack.append(sym)
+
+ while 1:
+ # Get the next symbol on the input. If a lookahead symbol
+ # is already set, we just use that. Otherwise, we'll pull
+ # the next token off of the lookaheadstack or from the lexer
+ if debug > 1:
+ print 'state', statestack[-1]
+ if not lookahead:
+ if not lookaheadstack:
+ lookahead = get_token() # Get the next token
+ else:
+ lookahead = lookaheadstack.pop()
+ if not lookahead:
+ lookahead = YaccSymbol()
+ lookahead.type = '$end'
+ if debug:
+ errorlead = ("%s . %s" % (" ".join([xx.type for xx in symstack][1:]), str(lookahead))).lstrip()
+
+ # Check the action table
+ s = statestack[-1]
+ ltype = lookahead.type
+ t = actions.get((s,ltype),None)
+
+ if debug > 1:
+ print 'action', t
+ if t is not None:
+ if t > 0:
+ # shift a symbol on the stack
+ if ltype == '$end':
+ # Error, end of input
+ sys.stderr.write("yacc: Parse error. EOF\n")
+ return
+ statestack.append(t)
+ if debug > 1:
+ sys.stderr.write("%-60s shift state %s\n" % (errorlead, t))
+ symstack.append(lookahead)
+ lookahead = None
+
+ # Decrease error count on successful shift
+ if self.errorcount > 0:
+ self.errorcount -= 1
+
+ continue
+
+ if t < 0:
+ # reduce a symbol on the stack, emit a production
+ p = prod[-t]
+ pname = p.name
+ plen = p.len
+
+ # Get production function
+ sym = YaccSymbol()
+ sym.type = pname # Production name
+ sym.value = None
+ if debug > 1:
+ sys.stderr.write("%-60s reduce %d\n" % (errorlead, -t))
+
+ if plen:
+ targ = symstack[-plen-1:]
+ targ[0] = sym
+ try:
+ sym.lineno = targ[1].lineno
+ sym.endlineno = getattr(targ[-1],"endlineno",targ[-1].lineno)
+ sym.lexpos = targ[1].lexpos
+ sym.endlexpos = getattr(targ[-1],"endlexpos",targ[-1].lexpos)
+ except AttributeError:
+ sym.lineno = 0
+ del symstack[-plen:]
+ del statestack[-plen:]
+ else:
+ sym.lineno = 0
+ targ = [ sym ]
+ pslice.slice = targ
+ pslice.pbstack = []
+ # Call the grammar rule with our special slice object
+ p.func(pslice)
+
+ # If there was a pushback, put that on the stack
+ if pslice.pbstack:
+ lookaheadstack.append(lookahead)
+ for _t in pslice.pbstack:
+ lookaheadstack.append(_t)
+ lookahead = None
+
+ symstack.append(sym)
+ statestack.append(goto[statestack[-1],pname])
+ continue
+
+ if t == 0:
+ n = symstack[-1]
+ return getattr(n,"value",None)
+ sys.stderr.write(errorlead, "\n")
+
+ if t == None:
+ if debug:
+ sys.stderr.write(errorlead + "\n")
+ # We have some kind of parsing error here. To handle
+ # this, we are going to push the current token onto
+ # the tokenstack and replace it with an 'error' token.
+ # If there are any synchronization rules, they may
+ # catch it.
+ #
+ # In addition to pushing the error token, we call call
+ # the user defined p_error() function if this is the
+ # first syntax error. This function is only called if
+ # errorcount == 0.
+ if not self.errorcount:
+ self.errorcount = error_count
+ errtoken = lookahead
+ if errtoken.type == '$end':
+ errtoken = None # End of file!
+ if self.errorfunc:
+ global errok,token,restart
+ errok = self.errok # Set some special functions available in error recovery
+ token = get_token
+ restart = self.restart
+ tok = self.errorfunc(errtoken)
+ del errok, token, restart # Delete special functions
+
+ if not self.errorcount:
+ # User must have done some kind of panic
+ # mode recovery on their own. The
+ # returned token is the next lookahead
+ lookahead = tok
+ errtoken = None
+ continue
+ else:
+ if errtoken:
+ if hasattr(errtoken,"lineno"): lineno = lookahead.lineno
+ else: lineno = 0
+ if lineno:
+ sys.stderr.write("yacc: Syntax error at line %d, token=%s\n" % (lineno, errtoken.type))
+ else:
+ sys.stderr.write("yacc: Syntax error, token=%s" % errtoken.type)
+ else:
+ sys.stderr.write("yacc: Parse error in input. EOF\n")
+ return
+
+ else:
+ self.errorcount = error_count
+
+ # case 1: the statestack only has 1 entry on it. If we're in this state, the
+ # entire parse has been rolled back and we're completely hosed. The token is
+ # discarded and we just keep going.
+
+ if len(statestack) <= 1 and lookahead.type != '$end':
+ lookahead = None
+ errtoken = None
+ # Nuke the pushback stack
+ del lookaheadstack[:]
+ continue
+
+ # case 2: the statestack has a couple of entries on it, but we're
+ # at the end of the file. nuke the top entry and generate an error token
+
+ # Start nuking entries on the stack
+ if lookahead.type == '$end':
+ # Whoa. We're really hosed here. Bail out
+ return
+
+ if lookahead.type != 'error':
+ sym = symstack[-1]
+ if sym.type == 'error':
+ # Hmmm. Error is on top of stack, we'll just nuke input
+ # symbol and continue
+ lookahead = None
+ continue
+ t = YaccSymbol()
+ t.type = 'error'
+ if hasattr(lookahead,"lineno"):
+ t.lineno = lookahead.lineno
+ t.value = lookahead
+ lookaheadstack.append(lookahead)
+ lookahead = t
+ else:
+ symstack.pop()
+ statestack.pop()
+
+ continue
+
+ # Call an error function here
+ raise RuntimeError, "yacc: internal parser error!!!\n"
+
+# -----------------------------------------------------------------------------
+# === Parser Construction ===
+#
+# The following functions and variables are used to implement the yacc() function
+# itself. This is pretty hairy stuff involving lots of error checking,
+# construction of LR items, kernels, and so forth. Although a lot of
+# this work is done using global variables, the resulting Parser object
+# is completely self contained--meaning that it is safe to repeatedly
+# call yacc() with different grammars in the same application.
+# -----------------------------------------------------------------------------
+
+# -----------------------------------------------------------------------------
+# validate_file()
+#
+# This function checks to see if there are duplicated p_rulename() functions
+# in the parser module file. Without this function, it is really easy for
+# users to make mistakes by cutting and pasting code fragments (and it's a real
+# bugger to try and figure out why the resulting parser doesn't work). Therefore,
+# we just do a little regular expression pattern matching of def statements
+# to try and detect duplicates.
+# -----------------------------------------------------------------------------
+
+def validate_file(filename):
+ base,ext = os.path.splitext(filename)
+ if ext != '.py': return 1 # No idea. Assume it's okay.
+
+ try:
+ f = open(filename)
+ lines = f.readlines()
+ f.close()
+ except IOError:
+ return 1 # Oh well
+
+ # Match def p_funcname(
+ fre = re.compile(r'\s*def\s+(p_[a-zA-Z_0-9]*)\(')
+ counthash = { }
+ linen = 1
+ noerror = 1
+ for l in lines:
+ m = fre.match(l)
+ if m:
+ name = m.group(1)
+ prev = counthash.get(name)
+ if not prev:
+ counthash[name] = linen
+ else:
+ sys.stderr.write("%s:%d: Function %s redefined. Previously defined on line %d\n" % (filename,linen,name,prev))
+ noerror = 0
+ linen += 1
+ return noerror
+
+# This function looks for functions that might be grammar rules, but which don't have the proper p_suffix.
+def validate_dict(d):
+ for n,v in d.items():
+ if n[0:2] == 'p_' and type(v) in (types.FunctionType, types.MethodType): continue
+ if n[0:2] == 't_': continue
+
+ if n[0:2] == 'p_':
+ sys.stderr.write("yacc: Warning. '%s' not defined as a function\n" % n)
+ if 1 and isinstance(v,types.FunctionType) and v.func_code.co_argcount == 1:
+ try:
+ doc = v.__doc__.split(" ")
+ if doc[1] == ':':
+ sys.stderr.write("%s:%d: Warning. Possible grammar rule '%s' defined without p_ prefix.\n" % (v.func_code.co_filename, v.func_code.co_firstlineno,n))
+ except StandardError:
+ pass
+
+# -----------------------------------------------------------------------------
+# === GRAMMAR FUNCTIONS ===
+#
+# The following global variables and functions are used to store, manipulate,
+# and verify the grammar rules specified by the user.
+# -----------------------------------------------------------------------------
+
+# Initialize all of the global variables used during grammar construction
+def initialize_vars():
+ global Productions, Prodnames, Prodmap, Terminals
+ global Nonterminals, First, Follow, Precedence, LRitems
+ global Errorfunc, Signature, Requires
+
+ Productions = [None] # A list of all of the productions. The first
+ # entry is always reserved for the purpose of
+ # building an augmented grammar
+
+ Prodnames = { } # A dictionary mapping the names of nonterminals to a list of all
+ # productions of that nonterminal.
+
+ Prodmap = { } # A dictionary that is only used to detect duplicate
+ # productions.
+
+ Terminals = { } # A dictionary mapping the names of terminal symbols to a
+ # list of the rules where they are used.
+
+ Nonterminals = { } # A dictionary mapping names of nonterminals to a list
+ # of rule numbers where they are used.
+
+ First = { } # A dictionary of precomputed FIRST(x) symbols
+
+ Follow = { } # A dictionary of precomputed FOLLOW(x) symbols
+
+ Precedence = { } # Precedence rules for each terminal. Contains tuples of the
+ # form ('right',level) or ('nonassoc', level) or ('left',level)
+
+ LRitems = [ ] # A list of all LR items for the grammar. These are the
+ # productions with the "dot" like E -> E . PLUS E
+
+ Errorfunc = None # User defined error handler
+
+ Signature = md5.new() # Digital signature of the grammar rules, precedence
+ # and other information. Used to determined when a
+ # parsing table needs to be regenerated.
+
+ Requires = { } # Requires list
+
+ # File objects used when creating the parser.out debugging file
+ global _vf, _vfc
+ _vf = cStringIO.StringIO()
+ _vfc = cStringIO.StringIO()
+
+# -----------------------------------------------------------------------------
+# class Production:
+#
+# This class stores the raw information about a single production or grammar rule.
+# It has a few required attributes:
+#
+# name - Name of the production (nonterminal)
+# prod - A list of symbols making up its production
+# number - Production number.
+#
+# In addition, a few additional attributes are used to help with debugging or
+# optimization of table generation.
+#
+# file - File where production action is defined.
+# lineno - Line number where action is defined
+# func - Action function
+# prec - Precedence level
+# lr_next - Next LR item. Example, if we are ' E -> E . PLUS E'
+# then lr_next refers to 'E -> E PLUS . E'
+# lr_index - LR item index (location of the ".") in the prod list.
+# lookaheads - LALR lookahead symbols for this item
+# len - Length of the production (number of symbols on right hand side)
+# -----------------------------------------------------------------------------
+
+class Production:
+ def __init__(self,**kw):
+ for k,v in kw.items():
+ setattr(self,k,v)
+ self.lr_index = -1
+ self.lr0_added = 0 # Flag indicating whether or not added to LR0 closure
+ self.lr1_added = 0 # Flag indicating whether or not added to LR1
+ self.usyms = [ ]
+ self.lookaheads = { }
+ self.lk_added = { }
+ self.setnumbers = [ ]
+
+ def __str__(self):
+ if self.prod:
+ s = "%s -> %s" % (self.name," ".join(self.prod))
+ else:
+ s = "%s -> <empty>" % self.name
+ return s
+
+ def __repr__(self):
+ return str(self)
+
+ # Compute lr_items from the production
+ def lr_item(self,n):
+ if n > len(self.prod): return None
+ p = Production()
+ p.name = self.name
+ p.prod = list(self.prod)
+ p.number = self.number
+ p.lr_index = n
+ p.lookaheads = { }
+ p.setnumbers = self.setnumbers
+ p.prod.insert(n,".")
+ p.prod = tuple(p.prod)
+ p.len = len(p.prod)
+ p.usyms = self.usyms
+
+ # Precompute list of productions immediately following
+ try:
+ p.lrafter = Prodnames[p.prod[n+1]]
+ except (IndexError,KeyError),e:
+ p.lrafter = []
+ try:
+ p.lrbefore = p.prod[n-1]
+ except IndexError:
+ p.lrbefore = None
+
+ return p
+
+class MiniProduction:
+ pass
+
+# regex matching identifiers
+_is_identifier = re.compile(r'^[a-zA-Z0-9_-]+$')
+
+# -----------------------------------------------------------------------------
+# add_production()
+#
+# Given an action function, this function assembles a production rule.
+# The production rule is assumed to be found in the function's docstring.
+# This rule has the general syntax:
+#
+# name1 ::= production1
+# | production2
+# | production3
+# ...
+# | productionn
+# name2 ::= production1
+# | production2
+# ...
+# -----------------------------------------------------------------------------
+
+def add_production(f,file,line,prodname,syms):
+
+ if Terminals.has_key(prodname):
+ sys.stderr.write("%s:%d: Illegal rule name '%s'. Already defined as a token.\n" % (file,line,prodname))
+ return -1
+ if prodname == 'error':
+ sys.stderr.write("%s:%d: Illegal rule name '%s'. error is a reserved word.\n" % (file,line,prodname))
+ return -1
+
+ if not _is_identifier.match(prodname):
+ sys.stderr.write("%s:%d: Illegal rule name '%s'\n" % (file,line,prodname))
+ return -1
+
+ for x in range(len(syms)):
+ s = syms[x]
+ if s[0] in "'\"":
+ try:
+ c = eval(s)
+ if (len(c) > 1):
+ sys.stderr.write("%s:%d: Literal token %s in rule '%s' may only be a single character\n" % (file,line,s, prodname))
+ return -1
+ if not Terminals.has_key(c):
+ Terminals[c] = []
+ syms[x] = c
+ continue
+ except SyntaxError:
+ pass
+ if not _is_identifier.match(s) and s != '%prec':
+ sys.stderr.write("%s:%d: Illegal name '%s' in rule '%s'\n" % (file,line,s, prodname))
+ return -1
+
+ # See if the rule is already in the rulemap
+ map = "%s -> %s" % (prodname,syms)
+ if Prodmap.has_key(map):
+ m = Prodmap[map]
+ sys.stderr.write("%s:%d: Duplicate rule %s.\n" % (file,line, m))
+ sys.stderr.write("%s:%d: Previous definition at %s:%d\n" % (file,line, m.file, m.line))
+ return -1
+
+ p = Production()
+ p.name = prodname
+ p.prod = syms
+ p.file = file
+ p.line = line
+ p.func = f
+ p.number = len(Productions)
+
+
+ Productions.append(p)
+ Prodmap[map] = p
+ if not Nonterminals.has_key(prodname):
+ Nonterminals[prodname] = [ ]
+
+ # Add all terminals to Terminals
+ i = 0
+ while i < len(p.prod):
+ t = p.prod[i]
+ if t == '%prec':
+ try:
+ precname = p.prod[i+1]
+ except IndexError:
+ sys.stderr.write("%s:%d: Syntax error. Nothing follows %%prec.\n" % (p.file,p.line))
+ return -1
+
+ prec = Precedence.get(precname,None)
+ if not prec:
+ sys.stderr.write("%s:%d: Nothing known about the precedence of '%s'\n" % (p.file,p.line,precname))
+ return -1
+ else:
+ p.prec = prec
+ del p.prod[i]
+ del p.prod[i]
+ continue
+
+ if Terminals.has_key(t):
+ Terminals[t].append(p.number)
+ # Is a terminal. We'll assign a precedence to p based on this
+ if not hasattr(p,"prec"):
+ p.prec = Precedence.get(t,('right',0))
+ else:
+ if not Nonterminals.has_key(t):
+ Nonterminals[t] = [ ]
+ Nonterminals[t].append(p.number)
+ i += 1
+
+ if not hasattr(p,"prec"):
+ p.prec = ('right',0)
+
+ # Set final length of productions
+ p.len = len(p.prod)
+ p.prod = tuple(p.prod)
+
+ # Calculate unique syms in the production
+ p.usyms = [ ]
+ for s in p.prod:
+ if s not in p.usyms:
+ p.usyms.append(s)
+
+ # Add to the global productions list
+ try:
+ Prodnames[p.name].append(p)
+ except KeyError:
+ Prodnames[p.name] = [ p ]
+ return 0
+
+# Given a raw rule function, this function rips out its doc string
+# and adds rules to the grammar
+
+def add_function(f):
+ line = f.func_code.co_firstlineno
+ file = f.func_code.co_filename
+ error = 0
+
+ if isinstance(f,types.MethodType):
+ reqdargs = 2
+ else:
+ reqdargs = 1
+
+ if f.func_code.co_argcount > reqdargs:
+ sys.stderr.write("%s:%d: Rule '%s' has too many arguments.\n" % (file,line,f.__name__))
+ return -1
+
+ if f.func_code.co_argcount < reqdargs:
+ sys.stderr.write("%s:%d: Rule '%s' requires an argument.\n" % (file,line,f.__name__))
+ return -1
+
+ if f.__doc__:
+ # Split the doc string into lines
+ pstrings = f.__doc__.splitlines()
+ lastp = None
+ dline = line
+ for ps in pstrings:
+ dline += 1
+ p = ps.split()
+ if not p: continue
+ try:
+ if p[0] == '|':
+ # This is a continuation of a previous rule
+ if not lastp:
+ sys.stderr.write("%s:%d: Misplaced '|'.\n" % (file,dline))
+ return -1
+ prodname = lastp
+ if len(p) > 1:
+ syms = p[1:]
+ else:
+ syms = [ ]
+ else:
+ prodname = p[0]
+ lastp = prodname
+ assign = p[1]
+ if len(p) > 2:
+ syms = p[2:]
+ else:
+ syms = [ ]
+ if assign != ':' and assign != '::=':
+ sys.stderr.write("%s:%d: Syntax error. Expected ':'\n" % (file,dline))
+ return -1
+
+
+ e = add_production(f,file,dline,prodname,syms)
+ error += e
+
+
+ except StandardError:
+ sys.stderr.write("%s:%d: Syntax error in rule '%s'\n" % (file,dline,ps))
+ error -= 1
+ else:
+ sys.stderr.write("%s:%d: No documentation string specified in function '%s'\n" % (file,line,f.__name__))
+ return error
+
+
+# Cycle checking code (Michael Dyck)
+
+def compute_reachable():
+ '''
+ Find each symbol that can be reached from the start symbol.
+ Print a warning for any nonterminals that can't be reached.
+ (Unused terminals have already had their warning.)
+ '''
+ Reachable = { }
+ for s in Terminals.keys() + Nonterminals.keys():
+ Reachable[s] = 0
+
+ mark_reachable_from( Productions[0].prod[0], Reachable )
+
+ for s in Nonterminals.keys():
+ if not Reachable[s]:
+ sys.stderr.write("yacc: Symbol '%s' is unreachable.\n" % s)
+
+def mark_reachable_from(s, Reachable):
+ '''
+ Mark all symbols that are reachable from symbol s.
+ '''
+ if Reachable[s]:
+ # We've already reached symbol s.
+ return
+ Reachable[s] = 1
+ for p in Prodnames.get(s,[]):
+ for r in p.prod:
+ mark_reachable_from(r, Reachable)
+
+# -----------------------------------------------------------------------------
+# compute_terminates()
+#
+# This function looks at the various parsing rules and tries to detect
+# infinite recursion cycles (grammar rules where there is no possible way
+# to derive a string of only terminals).
+# -----------------------------------------------------------------------------
+def compute_terminates():
+ '''
+ Raise an error for any symbols that don't terminate.
+ '''
+ Terminates = {}
+
+ # Terminals:
+ for t in Terminals.keys():
+ Terminates[t] = 1
+
+ Terminates['$end'] = 1
+
+ # Nonterminals:
+
+ # Initialize to false:
+ for n in Nonterminals.keys():
+ Terminates[n] = 0
+
+ # Then propagate termination until no change:
+ while 1:
+ some_change = 0
+ for (n,pl) in Prodnames.items():
+ # Nonterminal n terminates iff any of its productions terminates.
+ for p in pl:
+ # Production p terminates iff all of its rhs symbols terminate.
+ for s in p.prod:
+ if not Terminates[s]:
+ # The symbol s does not terminate,
+ # so production p does not terminate.
+ p_terminates = 0
+ break
+ else:
+ # didn't break from the loop,
+ # so every symbol s terminates
+ # so production p terminates.
+ p_terminates = 1
+
+ if p_terminates:
+ # symbol n terminates!
+ if not Terminates[n]:
+ Terminates[n] = 1
+ some_change = 1
+ # Don't need to consider any more productions for this n.
+ break
+
+ if not some_change:
+ break
+
+ some_error = 0
+ for (s,terminates) in Terminates.items():
+ if not terminates:
+ if not Prodnames.has_key(s) and not Terminals.has_key(s) and s != 'error':
+ # s is used-but-not-defined, and we've already warned of that,
+ # so it would be overkill to say that it's also non-terminating.
+ pass
+ else:
+ sys.stderr.write("yacc: Infinite recursion detected for symbol '%s'.\n" % s)
+ some_error = 1
+
+ return some_error
+
+# -----------------------------------------------------------------------------
+# verify_productions()
+#
+# This function examines all of the supplied rules to see if they seem valid.
+# -----------------------------------------------------------------------------
+def verify_productions(cycle_check=1):
+ error = 0
+ for p in Productions:
+ if not p: continue
+
+ for s in p.prod:
+ if not Prodnames.has_key(s) and not Terminals.has_key(s) and s != 'error':
+ sys.stderr.write("%s:%d: Symbol '%s' used, but not defined as a token or a rule.\n" % (p.file,p.line,s))
+ error = 1
+ continue
+
+ unused_tok = 0
+ # Now verify all of the tokens
+ if yaccdebug:
+ _vf.write("Unused terminals:\n\n")
+ for s,v in Terminals.items():
+ if s != 'error' and not v:
+ sys.stderr.write("yacc: Warning. Token '%s' defined, but not used.\n" % s)
+ if yaccdebug: _vf.write(" %s\n"% s)
+ unused_tok += 1
+
+ # Print out all of the productions
+ if yaccdebug:
+ _vf.write("\nGrammar\n\n")
+ for i in range(1,len(Productions)):
+ _vf.write("Rule %-5d %s\n" % (i, Productions[i]))
+
+ unused_prod = 0
+ # Verify the use of all productions
+ for s,v in Nonterminals.items():
+ if not v:
+ p = Prodnames[s][0]
+ sys.stderr.write("%s:%d: Warning. Rule '%s' defined, but not used.\n" % (p.file,p.line, s))
+ unused_prod += 1
+
+
+ if unused_tok == 1:
+ sys.stderr.write("yacc: Warning. There is 1 unused token.\n")
+ if unused_tok > 1:
+ sys.stderr.write("yacc: Warning. There are %d unused tokens.\n" % unused_tok)
+
+ if unused_prod == 1:
+ sys.stderr.write("yacc: Warning. There is 1 unused rule.\n")
+ if unused_prod > 1:
+ sys.stderr.write("yacc: Warning. There are %d unused rules.\n" % unused_prod)
+
+ if yaccdebug:
+ _vf.write("\nTerminals, with rules where they appear\n\n")
+ ks = Terminals.keys()
+ ks.sort()
+ for k in ks:
+ _vf.write("%-20s : %s\n" % (k, " ".join([str(s) for s in Terminals[k]])))
+ _vf.write("\nNonterminals, with rules where they appear\n\n")
+ ks = Nonterminals.keys()
+ ks.sort()
+ for k in ks:
+ _vf.write("%-20s : %s\n" % (k, " ".join([str(s) for s in Nonterminals[k]])))
+
+ if (cycle_check):
+ compute_reachable()
+ error += compute_terminates()
+# error += check_cycles()
+ return error
+
+# -----------------------------------------------------------------------------
+# build_lritems()
+#
+# This function walks the list of productions and builds a complete set of the
+# LR items. The LR items are stored in two ways: First, they are uniquely
+# numbered and placed in the list _lritems. Second, a linked list of LR items
+# is built for each production. For example:
+#
+# E -> E PLUS E
+#
+# Creates the list
+#
+# [E -> . E PLUS E, E -> E . PLUS E, E -> E PLUS . E, E -> E PLUS E . ]
+# -----------------------------------------------------------------------------
+
+def build_lritems():
+ for p in Productions:
+ lastlri = p
+ lri = p.lr_item(0)
+ i = 0
+ while 1:
+ lri = p.lr_item(i)
+ lastlri.lr_next = lri
+ if not lri: break
+ lri.lr_num = len(LRitems)
+ LRitems.append(lri)
+ lastlri = lri
+ i += 1
+
+ # In order for the rest of the parser generator to work, we need to
+ # guarantee that no more lritems are generated. Therefore, we nuke
+ # the p.lr_item method. (Only used in debugging)
+ # Production.lr_item = None
+
+# -----------------------------------------------------------------------------
+# add_precedence()
+#
+# Given a list of precedence rules, add to the precedence table.
+# -----------------------------------------------------------------------------
+
+def add_precedence(plist):
+ plevel = 0
+ error = 0
+ for p in plist:
+ plevel += 1
+ try:
+ prec = p[0]
+ terms = p[1:]
+ if prec != 'left' and prec != 'right' and prec != 'nonassoc':
+ sys.stderr.write("yacc: Invalid precedence '%s'\n" % prec)
+ return -1
+ for t in terms:
+ if Precedence.has_key(t):
+ sys.stderr.write("yacc: Precedence already specified for terminal '%s'\n" % t)
+ error += 1
+ continue
+ Precedence[t] = (prec,plevel)
+ except:
+ sys.stderr.write("yacc: Invalid precedence table.\n")
+ error += 1
+
+ return error
+
+# -----------------------------------------------------------------------------
+# augment_grammar()
+#
+# Compute the augmented grammar. This is just a rule S' -> start where start
+# is the starting symbol.
+# -----------------------------------------------------------------------------
+
+def augment_grammar(start=None):
+ if not start:
+ start = Productions[1].name
+ Productions[0] = Production(name="S'",prod=[start],number=0,len=1,prec=('right',0),func=None)
+ Productions[0].usyms = [ start ]
+ Nonterminals[start].append(0)
+
+
+# -------------------------------------------------------------------------
+# first()
+#
+# Compute the value of FIRST1(beta) where beta is a tuple of symbols.
+#
+# During execution of compute_first1, the result may be incomplete.
+# Afterward (e.g., when called from compute_follow()), it will be complete.
+# -------------------------------------------------------------------------
+def first(beta):
+
+ # We are computing First(x1,x2,x3,...,xn)
+ result = [ ]
+ for x in beta:
+ x_produces_empty = 0
+
+ # Add all the non-<empty> symbols of First[x] to the result.
+ for f in First[x]:
+ if f == '<empty>':
+ x_produces_empty = 1
+ else:
+ if f not in result: result.append(f)
+
+ if x_produces_empty:
+ # We have to consider the next x in beta,
+ # i.e. stay in the loop.
+ pass
+ else:
+ # We don't have to consider any further symbols in beta.
+ break
+ else:
+ # There was no 'break' from the loop,
+ # so x_produces_empty was true for all x in beta,
+ # so beta produces empty as well.
+ result.append('<empty>')
+
+ return result
+
+
+# FOLLOW(x)
+# Given a non-terminal. This function computes the set of all symbols
+# that might follow it. Dragon book, p. 189.
+
+def compute_follow(start=None):
+ # Add '$end' to the follow list of the start symbol
+ for k in Nonterminals.keys():
+ Follow[k] = [ ]
+
+ if not start:
+ start = Productions[1].name
+
+ Follow[start] = [ '$end' ]
+
+ while 1:
+ didadd = 0
+ for p in Productions[1:]:
+ # Here is the production set
+ for i in range(len(p.prod)):
+ B = p.prod[i]
+ if Nonterminals.has_key(B):
+ # Okay. We got a non-terminal in a production
+ fst = first(p.prod[i+1:])
+ hasempty = 0
+ for f in fst:
+ if f != '<empty>' and f not in Follow[B]:
+ Follow[B].append(f)
+ didadd = 1
+ if f == '<empty>':
+ hasempty = 1
+ if hasempty or i == (len(p.prod)-1):
+ # Add elements of follow(a) to follow(b)
+ for f in Follow[p.name]:
+ if f not in Follow[B]:
+ Follow[B].append(f)
+ didadd = 1
+ if not didadd: break
+
+ if 0 and yaccdebug:
+ _vf.write('\nFollow:\n')
+ for k in Nonterminals.keys():
+ _vf.write("%-20s : %s\n" % (k, " ".join([str(s) for s in Follow[k]])))
+
+# -------------------------------------------------------------------------
+# compute_first1()
+#
+# Compute the value of FIRST1(X) for all symbols
+# -------------------------------------------------------------------------
+def compute_first1():
+
+ # Terminals:
+ for t in Terminals.keys():
+ First[t] = [t]
+
+ First['$end'] = ['$end']
+ First['#'] = ['#'] # what's this for?
+
+ # Nonterminals:
+
+ # Initialize to the empty set:
+ for n in Nonterminals.keys():
+ First[n] = []
+
+ # Then propagate symbols until no change:
+ while 1:
+ some_change = 0
+ for n in Nonterminals.keys():
+ for p in Prodnames[n]:
+ for f in first(p.prod):
+ if f not in First[n]:
+ First[n].append( f )
+ some_change = 1
+ if not some_change:
+ break
+
+ if 0 and yaccdebug:
+ _vf.write('\nFirst:\n')
+ for k in Nonterminals.keys():
+ _vf.write("%-20s : %s\n" %
+ (k, " ".join([str(s) for s in First[k]])))
+
+# -----------------------------------------------------------------------------
+# === SLR Generation ===
+#
+# The following functions are used to construct SLR (Simple LR) parsing tables
+# as described on p.221-229 of the dragon book.
+# -----------------------------------------------------------------------------
+
+# Global variables for the LR parsing engine
+def lr_init_vars():
+ global _lr_action, _lr_goto, _lr_method
+ global _lr_goto_cache, _lr0_cidhash
+
+ _lr_action = { } # Action table
+ _lr_goto = { } # Goto table
+ _lr_method = "Unknown" # LR method used
+ _lr_goto_cache = { }
+ _lr0_cidhash = { }
+
+
+# Compute the LR(0) closure operation on I, where I is a set of LR(0) items.
+# prodlist is a list of productions.
+
+_add_count = 0 # Counter used to detect cycles
+
+def lr0_closure(I):
+ global _add_count
+
+ _add_count += 1
+ prodlist = Productions
+
+ # Add everything in I to J
+ J = I[:]
+ didadd = 1
+ while didadd:
+ didadd = 0
+ for j in J:
+ for x in j.lrafter:
+ if x.lr0_added == _add_count: continue
+ # Add B --> .G to J
+ J.append(x.lr_next)
+ x.lr0_added = _add_count
+ didadd = 1
+
+ return J
+
+# Compute the LR(0) goto function goto(I,X) where I is a set
+# of LR(0) items and X is a grammar symbol. This function is written
+# in a way that guarantees uniqueness of the generated goto sets
+# (i.e. the same goto set will never be returned as two different Python
+# objects). With uniqueness, we can later do fast set comparisons using
+# id(obj) instead of element-wise comparison.
+
+def lr0_goto(I,x):
+ # First we look for a previously cached entry
+ g = _lr_goto_cache.get((id(I),x),None)
+ if g: return g
+
+ # Now we generate the goto set in a way that guarantees uniqueness
+ # of the result
+
+ s = _lr_goto_cache.get(x,None)
+ if not s:
+ s = { }
+ _lr_goto_cache[x] = s
+
+ gs = [ ]
+ for p in I:
+ n = p.lr_next
+ if n and n.lrbefore == x:
+ s1 = s.get(id(n),None)
+ if not s1:
+ s1 = { }
+ s[id(n)] = s1
+ gs.append(n)
+ s = s1
+ g = s.get('$end',None)
+ if not g:
+ if gs:
+ g = lr0_closure(gs)
+ s['$end'] = g
+ else:
+ s['$end'] = gs
+ _lr_goto_cache[(id(I),x)] = g
+ return g
+
+_lr0_cidhash = { }
+
+# Compute the LR(0) sets of item function
+def lr0_items():
+
+ C = [ lr0_closure([Productions[0].lr_next]) ]
+ i = 0
+ for I in C:
+ _lr0_cidhash[id(I)] = i
+ i += 1
+
+ # Loop over the items in C and each grammar symbols
+ i = 0
+ while i < len(C):
+ I = C[i]
+ i += 1
+
+ # Collect all of the symbols that could possibly be in the goto(I,X) sets
+ asyms = { }
+ for ii in I:
+ for s in ii.usyms:
+ asyms[s] = None
+
+ for x in asyms.keys():
+ g = lr0_goto(I,x)
+ if not g: continue
+ if _lr0_cidhash.has_key(id(g)): continue
+ _lr0_cidhash[id(g)] = len(C)
+ C.append(g)
+
+ return C
+
+# -----------------------------------------------------------------------------
+# ==== LALR(1) Parsing ====
+#
+# LALR(1) parsing is almost exactly the same as SLR except that instead of
+# relying upon Follow() sets when performing reductions, a more selective
+# lookahead set that incorporates the state of the LR(0) machine is utilized.
+# Thus, we mainly just have to focus on calculating the lookahead sets.
+#
+# The method used here is due to DeRemer and Pennelo (1982).
+#
+# DeRemer, F. L., and T. J. Pennelo: "Efficient Computation of LALR(1)
+# Lookahead Sets", ACM Transactions on Programming Languages and Systems,
+# Vol. 4, No. 4, Oct. 1982, pp. 615-649
+#
+# Further details can also be found in:
+#
+# J. Tremblay and P. Sorenson, "The Theory and Practice of Compiler Writing",
+# McGraw-Hill Book Company, (1985).
+#
+# Note: This implementation is a complete replacement of the LALR(1)
+# implementation in PLY-1.x releases. That version was based on
+# a less efficient algorithm and it had bugs in its implementation.
+# -----------------------------------------------------------------------------
+
+# -----------------------------------------------------------------------------
+# compute_nullable_nonterminals()
+#
+# Creates a dictionary containing all of the non-terminals that might produce
+# an empty production.
+# -----------------------------------------------------------------------------
+
+def compute_nullable_nonterminals():
+ nullable = {}
+ num_nullable = 0
+ while 1:
+ for p in Productions[1:]:
+ if p.len == 0:
+ nullable[p.name] = 1
+ continue
+ for t in p.prod:
+ if not nullable.has_key(t): break
+ else:
+ nullable[p.name] = 1
+ if len(nullable) == num_nullable: break
+ num_nullable = len(nullable)
+ return nullable
+
+# -----------------------------------------------------------------------------
+# find_nonterminal_trans(C)
+#
+# Given a set of LR(0) items, this functions finds all of the non-terminal
+# transitions. These are transitions in which a dot appears immediately before
+# a non-terminal. Returns a list of tuples of the form (state,N) where state
+# is the state number and N is the nonterminal symbol.
+#
+# The input C is the set of LR(0) items.
+# -----------------------------------------------------------------------------
+
+def find_nonterminal_transitions(C):
+ trans = []
+ for state in range(len(C)):
+ for p in C[state]:
+ if p.lr_index < p.len - 1:
+ t = (state,p.prod[p.lr_index+1])
+ if Nonterminals.has_key(t[1]):
+ if t not in trans: trans.append(t)
+ state = state + 1
+ return trans
+
+# -----------------------------------------------------------------------------
+# dr_relation()
+#
+# Computes the DR(p,A) relationships for non-terminal transitions. The input
+# is a tuple (state,N) where state is a number and N is a nonterminal symbol.
+#
+# Returns a list of terminals.
+# -----------------------------------------------------------------------------
+
+def dr_relation(C,trans,nullable):
+ dr_set = { }
+ state,N = trans
+ terms = []
+
+ g = lr0_goto(C[state],N)
+ for p in g:
+ if p.lr_index < p.len - 1:
+ a = p.prod[p.lr_index+1]
+ if Terminals.has_key(a):
+ if a not in terms: terms.append(a)
+
+ # This extra bit is to handle the start state
+ if state == 0 and N == Productions[0].prod[0]:
+ terms.append('$end')
+
+ return terms
+
+# -----------------------------------------------------------------------------
+# reads_relation()
+#
+# Computes the READS() relation (p,A) READS (t,C).
+# -----------------------------------------------------------------------------
+
+def reads_relation(C, trans, empty):
+ # Look for empty transitions
+ rel = []
+ state, N = trans
+
+ g = lr0_goto(C[state],N)
+ j = _lr0_cidhash.get(id(g),-1)
+ for p in g:
+ if p.lr_index < p.len - 1:
+ a = p.prod[p.lr_index + 1]
+ if empty.has_key(a):
+ rel.append((j,a))
+
+ return rel
+
+# -----------------------------------------------------------------------------
+# compute_lookback_includes()
+#
+# Determines the lookback and includes relations
+#
+# LOOKBACK:
+#
+# This relation is determined by running the LR(0) state machine forward.
+# For example, starting with a production "N : . A B C", we run it forward
+# to obtain "N : A B C ." We then build a relationship between this final
+# state and the starting state. These relationships are stored in a dictionary
+# lookdict.
+#
+# INCLUDES:
+#
+# Computes the INCLUDE() relation (p,A) INCLUDES (p',B).
+#
+# This relation is used to determine non-terminal transitions that occur
+# inside of other non-terminal transition states. (p,A) INCLUDES (p', B)
+# if the following holds:
+#
+# B -> LAT, where T -> epsilon and p' -L-> p
+#
+# L is essentially a prefix (which may be empty), T is a suffix that must be
+# able to derive an empty string. State p' must lead to state p with the string L.
+#
+# -----------------------------------------------------------------------------
+
+def compute_lookback_includes(C,trans,nullable):
+
+ lookdict = {} # Dictionary of lookback relations
+ includedict = {} # Dictionary of include relations
+
+ # Make a dictionary of non-terminal transitions
+ dtrans = {}
+ for t in trans:
+ dtrans[t] = 1
+
+ # Loop over all transitions and compute lookbacks and includes
+ for state,N in trans:
+ lookb = []
+ includes = []
+ for p in C[state]:
+ if p.name != N: continue
+
+ # Okay, we have a name match. We now follow the production all the way
+ # through the state machine until we get the . on the right hand side
+
+ lr_index = p.lr_index
+ j = state
+ while lr_index < p.len - 1:
+ lr_index = lr_index + 1
+ t = p.prod[lr_index]
+
+ # Check to see if this symbol and state are a non-terminal transition
+ if dtrans.has_key((j,t)):
+ # Yes. Okay, there is some chance that this is an includes relation
+ # the only way to know for certain is whether the rest of the
+ # production derives empty
+
+ li = lr_index + 1
+ while li < p.len:
+ if Terminals.has_key(p.prod[li]): break # No forget it
+ if not nullable.has_key(p.prod[li]): break
+ li = li + 1
+ else:
+ # Appears to be a relation between (j,t) and (state,N)
+ includes.append((j,t))
+
+ g = lr0_goto(C[j],t) # Go to next set
+ j = _lr0_cidhash.get(id(g),-1) # Go to next state
+
+ # When we get here, j is the final state, now we have to locate the production
+ for r in C[j]:
+ if r.name != p.name: continue
+ if r.len != p.len: continue
+ i = 0
+ # This look is comparing a production ". A B C" with "A B C ."
+ while i < r.lr_index:
+ if r.prod[i] != p.prod[i+1]: break
+ i = i + 1
+ else:
+ lookb.append((j,r))
+ for i in includes:
+ if not includedict.has_key(i): includedict[i] = []
+ includedict[i].append((state,N))
+ lookdict[(state,N)] = lookb
+
+ return lookdict,includedict
+
+# -----------------------------------------------------------------------------
+# digraph()
+# traverse()
+#
+# The following two functions are used to compute set valued functions
+# of the form:
+#
+# F(x) = F'(x) U U{F(y) | x R y}
+#
+# This is used to compute the values of Read() sets as well as FOLLOW sets
+# in LALR(1) generation.
+#
+# Inputs: X - An input set
+# R - A relation
+# FP - Set-valued function
+# ------------------------------------------------------------------------------
+
+def digraph(X,R,FP):
+ N = { }
+ for x in X:
+ N[x] = 0
+ stack = []
+ F = { }
+ for x in X:
+ if N[x] == 0: traverse(x,N,stack,F,X,R,FP)
+ return F
+
+def traverse(x,N,stack,F,X,R,FP):
+ stack.append(x)
+ d = len(stack)
+ N[x] = d
+ F[x] = FP(x) # F(X) <- F'(x)
+
+ rel = R(x) # Get y's related to x
+ for y in rel:
+ if N[y] == 0:
+ traverse(y,N,stack,F,X,R,FP)
+ N[x] = min(N[x],N[y])
+ for a in F.get(y,[]):
+ if a not in F[x]: F[x].append(a)
+ if N[x] == d:
+ N[stack[-1]] = sys.maxint
+ F[stack[-1]] = F[x]
+ element = stack.pop()
+ while element != x:
+ N[stack[-1]] = sys.maxint
+ F[stack[-1]] = F[x]
+ element = stack.pop()
+
+# -----------------------------------------------------------------------------
+# compute_read_sets()
+#
+# Given a set of LR(0) items, this function computes the read sets.
+#
+# Inputs: C = Set of LR(0) items
+# ntrans = Set of nonterminal transitions
+# nullable = Set of empty transitions
+#
+# Returns a set containing the read sets
+# -----------------------------------------------------------------------------
+
+def compute_read_sets(C, ntrans, nullable):
+ FP = lambda x: dr_relation(C,x,nullable)
+ R = lambda x: reads_relation(C,x,nullable)
+ F = digraph(ntrans,R,FP)
+ return F
+
+# -----------------------------------------------------------------------------
+# compute_follow_sets()
+#
+# Given a set of LR(0) items, a set of non-terminal transitions, a readset,
+# and an include set, this function computes the follow sets
+#
+# Follow(p,A) = Read(p,A) U U {Follow(p',B) | (p,A) INCLUDES (p',B)}
+#
+# Inputs:
+# ntrans = Set of nonterminal transitions
+# readsets = Readset (previously computed)
+# inclsets = Include sets (previously computed)
+#
+# Returns a set containing the follow sets
+# -----------------------------------------------------------------------------
+
+def compute_follow_sets(ntrans,readsets,inclsets):
+ FP = lambda x: readsets[x]
+ R = lambda x: inclsets.get(x,[])
+ F = digraph(ntrans,R,FP)
+ return F
+
+# -----------------------------------------------------------------------------
+# add_lookaheads()
+#
+# Attaches the lookahead symbols to grammar rules.
+#
+# Inputs: lookbacks - Set of lookback relations
+# followset - Computed follow set
+#
+# This function directly attaches the lookaheads to productions contained
+# in the lookbacks set
+# -----------------------------------------------------------------------------
+
+def add_lookaheads(lookbacks,followset):
+ for trans,lb in lookbacks.items():
+ # Loop over productions in lookback
+ for state,p in lb:
+ if not p.lookaheads.has_key(state):
+ p.lookaheads[state] = []
+ f = followset.get(trans,[])
+ for a in f:
+ if a not in p.lookaheads[state]: p.lookaheads[state].append(a)
+
+# -----------------------------------------------------------------------------
+# add_lalr_lookaheads()
+#
+# This function does all of the work of adding lookahead information for use
+# with LALR parsing
+# -----------------------------------------------------------------------------
+
+def add_lalr_lookaheads(C):
+ # Determine all of the nullable nonterminals
+ nullable = compute_nullable_nonterminals()
+
+ # Find all non-terminal transitions
+ trans = find_nonterminal_transitions(C)
+
+ # Compute read sets
+ readsets = compute_read_sets(C,trans,nullable)
+
+ # Compute lookback/includes relations
+ lookd, included = compute_lookback_includes(C,trans,nullable)
+
+ # Compute LALR FOLLOW sets
+ followsets = compute_follow_sets(trans,readsets,included)
+
+ # Add all of the lookaheads
+ add_lookaheads(lookd,followsets)
+
+# -----------------------------------------------------------------------------
+# lr_parse_table()
+#
+# This function constructs the parse tables for SLR or LALR
+# -----------------------------------------------------------------------------
+def lr_parse_table(method):
+ global _lr_method
+ goto = _lr_goto # Goto array
+ action = _lr_action # Action array
+ actionp = { } # Action production array (temporary)
+
+ _lr_method = method
+
+ n_srconflict = 0
+ n_rrconflict = 0
+
+ if yaccdebug:
+ sys.stderr.write("yacc: Generating %s parsing table...\n" % method)
+ _vf.write("\n\nParsing method: %s\n\n" % method)
+
+ # Step 1: Construct C = { I0, I1, ... IN}, collection of LR(0) items
+ # This determines the number of states
+
+ C = lr0_items()
+
+ if method == 'LALR':
+ add_lalr_lookaheads(C)
+
+ # Build the parser table, state by state
+ st = 0
+ for I in C:
+ # Loop over each production in I
+ actlist = [ ] # List of actions
+
+ if yaccdebug:
+ _vf.write("\nstate %d\n\n" % st)
+ for p in I:
+ _vf.write(" (%d) %s\n" % (p.number, str(p)))
+ _vf.write("\n")
+
+ for p in I:
+ try:
+ if p.prod[-1] == ".":
+ if p.name == "S'":
+ # Start symbol. Accept!
+ action[st,"$end"] = 0
+ actionp[st,"$end"] = p
+ else:
+ # We are at the end of a production. Reduce!
+ if method == 'LALR':
+ laheads = p.lookaheads[st]
+ else:
+ laheads = Follow[p.name]
+ for a in laheads:
+ actlist.append((a,p,"reduce using rule %d (%s)" % (p.number,p)))
+ r = action.get((st,a),None)
+ if r is not None:
+ # Whoa. Have a shift/reduce or reduce/reduce conflict
+ if r > 0:
+ # Need to decide on shift or reduce here
+ # By default we favor shifting. Need to add
+ # some precedence rules here.
+ sprec,slevel = Productions[actionp[st,a].number].prec
+ rprec,rlevel = Precedence.get(a,('right',0))
+ if (slevel < rlevel) or ((slevel == rlevel) and (rprec == 'left')):
+ # We really need to reduce here.
+ action[st,a] = -p.number
+ actionp[st,a] = p
+ if not slevel and not rlevel:
+ _vfc.write("shift/reduce conflict in state %d resolved as reduce.\n" % st)
+ _vf.write(" ! shift/reduce conflict for %s resolved as reduce.\n" % a)
+ n_srconflict += 1
+ elif (slevel == rlevel) and (rprec == 'nonassoc'):
+ action[st,a] = None
+ else:
+ # Hmmm. Guess we'll keep the shift
+ if not rlevel:
+ _vfc.write("shift/reduce conflict in state %d resolved as shift.\n" % st)
+ _vf.write(" ! shift/reduce conflict for %s resolved as shift.\n" % a)
+ n_srconflict +=1
+ elif r < 0:
+ # Reduce/reduce conflict. In this case, we favor the rule
+ # that was defined first in the grammar file
+ oldp = Productions[-r]
+ pp = Productions[p.number]
+ if oldp.line > pp.line:
+ action[st,a] = -p.number
+ actionp[st,a] = p
+ # sys.stderr.write("Reduce/reduce conflict in state %d\n" % st)
+ n_rrconflict += 1
+ _vfc.write("reduce/reduce conflict in state %d resolved using rule %d (%s).\n" % (st, actionp[st,a].number, actionp[st,a]))
+ _vf.write(" ! reduce/reduce conflict for %s resolved using rule %d (%s).\n" % (a,actionp[st,a].number, actionp[st,a]))
+ else:
+ sys.stderr.write("Unknown conflict in state %d\n" % st)
+ else:
+ action[st,a] = -p.number
+ actionp[st,a] = p
+ else:
+ i = p.lr_index
+ a = p.prod[i+1] # Get symbol right after the "."
+ if Terminals.has_key(a):
+ g = lr0_goto(I,a)
+ j = _lr0_cidhash.get(id(g),-1)
+ if j >= 0:
+ # We are in a shift state
+ actlist.append((a,p,"shift and go to state %d" % j))
+ r = action.get((st,a),None)
+ if r is not None:
+ # Whoa have a shift/reduce or shift/shift conflict
+ if r > 0:
+ if r != j:
+ sys.stderr.write("Shift/shift conflict in state %d\n" % st)
+ elif r < 0:
+ # Do a precedence check.
+ # - if precedence of reduce rule is higher, we reduce.
+ # - if precedence of reduce is same and left assoc, we reduce.
+ # - otherwise we shift
+ rprec,rlevel = Productions[actionp[st,a].number].prec
+ sprec,slevel = Precedence.get(a,('right',0))
+ if (slevel > rlevel) or ((slevel == rlevel) and (rprec != 'left')):
+ # We decide to shift here... highest precedence to shift
+ action[st,a] = j
+ actionp[st,a] = p
+ if not rlevel:
+ n_srconflict += 1
+ _vfc.write("shift/reduce conflict in state %d resolved as shift.\n" % st)
+ _vf.write(" ! shift/reduce conflict for %s resolved as shift.\n" % a)
+ elif (slevel == rlevel) and (rprec == 'nonassoc'):
+ action[st,a] = None
+ else:
+ # Hmmm. Guess we'll keep the reduce
+ if not slevel and not rlevel:
+ n_srconflict +=1
+ _vfc.write("shift/reduce conflict in state %d resolved as reduce.\n" % st)
+ _vf.write(" ! shift/reduce conflict for %s resolved as reduce.\n" % a)
+
+ else:
+ sys.stderr.write("Unknown conflict in state %d\n" % st)
+ else:
+ action[st,a] = j
+ actionp[st,a] = p
+
+ except StandardError,e:
+ raise YaccError, "Hosed in lr_parse_table", e
+
+ # Print the actions associated with each terminal
+ if yaccdebug:
+ _actprint = { }
+ for a,p,m in actlist:
+ if action.has_key((st,a)):
+ if p is actionp[st,a]:
+ _vf.write(" %-15s %s\n" % (a,m))
+ _actprint[(a,m)] = 1
+ _vf.write("\n")
+ for a,p,m in actlist:
+ if action.has_key((st,a)):
+ if p is not actionp[st,a]:
+ if not _actprint.has_key((a,m)):
+ _vf.write(" ! %-15s [ %s ]\n" % (a,m))
+ _actprint[(a,m)] = 1
+
+ # Construct the goto table for this state
+ if yaccdebug:
+ _vf.write("\n")
+ nkeys = { }
+ for ii in I:
+ for s in ii.usyms:
+ if Nonterminals.has_key(s):
+ nkeys[s] = None
+ for n in nkeys.keys():
+ g = lr0_goto(I,n)
+ j = _lr0_cidhash.get(id(g),-1)
+ if j >= 0:
+ goto[st,n] = j
+ if yaccdebug:
+ _vf.write(" %-30s shift and go to state %d\n" % (n,j))
+
+ st += 1
+
+ if yaccdebug:
+ if n_srconflict == 1:
+ sys.stderr.write("yacc: %d shift/reduce conflict\n" % n_srconflict)
+ if n_srconflict > 1:
+ sys.stderr.write("yacc: %d shift/reduce conflicts\n" % n_srconflict)
+ if n_rrconflict == 1:
+ sys.stderr.write("yacc: %d reduce/reduce conflict\n" % n_rrconflict)
+ if n_rrconflict > 1:
+ sys.stderr.write("yacc: %d reduce/reduce conflicts\n" % n_rrconflict)
+
+# -----------------------------------------------------------------------------
+# ==== LR Utility functions ====
+# -----------------------------------------------------------------------------
+
+# -----------------------------------------------------------------------------
+# _lr_write_tables()
+#
+# This function writes the LR parsing tables to a file
+# -----------------------------------------------------------------------------
+
+def lr_write_tables(modulename=tab_module,outputdir=''):
+ filename = os.path.join(outputdir,modulename) + ".py"
+ try:
+ f = open(filename,"w")
+
+ f.write("""
+# %s
+# This file is automatically generated. Do not edit.
+
+_lr_method = %s
+
+_lr_signature = %s
+""" % (filename, repr(_lr_method), repr(Signature.digest())))
+
+ # Change smaller to 0 to go back to original tables
+ smaller = 1
+
+ # Factor out names to try and make smaller
+ if smaller:
+ items = { }
+
+ for k,v in _lr_action.items():
+ i = items.get(k[1])
+ if not i:
+ i = ([],[])
+ items[k[1]] = i
+ i[0].append(k[0])
+ i[1].append(v)
+
+ f.write("\n_lr_action_items = {")
+ for k,v in items.items():
+ f.write("%r:([" % k)
+ for i in v[0]:
+ f.write("%r," % i)
+ f.write("],[")
+ for i in v[1]:
+ f.write("%r," % i)
+
+ f.write("]),")
+ f.write("}\n")
+
+ f.write("""
+_lr_action = { }
+for _k, _v in _lr_action_items.items():
+ for _x,_y in zip(_v[0],_v[1]):
+ _lr_action[(_x,_k)] = _y
+del _lr_action_items
+""")
+
+ else:
+ f.write("\n_lr_action = { ");
+ for k,v in _lr_action.items():
+ f.write("(%r,%r):%r," % (k[0],k[1],v))
+ f.write("}\n");
+
+ if smaller:
+ # Factor out names to try and make smaller
+ items = { }
+
+ for k,v in _lr_goto.items():
+ i = items.get(k[1])
+ if not i:
+ i = ([],[])
+ items[k[1]] = i
+ i[0].append(k[0])
+ i[1].append(v)
+
+ f.write("\n_lr_goto_items = {")
+ for k,v in items.items():
+ f.write("%r:([" % k)
+ for i in v[0]:
+ f.write("%r," % i)
+ f.write("],[")
+ for i in v[1]:
+ f.write("%r," % i)
+
+ f.write("]),")
+ f.write("}\n")
+
+ f.write("""
+_lr_goto = { }
+for _k, _v in _lr_goto_items.items():
+ for _x,_y in zip(_v[0],_v[1]):
+ _lr_goto[(_x,_k)] = _y
+del _lr_goto_items
+""")
+ else:
+ f.write("\n_lr_goto = { ");
+ for k,v in _lr_goto.items():
+ f.write("(%r,%r):%r," % (k[0],k[1],v))
+ f.write("}\n");
+
+ # Write production table
+ f.write("_lr_productions = [\n")
+ for p in Productions:
+ if p:
+ if (p.func):
+ f.write(" (%r,%d,%r,%r,%d),\n" % (p.name, p.len, p.func.__name__,p.file,p.line))
+ else:
+ f.write(" (%r,%d,None,None,None),\n" % (p.name, p.len))
+ else:
+ f.write(" None,\n")
+ f.write("]\n")
+
+ f.close()
+
+ except IOError,e:
+ print "Unable to create '%s'" % filename
+ print e
+ return
+
+def lr_read_tables(module=tab_module,optimize=0):
+ global _lr_action, _lr_goto, _lr_productions, _lr_method
+ try:
+ exec "import %s as parsetab" % module
+
+ if (optimize) or (Signature.digest() == parsetab._lr_signature):
+ _lr_action = parsetab._lr_action
+ _lr_goto = parsetab._lr_goto
+ _lr_productions = parsetab._lr_productions
+ _lr_method = parsetab._lr_method
+ return 1
+ else:
+ return 0
+
+ except (ImportError,AttributeError):
+ return 0
+
+
+# Available instance types. This is used when parsers are defined by a class.
+# it's a little funky because I want to preserve backwards compatibility
+# with Python 2.0 where types.ObjectType is undefined.
+
+try:
+ _INSTANCETYPE = (types.InstanceType, types.ObjectType)
+except AttributeError:
+ _INSTANCETYPE = types.InstanceType
+
+# -----------------------------------------------------------------------------
+# yacc(module)
+#
+# Build the parser module
+# -----------------------------------------------------------------------------
+
+def yacc(method=default_lr, debug=yaccdebug, module=None, tabmodule=tab_module, start=None, check_recursion=1, optimize=0,write_tables=1,debugfile=debug_file,outputdir=''):
+ global yaccdebug
+ yaccdebug = debug
+
+ initialize_vars()
+ files = { }
+ error = 0
+
+
+ # Add parsing method to signature
+ Signature.update(method)
+
+ # If a "module" parameter was supplied, extract its dictionary.
+ # Note: a module may in fact be an instance as well.
+
+ if module:
+ # User supplied a module object.
+ if isinstance(module, types.ModuleType):
+ ldict = module.__dict__
+ elif isinstance(module, _INSTANCETYPE):
+ _items = [(k,getattr(module,k)) for k in dir(module)]
+ ldict = { }
+ for i in _items:
+ ldict[i[0]] = i[1]
+ else:
+ raise ValueError,"Expected a module"
+
+ else:
+ # No module given. We might be able to get information from the caller.
+ # Throw an exception and unwind the traceback to get the globals
+
+ try:
+ raise RuntimeError
+ except RuntimeError:
+ e,b,t = sys.exc_info()
+ f = t.tb_frame
+ f = f.f_back # Walk out to our calling function
+ ldict = f.f_globals # Grab its globals dictionary
+
+ # Add starting symbol to signature
+ if not start:
+ start = ldict.get("start",None)
+ if start:
+ Signature.update(start)
+
+ # If running in optimized mode. We're going to
+
+ if (optimize and lr_read_tables(tabmodule,1)):
+ # Read parse table
+ del Productions[:]
+ for p in _lr_productions:
+ if not p:
+ Productions.append(None)
+ else:
+ m = MiniProduction()
+ m.name = p[0]
+ m.len = p[1]
+ m.file = p[3]
+ m.line = p[4]
+ if p[2]:
+ m.func = ldict[p[2]]
+ Productions.append(m)
+
+ else:
+ # Get the tokens map
+ if (module and isinstance(module,_INSTANCETYPE)):
+ tokens = getattr(module,"tokens",None)
+ else:
+ tokens = ldict.get("tokens",None)
+
+ if not tokens:
+ raise YaccError,"module does not define a list 'tokens'"
+ if not (isinstance(tokens,types.ListType) or isinstance(tokens,types.TupleType)):
+ raise YaccError,"tokens must be a list or tuple."
+
+ # Check to see if a requires dictionary is defined.
+ requires = ldict.get("require",None)
+ if requires:
+ if not (isinstance(requires,types.DictType)):
+ raise YaccError,"require must be a dictionary."
+
+ for r,v in requires.items():
+ try:
+ if not (isinstance(v,types.ListType)):
+ raise TypeError
+ v1 = [x.split(".") for x in v]
+ Requires[r] = v1
+ except StandardError:
+ print "Invalid specification for rule '%s' in require. Expected a list of strings" % r
+
+
+ # Build the dictionary of terminals. We a record a 0 in the
+ # dictionary to track whether or not a terminal is actually
+ # used in the grammar
+
+ if 'error' in tokens:
+ print "yacc: Illegal token 'error'. Is a reserved word."
+ raise YaccError,"Illegal token name"
+
+ for n in tokens:
+ if Terminals.has_key(n):
+ print "yacc: Warning. Token '%s' multiply defined." % n
+ Terminals[n] = [ ]
+
+ Terminals['error'] = [ ]
+
+ # Get the precedence map (if any)
+ prec = ldict.get("precedence",None)
+ if prec:
+ if not (isinstance(prec,types.ListType) or isinstance(prec,types.TupleType)):
+ raise YaccError,"precedence must be a list or tuple."
+ add_precedence(prec)
+ Signature.update(repr(prec))
+
+ for n in tokens:
+ if not Precedence.has_key(n):
+ Precedence[n] = ('right',0) # Default, right associative, 0 precedence
+
+ # Look for error handler
+ ef = ldict.get('p_error',None)
+ if ef:
+ if isinstance(ef,types.FunctionType):
+ ismethod = 0
+ elif isinstance(ef, types.MethodType):
+ ismethod = 1
+ else:
+ raise YaccError,"'p_error' defined, but is not a function or method."
+ eline = ef.func_code.co_firstlineno
+ efile = ef.func_code.co_filename
+ files[efile] = None
+
+ if (ef.func_code.co_argcount != 1+ismethod):
+ raise YaccError,"%s:%d: p_error() requires 1 argument." % (efile,eline)
+ global Errorfunc
+ Errorfunc = ef
+ else:
+ print "yacc: Warning. no p_error() function is defined."
+
+ # Get the list of built-in functions with p_ prefix
+ symbols = [ldict[f] for f in ldict.keys()
+ if (type(ldict[f]) in (types.FunctionType, types.MethodType) and ldict[f].__name__[:2] == 'p_'
+ and ldict[f].__name__ != 'p_error')]
+
+ # Check for non-empty symbols
+ if len(symbols) == 0:
+ raise YaccError,"no rules of the form p_rulename are defined."
+
+ # Sort the symbols by line number
+ symbols.sort(lambda x,y: cmp(x.func_code.co_firstlineno,y.func_code.co_firstlineno))
+
+ # Add all of the symbols to the grammar
+ for f in symbols:
+ if (add_function(f)) < 0:
+ error += 1
+ else:
+ files[f.func_code.co_filename] = None
+
+ # Make a signature of the docstrings
+ for f in symbols:
+ if f.__doc__:
+ Signature.update(f.__doc__)
+
+ lr_init_vars()
+
+ if error:
+ raise YaccError,"Unable to construct parser."
+
+ if not lr_read_tables(tabmodule):
+
+ # Validate files
+ for filename in files.keys():
+ if not validate_file(filename):
+ error = 1
+
+ # Validate dictionary
+ validate_dict(ldict)
+
+ if start and not Prodnames.has_key(start):
+ raise YaccError,"Bad starting symbol '%s'" % start
+
+ augment_grammar(start)
+ error = verify_productions(cycle_check=check_recursion)
+ otherfunc = [ldict[f] for f in ldict.keys()
+ if (type(f) in (types.FunctionType,types.MethodType) and ldict[f].__name__[:2] != 'p_')]
+
+ if error:
+ raise YaccError,"Unable to construct parser."
+
+ build_lritems()
+ compute_first1()
+ compute_follow(start)
+
+ if method in ['SLR','LALR']:
+ lr_parse_table(method)
+ else:
+ raise YaccError, "Unknown parsing method '%s'" % method
+
+ if write_tables:
+ lr_write_tables(tabmodule,outputdir)
+
+ if yaccdebug:
+ try:
+ f = open(os.path.join(outputdir,debugfile),"w")
+ f.write(_vfc.getvalue())
+ f.write("\n\n")
+ f.write(_vf.getvalue())
+ f.close()
+ except IOError,e:
+ print "yacc: can't create '%s'" % debugfile,e
+
+ # Made it here. Create a parser object and set up its internal state.
+ # Set global parse() method to bound method of parser object.
+
+ p = Parser("xyzzy")
+ p.productions = Productions
+ p.errorfunc = Errorfunc
+ p.action = _lr_action
+ p.goto = _lr_goto
+ p.method = _lr_method
+ p.require = Requires
+
+ global parse
+ parse = p.parse
+
+ global parser
+ parser = p
+
+ # Clean up all of the globals we created
+ if (not optimize):
+ yacc_cleanup()
+ return p
+
+# yacc_cleanup function. Delete all of the global variables
+# used during table construction
+
+def yacc_cleanup():
+ global _lr_action, _lr_goto, _lr_method, _lr_goto_cache
+ del _lr_action, _lr_goto, _lr_method, _lr_goto_cache
+
+ global Productions, Prodnames, Prodmap, Terminals
+ global Nonterminals, First, Follow, Precedence, LRitems
+ global Errorfunc, Signature, Requires
+
+ del Productions, Prodnames, Prodmap, Terminals
+ del Nonterminals, First, Follow, Precedence, LRitems
+ del Errorfunc, Signature, Requires
+
+ global _vf, _vfc
+ del _vf, _vfc
+
+
+# Stub that raises an error if parsing is attempted without first calling yacc()
+def parse(*args,**kwargs):
+ raise YaccError, "yacc: No parser built with yacc()"
+
diff --git a/chall/ply-2.2/doc/makedoc.py b/chall/ply-2.2/doc/makedoc.py
new file mode 100644
index 0000000..415a53a
--- /dev/null
+++ b/chall/ply-2.2/doc/makedoc.py
@@ -0,0 +1,194 @@
+#!/usr/local/bin/python
+
+###############################################################################
+# Takes a chapter as input and adds internal links and numbering to all
+# of the H1, H2, H3, H4 and H5 sections.
+#
+# Every heading HTML tag (H1, H2 etc) is given an autogenerated name to link
+# to. However, if the name is not an autogenerated name from a previous run,
+# it will be kept. If it is autogenerated, it might change on subsequent runs
+# of this program. Thus if you want to create links to one of the headings,
+# then change the heading link name to something that does not look like an
+# autogenerated link name.
+###############################################################################
+
+import sys
+import re
+import string
+
+###############################################################################
+# Functions
+###############################################################################
+
+# Regexs for <a name="..."></a>
+alink = re.compile(r"<a *name *= *\"(.*)\"></a>", re.IGNORECASE)
+heading = re.compile(r"(_nn\d)", re.IGNORECASE)
+
+def getheadingname(m):
+ autogeneratedheading = True;
+ if m.group(1) != None:
+ amatch = alink.match(m.group(1))
+ if amatch:
+ # A non-autogenerated heading - keep it
+ headingname = amatch.group(1)
+ autogeneratedheading = heading.match(headingname)
+ if autogeneratedheading:
+ # The heading name was either non-existent or autogenerated,
+ # We can create a new heading / change the existing heading
+ headingname = "%s_nn%d" % (filenamebase, nameindex)
+ return headingname
+
+###############################################################################
+# Main program
+###############################################################################
+
+if len(sys.argv) != 2:
+ print "usage: makedoc.py filename"
+ sys.exit(1)
+
+filename = sys.argv[1]
+filenamebase = string.split(filename,".")[0]
+
+section = 0
+subsection = 0
+subsubsection = 0
+subsubsubsection = 0
+nameindex = 0
+
+name = ""
+
+# Regexs for <h1>,... <h5> sections
+
+h1 = re.compile(r".*?<H1>(<a.*a>)*[\d\.\s]*(.*?)</H1>", re.IGNORECASE)
+h2 = re.compile(r".*?<H2>(<a.*a>)*[\d\.\s]*(.*?)</H2>", re.IGNORECASE)
+h3 = re.compile(r".*?<H3>(<a.*a>)*[\d\.\s]*(.*?)</H3>", re.IGNORECASE)
+h4 = re.compile(r".*?<H4>(<a.*a>)*[\d\.\s]*(.*?)</H4>", re.IGNORECASE)
+h5 = re.compile(r".*?<H5>(<a.*a>)*[\d\.\s]*(.*?)</H5>", re.IGNORECASE)
+
+data = open(filename).read() # Read data
+open(filename+".bak","w").write(data) # Make backup
+
+lines = data.splitlines()
+result = [ ] # This is the result of postprocessing the file
+index = "<!-- INDEX -->\n<div class=\"sectiontoc\">\n" # index contains the index for adding at the top of the file. Also printed to stdout.
+
+skip = 0
+skipspace = 0
+
+for s in lines:
+ if s == "<!-- INDEX -->":
+ if not skip:
+ result.append("@INDEX@")
+ skip = 1
+ else:
+ skip = 0
+ continue;
+ if skip:
+ continue
+
+ if not s and skipspace:
+ continue
+
+ if skipspace:
+ result.append("")
+ result.append("")
+ skipspace = 0
+
+ m = h2.match(s)
+ if m:
+ prevheadingtext = m.group(2)
+ nameindex += 1
+ section += 1
+ headingname = getheadingname(m)
+ result.append("""<H2><a name="%s"></a>%d. %s</H2>""" % (headingname,section, prevheadingtext))
+
+ if subsubsubsection:
+ index += "</ul>\n"
+ if subsubsection:
+ index += "</ul>\n"
+ if subsection:
+ index += "</ul>\n"
+ if section == 1:
+ index += "<ul>\n"
+
+ index += """<li><a href="#%s">%s</a>\n""" % (headingname,prevheadingtext)
+ subsection = 0
+ subsubsection = 0
+ subsubsubsection = 0
+ skipspace = 1
+ continue
+ m = h3.match(s)
+ if m:
+ prevheadingtext = m.group(2)
+ nameindex += 1
+ subsection += 1
+ headingname = getheadingname(m)
+ result.append("""<H3><a name="%s"></a>%d.%d %s</H3>""" % (headingname,section, subsection, prevheadingtext))
+
+ if subsubsubsection:
+ index += "</ul>\n"
+ if subsubsection:
+ index += "</ul>\n"
+ if subsection == 1:
+ index += "<ul>\n"
+
+ index += """<li><a href="#%s">%s</a>\n""" % (headingname,prevheadingtext)
+ subsubsection = 0
+ skipspace = 1
+ continue
+ m = h4.match(s)
+ if m:
+ prevheadingtext = m.group(2)
+ nameindex += 1
+ subsubsection += 1
+ subsubsubsection = 0
+ headingname = getheadingname(m)
+ result.append("""<H4><a name="%s"></a>%d.%d.%d %s</H4>""" % (headingname,section, subsection, subsubsection, prevheadingtext))
+
+ if subsubsubsection:
+ index += "</ul>\n"
+ if subsubsection == 1:
+ index += "<ul>\n"
+
+ index += """<li><a href="#%s">%s</a>\n""" % (headingname,prevheadingtext)
+ skipspace = 1
+ continue
+ m = h5.match(s)
+ if m:
+ prevheadingtext = m.group(2)
+ nameindex += 1
+ subsubsubsection += 1
+ headingname = getheadingname(m)
+ result.append("""<H5><a name="%s"></a>%d.%d.%d.%d %s</H5>""" % (headingname,section, subsection, subsubsection, subsubsubsection, prevheadingtext))
+
+ if subsubsubsection == 1:
+ index += "<ul>\n"
+
+ index += """<li><a href="#%s">%s</a>\n""" % (headingname,prevheadingtext)
+ skipspace = 1
+ continue
+
+ result.append(s)
+
+if subsubsubsection:
+ index += "</ul>\n"
+
+if subsubsection:
+ index += "</ul>\n"
+
+if subsection:
+ index += "</ul>\n"
+
+if section:
+ index += "</ul>\n"
+
+index += "</div>\n<!-- INDEX -->\n"
+
+data = "\n".join(result)
+
+data = data.replace("@INDEX@",index) + "\n";
+
+# Write the file back out
+open(filename,"w").write(data)
+
+
diff --git a/chall/ply-2.2/doc/ply.html b/chall/ply-2.2/doc/ply.html
new file mode 100644
index 0000000..b3219ea
--- /dev/null
+++ b/chall/ply-2.2/doc/ply.html
@@ -0,0 +1,2874 @@
+<html>
+<head>
+<title>PLY (Python Lex-Yacc)</title>
+</head>
+<body bgcolor="#ffffff">
+
+<h1>PLY (Python Lex-Yacc)</h1>
+
+<b>
+David M. Beazley <br>
+dave@dabeaz.com<br>
+</b>
+
+<p>
+<b>PLY Version: 2.2</b>
+<p>
+
+<!-- INDEX -->
+<div class="sectiontoc">
+<ul>
+<li><a href="#ply_nn1">Introduction</a>
+<li><a href="#ply_nn2">PLY Overview</a>
+<li><a href="#ply_nn3">Lex</a>
+<ul>
+<li><a href="#ply_nn4">Lex Example</a>
+<li><a href="#ply_nn5">The tokens list</a>
+<li><a href="#ply_nn6">Specification of tokens</a>
+<li><a href="#ply_nn7">Token values</a>
+<li><a href="#ply_nn8">Discarded tokens</a>
+<li><a href="#ply_nn9">Line numbers and positional information</a>
+<li><a href="#ply_nn10">Ignored characters</a>
+<li><a href="#ply_nn11">Literal characters</a>
+<li><a href="#ply_nn12">Error handling</a>
+<li><a href="#ply_nn13">Building and using the lexer</a>
+<li><a href="#ply_nn14">The @TOKEN decorator</a>
+<li><a href="#ply_nn15">Optimized mode</a>
+<li><a href="#ply_nn16">Debugging</a>
+<li><a href="#ply_nn17">Alternative specification of lexers</a>
+<li><a href="#ply_nn18">Maintaining state</a>
+<li><a href="#ply_nn19">Duplicating lexers</a>
+<li><a href="#ply_nn20">Internal lexer state</a>
+<li><a href="#ply_nn21">Conditional lexing and start conditions</a>
+<li><a href="#ply_nn21">Miscellaneous Issues</a>
+</ul>
+<li><a href="#ply_nn22">Parsing basics</a>
+<li><a href="#ply_nn23">Yacc reference</a>
+<ul>
+<li><a href="#ply_nn24">An example</a>
+<li><a href="#ply_nn25">Combining Grammar Rule Functions</a>
+<li><a href="#ply_nn26">Character Literals</a>
+<li><a href="#ply_nn26">Empty Productions</a>
+<li><a href="#ply_nn28">Changing the starting symbol</a>
+<li><a href="#ply_nn27">Dealing With Ambiguous Grammars</a>
+<li><a href="#ply_nn28">The parser.out file</a>
+<li><a href="#ply_nn29">Syntax Error Handling</a>
+<ul>
+<li><a href="#ply_nn30">Recovery and resynchronization with error rules</a>
+<li><a href="#ply_nn31">Panic mode recovery</a>
+<li><a href="#ply_nn32">General comments on error handling</a>
+</ul>
+<li><a href="#ply_nn33">Line Number and Position Tracking</a>
+<li><a href="#ply_nn34">AST Construction</a>
+<li><a href="#ply_nn35">Embedded Actions</a>
+<li><a href="#ply_nn36">Yacc implementation notes</a>
+</ul>
+<li><a href="#ply_nn37">Parser and Lexer State Management</a>
+<li><a href="#ply_nn38">Using Python's Optimized Mode</a>
+<li><a href="#ply_nn39">Where to go from here?</a>
+</ul>
+</div>
+<!-- INDEX -->
+
+
+
+
+
+
+<H2><a name="ply_nn1"></a>1. Introduction</H2>
+
+
+PLY is a pure-Python implementation of the popular compiler
+construction tools lex and yacc. The main goal of PLY is to stay
+fairly faithful to the way in which traditional lex/yacc tools work.
+This includes supporting LALR(1) parsing as well as providing
+extensive input validation, error reporting, and diagnostics. Thus,
+if you've used yacc in another programming language, it should be
+relatively straightforward to use PLY.
+
+<p>
+Early versions of PLY were developed to support an Introduction to
+Compilers Course I taught in 2001 at the University of Chicago. In this course,
+students built a fully functional compiler for a simple Pascal-like
+language. Their compiler, implemented entirely in Python, had to
+include lexical analysis, parsing, type checking, type inference,
+nested scoping, and code generation for the SPARC processor.
+Approximately 30 different compiler implementations were completed in
+this course. Most of PLY's interface and operation has been influenced by common
+usability problems encountered by students.
+
+<p>
+Since PLY was primarily developed as an instructional tool, you will
+find it to be fairly picky about token and grammar rule
+specification. In part, this
+added formality is meant to catch common programming mistakes made by
+novice users. However, advanced users will also find such features to
+be useful when building complicated grammars for real programming
+languages. It should also be noted that PLY does not provide much in
+the way of bells and whistles (e.g., automatic construction of
+abstract syntax trees, tree traversal, etc.). Nor would I consider it
+to be a parsing framework. Instead, you will find a bare-bones, yet
+fully capable lex/yacc implementation written entirely in Python.
+
+<p>
+The rest of this document assumes that you are somewhat familar with
+parsing theory, syntax directed translation, and the use of compiler
+construction tools such as lex and yacc in other programming
+languages. If you are unfamilar with these topics, you will probably
+want to consult an introductory text such as "Compilers: Principles,
+Techniques, and Tools", by Aho, Sethi, and Ullman. O'Reilly's "Lex
+and Yacc" by John Levine may also be handy. In fact, the O'Reilly book can be
+used as a reference for PLY as the concepts are virtually identical.
+
+<H2><a name="ply_nn2"></a>2. PLY Overview</H2>
+
+
+PLY consists of two separate modules; <tt>lex.py</tt> and
+<tt>yacc.py</tt>, both of which are found in a Python package
+called <tt>ply</tt>. The <tt>lex.py</tt> module is used to break input text into a
+collection of tokens specified by a collection of regular expression
+rules. <tt>yacc.py</tt> is used to recognize language syntax that has
+been specified in the form of a context free grammar. <tt>yacc.py</tt> uses LR parsing and generates its parsing tables
+using either the LALR(1) (the default) or SLR table generation algorithms.
+
+<p>
+The two tools are meant to work together. Specifically,
+<tt>lex.py</tt> provides an external interface in the form of a
+<tt>token()</tt> function that returns the next valid token on the
+input stream. <tt>yacc.py</tt> calls this repeatedly to retrieve
+tokens and invoke grammar rules. The output of <tt>yacc.py</tt> is
+often an Abstract Syntax Tree (AST). However, this is entirely up to
+the user. If desired, <tt>yacc.py</tt> can also be used to implement
+simple one-pass compilers.
+
+<p>
+Like its Unix counterpart, <tt>yacc.py</tt> provides most of the
+features you expect including extensive error checking, grammar
+validation, support for empty productions, error tokens, and ambiguity
+resolution via precedence rules. In fact, everything that is possible in traditional yacc
+should be supported in PLY.
+
+<p>
+The primary difference between
+<tt>yacc.py</tt> and Unix <tt>yacc</tt> is that <tt>yacc.py</tt>
+doesn't involve a separate code-generation process.
+Instead, PLY relies on reflection (introspection)
+to build its lexers and parsers. Unlike traditional lex/yacc which
+require a special input file that is converted into a separate source
+file, the specifications given to PLY <em>are</em> valid Python
+programs. This means that there are no extra source files nor is
+there a special compiler construction step (e.g., running yacc to
+generate Python code for the compiler). Since the generation of the
+parsing tables is relatively expensive, PLY caches the results and
+saves them to a file. If no changes are detected in the input source,
+the tables are read from the cache. Otherwise, they are regenerated.
+
+<H2><a name="ply_nn3"></a>3. Lex</H2>
+
+
+<tt>lex.py</tt> is used to tokenize an input string. For example, suppose
+you're writing a programming language and a user supplied the following input string:
+
+<blockquote>
+<pre>
+x = 3 + 42 * (s - t)
+</pre>
+</blockquote>
+
+A tokenizer splits the string into individual tokens
+
+<blockquote>
+<pre>
+'x','=', '3', '+', '42', '*', '(', 's', '-', 't', ')'
+</pre>
+</blockquote>
+
+Tokens are usually given names to indicate what they are. For example:
+
+<blockquote>
+<pre>
+'ID','EQUALS','NUMBER','PLUS','NUMBER','TIMES',
+'LPAREN','ID','MINUS','ID','RPAREN'
+</pre>
+</blockquote>
+
+More specifically, the input is broken into pairs of token types and values. For example:
+
+<blockquote>
+<pre>
+('ID','x'), ('EQUALS','='), ('NUMBER','3'),
+('PLUS','+'), ('NUMBER','42), ('TIMES','*'),
+('LPAREN','('), ('ID','s'), ('MINUS','-'),
+('ID','t'), ('RPAREN',')'
+</pre>
+</blockquote>
+
+The identification of tokens is typically done by writing a series of regular expression
+rules. The next section shows how this is done using <tt>lex.py</tt>.
+
+<H3><a name="ply_nn4"></a>3.1 Lex Example</H3>
+
+
+The following example shows how <tt>lex.py</tt> is used to write a simple tokenizer.
+
+<blockquote>
+<pre>
+# ------------------------------------------------------------
+# calclex.py
+#
+# tokenizer for a simple expression evaluator for
+# numbers and +,-,*,/
+# ------------------------------------------------------------
+import ply.lex as lex
+
+# List of token names. This is always required
+tokens = (
+ 'NUMBER',
+ 'PLUS',
+ 'MINUS',
+ 'TIMES',
+ 'DIVIDE',
+ 'LPAREN',
+ 'RPAREN',
+)
+
+# Regular expression rules for simple tokens
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_TIMES = r'\*'
+t_DIVIDE = r'/'
+t_LPAREN = r'\('
+t_RPAREN = r'\)'
+
+# A regular expression rule with some action code
+def t_NUMBER(t):
+ r'\d+'
+ try:
+ t.value = int(t.value)
+ except ValueError:
+ print "Line %d: Number %s is too large!" % (t.lineno,t.value)
+ t.value = 0
+ return t
+
+# Define a rule so we can track line numbers
+def t_newline(t):
+ r'\n+'
+ t.lexer.lineno += len(t.value)
+
+# A string containing ignored characters (spaces and tabs)
+t_ignore = ' \t'
+
+# Error handling rule
+def t_error(t):
+ print "Illegal character '%s'" % t.value[0]
+ t.lexer.skip(1)
+
+# Build the lexer
+lex.lex()
+
+</pre>
+</blockquote>
+To use the lexer, you first need to feed it some input text using its <tt>input()</tt> method. After that, repeated calls to <tt>token()</tt> produce tokens. The following code shows how this works:
+
+<blockquote>
+<pre>
+
+# Test it out
+data = '''
+3 + 4 * 10
+ + -20 *2
+'''
+
+# Give the lexer some input
+lex.input(data)
+
+# Tokenize
+while 1:
+ tok = lex.token()
+ if not tok: break # No more input
+ print tok
+</pre>
+</blockquote>
+
+When executed, the example will produce the following output:
+
+<blockquote>
+<pre>
+$ python example.py
+LexToken(NUMBER,3,2,1)
+LexToken(PLUS,'+',2,3)
+LexToken(NUMBER,4,2,5)
+LexToken(TIMES,'*',2,7)
+LexToken(NUMBER,10,2,10)
+LexToken(PLUS,'+',3,14)
+LexToken(MINUS,'-',3,16)
+LexToken(NUMBER,20,3,18)
+LexToken(TIMES,'*',3,20)
+LexToken(NUMBER,2,3,21)
+</pre>
+</blockquote>
+
+The tokens returned by <tt>lex.token()</tt> are instances
+of <tt>LexToken</tt>. This object has
+attributes <tt>tok.type</tt>, <tt>tok.value</tt>,
+<tt>tok.lineno</tt>, and <tt>tok.lexpos</tt>. The following code shows an example of
+accessing these attributes:
+
+<blockquote>
+<pre>
+# Tokenize
+while 1:
+ tok = lex.token()
+ if not tok: break # No more input
+ print tok.type, tok.value, tok.line, tok.lexpos
+</pre>
+</blockquote>
+
+The <tt>tok.type</tt> and <tt>tok.value</tt> attributes contain the
+type and value of the token itself.
+<tt>tok.line</tt> and <tt>tok.lexpos</tt> contain information about
+the location of the token. <tt>tok.lexpos</tt> is the index of the
+token relative to the start of the input text.
+
+<H3><a name="ply_nn5"></a>3.2 The tokens list</H3>
+
+
+All lexers must provide a list <tt>tokens</tt> that defines all of the possible token
+names that can be produced by the lexer. This list is always required
+and is used to perform a variety of validation checks. The tokens list is also used by the
+<tt>yacc.py</tt> module to identify terminals.
+
+<p>
+In the example, the following code specified the token names:
+
+<blockquote>
+<pre>
+tokens = (
+ 'NUMBER',
+ 'PLUS',
+ 'MINUS',
+ 'TIMES',
+ 'DIVIDE',
+ 'LPAREN',
+ 'RPAREN',
+)
+</pre>
+</blockquote>
+
+<H3><a name="ply_nn6"></a>3.3 Specification of tokens</H3>
+
+
+Each token is specified by writing a regular expression rule. Each of these rules are
+are defined by making declarations with a special prefix <tt>t_</tt> to indicate that it
+defines a token. For simple tokens, the regular expression can
+be specified as strings such as this (note: Python raw strings are used since they are the
+most convenient way to write regular expression strings):
+
+<blockquote>
+<pre>
+t_PLUS = r'\+'
+</pre>
+</blockquote>
+
+In this case, the name following the <tt>t_</tt> must exactly match one of the
+names supplied in <tt>tokens</tt>. If some kind of action needs to be performed,
+a token rule can be specified as a function. For example, this rule matches numbers and
+converts the string into a Python integer.
+
+<blockquote>
+<pre>
+def t_NUMBER(t):
+ r'\d+'
+ try:
+ t.value = int(t.value)
+ except ValueError:
+ print "Number %s is too large!" % t.value
+ t.value = 0
+ return t
+</pre>
+</blockquote>
+
+When a function is used, the regular expression rule is specified in the function documentation string.
+The function always takes a single argument which is an instance of
+<tt>LexToken</tt>. This object has attributes of <tt>t.type</tt> which is the token type (as a string),
+<tt>t.value</tt> which is the lexeme (the actual text matched), <tt>t.lineno</tt> which is the current line number, and <tt>t.lexpos</tt> which
+is the position of the token relative to the beginning of the input text.
+By default, <tt>t.type</tt> is set to the name following the <tt>t_</tt> prefix. The action
+function can modify the contents of the <tt>LexToken</tt> object as appropriate. However,
+when it is done, the resulting token should be returned. If no value is returned by the action
+function, the token is simply discarded and the next token read.
+
+<p>
+Internally, <tt>lex.py</tt> uses the <tt>re</tt> module to do its patten matching. When building the master regular expression,
+rules are added in the following order:
+<p>
+<ol>
+<li>All tokens defined by functions are added in the same order as they appear in the lexer file.
+<li>Tokens defined by strings are added next by sorting them in order of decreasing regular expression length (longer expressions
+are added first).
+</ol>
+<p>
+Without this ordering, it can be difficult to correctly match certain types of tokens. For example, if you
+wanted to have separate tokens for "=" and "==", you need to make sure that "==" is checked first. By sorting regular
+expressions in order of decreasing length, this problem is solved for rules defined as strings. For functions,
+the order can be explicitly controlled since rules appearing first are checked first.
+
+<p>
+To handle reserved words, it is usually easier to just match an identifier and do a special name lookup in a function
+like this:
+
+<blockquote>
+<pre>
+reserved = {
+ 'if' : 'IF',
+ 'then' : 'THEN',
+ 'else' : 'ELSE',
+ 'while' : 'WHILE',
+ ...
+}
+
+def t_ID(t):
+ r'[a-zA-Z_][a-zA-Z_0-9]*'
+ t.type = reserved.get(t.value,'ID') # Check for reserved words
+ return t
+</pre>
+</blockquote>
+
+This approach greatly reduces the number of regular expression rules and is likely to make things a little faster.
+
+<p>
+<b>Note:</b> You should avoid writing individual rules for reserved words. For example, if you write rules like this,
+
+<blockquote>
+<pre>
+t_FOR = r'for'
+t_PRINT = r'print'
+</pre>
+</blockquote>
+
+those rules will be triggered for identifiers that include those words as a prefix such as "forget" or "printed". This is probably not
+what you want.
+
+<H3><a name="ply_nn7"></a>3.4 Token values</H3>
+
+
+When tokens are returned by lex, they have a value that is stored in the <tt>value</tt> attribute. Normally, the value is the text
+that was matched. However, the value can be assigned to any Python object. For instance, when lexing identifiers, you may
+want to return both the identifier name and information from some sort of symbol table. To do this, you might write a rule like this:
+
+<blockquote>
+<pre>
+def t_ID(t):
+ ...
+ # Look up symbol table information and return a tuple
+ t.value = (t.value, symbol_lookup(t.value))
+ ...
+ return t
+</pre>
+</blockquote>
+
+It is important to note that storing data in other attribute names is <em>not</em> recommended. The <tt>yacc.py</tt> module only exposes the
+contents of the <tt>value</tt> attribute. Thus, accessing other attributes may be unnecessarily awkward.
+
+<H3><a name="ply_nn8"></a>3.5 Discarded tokens</H3>
+
+
+To discard a token, such as a comment, simply define a token rule that returns no value. For example:
+
+<blockquote>
+<pre>
+def t_COMMENT(t):
+ r'\#.*'
+ pass
+ # No return value. Token discarded
+</pre>
+</blockquote>
+
+Alternatively, you can include the prefix "ignore_" in the token declaration to force a token to be ignored. For example:
+
+<blockquote>
+<pre>
+t_ignore_COMMENT = r'\#.*'
+</pre>
+</blockquote>
+
+Be advised that if you are ignoring many different kinds of text, you may still want to use functions since these provide more precise
+control over the order in which regular expressions are matched (i.e., functions are matched in order of specification whereas strings are
+sorted by regular expression length).
+
+<H3><a name="ply_nn9"></a>3.6 Line numbers and positional information</H3>
+
+
+<p>By default, <tt>lex.py</tt> knows nothing about line numbers. This is because <tt>lex.py</tt> doesn't know anything
+about what constitutes a "line" of input (e.g., the newline character or even if the input is textual data).
+To update this information, you need to write a special rule. In the example, the <tt>t_newline()</tt> rule shows how to do this.
+
+<blockquote>
+<pre>
+# Define a rule so we can track line numbers
+def t_newline(t):
+ r'\n+'
+ t.lexer.lineno += len(t.value)
+</pre>
+</blockquote>
+Within the rule, the <tt>lineno</tt> attribute of the underlying lexer <tt>t.lexer</tt> is updated.
+After the line number is updated, the token is simply discarded since nothing is returned.
+
+<p>
+<tt>lex.py</tt> does not perform and kind of automatic column tracking. However, it does record positional
+information related to each token in the <tt>lexpos</tt> attribute. Using this, it is usually possible to compute
+column information as a separate step. For instance, just count backwards until you reach a newline.
+
+<blockquote>
+<pre>
+# Compute column.
+# input is the input text string
+# token is a token instance
+def find_column(input,token):
+ i = token.lexpos
+ while i > 0:
+ if input[i] == '\n': break
+ i -= 1
+ column = (token.lexpos - i)+1
+ return column
+</pre>
+</blockquote>
+
+Since column information is often only useful in the context of error handling, calculating the column
+position can be performed when needed as opposed to doing it for each token.
+
+<H3><a name="ply_nn10"></a>3.7 Ignored characters</H3>
+
+
+<p>
+The special <tt>t_ignore</tt> rule is reserved by <tt>lex.py</tt> for characters
+that should be completely ignored in the input stream.
+Usually this is used to skip over whitespace and other non-essential characters.
+Although it is possible to define a regular expression rule for whitespace in a manner
+similar to <tt>t_newline()</tt>, the use of <tt>t_ignore</tt> provides substantially better
+lexing performance because it is handled as a special case and is checked in a much
+more efficient manner than the normal regular expression rules.
+
+<H3><a name="ply_nn11"></a>3.8 Literal characters</H3>
+
+
+<p>
+Literal characters can be specified by defining a variable <tt>literals</tt> in your lexing module. For example:
+
+<blockquote>
+<pre>
+literals = [ '+','-','*','/' ]
+</pre>
+</blockquote>
+
+or alternatively
+
+<blockquote>
+<pre>
+literals = "+-*/"
+</pre>
+</blockquote>
+
+A literal character is simply a single character that is returned "as is" when encountered by the lexer. Literals are checked
+after all of the defined regular expression rules. Thus, if a rule starts with one of the literal characters, it will always
+take precedence.
+<p>
+When a literal token is returned, both its <tt>type</tt> and <tt>value</tt> attributes are set to the character itself. For example, <tt>'+'</tt>.
+
+<H3><a name="ply_nn12"></a>3.9 Error handling</H3>
+
+
+<p>
+Finally, the <tt>t_error()</tt>
+function is used to handle lexing errors that occur when illegal
+characters are detected. In this case, the <tt>t.value</tt> attribute contains the
+rest of the input string that has not been tokenized. In the example, the error function
+was defined as follows:
+
+<blockquote>
+<pre>
+# Error handling rule
+def t_error(t):
+ print "Illegal character '%s'" % t.value[0]
+ t.lexer.skip(1)
+</pre>
+</blockquote>
+
+In this case, we simply print the offending character and skip ahead one character by calling <tt>t.lexer.skip(1)</tt>.
+
+<H3><a name="ply_nn13"></a>3.10 Building and using the lexer</H3>
+
+
+<p>
+To build the lexer, the function <tt>lex.lex()</tt> is used. This function
+uses Python reflection (or introspection) to read the the regular expression rules
+out of the calling context and build the lexer. Once the lexer has been built, two functions can
+be used to control the lexer.
+
+<ul>
+<li><tt>lex.input(data)</tt>. Reset the lexer and store a new input string.
+<li><tt>lex.token()</tt>. Return the next token. Returns a special <tt>LexToken</tt> instance on success or
+None if the end of the input text has been reached.
+</ul>
+
+If desired, the lexer can also be used as an object. The <tt>lex()</tt> returns a <tt>Lexer</tt> object that
+can be used for this purpose. For example:
+
+<blockquote>
+<pre>
+lexer = lex.lex()
+lexer.input(sometext)
+while 1:
+ tok = lexer.token()
+ if not tok: break
+ print tok
+</pre>
+</blockquote>
+
+<p>
+This latter technique should be used if you intend to use multiple lexers in your application. Simply define each
+lexer in its own module and use the object returned by <tt>lex()</tt> as appropriate.
+
+<p>
+Note: The global functions <tt>lex.input()</tt> and <tt>lex.token()</tt> are bound to the <tt>input()</tt>
+and <tt>token()</tt> methods of the last lexer created by the lex module.
+
+<H3><a name="ply_nn14"></a>3.11 The @TOKEN decorator</H3>
+
+
+In some applications, you may want to define build tokens from as a series of
+more complex regular expression rules. For example:
+
+<blockquote>
+<pre>
+digit = r'([0-9])'
+nondigit = r'([_A-Za-z])'
+identifier = r'(' + nondigit + r'(' + digit + r'|' + nondigit + r')*)'
+
+def t_ID(t):
+ # want docstring to be identifier above. ?????
+ ...
+</pre>
+</blockquote>
+
+In this case, we want the regular expression rule for <tt>ID</tt> to be one of the variables above. However, there is no
+way to directly specify this using a normal documentation string. To solve this problem, you can use the <tt>@TOKEN</tt>
+decorator. For example:
+
+<blockquote>
+<pre>
+from ply.lex import TOKEN
+
+@TOKEN(identifier)
+def t_ID(t):
+ ...
+</pre>
+</blockquote>
+
+This will attach <tt>identifier</tt> to the docstring for <tt>t_ID()</tt> allowing <tt>lex.py</tt> to work normally. An alternative
+approach this problem is to set the docstring directly like this:
+
+<blockquote>
+<pre>
+def t_ID(t):
+ ...
+
+t_ID.__doc__ = identifier
+</pre>
+</blockquote>
+
+<b>NOTE:</b> Use of <tt>@TOKEN</tt> requires Python-2.4 or newer. If you're concerned about backwards compatibility with older
+versions of Python, use the alternative approach of setting the docstring directly.
+
+<H3><a name="ply_nn15"></a>3.12 Optimized mode</H3>
+
+
+For improved performance, it may be desirable to use Python's
+optimized mode (e.g., running Python with the <tt>-O</tt>
+option). However, doing so causes Python to ignore documentation
+strings. This presents special problems for <tt>lex.py</tt>. To
+handle this case, you can create your lexer using
+the <tt>optimize</tt> option as follows:
+
+<blockquote>
+<pre>
+lexer = lex.lex(optimize=1)
+</pre>
+</blockquote>
+
+Next, run Python in its normal operating mode. When you do
+this, <tt>lex.py</tt> will write a file called <tt>lextab.py</tt> to
+the current directory. This file contains all of the regular
+expression rules and tables used during lexing. On subsequent
+executions,
+<tt>lextab.py</tt> will simply be imported to build the lexer. This
+approach substantially improves the startup time of the lexer and it
+works in Python's optimized mode.
+
+<p>
+To change the name of the lexer-generated file, use the <tt>lextab</tt> keyword argument. For example:
+
+<blockquote>
+<pre>
+lexer = lex.lex(optimize=1,lextab="footab")
+</pre>
+</blockquote>
+
+When running in optimized mode, it is important to note that lex disables most error checking. Thus, this is really only recommended
+if you're sure everything is working correctly and you're ready to start releasing production code.
+
+<H3><a name="ply_nn16"></a>3.13 Debugging</H3>
+
+
+For the purpose of debugging, you can run <tt>lex()</tt> in a debugging mode as follows:
+
+<blockquote>
+<pre>
+lexer = lex.lex(debug=1)
+</pre>
+</blockquote>
+
+This will result in a large amount of debugging information to be printed including all of the added rules and the master
+regular expressions.
+
+In addition, <tt>lex.py</tt> comes with a simple main function which
+will either tokenize input read from standard input or from a file specified
+on the command line. To use it, simply put this in your lexer:
+
+<blockquote>
+<pre>
+if __name__ == '__main__':
+ lex.runmain()
+</pre>
+</blockquote>
+
+<H3><a name="ply_nn17"></a>3.14 Alternative specification of lexers</H3>
+
+
+As shown in the example, lexers are specified all within one Python module. If you want to
+put token rules in a different module from the one in which you invoke <tt>lex()</tt>, use the
+<tt>module</tt> keyword argument.
+
+<p>
+For example, you might have a dedicated module that just contains
+the token rules:
+
+<blockquote>
+<pre>
+# module: tokrules.py
+# This module just contains the lexing rules
+
+# List of token names. This is always required
+tokens = (
+ 'NUMBER',
+ 'PLUS',
+ 'MINUS',
+ 'TIMES',
+ 'DIVIDE',
+ 'LPAREN',
+ 'RPAREN',
+)
+
+# Regular expression rules for simple tokens
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_TIMES = r'\*'
+t_DIVIDE = r'/'
+t_LPAREN = r'\('
+t_RPAREN = r'\)'
+
+# A regular expression rule with some action code
+def t_NUMBER(t):
+ r'\d+'
+ try:
+ t.value = int(t.value)
+ except ValueError:
+ print "Line %d: Number %s is too large!" % (t.lineno,t.value)
+ t.value = 0
+ return t
+
+# Define a rule so we can track line numbers
+def t_newline(t):
+ r'\n+'
+ t.lexer.lineno += len(t.value)
+
+# A string containing ignored characters (spaces and tabs)
+t_ignore = ' \t'
+
+# Error handling rule
+def t_error(t):
+ print "Illegal character '%s'" % t.value[0]
+ t.lexer.skip(1)
+</pre>
+</blockquote>
+
+Now, if you wanted to build a tokenizer from these rules from within a different module, you would do the following (shown for Python interactive mode):
+
+<blockquote>
+<pre>
+>>> import tokrules
+>>> <b>lexer = lex.lex(module=tokrules)</b>
+>>> lexer.input("3 + 4")
+>>> lexer.token()
+LexToken(NUMBER,3,1,1,0)
+>>> lexer.token()
+LexToken(PLUS,'+',1,2)
+>>> lexer.token()
+LexToken(NUMBER,4,1,4)
+>>> lexer.token()
+None
+>>>
+</pre>
+</blockquote>
+
+The <tt>object</tt> option can be used to define lexers as a class instead of a module. For example:
+
+<blockquote>
+<pre>
+import ply.lex as lex
+
+class MyLexer:
+ # List of token names. This is always required
+ tokens = (
+ 'NUMBER',
+ 'PLUS',
+ 'MINUS',
+ 'TIMES',
+ 'DIVIDE',
+ 'LPAREN',
+ 'RPAREN',
+ )
+
+ # Regular expression rules for simple tokens
+ t_PLUS = r'\+'
+ t_MINUS = r'-'
+ t_TIMES = r'\*'
+ t_DIVIDE = r'/'
+ t_LPAREN = r'\('
+ t_RPAREN = r'\)'
+
+ # A regular expression rule with some action code
+ # Note addition of self parameter since we're in a class
+ def t_NUMBER(self,t):
+ r'\d+'
+ try:
+ t.value = int(t.value)
+ except ValueError:
+ print "Line %d: Number %s is too large!" % (t.lineno,t.value)
+ t.value = 0
+ return t
+
+ # Define a rule so we can track line numbers
+ def t_newline(self,t):
+ r'\n+'
+ t.lexer.lineno += len(t.value)
+
+ # A string containing ignored characters (spaces and tabs)
+ t_ignore = ' \t'
+
+ # Error handling rule
+ def t_error(self,t):
+ print "Illegal character '%s'" % t.value[0]
+ t.lexer.skip(1)
+
+ <b># Build the lexer
+ def build(self,**kwargs):
+ self.lexer = lex.lex(object=self, **kwargs)</b>
+
+ # Test it output
+ def test(self,data):
+ self.lexer.input(data)
+ while 1:
+ tok = lexer.token()
+ if not tok: break
+ print tok
+
+# Build the lexer and try it out
+m = MyLexer()
+m.build() # Build the lexer
+m.test("3 + 4") # Test it
+</pre>
+</blockquote>
+
+For reasons that are subtle, you should <em>NOT</em> invoke <tt>lex.lex()</tt> inside the <tt>__init__()</tt> method of your class. If you
+do, it may cause bizarre behavior if someone tries to duplicate a lexer object. Keep reading.
+
+<H3><a name="ply_nn18"></a>3.15 Maintaining state</H3>
+
+
+In your lexer, you may want to maintain a variety of state information. This might include mode settings, symbol tables, and other details. There are a few
+different ways to handle this situation. First, you could just keep some global variables:
+
+<blockquote>
+<pre>
+num_count = 0
+def t_NUMBER(t):
+ r'\d+'
+ global num_count
+ num_count += 1
+ try:
+ t.value = int(t.value)
+ except ValueError:
+ print "Line %d: Number %s is too large!" % (t.lineno,t.value)
+ t.value = 0
+ return t
+</pre>
+</blockquote>
+
+Alternatively, you can store this information inside the Lexer object created by <tt>lex()</tt>. To this, you can use the <tt>lexer</tt> attribute
+of tokens passed to the various rules. For example:
+
+<blockquote>
+<pre>
+def t_NUMBER(t):
+ r'\d+'
+ t.lexer.num_count += 1 # Note use of lexer attribute
+ try:
+ t.value = int(t.value)
+ except ValueError:
+ print "Line %d: Number %s is too large!" % (t.lineno,t.value)
+ t.value = 0
+ return t
+
+lexer = lex.lex()
+lexer.num_count = 0 # Set the initial count
+</pre>
+</blockquote>
+
+This latter approach has the advantage of storing information inside
+the lexer itself---something that may be useful if multiple instances
+of the same lexer have been created. However, it may also feel kind
+of "hacky" to the purists. Just to put their mind at some ease, all
+internal attributes of the lexer (with the exception of <tt>lineno</tt>) have names that are prefixed
+by <tt>lex</tt> (e.g., <tt>lexdata</tt>,<tt>lexpos</tt>, etc.). Thus,
+it should be perfectly safe to store attributes in the lexer that
+don't have names starting with that prefix.
+
+<p>
+A third approach is to define the lexer as a class as shown in the previous example:
+
+<blockquote>
+<pre>
+class MyLexer:
+ ...
+ def t_NUMBER(self,t):
+ r'\d+'
+ self.num_count += 1
+ try:
+ t.value = int(t.value)
+ except ValueError:
+ print "Line %d: Number %s is too large!" % (t.lineno,t.value)
+ t.value = 0
+ return t
+
+ def build(self, **kwargs):
+ self.lexer = lex.lex(object=self,**kwargs)
+
+ def __init__(self):
+ self.num_count = 0
+
+# Create a lexer
+m = MyLexer()
+lexer = lex.lex(object=m)
+</pre>
+</blockquote>
+
+The class approach may be the easiest to manage if your application is going to be creating multiple instances of the same lexer and
+you need to manage a lot of state.
+
+<H3><a name="ply_nn19"></a>3.16 Duplicating lexers</H3>
+
+
+<b>NOTE: I am thinking about deprecating this feature. Post comments on <a href="http://groups.google.com/group/ply-hack">ply-hack@googlegroups.com</a> or send me a private email at dave@dabeaz.com.</b>
+
+<p>
+If necessary, a lexer object can be quickly duplicated by invoking its <tt>clone()</tt> method. For example:
+
+<blockquote>
+<pre>
+lexer = lex.lex()
+...
+newlexer = lexer.clone()
+</pre>
+</blockquote>
+
+When a lexer is cloned, the copy is identical to the original lexer,
+including any input text. However, once created, different text can be
+fed to the clone which can be used independently. This capability may
+be useful in situations when you are writing a parser/compiler that
+involves recursive or reentrant processing. For instance, if you
+needed to scan ahead in the input for some reason, you could create a
+clone and use it to look ahead.
+
+<p>
+The advantage of using <tt>clone()</tt> instead of reinvoking <tt>lex()</tt> is
+that it is significantly faster. Namely, it is not necessary to re-examine all of the
+token rules, build a regular expression, and construct internal tables. All of this
+information can simply be reused in the new lexer.
+
+<p>
+Special considerations need to be made when cloning a lexer that is defined as a class. Previous sections
+showed an example of a class <tt>MyLexer</tt>. If you have the following code:
+
+<blockquote>
+<pre>
+m = MyLexer()
+a = lex.lex(object=m) # Create a lexer
+
+b = a.clone() # Clone the lexer
+</pre>
+</blockquote>
+
+Then both <tt>a</tt> and <tt>b</tt> are going to be bound to the same
+object <tt>m</tt>. If the object <tt>m</tt> contains internal state
+related to lexing, this sharing may lead to quite a bit of confusion. To fix this,
+the <tt>clone()</tt> method accepts an optional argument that can be used to supply a new object. This
+can be used to clone the lexer and bind it to a new instance. For example:
+
+<blockquote>
+<pre>
+m = MyLexer() # Create a lexer
+a = lex.lex(object=m)
+
+# Create a clone
+n = MyLexer() # New instance of MyLexer
+b = a.clone(n) # New lexer bound to n
+</pre>
+</blockquote>
+
+It may make sense to encapsulate all of this inside a method:
+
+<blockquote>
+<pre>
+class MyLexer:
+ ...
+ def clone(self):
+ c = MyLexer() # Create a new instance of myself
+ # Copy attributes from self to c as appropriate
+ ...
+ # Clone the lexer
+ c.lexer = self.lexer.clone(c)
+ return c
+</pre>
+</blockquote>
+
+The fact that a new instance of <tt>MyLexer</tt> may be created while cloning a lexer is the reason why you should never
+invoke <tt>lex.lex()</tt> inside <tt>__init__()</tt>. If you do, the lexer will be rebuilt from scratch and you lose
+all of the performance benefits of using <tt>clone()</tt> in the first place.
+
+<H3><a name="ply_nn20"></a>3.17 Internal lexer state</H3>
+
+
+A Lexer object <tt>lexer</tt> has a number of internal attributes that may be useful in certain
+situations.
+
+<p>
+<tt>lexer.lexpos</tt>
+<blockquote>
+This attribute is an integer that contains the current position within the input text. If you modify
+the value, it will change the result of the next call to <tt>token()</tt>. Within token rule functions, this points
+to the first character <em>after</em> the matched text. If the value is modified within a rule, the next returned token will be
+matched at the new position.
+</blockquote>
+
+<p>
+<tt>lexer.lineno</tt>
+<blockquote>
+The current value of the line number attribute stored in the lexer. This can be modified as needed to
+change the line number.
+</blockquote>
+
+<p>
+<tt>lexer.lexdata</tt>
+<blockquote>
+The current input text stored in the lexer. This is the string passed with the <tt>input()</tt> method. It
+would probably be a bad idea to modify this unless you really know what you're doing.
+</blockquote>
+
+<P>
+<tt>lexer.lexmatch</tt>
+<blockquote>
+This is the raw <tt>Match</tt> object returned by the Python <tt>re.match()</tt> function (used internally by PLY) for the
+current token. If you have written a regular expression that contains named groups, you can use this to retrieve those values.
+</blockquote>
+
+<H3><a name="ply_nn21"></a>3.18 Conditional lexing and start conditions</H3>
+
+
+In advanced parsing applications, it may be useful to have different
+lexing states. For instance, you may want the occurrence of a certain
+token or syntactic construct to trigger a different kind of lexing.
+PLY supports a feature that allows the underlying lexer to be put into
+a series of different states. Each state can have its own tokens,
+lexing rules, and so forth. The implementation is based largely on
+the "start condition" feature of GNU flex. Details of this can be found
+at <a
+href="http://www.gnu.org/software/flex/manual/html_chapter/flex_11.html">http://www.gnu.org/software/flex/manual/html_chapter/flex_11.html.</a>.
+
+<p>
+To define a new lexing state, it must first be declared. This is done by including a "states" declaration in your
+lex file. For example:
+
+<blockquote>
+<pre>
+states = (
+ ('foo','exclusive'),
+ ('bar','inclusive'),
+)
+</pre>
+</blockquote>
+
+This declaration declares two states, <tt>'foo'</tt>
+and <tt>'bar'</tt>. States may be of two types; <tt>'exclusive'</tt>
+and <tt>'inclusive'</tt>. An exclusive state completely overrides the
+default behavior of the lexer. That is, lex will only return tokens
+and apply rules defined specifically for that state. An inclusive
+state adds additional tokens and rules to the default set of rules.
+Thus, lex will return both the tokens defined by default in addition
+to those defined for the inclusive state.
+
+<p>
+Once a state has been declared, tokens and rules are declared by including the
+state name in token/rule declaration. For example:
+
+<blockquote>
+<pre>
+t_foo_NUMBER = r'\d+' # Token 'NUMBER' in state 'foo'
+t_bar_ID = r'[a-zA-Z_][a-zA-Z0-9_]*' # Token 'ID' in state 'bar'
+
+def t_foo_newline(t):
+ r'\n'
+ t.lexer.lineno += 1
+</pre>
+</blockquote>
+
+A token can be declared in multiple states by including multiple state names in the declaration. For example:
+
+<blockquote>
+<pre>
+t_foo_bar_NUMBER = r'\d+' # Defines token 'NUMBER' in both state 'foo' and 'bar'
+</pre>
+</blockquote>
+
+Alternative, a token can be declared in all states using the 'ANY' in the name.
+
+<blockquote>
+<pre>
+t_ANY_NUMBER = r'\d+' # Defines a token 'NUMBER' in all states
+</pre>
+</blockquote>
+
+If no state name is supplied, as is normally the case, the token is associated with a special state <tt>'INITIAL'</tt>. For example,
+these two declarations are identical:
+
+<blockquote>
+<pre>
+t_NUMBER = r'\d+'
+t_INITIAL_NUMBER = r'\d+'
+</pre>
+</blockquote>
+
+<p>
+States are also associated with the special <tt>t_ignore</tt> and <tt>t_error()</tt> declarations. For example, if a state treats
+these differently, you can declare:
+
+<blockquote>
+<pre>
+t_foo_ignore = " \t\n" # Ignored characters for state 'foo'
+
+def t_bar_error(t): # Special error handler for state 'bar'
+ pass
+</pre>
+</blockquote>
+
+By default, lexing operates in the <tt>'INITIAL'</tt> state. This state includes all of the normally defined tokens.
+For users who aren't using different states, this fact is completely transparent. If, during lexing or parsing, you want to change
+the lexing state, use the <tt>begin()</tt> method. For example:
+
+<blockquote>
+<pre>
+def t_begin_foo(t):
+ r'start_foo'
+ t.lexer.begin('foo') # Starts 'foo' state
+</pre>
+</blockquote>
+
+To get out of a state, you use <tt>begin()</tt> to switch back to the initial state. For example:
+
+<blockquote>
+<pre>
+def t_foo_end(t):
+ r'end_foo'
+ t.lexer.begin('INITIAL') # Back to the initial state
+</pre>
+</blockquote>
+
+The management of states can also be done with a stack. For example:
+
+<blockquote>
+<pre>
+def t_begin_foo(t):
+ r'start_foo'
+ t.lexer.push_state('foo') # Starts 'foo' state
+
+def t_foo_end(t):
+ r'end_foo'
+ t.lexer.pop_state() # Back to the previous state
+</pre>
+</blockquote>
+
+<p>
+The use of a stack would be useful in situations where there are many ways of entering a new lexing state and you merely want to go back
+to the previous state afterwards.
+
+<P>
+An example might help clarify. Suppose you were writing a parser and you wanted to grab sections of arbitrary C code enclosed by
+curly braces. That is, whenever you encounter a starting brace '{', you want to read all of the enclosed code up to the ending brace '}'
+and return it as a string. Doing this with a normal regular expression rule is nearly (if not actually) impossible. This is because braces can
+be nested and can be included in comments and strings. Thus, simply matching up to the first matching '}' character isn't good enough. Here is how
+you might use lexer states to do this:
+
+<blockquote>
+<pre>
+# Declare the state
+states = (
+ ('ccode','exclusive'),
+)
+
+# Match the first {. Enter ccode state.
+def t_ccode(t):
+ r'\{'
+ t.lexer.code_start = t.lexer.lexpos # Record the starting position
+ t.lexer.level = 1 # Initial brace level
+ t.lexer.begin('ccode') # Enter 'ccode' state
+
+# Rules for the ccode state
+def t_ccode_lbrace(t):
+ r'\{'
+ t.lexer.level +=1
+
+def t_ccode_rbrace(t):
+ r'\}'
+ t.lexer.level -=1
+
+ # If closing brace, return the code fragment
+ if t.lexer.level == 0:
+ t.value = t.lexer.lexdata[t.lexer.code_start:t.lexer.lexpos+1]
+ t.type = "CCODE"
+ t.lexer.lineno += t.value.count('\n')
+ t.lexer.begin('INITIAL')
+ return t
+
+# C or C++ comment (ignore)
+def t_ccode_comment(t):
+ r'(/\*(.|\n)*?*/)|(//.*)'
+ pass
+
+# C string
+def t_ccode_string(t):
+ r'\"([^\\\n]|(\\.))*?\"'
+
+# C character literal
+def t_ccode_char(t):
+ r'\'([^\\\n]|(\\.))*?\''
+
+# Any sequence of non-whitespace characters (not braces, strings)
+def t_ccode_nonspace(t):
+ r'[^\s\{\}\'\"]+'
+
+# Ignored characters (whitespace)
+t_ccode_ignore = " \t\n"
+
+# For bad characters, we just skip over it
+def t_ccode_error(t):
+ t.lexer.skip(1)
+</pre>
+</blockquote>
+
+In this example, the occurrence of the first '{' causes the lexer to record the starting position and enter a new state <tt>'ccode'</tt>. A collection of rules then match
+various parts of the input that follow (comments, strings, etc.). All of these rules merely discard the token (by not returning a value).
+However, if the closing right brace is encountered, the rule <tt>t_ccode_rbrace</tt> collects all of the code (using the earlier recorded starting
+position), stores it, and returns a token 'CCODE' containing all of that text. When returning the token, the lexing state is restored back to its
+initial state.
+
+<H3><a name="ply_nn21"></a>3.19 Miscellaneous Issues</H3>
+
+
+<P>
+<li>The lexer requires input to be supplied as a single input string. Since most machines have more than enough memory, this
+rarely presents a performance concern. However, it means that the lexer currently can't be used with streaming data
+such as open files or sockets. This limitation is primarily a side-effect of using the <tt>re</tt> module.
+
+<p>
+<li>The lexer should work properly with both Unicode strings given as token and pattern matching rules as
+well as for input text.
+
+<p>
+<li>If you need to supply optional flags to the re.compile() function, use the reflags option to lex. For example:
+
+<blockquote>
+<pre>
+lex.lex(reflags=re.UNICODE)
+</pre>
+</blockquote>
+
+<p>
+<li>Since the lexer is written entirely in Python, its performance is
+largely determined by that of the Python <tt>re</tt> module. Although
+the lexer has been written to be as efficient as possible, it's not
+blazingly fast when used on very large input files. If
+performance is concern, you might consider upgrading to the most
+recent version of Python, creating a hand-written lexer, or offloading
+the lexer into a C extension module.
+
+<p>
+If you are going to create a hand-written lexer and you plan to use it with <tt>yacc.py</tt>,
+it only needs to conform to the following requirements:
+
+<ul>
+<li>It must provide a <tt>token()</tt> method that returns the next token or <tt>None</tt> if no more
+tokens are available.
+<li>The <tt>token()</tt> method must return an object <tt>tok</tt> that has <tt>type</tt> and <tt>value</tt> attributes.
+</ul>
+
+<H2><a name="ply_nn22"></a>4. Parsing basics</H2>
+
+
+<tt>yacc.py</tt> is used to parse language syntax. Before showing an
+example, there are a few important bits of background that must be
+mentioned. First, <em>syntax</em> is usually specified in terms of a BNF grammar.
+For example, if you wanted to parse
+simple arithmetic expressions, you might first write an unambiguous
+grammar specification like this:
+
+<blockquote>
+<pre>
+expression : expression + term
+ | expression - term
+ | term
+
+term : term * factor
+ | term / factor
+ | factor
+
+factor : NUMBER
+ | ( expression )
+</pre>
+</blockquote>
+
+In the grammar, symbols such as <tt>NUMBER</tt>, <tt>+</tt>, <tt>-</tt>, <tt>*</tt>, and <tt>/</tt> are known
+as <em>terminals</em> and correspond to raw input tokens. Identifiers such as <tt>term</tt> and <tt>factor</tt> refer to more
+complex rules, typically comprised of a collection of tokens. These identifiers are known as <em>non-terminals</em>.
+<P>
+The semantic behavior of a language is often specified using a
+technique known as syntax directed translation. In syntax directed
+translation, attributes are attached to each symbol in a given grammar
+rule along with an action. Whenever a particular grammar rule is
+recognized, the action describes what to do. For example, given the
+expression grammar above, you might write the specification for a
+simple calculator like this:
+
+<blockquote>
+<pre>
+Grammar Action
+-------------------------------- --------------------------------------------
+expression0 : expression1 + term expression0.val = expression1.val + term.val
+ | expression1 - term expression0.val = expression1.val - term.val
+ | term expression0.val = term.val
+
+term0 : term1 * factor term0.val = term1.val * factor.val
+ | term1 / factor term0.val = term1.val / factor.val
+ | factor term0.val = factor.val
+
+factor : NUMBER factor.val = int(NUMBER.lexval)
+ | ( expression ) factor.val = expression.val
+</pre>
+</blockquote>
+
+A good way to think about syntax directed translation is to simply think of each symbol in the grammar as some
+kind of object. The semantics of the language are then expressed as a collection of methods/operations on these
+objects.
+
+<p>
+Yacc uses a parsing technique known as LR-parsing or shift-reduce parsing. LR parsing is a
+bottom up technique that tries to recognize the right-hand-side of various grammar rules.
+Whenever a valid right-hand-side is found in the input, the appropriate action code is triggered and the
+grammar symbols are replaced by the grammar symbol on the left-hand-side.
+
+<p>
+LR parsing is commonly implemented by shifting grammar symbols onto a stack and looking at the stack and the next
+input token for patterns. The details of the algorithm can be found in a compiler text, but the
+following example illustrates the steps that are performed if you wanted to parse the expression
+<tt>3 + 5 * (10 - 20)</tt> using the grammar defined above:
+
+<blockquote>
+<pre>
+Step Symbol Stack Input Tokens Action
+---- --------------------- --------------------- -------------------------------
+1 $ 3 + 5 * ( 10 - 20 )$ Shift 3
+2 $ 3 + 5 * ( 10 - 20 )$ Reduce factor : NUMBER
+3 $ factor + 5 * ( 10 - 20 )$ Reduce term : factor
+4 $ term + 5 * ( 10 - 20 )$ Reduce expr : term
+5 $ expr + 5 * ( 10 - 20 )$ Shift +
+6 $ expr + 5 * ( 10 - 20 )$ Shift 5
+7 $ expr + 5 * ( 10 - 20 )$ Reduce factor : NUMBER
+8 $ expr + factor * ( 10 - 20 )$ Reduce term : factor
+9 $ expr + term * ( 10 - 20 )$ Shift *
+10 $ expr + term * ( 10 - 20 )$ Shift (
+11 $ expr + term * ( 10 - 20 )$ Shift 10
+12 $ expr + term * ( 10 - 20 )$ Reduce factor : NUMBER
+13 $ expr + term * ( factor - 20 )$ Reduce term : factor
+14 $ expr + term * ( term - 20 )$ Reduce expr : term
+15 $ expr + term * ( expr - 20 )$ Shift -
+16 $ expr + term * ( expr - 20 )$ Shift 20
+17 $ expr + term * ( expr - 20 )$ Reduce factor : NUMBER
+18 $ expr + term * ( expr - factor )$ Reduce term : factor
+19 $ expr + term * ( expr - term )$ Reduce expr : expr - term
+20 $ expr + term * ( expr )$ Shift )
+21 $ expr + term * ( expr ) $ Reduce factor : (expr)
+22 $ expr + term * factor $ Reduce term : term * factor
+23 $ expr + term $ Reduce expr : expr + term
+24 $ expr $ Reduce expr
+25 $ $ Success!
+</pre>
+</blockquote>
+
+When parsing the expression, an underlying state machine and the current input token determine what to do next.
+If the next token looks like part of a valid grammar rule (based on other items on the stack), it is generally shifted
+onto the stack. If the top of the stack contains a valid right-hand-side of a grammar rule, it is
+usually "reduced" and the symbols replaced with the symbol on the left-hand-side. When this reduction occurs, the
+appropriate action is triggered (if defined). If the input token can't be shifted and the top of stack doesn't match
+any grammar rules, a syntax error has occurred and the parser must take some kind of recovery step (or bail out).
+
+<p>
+It is important to note that the underlying implementation is built around a large finite-state machine that is encoded
+in a collection of tables. The construction of these tables is quite complicated and beyond the scope of this discussion.
+However, subtle details of this process explain why, in the example above, the parser chooses to shift a token
+onto the stack in step 9 rather than reducing the rule <tt>expr : expr + term</tt>.
+
+<H2><a name="ply_nn23"></a>5. Yacc reference</H2>
+
+
+This section describes how to use write parsers in PLY.
+
+<H3><a name="ply_nn24"></a>5.1 An example</H3>
+
+
+Suppose you wanted to make a grammar for simple arithmetic expressions as previously described. Here is
+how you would do it with <tt>yacc.py</tt>:
+
+<blockquote>
+<pre>
+# Yacc example
+
+import ply.yacc as yacc
+
+# Get the token map from the lexer. This is required.
+from calclex import tokens
+
+def p_expression_plus(p):
+ 'expression : expression PLUS term'
+ p[0] = p[1] + p[3]
+
+def p_expression_minus(p):
+ 'expression : expression MINUS term'
+ p[0] = p[1] - p[3]
+
+def p_expression_term(p):
+ 'expression : term'
+ p[0] = p[1]
+
+def p_term_times(p):
+ 'term : term TIMES factor'
+ p[0] = p[1] * p[3]
+
+def p_term_div(p):
+ 'term : term DIVIDE factor'
+ p[0] = p[1] / p[3]
+
+def p_term_factor(p):
+ 'term : factor'
+ p[0] = p[1]
+
+def p_factor_num(p):
+ 'factor : NUMBER'
+ p[0] = p[1]
+
+def p_factor_expr(p):
+ 'factor : LPAREN expression RPAREN'
+ p[0] = p[2]
+
+# Error rule for syntax errors
+def p_error(p):
+ print "Syntax error in input!"
+
+# Build the parser
+yacc.yacc()
+
+# Use this if you want to build the parser using SLR instead of LALR
+# yacc.yacc(method="SLR")
+
+while 1:
+ try:
+ s = raw_input('calc > ')
+ except EOFError:
+ break
+ if not s: continue
+ result = yacc.parse(s)
+ print result
+</pre>
+</blockquote>
+
+In this example, each grammar rule is defined by a Python function where the docstring to that function contains the
+appropriate context-free grammar specification. Each function accepts a single
+argument <tt>p</tt> that is a sequence containing the values of each grammar symbol in the corresponding rule. The values of
+<tt>p[i]</tt> are mapped to grammar symbols as shown here:
+
+<blockquote>
+<pre>
+def p_expression_plus(p):
+ 'expression : expression PLUS term'
+ # ^ ^ ^ ^
+ # p[0] p[1] p[2] p[3]
+
+ p[0] = p[1] + p[3]
+</pre>
+</blockquote>
+
+For tokens, the "value" of the corresponding <tt>p[i]</tt> is the
+<em>same</em> as the <tt>p.value</tt> attribute assigned
+in the lexer module. For non-terminals, the value is determined by
+whatever is placed in <tt>p[0]</tt> when rules are reduced. This
+value can be anything at all. However, it probably most common for
+the value to be a simple Python type, a tuple, or an instance. In this example, we
+are relying on the fact that the <tt>NUMBER</tt> token stores an integer value in its value
+field. All of the other rules simply perform various types of integer operations and store
+the result.
+
+<P>
+Note: The use of negative indices have a special meaning in yacc---specially <tt>p[-1]</tt> does
+not have the same value as <tt>p[3]</tt> in this example. Please see the section on "Embedded Actions" for further
+details.
+
+<p>
+The first rule defined in the yacc specification determines the starting grammar
+symbol (in this case, a rule for <tt>expression</tt> appears first). Whenever
+the starting rule is reduced by the parser and no more input is available, parsing
+stops and the final value is returned (this value will be whatever the top-most rule
+placed in <tt>p[0]</tt>). Note: an alternative starting symbol can be specified using the <tt>start</tt> keyword argument to
+<tt>yacc()</tt>.
+
+<p>The <tt>p_error(p)</tt> rule is defined to catch syntax errors. See the error handling section
+below for more detail.
+
+<p>
+To build the parser, call the <tt>yacc.yacc()</tt> function. This function
+looks at the module and attempts to construct all of the LR parsing tables for the grammar
+you have specified. The first time <tt>yacc.yacc()</tt> is invoked, you will get a message
+such as this:
+
+<blockquote>
+<pre>
+$ python calcparse.py
+yacc: Generating LALR parsing table...
+calc >
+</pre>
+</blockquote>
+
+Since table construction is relatively expensive (especially for large
+grammars), the resulting parsing table is written to the current
+directory in a file called <tt>parsetab.py</tt>. In addition, a
+debugging file called <tt>parser.out</tt> is created. On subsequent
+executions, <tt>yacc</tt> will reload the table from
+<tt>parsetab.py</tt> unless it has detected a change in the underlying
+grammar (in which case the tables and <tt>parsetab.py</tt> file are
+regenerated). Note: The names of parser output files can be changed if necessary. See the notes that follow later.
+
+<p>
+If any errors are detected in your grammar specification, <tt>yacc.py</tt> will produce
+diagnostic messages and possibly raise an exception. Some of the errors that can be detected include:
+
+<ul>
+<li>Duplicated function names (if more than one rule function have the same name in the grammar file).
+<li>Shift/reduce and reduce/reduce conflicts generated by ambiguous grammars.
+<li>Badly specified grammar rules.
+<li>Infinite recursion (rules that can never terminate).
+<li>Unused rules and tokens
+<li>Undefined rules and tokens
+</ul>
+
+The next few sections now discuss a few finer points of grammar construction.
+
+<H3><a name="ply_nn25"></a>5.2 Combining Grammar Rule Functions</H3>
+
+
+When grammar rules are similar, they can be combined into a single function.
+For example, consider the two rules in our earlier example:
+
+<blockquote>
+<pre>
+def p_expression_plus(p):
+ 'expression : expression PLUS term'
+ p[0] = p[1] + p[3]
+
+def p_expression_minus(t):
+ 'expression : expression MINUS term'
+ p[0] = p[1] - p[3]
+</pre>
+</blockquote>
+
+Instead of writing two functions, you might write a single function like this:
+
+<blockquote>
+<pre>
+def p_expression(p):
+ '''expression : expression PLUS term
+ | expression MINUS term'''
+ if p[2] == '+':
+ p[0] = p[1] + p[3]
+ elif p[2] == '-':
+ p[0] = p[1] - p[3]
+</pre>
+</blockquote>
+
+In general, the doc string for any given function can contain multiple grammar rules. So, it would
+have also been legal (although possibly confusing) to write this:
+
+<blockquote>
+<pre>
+def p_binary_operators(p):
+ '''expression : expression PLUS term
+ | expression MINUS term
+ term : term TIMES factor
+ | term DIVIDE factor'''
+ if p[2] == '+':
+ p[0] = p[1] + p[3]
+ elif p[2] == '-':
+ p[0] = p[1] - p[3]
+ elif p[2] == '*':
+ p[0] = p[1] * p[3]
+ elif p[2] == '/':
+ p[0] = p[1] / p[3]
+</pre>
+</blockquote>
+
+When combining grammar rules into a single function, it is usually a good idea for all of the rules to have
+a similar structure (e.g., the same number of terms). Otherwise, the corresponding action code may be more
+complicated than necessary. However, it is possible to handle simple cases using len(). For example:
+
+<blockquote>
+<pre>
+def p_expressions(p):
+ '''expression : expression MINUS expression
+ | MINUS expression'''
+ if (len(p) == 4):
+ p[0] = p[1] - p[3]
+ elif (len(p) == 3):
+ p[0] = -p[2]
+</pre>
+</blockquote>
+
+<H3><a name="ply_nn26"></a>5.3 Character Literals</H3>
+
+
+If desired, a grammar may contain tokens defined as single character literals. For example:
+
+<blockquote>
+<pre>
+def p_binary_operators(p):
+ '''expression : expression '+' term
+ | expression '-' term
+ term : term '*' factor
+ | term '/' factor'''
+ if p[2] == '+':
+ p[0] = p[1] + p[3]
+ elif p[2] == '-':
+ p[0] = p[1] - p[3]
+ elif p[2] == '*':
+ p[0] = p[1] * p[3]
+ elif p[2] == '/':
+ p[0] = p[1] / p[3]
+</pre>
+</blockquote>
+
+A character literal must be enclosed in quotes such as <tt>'+'</tt>. In addition, if literals are used, they must be declared in the
+corresponding <tt>lex</tt> file through the use of a special <tt>literals</tt> declaration.
+
+<blockquote>
+<pre>
+# Literals. Should be placed in module given to lex()
+literals = ['+','-','*','/' ]
+</pre>
+</blockquote>
+
+<b>Character literals are limited to a single character</b>. Thus, it is not legal to specify literals such as <tt>'&lt;='</tt> or <tt>'=='</tt>. For this, use
+the normal lexing rules (e.g., define a rule such as <tt>t_EQ = r'=='</tt>).
+
+<H3><a name="ply_nn26"></a>5.4 Empty Productions</H3>
+
+
+<tt>yacc.py</tt> can handle empty productions by defining a rule like this:
+
+<blockquote>
+<pre>
+def p_empty(p):
+ 'empty :'
+ pass
+</pre>
+</blockquote>
+
+Now to use the empty production, simply use 'empty' as a symbol. For example:
+
+<blockquote>
+<pre>
+def p_optitem(p):
+ 'optitem : item'
+ ' | empty'
+ ...
+</pre>
+</blockquote>
+
+Note: You can write empty rules anywhere by simply specifying an empty right hand side. However, I personally find that
+writing an "empty" rule and using "empty" to denote an empty production is easier to read.
+
+<H3><a name="ply_nn28"></a>5.5 Changing the starting symbol</H3>
+
+
+Normally, the first rule found in a yacc specification defines the starting grammar rule (top level rule). To change this, simply
+supply a <tt>start</tt> specifier in your file. For example:
+
+<blockquote>
+<pre>
+start = 'foo'
+
+def p_bar(p):
+ 'bar : A B'
+
+# This is the starting rule due to the start specifier above
+def p_foo(p):
+ 'foo : bar X'
+...
+</pre>
+</blockquote>
+
+The use of a <tt>start</tt> specifier may be useful during debugging since you can use it to have yacc build a subset of
+a larger grammar. For this purpose, it is also possible to specify a starting symbol as an argument to <tt>yacc()</tt>. For example:
+
+<blockquote>
+<pre>
+yacc.yacc(start='foo')
+</pre>
+</blockquote>
+
+<H3><a name="ply_nn27"></a>5.6 Dealing With Ambiguous Grammars</H3>
+
+
+The expression grammar given in the earlier example has been written in a special format to eliminate ambiguity.
+However, in many situations, it is extremely difficult or awkward to write grammars in this format. A
+much more natural way to express the grammar is in a more compact form like this:
+
+<blockquote>
+<pre>
+expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression
+ | LPAREN expression RPAREN
+ | NUMBER
+</pre>
+</blockquote>
+
+Unfortunately, this grammar specification is ambiguous. For example, if you are parsing the string
+"3 * 4 + 5", there is no way to tell how the operators are supposed to be grouped.
+For example, does the expression mean "(3 * 4) + 5" or is it "3 * (4+5)"?
+
+<p>
+When an ambiguous grammar is given to <tt>yacc.py</tt> it will print messages about "shift/reduce conflicts"
+or a "reduce/reduce conflicts". A shift/reduce conflict is caused when the parser generator can't decide
+whether or not to reduce a rule or shift a symbol on the parsing stack. For example, consider
+the string "3 * 4 + 5" and the internal parsing stack:
+
+<blockquote>
+<pre>
+Step Symbol Stack Input Tokens Action
+---- --------------------- --------------------- -------------------------------
+1 $ 3 * 4 + 5$ Shift 3
+2 $ 3 * 4 + 5$ Reduce : expression : NUMBER
+3 $ expr * 4 + 5$ Shift *
+4 $ expr * 4 + 5$ Shift 4
+5 $ expr * 4 + 5$ Reduce: expression : NUMBER
+6 $ expr * expr + 5$ SHIFT/REDUCE CONFLICT ????
+</pre>
+</blockquote>
+
+In this case, when the parser reaches step 6, it has two options. One is to reduce the
+rule <tt>expr : expr * expr</tt> on the stack. The other option is to shift the
+token <tt>+</tt> on the stack. Both options are perfectly legal from the rules
+of the context-free-grammar.
+
+<p>
+By default, all shift/reduce conflicts are resolved in favor of shifting. Therefore, in the above
+example, the parser will always shift the <tt>+</tt> instead of reducing. Although this
+strategy works in many cases (including the ambiguous if-then-else), it is not enough for arithmetic
+expressions. In fact, in the above example, the decision to shift <tt>+</tt> is completely wrong---we should have
+reduced <tt>expr * expr</tt> since multiplication has higher mathematical precedence than addition.
+
+<p>To resolve ambiguity, especially in expression grammars, <tt>yacc.py</tt> allows individual
+tokens to be assigned a precedence level and associativity. This is done by adding a variable
+<tt>precedence</tt> to the grammar file like this:
+
+<blockquote>
+<pre>
+precedence = (
+ ('left', 'PLUS', 'MINUS'),
+ ('left', 'TIMES', 'DIVIDE'),
+)
+</pre>
+</blockquote>
+
+This declaration specifies that <tt>PLUS</tt>/<tt>MINUS</tt> have
+the same precedence level and are left-associative and that
+<tt>TIMES</tt>/<tt>DIVIDE</tt> have the same precedence and are left-associative.
+Within the <tt>precedence</tt> declaration, tokens are ordered from lowest to highest precedence. Thus,
+this declaration specifies that <tt>TIMES</tt>/<tt>DIVIDE</tt> have higher
+precedence than <tt>PLUS</tt>/<tt>MINUS</tt> (since they appear later in the
+precedence specification).
+
+<p>
+The precedence specification works by associating a numerical precedence level value and associativity direction to
+the listed tokens. For example, in the above example you get:
+
+<blockquote>
+<pre>
+PLUS : level = 1, assoc = 'left'
+MINUS : level = 1, assoc = 'left'
+TIMES : level = 2, assoc = 'left'
+DIVIDE : level = 2, assoc = 'left'
+</pre>
+</blockquote>
+
+These values are then used to attach a numerical precedence value and associativity direction
+to each grammar rule. <em>This is always determined by looking at the precedence of the right-most terminal symbol.</em>
+For example:
+
+<blockquote>
+<pre>
+expression : expression PLUS expression # level = 1, left
+ | expression MINUS expression # level = 1, left
+ | expression TIMES expression # level = 2, left
+ | expression DIVIDE expression # level = 2, left
+ | LPAREN expression RPAREN # level = None (not specified)
+ | NUMBER # level = None (not specified)
+</pre>
+</blockquote>
+
+When shift/reduce conflicts are encountered, the parser generator resolves the conflict by
+looking at the precedence rules and associativity specifiers.
+
+<p>
+<ol>
+<li>If the current token has higher precedence, it is shifted.
+<li>If the grammar rule on the stack has higher precedence, the rule is reduced.
+<li>If the current token and the grammar rule have the same precedence, the
+rule is reduced for left associativity, whereas the token is shifted for right associativity.
+<li>If nothing is known about the precedence, shift/reduce conflicts are resolved in
+favor of shifting (the default).
+</ol>
+
+For example, if "expression PLUS expression" has been parsed and the next token
+is "TIMES", the action is going to be a shift because "TIMES" has a higher precedence level than "PLUS". On the other
+hand, if "expression TIMES expression" has been parsed and the next token is "PLUS", the action
+is going to be reduce because "PLUS" has a lower precedence than "TIMES."
+
+<p>
+When shift/reduce conflicts are resolved using the first three techniques (with the help of
+precedence rules), <tt>yacc.py</tt> will report no errors or conflicts in the grammar.
+
+<p>
+One problem with the precedence specifier technique is that it is sometimes necessary to
+change the precedence of an operator in certain contents. For example, consider a unary-minus operator
+in "3 + 4 * -5". Normally, unary minus has a very high precedence--being evaluated before the multiply.
+However, in our precedence specifier, MINUS has a lower precedence than TIMES. To deal with this,
+precedence rules can be given for fictitious tokens like this:
+
+<blockquote>
+<pre>
+precedence = (
+ ('left', 'PLUS', 'MINUS'),
+ ('left', 'TIMES', 'DIVIDE'),
+ ('right', 'UMINUS'), # Unary minus operator
+)
+</pre>
+</blockquote>
+
+Now, in the grammar file, we can write our unary minus rule like this:
+
+<blockquote>
+<pre>
+def p_expr_uminus(p):
+ 'expression : MINUS expression %prec UMINUS'
+ p[0] = -p[2]
+</pre>
+</blockquote>
+
+In this case, <tt>%prec UMINUS</tt> overrides the default rule precedence--setting it to that
+of UMINUS in the precedence specifier.
+
+<p>
+At first, the use of UMINUS in this example may appear very confusing.
+UMINUS is not an input token or a grammer rule. Instead, you should
+think of it as the name of a special marker in the precedence table. When you use the <tt>%prec</tt> qualifier, you're simply
+telling yacc that you want the precedence of the expression to be the same as for this special marker instead of the usual precedence.
+
+<p>
+It is also possible to specify non-associativity in the <tt>precedence</tt> table. This would
+be used when you <em>don't</em> want operations to chain together. For example, suppose
+you wanted to support comparison operators like <tt>&lt;</tt> and <tt>&gt;</tt> but you didn't want to allow
+combinations like <tt>a &lt; b &lt; c</tt>. To do this, simply specify a rule like this:
+
+<blockquote>
+<pre>
+precedence = (
+ ('nonassoc', 'LESSTHAN', 'GREATERTHAN'), # Nonassociative operators
+ ('left', 'PLUS', 'MINUS'),
+ ('left', 'TIMES', 'DIVIDE'),
+ ('right', 'UMINUS'), # Unary minus operator
+)
+</pre>
+</blockquote>
+
+<p>
+If you do this, the occurrence of input text such as <tt> a &lt; b &lt; c</tt> will result in a syntax error. However, simple
+expressions such as <tt>a &lt; b</tt> will still be fine.
+
+<p>
+Reduce/reduce conflicts are caused when there are multiple grammar
+rules that can be applied to a given set of symbols. This kind of
+conflict is almost always bad and is always resolved by picking the
+rule that appears first in the grammar file. Reduce/reduce conflicts
+are almost always caused when different sets of grammar rules somehow
+generate the same set of symbols. For example:
+
+<blockquote>
+<pre>
+assignment : ID EQUALS NUMBER
+ | ID EQUALS expression
+
+expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression
+ | LPAREN expression RPAREN
+ | NUMBER
+</pre>
+</blockquote>
+
+In this case, a reduce/reduce conflict exists between these two rules:
+
+<blockquote>
+<pre>
+assignment : ID EQUALS NUMBER
+expression : NUMBER
+</pre>
+</blockquote>
+
+For example, if you wrote "a = 5", the parser can't figure out if this
+is supposed to be reduced as <tt>assignment : ID EQUALS NUMBER</tt> or
+whether it's supposed to reduce the 5 as an expression and then reduce
+the rule <tt>assignment : ID EQUALS expression</tt>.
+
+<p>
+It should be noted that reduce/reduce conflicts are notoriously difficult to spot
+simply looking at the input grammer. To locate these, it is usually easier to look at the
+<tt>parser.out</tt> debugging file with an appropriately high level of caffeination.
+
+<H3><a name="ply_nn28"></a>5.7 The parser.out file</H3>
+
+
+Tracking down shift/reduce and reduce/reduce conflicts is one of the finer pleasures of using an LR
+parsing algorithm. To assist in debugging, <tt>yacc.py</tt> creates a debugging file called
+'parser.out' when it generates the parsing table. The contents of this file look like the following:
+
+<blockquote>
+<pre>
+Unused terminals:
+
+
+Grammar
+
+Rule 1 expression -> expression PLUS expression
+Rule 2 expression -> expression MINUS expression
+Rule 3 expression -> expression TIMES expression
+Rule 4 expression -> expression DIVIDE expression
+Rule 5 expression -> NUMBER
+Rule 6 expression -> LPAREN expression RPAREN
+
+Terminals, with rules where they appear
+
+TIMES : 3
+error :
+MINUS : 2
+RPAREN : 6
+LPAREN : 6
+DIVIDE : 4
+PLUS : 1
+NUMBER : 5
+
+Nonterminals, with rules where they appear
+
+expression : 1 1 2 2 3 3 4 4 6 0
+
+
+Parsing method: LALR
+
+
+state 0
+
+ S' -> . expression
+ expression -> . expression PLUS expression
+ expression -> . expression MINUS expression
+ expression -> . expression TIMES expression
+ expression -> . expression DIVIDE expression
+ expression -> . NUMBER
+ expression -> . LPAREN expression RPAREN
+
+ NUMBER shift and go to state 3
+ LPAREN shift and go to state 2
+
+
+state 1
+
+ S' -> expression .
+ expression -> expression . PLUS expression
+ expression -> expression . MINUS expression
+ expression -> expression . TIMES expression
+ expression -> expression . DIVIDE expression
+
+ PLUS shift and go to state 6
+ MINUS shift and go to state 5
+ TIMES shift and go to state 4
+ DIVIDE shift and go to state 7
+
+
+state 2
+
+ expression -> LPAREN . expression RPAREN
+ expression -> . expression PLUS expression
+ expression -> . expression MINUS expression
+ expression -> . expression TIMES expression
+ expression -> . expression DIVIDE expression
+ expression -> . NUMBER
+ expression -> . LPAREN expression RPAREN
+
+ NUMBER shift and go to state 3
+ LPAREN shift and go to state 2
+
+
+state 3
+
+ expression -> NUMBER .
+
+ $ reduce using rule 5
+ PLUS reduce using rule 5
+ MINUS reduce using rule 5
+ TIMES reduce using rule 5
+ DIVIDE reduce using rule 5
+ RPAREN reduce using rule 5
+
+
+state 4
+
+ expression -> expression TIMES . expression
+ expression -> . expression PLUS expression
+ expression -> . expression MINUS expression
+ expression -> . expression TIMES expression
+ expression -> . expression DIVIDE expression
+ expression -> . NUMBER
+ expression -> . LPAREN expression RPAREN
+
+ NUMBER shift and go to state 3
+ LPAREN shift and go to state 2
+
+
+state 5
+
+ expression -> expression MINUS . expression
+ expression -> . expression PLUS expression
+ expression -> . expression MINUS expression
+ expression -> . expression TIMES expression
+ expression -> . expression DIVIDE expression
+ expression -> . NUMBER
+ expression -> . LPAREN expression RPAREN
+
+ NUMBER shift and go to state 3
+ LPAREN shift and go to state 2
+
+
+state 6
+
+ expression -> expression PLUS . expression
+ expression -> . expression PLUS expression
+ expression -> . expression MINUS expression
+ expression -> . expression TIMES expression
+ expression -> . expression DIVIDE expression
+ expression -> . NUMBER
+ expression -> . LPAREN expression RPAREN
+
+ NUMBER shift and go to state 3
+ LPAREN shift and go to state 2
+
+
+state 7
+
+ expression -> expression DIVIDE . expression
+ expression -> . expression PLUS expression
+ expression -> . expression MINUS expression
+ expression -> . expression TIMES expression
+ expression -> . expression DIVIDE expression
+ expression -> . NUMBER
+ expression -> . LPAREN expression RPAREN
+
+ NUMBER shift and go to state 3
+ LPAREN shift and go to state 2
+
+
+state 8
+
+ expression -> LPAREN expression . RPAREN
+ expression -> expression . PLUS expression
+ expression -> expression . MINUS expression
+ expression -> expression . TIMES expression
+ expression -> expression . DIVIDE expression
+
+ RPAREN shift and go to state 13
+ PLUS shift and go to state 6
+ MINUS shift and go to state 5
+ TIMES shift and go to state 4
+ DIVIDE shift and go to state 7
+
+
+state 9
+
+ expression -> expression TIMES expression .
+ expression -> expression . PLUS expression
+ expression -> expression . MINUS expression
+ expression -> expression . TIMES expression
+ expression -> expression . DIVIDE expression
+
+ $ reduce using rule 3
+ PLUS reduce using rule 3
+ MINUS reduce using rule 3
+ TIMES reduce using rule 3
+ DIVIDE reduce using rule 3
+ RPAREN reduce using rule 3
+
+ ! PLUS [ shift and go to state 6 ]
+ ! MINUS [ shift and go to state 5 ]
+ ! TIMES [ shift and go to state 4 ]
+ ! DIVIDE [ shift and go to state 7 ]
+
+state 10
+
+ expression -> expression MINUS expression .
+ expression -> expression . PLUS expression
+ expression -> expression . MINUS expression
+ expression -> expression . TIMES expression
+ expression -> expression . DIVIDE expression
+
+ $ reduce using rule 2
+ PLUS reduce using rule 2
+ MINUS reduce using rule 2
+ RPAREN reduce using rule 2
+ TIMES shift and go to state 4
+ DIVIDE shift and go to state 7
+
+ ! TIMES [ reduce using rule 2 ]
+ ! DIVIDE [ reduce using rule 2 ]
+ ! PLUS [ shift and go to state 6 ]
+ ! MINUS [ shift and go to state 5 ]
+
+state 11
+
+ expression -> expression PLUS expression .
+ expression -> expression . PLUS expression
+ expression -> expression . MINUS expression
+ expression -> expression . TIMES expression
+ expression -> expression . DIVIDE expression
+
+ $ reduce using rule 1
+ PLUS reduce using rule 1
+ MINUS reduce using rule 1
+ RPAREN reduce using rule 1
+ TIMES shift and go to state 4
+ DIVIDE shift and go to state 7
+
+ ! TIMES [ reduce using rule 1 ]
+ ! DIVIDE [ reduce using rule 1 ]
+ ! PLUS [ shift and go to state 6 ]
+ ! MINUS [ shift and go to state 5 ]
+
+state 12
+
+ expression -> expression DIVIDE expression .
+ expression -> expression . PLUS expression
+ expression -> expression . MINUS expression
+ expression -> expression . TIMES expression
+ expression -> expression . DIVIDE expression
+
+ $ reduce using rule 4
+ PLUS reduce using rule 4
+ MINUS reduce using rule 4
+ TIMES reduce using rule 4
+ DIVIDE reduce using rule 4
+ RPAREN reduce using rule 4
+
+ ! PLUS [ shift and go to state 6 ]
+ ! MINUS [ shift and go to state 5 ]
+ ! TIMES [ shift and go to state 4 ]
+ ! DIVIDE [ shift and go to state 7 ]
+
+state 13
+
+ expression -> LPAREN expression RPAREN .
+
+ $ reduce using rule 6
+ PLUS reduce using rule 6
+ MINUS reduce using rule 6
+ TIMES reduce using rule 6
+ DIVIDE reduce using rule 6
+ RPAREN reduce using rule 6
+</pre>
+</blockquote>
+
+In the file, each state of the grammar is described. Within each state the "." indicates the current
+location of the parse within any applicable grammar rules. In addition, the actions for each valid
+input token are listed. When a shift/reduce or reduce/reduce conflict arises, rules <em>not</em> selected
+are prefixed with an !. For example:
+
+<blockquote>
+<pre>
+ ! TIMES [ reduce using rule 2 ]
+ ! DIVIDE [ reduce using rule 2 ]
+ ! PLUS [ shift and go to state 6 ]
+ ! MINUS [ shift and go to state 5 ]
+</pre>
+</blockquote>
+
+By looking at these rules (and with a little practice), you can usually track down the source
+of most parsing conflicts. It should also be stressed that not all shift-reduce conflicts are
+bad. However, the only way to be sure that they are resolved correctly is to look at <tt>parser.out</tt>.
+
+<H3><a name="ply_nn29"></a>5.8 Syntax Error Handling</H3>
+
+
+When a syntax error occurs during parsing, the error is immediately
+detected (i.e., the parser does not read any more tokens beyond the
+source of the error). Error recovery in LR parsers is a delicate
+topic that involves ancient rituals and black-magic. The recovery mechanism
+provided by <tt>yacc.py</tt> is comparable to Unix yacc so you may want
+consult a book like O'Reilly's "Lex and Yacc" for some of the finer details.
+
+<p>
+When a syntax error occurs, <tt>yacc.py</tt> performs the following steps:
+
+<ol>
+<li>On the first occurrence of an error, the user-defined <tt>p_error()</tt> function
+is called with the offending token as an argument. Afterwards, the parser enters
+an "error-recovery" mode in which it will not make future calls to <tt>p_error()</tt> until it
+has successfully shifted at least 3 tokens onto the parsing stack.
+
+<p>
+<li>If no recovery action is taken in <tt>p_error()</tt>, the offending lookahead token is replaced
+with a special <tt>error</tt> token.
+
+<p>
+<li>If the offending lookahead token is already set to <tt>error</tt>, the top item of the parsing stack is
+deleted.
+
+<p>
+<li>If the entire parsing stack is unwound, the parser enters a restart state and attempts to start
+parsing from its initial state.
+
+<p>
+<li>If a grammar rule accepts <tt>error</tt> as a token, it will be
+shifted onto the parsing stack.
+
+<p>
+<li>If the top item of the parsing stack is <tt>error</tt>, lookahead tokens will be discarded until the
+parser can successfully shift a new symbol or reduce a rule involving <tt>error</tt>.
+</ol>
+
+<H4><a name="ply_nn30"></a>5.8.1 Recovery and resynchronization with error rules</H4>
+
+
+The most well-behaved approach for handling syntax errors is to write grammar rules that include the <tt>error</tt>
+token. For example, suppose your language had a grammar rule for a print statement like this:
+
+<blockquote>
+<pre>
+def p_statement_print(p):
+ 'statement : PRINT expr SEMI'
+ ...
+</pre>
+</blockquote>
+
+To account for the possibility of a bad expression, you might write an additional grammar rule like this:
+
+<blockquote>
+<pre>
+def p_statement_print_error(p):
+ 'statement : PRINT error SEMI'
+ print "Syntax error in print statement. Bad expression"
+
+</pre>
+</blockquote>
+
+In this case, the <tt>error</tt> token will match any sequence of
+tokens that might appear up to the first semicolon that is
+encountered. Once the semicolon is reached, the rule will be
+invoked and the <tt>error</tt> token will go away.
+
+<p>
+This type of recovery is sometimes known as parser resynchronization.
+The <tt>error</tt> token acts as a wildcard for any bad input text and
+the token immediately following <tt>error</tt> acts as a
+synchronization token.
+
+<p>
+It is important to note that the <tt>error</tt> token usually does not appear as the last token
+on the right in an error rule. For example:
+
+<blockquote>
+<pre>
+def p_statement_print_error(p):
+ 'statement : PRINT error'
+ print "Syntax error in print statement. Bad expression"
+</pre>
+</blockquote>
+
+This is because the first bad token encountered will cause the rule to
+be reduced--which may make it difficult to recover if more bad tokens
+immediately follow.
+
+<H4><a name="ply_nn31"></a>5.8.2 Panic mode recovery</H4>
+
+
+An alternative error recovery scheme is to enter a panic mode recovery in which tokens are
+discarded to a point where the parser might be able to recover in some sensible manner.
+
+<p>
+Panic mode recovery is implemented entirely in the <tt>p_error()</tt> function. For example, this
+function starts discarding tokens until it reaches a closing '}'. Then, it restarts the
+parser in its initial state.
+
+<blockquote>
+<pre>
+def p_error(p):
+ print "Whoa. You are seriously hosed."
+ # Read ahead looking for a closing '}'
+ while 1:
+ tok = yacc.token() # Get the next token
+ if not tok or tok.type == 'RBRACE': break
+ yacc.restart()
+</pre>
+</blockquote>
+
+<p>
+This function simply discards the bad token and tells the parser that the error was ok.
+
+<blockquote>
+<pre>
+def p_error(p):
+ print "Syntax error at token", p.type
+ # Just discard the token and tell the parser it's okay.
+ yacc.errok()
+</pre>
+</blockquote>
+
+<P>
+Within the <tt>p_error()</tt> function, three functions are available to control the behavior
+of the parser:
+<p>
+<ul>
+<li><tt>yacc.errok()</tt>. This resets the parser state so it doesn't think it's in error-recovery
+mode. This will prevent an <tt>error</tt> token from being generated and will reset the internal
+error counters so that the next syntax error will call <tt>p_error()</tt> again.
+
+<p>
+<li><tt>yacc.token()</tt>. This returns the next token on the input stream.
+
+<p>
+<li><tt>yacc.restart()</tt>. This discards the entire parsing stack and resets the parser
+to its initial state.
+</ul>
+
+Note: these functions are only available when invoking <tt>p_error()</tt> and are not available
+at any other time.
+
+<p>
+To supply the next lookahead token to the parser, <tt>p_error()</tt> can return a token. This might be
+useful if trying to synchronize on special characters. For example:
+
+<blockquote>
+<pre>
+def p_error(p):
+ # Read ahead looking for a terminating ";"
+ while 1:
+ tok = yacc.token() # Get the next token
+ if not tok or tok.type == 'SEMI': break
+ yacc.errok()
+
+ # Return SEMI to the parser as the next lookahead token
+ return tok
+</pre>
+</blockquote>
+
+<H4><a name="ply_nn32"></a>5.8.3 General comments on error handling</H4>
+
+
+For normal types of languages, error recovery with error rules and resynchronization characters is probably the most reliable
+technique. This is because you can instrument the grammar to catch errors at selected places where it is relatively easy
+to recover and continue parsing. Panic mode recovery is really only useful in certain specialized applications where you might want
+to discard huge portions of the input text to find a valid restart point.
+
+<H3><a name="ply_nn33"></a>5.9 Line Number and Position Tracking</H3>
+
+
+<tt>yacc.py</tt> automatically tracks line numbers and positions for all of the grammar symbols and tokens it processes. To retrieve the line
+numbers, two functions are used in grammar rules:
+
+<ul>
+<li><tt>p.lineno(num)</tt>. Return the starting line number for symbol <em>num</em>
+<li><tt>p.linespan(num)</tt>. Return a tuple (startline,endline) with the starting and ending line number for symbol <em>num</em>.
+</ul>
+
+For example:
+
+<blockquote>
+<pre>
+def p_expression(p):
+ 'expression : expression PLUS expression'
+ p.lineno(1) # Line number of the left expression
+ p.lineno(2) # line number of the PLUS operator
+ p.lineno(3) # line number of the right expression
+ ...
+ start,end = p.linespan(3) # Start,end lines of the right expression
+
+</pre>
+</blockquote>
+
+Since line numbers are managed internally by the parser, there is usually no need to modify the line
+numbers. However, if you want to save the line numbers in a parse-tree node, you will need to make your own
+private copy.
+
+<p>
+To get positional information about where tokens were lexed, the following two functions are used:
+
+<ul>
+<li><tt>p.lexpos(num)</tt>. Return the starting lexing position for symbol <em>num</em>
+<li><tt>p.lexspan(num)</tt>. Return a tuple (start,end) with the starting and ending positions for symbol <em>num</em>.
+</ul>
+
+For example:
+
+<blockquote>
+<pre>
+def p_expression(p):
+ 'expression : expression PLUS expression'
+ p.lexpos(1) # Lexing position of the left expression
+ p.lexpos(2) # Lexing position of the PLUS operator
+ p.lexpos(3) # Lexing position of the right expression
+ ...
+ start,end = p.lexspan(3) # Start,end positions of the right expression
+</pre>
+</blockquote>
+
+Note: The <tt>lexspan()</tt> function only returns the range of values up the start of the last grammar symbol.
+
+<H3><a name="ply_nn34"></a>5.10 AST Construction</H3>
+
+
+<tt>yacc.py</tt> provides no special functions for constructing an abstract syntax tree. However, such
+construction is easy enough to do on your own. Simply create a data structure for abstract syntax tree nodes
+and assign nodes to <tt>p[0]</tt> in each rule.
+
+For example:
+
+<blockquote>
+<pre>
+class Expr: pass
+
+class BinOp(Expr):
+ def __init__(self,left,op,right):
+ self.type = "binop"
+ self.left = left
+ self.right = right
+ self.op = op
+
+class Number(Expr):
+ def __init__(self,value):
+ self.type = "number"
+ self.value = value
+
+def p_expression_binop(p):
+ '''expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+
+ p[0] = BinOp(p[1],p[2],p[3])
+
+def p_expression_group(p):
+ 'expression : LPAREN expression RPAREN'
+ p[0] = p[2]
+
+def p_expression_number(p):
+ 'expression : NUMBER'
+ p[0] = Number(p[1])
+</pre>
+</blockquote>
+
+To simplify tree traversal, it may make sense to pick a very generic tree structure for your parse tree nodes.
+For example:
+
+<blockquote>
+<pre>
+class Node:
+ def __init__(self,type,children=None,leaf=None):
+ self.type = type
+ if children:
+ self.children = children
+ else:
+ self.children = [ ]
+ self.leaf = leaf
+
+def p_expression_binop(p):
+ '''expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+
+ p[0] = Node("binop", [p[1],p[3]], p[2])
+</pre>
+</blockquote>
+
+<H3><a name="ply_nn35"></a>5.11 Embedded Actions</H3>
+
+
+The parsing technique used by yacc only allows actions to be executed at the end of a rule. For example,
+suppose you have a rule like this:
+
+<blockquote>
+<pre>
+def p_foo(p):
+ "foo : A B C D"
+ print "Parsed a foo", p[1],p[2],p[3],p[4]
+</pre>
+</blockquote>
+
+<p>
+In this case, the supplied action code only executes after all of the
+symbols <tt>A</tt>, <tt>B</tt>, <tt>C</tt>, and <tt>D</tt> have been
+parsed. Sometimes, however, it is useful to execute small code
+fragments during intermediate stages of parsing. For example, suppose
+you wanted to perform some action immediately after <tt>A</tt> has
+been parsed. To do this, you can write a empty rule like this:
+
+<blockquote>
+<pre>
+def p_foo(p):
+ "foo : A seen_A B C D"
+ print "Parsed a foo", p[1],p[3],p[4],p[5]
+ print "seen_A returned", p[2]
+
+def p_seen_A(p):
+ "seen_A :"
+ print "Saw an A = ", p[-1] # Access grammar symbol to left
+ p[0] = some_value # Assign value to seen_A
+
+</pre>
+</blockquote>
+
+<p>
+In this example, the empty <tt>seen_A</tt> rule executes immediately
+after <tt>A</tt> is shifted onto the parsing stack. Within this
+rule, <tt>p[-1]</tt> refers to the symbol on the stack that appears
+immediately to the left of the <tt>seen_A</tt> symbol. In this case,
+it would be the value of <tt>A</tt> in the <tt>foo</tt> rule
+immediately above. Like other rules, a value can be returned from an
+embedded action by simply assigning it to <tt>p[0]</tt>
+
+<p>
+The use of embedded actions can sometimes introduce extra shift/reduce conflicts. For example,
+this grammar has no conflicts:
+
+<blockquote>
+<pre>
+def p_foo(p):
+ """foo : abcd
+ | abcx"""
+
+def p_abcd(p):
+ "abcd : A B C D"
+
+def p_abcx(p):
+ "abcx : A B C X"
+</pre>
+</blockquote>
+
+However, if you insert an embedded action into one of the rules like this,
+
+<blockquote>
+<pre>
+def p_foo(p):
+ """foo : abcd
+ | abcx"""
+
+def p_abcd(p):
+ "abcd : A B C D"
+
+def p_abcx(p):
+ "abcx : A B seen_AB C X"
+
+def p_seen_AB(p):
+ "seen_AB :"
+</pre>
+</blockquote>
+
+an extra shift-reduce conflict will be introduced. This conflict is caused by the fact that the same symbol <tt>C</tt> appears next in
+both the <tt>abcd</tt> and <tt>abcx</tt> rules. The parser can either shift the symbol (<tt>abcd</tt> rule) or reduce the empty rule <tt>seen_AB</tt> (<tt>abcx</tt> rule).
+
+<p>
+A common use of embedded rules is to control other aspects of parsing
+such as scoping of local variables. For example, if you were parsing C code, you might
+write code like this:
+
+<blockquote>
+<pre>
+def p_statements_block(p):
+ "statements: LBRACE new_scope statements RBRACE"""
+ # Action code
+ ...
+ pop_scope() # Return to previous scope
+
+def p_new_scope(p):
+ "new_scope :"
+ # Create a new scope for local variables
+ s = new_scope()
+ push_scope(s)
+ ...
+</pre>
+</blockquote>
+
+In this case, the embedded action <tt>new_scope</tt> executes immediately after a <tt>LBRACE</tt> (<tt>{</tt>) symbol is parsed. This might
+adjust internal symbol tables and other aspects of the parser. Upon completion of the rule <tt>statements_block</tt>, code might undo the operations performed in the embedded action (e.g., <tt>pop_scope()</tt>).
+
+<H3><a name="ply_nn36"></a>5.12 Yacc implementation notes</H3>
+
+
+<ul>
+<li>The default parsing method is LALR. To use SLR instead, run yacc() as follows:
+
+<blockquote>
+<pre>
+yacc.yacc(method="SLR")
+</pre>
+</blockquote>
+Note: LALR table generation takes approximately twice as long as SLR table generation. There is no
+difference in actual parsing performance---the same code is used in both cases. LALR is preferred when working
+with more complicated grammars since it is more powerful.
+
+<p>
+
+<li>By default, <tt>yacc.py</tt> relies on <tt>lex.py</tt> for tokenizing. However, an alternative tokenizer
+can be supplied as follows:
+
+<blockquote>
+<pre>
+yacc.parse(lexer=x)
+</pre>
+</blockquote>
+in this case, <tt>x</tt> must be a Lexer object that minimally has a <tt>x.token()</tt> method for retrieving the next
+token. If an input string is given to <tt>yacc.parse()</tt>, the lexer must also have an <tt>x.input()</tt> method.
+
+<p>
+<li>By default, the yacc generates tables in debugging mode (which produces the parser.out file and other output).
+To disable this, use
+
+<blockquote>
+<pre>
+yacc.yacc(debug=0)
+</pre>
+</blockquote>
+
+<p>
+<li>To change the name of the <tt>parsetab.py</tt> file, use:
+
+<blockquote>
+<pre>
+yacc.yacc(tabmodule="foo")
+</pre>
+</blockquote>
+
+<p>
+<li>To change the directory in which the <tt>parsetab.py</tt> file (and other output files) are written, use:
+<blockquote>
+<pre>
+yacc.yacc(tabmodule="foo",outputdir="somedirectory")
+</pre>
+</blockquote>
+
+<p>
+<li>To prevent yacc from generating any kind of parser table file, use:
+<blockquote>
+<pre>
+yacc.yacc(write_tables=0)
+</pre>
+</blockquote>
+
+Note: If you disable table generation, yacc() will regenerate the parsing tables
+each time it runs (which may take awhile depending on how large your grammar is).
+
+<P>
+<li>To print copious amounts of debugging during parsing, use:
+
+<blockquote>
+<pre>
+yacc.parse(debug=1)
+</pre>
+</blockquote>
+
+<p>
+<li>To redirect the debugging output to a filename of your choosing, use:
+
+<blockquote>
+<pre>
+yacc.parse(debug=1, debugfile="debugging.out")
+</pre>
+</blockquote>
+
+<p>
+<li>The <tt>yacc.yacc()</tt> function really returns a parser object. If you want to support multiple
+parsers in the same application, do this:
+
+<blockquote>
+<pre>
+p = yacc.yacc()
+...
+p.parse()
+</pre>
+</blockquote>
+
+Note: The function <tt>yacc.parse()</tt> is bound to the last parser that was generated.
+
+<p>
+<li>Since the generation of the LALR tables is relatively expensive, previously generated tables are
+cached and reused if possible. The decision to regenerate the tables is determined by taking an MD5
+checksum of all grammar rules and precedence rules. Only in the event of a mismatch are the tables regenerated.
+
+<p>
+It should be noted that table generation is reasonably efficient, even for grammars that involve around a 100 rules
+and several hundred states. For more complex languages such as C, table generation may take 30-60 seconds on a slow
+machine. Please be patient.
+
+<p>
+<li>Since LR parsing is driven by tables, the performance of the parser is largely independent of the
+size of the grammar. The biggest bottlenecks will be the lexer and the complexity of the code in your grammar rules.
+</ul>
+
+<H2><a name="ply_nn37"></a>6. Parser and Lexer State Management</H2>
+
+
+In advanced parsing applications, you may want to have multiple
+parsers and lexers. Furthermore, the parser may want to control the
+behavior of the lexer in some way.
+
+<p>
+To do this, it is important to note that both the lexer and parser are
+actually implemented as objects. These objects are returned by the
+<tt>lex()</tt> and <tt>yacc()</tt> functions respectively. For example:
+
+<blockquote>
+<pre>
+lexer = lex.lex() # Return lexer object
+parser = yacc.yacc() # Return parser object
+</pre>
+</blockquote>
+
+To attach the lexer and parser together, make sure you use the <tt>lexer</tt> argumemnt to parse. For example:
+
+<blockquote>
+<pre>
+parser.parse(text,lexer=lexer)
+</pre>
+</blockquote>
+
+Within lexer and parser rules, these objects are also available. In the lexer,
+the "lexer" attribute of a token refers to the lexer object in use. For example:
+
+<blockquote>
+<pre>
+def t_NUMBER(t):
+ r'\d+'
+ ...
+ print t.lexer # Show lexer object
+</pre>
+</blockquote>
+
+In the parser, the "lexer" and "parser" attributes refer to the lexer
+and parser objects respectively.
+
+<blockquote>
+<pre>
+def p_expr_plus(p):
+ 'expr : expr PLUS expr'
+ ...
+ print p.parser # Show parser object
+ print p.lexer # Show lexer object
+</pre>
+</blockquote>
+
+If necessary, arbitrary attributes can be attached to the lexer or parser object.
+For example, if you wanted to have different parsing modes, you could attach a mode
+attribute to the parser object and look at it later.
+
+<H2><a name="ply_nn38"></a>7. Using Python's Optimized Mode</H2>
+
+
+Because PLY uses information from doc-strings, parsing and lexing
+information must be gathered while running the Python interpreter in
+normal mode (i.e., not with the -O or -OO options). However, if you
+specify optimized mode like this:
+
+<blockquote>
+<pre>
+lex.lex(optimize=1)
+yacc.yacc(optimize=1)
+</pre>
+</blockquote>
+
+then PLY can later be used when Python runs in optimized mode. To make this work,
+make sure you first run Python in normal mode. Once the lexing and parsing tables
+have been generated the first time, run Python in optimized mode. PLY will use
+the tables without the need for doc strings.
+
+<p>
+Beware: running PLY in optimized mode disables a lot of error
+checking. You should only do this when your project has stabilized
+and you don't need to do any debugging.
+
+<H2><a name="ply_nn39"></a>8. Where to go from here?</H2>
+
+
+The <tt>examples</tt> directory of the PLY distribution contains several simple examples. Please consult a
+compilers textbook for the theory and underlying implementation details or LR parsing.
+
+</body>
+</html>
+
+
+
+
+
+
+
diff --git a/chall/ply-2.2/example/BASIC/README b/chall/ply-2.2/example/BASIC/README
new file mode 100644
index 0000000..be24a30
--- /dev/null
+++ b/chall/ply-2.2/example/BASIC/README
@@ -0,0 +1,79 @@
+Inspired by a September 14, 2006 Salon article "Why Johnny Can't Code" by
+David Brin (http://www.salon.com/tech/feature/2006/09/14/basic/index.html),
+I thought that a fully working BASIC interpreter might be an interesting,
+if not questionable, PLY example. Uh, okay, so maybe it's just a bad idea,
+but in any case, here it is.
+
+In this example, you'll find a rough implementation of 1964 Dartmouth BASIC
+as described in the manual at:
+
+ http://www.bitsavers.org/pdf/dartmouth/BASIC_Oct64.pdf
+
+See also:
+
+ http://en.wikipedia.org/wiki/Dartmouth_BASIC
+
+This dialect is downright primitive---there are no string variables
+and no facilities for interactive input. Moreover, subroutines and functions
+are brain-dead even more than they usually are for BASIC. Of course,
+the GOTO statement is provided.
+
+Nevertheless, there are a few interesting aspects of this example:
+
+ - It illustrates a fully working interpreter including lexing, parsing,
+ and interpretation of instructions.
+
+ - The parser shows how to catch and report various kinds of parsing
+ errors in a more graceful way.
+
+ - The example both parses files (supplied on command line) and
+ interactive input entered line by line.
+
+ - It shows how you might represent parsed information. In this case,
+ each BASIC statement is encoded into a Python tuple containing the
+ statement type and parameters. These tuples are then stored in
+ a dictionary indexed by program line numbers.
+
+ - Even though it's just BASIC, the parser contains more than 80
+ rules and 150 parsing states. Thus, it's a little more meaty than
+ the calculator example.
+
+To use the example, run it as follows:
+
+ % python basic.py hello.bas
+ HELLO WORLD
+ %
+
+or use it interactively:
+
+ % python basic.py
+ [BASIC] 10 PRINT "HELLO WORLD"
+ [BASIC] 20 END
+ [BASIC] RUN
+ HELLO WORLD
+ [BASIC]
+
+The following files are defined:
+
+ basic.py - High level script that controls everything
+ basiclex.py - BASIC tokenizer
+ basparse.py - BASIC parser
+ basinterp.py - BASIC interpreter that runs parsed programs.
+
+In addition, a number of sample BASIC programs (.bas suffix) are
+provided. These were taken out of the Dartmouth manual.
+
+Disclaimer: I haven't spent a ton of time testing this and it's likely that
+I've skimped here and there on a few finer details (e.g., strictly enforcing
+variable naming rules). However, the interpreter seems to be able to run
+the examples in the BASIC manual.
+
+Have fun!
+
+-Dave
+
+
+
+
+
+
diff --git a/chall/ply-2.2/example/BASIC/basic.py b/chall/ply-2.2/example/BASIC/basic.py
new file mode 100644
index 0000000..6a2f489
--- /dev/null
+++ b/chall/ply-2.2/example/BASIC/basic.py
@@ -0,0 +1,68 @@
+# An implementation of Dartmouth BASIC (1964)
+#
+
+import sys
+sys.path.insert(0,"../..")
+
+import basiclex
+import basparse
+import basinterp
+
+# If a filename has been specified, we try to run it.
+# If a runtime error occurs, we bail out and enter
+# interactive mode below
+if len(sys.argv) == 2:
+ data = open(sys.argv[1]).read()
+ prog = basparse.parse(data)
+ if not prog: raise SystemExit
+ b = basinterp.BasicInterpreter(prog)
+ try:
+ b.run()
+ raise SystemExit
+ except RuntimeError:
+ pass
+
+else:
+ b = basinterp.BasicInterpreter({})
+
+# Interactive mode. This incrementally adds/deletes statements
+# from the program stored in the BasicInterpreter object. In
+# addition, special commands 'NEW','LIST',and 'RUN' are added.
+# Specifying a line number with no code deletes that line from
+# the program.
+
+while 1:
+ try:
+ line = raw_input("[BASIC] ")
+ except EOFError:
+ raise SystemExit
+ if not line: continue
+ line += "\n"
+ prog = basparse.parse(line)
+ if not prog: continue
+
+ keys = prog.keys()
+ if keys[0] > 0:
+ b.add_statements(prog)
+ else:
+ stat = prog[keys[0]]
+ if stat[0] == 'RUN':
+ try:
+ b.run()
+ except RuntimeError:
+ pass
+ elif stat[0] == 'LIST':
+ b.list()
+ elif stat[0] == 'BLANK':
+ b.del_line(stat[1])
+ elif stat[0] == 'NEW':
+ b.new()
+
+
+
+
+
+
+
+
+
diff --git a/chall/ply-2.2/example/BASIC/basiclex.py b/chall/ply-2.2/example/BASIC/basiclex.py
new file mode 100644
index 0000000..463ef9b
--- /dev/null
+++ b/chall/ply-2.2/example/BASIC/basiclex.py
@@ -0,0 +1,74 @@
+# An implementation of Dartmouth BASIC (1964)
+
+from ply import *
+
+keywords = (
+ 'LET','READ','DATA','PRINT','GOTO','IF','THEN','FOR','NEXT','TO','STEP',
+ 'END','STOP','DEF','GOSUB','DIM','REM','RETURN','RUN','LIST','NEW',
+)
+
+tokens = keywords + (
+ 'EQUALS','PLUS','MINUS','TIMES','DIVIDE','POWER',
+ 'LPAREN','RPAREN','LT','LE','GT','GE','NE',
+ 'COMMA','SEMI', 'INTEGER','FLOAT', 'STRING',
+ 'ID','NEWLINE'
+)
+
+t_ignore = ' \t'
+
+def t_REM(t):
+ r'REM .*'
+ return t
+
+def t_ID(t):
+ r'[A-Z][A-Z0-9]*'
+ if t.value in keywords:
+ t.type = t.value
+ return t
+
+t_EQUALS = r'='
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_TIMES = r'\*'
+t_POWER = r'\^'
+t_DIVIDE = r'/'
+t_LPAREN = r'\('
+t_RPAREN = r'\)'
+t_LT = r'<'
+t_LE = r'<='
+t_GT = r'>'
+t_GE = r'>='
+t_NE = r'<>'
+t_COMMA = r'\,'
+t_SEMI = r';'
+t_INTEGER = r'\d+'
+t_FLOAT = r'((\d*\.\d+)(E[\+-]?\d+)?|([1-9]\d*E[\+-]?\d+))'
+t_STRING = r'\".*?\"'
+
+def t_NEWLINE(t):
+ r'\n'
+ t.lexer.lineno += 1
+ return t
+
+def t_error(t):
+ print "Illegal character", t.value[0]
+ t.lexer.skip(1)
+
+lex.lex()
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/chall/ply-2.2/example/BASIC/basinterp.py b/chall/ply-2.2/example/BASIC/basinterp.py
new file mode 100644
index 0000000..0252aa3
--- /dev/null
+++ b/chall/ply-2.2/example/BASIC/basinterp.py
@@ -0,0 +1,440 @@
+# This file provides the runtime support for running a basic program
+# Assumes the program has been parsed using basparse.py
+
+import sys
+import math
+import random
+
+class BasicInterpreter:
+
+ # Initialize the interpreter. prog is a dictionary
+ # containing (line,statement) mappings
+ def __init__(self,prog):
+ self.prog = prog
+
+ self.functions = { # Built-in function table
+ 'SIN' : lambda z: math.sin(self.eval(z)),
+ 'COS' : lambda z: math.cos(self.eval(z)),
+ 'TAN' : lambda z: math.tan(self.eval(z)),
+ 'ATN' : lambda z: math.atan(self.eval(z)),
+ 'EXP' : lambda z: math.exp(self.eval(z)),
+ 'ABS' : lambda z: abs(self.eval(z)),
+ 'LOG' : lambda z: math.log(self.eval(z)),
+ 'SQR' : lambda z: math.sqrt(self.eval(z)),
+ 'INT' : lambda z: int(self.eval(z)),
+ 'RND' : lambda z: random.random()
+ }
+
+ # Collect all data statements
+ def collect_data(self):
+ self.data = []
+ for lineno in self.stat:
+ if self.prog[lineno][0] == 'DATA':
+ self.data = self.data + self.prog[lineno][1]
+ self.dc = 0 # Initialize the data counter
+
+ # Check for end statements
+ def check_end(self):
+ has_end = 0
+ for lineno in self.stat:
+ if self.prog[lineno][0] == 'END' and not has_end:
+ has_end = lineno
+ if not has_end:
+ print "NO END INSTRUCTION"
+ self.error = 1
+ if has_end != lineno:
+ print "END IS NOT LAST"
+ self.error = 1
+
+ # Check loops
+ def check_loops(self):
+ for pc in range(len(self.stat)):
+ lineno = self.stat[pc]
+ if self.prog[lineno][0] == 'FOR':
+ forinst = self.prog[lineno]
+ loopvar = forinst[1]
+ for i in range(pc+1,len(self.stat)):
+ if self.prog[self.stat[i]][0] == 'NEXT':
+ nextvar = self.prog[self.stat[i]][1]
+ if nextvar != loopvar: continue
+ self.loopend[pc] = i
+ break
+ else:
+ print "FOR WITHOUT NEXT AT LINE" % self.stat[pc]
+ self.error = 1
+
+ # Evaluate an expression
+ def eval(self,expr):
+ etype = expr[0]
+ if etype == 'NUM': return expr[1]
+ elif etype == 'GROUP': return self.eval(expr[1])
+ elif etype == 'UNARY':
+ if expr[1] == '-': return -self.eval(expr[2])
+ elif etype == 'BINOP':
+ if expr[1] == '+': return self.eval(expr[2])+self.eval(expr[3])
+ elif expr[1] == '-': return self.eval(expr[2])-self.eval(expr[3])
+ elif expr[1] == '*': return self.eval(expr[2])*self.eval(expr[3])
+ elif expr[1] == '/': return float(self.eval(expr[2]))/self.eval(expr[3])
+ elif expr[1] == '^': return abs(self.eval(expr[2]))**self.eval(expr[3])
+ elif etype == 'VAR':
+ var,dim1,dim2 = expr[1]
+ if not dim1 and not dim2:
+ if self.vars.has_key(var):
+ return self.vars[var]
+ else:
+ print "UNDEFINED VARIABLE", var, "AT LINE", self.stat[self.pc]
+ raise RuntimeError
+ # May be a list lookup or a function evaluation
+ if dim1 and not dim2:
+ if self.functions.has_key(var):
+ # A function
+ return self.functions[var](dim1)
+ else:
+ # A list evaluation
+ if self.lists.has_key(var):
+ dim1val = self.eval(dim1)
+ if dim1val < 1 or dim1val > len(self.lists[var]):
+ print "LIST INDEX OUT OF BOUNDS AT LINE", self.stat[self.pc]
+ raise RuntimeError
+ return self.lists[var][dim1val-1]
+ if dim1 and dim2:
+ if self.tables.has_key(var):
+ dim1val = self.eval(dim1)
+ dim2val = self.eval(dim2)
+ if dim1val < 1 or dim1val > len(self.tables[var]) or dim2val < 1 or dim2val > len(self.tables[var][0]):
+ print "TABLE INDEX OUT OUT BOUNDS AT LINE", self.stat[self.pc]
+ raise RuntimeError
+ return self.tables[var][dim1val-1][dim2val-1]
+ print "UNDEFINED VARIABLE", var, "AT LINE", self.stat[self.pc]
+ raise RuntimeError
+
+ # Evaluate a relational expression
+ def releval(self,expr):
+ etype = expr[1]
+ lhs = self.eval(expr[2])
+ rhs = self.eval(expr[3])
+ if etype == '<':
+ if lhs < rhs: return 1
+ else: return 0
+
+ elif etype == '<=':
+ if lhs <= rhs: return 1
+ else: return 0
+
+ elif etype == '>':
+ if lhs > rhs: return 1
+ else: return 0
+
+ elif etype == '>=':
+ if lhs >= rhs: return 1
+ else: return 0
+
+ elif etype == '=':
+ if lhs == rhs: return 1
+ else: return 0
+
+ elif etype == '<>':
+ if lhs != rhs: return 1
+ else: return 0
+
+ # Assignment
+ def assign(self,target,value):
+ var, dim1, dim2 = target
+ if not dim1 and not dim2:
+ self.vars[var] = self.eval(value)
+ elif dim1 and not dim2:
+ # List assignment
+ dim1val = self.eval(dim1)
+ if not self.lists.has_key(var):
+ self.lists[var] = [0]*10
+
+ if dim1val > len(self.lists[var]):
+ print "DIMENSION TOO LARGE AT LINE", self.stat[self.pc]
+ raise RuntimeError
+ self.lists[var][dim1val-1] = self.eval(value)
+ elif dim1 and dim2:
+ dim1val = self.eval(dim1)
+ dim2val = self.eval(dim2)
+ if not self.tables.has_key(var):
+ temp = [0]*10
+ v = []
+ for i in range(10): v.append(temp[:])
+ self.tables[var] = v
+ # Variable already exists
+ if dim1val > len(self.tables[var]) or dim2val > len(self.tables[var][0]):
+ print "DIMENSION TOO LARGE AT LINE", self.stat[self.pc]
+ raise RuntimeError
+ self.tables[var][dim1val-1][dim2val-1] = self.eval(value)
+
+ # Change the current line number
+ def goto(self,linenum):
+ if not self.prog.has_key(linenum):
+ print "UNDEFINED LINE NUMBER %d AT LINE %d" % (linenum, self.stat[self.pc])
+ raise RuntimeError
+ self.pc = self.stat.index(linenum)
+
+ # Run it
+ def run(self):
+ self.vars = { } # All variables
+ self.lists = { } # List variables
+ self.tables = { } # Tables
+ self.loops = [ ] # Currently active loops
+ self.loopend= { } # Mapping saying where loops end
+ self.gosub = None # Gosub return point (if any)
+ self.error = 0 # Indicates program error
+
+ self.stat = self.prog.keys() # Ordered list of all line numbers
+ self.stat.sort()
+ self.pc = 0 # Current program counter
+
+ # Processing prior to running
+
+ self.collect_data() # Collect all of the data statements
+ self.check_end()
+ self.check_loops()
+
+ if self.error: raise RuntimeError
+
+ while 1:
+ line = self.stat[self.pc]
+ instr = self.prog[line]
+
+ op = instr[0]
+
+ # END and STOP statements
+ if op == 'END' or op == 'STOP':
+ break # We're done
+
+ # GOTO statement
+ elif op == 'GOTO':
+ newline = instr[1]
+ self.goto(newline)
+ continue
+
+ # PRINT statement
+ elif op == 'PRINT':
+ plist = instr[1]
+ out = ""
+ for label,val in plist:
+ if out:
+ out += ' '*(15 - (len(out) % 15))
+ out += label
+ if val:
+ if label: out += " "
+ eval = self.eval(val)
+ out += str(eval)
+ sys.stdout.write(out)
+ end = instr[2]
+ if not (end == ',' or end == ';'):
+ sys.stdout.write("\n")
+ if end == ',': sys.stdout.write(" "*(15-(len(out) % 15)))
+ if end == ';': sys.stdout.write(" "*(3-(len(out) % 3)))
+
+ # LET statement
+ elif op == 'LET':
+ target = instr[1]
+ value = instr[2]
+ self.assign(target,value)
+
+ # READ statement
+ elif op == 'READ':
+ for target in instr[1]:
+ if self.dc < len(self.data):
+ value = ('NUM',self.data[self.dc])
+ self.assign(target,value)
+ self.dc += 1
+ else:
+ # No more data. Program ends
+ return
+ elif op == 'IF':
+ relop = instr[1]
+ newline = instr[2]
+ if (self.releval(relop)):
+ self.goto(newline)
+ continue
+
+ elif op == 'FOR':
+ loopvar = instr[1]
+ initval = instr[2]
+ finval = instr[3]
+ stepval = instr[4]
+
+ # Check to see if this is a new loop
+ if not self.loops or self.loops[-1][0] != self.pc:
+ # Looks like a new loop. Make the initial assignment
+ newvalue = initval
+ self.assign((loopvar,None,None),initval)
+ if not stepval: stepval = ('NUM',1)
+ stepval = self.eval(stepval) # Evaluate step here
+ self.loops.append((self.pc,stepval))
+ else:
+ # It's a repeat of the previous loop
+ # Update the value of the loop variable according to the step
+ stepval = ('NUM',self.loops[-1][1])
+ newvalue = ('BINOP','+',('VAR',(loopvar,None,None)),stepval)
+
+ if self.loops[-1][1] < 0: relop = '>='
+ else: relop = '<='
+ if not self.releval(('RELOP',relop,newvalue,finval)):
+ # Loop is done. Jump to the NEXT
+ self.pc = self.loopend[self.pc]
+ self.loops.pop()
+ else:
+ self.assign((loopvar,None,None),newvalue)
+
+ elif op == 'NEXT':
+ if not self.loops:
+ print "NEXT WITHOUT FOR AT LINE",line
+ return
+
+ nextvar = instr[1]
+ self.pc = self.loops[-1][0]
+ loopinst = self.prog[self.stat[self.pc]]
+ forvar = loopinst[1]
+ if nextvar != forvar:
+ print "NEXT DOESN'T MATCH FOR AT LINE", line
+ return
+ continue
+ elif op == 'GOSUB':
+ newline = instr[1]
+ if self.gosub:
+ print "ALREADY IN A SUBROUTINE AT LINE", line
+ return
+ self.gosub = self.stat[self.pc]
+ self.goto(newline)
+ continue
+
+ elif op == 'RETURN':
+ if not self.gosub:
+ print "RETURN WITHOUT A GOSUB AT LINE",line
+ return
+ self.goto(self.gosub)
+ self.gosub = None
+
+ elif op == 'FUNC':
+ fname = instr[1]
+ pname = instr[2]
+ expr = instr[3]
+ def eval_func(pvalue,name=pname,self=self,expr=expr):
+ self.assign((pname,None,None),pvalue)
+ return self.eval(expr)
+ self.functions[fname] = eval_func
+
+ elif op == 'DIM':
+ for vname,x,y in instr[1]:
+ if y == 0:
+ # Single dimension variable
+ self.lists[vname] = [0]*x
+ else:
+ # Double dimension variable
+ temp = [0]*y
+ v = []
+ for i in range(x):
+ v.append(temp[:])
+ self.tables[vname] = v
+
+ self.pc += 1
+
+ # Utility functions for program listing
+ def expr_str(self,expr):
+ etype = expr[0]
+ if etype == 'NUM': return str(expr[1])
+ elif etype == 'GROUP': return "(%s)" % self.expr_str(expr[1])
+ elif etype == 'UNARY':
+ if expr[1] == '-': return "-"+str(expr[2])
+ elif etype == 'BINOP':
+ return "%s %s %s" % (self.expr_str(expr[2]),expr[1],self.expr_str(expr[3]))
+ elif etype == 'VAR':
+ return self.var_str(expr[1])
+
+ def relexpr_str(self,expr):
+ return "%s %s %s" % (self.expr_str(expr[2]),expr[1],self.expr_str(expr[3]))
+
+ def var_str(self,var):
+ varname,dim1,dim2 = var
+ if not dim1 and not dim2: return varname
+ if dim1 and not dim2: return "%s(%s)" % (varname, self.expr_str(dim1))
+ return "%s(%s,%s)" % (varname, self.expr_str(dim1),self.expr_str(dim2))
+
+ # Create a program listing
+ def list(self):
+ stat = self.prog.keys() # Ordered list of all line numbers
+ stat.sort()
+ for line in stat:
+ instr = self.prog[line]
+ op = instr[0]
+ if op in ['END','STOP','RETURN']:
+ print line, op
+ continue
+ elif op == 'REM':
+ print line, instr[1]
+ elif op == 'PRINT':
+ print line, op,
+ first = 1
+ for p in instr[1]:
+ if not first: print ",",
+ if p[0] and p[1]: print '"%s"%s' % (p[0],self.expr_str(p[1])),
+ elif p[1]: print self.expr_str(p[1]),
+ else: print '"%s"' % (p[0],),
+ first = 0
+ if instr[2]: print instr[2]
+ else: print
+ elif op == 'LET':
+ print line,"LET",self.var_str(instr[1]),"=",self.expr_str(instr[2])
+ elif op == 'READ':
+ print line,"READ",
+ first = 1
+ for r in instr[1]:
+ if not first: print ",",
+ print self.var_str(r),
+ first = 0
+ print ""
+ elif op == 'IF':
+ print line,"IF %s THEN %d" % (self.relexpr_str(instr[1]),instr[2])
+ elif op == 'GOTO' or op == 'GOSUB':
+ print line, op, instr[1]
+ elif op == 'FOR':
+ print line,"FOR %s = %s TO %s" % (instr[1],self.expr_str(instr[2]),self.expr_str(instr[3])),
+ if instr[4]: print "STEP %s" % (self.expr_str(instr[4])),
+ print
+ elif op == 'NEXT':
+ print line,"NEXT", instr[1]
+ elif op == 'FUNC':
+ print line,"DEF %s(%s) = %s" % (instr[1],instr[2],self.expr_str(instr[3]))
+ elif op == 'DIM':
+ print line,"DIM",
+ first = 1
+ for vname,x,y in instr[1]:
+ if not first: print ",",
+ first = 0
+ if y == 0:
+ print "%s(%d)" % (vname,x),
+ else:
+ print "%s(%d,%d)" % (vname,x,y),
+
+ print
+ elif op == 'DATA':
+ print line,"DATA",
+ first = 1
+ for v in instr[1]:
+ if not first: print ",",
+ first = 0
+ print v,
+ print
+
+ # Erase the current program
+ def new(self):
+ self.prog = {}
+
+ # Insert statements
+ def add_statements(self,prog):
+ for line,stat in prog.items():
+ self.prog[line] = stat
+
+ # Delete a statement
+ def del_line(self,lineno):
+ try:
+ del self.prog[lineno]
+ except KeyError:
+ pass
+
diff --git a/chall/ply-2.2/example/BASIC/basparse.py b/chall/ply-2.2/example/BASIC/basparse.py
new file mode 100644
index 0000000..79210ad
--- /dev/null
+++ b/chall/ply-2.2/example/BASIC/basparse.py
@@ -0,0 +1,424 @@
+# An implementation of Dartmouth BASIC (1964)
+#
+
+from ply import *
+import basiclex
+
+tokens = basiclex.tokens
+
+precedence = (
+ ('left', 'PLUS','MINUS'),
+ ('left', 'TIMES','DIVIDE'),
+ ('left', 'POWER'),
+ ('right','UMINUS')
+)
+
+#### A BASIC program is a series of statements. We represent the program as a
+#### dictionary of tuples indexed by line number.
+
+def p_program(p):
+ '''program : program statement
+ | statement'''
+
+ if len(p) == 2 and p[1]:
+ p[0] = { }
+ line,stat = p[1]
+ p[0][line] = stat
+ elif len(p) ==3:
+ p[0] = p[1]
+ if not p[0]: p[0] = { }
+ if p[2]:
+ line,stat = p[2]
+ p[0][line] = stat
+
+#### This catch-all rule is used for any catastrophic errors. In this case,
+#### we simply return nothing
+
+def p_program_error(p):
+ '''program : error'''
+ p[0] = None
+ p.parser.error = 1
+
+#### Format of all BASIC statements.
+
+def p_statement(p):
+ '''statement : INTEGER command NEWLINE'''
+ if isinstance(p[2],str):
+ print p[2],"AT LINE", p[1]
+ p[0] = None
+ p.parser.error = 1
+ else:
+ lineno = int(p[1])
+ p[0] = (lineno,p[2])
+
+#### Interactive statements.
+
+def p_statement_interactive(p):
+ '''statement : RUN NEWLINE
+ | LIST NEWLINE
+ | NEW NEWLINE'''
+ p[0] = (0, (p[1],0))
+
+#### Blank line number
+def p_statement_blank(p):
+ '''statement : INTEGER NEWLINE'''
+ p[0] = (0,('BLANK',int(p[1])))
+
+#### Error handling for malformed statements
+
+def p_statement_bad(p):
+ '''statement : INTEGER error NEWLINE'''
+ print "MALFORMED STATEMENT AT LINE", p[1]
+ p[0] = None
+ p.parser.error = 1
+
+#### Blank line
+
+def p_statement_newline(p):
+ '''statement : NEWLINE'''
+ p[0] = None
+
+#### LET statement
+
+def p_command_let(p):
+ '''command : LET variable EQUALS expr'''
+ p[0] = ('LET',p[2],p[4])
+
+def p_command_let_bad(p):
+ '''command : LET variable EQUALS error'''
+ p[0] = "BAD EXPRESSION IN LET"
+
+#### READ statement
+
+def p_command_read(p):
+ '''command : READ varlist'''
+ p[0] = ('READ',p[2])
+
+def p_command_read_bad(p):
+ '''command : READ error'''
+ p[0] = "MALFORMED VARIABLE LIST IN READ"
+
+#### DATA statement
+
+def p_command_data(p):
+ '''command : DATA numlist'''
+ p[0] = ('DATA',p[2])
+
+def p_command_data_bad(p):
+ '''command : DATA error'''
+ p[0] = "MALFORMED NUMBER LIST IN DATA"
+
+#### PRINT statement
+
+def p_command_print(p):
+ '''command : PRINT plist optend'''
+ p[0] = ('PRINT',p[2],p[3])
+
+def p_command_print_bad(p):
+ '''command : PRINT error'''
+ p[0] = "MALFORMED PRINT STATEMENT"
+
+#### Optional ending on PRINT. Either a comma (,) or semicolon (;)
+
+def p_optend(p):
+ '''optend : COMMA
+ | SEMI
+ |'''
+ if len(p) == 2:
+ p[0] = p[1]
+ else:
+ p[0] = None
+
+#### PRINT statement with no arguments
+
+def p_command_print_empty(p):
+ '''command : PRINT'''
+ p[0] = ('PRINT',[],None)
+
+#### GOTO statement
+
+def p_command_goto(p):
+ '''command : GOTO INTEGER'''
+ p[0] = ('GOTO',int(p[2]))
+
+def p_command_goto_bad(p):
+ '''command : GOTO error'''
+ p[0] = "INVALID LINE NUMBER IN GOTO"
+
+#### IF-THEN statement
+
+def p_command_if(p):
+ '''command : IF relexpr THEN INTEGER'''
+ p[0] = ('IF',p[2],int(p[4]))
+
+def p_command_if_bad(p):
+ '''command : IF error THEN INTEGER'''
+ p[0] = "BAD RELATIONAL EXPRESSION"
+
+def p_command_if_bad2(p):
+ '''command : IF relexpr THEN error'''
+ p[0] = "INVALID LINE NUMBER IN THEN"
+
+#### FOR statement
+
+def p_command_for(p):
+ '''command : FOR ID EQUALS expr TO expr optstep'''
+ p[0] = ('FOR',p[2],p[4],p[6],p[7])
+
+def p_command_for_bad_initial(p):
+ '''command : FOR ID EQUALS error TO expr optstep'''
+ p[0] = "BAD INITIAL VALUE IN FOR STATEMENT"
+
+def p_command_for_bad_final(p):
+ '''command : FOR ID EQUALS expr TO error optstep'''
+ p[0] = "BAD FINAL VALUE IN FOR STATEMENT"
+
+def p_command_for_bad_step(p):
+ '''command : FOR ID EQUALS expr TO expr STEP error'''
+ p[0] = "MALFORMED STEP IN FOR STATEMENT"
+
+#### Optional STEP qualifier on FOR statement
+
+def p_optstep(p):
+ '''optstep : STEP expr
+ | empty'''
+ if len(p) == 3:
+ p[0] = p[2]
+ else:
+ p[0] = None
+
+#### NEXT statement
+
+def p_command_next(p):
+ '''command : NEXT ID'''
+
+ p[0] = ('NEXT',p[2])
+
+def p_command_next_bad(p):
+ '''command : NEXT error'''
+ p[0] = "MALFORMED NEXT"
+
+#### END statement
+
+def p_command_end(p):
+ '''command : END'''
+ p[0] = ('END',)
+
+#### REM statement
+
+def p_command_rem(p):
+ '''command : REM'''
+ p[0] = ('REM',p[1])
+
+#### STOP statement
+
+def p_command_stop(p):
+ '''command : STOP'''
+ p[0] = ('STOP',)
+
+#### DEF statement
+
+def p_command_def(p):
+ '''command : DEF ID LPAREN ID RPAREN EQUALS expr'''
+ p[0] = ('FUNC',p[2],p[4],p[7])
+
+def p_command_def_bad_rhs(p):
+ '''command : DEF ID LPAREN ID RPAREN EQUALS error'''
+ p[0] = "BAD EXPRESSION IN DEF STATEMENT"
+
+def p_command_def_bad_arg(p):
+ '''command : DEF ID LPAREN error RPAREN EQUALS expr'''
+ p[0] = "BAD ARGUMENT IN DEF STATEMENT"
+
+#### GOSUB statement
+
+def p_command_gosub(p):
+ '''command : GOSUB INTEGER'''
+ p[0] = ('GOSUB',int(p[2]))
+
+def p_command_gosub_bad(p):
+ '''command : GOSUB error'''
+ p[0] = "INVALID LINE NUMBER IN GOSUB"
+
+#### RETURN statement
+
+def p_command_return(p):
+ '''command : RETURN'''
+ p[0] = ('RETURN',)
+
+#### DIM statement
+
+def p_command_dim(p):
+ '''command : DIM dimlist'''
+ p[0] = ('DIM',p[2])
+
+def p_command_dim_bad(p):
+ '''command : DIM error'''
+ p[0] = "MALFORMED VARIABLE LIST IN DIM"
+
+#### List of variables supplied to DIM statement
+
+def p_dimlist(p):
+ '''dimlist : dimlist COMMA dimitem
+ | dimitem'''
+ if len(p) == 4:
+ p[0] = p[1]
+ p[0].append(p[3])
+ else:
+ p[0] = [p[1]]
+
+#### DIM items
+
+def p_dimitem_single(p):
+ '''dimitem : ID LPAREN INTEGER RPAREN'''
+ p[0] = (p[1],eval(p[3]),0)
+
+def p_dimitem_double(p):
+ '''dimitem : ID LPAREN INTEGER COMMA INTEGER RPAREN'''
+ p[0] = (p[1],eval(p[3]),eval(p[5]))
+
+#### Arithmetic expressions
+
+def p_expr_binary(p):
+ '''expr : expr PLUS expr
+ | expr MINUS expr
+ | expr TIMES expr
+ | expr DIVIDE expr
+ | expr POWER expr'''
+
+ p[0] = ('BINOP',p[2],p[1],p[3])
+
+def p_expr_number(p):
+ '''expr : INTEGER
+ | FLOAT'''
+ p[0] = ('NUM',eval(p[1]))
+
+def p_expr_variable(p):
+ '''expr : variable'''
+ p[0] = ('VAR',p[1])
+
+def p_expr_group(p):
+ '''expr : LPAREN expr RPAREN'''
+ p[0] = ('GROUP',p[2])
+
+def p_expr_unary(p):
+ '''expr : MINUS expr %prec UMINUS'''
+ p[0] = ('UNARY','-',p[2])
+
+#### Relational expressions
+
+def p_relexpr(p):
+ '''relexpr : expr LT expr
+ | expr LE expr
+ | expr GT expr
+ | expr GE expr
+ | expr EQUALS expr
+ | expr NE expr'''
+ p[0] = ('RELOP',p[2],p[1],p[3])
+
+#### Variables
+
+def p_variable(p):
+ '''variable : ID
+ | ID LPAREN expr RPAREN
+ | ID LPAREN expr COMMA expr RPAREN'''
+ if len(p) == 2:
+ p[0] = (p[1],None,None)
+ elif len(p) == 5:
+ p[0] = (p[1],p[3],None)
+ else:
+ p[0] = (p[1],p[3],p[5])
+
+#### Builds a list of variable targets as a Python list
+
+def p_varlist(p):
+ '''varlist : varlist COMMA variable
+ | variable'''
+ if len(p) > 2:
+ p[0] = p[1]
+ p[0].append(p[3])
+ else:
+ p[0] = [p[1]]
+
+
+#### Builds a list of numbers as a Python list
+
+def p_numlist(p):
+ '''numlist : numlist COMMA number
+ | number'''
+
+ if len(p) > 2:
+ p[0] = p[1]
+ p[0].append(p[3])
+ else:
+ p[0] = [p[1]]
+
+#### A number. May be an integer or a float
+
+def p_number(p):
+ '''number : INTEGER
+ | FLOAT'''
+ p[0] = eval(p[1])
+
+#### A signed number.
+
+def p_number_signed(p):
+ '''number : MINUS INTEGER
+ | MINUS FLOAT'''
+ p[0] = eval("-"+p[2])
+
+#### List of targets for a print statement
+#### Returns a list of tuples (label,expr)
+
+def p_plist(p):
+ '''plist : plist COMMA pitem
+ | pitem'''
+ if len(p) > 3:
+ p[0] = p[1]
+ p[0].append(p[3])
+ else:
+ p[0] = [p[1]]
+
+def p_item_string(p):
+ '''pitem : STRING'''
+ p[0] = (p[1][1:-1],None)
+
+def p_item_string_expr(p):
+ '''pitem : STRING expr'''
+ p[0] = (p[1][1:-1],p[2])
+
+def p_item_expr(p):
+ '''pitem : expr'''
+ p[0] = ("",p[1])
+
+#### Empty
+
+def p_empty(p):
+ '''empty : '''
+
+#### Catastrophic error handler
+def p_error(p):
+ if not p:
+ print "SYNTAX ERROR AT EOF"
+
+bparser = yacc.yacc()
+
+def parse(data):
+ bparser.error = 0
+ p = bparser.parse(data)
+ if bparser.error: return None
+ return p
+
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/chall/ply-2.2/example/BASIC/dim.bas b/chall/ply-2.2/example/BASIC/dim.bas
new file mode 100644
index 0000000..87bd95b
--- /dev/null
+++ b/chall/ply-2.2/example/BASIC/dim.bas
@@ -0,0 +1,14 @@
+5 DIM A(50,15)
+10 FOR I = 1 TO 50
+20 FOR J = 1 TO 15
+30 LET A(I,J) = I + J
+35 REM PRINT I,J, A(I,J)
+40 NEXT J
+50 NEXT I
+100 FOR I = 1 TO 50
+110 FOR J = 1 TO 15
+120 PRINT A(I,J),
+130 NEXT J
+140 PRINT
+150 NEXT I
+999 END
diff --git a/chall/ply-2.2/example/BASIC/func.bas b/chall/ply-2.2/example/BASIC/func.bas
new file mode 100644
index 0000000..447ee16
--- /dev/null
+++ b/chall/ply-2.2/example/BASIC/func.bas
@@ -0,0 +1,5 @@
+10 DEF FDX(X) = 2*X
+20 FOR I = 0 TO 100
+30 PRINT FDX(I)
+40 NEXT I
+50 END
diff --git a/chall/ply-2.2/example/BASIC/gcd.bas b/chall/ply-2.2/example/BASIC/gcd.bas
new file mode 100644
index 0000000..d0b7746
--- /dev/null
+++ b/chall/ply-2.2/example/BASIC/gcd.bas
@@ -0,0 +1,22 @@
+10 PRINT "A","B","C","GCD"
+20 READ A,B,C
+30 LET X = A
+40 LET Y = B
+50 GOSUB 200
+60 LET X = G
+70 LET Y = C
+80 GOSUB 200
+90 PRINT A, B, C, G
+100 GOTO 20
+110 DATA 60, 90, 120
+120 DATA 38456, 64872, 98765
+130 DATA 32, 384, 72
+200 LET Q = INT(X/Y)
+210 LET R = X - Q*Y
+220 IF R = 0 THEN 300
+230 LET X = Y
+240 LET Y = R
+250 GOTO 200
+300 LET G = Y
+310 RETURN
+999 END
diff --git a/chall/ply-2.2/example/BASIC/gosub.bas b/chall/ply-2.2/example/BASIC/gosub.bas
new file mode 100644
index 0000000..99737b1
--- /dev/null
+++ b/chall/ply-2.2/example/BASIC/gosub.bas
@@ -0,0 +1,13 @@
+100 LET X = 3
+110 GOSUB 400
+120 PRINT U, V, W
+200 LET X = 5
+210 GOSUB 400
+220 LET Z = U + 2*V + 3*W
+230 PRINT Z
+240 GOTO 999
+400 LET U = X*X
+410 LET V = X*X*X
+420 LET W = X*X*X*X + X*X*X + X*X + X
+430 RETURN
+999 END
diff --git a/chall/ply-2.2/example/BASIC/hello.bas b/chall/ply-2.2/example/BASIC/hello.bas
new file mode 100644
index 0000000..cc6f0b0
--- /dev/null
+++ b/chall/ply-2.2/example/BASIC/hello.bas
@@ -0,0 +1,4 @@
+5 REM HELLO WORLD PROGAM
+10 PRINT "HELLO WORLD"
+99 END
+
diff --git a/chall/ply-2.2/example/BASIC/linear.bas b/chall/ply-2.2/example/BASIC/linear.bas
new file mode 100644
index 0000000..56c0822
--- /dev/null
+++ b/chall/ply-2.2/example/BASIC/linear.bas
@@ -0,0 +1,17 @@
+1 REM ::: SOLVE A SYSTEM OF LINEAR EQUATIONS
+2 REM ::: A1*X1 + A2*X2 = B1
+3 REM ::: A3*X1 + A4*X2 = B2
+4 REM --------------------------------------
+10 READ A1, A2, A3, A4
+15 LET D = A1 * A4 - A3 * A2
+20 IF D = 0 THEN 65
+30 READ B1, B2
+37 LET X1 = (B1*A4 - B2*A2) / D
+42 LET X2 = (A1*B2 - A3*B1) / D
+55 PRINT X1, X2
+60 GOTO 30
+65 PRINT "NO UNIQUE SOLUTION"
+70 DATA 1, 2, 4
+80 DATA 2, -7, 5
+85 DATA 1, 3, 4, -7
+90 END
diff --git a/chall/ply-2.2/example/BASIC/maxsin.bas b/chall/ply-2.2/example/BASIC/maxsin.bas
new file mode 100644
index 0000000..b969015
--- /dev/null
+++ b/chall/ply-2.2/example/BASIC/maxsin.bas
@@ -0,0 +1,12 @@
+5 PRINT "X VALUE", "SINE", "RESOLUTION"
+10 READ D
+20 LET M = -1
+30 FOR X = 0 TO 3 STEP D
+40 IF SIN(X) <= M THEN 80
+50 LET X0 = X
+60 LET M = SIN(X)
+80 NEXT X
+85 PRINT X0, M, D
+90 GOTO 10
+100 DATA .1, .01, .001
+110 END
diff --git a/chall/ply-2.2/example/BASIC/powers.bas b/chall/ply-2.2/example/BASIC/powers.bas
new file mode 100644
index 0000000..a454dc3
--- /dev/null
+++ b/chall/ply-2.2/example/BASIC/powers.bas
@@ -0,0 +1,13 @@
+5 PRINT "THIS PROGRAM COMPUTES AND PRINTS THE NTH POWERS"
+6 PRINT "OF THE NUMBERS LESS THAN OR EQUAL TO N FOR VARIOUS"
+7 PRINT "N FROM 1 THROUGH 7"
+8 PRINT
+10 FOR N = 1 TO 7
+15 PRINT "N = "N
+20 FOR I = 1 TO N
+30 PRINT I^N,
+40 NEXT I
+50 PRINT
+60 PRINT
+70 NEXT N
+80 END
diff --git a/chall/ply-2.2/example/BASIC/rand.bas b/chall/ply-2.2/example/BASIC/rand.bas
new file mode 100644
index 0000000..4ff7a14
--- /dev/null
+++ b/chall/ply-2.2/example/BASIC/rand.bas
@@ -0,0 +1,4 @@
+10 FOR I = 1 TO 20
+20 PRINT INT(10*RND(0))
+30 NEXT I
+40 END
diff --git a/chall/ply-2.2/example/BASIC/sales.bas b/chall/ply-2.2/example/BASIC/sales.bas
new file mode 100644
index 0000000..a39aefb
--- /dev/null
+++ b/chall/ply-2.2/example/BASIC/sales.bas
@@ -0,0 +1,20 @@
+10 FOR I = 1 TO 3
+20 READ P(I)
+30 NEXT I
+40 FOR I = 1 TO 3
+50 FOR J = 1 TO 5
+60 READ S(I,J)
+70 NEXT J
+80 NEXT I
+90 FOR J = 1 TO 5
+100 LET S = 0
+110 FOR I = 1 TO 3
+120 LET S = S + P(I) * S(I,J)
+130 NEXT I
+140 PRINT "TOTAL SALES FOR SALESMAN"J, "$"S
+150 NEXT J
+200 DATA 1.25, 4.30, 2.50
+210 DATA 40, 20, 37, 29, 42
+220 DATA 10, 16, 3, 21, 8
+230 DATA 35, 47, 29, 16, 33
+300 END
diff --git a/chall/ply-2.2/example/BASIC/sears.bas b/chall/ply-2.2/example/BASIC/sears.bas
new file mode 100644
index 0000000..5ced397
--- /dev/null
+++ b/chall/ply-2.2/example/BASIC/sears.bas
@@ -0,0 +1,18 @@
+1 REM :: THIS PROGRAM COMPUTES HOW MANY TIMES YOU HAVE TO FOLD
+2 REM :: A PIECE OF PAPER SO THAT IT IS TALLER THAN THE
+3 REM :: SEARS TOWER.
+4 REM :: S = HEIGHT OF TOWER (METERS)
+5 REM :: T = THICKNESS OF PAPER (MILLIMETERS)
+10 LET S = 442
+20 LET T = 0.1
+30 REM CONVERT T TO METERS
+40 LET T = T * .001
+50 LET F = 1
+60 LET H = T
+100 IF H > S THEN 200
+120 LET H = 2 * H
+125 LET F = F + 1
+130 GOTO 100
+200 PRINT "NUMBER OF FOLDS ="F
+220 PRINT "FINAL HEIGHT ="H
+999 END
diff --git a/chall/ply-2.2/example/BASIC/sqrt1.bas b/chall/ply-2.2/example/BASIC/sqrt1.bas
new file mode 100644
index 0000000..6673a91
--- /dev/null
+++ b/chall/ply-2.2/example/BASIC/sqrt1.bas
@@ -0,0 +1,5 @@
+10 LET X = 0
+20 LET X = X + 1
+30 PRINT X, SQR(X)
+40 IF X < 100 THEN 20
+50 END
diff --git a/chall/ply-2.2/example/BASIC/sqrt2.bas b/chall/ply-2.2/example/BASIC/sqrt2.bas
new file mode 100644
index 0000000..862d85e
--- /dev/null
+++ b/chall/ply-2.2/example/BASIC/sqrt2.bas
@@ -0,0 +1,4 @@
+10 FOR X = 1 TO 100
+20 PRINT X, SQR(X)
+30 NEXT X
+40 END
diff --git a/chall/ply-2.2/example/GardenSnake/GardenSnake.py b/chall/ply-2.2/example/GardenSnake/GardenSnake.py
new file mode 100644
index 0000000..2a7f45e
--- /dev/null
+++ b/chall/ply-2.2/example/GardenSnake/GardenSnake.py
@@ -0,0 +1,709 @@
+# GardenSnake - a parser generator demonstration program
+#
+# This implements a modified version of a subset of Python:
+# - only 'def', 'return' and 'if' statements
+# - 'if' only has 'then' clause (no elif nor else)
+# - single-quoted strings only, content in raw format
+# - numbers are decimal.Decimal instances (not integers or floats)
+# - no print statment; use the built-in 'print' function
+# - only < > == + - / * implemented (and unary + -)
+# - assignment and tuple assignment work
+# - no generators of any sort
+# - no ... well, no quite a lot
+
+# Why? I'm thinking about a new indentation-based configuration
+# language for a project and wanted to figure out how to do it. Once
+# I got that working I needed a way to test it out. My original AST
+# was dumb so I decided to target Python's AST and compile it into
+# Python code. Plus, it's pretty cool that it only took a day or so
+# from sitting down with Ply to having working code.
+
+# This uses David Beazley's Ply from http://www.dabeaz.com/ply/
+
+# This work is hereby released into the Public Domain. To view a copy of
+# the public domain dedication, visit
+# http://creativecommons.org/licenses/publicdomain/ or send a letter to
+# Creative Commons, 543 Howard Street, 5th Floor, San Francisco,
+# California, 94105, USA.
+#
+# Portions of this work are derived from Python's Grammar definition
+# and may be covered under the Python copyright and license
+#
+# Andrew Dalke / Dalke Scientific Software, LLC
+# 30 August 2006 / Cape Town, South Africa
+
+# Changelog:
+# 30 August - added link to CC license; removed the "swapcase" encoding
+
+# Modifications for inclusion in PLY distribution
+import sys
+sys.path.insert(0,"../..")
+from ply import *
+
+##### Lexer ######
+#import lex
+import decimal
+
+tokens = (
+ 'DEF',
+ 'IF',
+ 'NAME',
+ 'NUMBER', # Python decimals
+ 'STRING', # single quoted strings only; syntax of raw strings
+ 'LPAR',
+ 'RPAR',
+ 'COLON',
+ 'EQ',
+ 'ASSIGN',
+ 'LT',
+ 'GT',
+ 'PLUS',
+ 'MINUS',
+ 'MULT',
+ 'DIV',
+ 'RETURN',
+ 'WS',
+ 'NEWLINE',
+ 'COMMA',
+ 'SEMICOLON',
+ 'INDENT',
+ 'DEDENT',
+ 'ENDMARKER',
+ )
+
+#t_NUMBER = r'\d+'
+# taken from decmial.py but without the leading sign
+def t_NUMBER(t):
+ r"""(\d+(\.\d*)?|\.\d+)([eE][-+]? \d+)?"""
+ t.value = decimal.Decimal(t.value)
+ return t
+
+def t_STRING(t):
+ r"'([^\\']+|\\'|\\\\)*'" # I think this is right ...
+ t.value=t.value[1:-1].decode("string-escape") # .swapcase() # for fun
+ return t
+
+t_COLON = r':'
+t_EQ = r'=='
+t_ASSIGN = r'='
+t_LT = r'<'
+t_GT = r'>'
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_MULT = r'\*'
+t_DIV = r'/'
+t_COMMA = r','
+t_SEMICOLON = r';'
+
+# Ply nicely documented how to do this.
+
+RESERVED = {
+ "def": "DEF",
+ "if": "IF",
+ "return": "RETURN",
+ }
+
+def t_NAME(t):
+ r'[a-zA-Z_][a-zA-Z0-9_]*'
+ t.type = RESERVED.get(t.value, "NAME")
+ return t
+
+# Putting this before t_WS let it consume lines with only comments in
+# them so the latter code never sees the WS part. Not consuming the
+# newline. Needed for "if 1: #comment"
+def t_comment(t):
+ r"[ ]*\043[^\n]*" # \043 is '#'
+ pass
+
+
+# Whitespace
+def t_WS(t):
+ r' [ ]+ '
+ if t.lexer.at_line_start and t.lexer.paren_count == 0:
+ return t
+
+# Don't generate newline tokens when inside of parenthesis, eg
+# a = (1,
+# 2, 3)
+def t_newline(t):
+ r'\n+'
+ t.lexer.lineno += len(t.value)
+ t.type = "NEWLINE"
+ if t.lexer.paren_count == 0:
+ return t
+
+def t_LPAR(t):
+ r'\('
+ t.lexer.paren_count += 1
+ return t
+
+def t_RPAR(t):
+ r'\)'
+ # check for underflow? should be the job of the parser
+ t.lexer.paren_count -= 1
+ return t
+
+
+def t_error(t):
+ raise SyntaxError("Unknown symbol %r" % (t.value[0],))
+ print "Skipping", repr(t.value[0])
+ t.lexer.skip(1)
+
+## I implemented INDENT / DEDENT generation as a post-processing filter
+
+# The original lex token stream contains WS and NEWLINE characters.
+# WS will only occur before any other tokens on a line.
+
+# I have three filters. One tags tokens by adding two attributes.
+# "must_indent" is True if the token must be indented from the
+# previous code. The other is "at_line_start" which is True for WS
+# and the first non-WS/non-NEWLINE on a line. It flags the check so
+# see if the new line has changed indication level.
+
+# Python's syntax has three INDENT states
+# 0) no colon hence no need to indent
+# 1) "if 1: go()" - simple statements have a COLON but no need for an indent
+# 2) "if 1:\n go()" - complex statements have a COLON NEWLINE and must indent
+NO_INDENT = 0
+MAY_INDENT = 1
+MUST_INDENT = 2
+
+# only care about whitespace at the start of a line
+def track_tokens_filter(lexer, tokens):
+ lexer.at_line_start = at_line_start = True
+ indent = NO_INDENT
+ saw_colon = False
+ for token in tokens:
+ token.at_line_start = at_line_start
+
+ if token.type == "COLON":
+ at_line_start = False
+ indent = MAY_INDENT
+ token.must_indent = False
+
+ elif token.type == "NEWLINE":
+ at_line_start = True
+ if indent == MAY_INDENT:
+ indent = MUST_INDENT
+ token.must_indent = False
+
+ elif token.type == "WS":
+ assert token.at_line_start == True
+ at_line_start = True
+ token.must_indent = False
+
+ else:
+ # A real token; only indent after COLON NEWLINE
+ if indent == MUST_INDENT:
+ token.must_indent = True
+ else:
+ token.must_indent = False
+ at_line_start = False
+ indent = NO_INDENT
+
+ yield token
+ lexer.at_line_start = at_line_start
+
+def _new_token(type, lineno):
+ tok = lex.LexToken()
+ tok.type = type
+ tok.value = None
+ tok.lineno = lineno
+ return tok
+
+# Synthesize a DEDENT tag
+def DEDENT(lineno):
+ return _new_token("DEDENT", lineno)
+
+# Synthesize an INDENT tag
+def INDENT(lineno):
+ return _new_token("INDENT", lineno)
+
+
+# Track the indentation level and emit the right INDENT / DEDENT events.
+def indentation_filter(tokens):
+ # A stack of indentation levels; will never pop item 0
+ levels = [0]
+ token = None
+ depth = 0
+ prev_was_ws = False
+ for token in tokens:
+## if 1:
+## print "Process", token,
+## if token.at_line_start:
+## print "at_line_start",
+## if token.must_indent:
+## print "must_indent",
+## print
+
+ # WS only occurs at the start of the line
+ # There may be WS followed by NEWLINE so
+ # only track the depth here. Don't indent/dedent
+ # until there's something real.
+ if token.type == "WS":
+ assert depth == 0
+ depth = len(token.value)
+ prev_was_ws = True
+ # WS tokens are never passed to the parser
+ continue
+
+ if token.type == "NEWLINE":
+ depth = 0
+ if prev_was_ws or token.at_line_start:
+ # ignore blank lines
+ continue
+ # pass the other cases on through
+ yield token
+ continue
+
+ # then it must be a real token (not WS, not NEWLINE)
+ # which can affect the indentation level
+
+ prev_was_ws = False
+ if token.must_indent:
+ # The current depth must be larger than the previous level
+ if not (depth > levels[-1]):
+ raise IndentationError("expected an indented block")
+
+ levels.append(depth)
+ yield INDENT(token.lineno)
+
+ elif token.at_line_start:
+ # Must be on the same level or one of the previous levels
+ if depth == levels[-1]:
+ # At the same level
+ pass
+ elif depth > levels[-1]:
+ raise IndentationError("indentation increase but not in new block")
+ else:
+ # Back up; but only if it matches a previous level
+ try:
+ i = levels.index(depth)
+ except ValueError:
+ raise IndentationError("inconsistent indentation")
+ for _ in range(i+1, len(levels)):
+ yield DEDENT(token.lineno)
+ levels.pop()
+
+ yield token
+
+ ### Finished processing ###
+
+ # Must dedent any remaining levels
+ if len(levels) > 1:
+ assert token is not None
+ for _ in range(1, len(levels)):
+ yield DEDENT(token.lineno)
+
+
+# The top-level filter adds an ENDMARKER, if requested.
+# Python's grammar uses it.
+def filter(lexer, add_endmarker = True):
+ token = None
+ tokens = iter(lexer.token, None)
+ tokens = track_tokens_filter(lexer, tokens)
+ for token in indentation_filter(tokens):
+ yield token
+
+ if add_endmarker:
+ lineno = 1
+ if token is not None:
+ lineno = token.lineno
+ yield _new_token("ENDMARKER", lineno)
+
+# Combine Ply and my filters into a new lexer
+
+class IndentLexer(object):
+ def __init__(self, debug=0, optimize=0, lextab='lextab', reflags=0):
+ self.lexer = lex.lex(debug=debug, optimize=optimize, lextab=lextab, reflags=reflags)
+ self.token_stream = None
+ def input(self, s, add_endmarker=True):
+ self.lexer.paren_count = 0
+ self.lexer.input(s)
+ self.token_stream = filter(self.lexer, add_endmarker)
+ def token(self):
+ try:
+ return self.token_stream.next()
+ except StopIteration:
+ return None
+
+########## Parser (tokens -> AST) ######
+
+# also part of Ply
+#import yacc
+
+# I use the Python AST
+from compiler import ast
+
+# Helper function
+def Assign(left, right):
+ names = []
+ if isinstance(left, ast.Name):
+ # Single assignment on left
+ return ast.Assign([ast.AssName(left.name, 'OP_ASSIGN')], right)
+ elif isinstance(left, ast.Tuple):
+ # List of things - make sure they are Name nodes
+ names = []
+ for child in left.getChildren():
+ if not isinstance(child, ast.Name):
+ raise SyntaxError("that assignment not supported")
+ names.append(child.name)
+ ass_list = [ast.AssName(name, 'OP_ASSIGN') for name in names]
+ return ast.Assign([ast.AssTuple(ass_list)], right)
+ else:
+ raise SyntaxError("Can't do that yet")
+
+
+# The grammar comments come from Python's Grammar/Grammar file
+
+## NB: compound_stmt in single_input is followed by extra NEWLINE!
+# file_input: (NEWLINE | stmt)* ENDMARKER
+def p_file_input_end(p):
+ """file_input_end : file_input ENDMARKER"""
+ p[0] = ast.Stmt(p[1])
+def p_file_input(p):
+ """file_input : file_input NEWLINE
+ | file_input stmt
+ | NEWLINE
+ | stmt"""
+ if isinstance(p[len(p)-1], basestring):
+ if len(p) == 3:
+ p[0] = p[1]
+ else:
+ p[0] = [] # p == 2 --> only a blank line
+ else:
+ if len(p) == 3:
+ p[0] = p[1] + p[2]
+ else:
+ p[0] = p[1]
+
+
+# funcdef: [decorators] 'def' NAME parameters ':' suite
+# ignoring decorators
+def p_funcdef(p):
+ "funcdef : DEF NAME parameters COLON suite"
+ p[0] = ast.Function(None, p[2], tuple(p[3]), (), 0, None, p[5])
+
+# parameters: '(' [varargslist] ')'
+def p_parameters(p):
+ """parameters : LPAR RPAR
+ | LPAR varargslist RPAR"""
+ if len(p) == 3:
+ p[0] = []
+ else:
+ p[0] = p[2]
+
+
+# varargslist: (fpdef ['=' test] ',')* ('*' NAME [',' '**' NAME] | '**' NAME) |
+# highly simplified
+def p_varargslist(p):
+ """varargslist : varargslist COMMA NAME
+ | NAME"""
+ if len(p) == 4:
+ p[0] = p[1] + p[3]
+ else:
+ p[0] = [p[1]]
+
+# stmt: simple_stmt | compound_stmt
+def p_stmt_simple(p):
+ """stmt : simple_stmt"""
+ # simple_stmt is a list
+ p[0] = p[1]
+
+def p_stmt_compound(p):
+ """stmt : compound_stmt"""
+ p[0] = [p[1]]
+
+# simple_stmt: small_stmt (';' small_stmt)* [';'] NEWLINE
+def p_simple_stmt(p):
+ """simple_stmt : small_stmts NEWLINE
+ | small_stmts SEMICOLON NEWLINE"""
+ p[0] = p[1]
+
+def p_small_stmts(p):
+ """small_stmts : small_stmts SEMICOLON small_stmt
+ | small_stmt"""
+ if len(p) == 4:
+ p[0] = p[1] + [p[3]]
+ else:
+ p[0] = [p[1]]
+
+# small_stmt: expr_stmt | print_stmt | del_stmt | pass_stmt | flow_stmt |
+# import_stmt | global_stmt | exec_stmt | assert_stmt
+def p_small_stmt(p):
+ """small_stmt : flow_stmt
+ | expr_stmt"""
+ p[0] = p[1]
+
+# expr_stmt: testlist (augassign (yield_expr|testlist) |
+# ('=' (yield_expr|testlist))*)
+# augassign: ('+=' | '-=' | '*=' | '/=' | '%=' | '&=' | '|=' | '^=' |
+# '<<=' | '>>=' | '**=' | '//=')
+def p_expr_stmt(p):
+ """expr_stmt : testlist ASSIGN testlist
+ | testlist """
+ if len(p) == 2:
+ # a list of expressions
+ p[0] = ast.Discard(p[1])
+ else:
+ p[0] = Assign(p[1], p[3])
+
+def p_flow_stmt(p):
+ "flow_stmt : return_stmt"
+ p[0] = p[1]
+
+# return_stmt: 'return' [testlist]
+def p_return_stmt(p):
+ "return_stmt : RETURN testlist"
+ p[0] = ast.Return(p[2])
+
+
+def p_compound_stmt(p):
+ """compound_stmt : if_stmt
+ | funcdef"""
+ p[0] = p[1]
+
+def p_if_stmt(p):
+ 'if_stmt : IF test COLON suite'
+ p[0] = ast.If([(p[2], p[4])], None)
+
+def p_suite(p):
+ """suite : simple_stmt
+ | NEWLINE INDENT stmts DEDENT"""
+ if len(p) == 2:
+ p[0] = ast.Stmt(p[1])
+ else:
+ p[0] = ast.Stmt(p[3])
+
+
+def p_stmts(p):
+ """stmts : stmts stmt
+ | stmt"""
+ if len(p) == 3:
+ p[0] = p[1] + p[2]
+ else:
+ p[0] = p[1]
+
+## No using Python's approach because Ply supports precedence
+
+# comparison: expr (comp_op expr)*
+# arith_expr: term (('+'|'-') term)*
+# term: factor (('*'|'/'|'%'|'//') factor)*
+# factor: ('+'|'-'|'~') factor | power
+# comp_op: '<'|'>'|'=='|'>='|'<='|'<>'|'!='|'in'|'not' 'in'|'is'|'is' 'not'
+
+def make_lt_compare((left, right)):
+ return ast.Compare(left, [('<', right),])
+def make_gt_compare((left, right)):
+ return ast.Compare(left, [('>', right),])
+def make_eq_compare((left, right)):
+ return ast.Compare(left, [('==', right),])
+
+
+binary_ops = {
+ "+": ast.Add,
+ "-": ast.Sub,
+ "*": ast.Mul,
+ "/": ast.Div,
+ "<": make_lt_compare,
+ ">": make_gt_compare,
+ "==": make_eq_compare,
+}
+unary_ops = {
+ "+": ast.UnaryAdd,
+ "-": ast.UnarySub,
+ }
+precedence = (
+ ("left", "EQ", "GT", "LT"),
+ ("left", "PLUS", "MINUS"),
+ ("left", "MULT", "DIV"),
+ )
+
+def p_comparison(p):
+ """comparison : comparison PLUS comparison
+ | comparison MINUS comparison
+ | comparison MULT comparison
+ | comparison DIV comparison
+ | comparison LT comparison
+ | comparison EQ comparison
+ | comparison GT comparison
+ | PLUS comparison
+ | MINUS comparison
+ | power"""
+ if len(p) == 4:
+ p[0] = binary_ops[p[2]]((p[1], p[3]))
+ elif len(p) == 3:
+ p[0] = unary_ops[p[1]](p[2])
+ else:
+ p[0] = p[1]
+
+# power: atom trailer* ['**' factor]
+# trailers enables function calls. I only allow one level of calls
+# so this is 'trailer'
+def p_power(p):
+ """power : atom
+ | atom trailer"""
+ if len(p) == 2:
+ p[0] = p[1]
+ else:
+ if p[2][0] == "CALL":
+ p[0] = ast.CallFunc(p[1], p[2][1], None, None)
+ else:
+ raise AssertionError("not implemented")
+
+def p_atom_name(p):
+ """atom : NAME"""
+ p[0] = ast.Name(p[1])
+
+def p_atom_number(p):
+ """atom : NUMBER
+ | STRING"""
+ p[0] = ast.Const(p[1])
+
+def p_atom_tuple(p):
+ """atom : LPAR testlist RPAR"""
+ p[0] = p[2]
+
+# trailer: '(' [arglist] ')' | '[' subscriptlist ']' | '.' NAME
+def p_trailer(p):
+ "trailer : LPAR arglist RPAR"
+ p[0] = ("CALL", p[2])
+
+# testlist: test (',' test)* [',']
+# Contains shift/reduce error
+def p_testlist(p):
+ """testlist : testlist_multi COMMA
+ | testlist_multi """
+ if len(p) == 2:
+ p[0] = p[1]
+ else:
+ # May need to promote singleton to tuple
+ if isinstance(p[1], list):
+ p[0] = p[1]
+ else:
+ p[0] = [p[1]]
+ # Convert into a tuple?
+ if isinstance(p[0], list):
+ p[0] = ast.Tuple(p[0])
+
+def p_testlist_multi(p):
+ """testlist_multi : testlist_multi COMMA test
+ | test"""
+ if len(p) == 2:
+ # singleton
+ p[0] = p[1]
+ else:
+ if isinstance(p[1], list):
+ p[0] = p[1] + [p[3]]
+ else:
+ # singleton -> tuple
+ p[0] = [p[1], p[3]]
+
+
+# test: or_test ['if' or_test 'else' test] | lambdef
+# as I don't support 'and', 'or', and 'not' this works down to 'comparison'
+def p_test(p):
+ "test : comparison"
+ p[0] = p[1]
+
+
+
+# arglist: (argument ',')* (argument [',']| '*' test [',' '**' test] | '**' test)
+# XXX INCOMPLETE: this doesn't allow the trailing comma
+def p_arglist(p):
+ """arglist : arglist COMMA argument
+ | argument"""
+ if len(p) == 4:
+ p[0] = p[1] + [p[3]]
+ else:
+ p[0] = [p[1]]
+
+# argument: test [gen_for] | test '=' test # Really [keyword '='] test
+def p_argument(p):
+ "argument : test"
+ p[0] = p[1]
+
+def p_error(p):
+ #print "Error!", repr(p)
+ raise SyntaxError(p)
+
+
+class GardenSnakeParser(object):
+ def __init__(self, lexer = None):
+ if lexer is None:
+ lexer = IndentLexer()
+ self.lexer = lexer
+ self.parser = yacc.yacc(start="file_input_end")
+
+ def parse(self, code):
+ self.lexer.input(code)
+ result = self.parser.parse(lexer = self.lexer)
+ return ast.Module(None, result)
+
+
+###### Code generation ######
+
+from compiler import misc, syntax, pycodegen
+
+class GardenSnakeCompiler(object):
+ def __init__(self):
+ self.parser = GardenSnakeParser()
+ def compile(self, code, filename="<string>"):
+ tree = self.parser.parse(code)
+ #print tree
+ misc.set_filename(filename, tree)
+ syntax.check(tree)
+ gen = pycodegen.ModuleCodeGenerator(tree)
+ code = gen.getCode()
+ return code
+
+####### Test code #######
+
+compile = GardenSnakeCompiler().compile
+
+code = r"""
+
+print('LET\'S TRY THIS \\OUT')
+
+#Comment here
+def x(a):
+ print('called with',a)
+ if a == 1:
+ return 2
+ if a*2 > 10: return 999 / 4
+ # Another comment here
+
+ return a+2*3
+
+ints = (1, 2,
+ 3, 4,
+5)
+print('mutiline-expression', ints)
+
+t = 4+1/3*2+6*(9-5+1)
+print('predence test; should be 34+2/3:', t, t==(34+2/3))
+
+print('numbers', 1,2,3,4,5)
+if 1:
+ 8
+ a=9
+ print(x(a))
+
+print(x(1))
+print(x(2))
+print(x(8),'3')
+print('this is decimal', 1/5)
+print('BIG DECIMAL', 1.234567891234567e12345)
+
+"""
+
+# Set up the GardenSnake run-time environment
+def print_(*args):
+ print "-->", " ".join(map(str,args))
+
+globals()["print"] = print_
+
+compiled_code = compile(code)
+
+exec compiled_code in globals()
+print "Done"
diff --git a/chall/ply-2.2/example/GardenSnake/README b/chall/ply-2.2/example/GardenSnake/README
new file mode 100644
index 0000000..4d8be2d
--- /dev/null
+++ b/chall/ply-2.2/example/GardenSnake/README
@@ -0,0 +1,5 @@
+This example is Andrew Dalke's GardenSnake language. It shows how to process an
+indentation-like language like Python. Further details can be found here:
+
+http://dalkescientific.com/writings/diary/archive/2006/08/30/gardensnake_language.html
+
diff --git a/chall/ply-2.2/example/README b/chall/ply-2.2/example/README
new file mode 100644
index 0000000..63519b5
--- /dev/null
+++ b/chall/ply-2.2/example/README
@@ -0,0 +1,10 @@
+Simple examples:
+ calc - Simple calculator
+ classcalc - Simple calculate defined as a class
+
+Complex examples
+ ansic - ANSI C grammar from K&R
+ BASIC - A small BASIC interpreter
+ GardenSnake - A simple python-like language
+ yply - Converts Unix yacc files to PLY programs.
+
diff --git a/chall/ply-2.2/example/ansic/README b/chall/ply-2.2/example/ansic/README
new file mode 100644
index 0000000..e049d3b
--- /dev/null
+++ b/chall/ply-2.2/example/ansic/README
@@ -0,0 +1,2 @@
+This example is incomplete. Was going to specify an ANSI C parser.
+This is part of it.
diff --git a/chall/ply-2.2/example/ansic/clex.py b/chall/ply-2.2/example/ansic/clex.py
new file mode 100644
index 0000000..6b9d7e7
--- /dev/null
+++ b/chall/ply-2.2/example/ansic/clex.py
@@ -0,0 +1,164 @@
+# ----------------------------------------------------------------------
+# clex.py
+#
+# A lexer for ANSI C.
+# ----------------------------------------------------------------------
+
+import sys
+sys.path.insert(0,"../..")
+
+import ply.lex as lex
+
+# Reserved words
+reserved = (
+ 'AUTO', 'BREAK', 'CASE', 'CHAR', 'CONST', 'CONTINUE', 'DEFAULT', 'DO', 'DOUBLE',
+ 'ELSE', 'ENUM', 'EXTERN', 'FLOAT', 'FOR', 'GOTO', 'IF', 'INT', 'LONG', 'REGISTER',
+ 'RETURN', 'SHORT', 'SIGNED', 'SIZEOF', 'STATIC', 'STRUCT', 'SWITCH', 'TYPEDEF',
+ 'UNION', 'UNSIGNED', 'VOID', 'VOLATILE', 'WHILE',
+ )
+
+tokens = reserved + (
+ # Literals (identifier, integer constant, float constant, string constant, char const)
+ 'ID', 'TYPEID', 'ICONST', 'FCONST', 'SCONST', 'CCONST',
+
+ # Operators (+,-,*,/,%,|,&,~,^,<<,>>, ||, &&, !, <, <=, >, >=, ==, !=)
+ 'PLUS', 'MINUS', 'TIMES', 'DIVIDE', 'MOD',
+ 'OR', 'AND', 'NOT', 'XOR', 'LSHIFT', 'RSHIFT',
+ 'LOR', 'LAND', 'LNOT',
+ 'LT', 'LE', 'GT', 'GE', 'EQ', 'NE',
+
+ # Assignment (=, *=, /=, %=, +=, -=, <<=, >>=, &=, ^=, |=)
+ 'EQUALS', 'TIMESEQUAL', 'DIVEQUAL', 'MODEQUAL', 'PLUSEQUAL', 'MINUSEQUAL',
+ 'LSHIFTEQUAL','RSHIFTEQUAL', 'ANDEQUAL', 'XOREQUAL', 'OREQUAL',
+
+ # Increment/decrement (++,--)
+ 'PLUSPLUS', 'MINUSMINUS',
+
+ # Structure dereference (->)
+ 'ARROW',
+
+ # Conditional operator (?)
+ 'CONDOP',
+
+ # Delimeters ( ) [ ] { } , . ; :
+ 'LPAREN', 'RPAREN',
+ 'LBRACKET', 'RBRACKET',
+ 'LBRACE', 'RBRACE',
+ 'COMMA', 'PERIOD', 'SEMI', 'COLON',
+
+ # Ellipsis (...)
+ 'ELLIPSIS',
+ )
+
+# Completely ignored characters
+t_ignore = ' \t\x0c'
+
+# Newlines
+def t_NEWLINE(t):
+ r'\n+'
+ t.lexer.lineno += t.value.count("\n")
+
+# Operators
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_TIMES = r'\*'
+t_DIVIDE = r'/'
+t_MOD = r'%'
+t_OR = r'\|'
+t_AND = r'&'
+t_NOT = r'~'
+t_XOR = r'\^'
+t_LSHIFT = r'<<'
+t_RSHIFT = r'>>'
+t_LOR = r'\|\|'
+t_LAND = r'&&'
+t_LNOT = r'!'
+t_LT = r'<'
+t_GT = r'>'
+t_LE = r'<='
+t_GE = r'>='
+t_EQ = r'=='
+t_NE = r'!='
+
+# Assignment operators
+
+t_EQUALS = r'='
+t_TIMESEQUAL = r'\*='
+t_DIVEQUAL = r'/='
+t_MODEQUAL = r'%='
+t_PLUSEQUAL = r'\+='
+t_MINUSEQUAL = r'-='
+t_LSHIFTEQUAL = r'<<='
+t_RSHIFTEQUAL = r'>>='
+t_ANDEQUAL = r'&='
+t_OREQUAL = r'\|='
+t_XOREQUAL = r'^='
+
+# Increment/decrement
+t_PLUSPLUS = r'\+\+'
+t_MINUSMINUS = r'--'
+
+# ->
+t_ARROW = r'->'
+
+# ?
+t_CONDOP = r'\?'
+
+# Delimeters
+t_LPAREN = r'\('
+t_RPAREN = r'\)'
+t_LBRACKET = r'\['
+t_RBRACKET = r'\]'
+t_LBRACE = r'\{'
+t_RBRACE = r'\}'
+t_COMMA = r','
+t_PERIOD = r'\.'
+t_SEMI = r';'
+t_COLON = r':'
+t_ELLIPSIS = r'\.\.\.'
+
+# Identifiers and reserved words
+
+reserved_map = { }
+for r in reserved:
+ reserved_map[r.lower()] = r
+
+def t_ID(t):
+ r'[A-Za-z_][\w_]*'
+ t.type = reserved_map.get(t.value,"ID")
+ return t
+
+# Integer literal
+t_ICONST = r'\d+([uU]|[lL]|[uU][lL]|[lL][uU])?'
+
+# Floating literal
+t_FCONST = r'((\d+)(\.\d+)(e(\+|-)?(\d+))? | (\d+)e(\+|-)?(\d+))([lL]|[fF])?'
+
+# String literal
+t_SCONST = r'\"([^\\\n]|(\\.))*?\"'
+
+# Character constant 'c' or L'c'
+t_CCONST = r'(L)?\'([^\\\n]|(\\.))*?\''
+
+# Comments
+def t_comment(t):
+ r' /\*(.|\n)*?\*/'
+ t.lineno += t.value.count('\n')
+
+# Preprocessor directive (ignored)
+def t_preprocessor(t):
+ r'\#(.)*?\n'
+ t.lineno += 1
+
+def t_error(t):
+ print "Illegal character %s" % repr(t.value[0])
+ t.lexer.skip(1)
+
+lexer = lex.lex(optimize=1)
+if __name__ == "__main__":
+ lex.runmain(lexer)
+
+
+
+
+
diff --git a/chall/ply-2.2/example/ansic/cparse.py b/chall/ply-2.2/example/ansic/cparse.py
new file mode 100644
index 0000000..b6a0c42
--- /dev/null
+++ b/chall/ply-2.2/example/ansic/cparse.py
@@ -0,0 +1,863 @@
+# -----------------------------------------------------------------------------
+# cparse.py
+#
+# Simple parser for ANSI C. Based on the grammar in K&R, 2nd Ed.
+# -----------------------------------------------------------------------------
+
+import sys
+import clex
+import ply.yacc as yacc
+
+# Get the token map
+tokens = clex.tokens
+
+# translation-unit:
+
+def p_translation_unit_1(t):
+ 'translation_unit : external_declaration'
+ pass
+
+def p_translation_unit_2(t):
+ 'translation_unit : translation_unit external_declaration'
+ pass
+
+# external-declaration:
+
+def p_external_declaration_1(t):
+ 'external_declaration : function_definition'
+ pass
+
+def p_external_declaration_2(t):
+ 'external_declaration : declaration'
+ pass
+
+# function-definition:
+
+def p_function_definition_1(t):
+ 'function_definition : declaration_specifiers declarator declaration_list compound_statement'
+ pass
+
+def p_function_definition_2(t):
+ 'function_definition : declarator declaration_list compound_statement'
+ pass
+
+def p_function_definition_3(t):
+ 'function_definition : declarator compound_statement'
+ pass
+
+def p_function_definition_4(t):
+ 'function_definition : declaration_specifiers declarator compound_statement'
+ pass
+
+# declaration:
+
+def p_declaration_1(t):
+ 'declaration : declaration_specifiers init_declarator_list SEMI'
+ pass
+
+def p_declaration_2(t):
+ 'declaration : declaration_specifiers SEMI'
+ pass
+
+# declaration-list:
+
+def p_declaration_list_1(t):
+ 'declaration_list : declaration'
+ pass
+
+def p_declaration_list_2(t):
+ 'declaration_list : declaration_list declaration '
+ pass
+
+# declaration-specifiers
+def p_declaration_specifiers_1(t):
+ 'declaration_specifiers : storage_class_specifier declaration_specifiers'
+ pass
+
+def p_declaration_specifiers_2(t):
+ 'declaration_specifiers : type_specifier declaration_specifiers'
+ pass
+
+def p_declaration_specifiers_3(t):
+ 'declaration_specifiers : type_qualifier declaration_specifiers'
+ pass
+
+def p_declaration_specifiers_4(t):
+ 'declaration_specifiers : storage_class_specifier'
+ pass
+
+def p_declaration_specifiers_5(t):
+ 'declaration_specifiers : type_specifier'
+ pass
+
+def p_declaration_specifiers_6(t):
+ 'declaration_specifiers : type_qualifier'
+ pass
+
+# storage-class-specifier
+def p_storage_class_specifier(t):
+ '''storage_class_specifier : AUTO
+ | REGISTER
+ | STATIC
+ | EXTERN
+ | TYPEDEF
+ '''
+ pass
+
+# type-specifier:
+def p_type_specifier(t):
+ '''type_specifier : VOID
+ | CHAR
+ | SHORT
+ | INT
+ | LONG
+ | FLOAT
+ | DOUBLE
+ | SIGNED
+ | UNSIGNED
+ | struct_or_union_specifier
+ | enum_specifier
+ | TYPEID
+ '''
+ pass
+
+# type-qualifier:
+def p_type_qualifier(t):
+ '''type_qualifier : CONST
+ | VOLATILE'''
+ pass
+
+# struct-or-union-specifier
+
+def p_struct_or_union_specifier_1(t):
+ 'struct_or_union_specifier : struct_or_union ID LBRACE struct_declaration_list RBRACE'
+ pass
+
+def p_struct_or_union_specifier_2(t):
+ 'struct_or_union_specifier : struct_or_union LBRACE struct_declaration_list RBRACE'
+ pass
+
+def p_struct_or_union_specifier_3(t):
+ 'struct_or_union_specifier : struct_or_union ID'
+ pass
+
+# struct-or-union:
+def p_struct_or_union(t):
+ '''struct_or_union : STRUCT
+ | UNION
+ '''
+ pass
+
+# struct-declaration-list:
+
+def p_struct_declaration_list_1(t):
+ 'struct_declaration_list : struct_declaration'
+ pass
+
+def p_struct_declaration_list_2(t):
+ 'struct_declaration_list : struct_declarator_list struct_declaration'
+ pass
+
+# init-declarator-list:
+
+def p_init_declarator_list_1(t):
+ 'init_declarator_list : init_declarator'
+ pass
+
+def p_init_declarator_list_2(t):
+ 'init_declarator_list : init_declarator_list COMMA init_declarator'
+ pass
+
+# init-declarator
+
+def p_init_declarator_1(t):
+ 'init_declarator : declarator'
+ pass
+
+def p_init_declarator_2(t):
+ 'init_declarator : declarator EQUALS initializer'
+ pass
+
+# struct-declaration:
+
+def p_struct_declaration(t):
+ 'struct_declaration : specifier_qualifier_list struct_declarator_list SEMI'
+ pass
+
+# specifier-qualifier-list:
+
+def p_specifier_qualifier_list_1(t):
+ 'specifier_qualifier_list : type_specifier specifier_qualifier_list'
+ pass
+
+def p_specifier_qualifier_list_2(t):
+ 'specifier_qualifier_list : type_specifier'
+ pass
+
+def p_specifier_qualifier_list_3(t):
+ 'specifier_qualifier_list : type_qualifier specifier_qualifier_list'
+ pass
+
+def p_specifier_qualifier_list_4(t):
+ 'specifier_qualifier_list : type_qualifier'
+ pass
+
+# struct-declarator-list:
+
+def p_struct_declarator_list_1(t):
+ 'struct_declarator_list : struct_declarator'
+ pass
+
+def p_struct_declarator_list_2(t):
+ 'struct_declarator_list : struct_declarator_list COMMA struct_declarator'
+ pass
+
+# struct-declarator:
+
+def p_struct_declarator_1(t):
+ 'struct_declarator : declarator'
+ pass
+
+def p_struct_declarator_2(t):
+ 'struct_declarator : declarator COLON constant_expression'
+ pass
+
+def p_struct_declarator_3(t):
+ 'struct_declarator : COLON constant_expression'
+ pass
+
+# enum-specifier:
+
+def p_enum_specifier_1(t):
+ 'enum_specifier : ENUM ID LBRACE enumerator_list RBRACE'
+ pass
+
+def p_enum_specifier_2(t):
+ 'enum_specifier : ENUM LBRACE enumerator_list RBRACE'
+ pass
+
+def p_enum_specifier_3(t):
+ 'enum_specifier : ENUM ID'
+ pass
+
+# enumerator_list:
+def p_enumerator_list_1(t):
+ 'enumerator_list : enumerator'
+ pass
+
+def p_enumerator_list_2(t):
+ 'enumerator_list : enumerator_list COMMA enumerator'
+ pass
+
+# enumerator:
+def p_enumerator_1(t):
+ 'enumerator : ID'
+ pass
+
+def p_enumerator_2(t):
+ 'enumerator : ID EQUALS constant_expression'
+ pass
+
+# declarator:
+
+def p_declarator_1(t):
+ 'declarator : pointer direct_declarator'
+ pass
+
+def p_declarator_2(t):
+ 'declarator : direct_declarator'
+ pass
+
+# direct-declarator:
+
+def p_direct_declarator_1(t):
+ 'direct_declarator : ID'
+ pass
+
+def p_direct_declarator_2(t):
+ 'direct_declarator : LPAREN declarator RPAREN'
+ pass
+
+def p_direct_declarator_3(t):
+ 'direct_declarator : direct_declarator LBRACKET constant_expression_opt RBRACKET'
+ pass
+
+def p_direct_declarator_4(t):
+ 'direct_declarator : direct_declarator LPAREN parameter_type_list RPAREN '
+ pass
+
+def p_direct_declarator_5(t):
+ 'direct_declarator : direct_declarator LPAREN identifier_list RPAREN '
+ pass
+
+def p_direct_declarator_6(t):
+ 'direct_declarator : direct_declarator LPAREN RPAREN '
+ pass
+
+# pointer:
+def p_pointer_1(t):
+ 'pointer : TIMES type_qualifier_list'
+ pass
+
+def p_pointer_2(t):
+ 'pointer : TIMES'
+ pass
+
+def p_pointer_3(t):
+ 'pointer : TIMES type_qualifier_list pointer'
+ pass
+
+def p_pointer_4(t):
+ 'pointer : TIMES pointer'
+ pass
+
+# type-qualifier-list:
+
+def p_type_qualifier_list_1(t):
+ 'type_qualifier_list : type_qualifier'
+ pass
+
+def p_type_qualifier_list_2(t):
+ 'type_qualifier_list : type_qualifier_list type_qualifier'
+ pass
+
+# parameter-type-list:
+
+def p_parameter_type_list_1(t):
+ 'parameter_type_list : parameter_list'
+ pass
+
+def p_parameter_type_list_2(t):
+ 'parameter_type_list : parameter_list COMMA ELLIPSIS'
+ pass
+
+# parameter-list:
+
+def p_parameter_list_1(t):
+ 'parameter_list : parameter_declaration'
+ pass
+
+def p_parameter_list_2(t):
+ 'parameter_list : parameter_list COMMA parameter_declaration'
+ pass
+
+# parameter-declaration:
+def p_parameter_declaration_1(t):
+ 'parameter_declaration : declaration_specifiers declarator'
+ pass
+
+def p_parameter_declaration_2(t):
+ 'parameter_declaration : declaration_specifiers abstract_declarator_opt'
+ pass
+
+# identifier-list:
+def p_identifier_list_1(t):
+ 'identifier_list : ID'
+ pass
+
+def p_identifier_list_2(t):
+ 'identifier_list : identifier_list COMMA ID'
+ pass
+
+# initializer:
+
+def p_initializer_1(t):
+ 'initializer : assignment_expression'
+ pass
+
+def p_initializer_2(t):
+ '''initializer : LBRACE initializer_list RBRACE
+ | LBRACE initializer_list COMMA RBRACE'''
+ pass
+
+# initializer-list:
+
+def p_initializer_list_1(t):
+ 'initializer_list : initializer'
+ pass
+
+def p_initializer_list_2(t):
+ 'initializer_list : initializer_list COMMA initializer'
+ pass
+
+# type-name:
+
+def p_type_name(t):
+ 'type_name : specifier_qualifier_list abstract_declarator_opt'
+ pass
+
+def p_abstract_declarator_opt_1(t):
+ 'abstract_declarator_opt : empty'
+ pass
+
+def p_abstract_declarator_opt_2(t):
+ 'abstract_declarator_opt : abstract_declarator'
+ pass
+
+# abstract-declarator:
+
+def p_abstract_declarator_1(t):
+ 'abstract_declarator : pointer '
+ pass
+
+def p_abstract_declarator_2(t):
+ 'abstract_declarator : pointer direct_abstract_declarator'
+ pass
+
+def p_abstract_declarator_3(t):
+ 'abstract_declarator : direct_abstract_declarator'
+ pass
+
+# direct-abstract-declarator:
+
+def p_direct_abstract_declarator_1(t):
+ 'direct_abstract_declarator : LPAREN abstract_declarator RPAREN'
+ pass
+
+def p_direct_abstract_declarator_2(t):
+ 'direct_abstract_declarator : direct_abstract_declarator LBRACKET constant_expression_opt RBRACKET'
+ pass
+
+def p_direct_abstract_declarator_3(t):
+ 'direct_abstract_declarator : LBRACKET constant_expression_opt RBRACKET'
+ pass
+
+def p_direct_abstract_declarator_4(t):
+ 'direct_abstract_declarator : direct_abstract_declarator LPAREN parameter_type_list_opt RPAREN'
+ pass
+
+def p_direct_abstract_declarator_5(t):
+ 'direct_abstract_declarator : LPAREN parameter_type_list_opt RPAREN'
+ pass
+
+# Optional fields in abstract declarators
+
+def p_constant_expression_opt_1(t):
+ 'constant_expression_opt : empty'
+ pass
+
+def p_constant_expression_opt_2(t):
+ 'constant_expression_opt : constant_expression'
+ pass
+
+def p_parameter_type_list_opt_1(t):
+ 'parameter_type_list_opt : empty'
+ pass
+
+def p_parameter_type_list_opt_2(t):
+ 'parameter_type_list_opt : parameter_type_list'
+ pass
+
+# statement:
+
+def p_statement(t):
+ '''
+ statement : labeled_statement
+ | expression_statement
+ | compound_statement
+ | selection_statement
+ | iteration_statement
+ | jump_statement
+ '''
+ pass
+
+# labeled-statement:
+
+def p_labeled_statement_1(t):
+ 'labeled_statement : ID COLON statement'
+ pass
+
+def p_labeled_statement_2(t):
+ 'labeled_statement : CASE constant_expression COLON statement'
+ pass
+
+def p_labeled_statement_3(t):
+ 'labeled_statement : DEFAULT COLON statement'
+ pass
+
+# expression-statement:
+def p_expression_statement(t):
+ 'expression_statement : expression_opt SEMI'
+ pass
+
+# compound-statement:
+
+def p_compound_statement_1(t):
+ 'compound_statement : LBRACE declaration_list statement_list RBRACE'
+ pass
+
+def p_compound_statement_2(t):
+ 'compound_statement : LBRACE statement_list RBRACE'
+ pass
+
+def p_compound_statement_3(t):
+ 'compound_statement : LBRACE declaration_list RBRACE'
+ pass
+
+def p_compound_statement_4(t):
+ 'compound_statement : LBRACE RBRACE'
+ pass
+
+# statement-list:
+
+def p_statement_list_1(t):
+ 'statement_list : statement'
+ pass
+
+def p_statement_list_2(t):
+ 'statement_list : statement_list statement'
+ pass
+
+# selection-statement
+
+def p_selection_statement_1(t):
+ 'selection_statement : IF LPAREN expression RPAREN statement'
+ pass
+
+def p_selection_statement_2(t):
+ 'selection_statement : IF LPAREN expression RPAREN statement ELSE statement '
+ pass
+
+def p_selection_statement_3(t):
+ 'selection_statement : SWITCH LPAREN expression RPAREN statement '
+ pass
+
+# iteration_statement:
+
+def p_iteration_statement_1(t):
+ 'iteration_statement : WHILE LPAREN expression RPAREN statement'
+ pass
+
+def p_iteration_statement_2(t):
+ 'iteration_statement : FOR LPAREN expression_opt SEMI expression_opt SEMI expression_opt RPAREN statement '
+ pass
+
+def p_iteration_statement_3(t):
+ 'iteration_statement : DO statement WHILE LPAREN expression RPAREN SEMI'
+ pass
+
+# jump_statement:
+
+def p_jump_statement_1(t):
+ 'jump_statement : GOTO ID SEMI'
+ pass
+
+def p_jump_statement_2(t):
+ 'jump_statement : CONTINUE SEMI'
+ pass
+
+def p_jump_statement_3(t):
+ 'jump_statement : BREAK SEMI'
+ pass
+
+def p_jump_statement_4(t):
+ 'jump_statement : RETURN expression_opt SEMI'
+ pass
+
+def p_expression_opt_1(t):
+ 'expression_opt : empty'
+ pass
+
+def p_expression_opt_2(t):
+ 'expression_opt : expression'
+ pass
+
+# expression:
+def p_expression_1(t):
+ 'expression : assignment_expression'
+ pass
+
+def p_expression_2(t):
+ 'expression : expression COMMA assignment_expression'
+ pass
+
+# assigment_expression:
+def p_assignment_expression_1(t):
+ 'assignment_expression : conditional_expression'
+ pass
+
+def p_assignment_expression_2(t):
+ 'assignment_expression : unary_expression assignment_operator assignment_expression'
+ pass
+
+# assignment_operator:
+def p_assignment_operator(t):
+ '''
+ assignment_operator : EQUALS
+ | TIMESEQUAL
+ | DIVEQUAL
+ | MODEQUAL
+ | PLUSEQUAL
+ | MINUSEQUAL
+ | LSHIFTEQUAL
+ | RSHIFTEQUAL
+ | ANDEQUAL
+ | OREQUAL
+ | XOREQUAL
+ '''
+ pass
+
+# conditional-expression
+def p_conditional_expression_1(t):
+ 'conditional_expression : logical_or_expression'
+ pass
+
+def p_conditional_expression_2(t):
+ 'conditional_expression : logical_or_expression CONDOP expression COLON conditional_expression '
+ pass
+
+# constant-expression
+
+def p_constant_expression(t):
+ 'constant_expression : conditional_expression'
+ pass
+
+# logical-or-expression
+
+def p_logical_or_expression_1(t):
+ 'logical_or_expression : logical_and_expression'
+ pass
+
+def p_logical_or_expression_2(t):
+ 'logical_or_expression : logical_or_expression LOR logical_and_expression'
+ pass
+
+# logical-and-expression
+
+def p_logical_and_expression_1(t):
+ 'logical_and_expression : inclusive_or_expression'
+ pass
+
+def p_logical_and_expression_2(t):
+ 'logical_and_expression : logical_and_expression LAND inclusive_or_expression'
+ pass
+
+# inclusive-or-expression:
+
+def p_inclusive_or_expression_1(t):
+ 'inclusive_or_expression : exclusive_or_expression'
+ pass
+
+def p_inclusive_or_expression_2(t):
+ 'inclusive_or_expression : inclusive_or_expression OR exclusive_or_expression'
+ pass
+
+# exclusive-or-expression:
+
+def p_exclusive_or_expression_1(t):
+ 'exclusive_or_expression : and_expression'
+ pass
+
+def p_exclusive_or_expression_2(t):
+ 'exclusive_or_expression : exclusive_or_expression XOR and_expression'
+ pass
+
+# AND-expression
+
+def p_and_expression_1(t):
+ 'and_expression : equality_expression'
+ pass
+
+def p_and_expression_2(t):
+ 'and_expression : and_expression AND equality_expression'
+ pass
+
+
+# equality-expression:
+def p_equality_expression_1(t):
+ 'equality_expression : relational_expression'
+ pass
+
+def p_equality_expression_2(t):
+ 'equality_expression : equality_expression EQ relational_expression'
+ pass
+
+def p_equality_expression_3(t):
+ 'equality_expression : equality_expression NE relational_expression'
+ pass
+
+
+# relational-expression:
+def p_relational_expression_1(t):
+ 'relational_expression : shift_expression'
+ pass
+
+def p_relational_expression_2(t):
+ 'relational_expression : relational_expression LT shift_expression'
+ pass
+
+def p_relational_expression_3(t):
+ 'relational_expression : relational_expression GT shift_expression'
+ pass
+
+def p_relational_expression_4(t):
+ 'relational_expression : relational_expression LE shift_expression'
+ pass
+
+def p_relational_expression_5(t):
+ 'relational_expression : relational_expression GE shift_expression'
+ pass
+
+# shift-expression
+
+def p_shift_expression_1(t):
+ 'shift_expression : additive_expression'
+ pass
+
+def p_shift_expression_2(t):
+ 'shift_expression : shift_expression LSHIFT additive_expression'
+ pass
+
+def p_shift_expression_3(t):
+ 'shift_expression : shift_expression RSHIFT additive_expression'
+ pass
+
+# additive-expression
+
+def p_additive_expression_1(t):
+ 'additive_expression : multiplicative_expression'
+ pass
+
+def p_additive_expression_2(t):
+ 'additive_expression : additive_expression PLUS multiplicative_expression'
+ pass
+
+def p_additive_expression_3(t):
+ 'additive_expression : additive_expression MINUS multiplicative_expression'
+ pass
+
+# multiplicative-expression
+
+def p_multiplicative_expression_1(t):
+ 'multiplicative_expression : cast_expression'
+ pass
+
+def p_multiplicative_expression_2(t):
+ 'multiplicative_expression : multiplicative_expression TIMES cast_expression'
+ pass
+
+def p_multiplicative_expression_3(t):
+ 'multiplicative_expression : multiplicative_expression DIVIDE cast_expression'
+ pass
+
+def p_multiplicative_expression_4(t):
+ 'multiplicative_expression : multiplicative_expression MOD cast_expression'
+ pass
+
+# cast-expression:
+
+def p_cast_expression_1(t):
+ 'cast_expression : unary_expression'
+ pass
+
+def p_cast_expression_2(t):
+ 'cast_expression : LPAREN type_name RPAREN cast_expression'
+ pass
+
+# unary-expression:
+def p_unary_expression_1(t):
+ 'unary_expression : postfix_expression'
+ pass
+
+def p_unary_expression_2(t):
+ 'unary_expression : PLUSPLUS unary_expression'
+ pass
+
+def p_unary_expression_3(t):
+ 'unary_expression : MINUSMINUS unary_expression'
+ pass
+
+def p_unary_expression_4(t):
+ 'unary_expression : unary_operator cast_expression'
+ pass
+
+def p_unary_expression_5(t):
+ 'unary_expression : SIZEOF unary_expression'
+ pass
+
+def p_unary_expression_6(t):
+ 'unary_expression : SIZEOF LPAREN type_name RPAREN'
+ pass
+
+#unary-operator
+def p_unary_operator(t):
+ '''unary_operator : AND
+ | TIMES
+ | PLUS
+ | MINUS
+ | NOT
+ | LNOT '''
+ pass
+
+# postfix-expression:
+def p_postfix_expression_1(t):
+ 'postfix_expression : primary_expression'
+ pass
+
+def p_postfix_expression_2(t):
+ 'postfix_expression : postfix_expression LBRACKET expression RBRACKET'
+ pass
+
+def p_postfix_expression_3(t):
+ 'postfix_expression : postfix_expression LPAREN argument_expression_list RPAREN'
+ pass
+
+def p_postfix_expression_4(t):
+ 'postfix_expression : postfix_expression LPAREN RPAREN'
+ pass
+
+def p_postfix_expression_5(t):
+ 'postfix_expression : postfix_expression PERIOD ID'
+ pass
+
+def p_postfix_expression_6(t):
+ 'postfix_expression : postfix_expression ARROW ID'
+ pass
+
+def p_postfix_expression_7(t):
+ 'postfix_expression : postfix_expression PLUSPLUS'
+ pass
+
+def p_postfix_expression_8(t):
+ 'postfix_expression : postfix_expression MINUSMINUS'
+ pass
+
+# primary-expression:
+def p_primary_expression(t):
+ '''primary_expression : ID
+ | constant
+ | SCONST
+ | LPAREN expression RPAREN'''
+ pass
+
+# argument-expression-list:
+def p_argument_expression_list(t):
+ '''argument_expression_list : assignment_expression
+ | argument_expression_list COMMA assignment_expression'''
+ pass
+
+# constant:
+def p_constant(t):
+ '''constant : ICONST
+ | FCONST
+ | CCONST'''
+ pass
+
+
+def p_empty(t):
+ 'empty : '
+ pass
+
+def p_error(t):
+ print "Whoa. We're hosed"
+
+import profile
+# Build the grammar
+
+yacc.yacc(method='LALR')
+
+#profile.run("yacc.yacc(method='LALR')")
+
+
+
+
diff --git a/chall/ply-2.2/example/ansic/lextab.py b/chall/ply-2.2/example/ansic/lextab.py
new file mode 100644
index 0000000..ce9804b
--- /dev/null
+++ b/chall/ply-2.2/example/ansic/lextab.py
@@ -0,0 +1,8 @@
+# lextab.py. This file automatically created by PLY (version 2.2). Don't edit!
+_lextokens = {'SHORT': None, 'SIGNED': None, 'TIMES': None, 'TYPEID': None, 'GT': None, 'ARROW': None, 'FCONST': None, 'CONST': None, 'GE': None, 'PERIOD': None, 'SEMI': None, 'REGISTER': None, 'ENUM': None, 'SIZEOF': None, 'COMMA': None, 'RBRACE': None, 'RPAREN': None, 'RSHIFTEQUAL': None, 'LT': None, 'OREQUAL': None, 'XOREQUAL': None, 'DOUBLE': None, 'LBRACE': None, 'STRUCT': None, 'LPAREN': None, 'PLUSEQUAL': None, 'LNOT': None, 'NOT': None, 'CONDOP': None, 'LE': None, 'FLOAT': None, 'GOTO': None, 'LOR': None, 'EQ': None, 'MOD': None, 'ICONST': None, 'LONG': None, 'PLUS': None, 'DIVIDE': None, 'WHILE': None, 'UNION': None, 'CHAR': None, 'SWITCH': None, 'DO': None, 'FOR': None, 'VOID': None, 'EXTERN': None, 'RETURN': None, 'MINUSEQUAL': None, 'ELSE': None, 'ANDEQUAL': None, 'BREAK': None, 'CCONST': None, 'INT': None, 'DIVEQUAL': None, 'DEFAULT': None, 'TIMESEQUAL': None, 'MINUS': None, 'OR': None, 'CONTINUE': None, 'IF': None, 'UNSIGNED': None, 'ID': None, 'MINUSMINUS': None, 'COLON': None, 'LSHIFTEQUAL': None, 'RBRACKET': None, 'VOLATILE': None, 'CASE': None, 'PLUSPLUS': None, 'RSHIFT': None, 'MODEQUAL': None, 'LAND': None, 'AND': None, 'ELLIPSIS': None, 'STATIC': None, 'LBRACKET': None, 'LSHIFT': None, 'NE': None, 'TYPEDEF': None, 'AUTO': None, 'XOR': None, 'EQUALS': None, 'SCONST': None}
+_lexreflags = 0
+_lexliterals = ''
+_lexstateinfo = {'INITIAL': 'inclusive'}
+_lexstatere = {'INITIAL': [('(?P<t_NEWLINE>\\n+)|(?P<t_ID>[A-Za-z_][\\w_]*)|(?P<t_comment> /\\*(.|\\n)*?\\*/)|(?P<t_preprocessor>\\#(.)*?\\n)|(?P<t_FCONST>((\\d+)(\\.\\d+)(e(\\+|-)?(\\d+))? | (\\d+)e(\\+|-)?(\\d+))([lL]|[fF])?)|(?P<t_ICONST>\\d+([uU]|[lL]|[uU][lL]|[lL][uU])?)|(?P<t_CCONST>(L)?\\\'([^\\\\\\n]|(\\\\.))*?\\\')|(?P<t_SCONST>\\"([^\\\\\\n]|(\\\\.))*?\\")|(?P<t_ELLIPSIS>\\.\\.\\.)|(?P<t_LOR>\\|\\|)|(?P<t_PLUSPLUS>\\+\\+)|(?P<t_TIMESEQUAL>\\*=)|(?P<t_RSHIFTEQUAL>>>=)|(?P<t_OREQUAL>\\|=)|(?P<t_PLUSEQUAL>\\+=)|(?P<t_LSHIFTEQUAL><<=)|(?P<t_RBRACKET>\\])|(?P<t_MODEQUAL>%=)|(?P<t_XOREQUAL>^=)|(?P<t_LSHIFT><<)|(?P<t_TIMES>\\*)|(?P<t_LAND>&&)|(?P<t_MINUSMINUS>--)|(?P<t_NE>!=)|(?P<t_LPAREN>\\()|(?P<t_ANDEQUAL>&=)|(?P<t_RSHIFT>>>)|(?P<t_LBRACKET>\\[)|(?P<t_LBRACE>\\{)|(?P<t_OR>\\|)|(?P<t_RBRACE>\\})|(?P<t_ARROW>->)|(?P<t_PLUS>\\+)|(?P<t_CONDOP>\\?)|(?P<t_LE><=)|(?P<t_MINUSEQUAL>-=)|(?P<t_PERIOD>\\.)|(?P<t_DIVEQUAL>/=)|(?P<t_EQ>==)|(?P<t_GE>>=)|(?P<t_RPAREN>\\))|(?P<t_XOR>\\^)|(?P<t_SEMI>;)|(?P<t_AND>&)|(?P<t_NOT>~)|(?P<t_EQUALS>=)|(?P<t_MOD>%)|(?P<t_LT><)|(?P<t_MINUS>-)|(?P<t_LNOT>!)|(?P<t_DIVIDE>/)|(?P<t_COMMA>,)|(?P<t_GT>>)|(?P<t_COLON>:)', [None, ('t_NEWLINE', 'NEWLINE'), ('t_ID', 'ID'), ('t_comment', 'comment'), None, ('t_preprocessor', 'preprocessor'), None, (None, 'FCONST'), None, None, None, None, None, None, None, None, None, None, (None, 'ICONST'), None, (None, 'CCONST'), None, None, None, (None, 'SCONST'), None, None, (None, 'ELLIPSIS'), (None, 'LOR'), (None, 'PLUSPLUS'), (None, 'TIMESEQUAL'), (None, 'RSHIFTEQUAL'), (None, 'OREQUAL'), (None, 'PLUSEQUAL'), (None, 'LSHIFTEQUAL'), (None, 'RBRACKET'), (None, 'MODEQUAL'), (None, 'XOREQUAL'), (None, 'LSHIFT'), (None, 'TIMES'), (None, 'LAND'), (None, 'MINUSMINUS'), (None, 'NE'), (None, 'LPAREN'), (None, 'ANDEQUAL'), (None, 'RSHIFT'), (None, 'LBRACKET'), (None, 'LBRACE'), (None, 'OR'), (None, 'RBRACE'), (None, 'ARROW'), (None, 'PLUS'), (None, 'CONDOP'), (None, 'LE'), (None, 'MINUSEQUAL'), (None, 'PERIOD'), (None, 'DIVEQUAL'), (None, 'EQ'), (None, 'GE'), (None, 'RPAREN'), (None, 'XOR'), (None, 'SEMI'), (None, 'AND'), (None, 'NOT'), (None, 'EQUALS'), (None, 'MOD'), (None, 'LT'), (None, 'MINUS'), (None, 'LNOT'), (None, 'DIVIDE'), (None, 'COMMA'), (None, 'GT'), (None, 'COLON')])]}
+_lexstateignore = {'INITIAL': ' \t\f'}
+_lexstateerrorf = {'INITIAL': 't_error'}
diff --git a/chall/ply-2.2/example/calc/calc.py b/chall/ply-2.2/example/calc/calc.py
new file mode 100644
index 0000000..5bf5d5d
--- /dev/null
+++ b/chall/ply-2.2/example/calc/calc.py
@@ -0,0 +1,105 @@
+# -----------------------------------------------------------------------------
+# calc.py
+#
+# A simple calculator with variables. This is from O'Reilly's
+# "Lex and Yacc", p. 63.
+# -----------------------------------------------------------------------------
+
+import sys
+sys.path.insert(0,"../..")
+
+tokens = (
+ 'NAME','NUMBER',
+ )
+
+literals = ['=','+','-','*','/', '(',')']
+
+# Tokens
+
+t_NAME = r'[a-zA-Z_][a-zA-Z0-9_]*'
+
+def t_NUMBER(t):
+ r'\d+'
+ try:
+ t.value = int(t.value)
+ except ValueError:
+ print "Integer value too large", t.value
+ t.value = 0
+ return t
+
+t_ignore = " \t"
+
+def t_newline(t):
+ r'\n+'
+ t.lexer.lineno += t.value.count("\n")
+
+def t_error(t):
+ print "Illegal character '%s'" % t.value[0]
+ t.lexer.skip(1)
+
+# Build the lexer
+import ply.lex as lex
+lex.lex()
+
+# Parsing rules
+
+precedence = (
+ ('left','+','-'),
+ ('left','*','/'),
+ ('right','UMINUS'),
+ )
+
+# dictionary of names
+names = { }
+
+def p_statement_assign(p):
+ 'statement : NAME "=" expression'
+ names[p[1]] = p[3]
+
+def p_statement_expr(p):
+ 'statement : expression'
+ print p[1]
+
+def p_expression_binop(p):
+ '''expression : expression '+' expression
+ | expression '-' expression
+ | expression '*' expression
+ | expression '/' expression'''
+ if p[2] == '+' : p[0] = p[1] + p[3]
+ elif p[2] == '-': p[0] = p[1] - p[3]
+ elif p[2] == '*': p[0] = p[1] * p[3]
+ elif p[2] == '/': p[0] = p[1] / p[3]
+
+def p_expression_uminus(p):
+ "expression : '-' expression %prec UMINUS"
+ p[0] = -p[2]
+
+def p_expression_group(p):
+ "expression : '(' expression ')'"
+ p[0] = p[2]
+
+def p_expression_number(p):
+ "expression : NUMBER"
+ p[0] = p[1]
+
+def p_expression_name(p):
+ "expression : NAME"
+ try:
+ p[0] = names[p[1]]
+ except LookupError:
+ print "Undefined name '%s'" % p[1]
+ p[0] = 0
+
+def p_error(p):
+ print "Syntax error at '%s'" % p.value
+
+import ply.yacc as yacc
+yacc.yacc()
+
+while 1:
+ try:
+ s = raw_input('calc > ')
+ except EOFError:
+ break
+ if not s: continue
+ yacc.parse(s)
diff --git a/chall/ply-2.2/example/classcalc/calc.py b/chall/ply-2.2/example/classcalc/calc.py
new file mode 100755
index 0000000..7ec09a6
--- /dev/null
+++ b/chall/ply-2.2/example/classcalc/calc.py
@@ -0,0 +1,152 @@
+#!/usr/bin/env python
+
+# -----------------------------------------------------------------------------
+# calc.py
+#
+# A simple calculator with variables. This is from O'Reilly's
+# "Lex and Yacc", p. 63.
+#
+# Class-based example contributed to PLY by David McNab
+# -----------------------------------------------------------------------------
+
+import sys
+sys.path.insert(0,"../..")
+
+import readline
+import ply.lex as lex
+import ply.yacc as yacc
+import os
+
+class Parser:
+ """
+ Base class for a lexer/parser that has the rules defined as methods
+ """
+ tokens = ()
+ precedence = ()
+
+ def __init__(self, **kw):
+ self.debug = kw.get('debug', 0)
+ self.names = { }
+ try:
+ modname = os.path.split(os.path.splitext(__file__)[0])[1] + "_" + self.__class__.__name__
+ except:
+ modname = "parser"+"_"+self.__class__.__name__
+ self.debugfile = modname + ".dbg"
+ self.tabmodule = modname + "_" + "parsetab"
+ #print self.debugfile, self.tabmodule
+
+ # Build the lexer and parser
+ lex.lex(module=self, debug=self.debug)
+ yacc.yacc(module=self,
+ debug=self.debug,
+ debugfile=self.debugfile,
+ tabmodule=self.tabmodule)
+
+ def run(self):
+ while 1:
+ try:
+ s = raw_input('calc > ')
+ except EOFError:
+ break
+ if not s: continue
+ yacc.parse(s)
+
+
+class Calc(Parser):
+
+ tokens = (
+ 'NAME','NUMBER',
+ 'PLUS','MINUS','EXP', 'TIMES','DIVIDE','EQUALS',
+ 'LPAREN','RPAREN',
+ )
+
+ # Tokens
+
+ t_PLUS = r'\+'
+ t_MINUS = r'-'
+ t_EXP = r'\*\*'
+ t_TIMES = r'\*'
+ t_DIVIDE = r'/'
+ t_EQUALS = r'='
+ t_LPAREN = r'\('
+ t_RPAREN = r'\)'
+ t_NAME = r'[a-zA-Z_][a-zA-Z0-9_]*'
+
+ def t_NUMBER(self, t):
+ r'\d+'
+ try:
+ t.value = int(t.value)
+ except ValueError:
+ print "Integer value too large", t.value
+ t.value = 0
+ #print "parsed number %s" % repr(t.value)
+ return t
+
+ t_ignore = " \t"
+
+ def t_newline(self, t):
+ r'\n+'
+ t.lexer.lineno += t.value.count("\n")
+
+ def t_error(self, t):
+ print "Illegal character '%s'" % t.value[0]
+ t.lexer.skip(1)
+
+ # Parsing rules
+
+ precedence = (
+ ('left','PLUS','MINUS'),
+ ('left','TIMES','DIVIDE'),
+ ('left', 'EXP'),
+ ('right','UMINUS'),
+ )
+
+ def p_statement_assign(self, p):
+ 'statement : NAME EQUALS expression'
+ self.names[p[1]] = p[3]
+
+ def p_statement_expr(self, p):
+ 'statement : expression'
+ print p[1]
+
+ def p_expression_binop(self, p):
+ """
+ expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression
+ | expression EXP expression
+ """
+ #print [repr(p[i]) for i in range(0,4)]
+ if p[2] == '+' : p[0] = p[1] + p[3]
+ elif p[2] == '-': p[0] = p[1] - p[3]
+ elif p[2] == '*': p[0] = p[1] * p[3]
+ elif p[2] == '/': p[0] = p[1] / p[3]
+ elif p[2] == '**': p[0] = p[1] ** p[3]
+
+ def p_expression_uminus(self, p):
+ 'expression : MINUS expression %prec UMINUS'
+ p[0] = -p[2]
+
+ def p_expression_group(self, p):
+ 'expression : LPAREN expression RPAREN'
+ p[0] = p[2]
+
+ def p_expression_number(self, p):
+ 'expression : NUMBER'
+ p[0] = p[1]
+
+ def p_expression_name(self, p):
+ 'expression : NAME'
+ try:
+ p[0] = self.names[p[1]]
+ except LookupError:
+ print "Undefined name '%s'" % p[1]
+ p[0] = 0
+
+ def p_error(self, p):
+ print "Syntax error at '%s'" % p.value
+
+if __name__ == '__main__':
+ calc = Calc()
+ calc.run()
diff --git a/chall/ply-2.2/example/cleanup.sh b/chall/ply-2.2/example/cleanup.sh
new file mode 100755
index 0000000..3e115f4
--- /dev/null
+++ b/chall/ply-2.2/example/cleanup.sh
@@ -0,0 +1,2 @@
+#!/bin/sh
+rm -f */*.pyc */parsetab.py */parser.out */*~ */*.class
diff --git a/chall/ply-2.2/example/hedit/hedit.py b/chall/ply-2.2/example/hedit/hedit.py
new file mode 100644
index 0000000..a3c58c7
--- /dev/null
+++ b/chall/ply-2.2/example/hedit/hedit.py
@@ -0,0 +1,48 @@
+# -----------------------------------------------------------------------------
+# hedit.py
+#
+# Paring of Fortran H Edit descriptions (Contributed by Pearu Peterson)
+#
+# These tokens can't be easily tokenized because they are of the following
+# form:
+#
+# nHc1...cn
+#
+# where n is a positive integer and c1 ... cn are characters.
+#
+# This example shows how to modify the state of the lexer to parse
+# such tokens
+# -----------------------------------------------------------------------------
+
+import sys
+sys.path.insert(0,"../..")
+
+
+tokens = (
+ 'H_EDIT_DESCRIPTOR',
+ )
+
+# Tokens
+t_ignore = " \t\n"
+
+def t_H_EDIT_DESCRIPTOR(t):
+ r"\d+H.*" # This grabs all of the remaining text
+ i = t.value.index('H')
+ n = eval(t.value[:i])
+
+ # Adjust the tokenizing position
+ t.lexer.lexpos -= len(t.value) - (i+1+n)
+
+ t.value = t.value[i+1:i+1+n]
+ return t
+
+def t_error(t):
+ print "Illegal character '%s'" % t.value[0]
+ t.lexer.skip(1)
+
+# Build the lexer
+import ply.lex as lex
+lex.lex()
+lex.runmain()
+
+
diff --git a/chall/ply-2.2/example/newclasscalc/calc.py b/chall/ply-2.2/example/newclasscalc/calc.py
new file mode 100755
index 0000000..b021b6b
--- /dev/null
+++ b/chall/ply-2.2/example/newclasscalc/calc.py
@@ -0,0 +1,155 @@
+#!/usr/bin/env python
+
+# -----------------------------------------------------------------------------
+# calc.py
+#
+# A simple calculator with variables. This is from O'Reilly's
+# "Lex and Yacc", p. 63.
+#
+# Class-based example contributed to PLY by David McNab.
+#
+# Modified to use new-style classes. Test case.
+# -----------------------------------------------------------------------------
+
+import sys
+sys.path.insert(0,"../..")
+
+import readline
+import ply.lex as lex
+import ply.yacc as yacc
+import os
+
+class Parser(object):
+ """
+ Base class for a lexer/parser that has the rules defined as methods
+ """
+ tokens = ()
+ precedence = ()
+
+
+ def __init__(self, **kw):
+ self.debug = kw.get('debug', 0)
+ self.names = { }
+ try:
+ modname = os.path.split(os.path.splitext(__file__)[0])[1] + "_" + self.__class__.__name__
+ except:
+ modname = "parser"+"_"+self.__class__.__name__
+ self.debugfile = modname + ".dbg"
+ self.tabmodule = modname + "_" + "parsetab"
+ #print self.debugfile, self.tabmodule
+
+ # Build the lexer and parser
+ lex.lex(module=self, debug=self.debug)
+ yacc.yacc(module=self,
+ debug=self.debug,
+ debugfile=self.debugfile,
+ tabmodule=self.tabmodule)
+
+ def run(self):
+ while 1:
+ try:
+ s = raw_input('calc > ')
+ except EOFError:
+ break
+ if not s: continue
+ yacc.parse(s)
+
+
+class Calc(Parser):
+
+ tokens = (
+ 'NAME','NUMBER',
+ 'PLUS','MINUS','EXP', 'TIMES','DIVIDE','EQUALS',
+ 'LPAREN','RPAREN',
+ )
+
+ # Tokens
+
+ t_PLUS = r'\+'
+ t_MINUS = r'-'
+ t_EXP = r'\*\*'
+ t_TIMES = r'\*'
+ t_DIVIDE = r'/'
+ t_EQUALS = r'='
+ t_LPAREN = r'\('
+ t_RPAREN = r'\)'
+ t_NAME = r'[a-zA-Z_][a-zA-Z0-9_]*'
+
+ def t_NUMBER(self, t):
+ r'\d+'
+ try:
+ t.value = int(t.value)
+ except ValueError:
+ print "Integer value too large", t.value
+ t.value = 0
+ #print "parsed number %s" % repr(t.value)
+ return t
+
+ t_ignore = " \t"
+
+ def t_newline(self, t):
+ r'\n+'
+ t.lexer.lineno += t.value.count("\n")
+
+ def t_error(self, t):
+ print "Illegal character '%s'" % t.value[0]
+ t.lexer.skip(1)
+
+ # Parsing rules
+
+ precedence = (
+ ('left','PLUS','MINUS'),
+ ('left','TIMES','DIVIDE'),
+ ('left', 'EXP'),
+ ('right','UMINUS'),
+ )
+
+ def p_statement_assign(self, p):
+ 'statement : NAME EQUALS expression'
+ self.names[p[1]] = p[3]
+
+ def p_statement_expr(self, p):
+ 'statement : expression'
+ print p[1]
+
+ def p_expression_binop(self, p):
+ """
+ expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression
+ | expression EXP expression
+ """
+ #print [repr(p[i]) for i in range(0,4)]
+ if p[2] == '+' : p[0] = p[1] + p[3]
+ elif p[2] == '-': p[0] = p[1] - p[3]
+ elif p[2] == '*': p[0] = p[1] * p[3]
+ elif p[2] == '/': p[0] = p[1] / p[3]
+ elif p[2] == '**': p[0] = p[1] ** p[3]
+
+ def p_expression_uminus(self, p):
+ 'expression : MINUS expression %prec UMINUS'
+ p[0] = -p[2]
+
+ def p_expression_group(self, p):
+ 'expression : LPAREN expression RPAREN'
+ p[0] = p[2]
+
+ def p_expression_number(self, p):
+ 'expression : NUMBER'
+ p[0] = p[1]
+
+ def p_expression_name(self, p):
+ 'expression : NAME'
+ try:
+ p[0] = self.names[p[1]]
+ except LookupError:
+ print "Undefined name '%s'" % p[1]
+ p[0] = 0
+
+ def p_error(self, p):
+ print "Syntax error at '%s'" % p.value
+
+if __name__ == '__main__':
+ calc = Calc()
+ calc.run()
diff --git a/chall/ply-2.2/example/optcalc/README b/chall/ply-2.2/example/optcalc/README
new file mode 100644
index 0000000..6d196f0
--- /dev/null
+++ b/chall/ply-2.2/example/optcalc/README
@@ -0,0 +1,9 @@
+An example showing how to use Python optimized mode.
+To run:
+
+ - First run 'python calc.py'
+
+ - Then run 'python -OO calc.py'
+
+If working corretly, the second version should run the
+same way.
diff --git a/chall/ply-2.2/example/optcalc/calc.py b/chall/ply-2.2/example/optcalc/calc.py
new file mode 100644
index 0000000..325f67c
--- /dev/null
+++ b/chall/ply-2.2/example/optcalc/calc.py
@@ -0,0 +1,113 @@
+# -----------------------------------------------------------------------------
+# calc.py
+#
+# A simple calculator with variables. This is from O'Reilly's
+# "Lex and Yacc", p. 63.
+# -----------------------------------------------------------------------------
+
+import sys
+sys.path.insert(0,"../..")
+
+tokens = (
+ 'NAME','NUMBER',
+ 'PLUS','MINUS','TIMES','DIVIDE','EQUALS',
+ 'LPAREN','RPAREN',
+ )
+
+# Tokens
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_TIMES = r'\*'
+t_DIVIDE = r'/'
+t_EQUALS = r'='
+t_LPAREN = r'\('
+t_RPAREN = r'\)'
+t_NAME = r'[a-zA-Z_][a-zA-Z0-9_]*'
+
+def t_NUMBER(t):
+ r'\d+'
+ try:
+ t.value = int(t.value)
+ except ValueError:
+ print "Integer value too large", t.value
+ t.value = 0
+ return t
+
+t_ignore = " \t"
+
+def t_newline(t):
+ r'\n+'
+ t.lexer.lineno += t.value.count("\n")
+
+def t_error(t):
+ print "Illegal character '%s'" % t.value[0]
+ t.lexer.skip(1)
+
+# Build the lexer
+import ply.lex as lex
+lex.lex(optimize=1)
+
+# Parsing rules
+
+precedence = (
+ ('left','PLUS','MINUS'),
+ ('left','TIMES','DIVIDE'),
+ ('right','UMINUS'),
+ )
+
+# dictionary of names
+names = { }
+
+def p_statement_assign(t):
+ 'statement : NAME EQUALS expression'
+ names[t[1]] = t[3]
+
+def p_statement_expr(t):
+ 'statement : expression'
+ print t[1]
+
+def p_expression_binop(t):
+ '''expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+ if t[2] == '+' : t[0] = t[1] + t[3]
+ elif t[2] == '-': t[0] = t[1] - t[3]
+ elif t[2] == '*': t[0] = t[1] * t[3]
+ elif t[2] == '/': t[0] = t[1] / t[3]
+ elif t[2] == '<': t[0] = t[1] < t[3]
+
+def p_expression_uminus(t):
+ 'expression : MINUS expression %prec UMINUS'
+ t[0] = -t[2]
+
+def p_expression_group(t):
+ 'expression : LPAREN expression RPAREN'
+ t[0] = t[2]
+
+def p_expression_number(t):
+ 'expression : NUMBER'
+ t[0] = t[1]
+
+def p_expression_name(t):
+ 'expression : NAME'
+ try:
+ t[0] = names[t[1]]
+ except LookupError:
+ print "Undefined name '%s'" % t[1]
+ t[0] = 0
+
+def p_error(t):
+ print "Syntax error at '%s'" % t.value
+
+import ply.yacc as yacc
+yacc.yacc(optimize=1)
+
+while 1:
+ try:
+ s = raw_input('calc > ')
+ except EOFError:
+ break
+ yacc.parse(s)
+
diff --git a/chall/ply-2.2/example/unicalc/calc.py b/chall/ply-2.2/example/unicalc/calc.py
new file mode 100644
index 0000000..7e60433
--- /dev/null
+++ b/chall/ply-2.2/example/unicalc/calc.py
@@ -0,0 +1,114 @@
+# -----------------------------------------------------------------------------
+# calc.py
+#
+# A simple calculator with variables. This is from O'Reilly's
+# "Lex and Yacc", p. 63.
+#
+# This example uses unicode strings for tokens, docstrings, and input.
+# -----------------------------------------------------------------------------
+
+import sys
+sys.path.insert(0,"../..")
+
+tokens = (
+ 'NAME','NUMBER',
+ 'PLUS','MINUS','TIMES','DIVIDE','EQUALS',
+ 'LPAREN','RPAREN',
+ )
+
+# Tokens
+
+t_PLUS = ur'\+'
+t_MINUS = ur'-'
+t_TIMES = ur'\*'
+t_DIVIDE = ur'/'
+t_EQUALS = ur'='
+t_LPAREN = ur'\('
+t_RPAREN = ur'\)'
+t_NAME = ur'[a-zA-Z_][a-zA-Z0-9_]*'
+
+def t_NUMBER(t):
+ ur'\d+'
+ try:
+ t.value = int(t.value)
+ except ValueError:
+ print "Integer value too large", t.value
+ t.value = 0
+ return t
+
+t_ignore = u" \t"
+
+def t_newline(t):
+ ur'\n+'
+ t.lexer.lineno += t.value.count("\n")
+
+def t_error(t):
+ print "Illegal character '%s'" % t.value[0]
+ t.lexer.skip(1)
+
+# Build the lexer
+import ply.lex as lex
+lex.lex()
+
+# Parsing rules
+
+precedence = (
+ ('left','PLUS','MINUS'),
+ ('left','TIMES','DIVIDE'),
+ ('right','UMINUS'),
+ )
+
+# dictionary of names
+names = { }
+
+def p_statement_assign(p):
+ 'statement : NAME EQUALS expression'
+ names[p[1]] = p[3]
+
+def p_statement_expr(p):
+ 'statement : expression'
+ print p[1]
+
+def p_expression_binop(p):
+ '''expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+ if p[2] == u'+' : p[0] = p[1] + p[3]
+ elif p[2] == u'-': p[0] = p[1] - p[3]
+ elif p[2] == u'*': p[0] = p[1] * p[3]
+ elif p[2] == u'/': p[0] = p[1] / p[3]
+
+def p_expression_uminus(p):
+ 'expression : MINUS expression %prec UMINUS'
+ p[0] = -p[2]
+
+def p_expression_group(p):
+ 'expression : LPAREN expression RPAREN'
+ p[0] = p[2]
+
+def p_expression_number(p):
+ 'expression : NUMBER'
+ p[0] = p[1]
+
+def p_expression_name(p):
+ 'expression : NAME'
+ try:
+ p[0] = names[p[1]]
+ except LookupError:
+ print "Undefined name '%s'" % p[1]
+ p[0] = 0
+
+def p_error(p):
+ print "Syntax error at '%s'" % p.value
+
+import ply.yacc as yacc
+yacc.yacc()
+
+while 1:
+ try:
+ s = raw_input('calc > ')
+ except EOFError:
+ break
+ if not s: continue
+ yacc.parse(unicode(s))
diff --git a/chall/ply-2.2/example/yply/README b/chall/ply-2.2/example/yply/README
new file mode 100644
index 0000000..bfadf36
--- /dev/null
+++ b/chall/ply-2.2/example/yply/README
@@ -0,0 +1,41 @@
+yply.py
+
+This example implements a program yply.py that converts a UNIX-yacc
+specification file into a PLY-compatible program. To use, simply
+run it like this:
+
+ % python yply.py [-nocode] inputfile.y >myparser.py
+
+The output of this program is Python code. In the output,
+any C code in the original file is included, but is commented out.
+If you use the -nocode option, then all of the C code in the
+original file is just discarded.
+
+To use the resulting grammer with PLY, you'll need to edit the
+myparser.py file. Within this file, some stub code is included that
+can be used to test the construction of the parsing tables. However,
+you'll need to do more editing to make a workable parser.
+
+Disclaimer: This just an example I threw together in an afternoon.
+It might have some bugs. However, it worked when I tried it on
+a yacc-specified C++ parser containing 442 rules and 855 parsing
+states.
+
+Comments:
+
+1. This example does not parse specification files meant for lex/flex.
+ You'll need to specify the tokenizer on your own.
+
+2. This example shows a number of interesting PLY features including
+
+ - Parsing of literal text delimited by nested parentheses
+ - Some interaction between the parser and the lexer.
+ - Use of literals in the grammar specification
+ - One pass compilation. The program just emits the result,
+ there is no intermediate parse tree.
+
+3. This program could probably be cleaned up and enhanced a lot.
+ It would be great if someone wanted to work on this (hint).
+
+-Dave
+
diff --git a/chall/ply-2.2/example/yply/ylex.py b/chall/ply-2.2/example/yply/ylex.py
new file mode 100644
index 0000000..67d2354
--- /dev/null
+++ b/chall/ply-2.2/example/yply/ylex.py
@@ -0,0 +1,112 @@
+# lexer for yacc-grammars
+#
+# Author: David Beazley (dave@dabeaz.com)
+# Date : October 2, 2006
+
+import sys
+sys.path.append("../..")
+
+from ply import *
+
+tokens = (
+ 'LITERAL','SECTION','TOKEN','LEFT','RIGHT','PREC','START','TYPE','NONASSOC','UNION','CODE',
+ 'ID','QLITERAL','NUMBER',
+)
+
+states = (('code','exclusive'),)
+
+literals = [ ';', ',', '<', '>', '|',':' ]
+t_ignore = ' \t'
+
+t_TOKEN = r'%token'
+t_LEFT = r'%left'
+t_RIGHT = r'%right'
+t_NONASSOC = r'%nonassoc'
+t_PREC = r'%prec'
+t_START = r'%start'
+t_TYPE = r'%type'
+t_UNION = r'%union'
+t_ID = r'[a-zA-Z_][a-zA-Z_0-9]*'
+t_QLITERAL = r'''(?P<quote>['"]).*?(?P=quote)'''
+t_NUMBER = r'\d+'
+
+def t_SECTION(t):
+ r'%%'
+ if getattr(t.lexer,"lastsection",0):
+ t.value = t.lexer.lexdata[t.lexpos+2:]
+ t.lexer.lexpos = len(t.lexer.lexdata)
+ else:
+ t.lexer.lastsection = 0
+ return t
+
+# Comments
+def t_ccomment(t):
+ r'/\*(.|\n)*?\*/'
+ t.lineno += t.value.count('\n')
+
+t_ignore_cppcomment = r'//.*'
+
+def t_LITERAL(t):
+ r'%\{(.|\n)*?%\}'
+ t.lexer.lineno += t.value.count("\n")
+ return t
+
+def t_NEWLINE(t):
+ r'\n'
+ t.lexer.lineno += 1
+
+def t_code(t):
+ r'\{'
+ t.lexer.codestart = t.lexpos
+ t.lexer.level = 1
+ t.lexer.begin('code')
+
+def t_code_ignore_string(t):
+ r'\"([^\\\n]|(\\.))*?\"'
+
+def t_code_ignore_char(t):
+ r'\'([^\\\n]|(\\.))*?\''
+
+def t_code_ignore_comment(t):
+ r'/\*(.|\n)*?\*/'
+
+def t_code_ignore_cppcom(t):
+ r'//.*'
+
+def t_code_lbrace(t):
+ r'\{'
+ t.lexer.level += 1
+
+def t_code_rbrace(t):
+ r'\}'
+ t.lexer.level -= 1
+ if t.lexer.level == 0:
+ t.type = 'CODE'
+ t.value = t.lexer.lexdata[t.lexer.codestart:t.lexpos+1]
+ t.lexer.begin('INITIAL')
+ t.lexer.lineno += t.value.count('\n')
+ return t
+
+t_code_ignore_nonspace = r'[^\s\}\'\"\{]+'
+t_code_ignore_whitespace = r'\s+'
+t_code_ignore = ""
+
+def t_code_error(t):
+ raise RuntimeError
+
+def t_error(t):
+ print "%d: Illegal character '%s'" % (t.lineno, t.value[0])
+ print t.value
+ t.lexer.skip(1)
+
+lex.lex()
+
+if __name__ == '__main__':
+ lex.runmain()
+
+
+
+
+
+
+
diff --git a/chall/ply-2.2/example/yply/yparse.py b/chall/ply-2.2/example/yply/yparse.py
new file mode 100644
index 0000000..ab5b884
--- /dev/null
+++ b/chall/ply-2.2/example/yply/yparse.py
@@ -0,0 +1,217 @@
+# parser for Unix yacc-based grammars
+#
+# Author: David Beazley (dave@dabeaz.com)
+# Date : October 2, 2006
+
+import ylex
+tokens = ylex.tokens
+
+from ply import *
+
+tokenlist = []
+preclist = []
+
+emit_code = 1
+
+def p_yacc(p):
+ '''yacc : defsection rulesection'''
+
+def p_defsection(p):
+ '''defsection : definitions SECTION
+ | SECTION'''
+ p.lexer.lastsection = 1
+ print "tokens = ", repr(tokenlist)
+ print
+ print "precedence = ", repr(preclist)
+ print
+ print "# -------------- RULES ----------------"
+ print
+
+def p_rulesection(p):
+ '''rulesection : rules SECTION'''
+
+ print "# -------------- RULES END ----------------"
+ print_code(p[2],0)
+
+def p_definitions(p):
+ '''definitions : definitions definition
+ | definition'''
+
+def p_definition_literal(p):
+ '''definition : LITERAL'''
+ print_code(p[1],0)
+
+def p_definition_start(p):
+ '''definition : START ID'''
+ print "start = '%s'" % p[2]
+
+def p_definition_token(p):
+ '''definition : toktype opttype idlist optsemi '''
+ for i in p[3]:
+ if i[0] not in "'\"":
+ tokenlist.append(i)
+ if p[1] == '%left':
+ preclist.append(('left',) + tuple(p[3]))
+ elif p[1] == '%right':
+ preclist.append(('right',) + tuple(p[3]))
+ elif p[1] == '%nonassoc':
+ preclist.append(('nonassoc',)+ tuple(p[3]))
+
+def p_toktype(p):
+ '''toktype : TOKEN
+ | LEFT
+ | RIGHT
+ | NONASSOC'''
+ p[0] = p[1]
+
+def p_opttype(p):
+ '''opttype : '<' ID '>'
+ | empty'''
+
+def p_idlist(p):
+ '''idlist : idlist optcomma tokenid
+ | tokenid'''
+ if len(p) == 2:
+ p[0] = [p[1]]
+ else:
+ p[0] = p[1]
+ p[1].append(p[3])
+
+def p_tokenid(p):
+ '''tokenid : ID
+ | ID NUMBER
+ | QLITERAL
+ | QLITERAL NUMBER'''
+ p[0] = p[1]
+
+def p_optsemi(p):
+ '''optsemi : ';'
+ | empty'''
+
+def p_optcomma(p):
+ '''optcomma : ','
+ | empty'''
+
+def p_definition_type(p):
+ '''definition : TYPE '<' ID '>' namelist optsemi'''
+ # type declarations are ignored
+
+def p_namelist(p):
+ '''namelist : namelist optcomma ID
+ | ID'''
+
+def p_definition_union(p):
+ '''definition : UNION CODE optsemi'''
+ # Union declarations are ignored
+
+def p_rules(p):
+ '''rules : rules rule
+ | rule'''
+ if len(p) == 2:
+ rule = p[1]
+ else:
+ rule = p[2]
+
+ # Print out a Python equivalent of this rule
+
+ embedded = [ ] # Embedded actions (a mess)
+ embed_count = 0
+
+ rulename = rule[0]
+ rulecount = 1
+ for r in rule[1]:
+ # r contains one of the rule possibilities
+ print "def p_%s_%d(p):" % (rulename,rulecount)
+ prod = []
+ prodcode = ""
+ for i in range(len(r)):
+ item = r[i]
+ if item[0] == '{': # A code block
+ if i == len(r) - 1:
+ prodcode = item
+ break
+ else:
+ # an embedded action
+ embed_name = "_embed%d_%s" % (embed_count,rulename)
+ prod.append(embed_name)
+ embedded.append((embed_name,item))
+ embed_count += 1
+ else:
+ prod.append(item)
+ print " '''%s : %s'''" % (rulename, " ".join(prod))
+ # Emit code
+ print_code(prodcode,4)
+ print
+ rulecount += 1
+
+ for e,code in embedded:
+ print "def p_%s(p):" % e
+ print " '''%s : '''" % e
+ print_code(code,4)
+ print
+
+def p_rule(p):
+ '''rule : ID ':' rulelist ';' '''
+ p[0] = (p[1],[p[3]])
+
+def p_rule2(p):
+ '''rule : ID ':' rulelist morerules ';' '''
+ p[4].insert(0,p[3])
+ p[0] = (p[1],p[4])
+
+def p_rule_empty(p):
+ '''rule : ID ':' ';' '''
+ p[0] = (p[1],[[]])
+
+def p_rule_empty2(p):
+ '''rule : ID ':' morerules ';' '''
+
+ p[3].insert(0,[])
+ p[0] = (p[1],p[3])
+
+def p_morerules(p):
+ '''morerules : morerules '|' rulelist
+ | '|' rulelist
+ | '|' '''
+
+ if len(p) == 2:
+ p[0] = [[]]
+ elif len(p) == 3:
+ p[0] = [p[2]]
+ else:
+ p[0] = p[1]
+ p[0].append(p[3])
+
+# print "morerules", len(p), p[0]
+
+def p_rulelist(p):
+ '''rulelist : rulelist ruleitem
+ | ruleitem'''
+
+ if len(p) == 2:
+ p[0] = [p[1]]
+ else:
+ p[0] = p[1]
+ p[1].append(p[2])
+
+def p_ruleitem(p):
+ '''ruleitem : ID
+ | QLITERAL
+ | CODE
+ | PREC'''
+ p[0] = p[1]
+
+def p_empty(p):
+ '''empty : '''
+
+def p_error(p):
+ pass
+
+yacc.yacc(debug=0)
+
+def print_code(code,indent):
+ if not emit_code: return
+ codelines = code.splitlines()
+ for c in codelines:
+ print "%s# %s" % (" "*indent,c)
+
diff --git a/chall/ply-2.2/example/yply/yply.py b/chall/ply-2.2/example/yply/yply.py
new file mode 100755
index 0000000..a439817
--- /dev/null
+++ b/chall/ply-2.2/example/yply/yply.py
@@ -0,0 +1,53 @@
+#!/usr/local/bin/python
+# yply.py
+#
+# Author: David Beazley (dave@dabeaz.com)
+# Date : October 2, 2006
+#
+# Converts a UNIX-yacc specification file into a PLY-compatible
+# specification. To use, simply do this:
+#
+# % python yply.py [-nocode] inputfile.y >myparser.py
+#
+# The output of this program is Python code. In the output,
+# any C code in the original file is included, but is commented.
+# If you use the -nocode option, then all of the C code in the
+# original file is discarded.
+#
+# Disclaimer: This just an example I threw together in an afternoon.
+# It might have some bugs. However, it worked when I tried it on
+# a yacc-specified C++ parser containing 442 rules and 855 parsing
+# states.
+#
+
+import sys
+sys.path.insert(0,"../..")
+
+import ylex
+import yparse
+
+from ply import *
+
+if len(sys.argv) == 1:
+ print "usage : yply.py [-nocode] inputfile"
+ raise SystemExit
+
+if len(sys.argv) == 3:
+ if sys.argv[1] == '-nocode':
+ yparse.emit_code = 0
+ else:
+ print "Unknown option '%s'" % sys.argv[1]
+ raise SystemExit
+ filename = sys.argv[2]
+else:
+ filename = sys.argv[1]
+
+yacc.parse(open(filename).read())
+
+print """
+if __name__ == '__main__':
+ from ply import *
+ yacc.yacc()
+"""
+
+
diff --git a/chall/ply-2.2/ply/__init__.py b/chall/ply-2.2/ply/__init__.py
new file mode 100644
index 0000000..853a985
--- /dev/null
+++ b/chall/ply-2.2/ply/__init__.py
@@ -0,0 +1,4 @@
+# PLY package
+# Author: David Beazley (dave@dabeaz.com)
+
+__all__ = ['lex','yacc']
diff --git a/chall/ply-2.2/ply/__init__.pyc b/chall/ply-2.2/ply/__init__.pyc
new file mode 100644
index 0000000..99d3089
--- /dev/null
+++ b/chall/ply-2.2/ply/__init__.pyc
Binary files differ
diff --git a/chall/ply-2.2/ply/lex.py b/chall/ply-2.2/ply/lex.py
new file mode 100644
index 0000000..c149366
--- /dev/null
+++ b/chall/ply-2.2/ply/lex.py
@@ -0,0 +1,866 @@
+#-----------------------------------------------------------------------------
+# ply: lex.py
+#
+# Author: David M. Beazley (dave@dabeaz.com)
+#
+# Copyright (C) 2001-2006, David M. Beazley
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+#
+# See the file COPYING for a complete copy of the LGPL.
+#-----------------------------------------------------------------------------
+
+__version__ = "2.2"
+
+import re, sys, types
+
+# Regular expression used to match valid token names
+_is_identifier = re.compile(r'^[a-zA-Z0-9_]+$')
+
+# Available instance types. This is used when lexers are defined by a class.
+# It's a little funky because I want to preserve backwards compatibility
+# with Python 2.0 where types.ObjectType is undefined.
+
+try:
+ _INSTANCETYPE = (types.InstanceType, types.ObjectType)
+except AttributeError:
+ _INSTANCETYPE = types.InstanceType
+ class object: pass # Note: needed if no new-style classes present
+
+# Exception thrown when invalid token encountered and no default error
+# handler is defined.
+class LexError(Exception):
+ def __init__(self,message,s):
+ self.args = (message,)
+ self.text = s
+
+# Token class
+class LexToken(object):
+ def __str__(self):
+ return "LexToken(%s,%r,%d,%d)" % (self.type,self.value,self.lineno,self.lexpos)
+ def __repr__(self):
+ return str(self)
+ def skip(self,n):
+ self.lexer.skip(n)
+
+# -----------------------------------------------------------------------------
+# Lexer class
+#
+# This class encapsulates all of the methods and data associated with a lexer.
+#
+# input() - Store a new string in the lexer
+# token() - Get the next token
+# -----------------------------------------------------------------------------
+
+class Lexer:
+ def __init__(self):
+ self.lexre = None # Master regular expression. This is a list of
+ # tuples (re,findex) where re is a compiled
+ # regular expression and findex is a list
+ # mapping regex group numbers to rules
+ self.lexretext = None # Current regular expression strings
+ self.lexstatere = {} # Dictionary mapping lexer states to master regexs
+ self.lexstateretext = {} # Dictionary mapping lexer states to regex strings
+ self.lexstate = "INITIAL" # Current lexer state
+ self.lexstatestack = [] # Stack of lexer states
+ self.lexstateinfo = None # State information
+ self.lexstateignore = {} # Dictionary of ignored characters for each state
+ self.lexstateerrorf = {} # Dictionary of error functions for each state
+ self.lexreflags = 0 # Optional re compile flags
+ self.lexdata = None # Actual input data (as a string)
+ self.lexpos = 0 # Current position in input text
+ self.lexlen = 0 # Length of the input text
+ self.lexerrorf = None # Error rule (if any)
+ self.lextokens = None # List of valid tokens
+ self.lexignore = "" # Ignored characters
+ self.lexliterals = "" # Literal characters that can be passed through
+ self.lexmodule = None # Module
+ self.lineno = 1 # Current line number
+ self.lexdebug = 0 # Debugging mode
+ self.lexoptimize = 0 # Optimized mode
+
+ def clone(self,object=None):
+ c = Lexer()
+ c.lexstatere = self.lexstatere
+ c.lexstateinfo = self.lexstateinfo
+ c.lexstateretext = self.lexstateretext
+ c.lexstate = self.lexstate
+ c.lexstatestack = self.lexstatestack
+ c.lexstateignore = self.lexstateignore
+ c.lexstateerrorf = self.lexstateerrorf
+ c.lexreflags = self.lexreflags
+ c.lexdata = self.lexdata
+ c.lexpos = self.lexpos
+ c.lexlen = self.lexlen
+ c.lextokens = self.lextokens
+ c.lexdebug = self.lexdebug
+ c.lineno = self.lineno
+ c.lexoptimize = self.lexoptimize
+ c.lexliterals = self.lexliterals
+ c.lexmodule = self.lexmodule
+
+ # If the object parameter has been supplied, it means we are attaching the
+ # lexer to a new object. In this case, we have to rebind all methods in
+ # the lexstatere and lexstateerrorf tables.
+
+ if object:
+ newtab = { }
+ for key, ritem in self.lexstatere.items():
+ newre = []
+ for cre, findex in ritem:
+ newfindex = []
+ for f in findex:
+ if not f or not f[0]:
+ newfindex.append(f)
+ continue
+ newfindex.append((getattr(object,f[0].__name__),f[1]))
+ newre.append((cre,newfindex))
+ newtab[key] = newre
+ c.lexstatere = newtab
+ c.lexstateerrorf = { }
+ for key, ef in self.lexstateerrorf.items():
+ c.lexstateerrorf[key] = getattr(object,ef.__name__)
+ c.lexmodule = object
+
+ # Set up other attributes
+ c.begin(c.lexstate)
+ return c
+
+ # ------------------------------------------------------------
+ # writetab() - Write lexer information to a table file
+ # ------------------------------------------------------------
+ def writetab(self,tabfile):
+ tf = open(tabfile+".py","w")
+ tf.write("# %s.py. This file automatically created by PLY (version %s). Don't edit!\n" % (tabfile,__version__))
+ tf.write("_lextokens = %s\n" % repr(self.lextokens))
+ tf.write("_lexreflags = %s\n" % repr(self.lexreflags))
+ tf.write("_lexliterals = %s\n" % repr(self.lexliterals))
+ tf.write("_lexstateinfo = %s\n" % repr(self.lexstateinfo))
+
+ tabre = { }
+ for key, lre in self.lexstatere.items():
+ titem = []
+ for i in range(len(lre)):
+ titem.append((self.lexstateretext[key][i],_funcs_to_names(lre[i][1])))
+ tabre[key] = titem
+
+ tf.write("_lexstatere = %s\n" % repr(tabre))
+ tf.write("_lexstateignore = %s\n" % repr(self.lexstateignore))
+
+ taberr = { }
+ for key, ef in self.lexstateerrorf.items():
+ if ef:
+ taberr[key] = ef.__name__
+ else:
+ taberr[key] = None
+ tf.write("_lexstateerrorf = %s\n" % repr(taberr))
+ tf.close()
+
+ # ------------------------------------------------------------
+ # readtab() - Read lexer information from a tab file
+ # ------------------------------------------------------------
+ def readtab(self,tabfile,fdict):
+ exec "import %s as lextab" % tabfile
+ self.lextokens = lextab._lextokens
+ self.lexreflags = lextab._lexreflags
+ self.lexliterals = lextab._lexliterals
+ self.lexstateinfo = lextab._lexstateinfo
+ self.lexstateignore = lextab._lexstateignore
+ self.lexstatere = { }
+ self.lexstateretext = { }
+ for key,lre in lextab._lexstatere.items():
+ titem = []
+ txtitem = []
+ for i in range(len(lre)):
+ titem.append((re.compile(lre[i][0],lextab._lexreflags),_names_to_funcs(lre[i][1],fdict)))
+ txtitem.append(lre[i][0])
+ self.lexstatere[key] = titem
+ self.lexstateretext[key] = txtitem
+ self.lexstateerrorf = { }
+ for key,ef in lextab._lexstateerrorf.items():
+ self.lexstateerrorf[key] = fdict[ef]
+ self.begin('INITIAL')
+
+ # ------------------------------------------------------------
+ # input() - Push a new string into the lexer
+ # ------------------------------------------------------------
+ def input(self,s):
+ if not (isinstance(s,types.StringType) or isinstance(s,types.UnicodeType)):
+ raise ValueError, "Expected a string"
+ self.lexdata = s
+ self.lexpos = 0
+ self.lexlen = len(s)
+
+ # ------------------------------------------------------------
+ # begin() - Changes the lexing state
+ # ------------------------------------------------------------
+ def begin(self,state):
+ if not self.lexstatere.has_key(state):
+ raise ValueError, "Undefined state"
+ self.lexre = self.lexstatere[state]
+ self.lexretext = self.lexstateretext[state]
+ self.lexignore = self.lexstateignore.get(state,"")
+ self.lexerrorf = self.lexstateerrorf.get(state,None)
+ self.lexstate = state
+
+ # ------------------------------------------------------------
+ # push_state() - Changes the lexing state and saves old on stack
+ # ------------------------------------------------------------
+ def push_state(self,state):
+ self.lexstatestack.append(self.lexstate)
+ self.begin(state)
+
+ # ------------------------------------------------------------
+ # pop_state() - Restores the previous state
+ # ------------------------------------------------------------
+ def pop_state(self):
+ self.begin(self.lexstatestack.pop())
+
+ # ------------------------------------------------------------
+ # current_state() - Returns the current lexing state
+ # ------------------------------------------------------------
+ def current_state(self):
+ return self.lexstate
+
+ # ------------------------------------------------------------
+ # skip() - Skip ahead n characters
+ # ------------------------------------------------------------
+ def skip(self,n):
+ self.lexpos += n
+
+ # ------------------------------------------------------------
+ # token() - Return the next token from the Lexer
+ #
+ # Note: This function has been carefully implemented to be as fast
+ # as possible. Don't make changes unless you really know what
+ # you are doing
+ # ------------------------------------------------------------
+ def token(self):
+ # Make local copies of frequently referenced attributes
+ lexpos = self.lexpos
+ lexlen = self.lexlen
+ lexignore = self.lexignore
+ lexdata = self.lexdata
+
+ while lexpos < lexlen:
+ # This code provides some short-circuit code for whitespace, tabs, and other ignored characters
+ if lexdata[lexpos] in lexignore:
+ lexpos += 1
+ continue
+
+ # Look for a regular expression match
+ for lexre,lexindexfunc in self.lexre:
+ m = lexre.match(lexdata,lexpos)
+ if not m: continue
+
+ # Set last match in lexer so that rules can access it if they want
+ self.lexmatch = m
+
+ # Create a token for return
+ tok = LexToken()
+ tok.value = m.group()
+ tok.lineno = self.lineno
+ tok.lexpos = lexpos
+ tok.lexer = self
+
+ lexpos = m.end()
+ i = m.lastindex
+ func,tok.type = lexindexfunc[i]
+ self.lexpos = lexpos
+
+ if not func:
+ # If no token type was set, it's an ignored token
+ if tok.type: return tok
+ break
+
+ # if func not callable, it means it's an ignored token
+ if not callable(func):
+ break
+
+ # If token is processed by a function, call it
+ newtok = func(tok)
+
+ # Every function must return a token, if nothing, we just move to next token
+ if not newtok:
+ lexpos = self.lexpos # This is here in case user has updated lexpos.
+ break
+
+ # Verify type of the token. If not in the token map, raise an error
+ if not self.lexoptimize:
+ if not self.lextokens.has_key(newtok.type):
+ raise LexError, ("%s:%d: Rule '%s' returned an unknown token type '%s'" % (
+ func.func_code.co_filename, func.func_code.co_firstlineno,
+ func.__name__, newtok.type),lexdata[lexpos:])
+
+ return newtok
+ else:
+ # No match, see if in literals
+ if lexdata[lexpos] in self.lexliterals:
+ tok = LexToken()
+ tok.value = lexdata[lexpos]
+ tok.lineno = self.lineno
+ tok.lexer = self
+ tok.type = tok.value
+ tok.lexpos = lexpos
+ self.lexpos = lexpos + 1
+ return tok
+
+ # No match. Call t_error() if defined.
+ if self.lexerrorf:
+ tok = LexToken()
+ tok.value = self.lexdata[lexpos:]
+ tok.lineno = self.lineno
+ tok.type = "error"
+ tok.lexer = self
+ tok.lexpos = lexpos
+ self.lexpos = lexpos
+ newtok = self.lexerrorf(tok)
+ if lexpos == self.lexpos:
+ # Error method didn't change text position at all. This is an error.
+ raise LexError, ("Scanning error. Illegal character '%s'" % (lexdata[lexpos]), lexdata[lexpos:])
+ lexpos = self.lexpos
+ if not newtok: continue
+ return newtok
+
+ self.lexpos = lexpos
+ raise LexError, ("Illegal character '%s' at index %d" % (lexdata[lexpos],lexpos), lexdata[lexpos:])
+
+ self.lexpos = lexpos + 1
+ if self.lexdata is None:
+ raise RuntimeError, "No input string given with input()"
+ return None
+
+# -----------------------------------------------------------------------------
+# _validate_file()
+#
+# This checks to see if there are duplicated t_rulename() functions or strings
+# in the parser input file. This is done using a simple regular expression
+# match on each line in the filename.
+# -----------------------------------------------------------------------------
+
+def _validate_file(filename):
+ import os.path
+ base,ext = os.path.splitext(filename)
+ if ext != '.py': return 1 # No idea what the file is. Return OK
+
+ try:
+ f = open(filename)
+ lines = f.readlines()
+ f.close()
+ except IOError:
+ return 1 # Oh well
+
+ fre = re.compile(r'\s*def\s+(t_[a-zA-Z_0-9]*)\(')
+ sre = re.compile(r'\s*(t_[a-zA-Z_0-9]*)\s*=')
+ counthash = { }
+ linen = 1
+ noerror = 1
+ for l in lines:
+ m = fre.match(l)
+ if not m:
+ m = sre.match(l)
+ if m:
+ name = m.group(1)
+ prev = counthash.get(name)
+ if not prev:
+ counthash[name] = linen
+ else:
+ print "%s:%d: Rule %s redefined. Previously defined on line %d" % (filename,linen,name,prev)
+ noerror = 0
+ linen += 1
+ return noerror
+
+# -----------------------------------------------------------------------------
+# _funcs_to_names()
+#
+# Given a list of regular expression functions, this converts it to a list
+# suitable for output to a table file
+# -----------------------------------------------------------------------------
+
+def _funcs_to_names(funclist):
+ result = []
+ for f in funclist:
+ if f and f[0]:
+ result.append((f[0].__name__,f[1]))
+ else:
+ result.append(f)
+ return result
+
+# -----------------------------------------------------------------------------
+# _names_to_funcs()
+#
+# Given a list of regular expression function names, this converts it back to
+# functions.
+# -----------------------------------------------------------------------------
+
+def _names_to_funcs(namelist,fdict):
+ result = []
+ for n in namelist:
+ if n and n[0]:
+ result.append((fdict[n[0]],n[1]))
+ else:
+ result.append(n)
+ return result
+
+# -----------------------------------------------------------------------------
+# _form_master_re()
+#
+# This function takes a list of all of the regex components and attempts to
+# form the master regular expression. Given limitations in the Python re
+# module, it may be necessary to break the master regex into separate expressions.
+# -----------------------------------------------------------------------------
+
+def _form_master_re(relist,reflags,ldict):
+ if not relist: return []
+ regex = "|".join(relist)
+ try:
+ lexre = re.compile(regex,re.VERBOSE | reflags)
+
+ # Build the index to function map for the matching engine
+ lexindexfunc = [ None ] * (max(lexre.groupindex.values())+1)
+ for f,i in lexre.groupindex.items():
+ handle = ldict.get(f,None)
+ if type(handle) in (types.FunctionType, types.MethodType):
+ lexindexfunc[i] = (handle,handle.__name__[2:])
+ elif handle is not None:
+ # If rule was specified as a string, we build an anonymous
+ # callback function to carry out the action
+ if f.find("ignore_") > 0:
+ lexindexfunc[i] = (None,None)
+ print "IGNORE", f
+ else:
+ lexindexfunc[i] = (None, f[2:])
+
+ return [(lexre,lexindexfunc)],[regex]
+ except Exception,e:
+ m = int(len(relist)/2)
+ if m == 0: m = 1
+ llist, lre = _form_master_re(relist[:m],reflags,ldict)
+ rlist, rre = _form_master_re(relist[m:],reflags,ldict)
+ return llist+rlist, lre+rre
+
+# -----------------------------------------------------------------------------
+# def _statetoken(s,names)
+#
+# Given a declaration name s of the form "t_" and a dictionary whose keys are
+# state names, this function returns a tuple (states,tokenname) where states
+# is a tuple of state names and tokenname is the name of the token. For example,
+# calling this with s = "t_foo_bar_SPAM" might return (('foo','bar'),'SPAM')
+# -----------------------------------------------------------------------------
+
+def _statetoken(s,names):
+ nonstate = 1
+ parts = s.split("_")
+ for i in range(1,len(parts)):
+ if not names.has_key(parts[i]) and parts[i] != 'ANY': break
+ if i > 1:
+ states = tuple(parts[1:i])
+ else:
+ states = ('INITIAL',)
+
+ if 'ANY' in states:
+ states = tuple(names.keys())
+
+ tokenname = "_".join(parts[i:])
+ return (states,tokenname)
+
+# -----------------------------------------------------------------------------
+# lex(module)
+#
+# Build all of the regular expression rules from definitions in the supplied module
+# -----------------------------------------------------------------------------
+def lex(module=None,object=None,debug=0,optimize=0,lextab="lextab",reflags=0,nowarn=0):
+ global lexer
+ ldict = None
+ stateinfo = { 'INITIAL' : 'inclusive'}
+ error = 0
+ files = { }
+ lexobj = Lexer()
+ lexobj.lexdebug = debug
+ lexobj.lexoptimize = optimize
+ global token,input
+
+ if nowarn: warn = 0
+ else: warn = 1
+
+ if object: module = object
+
+ if module:
+ # User supplied a module object.
+ if isinstance(module, types.ModuleType):
+ ldict = module.__dict__
+ elif isinstance(module, _INSTANCETYPE):
+ _items = [(k,getattr(module,k)) for k in dir(module)]
+ ldict = { }
+ for (i,v) in _items:
+ ldict[i] = v
+ else:
+ raise ValueError,"Expected a module or instance"
+ lexobj.lexmodule = module
+
+ else:
+ # No module given. We might be able to get information from the caller.
+ try:
+ raise RuntimeError
+ except RuntimeError:
+ e,b,t = sys.exc_info()
+ f = t.tb_frame
+ f = f.f_back # Walk out to our calling function
+ ldict = f.f_globals # Grab its globals dictionary
+
+ if optimize and lextab:
+ try:
+ lexobj.readtab(lextab,ldict)
+ token = lexobj.token
+ input = lexobj.input
+ lexer = lexobj
+ return lexobj
+
+ except ImportError:
+ pass
+
+ # Get the tokens, states, and literals variables (if any)
+ if (module and isinstance(module,_INSTANCETYPE)):
+ tokens = getattr(module,"tokens",None)
+ states = getattr(module,"states",None)
+ literals = getattr(module,"literals","")
+ else:
+ tokens = ldict.get("tokens",None)
+ states = ldict.get("states",None)
+ literals = ldict.get("literals","")
+
+ if not tokens:
+ raise SyntaxError,"lex: module does not define 'tokens'"
+ if not (isinstance(tokens,types.ListType) or isinstance(tokens,types.TupleType)):
+ raise SyntaxError,"lex: tokens must be a list or tuple."
+
+ # Build a dictionary of valid token names
+ lexobj.lextokens = { }
+ if not optimize:
+ for n in tokens:
+ if not _is_identifier.match(n):
+ print "lex: Bad token name '%s'" % n
+ error = 1
+ if warn and lexobj.lextokens.has_key(n):
+ print "lex: Warning. Token '%s' multiply defined." % n
+ lexobj.lextokens[n] = None
+ else:
+ for n in tokens: lexobj.lextokens[n] = None
+
+ if debug:
+ print "lex: tokens = '%s'" % lexobj.lextokens.keys()
+
+ try:
+ for c in literals:
+ if not (isinstance(c,types.StringType) or isinstance(c,types.UnicodeType)) or len(c) > 1:
+ print "lex: Invalid literal %s. Must be a single character" % repr(c)
+ error = 1
+ continue
+
+ except TypeError:
+ print "lex: Invalid literals specification. literals must be a sequence of characters."
+ error = 1
+
+ lexobj.lexliterals = literals
+
+ # Build statemap
+ if states:
+ if not (isinstance(states,types.TupleType) or isinstance(states,types.ListType)):
+ print "lex: states must be defined as a tuple or list."
+ error = 1
+ else:
+ for s in states:
+ if not isinstance(s,types.TupleType) or len(s) != 2:
+ print "lex: invalid state specifier %s. Must be a tuple (statename,'exclusive|inclusive')" % repr(s)
+ error = 1
+ continue
+ name, statetype = s
+ if not isinstance(name,types.StringType):
+ print "lex: state name %s must be a string" % repr(name)
+ error = 1
+ continue
+ if not (statetype == 'inclusive' or statetype == 'exclusive'):
+ print "lex: state type for state %s must be 'inclusive' or 'exclusive'" % name
+ error = 1
+ continue
+ if stateinfo.has_key(name):
+ print "lex: state '%s' already defined." % name
+ error = 1
+ continue
+ stateinfo[name] = statetype
+
+ # Get a list of symbols with the t_ or s_ prefix
+ tsymbols = [f for f in ldict.keys() if f[:2] == 't_' ]
+
+ # Now build up a list of functions and a list of strings
+
+ funcsym = { } # Symbols defined as functions
+ strsym = { } # Symbols defined as strings
+ toknames = { } # Mapping of symbols to token names
+
+ for s in stateinfo.keys():
+ funcsym[s] = []
+ strsym[s] = []
+
+ ignore = { } # Ignore strings by state
+ errorf = { } # Error functions by state
+
+ if len(tsymbols) == 0:
+ raise SyntaxError,"lex: no rules of the form t_rulename are defined."
+
+ for f in tsymbols:
+ t = ldict[f]
+ states, tokname = _statetoken(f,stateinfo)
+ toknames[f] = tokname
+
+ if callable(t):
+ for s in states: funcsym[s].append((f,t))
+ elif (isinstance(t, types.StringType) or isinstance(t,types.UnicodeType)):
+ for s in states: strsym[s].append((f,t))
+ else:
+ print "lex: %s not defined as a function or string" % f
+ error = 1
+
+ # Sort the functions by line number
+ for f in funcsym.values():
+ f.sort(lambda x,y: cmp(x[1].func_code.co_firstlineno,y[1].func_code.co_firstlineno))
+
+ # Sort the strings by regular expression length
+ for s in strsym.values():
+ s.sort(lambda x,y: (len(x[1]) < len(y[1])) - (len(x[1]) > len(y[1])))
+
+ regexs = { }
+
+ # Build the master regular expressions
+ for state in stateinfo.keys():
+ regex_list = []
+
+ # Add rules defined by functions first
+ for fname, f in funcsym[state]:
+ line = f.func_code.co_firstlineno
+ file = f.func_code.co_filename
+ files[file] = None
+ tokname = toknames[fname]
+
+ ismethod = isinstance(f, types.MethodType)
+
+ if not optimize:
+ nargs = f.func_code.co_argcount
+ if ismethod:
+ reqargs = 2
+ else:
+ reqargs = 1
+ if nargs > reqargs:
+ print "%s:%d: Rule '%s' has too many arguments." % (file,line,f.__name__)
+ error = 1
+ continue
+
+ if nargs < reqargs:
+ print "%s:%d: Rule '%s' requires an argument." % (file,line,f.__name__)
+ error = 1
+ continue
+
+ if tokname == 'ignore':
+ print "%s:%d: Rule '%s' must be defined as a string." % (file,line,f.__name__)
+ error = 1
+ continue
+
+ if tokname == 'error':
+ errorf[state] = f
+ continue
+
+ if f.__doc__:
+ if not optimize:
+ try:
+ c = re.compile("(?P<%s>%s)" % (f.__name__,f.__doc__), re.VERBOSE | reflags)
+ if c.match(""):
+ print "%s:%d: Regular expression for rule '%s' matches empty string." % (file,line,f.__name__)
+ error = 1
+ continue
+ except re.error,e:
+ print "%s:%d: Invalid regular expression for rule '%s'. %s" % (file,line,f.__name__,e)
+ if '#' in f.__doc__:
+ print "%s:%d. Make sure '#' in rule '%s' is escaped with '\\#'." % (file,line, f.__name__)
+ error = 1
+ continue
+
+ if debug:
+ print "lex: Adding rule %s -> '%s' (state '%s')" % (f.__name__,f.__doc__, state)
+
+ # Okay. The regular expression seemed okay. Let's append it to the master regular
+ # expression we're building
+
+ regex_list.append("(?P<%s>%s)" % (f.__name__,f.__doc__))
+ else:
+ print "%s:%d: No regular expression defined for rule '%s'" % (file,line,f.__name__)
+
+ # Now add all of the simple rules
+ for name,r in strsym[state]:
+ tokname = toknames[name]
+
+ if tokname == 'ignore':
+ ignore[state] = r
+ continue
+
+ if not optimize:
+ if tokname == 'error':
+ raise SyntaxError,"lex: Rule '%s' must be defined as a function" % name
+ error = 1
+ continue
+
+ if not lexobj.lextokens.has_key(tokname) and tokname.find("ignore_") < 0:
+ print "lex: Rule '%s' defined for an unspecified token %s." % (name,tokname)
+ error = 1
+ continue
+ try:
+ c = re.compile("(?P<%s>%s)" % (name,r),re.VERBOSE | reflags)
+ if (c.match("")):
+ print "lex: Regular expression for rule '%s' matches empty string." % name
+ error = 1
+ continue
+ except re.error,e:
+ print "lex: Invalid regular expression for rule '%s'. %s" % (name,e)
+ if '#' in r:
+ print "lex: Make sure '#' in rule '%s' is escaped with '\\#'." % name
+
+ error = 1
+ continue
+ if debug:
+ print "lex: Adding rule %s -> '%s' (state '%s')" % (name,r,state)
+
+ regex_list.append("(?P<%s>%s)" % (name,r))
+
+ if not regex_list:
+ print "lex: No rules defined for state '%s'" % state
+ error = 1
+
+ regexs[state] = regex_list
+
+
+ if not optimize:
+ for f in files.keys():
+ if not _validate_file(f):
+ error = 1
+
+ if error:
+ raise SyntaxError,"lex: Unable to build lexer."
+
+ # From this point forward, we're reasonably confident that we can build the lexer.
+ # No more errors will be generated, but there might be some warning messages.
+
+ # Build the master regular expressions
+
+ for state in regexs.keys():
+ lexre, re_text = _form_master_re(regexs[state],reflags,ldict)
+ lexobj.lexstatere[state] = lexre
+ lexobj.lexstateretext[state] = re_text
+ if debug:
+ for i in range(len(re_text)):
+ print "lex: state '%s'. regex[%d] = '%s'" % (state, i, re_text[i])
+
+ # For inclusive states, we need to add the INITIAL state
+ for state,type in stateinfo.items():
+ if state != "INITIAL" and type == 'inclusive':
+ lexobj.lexstatere[state].extend(lexobj.lexstatere['INITIAL'])
+ lexobj.lexstateretext[state].extend(lexobj.lexstateretext['INITIAL'])
+
+ lexobj.lexstateinfo = stateinfo
+ lexobj.lexre = lexobj.lexstatere["INITIAL"]
+ lexobj.lexretext = lexobj.lexstateretext["INITIAL"]
+
+ # Set up ignore variables
+ lexobj.lexstateignore = ignore
+ lexobj.lexignore = lexobj.lexstateignore.get("INITIAL","")
+
+ # Set up error functions
+ lexobj.lexstateerrorf = errorf
+ lexobj.lexerrorf = errorf.get("INITIAL",None)
+ if warn and not lexobj.lexerrorf:
+ print "lex: Warning. no t_error rule is defined."
+
+ # Check state information for ignore and error rules
+ for s,stype in stateinfo.items():
+ if stype == 'exclusive':
+ if warn and not errorf.has_key(s):
+ print "lex: Warning. no error rule is defined for exclusive state '%s'" % s
+ if warn and not ignore.has_key(s) and lexobj.lexignore:
+ print "lex: Warning. no ignore rule is defined for exclusive state '%s'" % s
+ elif stype == 'inclusive':
+ if not errorf.has_key(s):
+ errorf[s] = errorf.get("INITIAL",None)
+ if not ignore.has_key(s):
+ ignore[s] = ignore.get("INITIAL","")
+
+
+ # Create global versions of the token() and input() functions
+ token = lexobj.token
+ input = lexobj.input
+ lexer = lexobj
+
+ # If in optimize mode, we write the lextab
+ if lextab and optimize:
+ lexobj.writetab(lextab)
+
+ return lexobj
+
+# -----------------------------------------------------------------------------
+# runmain()
+#
+# This runs the lexer as a main program
+# -----------------------------------------------------------------------------
+
+def runmain(lexer=None,data=None):
+ if not data:
+ try:
+ filename = sys.argv[1]
+ f = open(filename)
+ data = f.read()
+ f.close()
+ except IndexError:
+ print "Reading from standard input (type EOF to end):"
+ data = sys.stdin.read()
+
+ if lexer:
+ _input = lexer.input
+ else:
+ _input = input
+ _input(data)
+ if lexer:
+ _token = lexer.token
+ else:
+ _token = token
+
+ while 1:
+ tok = _token()
+ if not tok: break
+ print "(%s,%r,%d,%d)" % (tok.type, tok.value, tok.lineno,tok.lexpos)
+
+
+# -----------------------------------------------------------------------------
+# @TOKEN(regex)
+#
+# This decorator function can be used to set the regex expression on a function
+# when its docstring might need to be set in an alternative way
+# -----------------------------------------------------------------------------
+
+def TOKEN(r):
+ def set_doc(f):
+ f.__doc__ = r
+ return f
+ return set_doc
+
+# Alternative spelling of the TOKEN decorator
+Token = TOKEN
+
diff --git a/chall/ply-2.2/ply/lex.pyc b/chall/ply-2.2/ply/lex.pyc
new file mode 100644
index 0000000..19af7ed
--- /dev/null
+++ b/chall/ply-2.2/ply/lex.pyc
Binary files differ
diff --git a/chall/ply-2.2/ply/yacc.py b/chall/ply-2.2/ply/yacc.py
new file mode 100644
index 0000000..caf98af
--- /dev/null
+++ b/chall/ply-2.2/ply/yacc.py
@@ -0,0 +1,2209 @@
+#-----------------------------------------------------------------------------
+# ply: yacc.py
+#
+# Author(s): David M. Beazley (dave@dabeaz.com)
+#
+# Copyright (C) 2001-2006, David M. Beazley
+#
+# This library is free software; you can redistribute it and/or
+# modify it under the terms of the GNU Lesser General Public
+# License as published by the Free Software Foundation; either
+# version 2.1 of the License, or (at your option) any later version.
+#
+# This library is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+# Lesser General Public License for more details.
+#
+# You should have received a copy of the GNU Lesser General Public
+# License along with this library; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA
+#
+# See the file COPYING for a complete copy of the LGPL.
+#
+#
+# This implements an LR parser that is constructed from grammar rules defined
+# as Python functions. The grammer is specified by supplying the BNF inside
+# Python documentation strings. The inspiration for this technique was borrowed
+# from John Aycock's Spark parsing system. PLY might be viewed as cross between
+# Spark and the GNU bison utility.
+#
+# The current implementation is only somewhat object-oriented. The
+# LR parser itself is defined in terms of an object (which allows multiple
+# parsers to co-exist). However, most of the variables used during table
+# construction are defined in terms of global variables. Users shouldn't
+# notice unless they are trying to define multiple parsers at the same
+# time using threads (in which case they should have their head examined).
+#
+# This implementation supports both SLR and LALR(1) parsing. LALR(1)
+# support was originally implemented by Elias Ioup (ezioup@alumni.uchicago.edu),
+# using the algorithm found in Aho, Sethi, and Ullman "Compilers: Principles,
+# Techniques, and Tools" (The Dragon Book). LALR(1) has since been replaced
+# by the more efficient DeRemer and Pennello algorithm.
+#
+# :::::::: WARNING :::::::
+#
+# Construction of LR parsing tables is fairly complicated and expensive.
+# To make this module run fast, a *LOT* of work has been put into
+# optimization---often at the expensive of readability and what might
+# consider to be good Python "coding style." Modify the code at your
+# own risk!
+# ----------------------------------------------------------------------------
+
+__version__ = "2.2"
+
+#-----------------------------------------------------------------------------
+# === User configurable parameters ===
+#
+# Change these to modify the default behavior of yacc (if you wish)
+#-----------------------------------------------------------------------------
+
+yaccdebug = 1 # Debugging mode. If set, yacc generates a
+ # a 'parser.out' file in the current directory
+
+debug_file = 'parser.out' # Default name of the debugging file
+tab_module = 'parsetab' # Default name of the table module
+default_lr = 'LALR' # Default LR table generation method
+
+error_count = 3 # Number of symbols that must be shifted to leave recovery mode
+
+import re, types, sys, cStringIO, md5, os.path
+
+# Exception raised for yacc-related errors
+class YaccError(Exception): pass
+
+#-----------------------------------------------------------------------------
+# === LR Parsing Engine ===
+#
+# The following classes are used for the LR parser itself. These are not
+# used during table construction and are independent of the actual LR
+# table generation algorithm
+#-----------------------------------------------------------------------------
+
+# This class is used to hold non-terminal grammar symbols during parsing.
+# It normally has the following attributes set:
+# .type = Grammar symbol type
+# .value = Symbol value
+# .lineno = Starting line number
+# .endlineno = Ending line number (optional, set automatically)
+# .lexpos = Starting lex position
+# .endlexpos = Ending lex position (optional, set automatically)
+
+class YaccSymbol:
+ def __str__(self): return self.type
+ def __repr__(self): return str(self)
+
+# This class is a wrapper around the objects actually passed to each
+# grammar rule. Index lookup and assignment actually assign the
+# .value attribute of the underlying YaccSymbol object.
+# The lineno() method returns the line number of a given
+# item (or 0 if not defined). The linespan() method returns
+# a tuple of (startline,endline) representing the range of lines
+# for a symbol. The lexspan() method returns a tuple (lexpos,endlexpos)
+# representing the range of positional information for a symbol.
+
+class YaccProduction:
+ def __init__(self,s,stack=None):
+ self.slice = s
+ self.pbstack = []
+ self.stack = stack
+
+ def __getitem__(self,n):
+ if type(n) == types.IntType:
+ if n >= 0: return self.slice[n].value
+ else: return self.stack[n].value
+ else:
+ return [s.value for s in self.slice[n.start:n.stop:n.step]]
+
+ def __setitem__(self,n,v):
+ self.slice[n].value = v
+
+ def __len__(self):
+ return len(self.slice)
+
+ def lineno(self,n):
+ return getattr(self.slice[n],"lineno",0)
+
+ def linespan(self,n):
+ startline = getattr(self.slice[n],"lineno",0)
+ endline = getattr(self.slice[n],"endlineno",startline)
+ return startline,endline
+
+ def lexpos(self,n):
+ return getattr(self.slice[n],"lexpos",0)
+
+ def lexspan(self,n):
+ startpos = getattr(self.slice[n],"lexpos",0)
+ endpos = getattr(self.slice[n],"endlexpos",startpos)
+ return startpos,endpos
+
+ def pushback(self,n):
+ if n <= 0:
+ raise ValueError, "Expected a positive value"
+ if n > (len(self.slice)-1):
+ raise ValueError, "Can't push %d tokens. Only %d are available." % (n,len(self.slice)-1)
+ for i in range(0,n):
+ self.pbstack.append(self.slice[-i-1])
+
+# The LR Parsing engine. This is defined as a class so that multiple parsers
+# can exist in the same process. A user never instantiates this directly.
+# Instead, the global yacc() function should be used to create a suitable Parser
+# object.
+
+class Parser:
+ def __init__(self,magic=None):
+
+ # This is a hack to keep users from trying to instantiate a Parser
+ # object directly.
+
+ if magic != "xyzzy":
+ raise YaccError, "Can't instantiate Parser. Use yacc() instead."
+
+ # Reset internal state
+ self.productions = None # List of productions
+ self.errorfunc = None # Error handling function
+ self.action = { } # LR Action table
+ self.goto = { } # LR goto table
+ self.require = { } # Attribute require table
+ self.method = "Unknown LR" # Table construction method used
+
+ def errok(self):
+ self.errorcount = 0
+
+ def restart(self):
+ del self.statestack[:]
+ del self.symstack[:]
+ sym = YaccSymbol()
+ sym.type = '$end'
+ self.symstack.append(sym)
+ self.statestack.append(0)
+
+ def parse(self,input=None,lexer=None,debug=0):
+ lookahead = None # Current lookahead symbol
+ lookaheadstack = [ ] # Stack of lookahead symbols
+ actions = self.action # Local reference to action table
+ goto = self.goto # Local reference to goto table
+ prod = self.productions # Local reference to production list
+ pslice = YaccProduction(None) # Production object passed to grammar rules
+ pslice.parser = self # Parser object
+ self.errorcount = 0 # Used during error recovery
+
+ # If no lexer was given, we will try to use the lex module
+ if not lexer:
+ import lex
+ lexer = lex.lexer
+
+ pslice.lexer = lexer
+
+ # If input was supplied, pass to lexer
+ if input:
+ lexer.input(input)
+
+ # Tokenize function
+ get_token = lexer.token
+
+ statestack = [ ] # Stack of parsing states
+ self.statestack = statestack
+ symstack = [ ] # Stack of grammar symbols
+ self.symstack = symstack
+
+ pslice.stack = symstack # Put in the production
+ errtoken = None # Err token
+
+ # The start state is assumed to be (0,$end)
+ statestack.append(0)
+ sym = YaccSymbol()
+ sym.type = '$end'
+ symstack.append(sym)
+
+ while 1:
+ # Get the next symbol on the input. If a lookahead symbol
+ # is already set, we just use that. Otherwise, we'll pull
+ # the next token off of the lookaheadstack or from the lexer
+ if debug > 1:
+ print 'state', statestack[-1]
+ if not lookahead:
+ if not lookaheadstack:
+ lookahead = get_token() # Get the next token
+ else:
+ lookahead = lookaheadstack.pop()
+ if not lookahead:
+ lookahead = YaccSymbol()
+ lookahead.type = '$end'
+ if debug:
+ errorlead = ("%s . %s" % (" ".join([xx.type for xx in symstack][1:]), str(lookahead))).lstrip()
+
+ # Check the action table
+ s = statestack[-1]
+ ltype = lookahead.type
+ t = actions.get((s,ltype),None)
+
+ if debug > 1:
+ print 'action', t
+ if t is not None:
+ if t > 0:
+ # shift a symbol on the stack
+ if ltype == '$end':
+ # Error, end of input
+ sys.stderr.write("yacc: Parse error. EOF\n")
+ return
+ statestack.append(t)
+ if debug > 1:
+ sys.stderr.write("%-60s shift state %s\n" % (errorlead, t))
+ symstack.append(lookahead)
+ lookahead = None
+
+ # Decrease error count on successful shift
+ if self.errorcount > 0:
+ self.errorcount -= 1
+
+ continue
+
+ if t < 0:
+ # reduce a symbol on the stack, emit a production
+ p = prod[-t]
+ pname = p.name
+ plen = p.len
+
+ # Get production function
+ sym = YaccSymbol()
+ sym.type = pname # Production name
+ sym.value = None
+ if debug > 1:
+ sys.stderr.write("%-60s reduce %d\n" % (errorlead, -t))
+
+ if plen:
+ targ = symstack[-plen-1:]
+ targ[0] = sym
+ try:
+ sym.lineno = targ[1].lineno
+ sym.endlineno = getattr(targ[-1],"endlineno",targ[-1].lineno)
+ sym.lexpos = targ[1].lexpos
+ sym.endlexpos = getattr(targ[-1],"endlexpos",targ[-1].lexpos)
+ except AttributeError:
+ sym.lineno = 0
+ del symstack[-plen:]
+ del statestack[-plen:]
+ else:
+ sym.lineno = 0
+ targ = [ sym ]
+ pslice.slice = targ
+ pslice.pbstack = []
+ # Call the grammar rule with our special slice object
+ p.func(pslice)
+
+ # If there was a pushback, put that on the stack
+ if pslice.pbstack:
+ lookaheadstack.append(lookahead)
+ for _t in pslice.pbstack:
+ lookaheadstack.append(_t)
+ lookahead = None
+
+ symstack.append(sym)
+ statestack.append(goto[statestack[-1],pname])
+ continue
+
+ if t == 0:
+ n = symstack[-1]
+ return getattr(n,"value",None)
+ sys.stderr.write(errorlead, "\n")
+
+ if t == None:
+ if debug:
+ sys.stderr.write(errorlead + "\n")
+ # We have some kind of parsing error here. To handle
+ # this, we are going to push the current token onto
+ # the tokenstack and replace it with an 'error' token.
+ # If there are any synchronization rules, they may
+ # catch it.
+ #
+ # In addition to pushing the error token, we call call
+ # the user defined p_error() function if this is the
+ # first syntax error. This function is only called if
+ # errorcount == 0.
+ if not self.errorcount:
+ self.errorcount = error_count
+ errtoken = lookahead
+ if errtoken.type == '$end':
+ errtoken = None # End of file!
+ if self.errorfunc:
+ global errok,token,restart
+ errok = self.errok # Set some special functions available in error recovery
+ token = get_token
+ restart = self.restart
+ tok = self.errorfunc(errtoken)
+ del errok, token, restart # Delete special functions
+
+ if not self.errorcount:
+ # User must have done some kind of panic
+ # mode recovery on their own. The
+ # returned token is the next lookahead
+ lookahead = tok
+ errtoken = None
+ continue
+ else:
+ if errtoken:
+ if hasattr(errtoken,"lineno"): lineno = lookahead.lineno
+ else: lineno = 0
+ if lineno:
+ sys.stderr.write("yacc: Syntax error at line %d, token=%s\n" % (lineno, errtoken.type))
+ else:
+ sys.stderr.write("yacc: Syntax error, token=%s" % errtoken.type)
+ else:
+ sys.stderr.write("yacc: Parse error in input. EOF\n")
+ return
+
+ else:
+ self.errorcount = error_count
+
+ # case 1: the statestack only has 1 entry on it. If we're in this state, the
+ # entire parse has been rolled back and we're completely hosed. The token is
+ # discarded and we just keep going.
+
+ if len(statestack) <= 1 and lookahead.type != '$end':
+ lookahead = None
+ errtoken = None
+ # Nuke the pushback stack
+ del lookaheadstack[:]
+ continue
+
+ # case 2: the statestack has a couple of entries on it, but we're
+ # at the end of the file. nuke the top entry and generate an error token
+
+ # Start nuking entries on the stack
+ if lookahead.type == '$end':
+ # Whoa. We're really hosed here. Bail out
+ return
+
+ if lookahead.type != 'error':
+ sym = symstack[-1]
+ if sym.type == 'error':
+ # Hmmm. Error is on top of stack, we'll just nuke input
+ # symbol and continue
+ lookahead = None
+ continue
+ t = YaccSymbol()
+ t.type = 'error'
+ if hasattr(lookahead,"lineno"):
+ t.lineno = lookahead.lineno
+ t.value = lookahead
+ lookaheadstack.append(lookahead)
+ lookahead = t
+ else:
+ symstack.pop()
+ statestack.pop()
+
+ continue
+
+ # Call an error function here
+ raise RuntimeError, "yacc: internal parser error!!!\n"
+
+# -----------------------------------------------------------------------------
+# === Parser Construction ===
+#
+# The following functions and variables are used to implement the yacc() function
+# itself. This is pretty hairy stuff involving lots of error checking,
+# construction of LR items, kernels, and so forth. Although a lot of
+# this work is done using global variables, the resulting Parser object
+# is completely self contained--meaning that it is safe to repeatedly
+# call yacc() with different grammars in the same application.
+# -----------------------------------------------------------------------------
+
+# -----------------------------------------------------------------------------
+# validate_file()
+#
+# This function checks to see if there are duplicated p_rulename() functions
+# in the parser module file. Without this function, it is really easy for
+# users to make mistakes by cutting and pasting code fragments (and it's a real
+# bugger to try and figure out why the resulting parser doesn't work). Therefore,
+# we just do a little regular expression pattern matching of def statements
+# to try and detect duplicates.
+# -----------------------------------------------------------------------------
+
+def validate_file(filename):
+ base,ext = os.path.splitext(filename)
+ if ext != '.py': return 1 # No idea. Assume it's okay.
+
+ try:
+ f = open(filename)
+ lines = f.readlines()
+ f.close()
+ except IOError:
+ return 1 # Oh well
+
+ # Match def p_funcname(
+ fre = re.compile(r'\s*def\s+(p_[a-zA-Z_0-9]*)\(')
+ counthash = { }
+ linen = 1
+ noerror = 1
+ for l in lines:
+ m = fre.match(l)
+ if m:
+ name = m.group(1)
+ prev = counthash.get(name)
+ if not prev:
+ counthash[name] = linen
+ else:
+ sys.stderr.write("%s:%d: Function %s redefined. Previously defined on line %d\n" % (filename,linen,name,prev))
+ noerror = 0
+ linen += 1
+ return noerror
+
+# This function looks for functions that might be grammar rules, but which don't have the proper p_suffix.
+def validate_dict(d):
+ for n,v in d.items():
+ if n[0:2] == 'p_' and type(v) in (types.FunctionType, types.MethodType): continue
+ if n[0:2] == 't_': continue
+
+ if n[0:2] == 'p_':
+ sys.stderr.write("yacc: Warning. '%s' not defined as a function\n" % n)
+ if 1 and isinstance(v,types.FunctionType) and v.func_code.co_argcount == 1:
+ try:
+ doc = v.__doc__.split(" ")
+ if doc[1] == ':':
+ sys.stderr.write("%s:%d: Warning. Possible grammar rule '%s' defined without p_ prefix.\n" % (v.func_code.co_filename, v.func_code.co_firstlineno,n))
+ except StandardError:
+ pass
+
+# -----------------------------------------------------------------------------
+# === GRAMMAR FUNCTIONS ===
+#
+# The following global variables and functions are used to store, manipulate,
+# and verify the grammar rules specified by the user.
+# -----------------------------------------------------------------------------
+
+# Initialize all of the global variables used during grammar construction
+def initialize_vars():
+ global Productions, Prodnames, Prodmap, Terminals
+ global Nonterminals, First, Follow, Precedence, LRitems
+ global Errorfunc, Signature, Requires
+
+ Productions = [None] # A list of all of the productions. The first
+ # entry is always reserved for the purpose of
+ # building an augmented grammar
+
+ Prodnames = { } # A dictionary mapping the names of nonterminals to a list of all
+ # productions of that nonterminal.
+
+ Prodmap = { } # A dictionary that is only used to detect duplicate
+ # productions.
+
+ Terminals = { } # A dictionary mapping the names of terminal symbols to a
+ # list of the rules where they are used.
+
+ Nonterminals = { } # A dictionary mapping names of nonterminals to a list
+ # of rule numbers where they are used.
+
+ First = { } # A dictionary of precomputed FIRST(x) symbols
+
+ Follow = { } # A dictionary of precomputed FOLLOW(x) symbols
+
+ Precedence = { } # Precedence rules for each terminal. Contains tuples of the
+ # form ('right',level) or ('nonassoc', level) or ('left',level)
+
+ LRitems = [ ] # A list of all LR items for the grammar. These are the
+ # productions with the "dot" like E -> E . PLUS E
+
+ Errorfunc = None # User defined error handler
+
+ Signature = md5.new() # Digital signature of the grammar rules, precedence
+ # and other information. Used to determined when a
+ # parsing table needs to be regenerated.
+
+ Requires = { } # Requires list
+
+ # File objects used when creating the parser.out debugging file
+ global _vf, _vfc
+ _vf = cStringIO.StringIO()
+ _vfc = cStringIO.StringIO()
+
+# -----------------------------------------------------------------------------
+# class Production:
+#
+# This class stores the raw information about a single production or grammar rule.
+# It has a few required attributes:
+#
+# name - Name of the production (nonterminal)
+# prod - A list of symbols making up its production
+# number - Production number.
+#
+# In addition, a few additional attributes are used to help with debugging or
+# optimization of table generation.
+#
+# file - File where production action is defined.
+# lineno - Line number where action is defined
+# func - Action function
+# prec - Precedence level
+# lr_next - Next LR item. Example, if we are ' E -> E . PLUS E'
+# then lr_next refers to 'E -> E PLUS . E'
+# lr_index - LR item index (location of the ".") in the prod list.
+# lookaheads - LALR lookahead symbols for this item
+# len - Length of the production (number of symbols on right hand side)
+# -----------------------------------------------------------------------------
+
+class Production:
+ def __init__(self,**kw):
+ for k,v in kw.items():
+ setattr(self,k,v)
+ self.lr_index = -1
+ self.lr0_added = 0 # Flag indicating whether or not added to LR0 closure
+ self.lr1_added = 0 # Flag indicating whether or not added to LR1
+ self.usyms = [ ]
+ self.lookaheads = { }
+ self.lk_added = { }
+ self.setnumbers = [ ]
+
+ def __str__(self):
+ if self.prod:
+ s = "%s -> %s" % (self.name," ".join(self.prod))
+ else:
+ s = "%s -> <empty>" % self.name
+ return s
+
+ def __repr__(self):
+ return str(self)
+
+ # Compute lr_items from the production
+ def lr_item(self,n):
+ if n > len(self.prod): return None
+ p = Production()
+ p.name = self.name
+ p.prod = list(self.prod)
+ p.number = self.number
+ p.lr_index = n
+ p.lookaheads = { }
+ p.setnumbers = self.setnumbers
+ p.prod.insert(n,".")
+ p.prod = tuple(p.prod)
+ p.len = len(p.prod)
+ p.usyms = self.usyms
+
+ # Precompute list of productions immediately following
+ try:
+ p.lrafter = Prodnames[p.prod[n+1]]
+ except (IndexError,KeyError),e:
+ p.lrafter = []
+ try:
+ p.lrbefore = p.prod[n-1]
+ except IndexError:
+ p.lrbefore = None
+
+ return p
+
+class MiniProduction:
+ pass
+
+# regex matching identifiers
+_is_identifier = re.compile(r'^[a-zA-Z0-9_-]+$')
+
+# -----------------------------------------------------------------------------
+# add_production()
+#
+# Given an action function, this function assembles a production rule.
+# The production rule is assumed to be found in the function's docstring.
+# This rule has the general syntax:
+#
+# name1 ::= production1
+# | production2
+# | production3
+# ...
+# | productionn
+# name2 ::= production1
+# | production2
+# ...
+# -----------------------------------------------------------------------------
+
+def add_production(f,file,line,prodname,syms):
+
+ if Terminals.has_key(prodname):
+ sys.stderr.write("%s:%d: Illegal rule name '%s'. Already defined as a token.\n" % (file,line,prodname))
+ return -1
+ if prodname == 'error':
+ sys.stderr.write("%s:%d: Illegal rule name '%s'. error is a reserved word.\n" % (file,line,prodname))
+ return -1
+
+ if not _is_identifier.match(prodname):
+ sys.stderr.write("%s:%d: Illegal rule name '%s'\n" % (file,line,prodname))
+ return -1
+
+ for x in range(len(syms)):
+ s = syms[x]
+ if s[0] in "'\"":
+ try:
+ c = eval(s)
+ if (len(c) > 1):
+ sys.stderr.write("%s:%d: Literal token %s in rule '%s' may only be a single character\n" % (file,line,s, prodname))
+ return -1
+ if not Terminals.has_key(c):
+ Terminals[c] = []
+ syms[x] = c
+ continue
+ except SyntaxError:
+ pass
+ if not _is_identifier.match(s) and s != '%prec':
+ sys.stderr.write("%s:%d: Illegal name '%s' in rule '%s'\n" % (file,line,s, prodname))
+ return -1
+
+ # See if the rule is already in the rulemap
+ map = "%s -> %s" % (prodname,syms)
+ if Prodmap.has_key(map):
+ m = Prodmap[map]
+ sys.stderr.write("%s:%d: Duplicate rule %s.\n" % (file,line, m))
+ sys.stderr.write("%s:%d: Previous definition at %s:%d\n" % (file,line, m.file, m.line))
+ return -1
+
+ p = Production()
+ p.name = prodname
+ p.prod = syms
+ p.file = file
+ p.line = line
+ p.func = f
+ p.number = len(Productions)
+
+
+ Productions.append(p)
+ Prodmap[map] = p
+ if not Nonterminals.has_key(prodname):
+ Nonterminals[prodname] = [ ]
+
+ # Add all terminals to Terminals
+ i = 0
+ while i < len(p.prod):
+ t = p.prod[i]
+ if t == '%prec':
+ try:
+ precname = p.prod[i+1]
+ except IndexError:
+ sys.stderr.write("%s:%d: Syntax error. Nothing follows %%prec.\n" % (p.file,p.line))
+ return -1
+
+ prec = Precedence.get(precname,None)
+ if not prec:
+ sys.stderr.write("%s:%d: Nothing known about the precedence of '%s'\n" % (p.file,p.line,precname))
+ return -1
+ else:
+ p.prec = prec
+ del p.prod[i]
+ del p.prod[i]
+ continue
+
+ if Terminals.has_key(t):
+ Terminals[t].append(p.number)
+ # Is a terminal. We'll assign a precedence to p based on this
+ if not hasattr(p,"prec"):
+ p.prec = Precedence.get(t,('right',0))
+ else:
+ if not Nonterminals.has_key(t):
+ Nonterminals[t] = [ ]
+ Nonterminals[t].append(p.number)
+ i += 1
+
+ if not hasattr(p,"prec"):
+ p.prec = ('right',0)
+
+ # Set final length of productions
+ p.len = len(p.prod)
+ p.prod = tuple(p.prod)
+
+ # Calculate unique syms in the production
+ p.usyms = [ ]
+ for s in p.prod:
+ if s not in p.usyms:
+ p.usyms.append(s)
+
+ # Add to the global productions list
+ try:
+ Prodnames[p.name].append(p)
+ except KeyError:
+ Prodnames[p.name] = [ p ]
+ return 0
+
+# Given a raw rule function, this function rips out its doc string
+# and adds rules to the grammar
+
+def add_function(f):
+ line = f.func_code.co_firstlineno
+ file = f.func_code.co_filename
+ error = 0
+
+ if isinstance(f,types.MethodType):
+ reqdargs = 2
+ else:
+ reqdargs = 1
+
+ if f.func_code.co_argcount > reqdargs:
+ sys.stderr.write("%s:%d: Rule '%s' has too many arguments.\n" % (file,line,f.__name__))
+ return -1
+
+ if f.func_code.co_argcount < reqdargs:
+ sys.stderr.write("%s:%d: Rule '%s' requires an argument.\n" % (file,line,f.__name__))
+ return -1
+
+ if f.__doc__:
+ # Split the doc string into lines
+ pstrings = f.__doc__.splitlines()
+ lastp = None
+ dline = line
+ for ps in pstrings:
+ dline += 1
+ p = ps.split()
+ if not p: continue
+ try:
+ if p[0] == '|':
+ # This is a continuation of a previous rule
+ if not lastp:
+ sys.stderr.write("%s:%d: Misplaced '|'.\n" % (file,dline))
+ return -1
+ prodname = lastp
+ if len(p) > 1:
+ syms = p[1:]
+ else:
+ syms = [ ]
+ else:
+ prodname = p[0]
+ lastp = prodname
+ assign = p[1]
+ if len(p) > 2:
+ syms = p[2:]
+ else:
+ syms = [ ]
+ if assign != ':' and assign != '::=':
+ sys.stderr.write("%s:%d: Syntax error. Expected ':'\n" % (file,dline))
+ return -1
+
+
+ e = add_production(f,file,dline,prodname,syms)
+ error += e
+
+
+ except StandardError:
+ sys.stderr.write("%s:%d: Syntax error in rule '%s'\n" % (file,dline,ps))
+ error -= 1
+ else:
+ sys.stderr.write("%s:%d: No documentation string specified in function '%s'\n" % (file,line,f.__name__))
+ return error
+
+
+# Cycle checking code (Michael Dyck)
+
+def compute_reachable():
+ '''
+ Find each symbol that can be reached from the start symbol.
+ Print a warning for any nonterminals that can't be reached.
+ (Unused terminals have already had their warning.)
+ '''
+ Reachable = { }
+ for s in Terminals.keys() + Nonterminals.keys():
+ Reachable[s] = 0
+
+ mark_reachable_from( Productions[0].prod[0], Reachable )
+
+ for s in Nonterminals.keys():
+ if not Reachable[s]:
+ sys.stderr.write("yacc: Symbol '%s' is unreachable.\n" % s)
+
+def mark_reachable_from(s, Reachable):
+ '''
+ Mark all symbols that are reachable from symbol s.
+ '''
+ if Reachable[s]:
+ # We've already reached symbol s.
+ return
+ Reachable[s] = 1
+ for p in Prodnames.get(s,[]):
+ for r in p.prod:
+ mark_reachable_from(r, Reachable)
+
+# -----------------------------------------------------------------------------
+# compute_terminates()
+#
+# This function looks at the various parsing rules and tries to detect
+# infinite recursion cycles (grammar rules where there is no possible way
+# to derive a string of only terminals).
+# -----------------------------------------------------------------------------
+def compute_terminates():
+ '''
+ Raise an error for any symbols that don't terminate.
+ '''
+ Terminates = {}
+
+ # Terminals:
+ for t in Terminals.keys():
+ Terminates[t] = 1
+
+ Terminates['$end'] = 1
+
+ # Nonterminals:
+
+ # Initialize to false:
+ for n in Nonterminals.keys():
+ Terminates[n] = 0
+
+ # Then propagate termination until no change:
+ while 1:
+ some_change = 0
+ for (n,pl) in Prodnames.items():
+ # Nonterminal n terminates iff any of its productions terminates.
+ for p in pl:
+ # Production p terminates iff all of its rhs symbols terminate.
+ for s in p.prod:
+ if not Terminates[s]:
+ # The symbol s does not terminate,
+ # so production p does not terminate.
+ p_terminates = 0
+ break
+ else:
+ # didn't break from the loop,
+ # so every symbol s terminates
+ # so production p terminates.
+ p_terminates = 1
+
+ if p_terminates:
+ # symbol n terminates!
+ if not Terminates[n]:
+ Terminates[n] = 1
+ some_change = 1
+ # Don't need to consider any more productions for this n.
+ break
+
+ if not some_change:
+ break
+
+ some_error = 0
+ for (s,terminates) in Terminates.items():
+ if not terminates:
+ if not Prodnames.has_key(s) and not Terminals.has_key(s) and s != 'error':
+ # s is used-but-not-defined, and we've already warned of that,
+ # so it would be overkill to say that it's also non-terminating.
+ pass
+ else:
+ sys.stderr.write("yacc: Infinite recursion detected for symbol '%s'.\n" % s)
+ some_error = 1
+
+ return some_error
+
+# -----------------------------------------------------------------------------
+# verify_productions()
+#
+# This function examines all of the supplied rules to see if they seem valid.
+# -----------------------------------------------------------------------------
+def verify_productions(cycle_check=1):
+ error = 0
+ for p in Productions:
+ if not p: continue
+
+ for s in p.prod:
+ if not Prodnames.has_key(s) and not Terminals.has_key(s) and s != 'error':
+ sys.stderr.write("%s:%d: Symbol '%s' used, but not defined as a token or a rule.\n" % (p.file,p.line,s))
+ error = 1
+ continue
+
+ unused_tok = 0
+ # Now verify all of the tokens
+ if yaccdebug:
+ _vf.write("Unused terminals:\n\n")
+ for s,v in Terminals.items():
+ if s != 'error' and not v:
+ sys.stderr.write("yacc: Warning. Token '%s' defined, but not used.\n" % s)
+ if yaccdebug: _vf.write(" %s\n"% s)
+ unused_tok += 1
+
+ # Print out all of the productions
+ if yaccdebug:
+ _vf.write("\nGrammar\n\n")
+ for i in range(1,len(Productions)):
+ _vf.write("Rule %-5d %s\n" % (i, Productions[i]))
+
+ unused_prod = 0
+ # Verify the use of all productions
+ for s,v in Nonterminals.items():
+ if not v:
+ p = Prodnames[s][0]
+ sys.stderr.write("%s:%d: Warning. Rule '%s' defined, but not used.\n" % (p.file,p.line, s))
+ unused_prod += 1
+
+
+ if unused_tok == 1:
+ sys.stderr.write("yacc: Warning. There is 1 unused token.\n")
+ if unused_tok > 1:
+ sys.stderr.write("yacc: Warning. There are %d unused tokens.\n" % unused_tok)
+
+ if unused_prod == 1:
+ sys.stderr.write("yacc: Warning. There is 1 unused rule.\n")
+ if unused_prod > 1:
+ sys.stderr.write("yacc: Warning. There are %d unused rules.\n" % unused_prod)
+
+ if yaccdebug:
+ _vf.write("\nTerminals, with rules where they appear\n\n")
+ ks = Terminals.keys()
+ ks.sort()
+ for k in ks:
+ _vf.write("%-20s : %s\n" % (k, " ".join([str(s) for s in Terminals[k]])))
+ _vf.write("\nNonterminals, with rules where they appear\n\n")
+ ks = Nonterminals.keys()
+ ks.sort()
+ for k in ks:
+ _vf.write("%-20s : %s\n" % (k, " ".join([str(s) for s in Nonterminals[k]])))
+
+ if (cycle_check):
+ compute_reachable()
+ error += compute_terminates()
+# error += check_cycles()
+ return error
+
+# -----------------------------------------------------------------------------
+# build_lritems()
+#
+# This function walks the list of productions and builds a complete set of the
+# LR items. The LR items are stored in two ways: First, they are uniquely
+# numbered and placed in the list _lritems. Second, a linked list of LR items
+# is built for each production. For example:
+#
+# E -> E PLUS E
+#
+# Creates the list
+#
+# [E -> . E PLUS E, E -> E . PLUS E, E -> E PLUS . E, E -> E PLUS E . ]
+# -----------------------------------------------------------------------------
+
+def build_lritems():
+ for p in Productions:
+ lastlri = p
+ lri = p.lr_item(0)
+ i = 0
+ while 1:
+ lri = p.lr_item(i)
+ lastlri.lr_next = lri
+ if not lri: break
+ lri.lr_num = len(LRitems)
+ LRitems.append(lri)
+ lastlri = lri
+ i += 1
+
+ # In order for the rest of the parser generator to work, we need to
+ # guarantee that no more lritems are generated. Therefore, we nuke
+ # the p.lr_item method. (Only used in debugging)
+ # Production.lr_item = None
+
+# -----------------------------------------------------------------------------
+# add_precedence()
+#
+# Given a list of precedence rules, add to the precedence table.
+# -----------------------------------------------------------------------------
+
+def add_precedence(plist):
+ plevel = 0
+ error = 0
+ for p in plist:
+ plevel += 1
+ try:
+ prec = p[0]
+ terms = p[1:]
+ if prec != 'left' and prec != 'right' and prec != 'nonassoc':
+ sys.stderr.write("yacc: Invalid precedence '%s'\n" % prec)
+ return -1
+ for t in terms:
+ if Precedence.has_key(t):
+ sys.stderr.write("yacc: Precedence already specified for terminal '%s'\n" % t)
+ error += 1
+ continue
+ Precedence[t] = (prec,plevel)
+ except:
+ sys.stderr.write("yacc: Invalid precedence table.\n")
+ error += 1
+
+ return error
+
+# -----------------------------------------------------------------------------
+# augment_grammar()
+#
+# Compute the augmented grammar. This is just a rule S' -> start where start
+# is the starting symbol.
+# -----------------------------------------------------------------------------
+
+def augment_grammar(start=None):
+ if not start:
+ start = Productions[1].name
+ Productions[0] = Production(name="S'",prod=[start],number=0,len=1,prec=('right',0),func=None)
+ Productions[0].usyms = [ start ]
+ Nonterminals[start].append(0)
+
+
+# -------------------------------------------------------------------------
+# first()
+#
+# Compute the value of FIRST1(beta) where beta is a tuple of symbols.
+#
+# During execution of compute_first1, the result may be incomplete.
+# Afterward (e.g., when called from compute_follow()), it will be complete.
+# -------------------------------------------------------------------------
+def first(beta):
+
+ # We are computing First(x1,x2,x3,...,xn)
+ result = [ ]
+ for x in beta:
+ x_produces_empty = 0
+
+ # Add all the non-<empty> symbols of First[x] to the result.
+ for f in First[x]:
+ if f == '<empty>':
+ x_produces_empty = 1
+ else:
+ if f not in result: result.append(f)
+
+ if x_produces_empty:
+ # We have to consider the next x in beta,
+ # i.e. stay in the loop.
+ pass
+ else:
+ # We don't have to consider any further symbols in beta.
+ break
+ else:
+ # There was no 'break' from the loop,
+ # so x_produces_empty was true for all x in beta,
+ # so beta produces empty as well.
+ result.append('<empty>')
+
+ return result
+
+
+# FOLLOW(x)
+# Given a non-terminal. This function computes the set of all symbols
+# that might follow it. Dragon book, p. 189.
+
+def compute_follow(start=None):
+ # Add '$end' to the follow list of the start symbol
+ for k in Nonterminals.keys():
+ Follow[k] = [ ]
+
+ if not start:
+ start = Productions[1].name
+
+ Follow[start] = [ '$end' ]
+
+ while 1:
+ didadd = 0
+ for p in Productions[1:]:
+ # Here is the production set
+ for i in range(len(p.prod)):
+ B = p.prod[i]
+ if Nonterminals.has_key(B):
+ # Okay. We got a non-terminal in a production
+ fst = first(p.prod[i+1:])
+ hasempty = 0
+ for f in fst:
+ if f != '<empty>' and f not in Follow[B]:
+ Follow[B].append(f)
+ didadd = 1
+ if f == '<empty>':
+ hasempty = 1
+ if hasempty or i == (len(p.prod)-1):
+ # Add elements of follow(a) to follow(b)
+ for f in Follow[p.name]:
+ if f not in Follow[B]:
+ Follow[B].append(f)
+ didadd = 1
+ if not didadd: break
+
+ if 0 and yaccdebug:
+ _vf.write('\nFollow:\n')
+ for k in Nonterminals.keys():
+ _vf.write("%-20s : %s\n" % (k, " ".join([str(s) for s in Follow[k]])))
+
+# -------------------------------------------------------------------------
+# compute_first1()
+#
+# Compute the value of FIRST1(X) for all symbols
+# -------------------------------------------------------------------------
+def compute_first1():
+
+ # Terminals:
+ for t in Terminals.keys():
+ First[t] = [t]
+
+ First['$end'] = ['$end']
+ First['#'] = ['#'] # what's this for?
+
+ # Nonterminals:
+
+ # Initialize to the empty set:
+ for n in Nonterminals.keys():
+ First[n] = []
+
+ # Then propagate symbols until no change:
+ while 1:
+ some_change = 0
+ for n in Nonterminals.keys():
+ for p in Prodnames[n]:
+ for f in first(p.prod):
+ if f not in First[n]:
+ First[n].append( f )
+ some_change = 1
+ if not some_change:
+ break
+
+ if 0 and yaccdebug:
+ _vf.write('\nFirst:\n')
+ for k in Nonterminals.keys():
+ _vf.write("%-20s : %s\n" %
+ (k, " ".join([str(s) for s in First[k]])))
+
+# -----------------------------------------------------------------------------
+# === SLR Generation ===
+#
+# The following functions are used to construct SLR (Simple LR) parsing tables
+# as described on p.221-229 of the dragon book.
+# -----------------------------------------------------------------------------
+
+# Global variables for the LR parsing engine
+def lr_init_vars():
+ global _lr_action, _lr_goto, _lr_method
+ global _lr_goto_cache, _lr0_cidhash
+
+ _lr_action = { } # Action table
+ _lr_goto = { } # Goto table
+ _lr_method = "Unknown" # LR method used
+ _lr_goto_cache = { }
+ _lr0_cidhash = { }
+
+
+# Compute the LR(0) closure operation on I, where I is a set of LR(0) items.
+# prodlist is a list of productions.
+
+_add_count = 0 # Counter used to detect cycles
+
+def lr0_closure(I):
+ global _add_count
+
+ _add_count += 1
+ prodlist = Productions
+
+ # Add everything in I to J
+ J = I[:]
+ didadd = 1
+ while didadd:
+ didadd = 0
+ for j in J:
+ for x in j.lrafter:
+ if x.lr0_added == _add_count: continue
+ # Add B --> .G to J
+ J.append(x.lr_next)
+ x.lr0_added = _add_count
+ didadd = 1
+
+ return J
+
+# Compute the LR(0) goto function goto(I,X) where I is a set
+# of LR(0) items and X is a grammar symbol. This function is written
+# in a way that guarantees uniqueness of the generated goto sets
+# (i.e. the same goto set will never be returned as two different Python
+# objects). With uniqueness, we can later do fast set comparisons using
+# id(obj) instead of element-wise comparison.
+
+def lr0_goto(I,x):
+ # First we look for a previously cached entry
+ g = _lr_goto_cache.get((id(I),x),None)
+ if g: return g
+
+ # Now we generate the goto set in a way that guarantees uniqueness
+ # of the result
+
+ s = _lr_goto_cache.get(x,None)
+ if not s:
+ s = { }
+ _lr_goto_cache[x] = s
+
+ gs = [ ]
+ for p in I:
+ n = p.lr_next
+ if n and n.lrbefore == x:
+ s1 = s.get(id(n),None)
+ if not s1:
+ s1 = { }
+ s[id(n)] = s1
+ gs.append(n)
+ s = s1
+ g = s.get('$end',None)
+ if not g:
+ if gs:
+ g = lr0_closure(gs)
+ s['$end'] = g
+ else:
+ s['$end'] = gs
+ _lr_goto_cache[(id(I),x)] = g
+ return g
+
+_lr0_cidhash = { }
+
+# Compute the LR(0) sets of item function
+def lr0_items():
+
+ C = [ lr0_closure([Productions[0].lr_next]) ]
+ i = 0
+ for I in C:
+ _lr0_cidhash[id(I)] = i
+ i += 1
+
+ # Loop over the items in C and each grammar symbols
+ i = 0
+ while i < len(C):
+ I = C[i]
+ i += 1
+
+ # Collect all of the symbols that could possibly be in the goto(I,X) sets
+ asyms = { }
+ for ii in I:
+ for s in ii.usyms:
+ asyms[s] = None
+
+ for x in asyms.keys():
+ g = lr0_goto(I,x)
+ if not g: continue
+ if _lr0_cidhash.has_key(id(g)): continue
+ _lr0_cidhash[id(g)] = len(C)
+ C.append(g)
+
+ return C
+
+# -----------------------------------------------------------------------------
+# ==== LALR(1) Parsing ====
+#
+# LALR(1) parsing is almost exactly the same as SLR except that instead of
+# relying upon Follow() sets when performing reductions, a more selective
+# lookahead set that incorporates the state of the LR(0) machine is utilized.
+# Thus, we mainly just have to focus on calculating the lookahead sets.
+#
+# The method used here is due to DeRemer and Pennelo (1982).
+#
+# DeRemer, F. L., and T. J. Pennelo: "Efficient Computation of LALR(1)
+# Lookahead Sets", ACM Transactions on Programming Languages and Systems,
+# Vol. 4, No. 4, Oct. 1982, pp. 615-649
+#
+# Further details can also be found in:
+#
+# J. Tremblay and P. Sorenson, "The Theory and Practice of Compiler Writing",
+# McGraw-Hill Book Company, (1985).
+#
+# Note: This implementation is a complete replacement of the LALR(1)
+# implementation in PLY-1.x releases. That version was based on
+# a less efficient algorithm and it had bugs in its implementation.
+# -----------------------------------------------------------------------------
+
+# -----------------------------------------------------------------------------
+# compute_nullable_nonterminals()
+#
+# Creates a dictionary containing all of the non-terminals that might produce
+# an empty production.
+# -----------------------------------------------------------------------------
+
+def compute_nullable_nonterminals():
+ nullable = {}
+ num_nullable = 0
+ while 1:
+ for p in Productions[1:]:
+ if p.len == 0:
+ nullable[p.name] = 1
+ continue
+ for t in p.prod:
+ if not nullable.has_key(t): break
+ else:
+ nullable[p.name] = 1
+ if len(nullable) == num_nullable: break
+ num_nullable = len(nullable)
+ return nullable
+
+# -----------------------------------------------------------------------------
+# find_nonterminal_trans(C)
+#
+# Given a set of LR(0) items, this functions finds all of the non-terminal
+# transitions. These are transitions in which a dot appears immediately before
+# a non-terminal. Returns a list of tuples of the form (state,N) where state
+# is the state number and N is the nonterminal symbol.
+#
+# The input C is the set of LR(0) items.
+# -----------------------------------------------------------------------------
+
+def find_nonterminal_transitions(C):
+ trans = []
+ for state in range(len(C)):
+ for p in C[state]:
+ if p.lr_index < p.len - 1:
+ t = (state,p.prod[p.lr_index+1])
+ if Nonterminals.has_key(t[1]):
+ if t not in trans: trans.append(t)
+ state = state + 1
+ return trans
+
+# -----------------------------------------------------------------------------
+# dr_relation()
+#
+# Computes the DR(p,A) relationships for non-terminal transitions. The input
+# is a tuple (state,N) where state is a number and N is a nonterminal symbol.
+#
+# Returns a list of terminals.
+# -----------------------------------------------------------------------------
+
+def dr_relation(C,trans,nullable):
+ dr_set = { }
+ state,N = trans
+ terms = []
+
+ g = lr0_goto(C[state],N)
+ for p in g:
+ if p.lr_index < p.len - 1:
+ a = p.prod[p.lr_index+1]
+ if Terminals.has_key(a):
+ if a not in terms: terms.append(a)
+
+ # This extra bit is to handle the start state
+ if state == 0 and N == Productions[0].prod[0]:
+ terms.append('$end')
+
+ return terms
+
+# -----------------------------------------------------------------------------
+# reads_relation()
+#
+# Computes the READS() relation (p,A) READS (t,C).
+# -----------------------------------------------------------------------------
+
+def reads_relation(C, trans, empty):
+ # Look for empty transitions
+ rel = []
+ state, N = trans
+
+ g = lr0_goto(C[state],N)
+ j = _lr0_cidhash.get(id(g),-1)
+ for p in g:
+ if p.lr_index < p.len - 1:
+ a = p.prod[p.lr_index + 1]
+ if empty.has_key(a):
+ rel.append((j,a))
+
+ return rel
+
+# -----------------------------------------------------------------------------
+# compute_lookback_includes()
+#
+# Determines the lookback and includes relations
+#
+# LOOKBACK:
+#
+# This relation is determined by running the LR(0) state machine forward.
+# For example, starting with a production "N : . A B C", we run it forward
+# to obtain "N : A B C ." We then build a relationship between this final
+# state and the starting state. These relationships are stored in a dictionary
+# lookdict.
+#
+# INCLUDES:
+#
+# Computes the INCLUDE() relation (p,A) INCLUDES (p',B).
+#
+# This relation is used to determine non-terminal transitions that occur
+# inside of other non-terminal transition states. (p,A) INCLUDES (p', B)
+# if the following holds:
+#
+# B -> LAT, where T -> epsilon and p' -L-> p
+#
+# L is essentially a prefix (which may be empty), T is a suffix that must be
+# able to derive an empty string. State p' must lead to state p with the string L.
+#
+# -----------------------------------------------------------------------------
+
+def compute_lookback_includes(C,trans,nullable):
+
+ lookdict = {} # Dictionary of lookback relations
+ includedict = {} # Dictionary of include relations
+
+ # Make a dictionary of non-terminal transitions
+ dtrans = {}
+ for t in trans:
+ dtrans[t] = 1
+
+ # Loop over all transitions and compute lookbacks and includes
+ for state,N in trans:
+ lookb = []
+ includes = []
+ for p in C[state]:
+ if p.name != N: continue
+
+ # Okay, we have a name match. We now follow the production all the way
+ # through the state machine until we get the . on the right hand side
+
+ lr_index = p.lr_index
+ j = state
+ while lr_index < p.len - 1:
+ lr_index = lr_index + 1
+ t = p.prod[lr_index]
+
+ # Check to see if this symbol and state are a non-terminal transition
+ if dtrans.has_key((j,t)):
+ # Yes. Okay, there is some chance that this is an includes relation
+ # the only way to know for certain is whether the rest of the
+ # production derives empty
+
+ li = lr_index + 1
+ while li < p.len:
+ if Terminals.has_key(p.prod[li]): break # No forget it
+ if not nullable.has_key(p.prod[li]): break
+ li = li + 1
+ else:
+ # Appears to be a relation between (j,t) and (state,N)
+ includes.append((j,t))
+
+ g = lr0_goto(C[j],t) # Go to next set
+ j = _lr0_cidhash.get(id(g),-1) # Go to next state
+
+ # When we get here, j is the final state, now we have to locate the production
+ for r in C[j]:
+ if r.name != p.name: continue
+ if r.len != p.len: continue
+ i = 0
+ # This look is comparing a production ". A B C" with "A B C ."
+ while i < r.lr_index:
+ if r.prod[i] != p.prod[i+1]: break
+ i = i + 1
+ else:
+ lookb.append((j,r))
+ for i in includes:
+ if not includedict.has_key(i): includedict[i] = []
+ includedict[i].append((state,N))
+ lookdict[(state,N)] = lookb
+
+ return lookdict,includedict
+
+# -----------------------------------------------------------------------------
+# digraph()
+# traverse()
+#
+# The following two functions are used to compute set valued functions
+# of the form:
+#
+# F(x) = F'(x) U U{F(y) | x R y}
+#
+# This is used to compute the values of Read() sets as well as FOLLOW sets
+# in LALR(1) generation.
+#
+# Inputs: X - An input set
+# R - A relation
+# FP - Set-valued function
+# ------------------------------------------------------------------------------
+
+def digraph(X,R,FP):
+ N = { }
+ for x in X:
+ N[x] = 0
+ stack = []
+ F = { }
+ for x in X:
+ if N[x] == 0: traverse(x,N,stack,F,X,R,FP)
+ return F
+
+def traverse(x,N,stack,F,X,R,FP):
+ stack.append(x)
+ d = len(stack)
+ N[x] = d
+ F[x] = FP(x) # F(X) <- F'(x)
+
+ rel = R(x) # Get y's related to x
+ for y in rel:
+ if N[y] == 0:
+ traverse(y,N,stack,F,X,R,FP)
+ N[x] = min(N[x],N[y])
+ for a in F.get(y,[]):
+ if a not in F[x]: F[x].append(a)
+ if N[x] == d:
+ N[stack[-1]] = sys.maxint
+ F[stack[-1]] = F[x]
+ element = stack.pop()
+ while element != x:
+ N[stack[-1]] = sys.maxint
+ F[stack[-1]] = F[x]
+ element = stack.pop()
+
+# -----------------------------------------------------------------------------
+# compute_read_sets()
+#
+# Given a set of LR(0) items, this function computes the read sets.
+#
+# Inputs: C = Set of LR(0) items
+# ntrans = Set of nonterminal transitions
+# nullable = Set of empty transitions
+#
+# Returns a set containing the read sets
+# -----------------------------------------------------------------------------
+
+def compute_read_sets(C, ntrans, nullable):
+ FP = lambda x: dr_relation(C,x,nullable)
+ R = lambda x: reads_relation(C,x,nullable)
+ F = digraph(ntrans,R,FP)
+ return F
+
+# -----------------------------------------------------------------------------
+# compute_follow_sets()
+#
+# Given a set of LR(0) items, a set of non-terminal transitions, a readset,
+# and an include set, this function computes the follow sets
+#
+# Follow(p,A) = Read(p,A) U U {Follow(p',B) | (p,A) INCLUDES (p',B)}
+#
+# Inputs:
+# ntrans = Set of nonterminal transitions
+# readsets = Readset (previously computed)
+# inclsets = Include sets (previously computed)
+#
+# Returns a set containing the follow sets
+# -----------------------------------------------------------------------------
+
+def compute_follow_sets(ntrans,readsets,inclsets):
+ FP = lambda x: readsets[x]
+ R = lambda x: inclsets.get(x,[])
+ F = digraph(ntrans,R,FP)
+ return F
+
+# -----------------------------------------------------------------------------
+# add_lookaheads()
+#
+# Attaches the lookahead symbols to grammar rules.
+#
+# Inputs: lookbacks - Set of lookback relations
+# followset - Computed follow set
+#
+# This function directly attaches the lookaheads to productions contained
+# in the lookbacks set
+# -----------------------------------------------------------------------------
+
+def add_lookaheads(lookbacks,followset):
+ for trans,lb in lookbacks.items():
+ # Loop over productions in lookback
+ for state,p in lb:
+ if not p.lookaheads.has_key(state):
+ p.lookaheads[state] = []
+ f = followset.get(trans,[])
+ for a in f:
+ if a not in p.lookaheads[state]: p.lookaheads[state].append(a)
+
+# -----------------------------------------------------------------------------
+# add_lalr_lookaheads()
+#
+# This function does all of the work of adding lookahead information for use
+# with LALR parsing
+# -----------------------------------------------------------------------------
+
+def add_lalr_lookaheads(C):
+ # Determine all of the nullable nonterminals
+ nullable = compute_nullable_nonterminals()
+
+ # Find all non-terminal transitions
+ trans = find_nonterminal_transitions(C)
+
+ # Compute read sets
+ readsets = compute_read_sets(C,trans,nullable)
+
+ # Compute lookback/includes relations
+ lookd, included = compute_lookback_includes(C,trans,nullable)
+
+ # Compute LALR FOLLOW sets
+ followsets = compute_follow_sets(trans,readsets,included)
+
+ # Add all of the lookaheads
+ add_lookaheads(lookd,followsets)
+
+# -----------------------------------------------------------------------------
+# lr_parse_table()
+#
+# This function constructs the parse tables for SLR or LALR
+# -----------------------------------------------------------------------------
+def lr_parse_table(method):
+ global _lr_method
+ goto = _lr_goto # Goto array
+ action = _lr_action # Action array
+ actionp = { } # Action production array (temporary)
+
+ _lr_method = method
+
+ n_srconflict = 0
+ n_rrconflict = 0
+
+ if yaccdebug:
+ sys.stderr.write("yacc: Generating %s parsing table...\n" % method)
+ _vf.write("\n\nParsing method: %s\n\n" % method)
+
+ # Step 1: Construct C = { I0, I1, ... IN}, collection of LR(0) items
+ # This determines the number of states
+
+ C = lr0_items()
+
+ if method == 'LALR':
+ add_lalr_lookaheads(C)
+
+ # Build the parser table, state by state
+ st = 0
+ for I in C:
+ # Loop over each production in I
+ actlist = [ ] # List of actions
+
+ if yaccdebug:
+ _vf.write("\nstate %d\n\n" % st)
+ for p in I:
+ _vf.write(" (%d) %s\n" % (p.number, str(p)))
+ _vf.write("\n")
+
+ for p in I:
+ try:
+ if p.prod[-1] == ".":
+ if p.name == "S'":
+ # Start symbol. Accept!
+ action[st,"$end"] = 0
+ actionp[st,"$end"] = p
+ else:
+ # We are at the end of a production. Reduce!
+ if method == 'LALR':
+ laheads = p.lookaheads[st]
+ else:
+ laheads = Follow[p.name]
+ for a in laheads:
+ actlist.append((a,p,"reduce using rule %d (%s)" % (p.number,p)))
+ r = action.get((st,a),None)
+ if r is not None:
+ # Whoa. Have a shift/reduce or reduce/reduce conflict
+ if r > 0:
+ # Need to decide on shift or reduce here
+ # By default we favor shifting. Need to add
+ # some precedence rules here.
+ sprec,slevel = Productions[actionp[st,a].number].prec
+ rprec,rlevel = Precedence.get(a,('right',0))
+ if (slevel < rlevel) or ((slevel == rlevel) and (rprec == 'left')):
+ # We really need to reduce here.
+ action[st,a] = -p.number
+ actionp[st,a] = p
+ if not slevel and not rlevel:
+ _vfc.write("shift/reduce conflict in state %d resolved as reduce.\n" % st)
+ _vf.write(" ! shift/reduce conflict for %s resolved as reduce.\n" % a)
+ n_srconflict += 1
+ elif (slevel == rlevel) and (rprec == 'nonassoc'):
+ action[st,a] = None
+ else:
+ # Hmmm. Guess we'll keep the shift
+ if not rlevel:
+ _vfc.write("shift/reduce conflict in state %d resolved as shift.\n" % st)
+ _vf.write(" ! shift/reduce conflict for %s resolved as shift.\n" % a)
+ n_srconflict +=1
+ elif r < 0:
+ # Reduce/reduce conflict. In this case, we favor the rule
+ # that was defined first in the grammar file
+ oldp = Productions[-r]
+ pp = Productions[p.number]
+ if oldp.line > pp.line:
+ action[st,a] = -p.number
+ actionp[st,a] = p
+ # sys.stderr.write("Reduce/reduce conflict in state %d\n" % st)
+ n_rrconflict += 1
+ _vfc.write("reduce/reduce conflict in state %d resolved using rule %d (%s).\n" % (st, actionp[st,a].number, actionp[st,a]))
+ _vf.write(" ! reduce/reduce conflict for %s resolved using rule %d (%s).\n" % (a,actionp[st,a].number, actionp[st,a]))
+ else:
+ sys.stderr.write("Unknown conflict in state %d\n" % st)
+ else:
+ action[st,a] = -p.number
+ actionp[st,a] = p
+ else:
+ i = p.lr_index
+ a = p.prod[i+1] # Get symbol right after the "."
+ if Terminals.has_key(a):
+ g = lr0_goto(I,a)
+ j = _lr0_cidhash.get(id(g),-1)
+ if j >= 0:
+ # We are in a shift state
+ actlist.append((a,p,"shift and go to state %d" % j))
+ r = action.get((st,a),None)
+ if r is not None:
+ # Whoa have a shift/reduce or shift/shift conflict
+ if r > 0:
+ if r != j:
+ sys.stderr.write("Shift/shift conflict in state %d\n" % st)
+ elif r < 0:
+ # Do a precedence check.
+ # - if precedence of reduce rule is higher, we reduce.
+ # - if precedence of reduce is same and left assoc, we reduce.
+ # - otherwise we shift
+ rprec,rlevel = Productions[actionp[st,a].number].prec
+ sprec,slevel = Precedence.get(a,('right',0))
+ if (slevel > rlevel) or ((slevel == rlevel) and (rprec != 'left')):
+ # We decide to shift here... highest precedence to shift
+ action[st,a] = j
+ actionp[st,a] = p
+ if not rlevel:
+ n_srconflict += 1
+ _vfc.write("shift/reduce conflict in state %d resolved as shift.\n" % st)
+ _vf.write(" ! shift/reduce conflict for %s resolved as shift.\n" % a)
+ elif (slevel == rlevel) and (rprec == 'nonassoc'):
+ action[st,a] = None
+ else:
+ # Hmmm. Guess we'll keep the reduce
+ if not slevel and not rlevel:
+ n_srconflict +=1
+ _vfc.write("shift/reduce conflict in state %d resolved as reduce.\n" % st)
+ _vf.write(" ! shift/reduce conflict for %s resolved as reduce.\n" % a)
+
+ else:
+ sys.stderr.write("Unknown conflict in state %d\n" % st)
+ else:
+ action[st,a] = j
+ actionp[st,a] = p
+
+ except StandardError,e:
+ raise YaccError, "Hosed in lr_parse_table", e
+
+ # Print the actions associated with each terminal
+ if yaccdebug:
+ _actprint = { }
+ for a,p,m in actlist:
+ if action.has_key((st,a)):
+ if p is actionp[st,a]:
+ _vf.write(" %-15s %s\n" % (a,m))
+ _actprint[(a,m)] = 1
+ _vf.write("\n")
+ for a,p,m in actlist:
+ if action.has_key((st,a)):
+ if p is not actionp[st,a]:
+ if not _actprint.has_key((a,m)):
+ _vf.write(" ! %-15s [ %s ]\n" % (a,m))
+ _actprint[(a,m)] = 1
+
+ # Construct the goto table for this state
+ if yaccdebug:
+ _vf.write("\n")
+ nkeys = { }
+ for ii in I:
+ for s in ii.usyms:
+ if Nonterminals.has_key(s):
+ nkeys[s] = None
+ for n in nkeys.keys():
+ g = lr0_goto(I,n)
+ j = _lr0_cidhash.get(id(g),-1)
+ if j >= 0:
+ goto[st,n] = j
+ if yaccdebug:
+ _vf.write(" %-30s shift and go to state %d\n" % (n,j))
+
+ st += 1
+
+ if yaccdebug:
+ if n_srconflict == 1:
+ sys.stderr.write("yacc: %d shift/reduce conflict\n" % n_srconflict)
+ if n_srconflict > 1:
+ sys.stderr.write("yacc: %d shift/reduce conflicts\n" % n_srconflict)
+ if n_rrconflict == 1:
+ sys.stderr.write("yacc: %d reduce/reduce conflict\n" % n_rrconflict)
+ if n_rrconflict > 1:
+ sys.stderr.write("yacc: %d reduce/reduce conflicts\n" % n_rrconflict)
+
+# -----------------------------------------------------------------------------
+# ==== LR Utility functions ====
+# -----------------------------------------------------------------------------
+
+# -----------------------------------------------------------------------------
+# _lr_write_tables()
+#
+# This function writes the LR parsing tables to a file
+# -----------------------------------------------------------------------------
+
+def lr_write_tables(modulename=tab_module,outputdir=''):
+ filename = os.path.join(outputdir,modulename) + ".py"
+ try:
+ f = open(filename,"w")
+
+ f.write("""
+# %s
+# This file is automatically generated. Do not edit.
+
+_lr_method = %s
+
+_lr_signature = %s
+""" % (filename, repr(_lr_method), repr(Signature.digest())))
+
+ # Change smaller to 0 to go back to original tables
+ smaller = 1
+
+ # Factor out names to try and make smaller
+ if smaller:
+ items = { }
+
+ for k,v in _lr_action.items():
+ i = items.get(k[1])
+ if not i:
+ i = ([],[])
+ items[k[1]] = i
+ i[0].append(k[0])
+ i[1].append(v)
+
+ f.write("\n_lr_action_items = {")
+ for k,v in items.items():
+ f.write("%r:([" % k)
+ for i in v[0]:
+ f.write("%r," % i)
+ f.write("],[")
+ for i in v[1]:
+ f.write("%r," % i)
+
+ f.write("]),")
+ f.write("}\n")
+
+ f.write("""
+_lr_action = { }
+for _k, _v in _lr_action_items.items():
+ for _x,_y in zip(_v[0],_v[1]):
+ _lr_action[(_x,_k)] = _y
+del _lr_action_items
+""")
+
+ else:
+ f.write("\n_lr_action = { ");
+ for k,v in _lr_action.items():
+ f.write("(%r,%r):%r," % (k[0],k[1],v))
+ f.write("}\n");
+
+ if smaller:
+ # Factor out names to try and make smaller
+ items = { }
+
+ for k,v in _lr_goto.items():
+ i = items.get(k[1])
+ if not i:
+ i = ([],[])
+ items[k[1]] = i
+ i[0].append(k[0])
+ i[1].append(v)
+
+ f.write("\n_lr_goto_items = {")
+ for k,v in items.items():
+ f.write("%r:([" % k)
+ for i in v[0]:
+ f.write("%r," % i)
+ f.write("],[")
+ for i in v[1]:
+ f.write("%r," % i)
+
+ f.write("]),")
+ f.write("}\n")
+
+ f.write("""
+_lr_goto = { }
+for _k, _v in _lr_goto_items.items():
+ for _x,_y in zip(_v[0],_v[1]):
+ _lr_goto[(_x,_k)] = _y
+del _lr_goto_items
+""")
+ else:
+ f.write("\n_lr_goto = { ");
+ for k,v in _lr_goto.items():
+ f.write("(%r,%r):%r," % (k[0],k[1],v))
+ f.write("}\n");
+
+ # Write production table
+ f.write("_lr_productions = [\n")
+ for p in Productions:
+ if p:
+ if (p.func):
+ f.write(" (%r,%d,%r,%r,%d),\n" % (p.name, p.len, p.func.__name__,p.file,p.line))
+ else:
+ f.write(" (%r,%d,None,None,None),\n" % (p.name, p.len))
+ else:
+ f.write(" None,\n")
+ f.write("]\n")
+
+ f.close()
+
+ except IOError,e:
+ print "Unable to create '%s'" % filename
+ print e
+ return
+
+def lr_read_tables(module=tab_module,optimize=0):
+ global _lr_action, _lr_goto, _lr_productions, _lr_method
+ try:
+ exec "import %s as parsetab" % module
+
+ if (optimize) or (Signature.digest() == parsetab._lr_signature):
+ _lr_action = parsetab._lr_action
+ _lr_goto = parsetab._lr_goto
+ _lr_productions = parsetab._lr_productions
+ _lr_method = parsetab._lr_method
+ return 1
+ else:
+ return 0
+
+ except (ImportError,AttributeError):
+ return 0
+
+
+# Available instance types. This is used when parsers are defined by a class.
+# it's a little funky because I want to preserve backwards compatibility
+# with Python 2.0 where types.ObjectType is undefined.
+
+try:
+ _INSTANCETYPE = (types.InstanceType, types.ObjectType)
+except AttributeError:
+ _INSTANCETYPE = types.InstanceType
+
+# -----------------------------------------------------------------------------
+# yacc(module)
+#
+# Build the parser module
+# -----------------------------------------------------------------------------
+
+def yacc(method=default_lr, debug=yaccdebug, module=None, tabmodule=tab_module, start=None, check_recursion=1, optimize=0,write_tables=1,debugfile=debug_file,outputdir=''):
+ global yaccdebug
+ yaccdebug = debug
+
+ initialize_vars()
+ files = { }
+ error = 0
+
+
+ # Add parsing method to signature
+ Signature.update(method)
+
+ # If a "module" parameter was supplied, extract its dictionary.
+ # Note: a module may in fact be an instance as well.
+
+ if module:
+ # User supplied a module object.
+ if isinstance(module, types.ModuleType):
+ ldict = module.__dict__
+ elif isinstance(module, _INSTANCETYPE):
+ _items = [(k,getattr(module,k)) for k in dir(module)]
+ ldict = { }
+ for i in _items:
+ ldict[i[0]] = i[1]
+ else:
+ raise ValueError,"Expected a module"
+
+ else:
+ # No module given. We might be able to get information from the caller.
+ # Throw an exception and unwind the traceback to get the globals
+
+ try:
+ raise RuntimeError
+ except RuntimeError:
+ e,b,t = sys.exc_info()
+ f = t.tb_frame
+ f = f.f_back # Walk out to our calling function
+ ldict = f.f_globals # Grab its globals dictionary
+
+ # Add starting symbol to signature
+ if not start:
+ start = ldict.get("start",None)
+ if start:
+ Signature.update(start)
+
+ # If running in optimized mode. We're going to
+
+ if (optimize and lr_read_tables(tabmodule,1)):
+ # Read parse table
+ del Productions[:]
+ for p in _lr_productions:
+ if not p:
+ Productions.append(None)
+ else:
+ m = MiniProduction()
+ m.name = p[0]
+ m.len = p[1]
+ m.file = p[3]
+ m.line = p[4]
+ if p[2]:
+ m.func = ldict[p[2]]
+ Productions.append(m)
+
+ else:
+ # Get the tokens map
+ if (module and isinstance(module,_INSTANCETYPE)):
+ tokens = getattr(module,"tokens",None)
+ else:
+ tokens = ldict.get("tokens",None)
+
+ if not tokens:
+ raise YaccError,"module does not define a list 'tokens'"
+ if not (isinstance(tokens,types.ListType) or isinstance(tokens,types.TupleType)):
+ raise YaccError,"tokens must be a list or tuple."
+
+ # Check to see if a requires dictionary is defined.
+ requires = ldict.get("require",None)
+ if requires:
+ if not (isinstance(requires,types.DictType)):
+ raise YaccError,"require must be a dictionary."
+
+ for r,v in requires.items():
+ try:
+ if not (isinstance(v,types.ListType)):
+ raise TypeError
+ v1 = [x.split(".") for x in v]
+ Requires[r] = v1
+ except StandardError:
+ print "Invalid specification for rule '%s' in require. Expected a list of strings" % r
+
+
+ # Build the dictionary of terminals. We a record a 0 in the
+ # dictionary to track whether or not a terminal is actually
+ # used in the grammar
+
+ if 'error' in tokens:
+ print "yacc: Illegal token 'error'. Is a reserved word."
+ raise YaccError,"Illegal token name"
+
+ for n in tokens:
+ if Terminals.has_key(n):
+ print "yacc: Warning. Token '%s' multiply defined." % n
+ Terminals[n] = [ ]
+
+ Terminals['error'] = [ ]
+
+ # Get the precedence map (if any)
+ prec = ldict.get("precedence",None)
+ if prec:
+ if not (isinstance(prec,types.ListType) or isinstance(prec,types.TupleType)):
+ raise YaccError,"precedence must be a list or tuple."
+ add_precedence(prec)
+ Signature.update(repr(prec))
+
+ for n in tokens:
+ if not Precedence.has_key(n):
+ Precedence[n] = ('right',0) # Default, right associative, 0 precedence
+
+ # Look for error handler
+ ef = ldict.get('p_error',None)
+ if ef:
+ if isinstance(ef,types.FunctionType):
+ ismethod = 0
+ elif isinstance(ef, types.MethodType):
+ ismethod = 1
+ else:
+ raise YaccError,"'p_error' defined, but is not a function or method."
+ eline = ef.func_code.co_firstlineno
+ efile = ef.func_code.co_filename
+ files[efile] = None
+
+ if (ef.func_code.co_argcount != 1+ismethod):
+ raise YaccError,"%s:%d: p_error() requires 1 argument." % (efile,eline)
+ global Errorfunc
+ Errorfunc = ef
+ else:
+ print "yacc: Warning. no p_error() function is defined."
+
+ # Get the list of built-in functions with p_ prefix
+ symbols = [ldict[f] for f in ldict.keys()
+ if (type(ldict[f]) in (types.FunctionType, types.MethodType) and ldict[f].__name__[:2] == 'p_'
+ and ldict[f].__name__ != 'p_error')]
+
+ # Check for non-empty symbols
+ if len(symbols) == 0:
+ raise YaccError,"no rules of the form p_rulename are defined."
+
+ # Sort the symbols by line number
+ symbols.sort(lambda x,y: cmp(x.func_code.co_firstlineno,y.func_code.co_firstlineno))
+
+ # Add all of the symbols to the grammar
+ for f in symbols:
+ if (add_function(f)) < 0:
+ error += 1
+ else:
+ files[f.func_code.co_filename] = None
+
+ # Make a signature of the docstrings
+ for f in symbols:
+ if f.__doc__:
+ Signature.update(f.__doc__)
+
+ lr_init_vars()
+
+ if error:
+ raise YaccError,"Unable to construct parser."
+
+ if not lr_read_tables(tabmodule):
+
+ # Validate files
+ for filename in files.keys():
+ if not validate_file(filename):
+ error = 1
+
+ # Validate dictionary
+ validate_dict(ldict)
+
+ if start and not Prodnames.has_key(start):
+ raise YaccError,"Bad starting symbol '%s'" % start
+
+ augment_grammar(start)
+ error = verify_productions(cycle_check=check_recursion)
+ otherfunc = [ldict[f] for f in ldict.keys()
+ if (type(f) in (types.FunctionType,types.MethodType) and ldict[f].__name__[:2] != 'p_')]
+
+ if error:
+ raise YaccError,"Unable to construct parser."
+
+ build_lritems()
+ compute_first1()
+ compute_follow(start)
+
+ if method in ['SLR','LALR']:
+ lr_parse_table(method)
+ else:
+ raise YaccError, "Unknown parsing method '%s'" % method
+
+ if write_tables:
+ lr_write_tables(tabmodule,outputdir)
+
+ if yaccdebug:
+ try:
+ f = open(os.path.join(outputdir,debugfile),"w")
+ f.write(_vfc.getvalue())
+ f.write("\n\n")
+ f.write(_vf.getvalue())
+ f.close()
+ except IOError,e:
+ print "yacc: can't create '%s'" % debugfile,e
+
+ # Made it here. Create a parser object and set up its internal state.
+ # Set global parse() method to bound method of parser object.
+
+ p = Parser("xyzzy")
+ p.productions = Productions
+ p.errorfunc = Errorfunc
+ p.action = _lr_action
+ p.goto = _lr_goto
+ p.method = _lr_method
+ p.require = Requires
+
+ global parse
+ parse = p.parse
+
+ global parser
+ parser = p
+
+ # Clean up all of the globals we created
+ if (not optimize):
+ yacc_cleanup()
+ return p
+
+# yacc_cleanup function. Delete all of the global variables
+# used during table construction
+
+def yacc_cleanup():
+ global _lr_action, _lr_goto, _lr_method, _lr_goto_cache
+ del _lr_action, _lr_goto, _lr_method, _lr_goto_cache
+
+ global Productions, Prodnames, Prodmap, Terminals
+ global Nonterminals, First, Follow, Precedence, LRitems
+ global Errorfunc, Signature, Requires
+
+ del Productions, Prodnames, Prodmap, Terminals
+ del Nonterminals, First, Follow, Precedence, LRitems
+ del Errorfunc, Signature, Requires
+
+ global _vf, _vfc
+ del _vf, _vfc
+
+
+# Stub that raises an error if parsing is attempted without first calling yacc()
+def parse(*args,**kwargs):
+ raise YaccError, "yacc: No parser built with yacc()"
+
diff --git a/chall/ply-2.2/ply/yacc.pyc b/chall/ply-2.2/ply/yacc.pyc
new file mode 100644
index 0000000..4b1adf7
--- /dev/null
+++ b/chall/ply-2.2/ply/yacc.pyc
Binary files differ
diff --git a/chall/ply-2.2/setup.py b/chall/ply-2.2/setup.py
new file mode 100644
index 0000000..0e74964
--- /dev/null
+++ b/chall/ply-2.2/setup.py
@@ -0,0 +1,27 @@
+from distutils.core import setup
+
+setup(name = "ply",
+ description="Python Lex & Yacc",
+ long_description = """
+PLY is yet another implementation of lex and yacc for Python. Although several other
+parsing tools are available for Python, there are several reasons why you might
+want to take a look at PLY:
+
+It's implemented entirely in Python.
+
+It uses LR-parsing which is reasonably efficient and well suited for larger grammars.
+
+PLY provides most of the standard lex/yacc features including support for empty
+productions, precedence rules, error recovery, and support for ambiguous grammars.
+
+PLY is extremely easy to use and provides very extensive error checking.
+""",
+ license="""Lesser GPL (LGPL)""",
+ version = "2.2",
+ author = "David Beazley",
+ author_email = "dave@dabeaz.com",
+ maintainer = "David Beazley",
+ maintainer_email = "dave@dabeaz.com",
+ url = "http://www.dabeaz.com/ply/",
+ packages = ['ply'],
+ )
diff --git a/chall/ply-2.2/test/README b/chall/ply-2.2/test/README
new file mode 100644
index 0000000..aac12b0
--- /dev/null
+++ b/chall/ply-2.2/test/README
@@ -0,0 +1,11 @@
+This directory mostly contains tests for various types of error
+conditions. To run:
+
+ $ python testlex.py .
+ $ python testyacc.py .
+
+The tests can also be run using the Python unittest module.
+
+ $ python rununit.py
+
+The script 'cleanup.sh' cleans up this directory to its original state.
diff --git a/chall/ply-2.2/test/calclex.py b/chall/ply-2.2/test/calclex.py
new file mode 100644
index 0000000..2550734
--- /dev/null
+++ b/chall/ply-2.2/test/calclex.py
@@ -0,0 +1,49 @@
+# -----------------------------------------------------------------------------
+# calclex.py
+# -----------------------------------------------------------------------------
+import sys
+
+sys.path.append("..")
+import ply.lex as lex
+
+tokens = (
+ 'NAME','NUMBER',
+ 'PLUS','MINUS','TIMES','DIVIDE','EQUALS',
+ 'LPAREN','RPAREN',
+ )
+
+# Tokens
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_TIMES = r'\*'
+t_DIVIDE = r'/'
+t_EQUALS = r'='
+t_LPAREN = r'\('
+t_RPAREN = r'\)'
+t_NAME = r'[a-zA-Z_][a-zA-Z0-9_]*'
+
+def t_NUMBER(t):
+ r'\d+'
+ try:
+ t.value = int(t.value)
+ except ValueError:
+ print "Integer value too large", t.value
+ t.value = 0
+ return t
+
+t_ignore = " \t"
+
+def t_newline(t):
+ r'\n+'
+ t.lineno += t.value.count("\n")
+
+def t_error(t):
+ print "Illegal character '%s'" % t.value[0]
+ t.lexer.skip(1)
+
+# Build the lexer
+lex.lex()
+
+
+
diff --git a/chall/ply-2.2/test/cleanup.sh b/chall/ply-2.2/test/cleanup.sh
new file mode 100755
index 0000000..d7d99b6
--- /dev/null
+++ b/chall/ply-2.2/test/cleanup.sh
@@ -0,0 +1,4 @@
+#!/bin/sh
+
+rm -f *~ *.pyc *.dif *.out
+
diff --git a/chall/ply-2.2/test/lex_doc1.exp b/chall/ply-2.2/test/lex_doc1.exp
new file mode 100644
index 0000000..5b63c1e
--- /dev/null
+++ b/chall/ply-2.2/test/lex_doc1.exp
@@ -0,0 +1 @@
+./lex_doc1.py:18: No regular expression defined for rule 't_NUMBER'
diff --git a/chall/ply-2.2/test/lex_doc1.py b/chall/ply-2.2/test/lex_doc1.py
new file mode 100644
index 0000000..3951b5c
--- /dev/null
+++ b/chall/ply-2.2/test/lex_doc1.py
@@ -0,0 +1,30 @@
+# lex_token.py
+#
+# Missing documentation string
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = [
+ "PLUS",
+ "MINUS",
+ "NUMBER",
+ ]
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+def t_NUMBER(t):
+ pass
+
+def t_error(t):
+ pass
+
+
+import sys
+sys.tracebacklimit = 0
+
+lex.lex()
+
+
diff --git a/chall/ply-2.2/test/lex_dup1.exp b/chall/ply-2.2/test/lex_dup1.exp
new file mode 100644
index 0000000..2098a40
--- /dev/null
+++ b/chall/ply-2.2/test/lex_dup1.exp
@@ -0,0 +1,2 @@
+./lex_dup1.py:20: Rule t_NUMBER redefined. Previously defined on line 18
+SyntaxError: lex: Unable to build lexer.
diff --git a/chall/ply-2.2/test/lex_dup1.py b/chall/ply-2.2/test/lex_dup1.py
new file mode 100644
index 0000000..68f8092
--- /dev/null
+++ b/chall/ply-2.2/test/lex_dup1.py
@@ -0,0 +1,29 @@
+# lex_token.py
+#
+# Duplicated rule specifiers
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = [
+ "PLUS",
+ "MINUS",
+ "NUMBER",
+ ]
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_NUMBER = r'\d+'
+
+t_NUMBER = r'\d+'
+
+def t_error(t):
+ pass
+
+sys.tracebacklimit = 0
+
+lex.lex()
+
+
diff --git a/chall/ply-2.2/test/lex_dup2.exp b/chall/ply-2.2/test/lex_dup2.exp
new file mode 100644
index 0000000..d327cfe
--- /dev/null
+++ b/chall/ply-2.2/test/lex_dup2.exp
@@ -0,0 +1,2 @@
+./lex_dup2.py:22: Rule t_NUMBER redefined. Previously defined on line 18
+SyntaxError: lex: Unable to build lexer.
diff --git a/chall/ply-2.2/test/lex_dup2.py b/chall/ply-2.2/test/lex_dup2.py
new file mode 100644
index 0000000..f4d346e
--- /dev/null
+++ b/chall/ply-2.2/test/lex_dup2.py
@@ -0,0 +1,33 @@
+# lex_token.py
+#
+# Duplicated rule specifiers
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = [
+ "PLUS",
+ "MINUS",
+ "NUMBER",
+ ]
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+def t_NUMBER(t):
+ r'\d+'
+ pass
+
+def t_NUMBER(t):
+ r'\d+'
+ pass
+
+def t_error(t):
+ pass
+
+sys.tracebacklimit = 0
+
+lex.lex()
+
+
diff --git a/chall/ply-2.2/test/lex_dup3.exp b/chall/ply-2.2/test/lex_dup3.exp
new file mode 100644
index 0000000..ec0680c
--- /dev/null
+++ b/chall/ply-2.2/test/lex_dup3.exp
@@ -0,0 +1,2 @@
+./lex_dup3.py:20: Rule t_NUMBER redefined. Previously defined on line 18
+SyntaxError: lex: Unable to build lexer.
diff --git a/chall/ply-2.2/test/lex_dup3.py b/chall/ply-2.2/test/lex_dup3.py
new file mode 100644
index 0000000..e17b520
--- /dev/null
+++ b/chall/ply-2.2/test/lex_dup3.py
@@ -0,0 +1,31 @@
+# lex_token.py
+#
+# Duplicated rule specifiers
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = [
+ "PLUS",
+ "MINUS",
+ "NUMBER",
+ ]
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_NUMBER = r'\d+'
+
+def t_NUMBER(t):
+ r'\d+'
+ pass
+
+def t_error(t):
+ pass
+
+sys.tracebacklimit = 0
+
+lex.lex()
+
+
diff --git a/chall/ply-2.2/test/lex_empty.exp b/chall/ply-2.2/test/lex_empty.exp
new file mode 100644
index 0000000..af38602
--- /dev/null
+++ b/chall/ply-2.2/test/lex_empty.exp
@@ -0,0 +1 @@
+SyntaxError: lex: no rules of the form t_rulename are defined.
diff --git a/chall/ply-2.2/test/lex_empty.py b/chall/ply-2.2/test/lex_empty.py
new file mode 100644
index 0000000..96625f7
--- /dev/null
+++ b/chall/ply-2.2/test/lex_empty.py
@@ -0,0 +1,20 @@
+# lex_token.py
+#
+# No rules defined
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = [
+ "PLUS",
+ "MINUS",
+ "NUMBER",
+ ]
+
+sys.tracebacklimit = 0
+
+lex.lex()
+
+
diff --git a/chall/ply-2.2/test/lex_error1.exp b/chall/ply-2.2/test/lex_error1.exp
new file mode 100644
index 0000000..baa19e5
--- /dev/null
+++ b/chall/ply-2.2/test/lex_error1.exp
@@ -0,0 +1 @@
+lex: Warning. no t_error rule is defined.
diff --git a/chall/ply-2.2/test/lex_error1.py b/chall/ply-2.2/test/lex_error1.py
new file mode 100644
index 0000000..a99d9be
--- /dev/null
+++ b/chall/ply-2.2/test/lex_error1.py
@@ -0,0 +1,24 @@
+# lex_token.py
+#
+# Missing t_error() rule
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = [
+ "PLUS",
+ "MINUS",
+ "NUMBER",
+ ]
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_NUMBER = r'\d+'
+
+sys.tracebacklimit = 0
+
+lex.lex()
+
+
diff --git a/chall/ply-2.2/test/lex_error2.exp b/chall/ply-2.2/test/lex_error2.exp
new file mode 100644
index 0000000..fb1b55c
--- /dev/null
+++ b/chall/ply-2.2/test/lex_error2.exp
@@ -0,0 +1 @@
+SyntaxError: lex: Rule 't_error' must be defined as a function
diff --git a/chall/ply-2.2/test/lex_error2.py b/chall/ply-2.2/test/lex_error2.py
new file mode 100644
index 0000000..a59c8d4
--- /dev/null
+++ b/chall/ply-2.2/test/lex_error2.py
@@ -0,0 +1,26 @@
+# lex_token.py
+#
+# t_error defined, but not function
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = [
+ "PLUS",
+ "MINUS",
+ "NUMBER",
+ ]
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_NUMBER = r'\d+'
+
+t_error = "foo"
+
+sys.tracebacklimit = 0
+
+lex.lex()
+
+
diff --git a/chall/ply-2.2/test/lex_error3.exp b/chall/ply-2.2/test/lex_error3.exp
new file mode 100644
index 0000000..1b482bf
--- /dev/null
+++ b/chall/ply-2.2/test/lex_error3.exp
@@ -0,0 +1,2 @@
+./lex_error3.py:20: Rule 't_error' requires an argument.
+SyntaxError: lex: Unable to build lexer.
diff --git a/chall/ply-2.2/test/lex_error3.py b/chall/ply-2.2/test/lex_error3.py
new file mode 100644
index 0000000..584600f
--- /dev/null
+++ b/chall/ply-2.2/test/lex_error3.py
@@ -0,0 +1,27 @@
+# lex_token.py
+#
+# t_error defined as function, but with wrong # args
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = [
+ "PLUS",
+ "MINUS",
+ "NUMBER",
+ ]
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_NUMBER = r'\d+'
+
+def t_error():
+ pass
+
+sys.tracebacklimit = 0
+
+lex.lex()
+
+
diff --git a/chall/ply-2.2/test/lex_error4.exp b/chall/ply-2.2/test/lex_error4.exp
new file mode 100644
index 0000000..98505a2
--- /dev/null
+++ b/chall/ply-2.2/test/lex_error4.exp
@@ -0,0 +1,2 @@
+./lex_error4.py:20: Rule 't_error' has too many arguments.
+SyntaxError: lex: Unable to build lexer.
diff --git a/chall/ply-2.2/test/lex_error4.py b/chall/ply-2.2/test/lex_error4.py
new file mode 100644
index 0000000..d05de74
--- /dev/null
+++ b/chall/ply-2.2/test/lex_error4.py
@@ -0,0 +1,27 @@
+# lex_token.py
+#
+# t_error defined as function, but too many args
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = [
+ "PLUS",
+ "MINUS",
+ "NUMBER",
+ ]
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_NUMBER = r'\d+'
+
+def t_error(t,s):
+ pass
+
+sys.tracebacklimit = 0
+
+lex.lex()
+
+
diff --git a/chall/ply-2.2/test/lex_hedit.exp b/chall/ply-2.2/test/lex_hedit.exp
new file mode 100644
index 0000000..7b27dcb
--- /dev/null
+++ b/chall/ply-2.2/test/lex_hedit.exp
@@ -0,0 +1,3 @@
+(H_EDIT_DESCRIPTOR,'abc',1,0)
+(H_EDIT_DESCRIPTOR,'abcdefghij',1,6)
+(H_EDIT_DESCRIPTOR,'xy',1,20)
diff --git a/chall/ply-2.2/test/lex_hedit.py b/chall/ply-2.2/test/lex_hedit.py
new file mode 100644
index 0000000..0f87423
--- /dev/null
+++ b/chall/ply-2.2/test/lex_hedit.py
@@ -0,0 +1,47 @@
+# -----------------------------------------------------------------------------
+# hedit.py
+#
+# Paring of Fortran H Edit descriptions (Contributed by Pearu Peterson)
+#
+# These tokens can't be easily tokenized because they are of the following
+# form:
+#
+# nHc1...cn
+#
+# where n is a positive integer and c1 ... cn are characters.
+#
+# This example shows how to modify the state of the lexer to parse
+# such tokens
+# -----------------------------------------------------------------------------
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = (
+ 'H_EDIT_DESCRIPTOR',
+ )
+
+# Tokens
+t_ignore = " \t\n"
+
+def t_H_EDIT_DESCRIPTOR(t):
+ r"\d+H.*" # This grabs all of the remaining text
+ i = t.value.index('H')
+ n = eval(t.value[:i])
+
+ # Adjust the tokenizing position
+ t.lexer.lexpos -= len(t.value) - (i+1+n)
+ t.value = t.value[i+1:i+1+n]
+ return t
+
+def t_error(t):
+ print "Illegal character '%s'" % t.value[0]
+ t.lexer.skip(1)
+
+# Build the lexer
+lex.lex()
+lex.runmain(data="3Habc 10Habcdefghij 2Hxy")
+
+
+
diff --git a/chall/ply-2.2/test/lex_ignore.exp b/chall/ply-2.2/test/lex_ignore.exp
new file mode 100644
index 0000000..85e2961
--- /dev/null
+++ b/chall/ply-2.2/test/lex_ignore.exp
@@ -0,0 +1,7 @@
+./lex_ignore.py:20: Rule 't_ignore' must be defined as a string.
+Traceback (most recent call last):
+ File "./lex_ignore.py", line 29, in ?
+ lex.lex()
+ File "../ply/lex.py", line 758, in lex
+ raise SyntaxError,"lex: Unable to build lexer."
+SyntaxError: lex: Unable to build lexer.
diff --git a/chall/ply-2.2/test/lex_ignore.py b/chall/ply-2.2/test/lex_ignore.py
new file mode 100644
index 0000000..94b0266
--- /dev/null
+++ b/chall/ply-2.2/test/lex_ignore.py
@@ -0,0 +1,31 @@
+# lex_token.py
+#
+# Improperly specific ignore declaration
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = [
+ "PLUS",
+ "MINUS",
+ "NUMBER",
+ ]
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_NUMBER = r'\d+'
+
+def t_ignore(t):
+ ' \t'
+ pass
+
+def t_error(t):
+ pass
+
+import sys
+
+lex.lex()
+
+
diff --git a/chall/ply-2.2/test/lex_nowarn.exp b/chall/ply-2.2/test/lex_nowarn.exp
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/chall/ply-2.2/test/lex_nowarn.exp
diff --git a/chall/ply-2.2/test/lex_nowarn.py b/chall/ply-2.2/test/lex_nowarn.py
new file mode 100644
index 0000000..d60d31c
--- /dev/null
+++ b/chall/ply-2.2/test/lex_nowarn.py
@@ -0,0 +1,30 @@
+# lex_token.py
+#
+# Missing t_error() rule
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = [
+ "PLUS",
+ "MINUS",
+ "NUMBER",
+ "NUMBER",
+ ]
+
+states = (('foo','exclusive'),)
+
+t_ignore = ' \t'
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_NUMBER = r'\d+'
+
+t_foo_NUMBER = r'\d+'
+
+sys.tracebacklimit = 0
+
+lex.lex(nowarn=1)
+
+
diff --git a/chall/ply-2.2/test/lex_re1.exp b/chall/ply-2.2/test/lex_re1.exp
new file mode 100644
index 0000000..b9e621c
--- /dev/null
+++ b/chall/ply-2.2/test/lex_re1.exp
@@ -0,0 +1,7 @@
+lex: Invalid regular expression for rule 't_NUMBER'. unbalanced parenthesis
+Traceback (most recent call last):
+ File "./lex_re1.py", line 25, in ?
+ lex.lex()
+ File "../ply/lex.py", line 758, in lex
+ raise SyntaxError,"lex: Unable to build lexer."
+SyntaxError: lex: Unable to build lexer.
diff --git a/chall/ply-2.2/test/lex_re1.py b/chall/ply-2.2/test/lex_re1.py
new file mode 100644
index 0000000..9e544fe
--- /dev/null
+++ b/chall/ply-2.2/test/lex_re1.py
@@ -0,0 +1,27 @@
+# lex_token.py
+#
+# Bad regular expression in a string
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = [
+ "PLUS",
+ "MINUS",
+ "NUMBER",
+ ]
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_NUMBER = r'(\d+'
+
+def t_error(t):
+ pass
+
+import sys
+
+lex.lex()
+
+
diff --git a/chall/ply-2.2/test/lex_re2.exp b/chall/ply-2.2/test/lex_re2.exp
new file mode 100644
index 0000000..7ba89b4
--- /dev/null
+++ b/chall/ply-2.2/test/lex_re2.exp
@@ -0,0 +1,7 @@
+lex: Regular expression for rule 't_PLUS' matches empty string.
+Traceback (most recent call last):
+ File "./lex_re2.py", line 25, in ?
+ lex.lex()
+ File "../ply/lex.py", line 758, in lex
+ raise SyntaxError,"lex: Unable to build lexer."
+SyntaxError: lex: Unable to build lexer.
diff --git a/chall/ply-2.2/test/lex_re2.py b/chall/ply-2.2/test/lex_re2.py
new file mode 100644
index 0000000..522b415
--- /dev/null
+++ b/chall/ply-2.2/test/lex_re2.py
@@ -0,0 +1,27 @@
+# lex_token.py
+#
+# Regular expression rule matches empty string
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = [
+ "PLUS",
+ "MINUS",
+ "NUMBER",
+ ]
+
+t_PLUS = r'\+?'
+t_MINUS = r'-'
+t_NUMBER = r'(\d+)'
+
+def t_error(t):
+ pass
+
+import sys
+
+lex.lex()
+
+
diff --git a/chall/ply-2.2/test/lex_re3.exp b/chall/ply-2.2/test/lex_re3.exp
new file mode 100644
index 0000000..7cdcae4
--- /dev/null
+++ b/chall/ply-2.2/test/lex_re3.exp
@@ -0,0 +1,8 @@
+lex: Invalid regular expression for rule 't_POUND'. unbalanced parenthesis
+lex: Make sure '#' in rule 't_POUND' is escaped with '\#'.
+Traceback (most recent call last):
+ File "./lex_re3.py", line 27, in ?
+ lex.lex()
+ File "../ply/lex.py", line 758, in lex
+ raise SyntaxError,"lex: Unable to build lexer."
+SyntaxError: lex: Unable to build lexer.
diff --git a/chall/ply-2.2/test/lex_re3.py b/chall/ply-2.2/test/lex_re3.py
new file mode 100644
index 0000000..099e156
--- /dev/null
+++ b/chall/ply-2.2/test/lex_re3.py
@@ -0,0 +1,29 @@
+# lex_token.py
+#
+# Regular expression rule matches empty string
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = [
+ "PLUS",
+ "MINUS",
+ "NUMBER",
+ "POUND",
+ ]
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_NUMBER = r'(\d+)'
+t_POUND = r'#'
+
+def t_error(t):
+ pass
+
+import sys
+
+lex.lex()
+
+
diff --git a/chall/ply-2.2/test/lex_rule1.exp b/chall/ply-2.2/test/lex_rule1.exp
new file mode 100644
index 0000000..0c23ca2
--- /dev/null
+++ b/chall/ply-2.2/test/lex_rule1.exp
@@ -0,0 +1,2 @@
+lex: t_NUMBER not defined as a function or string
+SyntaxError: lex: Unable to build lexer.
diff --git a/chall/ply-2.2/test/lex_rule1.py b/chall/ply-2.2/test/lex_rule1.py
new file mode 100644
index 0000000..e49a15b
--- /dev/null
+++ b/chall/ply-2.2/test/lex_rule1.py
@@ -0,0 +1,27 @@
+# lex_token.py
+#
+# Rule defined as some other type
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = [
+ "PLUS",
+ "MINUS",
+ "NUMBER",
+ ]
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_NUMBER = 1
+
+def t_error(t):
+ pass
+
+sys.tracebacklimit = 0
+
+lex.lex()
+
+
diff --git a/chall/ply-2.2/test/lex_state1.exp b/chall/ply-2.2/test/lex_state1.exp
new file mode 100644
index 0000000..8b58050
--- /dev/null
+++ b/chall/ply-2.2/test/lex_state1.exp
@@ -0,0 +1,7 @@
+lex: states must be defined as a tuple or list.
+Traceback (most recent call last):
+ File "./lex_state1.py", line 38, in ?
+ lex.lex()
+ File "../ply/lex.py", line 758, in lex
+ raise SyntaxError,"lex: Unable to build lexer."
+SyntaxError: lex: Unable to build lexer.
diff --git a/chall/ply-2.2/test/lex_state1.py b/chall/ply-2.2/test/lex_state1.py
new file mode 100644
index 0000000..7eb2976
--- /dev/null
+++ b/chall/ply-2.2/test/lex_state1.py
@@ -0,0 +1,40 @@
+# lex_state1.py
+#
+# Bad state declaration
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = [
+ "PLUS",
+ "MINUS",
+ "NUMBER",
+ ]
+
+states = 'comment'
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_NUMBER = r'\d+'
+
+# Comments
+def t_comment(t):
+ r'/\*'
+ t.lexer.begin('comment')
+ print "Entering comment state"
+
+def t_comment_body_part(t):
+ r'(.|\n)*\*/'
+ print "comment body", t
+ t.lexer.begin('INITIAL')
+
+def t_error(t):
+ pass
+
+import sys
+
+lex.lex()
+
+
diff --git a/chall/ply-2.2/test/lex_state2.exp b/chall/ply-2.2/test/lex_state2.exp
new file mode 100644
index 0000000..11c33a7
--- /dev/null
+++ b/chall/ply-2.2/test/lex_state2.exp
@@ -0,0 +1,8 @@
+lex: invalid state specifier 'comment'. Must be a tuple (statename,'exclusive|inclusive')
+lex: invalid state specifier 'example'. Must be a tuple (statename,'exclusive|inclusive')
+Traceback (most recent call last):
+ File "./lex_state2.py", line 38, in ?
+ lex.lex()
+ File "../ply/lex.py", line 758, in lex
+ raise SyntaxError,"lex: Unable to build lexer."
+SyntaxError: lex: Unable to build lexer.
diff --git a/chall/ply-2.2/test/lex_state2.py b/chall/ply-2.2/test/lex_state2.py
new file mode 100644
index 0000000..b76b0db
--- /dev/null
+++ b/chall/ply-2.2/test/lex_state2.py
@@ -0,0 +1,40 @@
+# lex_state2.py
+#
+# Bad state declaration
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = [
+ "PLUS",
+ "MINUS",
+ "NUMBER",
+ ]
+
+states = ('comment','example')
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_NUMBER = r'\d+'
+
+# Comments
+def t_comment(t):
+ r'/\*'
+ t.lexer.begin('comment')
+ print "Entering comment state"
+
+def t_comment_body_part(t):
+ r'(.|\n)*\*/'
+ print "comment body", t
+ t.lexer.begin('INITIAL')
+
+def t_error(t):
+ pass
+
+import sys
+
+lex.lex()
+
+
diff --git a/chall/ply-2.2/test/lex_state3.exp b/chall/ply-2.2/test/lex_state3.exp
new file mode 100644
index 0000000..2c3442c
--- /dev/null
+++ b/chall/ply-2.2/test/lex_state3.exp
@@ -0,0 +1,8 @@
+lex: state name 1 must be a string
+lex: No rules defined for state 'example'
+Traceback (most recent call last):
+ File "./lex_state3.py", line 40, in ?
+ lex.lex()
+ File "../ply/lex.py", line 758, in lex
+ raise SyntaxError,"lex: Unable to build lexer."
+SyntaxError: lex: Unable to build lexer.
diff --git a/chall/ply-2.2/test/lex_state3.py b/chall/ply-2.2/test/lex_state3.py
new file mode 100644
index 0000000..fb4ce6c
--- /dev/null
+++ b/chall/ply-2.2/test/lex_state3.py
@@ -0,0 +1,42 @@
+# lex_state2.py
+#
+# Bad state declaration
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = [
+ "PLUS",
+ "MINUS",
+ "NUMBER",
+ ]
+
+comment = 1
+states = ((comment, 'inclusive'),
+ ('example', 'exclusive'))
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_NUMBER = r'\d+'
+
+# Comments
+def t_comment(t):
+ r'/\*'
+ t.lexer.begin('comment')
+ print "Entering comment state"
+
+def t_comment_body_part(t):
+ r'(.|\n)*\*/'
+ print "comment body", t
+ t.lexer.begin('INITIAL')
+
+def t_error(t):
+ pass
+
+import sys
+
+lex.lex()
+
+
diff --git a/chall/ply-2.2/test/lex_state4.exp b/chall/ply-2.2/test/lex_state4.exp
new file mode 100644
index 0000000..7497a47
--- /dev/null
+++ b/chall/ply-2.2/test/lex_state4.exp
@@ -0,0 +1,7 @@
+lex: state type for state comment must be 'inclusive' or 'exclusive'
+Traceback (most recent call last):
+ File "./lex_state4.py", line 39, in ?
+ lex.lex()
+ File "../ply/lex.py", line 758, in lex
+ raise SyntaxError,"lex: Unable to build lexer."
+SyntaxError: lex: Unable to build lexer.
diff --git a/chall/ply-2.2/test/lex_state4.py b/chall/ply-2.2/test/lex_state4.py
new file mode 100644
index 0000000..0993aa9
--- /dev/null
+++ b/chall/ply-2.2/test/lex_state4.py
@@ -0,0 +1,41 @@
+# lex_state2.py
+#
+# Bad state declaration
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = [
+ "PLUS",
+ "MINUS",
+ "NUMBER",
+ ]
+
+comment = 1
+states = (('comment', 'exclsive'),)
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_NUMBER = r'\d+'
+
+# Comments
+def t_comment(t):
+ r'/\*'
+ t.lexer.begin('comment')
+ print "Entering comment state"
+
+def t_comment_body_part(t):
+ r'(.|\n)*\*/'
+ print "comment body", t
+ t.lexer.begin('INITIAL')
+
+def t_error(t):
+ pass
+
+import sys
+
+lex.lex()
+
+
diff --git a/chall/ply-2.2/test/lex_state5.exp b/chall/ply-2.2/test/lex_state5.exp
new file mode 100644
index 0000000..e9e43e8
--- /dev/null
+++ b/chall/ply-2.2/test/lex_state5.exp
@@ -0,0 +1,7 @@
+lex: state 'comment' already defined.
+Traceback (most recent call last):
+ File "./lex_state5.py", line 40, in ?
+ lex.lex()
+ File "../ply/lex.py", line 758, in lex
+ raise SyntaxError,"lex: Unable to build lexer."
+SyntaxError: lex: Unable to build lexer.
diff --git a/chall/ply-2.2/test/lex_state5.py b/chall/ply-2.2/test/lex_state5.py
new file mode 100644
index 0000000..c3c1cbf
--- /dev/null
+++ b/chall/ply-2.2/test/lex_state5.py
@@ -0,0 +1,42 @@
+# lex_state2.py
+#
+# Bad state declaration
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = [
+ "PLUS",
+ "MINUS",
+ "NUMBER",
+ ]
+
+comment = 1
+states = (('comment', 'exclusive'),
+ ('comment', 'exclusive'))
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_NUMBER = r'\d+'
+
+# Comments
+def t_comment(t):
+ r'/\*'
+ t.lexer.begin('comment')
+ print "Entering comment state"
+
+def t_comment_body_part(t):
+ r'(.|\n)*\*/'
+ print "comment body", t
+ t.lexer.begin('INITIAL')
+
+def t_error(t):
+ pass
+
+import sys
+
+lex.lex()
+
+
diff --git a/chall/ply-2.2/test/lex_state_noerror.exp b/chall/ply-2.2/test/lex_state_noerror.exp
new file mode 100644
index 0000000..e14149f
--- /dev/null
+++ b/chall/ply-2.2/test/lex_state_noerror.exp
@@ -0,0 +1 @@
+lex: Warning. no error rule is defined for exclusive state 'comment'
diff --git a/chall/ply-2.2/test/lex_state_noerror.py b/chall/ply-2.2/test/lex_state_noerror.py
new file mode 100644
index 0000000..853b157
--- /dev/null
+++ b/chall/ply-2.2/test/lex_state_noerror.py
@@ -0,0 +1,41 @@
+# lex_state2.py
+#
+# Declaration of a state for which no rules are defined
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = [
+ "PLUS",
+ "MINUS",
+ "NUMBER",
+ ]
+
+comment = 1
+states = (('comment', 'exclusive'),)
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_NUMBER = r'\d+'
+
+# Comments
+def t_comment(t):
+ r'/\*'
+ t.lexer.begin('comment')
+ print "Entering comment state"
+
+def t_comment_body_part(t):
+ r'(.|\n)*\*/'
+ print "comment body", t
+ t.lexer.begin('INITIAL')
+
+def t_error(t):
+ pass
+
+import sys
+
+lex.lex()
+
+
diff --git a/chall/ply-2.2/test/lex_state_norule.exp b/chall/ply-2.2/test/lex_state_norule.exp
new file mode 100644
index 0000000..a8ff4ca
--- /dev/null
+++ b/chall/ply-2.2/test/lex_state_norule.exp
@@ -0,0 +1,7 @@
+lex: No rules defined for state 'example'
+Traceback (most recent call last):
+ File "./lex_state_norule.py", line 40, in ?
+ lex.lex()
+ File "../ply/lex.py", line 758, in lex
+ raise SyntaxError,"lex: Unable to build lexer."
+SyntaxError: lex: Unable to build lexer.
diff --git a/chall/ply-2.2/test/lex_state_norule.py b/chall/ply-2.2/test/lex_state_norule.py
new file mode 100644
index 0000000..e48a319
--- /dev/null
+++ b/chall/ply-2.2/test/lex_state_norule.py
@@ -0,0 +1,42 @@
+# lex_state2.py
+#
+# Declaration of a state for which no rules are defined
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = [
+ "PLUS",
+ "MINUS",
+ "NUMBER",
+ ]
+
+comment = 1
+states = (('comment', 'exclusive'),
+ ('example', 'exclusive'))
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_NUMBER = r'\d+'
+
+# Comments
+def t_comment(t):
+ r'/\*'
+ t.lexer.begin('comment')
+ print "Entering comment state"
+
+def t_comment_body_part(t):
+ r'(.|\n)*\*/'
+ print "comment body", t
+ t.lexer.begin('INITIAL')
+
+def t_error(t):
+ pass
+
+import sys
+
+lex.lex()
+
+
diff --git a/chall/ply-2.2/test/lex_state_try.exp b/chall/ply-2.2/test/lex_state_try.exp
new file mode 100644
index 0000000..65f2e38
--- /dev/null
+++ b/chall/ply-2.2/test/lex_state_try.exp
@@ -0,0 +1,7 @@
+(NUMBER,'3',1,0)
+(PLUS,'+',1,2)
+(NUMBER,'4',1,4)
+Entering comment state
+comment body LexToken(comment_body_part,'This is a comment */',1,9)
+(PLUS,'+',1,30)
+(NUMBER,'10',1,32)
diff --git a/chall/ply-2.2/test/lex_state_try.py b/chall/ply-2.2/test/lex_state_try.py
new file mode 100644
index 0000000..a16403e
--- /dev/null
+++ b/chall/ply-2.2/test/lex_state_try.py
@@ -0,0 +1,48 @@
+# lex_state2.py
+#
+# Declaration of a state for which no rules are defined
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = [
+ "PLUS",
+ "MINUS",
+ "NUMBER",
+ ]
+
+comment = 1
+states = (('comment', 'exclusive'),)
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_NUMBER = r'\d+'
+
+t_ignore = " \t"
+
+# Comments
+def t_comment(t):
+ r'/\*'
+ t.lexer.begin('comment')
+ print "Entering comment state"
+
+def t_comment_body_part(t):
+ r'(.|\n)*\*/'
+ print "comment body", t
+ t.lexer.begin('INITIAL')
+
+def t_error(t):
+ pass
+
+t_comment_error = t_error
+t_comment_ignore = t_ignore
+
+import sys
+
+lex.lex()
+
+data = "3 + 4 /* This is a comment */ + 10"
+
+lex.runmain(data=data)
diff --git a/chall/ply-2.2/test/lex_token1.exp b/chall/ply-2.2/test/lex_token1.exp
new file mode 100644
index 0000000..3792831
--- /dev/null
+++ b/chall/ply-2.2/test/lex_token1.exp
@@ -0,0 +1 @@
+SyntaxError: lex: module does not define 'tokens'
diff --git a/chall/ply-2.2/test/lex_token1.py b/chall/ply-2.2/test/lex_token1.py
new file mode 100644
index 0000000..380c31c
--- /dev/null
+++ b/chall/ply-2.2/test/lex_token1.py
@@ -0,0 +1,21 @@
+# lex_token.py
+#
+# Tests for absence of tokens variable
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_NUMBER = r'\d+'
+
+def t_error(t):
+ pass
+
+sys.tracebacklimit = 0
+
+lex.lex()
+
+
diff --git a/chall/ply-2.2/test/lex_token2.exp b/chall/ply-2.2/test/lex_token2.exp
new file mode 100644
index 0000000..3f98fe5
--- /dev/null
+++ b/chall/ply-2.2/test/lex_token2.exp
@@ -0,0 +1 @@
+SyntaxError: lex: tokens must be a list or tuple.
diff --git a/chall/ply-2.2/test/lex_token2.py b/chall/ply-2.2/test/lex_token2.py
new file mode 100644
index 0000000..87db8a0
--- /dev/null
+++ b/chall/ply-2.2/test/lex_token2.py
@@ -0,0 +1,23 @@
+# lex_token.py
+#
+# Tests for tokens of wrong type
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = "PLUS MINUS NUMBER"
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_NUMBER = r'\d+'
+
+def t_error(t):
+ pass
+
+sys.tracebacklimit = 0
+
+lex.lex()
+
+
diff --git a/chall/ply-2.2/test/lex_token3.exp b/chall/ply-2.2/test/lex_token3.exp
new file mode 100644
index 0000000..d991d3c
--- /dev/null
+++ b/chall/ply-2.2/test/lex_token3.exp
@@ -0,0 +1,2 @@
+lex: Rule 't_MINUS' defined for an unspecified token MINUS.
+SyntaxError: lex: Unable to build lexer.
diff --git a/chall/ply-2.2/test/lex_token3.py b/chall/ply-2.2/test/lex_token3.py
new file mode 100644
index 0000000..27ce947
--- /dev/null
+++ b/chall/ply-2.2/test/lex_token3.py
@@ -0,0 +1,27 @@
+# lex_token.py
+#
+# tokens is right type, but is missing a token for one rule
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = [
+ "PLUS",
+ "NUMBER",
+ ]
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_NUMBER = r'\d+'
+
+def t_error(t):
+ pass
+
+
+sys.tracebacklimit = 0
+
+lex.lex()
+
+
diff --git a/chall/ply-2.2/test/lex_token4.exp b/chall/ply-2.2/test/lex_token4.exp
new file mode 100644
index 0000000..3dd88e0
--- /dev/null
+++ b/chall/ply-2.2/test/lex_token4.exp
@@ -0,0 +1,2 @@
+lex: Bad token name '-'
+SyntaxError: lex: Unable to build lexer.
diff --git a/chall/ply-2.2/test/lex_token4.py b/chall/ply-2.2/test/lex_token4.py
new file mode 100644
index 0000000..612ff13
--- /dev/null
+++ b/chall/ply-2.2/test/lex_token4.py
@@ -0,0 +1,28 @@
+# lex_token.py
+#
+# Bad token name
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = [
+ "PLUS",
+ "MINUS",
+ "-",
+ "NUMBER",
+ ]
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+t_NUMBER = r'\d+'
+
+def t_error(t):
+ pass
+
+sys.tracebacklimit = 0
+
+lex.lex()
+
+
diff --git a/chall/ply-2.2/test/lex_token5.exp b/chall/ply-2.2/test/lex_token5.exp
new file mode 100644
index 0000000..2f03889
--- /dev/null
+++ b/chall/ply-2.2/test/lex_token5.exp
@@ -0,0 +1 @@
+ply.lex.LexError: ./lex_token5.py:19: Rule 't_NUMBER' returned an unknown token type 'NUM'
diff --git a/chall/ply-2.2/test/lex_token5.py b/chall/ply-2.2/test/lex_token5.py
new file mode 100644
index 0000000..77fabde
--- /dev/null
+++ b/chall/ply-2.2/test/lex_token5.py
@@ -0,0 +1,33 @@
+# lex_token.py
+#
+# Return a bad token name
+
+import sys
+sys.path.insert(0,"..")
+
+import ply.lex as lex
+
+tokens = [
+ "PLUS",
+ "MINUS",
+ "NUMBER",
+ ]
+
+t_PLUS = r'\+'
+t_MINUS = r'-'
+
+def t_NUMBER(t):
+ r'\d+'
+ t.type = "NUM"
+ return t
+
+def t_error(t):
+ pass
+
+sys.tracebacklimit = 0
+
+lex.lex()
+lex.input("1234")
+t = lex.token()
+
+
diff --git a/chall/ply-2.2/test/rununit.py b/chall/ply-2.2/test/rununit.py
new file mode 100644
index 0000000..d6b36fd
--- /dev/null
+++ b/chall/ply-2.2/test/rununit.py
@@ -0,0 +1,62 @@
+#!/usr/bin/env python
+'''Script to run all tests using python "unittest" module'''
+
+__author__ = "Miki Tebeka <miki.tebeka@zoran.com>"
+
+from unittest import TestCase, main, makeSuite, TestSuite
+from os import popen, environ, remove
+from glob import glob
+from sys import executable, argv
+from os.path import isfile, basename, splitext
+
+# Add path to lex.py and yacc.py
+environ["PYTHONPATH"] = ".."
+
+class PLYTest(TestCase):
+ '''General test case for PLY test'''
+ def _runtest(self, filename):
+ '''Run a single test file an compare result'''
+ exp_file = filename.replace(".py", ".exp")
+ self.failUnless(isfile(exp_file), "can't find %s" % exp_file)
+ pipe = popen("%s %s 2>&1" % (executable, filename))
+ out = pipe.read().strip()
+ self.failUnlessEqual(out, open(exp_file).read().strip())
+
+
+class LexText(PLYTest):
+ '''Testing Lex'''
+ pass
+
+class YaccTest(PLYTest):
+ '''Testing Yacc'''
+
+ def tearDown(self):
+ '''Cleanup parsetab.py[c] file'''
+ for ext in (".py", ".pyc"):
+ fname = "parsetab%s" % ext
+ if isfile(fname):
+ remove(fname)
+
+def add_test(klass, filename):
+ '''Add a test to TestCase class'''
+ def t(self):
+ self._runtest(filename)
+ # Test name is test_FILENAME without the ./ and without the .py
+ setattr(klass, "test_%s" % (splitext(basename(filename))[0]), t)
+
+# Add lex tests
+for file in glob("./lex_*.py"):
+ add_test(LexText, file)
+lex_suite = makeSuite(LexText, "test_")
+
+# Add yacc tests
+for file in glob("./yacc_*.py"):
+ add_test(YaccTest, file)
+yacc_suite = makeSuite(YaccTest, "test_")
+
+# All tests suite
+test_suite = TestSuite((lex_suite, yacc_suite))
+
+if __name__ == "__main__":
+ main()
+
diff --git a/chall/ply-2.2/test/testlex.py b/chall/ply-2.2/test/testlex.py
new file mode 100755
index 0000000..2dae47a
--- /dev/null
+++ b/chall/ply-2.2/test/testlex.py
@@ -0,0 +1,57 @@
+#!/usr/local/bin
+# ----------------------------------------------------------------------
+# testlex.py
+#
+# Run tests for the lexing module
+# ----------------------------------------------------------------------
+
+import sys,os,glob
+
+if len(sys.argv) < 2:
+ print "Usage: python testlex.py directory"
+ raise SystemExit
+
+dirname = None
+make = 0
+
+for o in sys.argv[1:]:
+ if o == '-make':
+ make = 1
+ else:
+ dirname = o
+ break
+
+if not dirname:
+ print "Usage: python testlex.py [-make] directory"
+ raise SystemExit
+
+f = glob.glob("%s/%s" % (dirname,"lex_*.py"))
+
+print "**** Running tests for lex ****"
+
+for t in f:
+ name = t[:-3]
+ print "Testing %-32s" % name,
+ if make:
+ if not os.path.exists("%s.exp" % name):
+ os.system("python %s.py >%s.exp 2>&1" % (name,name))
+ passed = 1
+ else:
+ os.system("python %s.py >%s.out 2>&1" % (name,name))
+ a = os.system("diff %s.out %s.exp >%s.dif" % (name,name,name))
+ if a == 0:
+ passed = 1
+ else:
+ passed = 0
+
+ if passed:
+ print "Passed"
+ else:
+ print "Failed. See %s.dif" % name
+
+
+
+
+
+
+
diff --git a/chall/ply-2.2/test/testyacc.py b/chall/ply-2.2/test/testyacc.py
new file mode 100644
index 0000000..f976ff5
--- /dev/null
+++ b/chall/ply-2.2/test/testyacc.py
@@ -0,0 +1,58 @@
+#!/usr/local/bin
+# ----------------------------------------------------------------------
+# testyacc.py
+#
+# Run tests for the yacc module
+# ----------------------------------------------------------------------
+
+import sys,os,glob
+
+if len(sys.argv) < 2:
+ print "Usage: python testyacc.py directory"
+ raise SystemExit
+
+dirname = None
+make = 0
+
+for o in sys.argv[1:]:
+ if o == '-make':
+ make = 1
+ else:
+ dirname = o
+ break
+
+if not dirname:
+ print "Usage: python testyacc.py [-make] directory"
+ raise SystemExit
+
+f = glob.glob("%s/%s" % (dirname,"yacc_*.py"))
+
+print "**** Running tests for yacc ****"
+
+for t in f:
+ name = t[:-3]
+ print "Testing %-32s" % name,
+ os.system("rm -f %s/parsetab.*" % dirname)
+ if make:
+ if not os.path.exists("%s.exp" % name):
+ os.system("python %s.py >%s.exp 2>&1" % (name,name))
+ passed = 1
+ else:
+ os.system("python %s.py >%s.out 2>&1" % (name,name))
+ a = os.system("diff %s.out %s.exp >%s.dif" % (name,name,name))
+ if a == 0:
+ passed = 1
+ else:
+ passed = 0
+
+ if passed:
+ print "Passed"
+ else:
+ print "Failed. See %s.dif" % name
+
+
+
+
+
+
+
diff --git a/chall/ply-2.2/test/yacc_badargs.exp b/chall/ply-2.2/test/yacc_badargs.exp
new file mode 100644
index 0000000..e994676
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_badargs.exp
@@ -0,0 +1,3 @@
+./yacc_badargs.py:23: Rule 'p_statement_assign' has too many arguments.
+./yacc_badargs.py:27: Rule 'p_statement_expr' requires an argument.
+ply.yacc.YaccError: Unable to construct parser.
diff --git a/chall/ply-2.2/test/yacc_badargs.py b/chall/ply-2.2/test/yacc_badargs.py
new file mode 100644
index 0000000..810e529
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_badargs.py
@@ -0,0 +1,68 @@
+# -----------------------------------------------------------------------------
+# yacc_badargs.py
+#
+# Rules with wrong # args
+# -----------------------------------------------------------------------------
+import sys
+sys.tracebacklimit = 0
+sys.path.insert(0,"..")
+import ply.yacc as yacc
+
+from calclex import tokens
+
+# Parsing rules
+precedence = (
+ ('left','PLUS','MINUS'),
+ ('left','TIMES','DIVIDE'),
+ ('right','UMINUS'),
+ )
+
+# dictionary of names
+names = { }
+
+def p_statement_assign(t,s):
+ 'statement : NAME EQUALS expression'
+ names[t[1]] = t[3]
+
+def p_statement_expr():
+ 'statement : expression'
+ print t[1]
+
+def p_expression_binop(t):
+ '''expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+ if t[2] == '+' : t[0] = t[1] + t[3]
+ elif t[2] == '-': t[0] = t[1] - t[3]
+ elif t[2] == '*': t[0] = t[1] * t[3]
+ elif t[3] == '/': t[0] = t[1] / t[3]
+
+def p_expression_uminus(t):
+ 'expression : MINUS expression %prec UMINUS'
+ t[0] = -t[2]
+
+def p_expression_group(t):
+ 'expression : LPAREN expression RPAREN'
+ t[0] = t[2]
+
+def p_expression_number(t):
+ 'expression : NUMBER'
+ t[0] = t[1]
+
+def p_expression_name(t):
+ 'expression : NAME'
+ try:
+ t[0] = names[t[1]]
+ except LookupError:
+ print "Undefined name '%s'" % t[1]
+ t[0] = 0
+
+def p_error(t):
+ print "Syntax error at '%s'" % t.value
+
+yacc.yacc()
+
+
+
+
diff --git a/chall/ply-2.2/test/yacc_badprec.exp b/chall/ply-2.2/test/yacc_badprec.exp
new file mode 100644
index 0000000..f4f574b
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_badprec.exp
@@ -0,0 +1 @@
+ply.yacc.YaccError: precedence must be a list or tuple.
diff --git a/chall/ply-2.2/test/yacc_badprec.py b/chall/ply-2.2/test/yacc_badprec.py
new file mode 100644
index 0000000..8f64652
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_badprec.py
@@ -0,0 +1,65 @@
+# -----------------------------------------------------------------------------
+# yacc_badprec.py
+#
+# Bad precedence specifier
+# -----------------------------------------------------------------------------
+import sys
+sys.tracebacklimit = 0
+
+sys.path.insert(0,"..")
+import ply.yacc as yacc
+
+from calclex import tokens
+
+# Parsing rules
+precedence = "blah"
+
+# dictionary of names
+names = { }
+
+def p_statement_assign(t):
+ 'statement : NAME EQUALS expression'
+ names[t[1]] = t[3]
+
+def p_statement_expr(t):
+ 'statement : expression'
+ print t[1]
+
+def p_expression_binop(t):
+ '''expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+ if t[2] == '+' : t[0] = t[1] + t[3]
+ elif t[2] == '-': t[0] = t[1] - t[3]
+ elif t[2] == '*': t[0] = t[1] * t[3]
+ elif t[3] == '/': t[0] = t[1] / t[3]
+
+def p_expression_uminus(t):
+ 'expression : MINUS expression %prec UMINUS'
+ t[0] = -t[2]
+
+def p_expression_group(t):
+ 'expression : LPAREN expression RPAREN'
+ t[0] = t[2]
+
+def p_expression_number(t):
+ 'expression : NUMBER'
+ t[0] = t[1]
+
+def p_expression_name(t):
+ 'expression : NAME'
+ try:
+ t[0] = names[t[1]]
+ except LookupError:
+ print "Undefined name '%s'" % t[1]
+ t[0] = 0
+
+def p_error(t):
+ print "Syntax error at '%s'" % t.value
+
+yacc.yacc()
+
+
+
+
diff --git a/chall/ply-2.2/test/yacc_badprec2.exp b/chall/ply-2.2/test/yacc_badprec2.exp
new file mode 100644
index 0000000..8fac075
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_badprec2.exp
@@ -0,0 +1,3 @@
+yacc: Invalid precedence table.
+yacc: Generating LALR parsing table...
+yacc: 8 shift/reduce conflicts
diff --git a/chall/ply-2.2/test/yacc_badprec2.py b/chall/ply-2.2/test/yacc_badprec2.py
new file mode 100644
index 0000000..206bda7
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_badprec2.py
@@ -0,0 +1,69 @@
+# -----------------------------------------------------------------------------
+# yacc_badprec2.py
+#
+# Bad precedence
+# -----------------------------------------------------------------------------
+import sys
+sys.tracebacklimit = 0
+
+sys.path.insert(0,"..")
+import ply.yacc as yacc
+
+from calclex import tokens
+
+# Parsing rules
+precedence = (
+ 42,
+ ('left','TIMES','DIVIDE'),
+ ('right','UMINUS'),
+ )
+
+# dictionary of names
+names = { }
+
+def p_statement_assign(t):
+ 'statement : NAME EQUALS expression'
+ names[t[1]] = t[3]
+
+def p_statement_expr(t):
+ 'statement : expression'
+ print t[1]
+
+def p_expression_binop(t):
+ '''expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+ if t[2] == '+' : t[0] = t[1] + t[3]
+ elif t[2] == '-': t[0] = t[1] - t[3]
+ elif t[2] == '*': t[0] = t[1] * t[3]
+ elif t[3] == '/': t[0] = t[1] / t[3]
+
+def p_expression_uminus(t):
+ 'expression : MINUS expression %prec UMINUS'
+ t[0] = -t[2]
+
+def p_expression_group(t):
+ 'expression : LPAREN expression RPAREN'
+ t[0] = t[2]
+
+def p_expression_number(t):
+ 'expression : NUMBER'
+ t[0] = t[1]
+
+def p_expression_name(t):
+ 'expression : NAME'
+ try:
+ t[0] = names[t[1]]
+ except LookupError:
+ print "Undefined name '%s'" % t[1]
+ t[0] = 0
+
+def p_error(t):
+ print "Syntax error at '%s'" % t.value
+
+yacc.yacc()
+
+
+
+
diff --git a/chall/ply-2.2/test/yacc_badrule.exp b/chall/ply-2.2/test/yacc_badrule.exp
new file mode 100644
index 0000000..a87bf7d
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_badrule.exp
@@ -0,0 +1,5 @@
+./yacc_badrule.py:25: Syntax error. Expected ':'
+./yacc_badrule.py:29: Syntax error in rule 'statement'
+./yacc_badrule.py:34: Syntax error. Expected ':'
+./yacc_badrule.py:43: Syntax error. Expected ':'
+ply.yacc.YaccError: Unable to construct parser.
diff --git a/chall/ply-2.2/test/yacc_badrule.py b/chall/ply-2.2/test/yacc_badrule.py
new file mode 100644
index 0000000..f5fef8a
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_badrule.py
@@ -0,0 +1,69 @@
+# -----------------------------------------------------------------------------
+# yacc_badrule.py
+#
+# Syntax problems in the rule strings
+# -----------------------------------------------------------------------------
+import sys
+sys.tracebacklimit = 0
+
+sys.path.insert(0,"..")
+import ply.yacc as yacc
+
+from calclex import tokens
+
+# Parsing rules
+precedence = (
+ ('left','PLUS','MINUS'),
+ ('left','TIMES','DIVIDE'),
+ ('right','UMINUS'),
+ )
+
+# dictionary of names
+names = { }
+
+def p_statement_assign(t):
+ 'statement NAME EQUALS expression'
+ names[t[1]] = t[3]
+
+def p_statement_expr(t):
+ 'statement'
+ print t[1]
+
+def p_expression_binop(t):
+ '''expression : expression PLUS expression
+ expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+ if t[2] == '+' : t[0] = t[1] + t[3]
+ elif t[2] == '-': t[0] = t[1] - t[3]
+ elif t[2] == '*': t[0] = t[1] * t[3]
+ elif t[3] == '/': t[0] = t[1] / t[3]
+
+def p_expression_uminus(t):
+ 'expression: MINUS expression %prec UMINUS'
+ t[0] = -t[2]
+
+def p_expression_group(t):
+ 'expression : LPAREN expression RPAREN'
+ t[0] = t[2]
+
+def p_expression_number(t):
+ 'expression : NUMBER'
+ t[0] = t[1]
+
+def p_expression_name(t):
+ 'expression : NAME'
+ try:
+ t[0] = names[t[1]]
+ except LookupError:
+ print "Undefined name '%s'" % t[1]
+ t[0] = 0
+
+def p_error(t):
+ print "Syntax error at '%s'" % t.value
+
+yacc.yacc()
+
+
+
+
diff --git a/chall/ply-2.2/test/yacc_badtok.exp b/chall/ply-2.2/test/yacc_badtok.exp
new file mode 100644
index 0000000..ccdc0e7
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_badtok.exp
@@ -0,0 +1 @@
+ply.yacc.YaccError: tokens must be a list or tuple.
diff --git a/chall/ply-2.2/test/yacc_badtok.py b/chall/ply-2.2/test/yacc_badtok.py
new file mode 100644
index 0000000..4f2af51
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_badtok.py
@@ -0,0 +1,70 @@
+# -----------------------------------------------------------------------------
+# yacc_badtok.py
+#
+# A grammar, but tokens is a bad datatype
+# -----------------------------------------------------------------------------
+
+import sys
+sys.tracebacklimit = 0
+
+sys.path.insert(0,"..")
+import ply.yacc as yacc
+
+tokens = "Hello"
+
+# Parsing rules
+precedence = (
+ ('left','PLUS','MINUS'),
+ ('left','TIMES','DIVIDE'),
+ ('right','UMINUS'),
+ )
+
+# dictionary of names
+names = { }
+
+def p_statement_assign(t):
+ 'statement : NAME EQUALS expression'
+ names[t[1]] = t[3]
+
+def p_statement_expr(t):
+ 'statement : expression'
+ print t[1]
+
+def p_expression_binop(t):
+ '''expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+ if t[2] == '+' : t[0] = t[1] + t[3]
+ elif t[2] == '-': t[0] = t[1] - t[3]
+ elif t[2] == '*': t[0] = t[1] * t[3]
+ elif t[3] == '/': t[0] = t[1] / t[3]
+
+def p_expression_uminus(t):
+ 'expression : MINUS expression %prec UMINUS'
+ t[0] = -t[2]
+
+def p_expression_group(t):
+ 'expression : LPAREN expression RPAREN'
+ t[0] = t[2]
+
+def p_expression_number(t):
+ 'expression : NUMBER'
+ t[0] = t[1]
+
+def p_expression_name(t):
+ 'expression : NAME'
+ try:
+ t[0] = names[t[1]]
+ except LookupError:
+ print "Undefined name '%s'" % t[1]
+ t[0] = 0
+
+def p_error(t):
+ print "Syntax error at '%s'" % t.value
+
+yacc.yacc()
+
+
+
+
diff --git a/chall/ply-2.2/test/yacc_dup.exp b/chall/ply-2.2/test/yacc_dup.exp
new file mode 100644
index 0000000..fdfb210
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_dup.exp
@@ -0,0 +1,4 @@
+./yacc_dup.py:28: Function p_statement redefined. Previously defined on line 24
+yacc: Warning. Token 'EQUALS' defined, but not used.
+yacc: Warning. There is 1 unused token.
+yacc: Generating LALR parsing table...
diff --git a/chall/ply-2.2/test/yacc_dup.py b/chall/ply-2.2/test/yacc_dup.py
new file mode 100644
index 0000000..e0b683d
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_dup.py
@@ -0,0 +1,69 @@
+# -----------------------------------------------------------------------------
+# yacc_dup.py
+#
+# Duplicated rule name
+# -----------------------------------------------------------------------------
+import sys
+sys.tracebacklimit = 0
+
+sys.path.insert(0,"..")
+import ply.yacc as yacc
+
+from calclex import tokens
+
+# Parsing rules
+precedence = (
+ ('left','PLUS','MINUS'),
+ ('left','TIMES','DIVIDE'),
+ ('right','UMINUS'),
+ )
+
+# dictionary of names
+names = { }
+
+def p_statement(t):
+ 'statement : NAME EQUALS expression'
+ names[t[1]] = t[3]
+
+def p_statement(t):
+ 'statement : expression'
+ print t[1]
+
+def p_expression_binop(t):
+ '''expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+ if t[2] == '+' : t[0] = t[1] + t[3]
+ elif t[2] == '-': t[0] = t[1] - t[3]
+ elif t[2] == '*': t[0] = t[1] * t[3]
+ elif t[3] == '/': t[0] = t[1] / t[3]
+
+def p_expression_uminus(t):
+ 'expression : MINUS expression %prec UMINUS'
+ t[0] = -t[2]
+
+def p_expression_group(t):
+ 'expression : LPAREN expression RPAREN'
+ t[0] = t[2]
+
+def p_expression_number(t):
+ 'expression : NUMBER'
+ t[0] = t[1]
+
+def p_expression_name(t):
+ 'expression : NAME'
+ try:
+ t[0] = names[t[1]]
+ except LookupError:
+ print "Undefined name '%s'" % t[1]
+ t[0] = 0
+
+def p_error(t):
+ print "Syntax error at '%s'" % t.value
+
+yacc.yacc()
+
+
+
+
diff --git a/chall/ply-2.2/test/yacc_error1.exp b/chall/ply-2.2/test/yacc_error1.exp
new file mode 100644
index 0000000..13bed04
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_error1.exp
@@ -0,0 +1 @@
+ply.yacc.YaccError: ./yacc_error1.py:62: p_error() requires 1 argument.
diff --git a/chall/ply-2.2/test/yacc_error1.py b/chall/ply-2.2/test/yacc_error1.py
new file mode 100644
index 0000000..2768fc1
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_error1.py
@@ -0,0 +1,69 @@
+# -----------------------------------------------------------------------------
+# yacc_error1.py
+#
+# Bad p_error() function
+# -----------------------------------------------------------------------------
+import sys
+sys.tracebacklimit = 0
+
+sys.path.insert(0,"..")
+import ply.yacc as yacc
+
+from calclex import tokens
+
+# Parsing rules
+precedence = (
+ ('left','PLUS','MINUS'),
+ ('left','TIMES','DIVIDE'),
+ ('right','UMINUS'),
+ )
+
+# dictionary of names
+names = { }
+
+def p_statement_assign(t):
+ 'statement : NAME EQUALS expression'
+ names[t[1]] = t[3]
+
+def p_statement_expr(t):
+ 'statement : expression'
+ print t[1]
+
+def p_expression_binop(t):
+ '''expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+ if t[2] == '+' : t[0] = t[1] + t[3]
+ elif t[2] == '-': t[0] = t[1] - t[3]
+ elif t[2] == '*': t[0] = t[1] * t[3]
+ elif t[3] == '/': t[0] = t[1] / t[3]
+
+def p_expression_uminus(t):
+ 'expression : MINUS expression %prec UMINUS'
+ t[0] = -t[2]
+
+def p_expression_group(t):
+ 'expression : LPAREN expression RPAREN'
+ t[0] = t[2]
+
+def p_expression_number(t):
+ 'expression : NUMBER'
+ t[0] = t[1]
+
+def p_expression_name(t):
+ 'expression : NAME'
+ try:
+ t[0] = names[t[1]]
+ except LookupError:
+ print "Undefined name '%s'" % t[1]
+ t[0] = 0
+
+def p_error(t,s):
+ print "Syntax error at '%s'" % t.value
+
+yacc.yacc()
+
+
+
+
diff --git a/chall/ply-2.2/test/yacc_error2.exp b/chall/ply-2.2/test/yacc_error2.exp
new file mode 100644
index 0000000..4a7628d
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_error2.exp
@@ -0,0 +1 @@
+ply.yacc.YaccError: ./yacc_error2.py:62: p_error() requires 1 argument.
diff --git a/chall/ply-2.2/test/yacc_error2.py b/chall/ply-2.2/test/yacc_error2.py
new file mode 100644
index 0000000..8f3a052
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_error2.py
@@ -0,0 +1,69 @@
+# -----------------------------------------------------------------------------
+# yacc_error1.py
+#
+# Bad p_error() function
+# -----------------------------------------------------------------------------
+import sys
+sys.tracebacklimit = 0
+
+sys.path.insert(0,"..")
+import ply.yacc as yacc
+
+from calclex import tokens
+
+# Parsing rules
+precedence = (
+ ('left','PLUS','MINUS'),
+ ('left','TIMES','DIVIDE'),
+ ('right','UMINUS'),
+ )
+
+# dictionary of names
+names = { }
+
+def p_statement_assign(t):
+ 'statement : NAME EQUALS expression'
+ names[t[1]] = t[3]
+
+def p_statement_expr(t):
+ 'statement : expression'
+ print t[1]
+
+def p_expression_binop(t):
+ '''expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+ if t[2] == '+' : t[0] = t[1] + t[3]
+ elif t[2] == '-': t[0] = t[1] - t[3]
+ elif t[2] == '*': t[0] = t[1] * t[3]
+ elif t[3] == '/': t[0] = t[1] / t[3]
+
+def p_expression_uminus(t):
+ 'expression : MINUS expression %prec UMINUS'
+ t[0] = -t[2]
+
+def p_expression_group(t):
+ 'expression : LPAREN expression RPAREN'
+ t[0] = t[2]
+
+def p_expression_number(t):
+ 'expression : NUMBER'
+ t[0] = t[1]
+
+def p_expression_name(t):
+ 'expression : NAME'
+ try:
+ t[0] = names[t[1]]
+ except LookupError:
+ print "Undefined name '%s'" % t[1]
+ t[0] = 0
+
+def p_error():
+ print "Syntax error at '%s'" % t.value
+
+yacc.yacc()
+
+
+
+
diff --git a/chall/ply-2.2/test/yacc_error3.exp b/chall/ply-2.2/test/yacc_error3.exp
new file mode 100644
index 0000000..7fca2fe
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_error3.exp
@@ -0,0 +1 @@
+ply.yacc.YaccError: 'p_error' defined, but is not a function or method.
diff --git a/chall/ply-2.2/test/yacc_error3.py b/chall/ply-2.2/test/yacc_error3.py
new file mode 100644
index 0000000..b387de5
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_error3.py
@@ -0,0 +1,68 @@
+# -----------------------------------------------------------------------------
+# yacc_error1.py
+#
+# Bad p_error() function
+# -----------------------------------------------------------------------------
+import sys
+sys.tracebacklimit = 0
+
+sys.path.insert(0,"..")
+import ply.yacc as yacc
+
+from calclex import tokens
+
+# Parsing rules
+precedence = (
+ ('left','PLUS','MINUS'),
+ ('left','TIMES','DIVIDE'),
+ ('right','UMINUS'),
+ )
+
+# dictionary of names
+names = { }
+
+def p_statement_assign(t):
+ 'statement : NAME EQUALS expression'
+ names[t[1]] = t[3]
+
+def p_statement_expr(t):
+ 'statement : expression'
+ print t[1]
+
+def p_expression_binop(t):
+ '''expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+ if t[2] == '+' : t[0] = t[1] + t[3]
+ elif t[2] == '-': t[0] = t[1] - t[3]
+ elif t[2] == '*': t[0] = t[1] * t[3]
+ elif t[3] == '/': t[0] = t[1] / t[3]
+
+def p_expression_uminus(t):
+ 'expression : MINUS expression %prec UMINUS'
+ t[0] = -t[2]
+
+def p_expression_group(t):
+ 'expression : LPAREN expression RPAREN'
+ t[0] = t[2]
+
+def p_expression_number(t):
+ 'expression : NUMBER'
+ t[0] = t[1]
+
+def p_expression_name(t):
+ 'expression : NAME'
+ try:
+ t[0] = names[t[1]]
+ except LookupError:
+ print "Undefined name '%s'" % t[1]
+ t[0] = 0
+
+p_error = "blah"
+
+yacc.yacc()
+
+
+
+
diff --git a/chall/ply-2.2/test/yacc_inf.exp b/chall/ply-2.2/test/yacc_inf.exp
new file mode 100644
index 0000000..88cfa4a
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_inf.exp
@@ -0,0 +1,5 @@
+yacc: Warning. Token 'NUMBER' defined, but not used.
+yacc: Warning. There is 1 unused token.
+yacc: Infinite recursion detected for symbol 'statement'.
+yacc: Infinite recursion detected for symbol 'expression'.
+ply.yacc.YaccError: Unable to construct parser.
diff --git a/chall/ply-2.2/test/yacc_inf.py b/chall/ply-2.2/test/yacc_inf.py
new file mode 100644
index 0000000..9b9aef7
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_inf.py
@@ -0,0 +1,57 @@
+# -----------------------------------------------------------------------------
+# yacc_inf.py
+#
+# Infinite recursion
+# -----------------------------------------------------------------------------
+import sys
+sys.tracebacklimit = 0
+
+sys.path.insert(0,"..")
+import ply.yacc as yacc
+
+from calclex import tokens
+
+# Parsing rules
+precedence = (
+ ('left','PLUS','MINUS'),
+ ('left','TIMES','DIVIDE'),
+ ('right','UMINUS'),
+ )
+
+# dictionary of names
+names = { }
+
+def p_statement_assign(t):
+ 'statement : NAME EQUALS expression'
+ names[t[1]] = t[3]
+
+def p_statement_expr(t):
+ 'statement : expression'
+ print t[1]
+
+def p_expression_binop(t):
+ '''expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+ if t[2] == '+' : t[0] = t[1] + t[3]
+ elif t[2] == '-': t[0] = t[1] - t[3]
+ elif t[2] == '*': t[0] = t[1] * t[3]
+ elif t[3] == '/': t[0] = t[1] / t[3]
+
+def p_expression_uminus(t):
+ 'expression : MINUS expression %prec UMINUS'
+ t[0] = -t[2]
+
+def p_expression_group(t):
+ 'expression : LPAREN expression RPAREN'
+ t[0] = t[2]
+
+def p_error(t):
+ print "Syntax error at '%s'" % t.value
+
+yacc.yacc()
+
+
+
+
diff --git a/chall/ply-2.2/test/yacc_missing1.exp b/chall/ply-2.2/test/yacc_missing1.exp
new file mode 100644
index 0000000..de63d4f
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_missing1.exp
@@ -0,0 +1,2 @@
+./yacc_missing1.py:25: Symbol 'location' used, but not defined as a token or a rule.
+ply.yacc.YaccError: Unable to construct parser.
diff --git a/chall/ply-2.2/test/yacc_missing1.py b/chall/ply-2.2/test/yacc_missing1.py
new file mode 100644
index 0000000..fbc54d8
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_missing1.py
@@ -0,0 +1,69 @@
+# -----------------------------------------------------------------------------
+# yacc_missing1.py
+#
+# Grammar with a missing rule
+# -----------------------------------------------------------------------------
+import sys
+sys.tracebacklimit = 0
+
+sys.path.insert(0,"..")
+import ply.yacc as yacc
+
+from calclex import tokens
+
+# Parsing rules
+precedence = (
+ ('left','PLUS','MINUS'),
+ ('left','TIMES','DIVIDE'),
+ ('right','UMINUS'),
+ )
+
+# dictionary of names
+names = { }
+
+def p_statement_assign(t):
+ 'statement : location EQUALS expression'
+ names[t[1]] = t[3]
+
+def p_statement_expr(t):
+ 'statement : expression'
+ print t[1]
+
+def p_expression_binop(t):
+ '''expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+ if t[2] == '+' : t[0] = t[1] + t[3]
+ elif t[2] == '-': t[0] = t[1] - t[3]
+ elif t[2] == '*': t[0] = t[1] * t[3]
+ elif t[3] == '/': t[0] = t[1] / t[3]
+
+def p_expression_uminus(t):
+ 'expression : MINUS expression %prec UMINUS'
+ t[0] = -t[2]
+
+def p_expression_group(t):
+ 'expression : LPAREN expression RPAREN'
+ t[0] = t[2]
+
+def p_expression_number(t):
+ 'expression : NUMBER'
+ t[0] = t[1]
+
+def p_expression_name(t):
+ 'expression : NAME'
+ try:
+ t[0] = names[t[1]]
+ except LookupError:
+ print "Undefined name '%s'" % t[1]
+ t[0] = 0
+
+def p_error(t):
+ print "Syntax error at '%s'" % t.value
+
+yacc.yacc()
+
+
+
+
diff --git a/chall/ply-2.2/test/yacc_nodoc.exp b/chall/ply-2.2/test/yacc_nodoc.exp
new file mode 100644
index 0000000..889ccfc
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_nodoc.exp
@@ -0,0 +1,2 @@
+./yacc_nodoc.py:28: No documentation string specified in function 'p_statement_expr'
+yacc: Generating LALR parsing table...
diff --git a/chall/ply-2.2/test/yacc_nodoc.py b/chall/ply-2.2/test/yacc_nodoc.py
new file mode 100644
index 0000000..4c5ab20
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_nodoc.py
@@ -0,0 +1,68 @@
+# -----------------------------------------------------------------------------
+# yacc_nodoc.py
+#
+# Rule with a missing doc-string
+# -----------------------------------------------------------------------------
+import sys
+sys.tracebacklimit = 0
+
+sys.path.insert(0,"..")
+import ply.yacc as yacc
+
+from calclex import tokens
+
+# Parsing rules
+precedence = (
+ ('left','PLUS','MINUS'),
+ ('left','TIMES','DIVIDE'),
+ ('right','UMINUS'),
+ )
+
+# dictionary of names
+names = { }
+
+def p_statement_assign(t):
+ 'statement : NAME EQUALS expression'
+ names[t[1]] = t[3]
+
+def p_statement_expr(t):
+ print t[1]
+
+def p_expression_binop(t):
+ '''expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+ if t[2] == '+' : t[0] = t[1] + t[3]
+ elif t[2] == '-': t[0] = t[1] - t[3]
+ elif t[2] == '*': t[0] = t[1] * t[3]
+ elif t[3] == '/': t[0] = t[1] / t[3]
+
+def p_expression_uminus(t):
+ 'expression : MINUS expression %prec UMINUS'
+ t[0] = -t[2]
+
+def p_expression_group(t):
+ 'expression : LPAREN expression RPAREN'
+ t[0] = t[2]
+
+def p_expression_number(t):
+ 'expression : NUMBER'
+ t[0] = t[1]
+
+def p_expression_name(t):
+ 'expression : NAME'
+ try:
+ t[0] = names[t[1]]
+ except LookupError:
+ print "Undefined name '%s'" % t[1]
+ t[0] = 0
+
+def p_error(t):
+ print "Syntax error at '%s'" % t.value
+
+yacc.yacc()
+
+
+
+
diff --git a/chall/ply-2.2/test/yacc_noerror.exp b/chall/ply-2.2/test/yacc_noerror.exp
new file mode 100644
index 0000000..658f907
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_noerror.exp
@@ -0,0 +1,2 @@
+yacc: Generating LALR parsing table...
+yacc: Warning. no p_error() function is defined.
diff --git a/chall/ply-2.2/test/yacc_noerror.py b/chall/ply-2.2/test/yacc_noerror.py
new file mode 100644
index 0000000..9c11838
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_noerror.py
@@ -0,0 +1,67 @@
+# -----------------------------------------------------------------------------
+# yacc_noerror.py
+#
+# No p_error() rule defined.
+# -----------------------------------------------------------------------------
+import sys
+sys.tracebacklimit = 0
+
+sys.path.insert(0,"..")
+import ply.yacc as yacc
+
+from calclex import tokens
+
+# Parsing rules
+precedence = (
+ ('left','PLUS','MINUS'),
+ ('left','TIMES','DIVIDE'),
+ ('right','UMINUS'),
+ )
+
+# dictionary of names
+names = { }
+
+def p_statement_assign(t):
+ 'statement : NAME EQUALS expression'
+ names[t[1]] = t[3]
+
+def p_statement_expr(t):
+ 'statement : expression'
+ print t[1]
+
+def p_expression_binop(t):
+ '''expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+ if t[2] == '+' : t[0] = t[1] + t[3]
+ elif t[2] == '-': t[0] = t[1] - t[3]
+ elif t[2] == '*': t[0] = t[1] * t[3]
+ elif t[3] == '/': t[0] = t[1] / t[3]
+
+def p_expression_uminus(t):
+ 'expression : MINUS expression %prec UMINUS'
+ t[0] = -t[2]
+
+def p_expression_group(t):
+ 'expression : LPAREN expression RPAREN'
+ t[0] = t[2]
+
+def p_expression_number(t):
+ 'expression : NUMBER'
+ t[0] = t[1]
+
+def p_expression_name(t):
+ 'expression : NAME'
+ try:
+ t[0] = names[t[1]]
+ except LookupError:
+ print "Undefined name '%s'" % t[1]
+ t[0] = 0
+
+
+yacc.yacc()
+
+
+
+
diff --git a/chall/ply-2.2/test/yacc_nop.exp b/chall/ply-2.2/test/yacc_nop.exp
new file mode 100644
index 0000000..515fff7
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_nop.exp
@@ -0,0 +1,2 @@
+./yacc_nop.py:28: Warning. Possible grammar rule 'statement_expr' defined without p_ prefix.
+yacc: Generating LALR parsing table...
diff --git a/chall/ply-2.2/test/yacc_nop.py b/chall/ply-2.2/test/yacc_nop.py
new file mode 100644
index 0000000..c0b431d
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_nop.py
@@ -0,0 +1,69 @@
+# -----------------------------------------------------------------------------
+# yacc_nop.py
+#
+# Possible grammar rule defined without p_ prefix
+# -----------------------------------------------------------------------------
+import sys
+sys.tracebacklimit = 0
+
+sys.path.insert(0,"..")
+import ply.yacc as yacc
+
+from calclex import tokens
+
+# Parsing rules
+precedence = (
+ ('left','PLUS','MINUS'),
+ ('left','TIMES','DIVIDE'),
+ ('right','UMINUS'),
+ )
+
+# dictionary of names
+names = { }
+
+def p_statement_assign(t):
+ 'statement : NAME EQUALS expression'
+ names[t[1]] = t[3]
+
+def statement_expr(t):
+ 'statement : expression'
+ print t[1]
+
+def p_expression_binop(t):
+ '''expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+ if t[2] == '+' : t[0] = t[1] + t[3]
+ elif t[2] == '-': t[0] = t[1] - t[3]
+ elif t[2] == '*': t[0] = t[1] * t[3]
+ elif t[3] == '/': t[0] = t[1] / t[3]
+
+def p_expression_uminus(t):
+ 'expression : MINUS expression %prec UMINUS'
+ t[0] = -t[2]
+
+def p_expression_group(t):
+ 'expression : LPAREN expression RPAREN'
+ t[0] = t[2]
+
+def p_expression_number(t):
+ 'expression : NUMBER'
+ t[0] = t[1]
+
+def p_expression_name(t):
+ 'expression : NAME'
+ try:
+ t[0] = names[t[1]]
+ except LookupError:
+ print "Undefined name '%s'" % t[1]
+ t[0] = 0
+
+def p_error(t):
+ print "Syntax error at '%s'" % t.value
+
+yacc.yacc()
+
+
+
+
diff --git a/chall/ply-2.2/test/yacc_notfunc.exp b/chall/ply-2.2/test/yacc_notfunc.exp
new file mode 100644
index 0000000..f73bc93
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_notfunc.exp
@@ -0,0 +1,4 @@
+yacc: Warning. 'p_statement_assign' not defined as a function
+yacc: Warning. Token 'EQUALS' defined, but not used.
+yacc: Warning. There is 1 unused token.
+yacc: Generating LALR parsing table...
diff --git a/chall/ply-2.2/test/yacc_notfunc.py b/chall/ply-2.2/test/yacc_notfunc.py
new file mode 100644
index 0000000..8389355
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_notfunc.py
@@ -0,0 +1,67 @@
+# -----------------------------------------------------------------------------
+# yacc_notfunc.py
+#
+# p_rule not defined as a function
+# -----------------------------------------------------------------------------
+import sys
+sys.tracebacklimit = 0
+
+sys.path.insert(0,"..")
+import ply.yacc as yacc
+
+from calclex import tokens
+
+# Parsing rules
+precedence = (
+ ('left','PLUS','MINUS'),
+ ('left','TIMES','DIVIDE'),
+ ('right','UMINUS'),
+ )
+
+# dictionary of names
+names = { }
+
+p_statement_assign = "Blah"
+
+def p_statement_expr(t):
+ 'statement : expression'
+ print t[1]
+
+def p_expression_binop(t):
+ '''expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+ if t[2] == '+' : t[0] = t[1] + t[3]
+ elif t[2] == '-': t[0] = t[1] - t[3]
+ elif t[2] == '*': t[0] = t[1] * t[3]
+ elif t[3] == '/': t[0] = t[1] / t[3]
+
+def p_expression_uminus(t):
+ 'expression : MINUS expression %prec UMINUS'
+ t[0] = -t[2]
+
+def p_expression_group(t):
+ 'expression : LPAREN expression RPAREN'
+ t[0] = t[2]
+
+def p_expression_number(t):
+ 'expression : NUMBER'
+ t[0] = t[1]
+
+def p_expression_name(t):
+ 'expression : NAME'
+ try:
+ t[0] = names[t[1]]
+ except LookupError:
+ print "Undefined name '%s'" % t[1]
+ t[0] = 0
+
+def p_error(t):
+ print "Syntax error at '%s'" % t.value
+
+yacc.yacc()
+
+
+
+
diff --git a/chall/ply-2.2/test/yacc_notok.exp b/chall/ply-2.2/test/yacc_notok.exp
new file mode 100644
index 0000000..d2399fe
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_notok.exp
@@ -0,0 +1 @@
+ply.yacc.YaccError: module does not define a list 'tokens'
diff --git a/chall/ply-2.2/test/yacc_notok.py b/chall/ply-2.2/test/yacc_notok.py
new file mode 100644
index 0000000..e566a1b
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_notok.py
@@ -0,0 +1,68 @@
+# -----------------------------------------------------------------------------
+# yacc_notok.py
+#
+# A grammar, but we forgot to import the tokens list
+# -----------------------------------------------------------------------------
+
+import sys
+sys.tracebacklimit = 0
+
+sys.path.insert(0,"..")
+import ply.yacc as yacc
+
+# Parsing rules
+precedence = (
+ ('left','PLUS','MINUS'),
+ ('left','TIMES','DIVIDE'),
+ ('right','UMINUS'),
+ )
+
+# dictionary of names
+names = { }
+
+def p_statement_assign(t):
+ 'statement : NAME EQUALS expression'
+ names[t[1]] = t[3]
+
+def p_statement_expr(t):
+ 'statement : expression'
+ print t[1]
+
+def p_expression_binop(t):
+ '''expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+ if t[2] == '+' : t[0] = t[1] + t[3]
+ elif t[2] == '-': t[0] = t[1] - t[3]
+ elif t[2] == '*': t[0] = t[1] * t[3]
+ elif t[3] == '/': t[0] = t[1] / t[3]
+
+def p_expression_uminus(t):
+ 'expression : MINUS expression %prec UMINUS'
+ t[0] = -t[2]
+
+def p_expression_group(t):
+ 'expression : LPAREN expression RPAREN'
+ t[0] = t[2]
+
+def p_expression_number(t):
+ 'expression : NUMBER'
+ t[0] = t[1]
+
+def p_expression_name(t):
+ 'expression : NAME'
+ try:
+ t[0] = names[t[1]]
+ except LookupError:
+ print "Undefined name '%s'" % t[1]
+ t[0] = 0
+
+def p_error(t):
+ print "Syntax error at '%s'" % t.value
+
+yacc.yacc()
+
+
+
+
diff --git a/chall/ply-2.2/test/yacc_rr.exp b/chall/ply-2.2/test/yacc_rr.exp
new file mode 100644
index 0000000..f73cefd
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_rr.exp
@@ -0,0 +1,2 @@
+yacc: Generating LALR parsing table...
+yacc: 1 reduce/reduce conflict
diff --git a/chall/ply-2.2/test/yacc_rr.py b/chall/ply-2.2/test/yacc_rr.py
new file mode 100644
index 0000000..bb8cba2
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_rr.py
@@ -0,0 +1,73 @@
+# -----------------------------------------------------------------------------
+# yacc_rr.py
+#
+# A grammar with a reduce/reduce conflict
+# -----------------------------------------------------------------------------
+import sys
+sys.tracebacklimit = 0
+
+sys.path.insert(0,"..")
+import ply.yacc as yacc
+
+from calclex import tokens
+
+# Parsing rules
+precedence = (
+ ('left','PLUS','MINUS'),
+ ('left','TIMES','DIVIDE'),
+ ('right','UMINUS'),
+ )
+
+# dictionary of names
+names = { }
+
+def p_statement_assign(t):
+ 'statement : NAME EQUALS expression'
+ names[t[1]] = t[3]
+
+def p_statement_assign_2(t):
+ 'statement : NAME EQUALS NUMBER'
+ names[t[1]] = t[3]
+
+def p_statement_expr(t):
+ 'statement : expression'
+ print t[1]
+
+def p_expression_binop(t):
+ '''expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+ if t[2] == '+' : t[0] = t[1] + t[3]
+ elif t[2] == '-': t[0] = t[1] - t[3]
+ elif t[2] == '*': t[0] = t[1] * t[3]
+ elif t[3] == '/': t[0] = t[1] / t[3]
+
+def p_expression_uminus(t):
+ 'expression : MINUS expression %prec UMINUS'
+ t[0] = -t[2]
+
+def p_expression_group(t):
+ 'expression : LPAREN expression RPAREN'
+ t[0] = t[2]
+
+def p_expression_number(t):
+ 'expression : NUMBER'
+ t[0] = t[1]
+
+def p_expression_name(t):
+ 'expression : NAME'
+ try:
+ t[0] = names[t[1]]
+ except LookupError:
+ print "Undefined name '%s'" % t[1]
+ t[0] = 0
+
+def p_error(t):
+ print "Syntax error at '%s'" % t.value
+
+yacc.yacc()
+
+
+
+
diff --git a/chall/ply-2.2/test/yacc_simple.exp b/chall/ply-2.2/test/yacc_simple.exp
new file mode 100644
index 0000000..3836031
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_simple.exp
@@ -0,0 +1 @@
+yacc: Generating LALR parsing table...
diff --git a/chall/ply-2.2/test/yacc_simple.py b/chall/ply-2.2/test/yacc_simple.py
new file mode 100644
index 0000000..b5dc9f3
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_simple.py
@@ -0,0 +1,69 @@
+# -----------------------------------------------------------------------------
+# yacc_simple.py
+#
+# A simple, properly specifier grammar
+# -----------------------------------------------------------------------------
+import sys
+sys.tracebacklimit = 0
+
+sys.path.insert(0,"..")
+import ply.yacc as yacc
+
+from calclex import tokens
+
+# Parsing rules
+precedence = (
+ ('left','PLUS','MINUS'),
+ ('left','TIMES','DIVIDE'),
+ ('right','UMINUS'),
+ )
+
+# dictionary of names
+names = { }
+
+def p_statement_assign(t):
+ 'statement : NAME EQUALS expression'
+ names[t[1]] = t[3]
+
+def p_statement_expr(t):
+ 'statement : expression'
+ print t[1]
+
+def p_expression_binop(t):
+ '''expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+ if t[2] == '+' : t[0] = t[1] + t[3]
+ elif t[2] == '-': t[0] = t[1] - t[3]
+ elif t[2] == '*': t[0] = t[1] * t[3]
+ elif t[3] == '/': t[0] = t[1] / t[3]
+
+def p_expression_uminus(t):
+ 'expression : MINUS expression %prec UMINUS'
+ t[0] = -t[2]
+
+def p_expression_group(t):
+ 'expression : LPAREN expression RPAREN'
+ t[0] = t[2]
+
+def p_expression_number(t):
+ 'expression : NUMBER'
+ t[0] = t[1]
+
+def p_expression_name(t):
+ 'expression : NAME'
+ try:
+ t[0] = names[t[1]]
+ except LookupError:
+ print "Undefined name '%s'" % t[1]
+ t[0] = 0
+
+def p_error(t):
+ print "Syntax error at '%s'" % t.value
+
+yacc.yacc()
+
+
+
+
diff --git a/chall/ply-2.2/test/yacc_sr.exp b/chall/ply-2.2/test/yacc_sr.exp
new file mode 100644
index 0000000..1b76450
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_sr.exp
@@ -0,0 +1,2 @@
+yacc: Generating LALR parsing table...
+yacc: 20 shift/reduce conflicts
diff --git a/chall/ply-2.2/test/yacc_sr.py b/chall/ply-2.2/test/yacc_sr.py
new file mode 100644
index 0000000..e2f03ec
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_sr.py
@@ -0,0 +1,64 @@
+# -----------------------------------------------------------------------------
+# yacc_sr.py
+#
+# A grammar with shift-reduce conflicts
+# -----------------------------------------------------------------------------
+import sys
+sys.tracebacklimit = 0
+
+sys.path.insert(0,"..")
+import ply.yacc as yacc
+
+from calclex import tokens
+
+# Parsing rules
+
+# dictionary of names
+names = { }
+
+def p_statement_assign(t):
+ 'statement : NAME EQUALS expression'
+ names[t[1]] = t[3]
+
+def p_statement_expr(t):
+ 'statement : expression'
+ print t[1]
+
+def p_expression_binop(t):
+ '''expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+ if t[2] == '+' : t[0] = t[1] + t[3]
+ elif t[2] == '-': t[0] = t[1] - t[3]
+ elif t[2] == '*': t[0] = t[1] * t[3]
+ elif t[3] == '/': t[0] = t[1] / t[3]
+
+def p_expression_uminus(t):
+ 'expression : MINUS expression'
+ t[0] = -t[2]
+
+def p_expression_group(t):
+ 'expression : LPAREN expression RPAREN'
+ t[0] = t[2]
+
+def p_expression_number(t):
+ 'expression : NUMBER'
+ t[0] = t[1]
+
+def p_expression_name(t):
+ 'expression : NAME'
+ try:
+ t[0] = names[t[1]]
+ except LookupError:
+ print "Undefined name '%s'" % t[1]
+ t[0] = 0
+
+def p_error(t):
+ print "Syntax error at '%s'" % t.value
+
+yacc.yacc()
+
+
+
+
diff --git a/chall/ply-2.2/test/yacc_term1.exp b/chall/ply-2.2/test/yacc_term1.exp
new file mode 100644
index 0000000..40f9bdf
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_term1.exp
@@ -0,0 +1,2 @@
+./yacc_term1.py:25: Illegal rule name 'NUMBER'. Already defined as a token.
+ply.yacc.YaccError: Unable to construct parser.
diff --git a/chall/ply-2.2/test/yacc_term1.py b/chall/ply-2.2/test/yacc_term1.py
new file mode 100644
index 0000000..bbc52da
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_term1.py
@@ -0,0 +1,69 @@
+# -----------------------------------------------------------------------------
+# yacc_term1.py
+#
+# Terminal used on the left-hand-side
+# -----------------------------------------------------------------------------
+import sys
+sys.tracebacklimit = 0
+
+sys.path.insert(0,"..")
+import ply.yacc as yacc
+
+from calclex import tokens
+
+# Parsing rules
+precedence = (
+ ('left','PLUS','MINUS'),
+ ('left','TIMES','DIVIDE'),
+ ('right','UMINUS'),
+ )
+
+# dictionary of names
+names = { }
+
+def p_statement_assign(t):
+ 'NUMBER : NAME EQUALS expression'
+ names[t[1]] = t[3]
+
+def p_statement_expr(t):
+ 'statement : expression'
+ print t[1]
+
+def p_expression_binop(t):
+ '''expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+ if t[2] == '+' : t[0] = t[1] + t[3]
+ elif t[2] == '-': t[0] = t[1] - t[3]
+ elif t[2] == '*': t[0] = t[1] * t[3]
+ elif t[3] == '/': t[0] = t[1] / t[3]
+
+def p_expression_uminus(t):
+ 'expression : MINUS expression %prec UMINUS'
+ t[0] = -t[2]
+
+def p_expression_group(t):
+ 'expression : LPAREN expression RPAREN'
+ t[0] = t[2]
+
+def p_expression_number(t):
+ 'expression : NUMBER'
+ t[0] = t[1]
+
+def p_expression_name(t):
+ 'expression : NAME'
+ try:
+ t[0] = names[t[1]]
+ except LookupError:
+ print "Undefined name '%s'" % t[1]
+ t[0] = 0
+
+def p_error(t):
+ print "Syntax error at '%s'" % t.value
+
+yacc.yacc()
+
+
+
+
diff --git a/chall/ply-2.2/test/yacc_unused.exp b/chall/ply-2.2/test/yacc_unused.exp
new file mode 100644
index 0000000..6caafd2
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_unused.exp
@@ -0,0 +1,4 @@
+./yacc_unused.py:63: Symbol 'COMMA' used, but not defined as a token or a rule.
+yacc: Symbol 'COMMA' is unreachable.
+yacc: Symbol 'exprlist' is unreachable.
+ply.yacc.YaccError: Unable to construct parser.
diff --git a/chall/ply-2.2/test/yacc_unused.py b/chall/ply-2.2/test/yacc_unused.py
new file mode 100644
index 0000000..3a61f99
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_unused.py
@@ -0,0 +1,78 @@
+# -----------------------------------------------------------------------------
+# yacc_unused.py
+#
+# A grammar with an unused rule
+# -----------------------------------------------------------------------------
+import sys
+sys.tracebacklimit = 0
+
+sys.path.insert(0,"..")
+import ply.yacc as yacc
+
+from calclex import tokens
+
+# Parsing rules
+precedence = (
+ ('left','PLUS','MINUS'),
+ ('left','TIMES','DIVIDE'),
+ ('right','UMINUS'),
+ )
+
+# dictionary of names
+names = { }
+
+def p_statement_assign(t):
+ 'statement : NAME EQUALS expression'
+ names[t[1]] = t[3]
+
+def p_statement_expr(t):
+ 'statement : expression'
+ print t[1]
+
+def p_expression_binop(t):
+ '''expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+ if t[2] == '+' : t[0] = t[1] + t[3]
+ elif t[2] == '-': t[0] = t[1] - t[3]
+ elif t[2] == '*': t[0] = t[1] * t[3]
+ elif t[3] == '/': t[0] = t[1] / t[3]
+
+def p_expression_uminus(t):
+ 'expression : MINUS expression %prec UMINUS'
+ t[0] = -t[2]
+
+def p_expression_group(t):
+ 'expression : LPAREN expression RPAREN'
+ t[0] = t[2]
+
+def p_expression_number(t):
+ 'expression : NUMBER'
+ t[0] = t[1]
+
+def p_expression_name(t):
+ 'expression : NAME'
+ try:
+ t[0] = names[t[1]]
+ except LookupError:
+ print "Undefined name '%s'" % t[1]
+ t[0] = 0
+
+def p_expr_list(t):
+ 'exprlist : exprlist COMMA expression'
+ pass
+
+def p_expr_list_2(t):
+ 'exprlist : expression'
+ pass
+
+
+def p_error(t):
+ print "Syntax error at '%s'" % t.value
+
+yacc.yacc()
+
+
+
+
diff --git a/chall/ply-2.2/test/yacc_uprec.exp b/chall/ply-2.2/test/yacc_uprec.exp
new file mode 100644
index 0000000..eb9a398
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_uprec.exp
@@ -0,0 +1,2 @@
+./yacc_uprec.py:38: Nothing known about the precedence of 'UMINUS'
+ply.yacc.YaccError: Unable to construct parser.
diff --git a/chall/ply-2.2/test/yacc_uprec.py b/chall/ply-2.2/test/yacc_uprec.py
new file mode 100644
index 0000000..0e8711e
--- /dev/null
+++ b/chall/ply-2.2/test/yacc_uprec.py
@@ -0,0 +1,64 @@
+# -----------------------------------------------------------------------------
+# yacc_uprec.py
+#
+# A grammar with a bad %prec specifier
+# -----------------------------------------------------------------------------
+import sys
+sys.tracebacklimit = 0
+
+sys.path.insert(0,"..")
+import ply.yacc as yacc
+
+from calclex import tokens
+
+# Parsing rules
+
+# dictionary of names
+names = { }
+
+def p_statement_assign(t):
+ 'statement : NAME EQUALS expression'
+ names[t[1]] = t[3]
+
+def p_statement_expr(t):
+ 'statement : expression'
+ print t[1]
+
+def p_expression_binop(t):
+ '''expression : expression PLUS expression
+ | expression MINUS expression
+ | expression TIMES expression
+ | expression DIVIDE expression'''
+ if t[2] == '+' : t[0] = t[1] + t[3]
+ elif t[2] == '-': t[0] = t[1] - t[3]
+ elif t[2] == '*': t[0] = t[1] * t[3]
+ elif t[3] == '/': t[0] = t[1] / t[3]
+
+def p_expression_uminus(t):
+ 'expression : MINUS expression %prec UMINUS'
+ t[0] = -t[2]
+
+def p_expression_group(t):
+ 'expression : LPAREN expression RPAREN'
+ t[0] = t[2]
+
+def p_expression_number(t):
+ 'expression : NUMBER'
+ t[0] = t[1]
+
+def p_expression_name(t):
+ 'expression : NAME'
+ try:
+ t[0] = names[t[1]]
+ except LookupError:
+ print "Undefined name '%s'" % t[1]
+ t[0] = 0
+
+def p_error(t):
+ print "Syntax error at '%s'" % t.value
+
+yacc.yacc()
+
+
+
+
diff --git a/chall/src/css/bootstrap-grid.css b/chall/src/css/bootstrap-grid.css
new file mode 100644
index 0000000..5a71a41
--- /dev/null
+++ b/chall/src/css/bootstrap-grid.css
@@ -0,0 +1,2050 @@
+/*!
+ * Bootstrap Grid v4.0.0 (https://getbootstrap.com)
+ * Copyright 2011-2018 The Bootstrap Authors
+ * Copyright 2011-2018 Twitter, Inc.
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ */
+@-ms-viewport {
+ width: device-width;
+}
+
+html {
+ box-sizing: border-box;
+ -ms-overflow-style: scrollbar;
+}
+
+*,
+*::before,
+*::after {
+ box-sizing: inherit;
+}
+
+.container {
+ width: 100%;
+ padding-right: 15px;
+ padding-left: 15px;
+ margin-right: auto;
+ margin-left: auto;
+}
+
+@media (min-width: 576px) {
+ .container {
+ max-width: 540px;
+ }
+}
+
+@media (min-width: 768px) {
+ .container {
+ max-width: 720px;
+ }
+}
+
+@media (min-width: 992px) {
+ .container {
+ max-width: 960px;
+ }
+}
+
+@media (min-width: 1200px) {
+ .container {
+ max-width: 1140px;
+ }
+}
+
+.container-fluid {
+ width: 100%;
+ padding-right: 15px;
+ padding-left: 15px;
+ margin-right: auto;
+ margin-left: auto;
+}
+
+.row {
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -ms-flex-wrap: wrap;
+ flex-wrap: wrap;
+ margin-right: -15px;
+ margin-left: -15px;
+}
+
+.no-gutters {
+ margin-right: 0;
+ margin-left: 0;
+}
+
+.no-gutters > .col,
+.no-gutters > [class*="col-"] {
+ padding-right: 0;
+ padding-left: 0;
+}
+
+.col-1, .col-2, .col-3, .col-4, .col-5, .col-6, .col-7, .col-8, .col-9, .col-10, .col-11, .col-12, .col,
+.col-auto, .col-sm-1, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9, .col-sm-10, .col-sm-11, .col-sm-12, .col-sm,
+.col-sm-auto, .col-md-1, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9, .col-md-10, .col-md-11, .col-md-12, .col-md,
+.col-md-auto, .col-lg-1, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9, .col-lg-10, .col-lg-11, .col-lg-12, .col-lg,
+.col-lg-auto, .col-xl-1, .col-xl-2, .col-xl-3, .col-xl-4, .col-xl-5, .col-xl-6, .col-xl-7, .col-xl-8, .col-xl-9, .col-xl-10, .col-xl-11, .col-xl-12, .col-xl,
+.col-xl-auto {
+ position: relative;
+ width: 100%;
+ min-height: 1px;
+ padding-right: 15px;
+ padding-left: 15px;
+}
+
+.col {
+ -ms-flex-preferred-size: 0;
+ flex-basis: 0;
+ -webkit-box-flex: 1;
+ -ms-flex-positive: 1;
+ flex-grow: 1;
+ max-width: 100%;
+}
+
+.col-auto {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 auto;
+ flex: 0 0 auto;
+ width: auto;
+ max-width: none;
+}
+
+.col-1 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 8.333333%;
+ flex: 0 0 8.333333%;
+ max-width: 8.333333%;
+}
+
+.col-2 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 16.666667%;
+ flex: 0 0 16.666667%;
+ max-width: 16.666667%;
+}
+
+.col-3 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 25%;
+ flex: 0 0 25%;
+ max-width: 25%;
+}
+
+.col-4 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 33.333333%;
+ flex: 0 0 33.333333%;
+ max-width: 33.333333%;
+}
+
+.col-5 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 41.666667%;
+ flex: 0 0 41.666667%;
+ max-width: 41.666667%;
+}
+
+.col-6 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 50%;
+ flex: 0 0 50%;
+ max-width: 50%;
+}
+
+.col-7 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 58.333333%;
+ flex: 0 0 58.333333%;
+ max-width: 58.333333%;
+}
+
+.col-8 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 66.666667%;
+ flex: 0 0 66.666667%;
+ max-width: 66.666667%;
+}
+
+.col-9 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 75%;
+ flex: 0 0 75%;
+ max-width: 75%;
+}
+
+.col-10 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 83.333333%;
+ flex: 0 0 83.333333%;
+ max-width: 83.333333%;
+}
+
+.col-11 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 91.666667%;
+ flex: 0 0 91.666667%;
+ max-width: 91.666667%;
+}
+
+.col-12 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 100%;
+ flex: 0 0 100%;
+ max-width: 100%;
+}
+
+.order-first {
+ -webkit-box-ordinal-group: 0;
+ -ms-flex-order: -1;
+ order: -1;
+}
+
+.order-last {
+ -webkit-box-ordinal-group: 14;
+ -ms-flex-order: 13;
+ order: 13;
+}
+
+.order-0 {
+ -webkit-box-ordinal-group: 1;
+ -ms-flex-order: 0;
+ order: 0;
+}
+
+.order-1 {
+ -webkit-box-ordinal-group: 2;
+ -ms-flex-order: 1;
+ order: 1;
+}
+
+.order-2 {
+ -webkit-box-ordinal-group: 3;
+ -ms-flex-order: 2;
+ order: 2;
+}
+
+.order-3 {
+ -webkit-box-ordinal-group: 4;
+ -ms-flex-order: 3;
+ order: 3;
+}
+
+.order-4 {
+ -webkit-box-ordinal-group: 5;
+ -ms-flex-order: 4;
+ order: 4;
+}
+
+.order-5 {
+ -webkit-box-ordinal-group: 6;
+ -ms-flex-order: 5;
+ order: 5;
+}
+
+.order-6 {
+ -webkit-box-ordinal-group: 7;
+ -ms-flex-order: 6;
+ order: 6;
+}
+
+.order-7 {
+ -webkit-box-ordinal-group: 8;
+ -ms-flex-order: 7;
+ order: 7;
+}
+
+.order-8 {
+ -webkit-box-ordinal-group: 9;
+ -ms-flex-order: 8;
+ order: 8;
+}
+
+.order-9 {
+ -webkit-box-ordinal-group: 10;
+ -ms-flex-order: 9;
+ order: 9;
+}
+
+.order-10 {
+ -webkit-box-ordinal-group: 11;
+ -ms-flex-order: 10;
+ order: 10;
+}
+
+.order-11 {
+ -webkit-box-ordinal-group: 12;
+ -ms-flex-order: 11;
+ order: 11;
+}
+
+.order-12 {
+ -webkit-box-ordinal-group: 13;
+ -ms-flex-order: 12;
+ order: 12;
+}
+
+.offset-1 {
+ margin-left: 8.333333%;
+}
+
+.offset-2 {
+ margin-left: 16.666667%;
+}
+
+.offset-3 {
+ margin-left: 25%;
+}
+
+.offset-4 {
+ margin-left: 33.333333%;
+}
+
+.offset-5 {
+ margin-left: 41.666667%;
+}
+
+.offset-6 {
+ margin-left: 50%;
+}
+
+.offset-7 {
+ margin-left: 58.333333%;
+}
+
+.offset-8 {
+ margin-left: 66.666667%;
+}
+
+.offset-9 {
+ margin-left: 75%;
+}
+
+.offset-10 {
+ margin-left: 83.333333%;
+}
+
+.offset-11 {
+ margin-left: 91.666667%;
+}
+
+@media (min-width: 576px) {
+ .col-sm {
+ -ms-flex-preferred-size: 0;
+ flex-basis: 0;
+ -webkit-box-flex: 1;
+ -ms-flex-positive: 1;
+ flex-grow: 1;
+ max-width: 100%;
+ }
+ .col-sm-auto {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 auto;
+ flex: 0 0 auto;
+ width: auto;
+ max-width: none;
+ }
+ .col-sm-1 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 8.333333%;
+ flex: 0 0 8.333333%;
+ max-width: 8.333333%;
+ }
+ .col-sm-2 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 16.666667%;
+ flex: 0 0 16.666667%;
+ max-width: 16.666667%;
+ }
+ .col-sm-3 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 25%;
+ flex: 0 0 25%;
+ max-width: 25%;
+ }
+ .col-sm-4 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 33.333333%;
+ flex: 0 0 33.333333%;
+ max-width: 33.333333%;
+ }
+ .col-sm-5 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 41.666667%;
+ flex: 0 0 41.666667%;
+ max-width: 41.666667%;
+ }
+ .col-sm-6 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 50%;
+ flex: 0 0 50%;
+ max-width: 50%;
+ }
+ .col-sm-7 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 58.333333%;
+ flex: 0 0 58.333333%;
+ max-width: 58.333333%;
+ }
+ .col-sm-8 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 66.666667%;
+ flex: 0 0 66.666667%;
+ max-width: 66.666667%;
+ }
+ .col-sm-9 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 75%;
+ flex: 0 0 75%;
+ max-width: 75%;
+ }
+ .col-sm-10 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 83.333333%;
+ flex: 0 0 83.333333%;
+ max-width: 83.333333%;
+ }
+ .col-sm-11 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 91.666667%;
+ flex: 0 0 91.666667%;
+ max-width: 91.666667%;
+ }
+ .col-sm-12 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 100%;
+ flex: 0 0 100%;
+ max-width: 100%;
+ }
+ .order-sm-first {
+ -webkit-box-ordinal-group: 0;
+ -ms-flex-order: -1;
+ order: -1;
+ }
+ .order-sm-last {
+ -webkit-box-ordinal-group: 14;
+ -ms-flex-order: 13;
+ order: 13;
+ }
+ .order-sm-0 {
+ -webkit-box-ordinal-group: 1;
+ -ms-flex-order: 0;
+ order: 0;
+ }
+ .order-sm-1 {
+ -webkit-box-ordinal-group: 2;
+ -ms-flex-order: 1;
+ order: 1;
+ }
+ .order-sm-2 {
+ -webkit-box-ordinal-group: 3;
+ -ms-flex-order: 2;
+ order: 2;
+ }
+ .order-sm-3 {
+ -webkit-box-ordinal-group: 4;
+ -ms-flex-order: 3;
+ order: 3;
+ }
+ .order-sm-4 {
+ -webkit-box-ordinal-group: 5;
+ -ms-flex-order: 4;
+ order: 4;
+ }
+ .order-sm-5 {
+ -webkit-box-ordinal-group: 6;
+ -ms-flex-order: 5;
+ order: 5;
+ }
+ .order-sm-6 {
+ -webkit-box-ordinal-group: 7;
+ -ms-flex-order: 6;
+ order: 6;
+ }
+ .order-sm-7 {
+ -webkit-box-ordinal-group: 8;
+ -ms-flex-order: 7;
+ order: 7;
+ }
+ .order-sm-8 {
+ -webkit-box-ordinal-group: 9;
+ -ms-flex-order: 8;
+ order: 8;
+ }
+ .order-sm-9 {
+ -webkit-box-ordinal-group: 10;
+ -ms-flex-order: 9;
+ order: 9;
+ }
+ .order-sm-10 {
+ -webkit-box-ordinal-group: 11;
+ -ms-flex-order: 10;
+ order: 10;
+ }
+ .order-sm-11 {
+ -webkit-box-ordinal-group: 12;
+ -ms-flex-order: 11;
+ order: 11;
+ }
+ .order-sm-12 {
+ -webkit-box-ordinal-group: 13;
+ -ms-flex-order: 12;
+ order: 12;
+ }
+ .offset-sm-0 {
+ margin-left: 0;
+ }
+ .offset-sm-1 {
+ margin-left: 8.333333%;
+ }
+ .offset-sm-2 {
+ margin-left: 16.666667%;
+ }
+ .offset-sm-3 {
+ margin-left: 25%;
+ }
+ .offset-sm-4 {
+ margin-left: 33.333333%;
+ }
+ .offset-sm-5 {
+ margin-left: 41.666667%;
+ }
+ .offset-sm-6 {
+ margin-left: 50%;
+ }
+ .offset-sm-7 {
+ margin-left: 58.333333%;
+ }
+ .offset-sm-8 {
+ margin-left: 66.666667%;
+ }
+ .offset-sm-9 {
+ margin-left: 75%;
+ }
+ .offset-sm-10 {
+ margin-left: 83.333333%;
+ }
+ .offset-sm-11 {
+ margin-left: 91.666667%;
+ }
+}
+
+@media (min-width: 768px) {
+ .col-md {
+ -ms-flex-preferred-size: 0;
+ flex-basis: 0;
+ -webkit-box-flex: 1;
+ -ms-flex-positive: 1;
+ flex-grow: 1;
+ max-width: 100%;
+ }
+ .col-md-auto {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 auto;
+ flex: 0 0 auto;
+ width: auto;
+ max-width: none;
+ }
+ .col-md-1 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 8.333333%;
+ flex: 0 0 8.333333%;
+ max-width: 8.333333%;
+ }
+ .col-md-2 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 16.666667%;
+ flex: 0 0 16.666667%;
+ max-width: 16.666667%;
+ }
+ .col-md-3 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 25%;
+ flex: 0 0 25%;
+ max-width: 25%;
+ }
+ .col-md-4 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 33.333333%;
+ flex: 0 0 33.333333%;
+ max-width: 33.333333%;
+ }
+ .col-md-5 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 41.666667%;
+ flex: 0 0 41.666667%;
+ max-width: 41.666667%;
+ }
+ .col-md-6 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 50%;
+ flex: 0 0 50%;
+ max-width: 50%;
+ }
+ .col-md-7 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 58.333333%;
+ flex: 0 0 58.333333%;
+ max-width: 58.333333%;
+ }
+ .col-md-8 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 66.666667%;
+ flex: 0 0 66.666667%;
+ max-width: 66.666667%;
+ }
+ .col-md-9 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 75%;
+ flex: 0 0 75%;
+ max-width: 75%;
+ }
+ .col-md-10 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 83.333333%;
+ flex: 0 0 83.333333%;
+ max-width: 83.333333%;
+ }
+ .col-md-11 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 91.666667%;
+ flex: 0 0 91.666667%;
+ max-width: 91.666667%;
+ }
+ .col-md-12 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 100%;
+ flex: 0 0 100%;
+ max-width: 100%;
+ }
+ .order-md-first {
+ -webkit-box-ordinal-group: 0;
+ -ms-flex-order: -1;
+ order: -1;
+ }
+ .order-md-last {
+ -webkit-box-ordinal-group: 14;
+ -ms-flex-order: 13;
+ order: 13;
+ }
+ .order-md-0 {
+ -webkit-box-ordinal-group: 1;
+ -ms-flex-order: 0;
+ order: 0;
+ }
+ .order-md-1 {
+ -webkit-box-ordinal-group: 2;
+ -ms-flex-order: 1;
+ order: 1;
+ }
+ .order-md-2 {
+ -webkit-box-ordinal-group: 3;
+ -ms-flex-order: 2;
+ order: 2;
+ }
+ .order-md-3 {
+ -webkit-box-ordinal-group: 4;
+ -ms-flex-order: 3;
+ order: 3;
+ }
+ .order-md-4 {
+ -webkit-box-ordinal-group: 5;
+ -ms-flex-order: 4;
+ order: 4;
+ }
+ .order-md-5 {
+ -webkit-box-ordinal-group: 6;
+ -ms-flex-order: 5;
+ order: 5;
+ }
+ .order-md-6 {
+ -webkit-box-ordinal-group: 7;
+ -ms-flex-order: 6;
+ order: 6;
+ }
+ .order-md-7 {
+ -webkit-box-ordinal-group: 8;
+ -ms-flex-order: 7;
+ order: 7;
+ }
+ .order-md-8 {
+ -webkit-box-ordinal-group: 9;
+ -ms-flex-order: 8;
+ order: 8;
+ }
+ .order-md-9 {
+ -webkit-box-ordinal-group: 10;
+ -ms-flex-order: 9;
+ order: 9;
+ }
+ .order-md-10 {
+ -webkit-box-ordinal-group: 11;
+ -ms-flex-order: 10;
+ order: 10;
+ }
+ .order-md-11 {
+ -webkit-box-ordinal-group: 12;
+ -ms-flex-order: 11;
+ order: 11;
+ }
+ .order-md-12 {
+ -webkit-box-ordinal-group: 13;
+ -ms-flex-order: 12;
+ order: 12;
+ }
+ .offset-md-0 {
+ margin-left: 0;
+ }
+ .offset-md-1 {
+ margin-left: 8.333333%;
+ }
+ .offset-md-2 {
+ margin-left: 16.666667%;
+ }
+ .offset-md-3 {
+ margin-left: 25%;
+ }
+ .offset-md-4 {
+ margin-left: 33.333333%;
+ }
+ .offset-md-5 {
+ margin-left: 41.666667%;
+ }
+ .offset-md-6 {
+ margin-left: 50%;
+ }
+ .offset-md-7 {
+ margin-left: 58.333333%;
+ }
+ .offset-md-8 {
+ margin-left: 66.666667%;
+ }
+ .offset-md-9 {
+ margin-left: 75%;
+ }
+ .offset-md-10 {
+ margin-left: 83.333333%;
+ }
+ .offset-md-11 {
+ margin-left: 91.666667%;
+ }
+}
+
+@media (min-width: 992px) {
+ .col-lg {
+ -ms-flex-preferred-size: 0;
+ flex-basis: 0;
+ -webkit-box-flex: 1;
+ -ms-flex-positive: 1;
+ flex-grow: 1;
+ max-width: 100%;
+ }
+ .col-lg-auto {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 auto;
+ flex: 0 0 auto;
+ width: auto;
+ max-width: none;
+ }
+ .col-lg-1 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 8.333333%;
+ flex: 0 0 8.333333%;
+ max-width: 8.333333%;
+ }
+ .col-lg-2 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 16.666667%;
+ flex: 0 0 16.666667%;
+ max-width: 16.666667%;
+ }
+ .col-lg-3 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 25%;
+ flex: 0 0 25%;
+ max-width: 25%;
+ }
+ .col-lg-4 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 33.333333%;
+ flex: 0 0 33.333333%;
+ max-width: 33.333333%;
+ }
+ .col-lg-5 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 41.666667%;
+ flex: 0 0 41.666667%;
+ max-width: 41.666667%;
+ }
+ .col-lg-6 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 50%;
+ flex: 0 0 50%;
+ max-width: 50%;
+ }
+ .col-lg-7 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 58.333333%;
+ flex: 0 0 58.333333%;
+ max-width: 58.333333%;
+ }
+ .col-lg-8 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 66.666667%;
+ flex: 0 0 66.666667%;
+ max-width: 66.666667%;
+ }
+ .col-lg-9 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 75%;
+ flex: 0 0 75%;
+ max-width: 75%;
+ }
+ .col-lg-10 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 83.333333%;
+ flex: 0 0 83.333333%;
+ max-width: 83.333333%;
+ }
+ .col-lg-11 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 91.666667%;
+ flex: 0 0 91.666667%;
+ max-width: 91.666667%;
+ }
+ .col-lg-12 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 100%;
+ flex: 0 0 100%;
+ max-width: 100%;
+ }
+ .order-lg-first {
+ -webkit-box-ordinal-group: 0;
+ -ms-flex-order: -1;
+ order: -1;
+ }
+ .order-lg-last {
+ -webkit-box-ordinal-group: 14;
+ -ms-flex-order: 13;
+ order: 13;
+ }
+ .order-lg-0 {
+ -webkit-box-ordinal-group: 1;
+ -ms-flex-order: 0;
+ order: 0;
+ }
+ .order-lg-1 {
+ -webkit-box-ordinal-group: 2;
+ -ms-flex-order: 1;
+ order: 1;
+ }
+ .order-lg-2 {
+ -webkit-box-ordinal-group: 3;
+ -ms-flex-order: 2;
+ order: 2;
+ }
+ .order-lg-3 {
+ -webkit-box-ordinal-group: 4;
+ -ms-flex-order: 3;
+ order: 3;
+ }
+ .order-lg-4 {
+ -webkit-box-ordinal-group: 5;
+ -ms-flex-order: 4;
+ order: 4;
+ }
+ .order-lg-5 {
+ -webkit-box-ordinal-group: 6;
+ -ms-flex-order: 5;
+ order: 5;
+ }
+ .order-lg-6 {
+ -webkit-box-ordinal-group: 7;
+ -ms-flex-order: 6;
+ order: 6;
+ }
+ .order-lg-7 {
+ -webkit-box-ordinal-group: 8;
+ -ms-flex-order: 7;
+ order: 7;
+ }
+ .order-lg-8 {
+ -webkit-box-ordinal-group: 9;
+ -ms-flex-order: 8;
+ order: 8;
+ }
+ .order-lg-9 {
+ -webkit-box-ordinal-group: 10;
+ -ms-flex-order: 9;
+ order: 9;
+ }
+ .order-lg-10 {
+ -webkit-box-ordinal-group: 11;
+ -ms-flex-order: 10;
+ order: 10;
+ }
+ .order-lg-11 {
+ -webkit-box-ordinal-group: 12;
+ -ms-flex-order: 11;
+ order: 11;
+ }
+ .order-lg-12 {
+ -webkit-box-ordinal-group: 13;
+ -ms-flex-order: 12;
+ order: 12;
+ }
+ .offset-lg-0 {
+ margin-left: 0;
+ }
+ .offset-lg-1 {
+ margin-left: 8.333333%;
+ }
+ .offset-lg-2 {
+ margin-left: 16.666667%;
+ }
+ .offset-lg-3 {
+ margin-left: 25%;
+ }
+ .offset-lg-4 {
+ margin-left: 33.333333%;
+ }
+ .offset-lg-5 {
+ margin-left: 41.666667%;
+ }
+ .offset-lg-6 {
+ margin-left: 50%;
+ }
+ .offset-lg-7 {
+ margin-left: 58.333333%;
+ }
+ .offset-lg-8 {
+ margin-left: 66.666667%;
+ }
+ .offset-lg-9 {
+ margin-left: 75%;
+ }
+ .offset-lg-10 {
+ margin-left: 83.333333%;
+ }
+ .offset-lg-11 {
+ margin-left: 91.666667%;
+ }
+}
+
+@media (min-width: 1200px) {
+ .col-xl {
+ -ms-flex-preferred-size: 0;
+ flex-basis: 0;
+ -webkit-box-flex: 1;
+ -ms-flex-positive: 1;
+ flex-grow: 1;
+ max-width: 100%;
+ }
+ .col-xl-auto {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 auto;
+ flex: 0 0 auto;
+ width: auto;
+ max-width: none;
+ }
+ .col-xl-1 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 8.333333%;
+ flex: 0 0 8.333333%;
+ max-width: 8.333333%;
+ }
+ .col-xl-2 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 16.666667%;
+ flex: 0 0 16.666667%;
+ max-width: 16.666667%;
+ }
+ .col-xl-3 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 25%;
+ flex: 0 0 25%;
+ max-width: 25%;
+ }
+ .col-xl-4 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 33.333333%;
+ flex: 0 0 33.333333%;
+ max-width: 33.333333%;
+ }
+ .col-xl-5 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 41.666667%;
+ flex: 0 0 41.666667%;
+ max-width: 41.666667%;
+ }
+ .col-xl-6 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 50%;
+ flex: 0 0 50%;
+ max-width: 50%;
+ }
+ .col-xl-7 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 58.333333%;
+ flex: 0 0 58.333333%;
+ max-width: 58.333333%;
+ }
+ .col-xl-8 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 66.666667%;
+ flex: 0 0 66.666667%;
+ max-width: 66.666667%;
+ }
+ .col-xl-9 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 75%;
+ flex: 0 0 75%;
+ max-width: 75%;
+ }
+ .col-xl-10 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 83.333333%;
+ flex: 0 0 83.333333%;
+ max-width: 83.333333%;
+ }
+ .col-xl-11 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 91.666667%;
+ flex: 0 0 91.666667%;
+ max-width: 91.666667%;
+ }
+ .col-xl-12 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 100%;
+ flex: 0 0 100%;
+ max-width: 100%;
+ }
+ .order-xl-first {
+ -webkit-box-ordinal-group: 0;
+ -ms-flex-order: -1;
+ order: -1;
+ }
+ .order-xl-last {
+ -webkit-box-ordinal-group: 14;
+ -ms-flex-order: 13;
+ order: 13;
+ }
+ .order-xl-0 {
+ -webkit-box-ordinal-group: 1;
+ -ms-flex-order: 0;
+ order: 0;
+ }
+ .order-xl-1 {
+ -webkit-box-ordinal-group: 2;
+ -ms-flex-order: 1;
+ order: 1;
+ }
+ .order-xl-2 {
+ -webkit-box-ordinal-group: 3;
+ -ms-flex-order: 2;
+ order: 2;
+ }
+ .order-xl-3 {
+ -webkit-box-ordinal-group: 4;
+ -ms-flex-order: 3;
+ order: 3;
+ }
+ .order-xl-4 {
+ -webkit-box-ordinal-group: 5;
+ -ms-flex-order: 4;
+ order: 4;
+ }
+ .order-xl-5 {
+ -webkit-box-ordinal-group: 6;
+ -ms-flex-order: 5;
+ order: 5;
+ }
+ .order-xl-6 {
+ -webkit-box-ordinal-group: 7;
+ -ms-flex-order: 6;
+ order: 6;
+ }
+ .order-xl-7 {
+ -webkit-box-ordinal-group: 8;
+ -ms-flex-order: 7;
+ order: 7;
+ }
+ .order-xl-8 {
+ -webkit-box-ordinal-group: 9;
+ -ms-flex-order: 8;
+ order: 8;
+ }
+ .order-xl-9 {
+ -webkit-box-ordinal-group: 10;
+ -ms-flex-order: 9;
+ order: 9;
+ }
+ .order-xl-10 {
+ -webkit-box-ordinal-group: 11;
+ -ms-flex-order: 10;
+ order: 10;
+ }
+ .order-xl-11 {
+ -webkit-box-ordinal-group: 12;
+ -ms-flex-order: 11;
+ order: 11;
+ }
+ .order-xl-12 {
+ -webkit-box-ordinal-group: 13;
+ -ms-flex-order: 12;
+ order: 12;
+ }
+ .offset-xl-0 {
+ margin-left: 0;
+ }
+ .offset-xl-1 {
+ margin-left: 8.333333%;
+ }
+ .offset-xl-2 {
+ margin-left: 16.666667%;
+ }
+ .offset-xl-3 {
+ margin-left: 25%;
+ }
+ .offset-xl-4 {
+ margin-left: 33.333333%;
+ }
+ .offset-xl-5 {
+ margin-left: 41.666667%;
+ }
+ .offset-xl-6 {
+ margin-left: 50%;
+ }
+ .offset-xl-7 {
+ margin-left: 58.333333%;
+ }
+ .offset-xl-8 {
+ margin-left: 66.666667%;
+ }
+ .offset-xl-9 {
+ margin-left: 75%;
+ }
+ .offset-xl-10 {
+ margin-left: 83.333333%;
+ }
+ .offset-xl-11 {
+ margin-left: 91.666667%;
+ }
+}
+
+.d-none {
+ display: none !important;
+}
+
+.d-inline {
+ display: inline !important;
+}
+
+.d-inline-block {
+ display: inline-block !important;
+}
+
+.d-block {
+ display: block !important;
+}
+
+.d-table {
+ display: table !important;
+}
+
+.d-table-row {
+ display: table-row !important;
+}
+
+.d-table-cell {
+ display: table-cell !important;
+}
+
+.d-flex {
+ display: -webkit-box !important;
+ display: -ms-flexbox !important;
+ display: flex !important;
+}
+
+.d-inline-flex {
+ display: -webkit-inline-box !important;
+ display: -ms-inline-flexbox !important;
+ display: inline-flex !important;
+}
+
+@media (min-width: 576px) {
+ .d-sm-none {
+ display: none !important;
+ }
+ .d-sm-inline {
+ display: inline !important;
+ }
+ .d-sm-inline-block {
+ display: inline-block !important;
+ }
+ .d-sm-block {
+ display: block !important;
+ }
+ .d-sm-table {
+ display: table !important;
+ }
+ .d-sm-table-row {
+ display: table-row !important;
+ }
+ .d-sm-table-cell {
+ display: table-cell !important;
+ }
+ .d-sm-flex {
+ display: -webkit-box !important;
+ display: -ms-flexbox !important;
+ display: flex !important;
+ }
+ .d-sm-inline-flex {
+ display: -webkit-inline-box !important;
+ display: -ms-inline-flexbox !important;
+ display: inline-flex !important;
+ }
+}
+
+@media (min-width: 768px) {
+ .d-md-none {
+ display: none !important;
+ }
+ .d-md-inline {
+ display: inline !important;
+ }
+ .d-md-inline-block {
+ display: inline-block !important;
+ }
+ .d-md-block {
+ display: block !important;
+ }
+ .d-md-table {
+ display: table !important;
+ }
+ .d-md-table-row {
+ display: table-row !important;
+ }
+ .d-md-table-cell {
+ display: table-cell !important;
+ }
+ .d-md-flex {
+ display: -webkit-box !important;
+ display: -ms-flexbox !important;
+ display: flex !important;
+ }
+ .d-md-inline-flex {
+ display: -webkit-inline-box !important;
+ display: -ms-inline-flexbox !important;
+ display: inline-flex !important;
+ }
+}
+
+@media (min-width: 992px) {
+ .d-lg-none {
+ display: none !important;
+ }
+ .d-lg-inline {
+ display: inline !important;
+ }
+ .d-lg-inline-block {
+ display: inline-block !important;
+ }
+ .d-lg-block {
+ display: block !important;
+ }
+ .d-lg-table {
+ display: table !important;
+ }
+ .d-lg-table-row {
+ display: table-row !important;
+ }
+ .d-lg-table-cell {
+ display: table-cell !important;
+ }
+ .d-lg-flex {
+ display: -webkit-box !important;
+ display: -ms-flexbox !important;
+ display: flex !important;
+ }
+ .d-lg-inline-flex {
+ display: -webkit-inline-box !important;
+ display: -ms-inline-flexbox !important;
+ display: inline-flex !important;
+ }
+}
+
+@media (min-width: 1200px) {
+ .d-xl-none {
+ display: none !important;
+ }
+ .d-xl-inline {
+ display: inline !important;
+ }
+ .d-xl-inline-block {
+ display: inline-block !important;
+ }
+ .d-xl-block {
+ display: block !important;
+ }
+ .d-xl-table {
+ display: table !important;
+ }
+ .d-xl-table-row {
+ display: table-row !important;
+ }
+ .d-xl-table-cell {
+ display: table-cell !important;
+ }
+ .d-xl-flex {
+ display: -webkit-box !important;
+ display: -ms-flexbox !important;
+ display: flex !important;
+ }
+ .d-xl-inline-flex {
+ display: -webkit-inline-box !important;
+ display: -ms-inline-flexbox !important;
+ display: inline-flex !important;
+ }
+}
+
+@media print {
+ .d-print-none {
+ display: none !important;
+ }
+ .d-print-inline {
+ display: inline !important;
+ }
+ .d-print-inline-block {
+ display: inline-block !important;
+ }
+ .d-print-block {
+ display: block !important;
+ }
+ .d-print-table {
+ display: table !important;
+ }
+ .d-print-table-row {
+ display: table-row !important;
+ }
+ .d-print-table-cell {
+ display: table-cell !important;
+ }
+ .d-print-flex {
+ display: -webkit-box !important;
+ display: -ms-flexbox !important;
+ display: flex !important;
+ }
+ .d-print-inline-flex {
+ display: -webkit-inline-box !important;
+ display: -ms-inline-flexbox !important;
+ display: inline-flex !important;
+ }
+}
+
+.flex-row {
+ -webkit-box-orient: horizontal !important;
+ -webkit-box-direction: normal !important;
+ -ms-flex-direction: row !important;
+ flex-direction: row !important;
+}
+
+.flex-column {
+ -webkit-box-orient: vertical !important;
+ -webkit-box-direction: normal !important;
+ -ms-flex-direction: column !important;
+ flex-direction: column !important;
+}
+
+.flex-row-reverse {
+ -webkit-box-orient: horizontal !important;
+ -webkit-box-direction: reverse !important;
+ -ms-flex-direction: row-reverse !important;
+ flex-direction: row-reverse !important;
+}
+
+.flex-column-reverse {
+ -webkit-box-orient: vertical !important;
+ -webkit-box-direction: reverse !important;
+ -ms-flex-direction: column-reverse !important;
+ flex-direction: column-reverse !important;
+}
+
+.flex-wrap {
+ -ms-flex-wrap: wrap !important;
+ flex-wrap: wrap !important;
+}
+
+.flex-nowrap {
+ -ms-flex-wrap: nowrap !important;
+ flex-wrap: nowrap !important;
+}
+
+.flex-wrap-reverse {
+ -ms-flex-wrap: wrap-reverse !important;
+ flex-wrap: wrap-reverse !important;
+}
+
+.justify-content-start {
+ -webkit-box-pack: start !important;
+ -ms-flex-pack: start !important;
+ justify-content: flex-start !important;
+}
+
+.justify-content-end {
+ -webkit-box-pack: end !important;
+ -ms-flex-pack: end !important;
+ justify-content: flex-end !important;
+}
+
+.justify-content-center {
+ -webkit-box-pack: center !important;
+ -ms-flex-pack: center !important;
+ justify-content: center !important;
+}
+
+.justify-content-between {
+ -webkit-box-pack: justify !important;
+ -ms-flex-pack: justify !important;
+ justify-content: space-between !important;
+}
+
+.justify-content-around {
+ -ms-flex-pack: distribute !important;
+ justify-content: space-around !important;
+}
+
+.align-items-start {
+ -webkit-box-align: start !important;
+ -ms-flex-align: start !important;
+ align-items: flex-start !important;
+}
+
+.align-items-end {
+ -webkit-box-align: end !important;
+ -ms-flex-align: end !important;
+ align-items: flex-end !important;
+}
+
+.align-items-center {
+ -webkit-box-align: center !important;
+ -ms-flex-align: center !important;
+ align-items: center !important;
+}
+
+.align-items-baseline {
+ -webkit-box-align: baseline !important;
+ -ms-flex-align: baseline !important;
+ align-items: baseline !important;
+}
+
+.align-items-stretch {
+ -webkit-box-align: stretch !important;
+ -ms-flex-align: stretch !important;
+ align-items: stretch !important;
+}
+
+.align-content-start {
+ -ms-flex-line-pack: start !important;
+ align-content: flex-start !important;
+}
+
+.align-content-end {
+ -ms-flex-line-pack: end !important;
+ align-content: flex-end !important;
+}
+
+.align-content-center {
+ -ms-flex-line-pack: center !important;
+ align-content: center !important;
+}
+
+.align-content-between {
+ -ms-flex-line-pack: justify !important;
+ align-content: space-between !important;
+}
+
+.align-content-around {
+ -ms-flex-line-pack: distribute !important;
+ align-content: space-around !important;
+}
+
+.align-content-stretch {
+ -ms-flex-line-pack: stretch !important;
+ align-content: stretch !important;
+}
+
+.align-self-auto {
+ -ms-flex-item-align: auto !important;
+ align-self: auto !important;
+}
+
+.align-self-start {
+ -ms-flex-item-align: start !important;
+ align-self: flex-start !important;
+}
+
+.align-self-end {
+ -ms-flex-item-align: end !important;
+ align-self: flex-end !important;
+}
+
+.align-self-center {
+ -ms-flex-item-align: center !important;
+ align-self: center !important;
+}
+
+.align-self-baseline {
+ -ms-flex-item-align: baseline !important;
+ align-self: baseline !important;
+}
+
+.align-self-stretch {
+ -ms-flex-item-align: stretch !important;
+ align-self: stretch !important;
+}
+
+@media (min-width: 576px) {
+ .flex-sm-row {
+ -webkit-box-orient: horizontal !important;
+ -webkit-box-direction: normal !important;
+ -ms-flex-direction: row !important;
+ flex-direction: row !important;
+ }
+ .flex-sm-column {
+ -webkit-box-orient: vertical !important;
+ -webkit-box-direction: normal !important;
+ -ms-flex-direction: column !important;
+ flex-direction: column !important;
+ }
+ .flex-sm-row-reverse {
+ -webkit-box-orient: horizontal !important;
+ -webkit-box-direction: reverse !important;
+ -ms-flex-direction: row-reverse !important;
+ flex-direction: row-reverse !important;
+ }
+ .flex-sm-column-reverse {
+ -webkit-box-orient: vertical !important;
+ -webkit-box-direction: reverse !important;
+ -ms-flex-direction: column-reverse !important;
+ flex-direction: column-reverse !important;
+ }
+ .flex-sm-wrap {
+ -ms-flex-wrap: wrap !important;
+ flex-wrap: wrap !important;
+ }
+ .flex-sm-nowrap {
+ -ms-flex-wrap: nowrap !important;
+ flex-wrap: nowrap !important;
+ }
+ .flex-sm-wrap-reverse {
+ -ms-flex-wrap: wrap-reverse !important;
+ flex-wrap: wrap-reverse !important;
+ }
+ .justify-content-sm-start {
+ -webkit-box-pack: start !important;
+ -ms-flex-pack: start !important;
+ justify-content: flex-start !important;
+ }
+ .justify-content-sm-end {
+ -webkit-box-pack: end !important;
+ -ms-flex-pack: end !important;
+ justify-content: flex-end !important;
+ }
+ .justify-content-sm-center {
+ -webkit-box-pack: center !important;
+ -ms-flex-pack: center !important;
+ justify-content: center !important;
+ }
+ .justify-content-sm-between {
+ -webkit-box-pack: justify !important;
+ -ms-flex-pack: justify !important;
+ justify-content: space-between !important;
+ }
+ .justify-content-sm-around {
+ -ms-flex-pack: distribute !important;
+ justify-content: space-around !important;
+ }
+ .align-items-sm-start {
+ -webkit-box-align: start !important;
+ -ms-flex-align: start !important;
+ align-items: flex-start !important;
+ }
+ .align-items-sm-end {
+ -webkit-box-align: end !important;
+ -ms-flex-align: end !important;
+ align-items: flex-end !important;
+ }
+ .align-items-sm-center {
+ -webkit-box-align: center !important;
+ -ms-flex-align: center !important;
+ align-items: center !important;
+ }
+ .align-items-sm-baseline {
+ -webkit-box-align: baseline !important;
+ -ms-flex-align: baseline !important;
+ align-items: baseline !important;
+ }
+ .align-items-sm-stretch {
+ -webkit-box-align: stretch !important;
+ -ms-flex-align: stretch !important;
+ align-items: stretch !important;
+ }
+ .align-content-sm-start {
+ -ms-flex-line-pack: start !important;
+ align-content: flex-start !important;
+ }
+ .align-content-sm-end {
+ -ms-flex-line-pack: end !important;
+ align-content: flex-end !important;
+ }
+ .align-content-sm-center {
+ -ms-flex-line-pack: center !important;
+ align-content: center !important;
+ }
+ .align-content-sm-between {
+ -ms-flex-line-pack: justify !important;
+ align-content: space-between !important;
+ }
+ .align-content-sm-around {
+ -ms-flex-line-pack: distribute !important;
+ align-content: space-around !important;
+ }
+ .align-content-sm-stretch {
+ -ms-flex-line-pack: stretch !important;
+ align-content: stretch !important;
+ }
+ .align-self-sm-auto {
+ -ms-flex-item-align: auto !important;
+ align-self: auto !important;
+ }
+ .align-self-sm-start {
+ -ms-flex-item-align: start !important;
+ align-self: flex-start !important;
+ }
+ .align-self-sm-end {
+ -ms-flex-item-align: end !important;
+ align-self: flex-end !important;
+ }
+ .align-self-sm-center {
+ -ms-flex-item-align: center !important;
+ align-self: center !important;
+ }
+ .align-self-sm-baseline {
+ -ms-flex-item-align: baseline !important;
+ align-self: baseline !important;
+ }
+ .align-self-sm-stretch {
+ -ms-flex-item-align: stretch !important;
+ align-self: stretch !important;
+ }
+}
+
+@media (min-width: 768px) {
+ .flex-md-row {
+ -webkit-box-orient: horizontal !important;
+ -webkit-box-direction: normal !important;
+ -ms-flex-direction: row !important;
+ flex-direction: row !important;
+ }
+ .flex-md-column {
+ -webkit-box-orient: vertical !important;
+ -webkit-box-direction: normal !important;
+ -ms-flex-direction: column !important;
+ flex-direction: column !important;
+ }
+ .flex-md-row-reverse {
+ -webkit-box-orient: horizontal !important;
+ -webkit-box-direction: reverse !important;
+ -ms-flex-direction: row-reverse !important;
+ flex-direction: row-reverse !important;
+ }
+ .flex-md-column-reverse {
+ -webkit-box-orient: vertical !important;
+ -webkit-box-direction: reverse !important;
+ -ms-flex-direction: column-reverse !important;
+ flex-direction: column-reverse !important;
+ }
+ .flex-md-wrap {
+ -ms-flex-wrap: wrap !important;
+ flex-wrap: wrap !important;
+ }
+ .flex-md-nowrap {
+ -ms-flex-wrap: nowrap !important;
+ flex-wrap: nowrap !important;
+ }
+ .flex-md-wrap-reverse {
+ -ms-flex-wrap: wrap-reverse !important;
+ flex-wrap: wrap-reverse !important;
+ }
+ .justify-content-md-start {
+ -webkit-box-pack: start !important;
+ -ms-flex-pack: start !important;
+ justify-content: flex-start !important;
+ }
+ .justify-content-md-end {
+ -webkit-box-pack: end !important;
+ -ms-flex-pack: end !important;
+ justify-content: flex-end !important;
+ }
+ .justify-content-md-center {
+ -webkit-box-pack: center !important;
+ -ms-flex-pack: center !important;
+ justify-content: center !important;
+ }
+ .justify-content-md-between {
+ -webkit-box-pack: justify !important;
+ -ms-flex-pack: justify !important;
+ justify-content: space-between !important;
+ }
+ .justify-content-md-around {
+ -ms-flex-pack: distribute !important;
+ justify-content: space-around !important;
+ }
+ .align-items-md-start {
+ -webkit-box-align: start !important;
+ -ms-flex-align: start !important;
+ align-items: flex-start !important;
+ }
+ .align-items-md-end {
+ -webkit-box-align: end !important;
+ -ms-flex-align: end !important;
+ align-items: flex-end !important;
+ }
+ .align-items-md-center {
+ -webkit-box-align: center !important;
+ -ms-flex-align: center !important;
+ align-items: center !important;
+ }
+ .align-items-md-baseline {
+ -webkit-box-align: baseline !important;
+ -ms-flex-align: baseline !important;
+ align-items: baseline !important;
+ }
+ .align-items-md-stretch {
+ -webkit-box-align: stretch !important;
+ -ms-flex-align: stretch !important;
+ align-items: stretch !important;
+ }
+ .align-content-md-start {
+ -ms-flex-line-pack: start !important;
+ align-content: flex-start !important;
+ }
+ .align-content-md-end {
+ -ms-flex-line-pack: end !important;
+ align-content: flex-end !important;
+ }
+ .align-content-md-center {
+ -ms-flex-line-pack: center !important;
+ align-content: center !important;
+ }
+ .align-content-md-between {
+ -ms-flex-line-pack: justify !important;
+ align-content: space-between !important;
+ }
+ .align-content-md-around {
+ -ms-flex-line-pack: distribute !important;
+ align-content: space-around !important;
+ }
+ .align-content-md-stretch {
+ -ms-flex-line-pack: stretch !important;
+ align-content: stretch !important;
+ }
+ .align-self-md-auto {
+ -ms-flex-item-align: auto !important;
+ align-self: auto !important;
+ }
+ .align-self-md-start {
+ -ms-flex-item-align: start !important;
+ align-self: flex-start !important;
+ }
+ .align-self-md-end {
+ -ms-flex-item-align: end !important;
+ align-self: flex-end !important;
+ }
+ .align-self-md-center {
+ -ms-flex-item-align: center !important;
+ align-self: center !important;
+ }
+ .align-self-md-baseline {
+ -ms-flex-item-align: baseline !important;
+ align-self: baseline !important;
+ }
+ .align-self-md-stretch {
+ -ms-flex-item-align: stretch !important;
+ align-self: stretch !important;
+ }
+}
+
+@media (min-width: 992px) {
+ .flex-lg-row {
+ -webkit-box-orient: horizontal !important;
+ -webkit-box-direction: normal !important;
+ -ms-flex-direction: row !important;
+ flex-direction: row !important;
+ }
+ .flex-lg-column {
+ -webkit-box-orient: vertical !important;
+ -webkit-box-direction: normal !important;
+ -ms-flex-direction: column !important;
+ flex-direction: column !important;
+ }
+ .flex-lg-row-reverse {
+ -webkit-box-orient: horizontal !important;
+ -webkit-box-direction: reverse !important;
+ -ms-flex-direction: row-reverse !important;
+ flex-direction: row-reverse !important;
+ }
+ .flex-lg-column-reverse {
+ -webkit-box-orient: vertical !important;
+ -webkit-box-direction: reverse !important;
+ -ms-flex-direction: column-reverse !important;
+ flex-direction: column-reverse !important;
+ }
+ .flex-lg-wrap {
+ -ms-flex-wrap: wrap !important;
+ flex-wrap: wrap !important;
+ }
+ .flex-lg-nowrap {
+ -ms-flex-wrap: nowrap !important;
+ flex-wrap: nowrap !important;
+ }
+ .flex-lg-wrap-reverse {
+ -ms-flex-wrap: wrap-reverse !important;
+ flex-wrap: wrap-reverse !important;
+ }
+ .justify-content-lg-start {
+ -webkit-box-pack: start !important;
+ -ms-flex-pack: start !important;
+ justify-content: flex-start !important;
+ }
+ .justify-content-lg-end {
+ -webkit-box-pack: end !important;
+ -ms-flex-pack: end !important;
+ justify-content: flex-end !important;
+ }
+ .justify-content-lg-center {
+ -webkit-box-pack: center !important;
+ -ms-flex-pack: center !important;
+ justify-content: center !important;
+ }
+ .justify-content-lg-between {
+ -webkit-box-pack: justify !important;
+ -ms-flex-pack: justify !important;
+ justify-content: space-between !important;
+ }
+ .justify-content-lg-around {
+ -ms-flex-pack: distribute !important;
+ justify-content: space-around !important;
+ }
+ .align-items-lg-start {
+ -webkit-box-align: start !important;
+ -ms-flex-align: start !important;
+ align-items: flex-start !important;
+ }
+ .align-items-lg-end {
+ -webkit-box-align: end !important;
+ -ms-flex-align: end !important;
+ align-items: flex-end !important;
+ }
+ .align-items-lg-center {
+ -webkit-box-align: center !important;
+ -ms-flex-align: center !important;
+ align-items: center !important;
+ }
+ .align-items-lg-baseline {
+ -webkit-box-align: baseline !important;
+ -ms-flex-align: baseline !important;
+ align-items: baseline !important;
+ }
+ .align-items-lg-stretch {
+ -webkit-box-align: stretch !important;
+ -ms-flex-align: stretch !important;
+ align-items: stretch !important;
+ }
+ .align-content-lg-start {
+ -ms-flex-line-pack: start !important;
+ align-content: flex-start !important;
+ }
+ .align-content-lg-end {
+ -ms-flex-line-pack: end !important;
+ align-content: flex-end !important;
+ }
+ .align-content-lg-center {
+ -ms-flex-line-pack: center !important;
+ align-content: center !important;
+ }
+ .align-content-lg-between {
+ -ms-flex-line-pack: justify !important;
+ align-content: space-between !important;
+ }
+ .align-content-lg-around {
+ -ms-flex-line-pack: distribute !important;
+ align-content: space-around !important;
+ }
+ .align-content-lg-stretch {
+ -ms-flex-line-pack: stretch !important;
+ align-content: stretch !important;
+ }
+ .align-self-lg-auto {
+ -ms-flex-item-align: auto !important;
+ align-self: auto !important;
+ }
+ .align-self-lg-start {
+ -ms-flex-item-align: start !important;
+ align-self: flex-start !important;
+ }
+ .align-self-lg-end {
+ -ms-flex-item-align: end !important;
+ align-self: flex-end !important;
+ }
+ .align-self-lg-center {
+ -ms-flex-item-align: center !important;
+ align-self: center !important;
+ }
+ .align-self-lg-baseline {
+ -ms-flex-item-align: baseline !important;
+ align-self: baseline !important;
+ }
+ .align-self-lg-stretch {
+ -ms-flex-item-align: stretch !important;
+ align-self: stretch !important;
+ }
+}
+
+@media (min-width: 1200px) {
+ .flex-xl-row {
+ -webkit-box-orient: horizontal !important;
+ -webkit-box-direction: normal !important;
+ -ms-flex-direction: row !important;
+ flex-direction: row !important;
+ }
+ .flex-xl-column {
+ -webkit-box-orient: vertical !important;
+ -webkit-box-direction: normal !important;
+ -ms-flex-direction: column !important;
+ flex-direction: column !important;
+ }
+ .flex-xl-row-reverse {
+ -webkit-box-orient: horizontal !important;
+ -webkit-box-direction: reverse !important;
+ -ms-flex-direction: row-reverse !important;
+ flex-direction: row-reverse !important;
+ }
+ .flex-xl-column-reverse {
+ -webkit-box-orient: vertical !important;
+ -webkit-box-direction: reverse !important;
+ -ms-flex-direction: column-reverse !important;
+ flex-direction: column-reverse !important;
+ }
+ .flex-xl-wrap {
+ -ms-flex-wrap: wrap !important;
+ flex-wrap: wrap !important;
+ }
+ .flex-xl-nowrap {
+ -ms-flex-wrap: nowrap !important;
+ flex-wrap: nowrap !important;
+ }
+ .flex-xl-wrap-reverse {
+ -ms-flex-wrap: wrap-reverse !important;
+ flex-wrap: wrap-reverse !important;
+ }
+ .justify-content-xl-start {
+ -webkit-box-pack: start !important;
+ -ms-flex-pack: start !important;
+ justify-content: flex-start !important;
+ }
+ .justify-content-xl-end {
+ -webkit-box-pack: end !important;
+ -ms-flex-pack: end !important;
+ justify-content: flex-end !important;
+ }
+ .justify-content-xl-center {
+ -webkit-box-pack: center !important;
+ -ms-flex-pack: center !important;
+ justify-content: center !important;
+ }
+ .justify-content-xl-between {
+ -webkit-box-pack: justify !important;
+ -ms-flex-pack: justify !important;
+ justify-content: space-between !important;
+ }
+ .justify-content-xl-around {
+ -ms-flex-pack: distribute !important;
+ justify-content: space-around !important;
+ }
+ .align-items-xl-start {
+ -webkit-box-align: start !important;
+ -ms-flex-align: start !important;
+ align-items: flex-start !important;
+ }
+ .align-items-xl-end {
+ -webkit-box-align: end !important;
+ -ms-flex-align: end !important;
+ align-items: flex-end !important;
+ }
+ .align-items-xl-center {
+ -webkit-box-align: center !important;
+ -ms-flex-align: center !important;
+ align-items: center !important;
+ }
+ .align-items-xl-baseline {
+ -webkit-box-align: baseline !important;
+ -ms-flex-align: baseline !important;
+ align-items: baseline !important;
+ }
+ .align-items-xl-stretch {
+ -webkit-box-align: stretch !important;
+ -ms-flex-align: stretch !important;
+ align-items: stretch !important;
+ }
+ .align-content-xl-start {
+ -ms-flex-line-pack: start !important;
+ align-content: flex-start !important;
+ }
+ .align-content-xl-end {
+ -ms-flex-line-pack: end !important;
+ align-content: flex-end !important;
+ }
+ .align-content-xl-center {
+ -ms-flex-line-pack: center !important;
+ align-content: center !important;
+ }
+ .align-content-xl-between {
+ -ms-flex-line-pack: justify !important;
+ align-content: space-between !important;
+ }
+ .align-content-xl-around {
+ -ms-flex-line-pack: distribute !important;
+ align-content: space-around !important;
+ }
+ .align-content-xl-stretch {
+ -ms-flex-line-pack: stretch !important;
+ align-content: stretch !important;
+ }
+ .align-self-xl-auto {
+ -ms-flex-item-align: auto !important;
+ align-self: auto !important;
+ }
+ .align-self-xl-start {
+ -ms-flex-item-align: start !important;
+ align-self: flex-start !important;
+ }
+ .align-self-xl-end {
+ -ms-flex-item-align: end !important;
+ align-self: flex-end !important;
+ }
+ .align-self-xl-center {
+ -ms-flex-item-align: center !important;
+ align-self: center !important;
+ }
+ .align-self-xl-baseline {
+ -ms-flex-item-align: baseline !important;
+ align-self: baseline !important;
+ }
+ .align-self-xl-stretch {
+ -ms-flex-item-align: stretch !important;
+ align-self: stretch !important;
+ }
+}
+/*# sourceMappingURL=bootstrap-grid.css.map */ \ No newline at end of file
diff --git a/chall/src/css/bootstrap-grid.min.css b/chall/src/css/bootstrap-grid.min.css
new file mode 100644
index 0000000..ea073e9
--- /dev/null
+++ b/chall/src/css/bootstrap-grid.min.css
@@ -0,0 +1,7 @@
+/*!
+ * Bootstrap Grid v4.0.0 (https://getbootstrap.com)
+ * Copyright 2011-2018 The Bootstrap Authors
+ * Copyright 2011-2018 Twitter, Inc.
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ */@-ms-viewport{width:device-width}html{box-sizing:border-box;-ms-overflow-style:scrollbar}*,::after,::before{box-sizing:inherit}.container{width:100%;padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}@media (min-width:576px){.container{max-width:540px}}@media (min-width:768px){.container{max-width:720px}}@media (min-width:992px){.container{max-width:960px}}@media (min-width:1200px){.container{max-width:1140px}}.container-fluid{width:100%;padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}.row{display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-right:-15px;margin-left:-15px}.no-gutters{margin-right:0;margin-left:0}.no-gutters>.col,.no-gutters>[class*=col-]{padding-right:0;padding-left:0}.col,.col-1,.col-10,.col-11,.col-12,.col-2,.col-3,.col-4,.col-5,.col-6,.col-7,.col-8,.col-9,.col-auto,.col-lg,.col-lg-1,.col-lg-10,.col-lg-11,.col-lg-12,.col-lg-2,.col-lg-3,.col-lg-4,.col-lg-5,.col-lg-6,.col-lg-7,.col-lg-8,.col-lg-9,.col-lg-auto,.col-md,.col-md-1,.col-md-10,.col-md-11,.col-md-12,.col-md-2,.col-md-3,.col-md-4,.col-md-5,.col-md-6,.col-md-7,.col-md-8,.col-md-9,.col-md-auto,.col-sm,.col-sm-1,.col-sm-10,.col-sm-11,.col-sm-12,.col-sm-2,.col-sm-3,.col-sm-4,.col-sm-5,.col-sm-6,.col-sm-7,.col-sm-8,.col-sm-9,.col-sm-auto,.col-xl,.col-xl-1,.col-xl-10,.col-xl-11,.col-xl-12,.col-xl-2,.col-xl-3,.col-xl-4,.col-xl-5,.col-xl-6,.col-xl-7,.col-xl-8,.col-xl-9,.col-xl-auto{position:relative;width:100%;min-height:1px;padding-right:15px;padding-left:15px}.col{-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-auto{-webkit-box-flex:0;-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-1{-webkit-box-flex:0;-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-2{-webkit-box-flex:0;-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-3{-webkit-box-flex:0;-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-4{-webkit-box-flex:0;-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-5{-webkit-box-flex:0;-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-6{-webkit-box-flex:0;-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-7{-webkit-box-flex:0;-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-8{-webkit-box-flex:0;-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-9{-webkit-box-flex:0;-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-10{-webkit-box-flex:0;-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-11{-webkit-box-flex:0;-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-12{-webkit-box-flex:0;-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-first{-webkit-box-ordinal-group:0;-ms-flex-order:-1;order:-1}.order-last{-webkit-box-ordinal-group:14;-ms-flex-order:13;order:13}.order-0{-webkit-box-ordinal-group:1;-ms-flex-order:0;order:0}.order-1{-webkit-box-ordinal-group:2;-ms-flex-order:1;order:1}.order-2{-webkit-box-ordinal-group:3;-ms-flex-order:2;order:2}.order-3{-webkit-box-ordinal-group:4;-ms-flex-order:3;order:3}.order-4{-webkit-box-ordinal-group:5;-ms-flex-order:4;order:4}.order-5{-webkit-box-ordinal-group:6;-ms-flex-order:5;order:5}.order-6{-webkit-box-ordinal-group:7;-ms-flex-order:6;order:6}.order-7{-webkit-box-ordinal-group:8;-ms-flex-order:7;order:7}.order-8{-webkit-box-ordinal-group:9;-ms-flex-order:8;order:8}.order-9{-webkit-box-ordinal-group:10;-ms-flex-order:9;order:9}.order-10{-webkit-box-ordinal-group:11;-ms-flex-order:10;order:10}.order-11{-webkit-box-ordinal-group:12;-ms-flex-order:11;order:11}.order-12{-webkit-box-ordinal-group:13;-ms-flex-order:12;order:12}.offset-1{margin-left:8.333333%}.offset-2{margin-left:16.666667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.333333%}.offset-5{margin-left:41.666667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.333333%}.offset-8{margin-left:66.666667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.333333%}.offset-11{margin-left:91.666667%}@media (min-width:576px){.col-sm{-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-sm-auto{-webkit-box-flex:0;-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-sm-1{-webkit-box-flex:0;-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-sm-2{-webkit-box-flex:0;-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-sm-3{-webkit-box-flex:0;-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-sm-4{-webkit-box-flex:0;-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-sm-5{-webkit-box-flex:0;-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-sm-6{-webkit-box-flex:0;-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-sm-7{-webkit-box-flex:0;-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-sm-8{-webkit-box-flex:0;-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-sm-9{-webkit-box-flex:0;-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-sm-10{-webkit-box-flex:0;-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-sm-11{-webkit-box-flex:0;-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-sm-12{-webkit-box-flex:0;-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-sm-first{-webkit-box-ordinal-group:0;-ms-flex-order:-1;order:-1}.order-sm-last{-webkit-box-ordinal-group:14;-ms-flex-order:13;order:13}.order-sm-0{-webkit-box-ordinal-group:1;-ms-flex-order:0;order:0}.order-sm-1{-webkit-box-ordinal-group:2;-ms-flex-order:1;order:1}.order-sm-2{-webkit-box-ordinal-group:3;-ms-flex-order:2;order:2}.order-sm-3{-webkit-box-ordinal-group:4;-ms-flex-order:3;order:3}.order-sm-4{-webkit-box-ordinal-group:5;-ms-flex-order:4;order:4}.order-sm-5{-webkit-box-ordinal-group:6;-ms-flex-order:5;order:5}.order-sm-6{-webkit-box-ordinal-group:7;-ms-flex-order:6;order:6}.order-sm-7{-webkit-box-ordinal-group:8;-ms-flex-order:7;order:7}.order-sm-8{-webkit-box-ordinal-group:9;-ms-flex-order:8;order:8}.order-sm-9{-webkit-box-ordinal-group:10;-ms-flex-order:9;order:9}.order-sm-10{-webkit-box-ordinal-group:11;-ms-flex-order:10;order:10}.order-sm-11{-webkit-box-ordinal-group:12;-ms-flex-order:11;order:11}.order-sm-12{-webkit-box-ordinal-group:13;-ms-flex-order:12;order:12}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.333333%}.offset-sm-2{margin-left:16.666667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.333333%}.offset-sm-5{margin-left:41.666667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.333333%}.offset-sm-8{margin-left:66.666667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.333333%}.offset-sm-11{margin-left:91.666667%}}@media (min-width:768px){.col-md{-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-md-auto{-webkit-box-flex:0;-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-md-1{-webkit-box-flex:0;-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-md-2{-webkit-box-flex:0;-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-md-3{-webkit-box-flex:0;-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-md-4{-webkit-box-flex:0;-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-md-5{-webkit-box-flex:0;-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-md-6{-webkit-box-flex:0;-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-md-7{-webkit-box-flex:0;-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-md-8{-webkit-box-flex:0;-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-md-9{-webkit-box-flex:0;-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-md-10{-webkit-box-flex:0;-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-md-11{-webkit-box-flex:0;-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-md-12{-webkit-box-flex:0;-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-md-first{-webkit-box-ordinal-group:0;-ms-flex-order:-1;order:-1}.order-md-last{-webkit-box-ordinal-group:14;-ms-flex-order:13;order:13}.order-md-0{-webkit-box-ordinal-group:1;-ms-flex-order:0;order:0}.order-md-1{-webkit-box-ordinal-group:2;-ms-flex-order:1;order:1}.order-md-2{-webkit-box-ordinal-group:3;-ms-flex-order:2;order:2}.order-md-3{-webkit-box-ordinal-group:4;-ms-flex-order:3;order:3}.order-md-4{-webkit-box-ordinal-group:5;-ms-flex-order:4;order:4}.order-md-5{-webkit-box-ordinal-group:6;-ms-flex-order:5;order:5}.order-md-6{-webkit-box-ordinal-group:7;-ms-flex-order:6;order:6}.order-md-7{-webkit-box-ordinal-group:8;-ms-flex-order:7;order:7}.order-md-8{-webkit-box-ordinal-group:9;-ms-flex-order:8;order:8}.order-md-9{-webkit-box-ordinal-group:10;-ms-flex-order:9;order:9}.order-md-10{-webkit-box-ordinal-group:11;-ms-flex-order:10;order:10}.order-md-11{-webkit-box-ordinal-group:12;-ms-flex-order:11;order:11}.order-md-12{-webkit-box-ordinal-group:13;-ms-flex-order:12;order:12}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.333333%}.offset-md-2{margin-left:16.666667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.333333%}.offset-md-5{margin-left:41.666667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.333333%}.offset-md-8{margin-left:66.666667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.333333%}.offset-md-11{margin-left:91.666667%}}@media (min-width:992px){.col-lg{-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-lg-auto{-webkit-box-flex:0;-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-lg-1{-webkit-box-flex:0;-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-lg-2{-webkit-box-flex:0;-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-lg-3{-webkit-box-flex:0;-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-lg-4{-webkit-box-flex:0;-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-lg-5{-webkit-box-flex:0;-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-lg-6{-webkit-box-flex:0;-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-lg-7{-webkit-box-flex:0;-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-lg-8{-webkit-box-flex:0;-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-lg-9{-webkit-box-flex:0;-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-lg-10{-webkit-box-flex:0;-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-lg-11{-webkit-box-flex:0;-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-lg-12{-webkit-box-flex:0;-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-lg-first{-webkit-box-ordinal-group:0;-ms-flex-order:-1;order:-1}.order-lg-last{-webkit-box-ordinal-group:14;-ms-flex-order:13;order:13}.order-lg-0{-webkit-box-ordinal-group:1;-ms-flex-order:0;order:0}.order-lg-1{-webkit-box-ordinal-group:2;-ms-flex-order:1;order:1}.order-lg-2{-webkit-box-ordinal-group:3;-ms-flex-order:2;order:2}.order-lg-3{-webkit-box-ordinal-group:4;-ms-flex-order:3;order:3}.order-lg-4{-webkit-box-ordinal-group:5;-ms-flex-order:4;order:4}.order-lg-5{-webkit-box-ordinal-group:6;-ms-flex-order:5;order:5}.order-lg-6{-webkit-box-ordinal-group:7;-ms-flex-order:6;order:6}.order-lg-7{-webkit-box-ordinal-group:8;-ms-flex-order:7;order:7}.order-lg-8{-webkit-box-ordinal-group:9;-ms-flex-order:8;order:8}.order-lg-9{-webkit-box-ordinal-group:10;-ms-flex-order:9;order:9}.order-lg-10{-webkit-box-ordinal-group:11;-ms-flex-order:10;order:10}.order-lg-11{-webkit-box-ordinal-group:12;-ms-flex-order:11;order:11}.order-lg-12{-webkit-box-ordinal-group:13;-ms-flex-order:12;order:12}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.333333%}.offset-lg-2{margin-left:16.666667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.333333%}.offset-lg-5{margin-left:41.666667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.333333%}.offset-lg-8{margin-left:66.666667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.333333%}.offset-lg-11{margin-left:91.666667%}}@media (min-width:1200px){.col-xl{-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-xl-auto{-webkit-box-flex:0;-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-xl-1{-webkit-box-flex:0;-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-xl-2{-webkit-box-flex:0;-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-xl-3{-webkit-box-flex:0;-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-xl-4{-webkit-box-flex:0;-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-xl-5{-webkit-box-flex:0;-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-xl-6{-webkit-box-flex:0;-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-xl-7{-webkit-box-flex:0;-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-xl-8{-webkit-box-flex:0;-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-xl-9{-webkit-box-flex:0;-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-xl-10{-webkit-box-flex:0;-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-xl-11{-webkit-box-flex:0;-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-xl-12{-webkit-box-flex:0;-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-xl-first{-webkit-box-ordinal-group:0;-ms-flex-order:-1;order:-1}.order-xl-last{-webkit-box-ordinal-group:14;-ms-flex-order:13;order:13}.order-xl-0{-webkit-box-ordinal-group:1;-ms-flex-order:0;order:0}.order-xl-1{-webkit-box-ordinal-group:2;-ms-flex-order:1;order:1}.order-xl-2{-webkit-box-ordinal-group:3;-ms-flex-order:2;order:2}.order-xl-3{-webkit-box-ordinal-group:4;-ms-flex-order:3;order:3}.order-xl-4{-webkit-box-ordinal-group:5;-ms-flex-order:4;order:4}.order-xl-5{-webkit-box-ordinal-group:6;-ms-flex-order:5;order:5}.order-xl-6{-webkit-box-ordinal-group:7;-ms-flex-order:6;order:6}.order-xl-7{-webkit-box-ordinal-group:8;-ms-flex-order:7;order:7}.order-xl-8{-webkit-box-ordinal-group:9;-ms-flex-order:8;order:8}.order-xl-9{-webkit-box-ordinal-group:10;-ms-flex-order:9;order:9}.order-xl-10{-webkit-box-ordinal-group:11;-ms-flex-order:10;order:10}.order-xl-11{-webkit-box-ordinal-group:12;-ms-flex-order:11;order:11}.order-xl-12{-webkit-box-ordinal-group:13;-ms-flex-order:12;order:12}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.333333%}.offset-xl-2{margin-left:16.666667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.333333%}.offset-xl-5{margin-left:41.666667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.333333%}.offset-xl-8{margin-left:66.666667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.333333%}.offset-xl-11{margin-left:91.666667%}}.d-none{display:none!important}.d-inline{display:inline!important}.d-inline-block{display:inline-block!important}.d-block{display:block!important}.d-table{display:table!important}.d-table-row{display:table-row!important}.d-table-cell{display:table-cell!important}.d-flex{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important}.d-inline-flex{display:-webkit-inline-box!important;display:-ms-inline-flexbox!important;display:inline-flex!important}@media (min-width:576px){.d-sm-none{display:none!important}.d-sm-inline{display:inline!important}.d-sm-inline-block{display:inline-block!important}.d-sm-block{display:block!important}.d-sm-table{display:table!important}.d-sm-table-row{display:table-row!important}.d-sm-table-cell{display:table-cell!important}.d-sm-flex{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important}.d-sm-inline-flex{display:-webkit-inline-box!important;display:-ms-inline-flexbox!important;display:inline-flex!important}}@media (min-width:768px){.d-md-none{display:none!important}.d-md-inline{display:inline!important}.d-md-inline-block{display:inline-block!important}.d-md-block{display:block!important}.d-md-table{display:table!important}.d-md-table-row{display:table-row!important}.d-md-table-cell{display:table-cell!important}.d-md-flex{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important}.d-md-inline-flex{display:-webkit-inline-box!important;display:-ms-inline-flexbox!important;display:inline-flex!important}}@media (min-width:992px){.d-lg-none{display:none!important}.d-lg-inline{display:inline!important}.d-lg-inline-block{display:inline-block!important}.d-lg-block{display:block!important}.d-lg-table{display:table!important}.d-lg-table-row{display:table-row!important}.d-lg-table-cell{display:table-cell!important}.d-lg-flex{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important}.d-lg-inline-flex{display:-webkit-inline-box!important;display:-ms-inline-flexbox!important;display:inline-flex!important}}@media (min-width:1200px){.d-xl-none{display:none!important}.d-xl-inline{display:inline!important}.d-xl-inline-block{display:inline-block!important}.d-xl-block{display:block!important}.d-xl-table{display:table!important}.d-xl-table-row{display:table-row!important}.d-xl-table-cell{display:table-cell!important}.d-xl-flex{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important}.d-xl-inline-flex{display:-webkit-inline-box!important;display:-ms-inline-flexbox!important;display:inline-flex!important}}@media print{.d-print-none{display:none!important}.d-print-inline{display:inline!important}.d-print-inline-block{display:inline-block!important}.d-print-block{display:block!important}.d-print-table{display:table!important}.d-print-table-row{display:table-row!important}.d-print-table-cell{display:table-cell!important}.d-print-flex{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important}.d-print-inline-flex{display:-webkit-inline-box!important;display:-ms-inline-flexbox!important;display:inline-flex!important}}.flex-row{-webkit-box-orient:horizontal!important;-webkit-box-direction:normal!important;-ms-flex-direction:row!important;flex-direction:row!important}.flex-column{-webkit-box-orient:vertical!important;-webkit-box-direction:normal!important;-ms-flex-direction:column!important;flex-direction:column!important}.flex-row-reverse{-webkit-box-orient:horizontal!important;-webkit-box-direction:reverse!important;-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-column-reverse{-webkit-box-orient:vertical!important;-webkit-box-direction:reverse!important;-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.justify-content-start{-webkit-box-pack:start!important;-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-end{-webkit-box-pack:end!important;-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-center{-webkit-box-pack:center!important;-ms-flex-pack:center!important;justify-content:center!important}.justify-content-between{-webkit-box-pack:justify!important;-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-start{-webkit-box-align:start!important;-ms-flex-align:start!important;align-items:flex-start!important}.align-items-end{-webkit-box-align:end!important;-ms-flex-align:end!important;align-items:flex-end!important}.align-items-center{-webkit-box-align:center!important;-ms-flex-align:center!important;align-items:center!important}.align-items-baseline{-webkit-box-align:baseline!important;-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-stretch{-webkit-box-align:stretch!important;-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}@media (min-width:576px){.flex-sm-row{-webkit-box-orient:horizontal!important;-webkit-box-direction:normal!important;-ms-flex-direction:row!important;flex-direction:row!important}.flex-sm-column{-webkit-box-orient:vertical!important;-webkit-box-direction:normal!important;-ms-flex-direction:column!important;flex-direction:column!important}.flex-sm-row-reverse{-webkit-box-orient:horizontal!important;-webkit-box-direction:reverse!important;-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-sm-column-reverse{-webkit-box-orient:vertical!important;-webkit-box-direction:reverse!important;-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-sm-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-sm-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-sm-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.justify-content-sm-start{-webkit-box-pack:start!important;-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-sm-end{-webkit-box-pack:end!important;-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-sm-center{-webkit-box-pack:center!important;-ms-flex-pack:center!important;justify-content:center!important}.justify-content-sm-between{-webkit-box-pack:justify!important;-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-sm-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-sm-start{-webkit-box-align:start!important;-ms-flex-align:start!important;align-items:flex-start!important}.align-items-sm-end{-webkit-box-align:end!important;-ms-flex-align:end!important;align-items:flex-end!important}.align-items-sm-center{-webkit-box-align:center!important;-ms-flex-align:center!important;align-items:center!important}.align-items-sm-baseline{-webkit-box-align:baseline!important;-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-sm-stretch{-webkit-box-align:stretch!important;-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-sm-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-sm-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-sm-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-sm-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-sm-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-sm-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-sm-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-sm-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-sm-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-sm-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-sm-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-sm-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media (min-width:768px){.flex-md-row{-webkit-box-orient:horizontal!important;-webkit-box-direction:normal!important;-ms-flex-direction:row!important;flex-direction:row!important}.flex-md-column{-webkit-box-orient:vertical!important;-webkit-box-direction:normal!important;-ms-flex-direction:column!important;flex-direction:column!important}.flex-md-row-reverse{-webkit-box-orient:horizontal!important;-webkit-box-direction:reverse!important;-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-md-column-reverse{-webkit-box-orient:vertical!important;-webkit-box-direction:reverse!important;-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-md-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-md-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-md-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.justify-content-md-start{-webkit-box-pack:start!important;-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-md-end{-webkit-box-pack:end!important;-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-md-center{-webkit-box-pack:center!important;-ms-flex-pack:center!important;justify-content:center!important}.justify-content-md-between{-webkit-box-pack:justify!important;-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-md-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-md-start{-webkit-box-align:start!important;-ms-flex-align:start!important;align-items:flex-start!important}.align-items-md-end{-webkit-box-align:end!important;-ms-flex-align:end!important;align-items:flex-end!important}.align-items-md-center{-webkit-box-align:center!important;-ms-flex-align:center!important;align-items:center!important}.align-items-md-baseline{-webkit-box-align:baseline!important;-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-md-stretch{-webkit-box-align:stretch!important;-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-md-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-md-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-md-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-md-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-md-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-md-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-md-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-md-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-md-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-md-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-md-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-md-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media (min-width:992px){.flex-lg-row{-webkit-box-orient:horizontal!important;-webkit-box-direction:normal!important;-ms-flex-direction:row!important;flex-direction:row!important}.flex-lg-column{-webkit-box-orient:vertical!important;-webkit-box-direction:normal!important;-ms-flex-direction:column!important;flex-direction:column!important}.flex-lg-row-reverse{-webkit-box-orient:horizontal!important;-webkit-box-direction:reverse!important;-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-lg-column-reverse{-webkit-box-orient:vertical!important;-webkit-box-direction:reverse!important;-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-lg-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-lg-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-lg-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.justify-content-lg-start{-webkit-box-pack:start!important;-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-lg-end{-webkit-box-pack:end!important;-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-lg-center{-webkit-box-pack:center!important;-ms-flex-pack:center!important;justify-content:center!important}.justify-content-lg-between{-webkit-box-pack:justify!important;-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-lg-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-lg-start{-webkit-box-align:start!important;-ms-flex-align:start!important;align-items:flex-start!important}.align-items-lg-end{-webkit-box-align:end!important;-ms-flex-align:end!important;align-items:flex-end!important}.align-items-lg-center{-webkit-box-align:center!important;-ms-flex-align:center!important;align-items:center!important}.align-items-lg-baseline{-webkit-box-align:baseline!important;-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-lg-stretch{-webkit-box-align:stretch!important;-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-lg-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-lg-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-lg-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-lg-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-lg-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-lg-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-lg-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-lg-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-lg-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-lg-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-lg-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-lg-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media (min-width:1200px){.flex-xl-row{-webkit-box-orient:horizontal!important;-webkit-box-direction:normal!important;-ms-flex-direction:row!important;flex-direction:row!important}.flex-xl-column{-webkit-box-orient:vertical!important;-webkit-box-direction:normal!important;-ms-flex-direction:column!important;flex-direction:column!important}.flex-xl-row-reverse{-webkit-box-orient:horizontal!important;-webkit-box-direction:reverse!important;-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-xl-column-reverse{-webkit-box-orient:vertical!important;-webkit-box-direction:reverse!important;-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-xl-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-xl-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-xl-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.justify-content-xl-start{-webkit-box-pack:start!important;-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-xl-end{-webkit-box-pack:end!important;-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-xl-center{-webkit-box-pack:center!important;-ms-flex-pack:center!important;justify-content:center!important}.justify-content-xl-between{-webkit-box-pack:justify!important;-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-xl-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-xl-start{-webkit-box-align:start!important;-ms-flex-align:start!important;align-items:flex-start!important}.align-items-xl-end{-webkit-box-align:end!important;-ms-flex-align:end!important;align-items:flex-end!important}.align-items-xl-center{-webkit-box-align:center!important;-ms-flex-align:center!important;align-items:center!important}.align-items-xl-baseline{-webkit-box-align:baseline!important;-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-xl-stretch{-webkit-box-align:stretch!important;-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-xl-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-xl-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-xl-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-xl-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-xl-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-xl-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-xl-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-xl-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-xl-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-xl-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-xl-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-xl-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}
+/*# sourceMappingURL=bootstrap-grid.min.css.map */ \ No newline at end of file
diff --git a/chall/src/css/bootstrap-reboot.css b/chall/src/css/bootstrap-reboot.css
new file mode 100644
index 0000000..5a75a62
--- /dev/null
+++ b/chall/src/css/bootstrap-reboot.css
@@ -0,0 +1,330 @@
+/*!
+ * Bootstrap Reboot v4.0.0 (https://getbootstrap.com)
+ * Copyright 2011-2018 The Bootstrap Authors
+ * Copyright 2011-2018 Twitter, Inc.
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * Forked from Normalize.css, licensed MIT (https://github.com/necolas/normalize.css/blob/master/LICENSE.md)
+ */
+*,
+*::before,
+*::after {
+ box-sizing: border-box;
+}
+
+html {
+ font-family: sans-serif;
+ line-height: 1.15;
+ -webkit-text-size-adjust: 100%;
+ -ms-text-size-adjust: 100%;
+ -ms-overflow-style: scrollbar;
+ -webkit-tap-highlight-color: transparent;
+}
+
+@-ms-viewport {
+ width: device-width;
+}
+
+article, aside, dialog, figcaption, figure, footer, header, hgroup, main, nav, section {
+ display: block;
+}
+
+body {
+ margin: 0;
+ font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol";
+ font-size: 1rem;
+ font-weight: 400;
+ line-height: 1.5;
+ color: #212529;
+ text-align: left;
+ background-color: #fff;
+}
+
+[tabindex="-1"]:focus {
+ outline: 0 !important;
+}
+
+hr {
+ box-sizing: content-box;
+ height: 0;
+ overflow: visible;
+}
+
+h1, h2, h3, h4, h5, h6 {
+ margin-top: 0;
+ margin-bottom: 0.5rem;
+}
+
+p {
+ margin-top: 0;
+ margin-bottom: 1rem;
+}
+
+abbr[title],
+abbr[data-original-title] {
+ text-decoration: underline;
+ -webkit-text-decoration: underline dotted;
+ text-decoration: underline dotted;
+ cursor: help;
+ border-bottom: 0;
+}
+
+address {
+ margin-bottom: 1rem;
+ font-style: normal;
+ line-height: inherit;
+}
+
+ol,
+ul,
+dl {
+ margin-top: 0;
+ margin-bottom: 1rem;
+}
+
+ol ol,
+ul ul,
+ol ul,
+ul ol {
+ margin-bottom: 0;
+}
+
+dt {
+ font-weight: 700;
+}
+
+dd {
+ margin-bottom: .5rem;
+ margin-left: 0;
+}
+
+blockquote {
+ margin: 0 0 1rem;
+}
+
+dfn {
+ font-style: italic;
+}
+
+b,
+strong {
+ font-weight: bolder;
+}
+
+small {
+ font-size: 80%;
+}
+
+sub,
+sup {
+ position: relative;
+ font-size: 75%;
+ line-height: 0;
+ vertical-align: baseline;
+}
+
+sub {
+ bottom: -.25em;
+}
+
+sup {
+ top: -.5em;
+}
+
+a {
+ color: #007bff;
+ text-decoration: none;
+ background-color: transparent;
+ -webkit-text-decoration-skip: objects;
+}
+
+a:hover {
+ color: #0056b3;
+ text-decoration: underline;
+}
+
+a:not([href]):not([tabindex]) {
+ color: inherit;
+ text-decoration: none;
+}
+
+a:not([href]):not([tabindex]):hover, a:not([href]):not([tabindex]):focus {
+ color: inherit;
+ text-decoration: none;
+}
+
+a:not([href]):not([tabindex]):focus {
+ outline: 0;
+}
+
+pre,
+code,
+kbd,
+samp {
+ font-family: monospace, monospace;
+ font-size: 1em;
+}
+
+pre {
+ margin-top: 0;
+ margin-bottom: 1rem;
+ overflow: auto;
+ -ms-overflow-style: scrollbar;
+}
+
+figure {
+ margin: 0 0 1rem;
+}
+
+img {
+ vertical-align: middle;
+ border-style: none;
+}
+
+svg:not(:root) {
+ overflow: hidden;
+}
+
+table {
+ border-collapse: collapse;
+}
+
+caption {
+ padding-top: 0.75rem;
+ padding-bottom: 0.75rem;
+ color: #6c757d;
+ text-align: left;
+ caption-side: bottom;
+}
+
+th {
+ text-align: inherit;
+}
+
+label {
+ display: inline-block;
+ margin-bottom: .5rem;
+}
+
+button {
+ border-radius: 0;
+}
+
+button:focus {
+ outline: 1px dotted;
+ outline: 5px auto -webkit-focus-ring-color;
+}
+
+input,
+button,
+select,
+optgroup,
+textarea {
+ margin: 0;
+ font-family: inherit;
+ font-size: inherit;
+ line-height: inherit;
+}
+
+button,
+input {
+ overflow: visible;
+}
+
+button,
+select {
+ text-transform: none;
+}
+
+button,
+html [type="button"],
+[type="reset"],
+[type="submit"] {
+ -webkit-appearance: button;
+}
+
+button::-moz-focus-inner,
+[type="button"]::-moz-focus-inner,
+[type="reset"]::-moz-focus-inner,
+[type="submit"]::-moz-focus-inner {
+ padding: 0;
+ border-style: none;
+}
+
+input[type="radio"],
+input[type="checkbox"] {
+ box-sizing: border-box;
+ padding: 0;
+}
+
+input[type="date"],
+input[type="time"],
+input[type="datetime-local"],
+input[type="month"] {
+ -webkit-appearance: listbox;
+}
+
+textarea {
+ overflow: auto;
+ resize: vertical;
+}
+
+fieldset {
+ min-width: 0;
+ padding: 0;
+ margin: 0;
+ border: 0;
+}
+
+legend {
+ display: block;
+ width: 100%;
+ max-width: 100%;
+ padding: 0;
+ margin-bottom: .5rem;
+ font-size: 1.5rem;
+ line-height: inherit;
+ color: inherit;
+ white-space: normal;
+}
+
+progress {
+ vertical-align: baseline;
+}
+
+[type="number"]::-webkit-inner-spin-button,
+[type="number"]::-webkit-outer-spin-button {
+ height: auto;
+}
+
+[type="search"] {
+ outline-offset: -2px;
+ -webkit-appearance: none;
+}
+
+[type="search"]::-webkit-search-cancel-button,
+[type="search"]::-webkit-search-decoration {
+ -webkit-appearance: none;
+}
+
+::-webkit-file-upload-button {
+ font: inherit;
+ -webkit-appearance: button;
+}
+
+output {
+ display: inline-block;
+}
+
+summary {
+ display: list-item;
+ cursor: pointer;
+}
+
+template {
+ display: none;
+}
+
+[hidden] {
+ display: none !important;
+}
+/*# sourceMappingURL=bootstrap-reboot.css.map */ \ No newline at end of file
diff --git a/chall/src/css/bootstrap-reboot.min.css b/chall/src/css/bootstrap-reboot.min.css
new file mode 100644
index 0000000..ced0468
--- /dev/null
+++ b/chall/src/css/bootstrap-reboot.min.css
@@ -0,0 +1,8 @@
+/*!
+ * Bootstrap Reboot v4.0.0 (https://getbootstrap.com)
+ * Copyright 2011-2018 The Bootstrap Authors
+ * Copyright 2011-2018 Twitter, Inc.
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * Forked from Normalize.css, licensed MIT (https://github.com/necolas/normalize.css/blob/master/LICENSE.md)
+ */*,::after,::before{box-sizing:border-box}html{font-family:sans-serif;line-height:1.15;-webkit-text-size-adjust:100%;-ms-text-size-adjust:100%;-ms-overflow-style:scrollbar;-webkit-tap-highlight-color:transparent}@-ms-viewport{width:device-width}article,aside,dialog,figcaption,figure,footer,header,hgroup,main,nav,section{display:block}body{margin:0;font-family:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";font-size:1rem;font-weight:400;line-height:1.5;color:#212529;text-align:left;background-color:#fff}[tabindex="-1"]:focus{outline:0!important}hr{box-sizing:content-box;height:0;overflow:visible}h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:.5rem}p{margin-top:0;margin-bottom:1rem}abbr[data-original-title],abbr[title]{text-decoration:underline;-webkit-text-decoration:underline dotted;text-decoration:underline dotted;cursor:help;border-bottom:0}address{margin-bottom:1rem;font-style:normal;line-height:inherit}dl,ol,ul{margin-top:0;margin-bottom:1rem}ol ol,ol ul,ul ol,ul ul{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem}dfn{font-style:italic}b,strong{font-weight:bolder}small{font-size:80%}sub,sup{position:relative;font-size:75%;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}a{color:#007bff;text-decoration:none;background-color:transparent;-webkit-text-decoration-skip:objects}a:hover{color:#0056b3;text-decoration:underline}a:not([href]):not([tabindex]){color:inherit;text-decoration:none}a:not([href]):not([tabindex]):focus,a:not([href]):not([tabindex]):hover{color:inherit;text-decoration:none}a:not([href]):not([tabindex]):focus{outline:0}code,kbd,pre,samp{font-family:monospace,monospace;font-size:1em}pre{margin-top:0;margin-bottom:1rem;overflow:auto;-ms-overflow-style:scrollbar}figure{margin:0 0 1rem}img{vertical-align:middle;border-style:none}svg:not(:root){overflow:hidden}table{border-collapse:collapse}caption{padding-top:.75rem;padding-bottom:.75rem;color:#6c757d;text-align:left;caption-side:bottom}th{text-align:inherit}label{display:inline-block;margin-bottom:.5rem}button{border-radius:0}button:focus{outline:1px dotted;outline:5px auto -webkit-focus-ring-color}button,input,optgroup,select,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,input{overflow:visible}button,select{text-transform:none}[type=reset],[type=submit],button,html [type=button]{-webkit-appearance:button}[type=button]::-moz-focus-inner,[type=reset]::-moz-focus-inner,[type=submit]::-moz-focus-inner,button::-moz-focus-inner{padding:0;border-style:none}input[type=checkbox],input[type=radio]{box-sizing:border-box;padding:0}input[type=date],input[type=datetime-local],input[type=month],input[type=time]{-webkit-appearance:listbox}textarea{overflow:auto;resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{display:block;width:100%;max-width:100%;padding:0;margin-bottom:.5rem;font-size:1.5rem;line-height:inherit;color:inherit;white-space:normal}progress{vertical-align:baseline}[type=number]::-webkit-inner-spin-button,[type=number]::-webkit-outer-spin-button{height:auto}[type=search]{outline-offset:-2px;-webkit-appearance:none}[type=search]::-webkit-search-cancel-button,[type=search]::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{font:inherit;-webkit-appearance:button}output{display:inline-block}summary{display:list-item;cursor:pointer}template{display:none}[hidden]{display:none!important}
+/*# sourceMappingURL=bootstrap-reboot.min.css.map */ \ No newline at end of file
diff --git a/chall/src/css/bootstrap.css b/chall/src/css/bootstrap.css
new file mode 100644
index 0000000..aa49713
--- /dev/null
+++ b/chall/src/css/bootstrap.css
@@ -0,0 +1,8975 @@
+/*!
+ * Bootstrap v4.0.0 (https://getbootstrap.com)
+ * Copyright 2011-2018 The Bootstrap Authors
+ * Copyright 2011-2018 Twitter, Inc.
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ */
+:root {
+ --blue: #007bff;
+ --indigo: #6610f2;
+ --purple: #6f42c1;
+ --pink: #e83e8c;
+ --red: #dc3545;
+ --orange: #fd7e14;
+ --yellow: #ffc107;
+ --green: #28a745;
+ --teal: #20c997;
+ --cyan: #17a2b8;
+ --white: #fff;
+ --gray: #6c757d;
+ --gray-dark: #343a40;
+ --primary: #007bff;
+ --secondary: #6c757d;
+ --success: #28a745;
+ --info: #17a2b8;
+ --warning: #ffc107;
+ --danger: #dc3545;
+ --light: #f8f9fa;
+ --dark: #343a40;
+ --breakpoint-xs: 0;
+ --breakpoint-sm: 576px;
+ --breakpoint-md: 768px;
+ --breakpoint-lg: 992px;
+ --breakpoint-xl: 1200px;
+ --font-family-sans-serif: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol";
+ --font-family-monospace: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
+}
+
+*,
+*::before,
+*::after {
+ box-sizing: border-box;
+}
+
+html {
+ font-family: sans-serif;
+ line-height: 1.15;
+ -webkit-text-size-adjust: 100%;
+ -ms-text-size-adjust: 100%;
+ -ms-overflow-style: scrollbar;
+ -webkit-tap-highlight-color: transparent;
+}
+
+@-ms-viewport {
+ width: device-width;
+}
+
+article, aside, dialog, figcaption, figure, footer, header, hgroup, main, nav, section {
+ display: block;
+}
+
+body {
+ margin: 0;
+ font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol";
+ font-size: 1rem;
+ font-weight: 400;
+ line-height: 1.5;
+ color: #212529;
+ text-align: left;
+ background-color: #fff;
+}
+
+[tabindex="-1"]:focus {
+ outline: 0 !important;
+}
+
+hr {
+ box-sizing: content-box;
+ height: 0;
+ overflow: visible;
+}
+
+h1, h2, h3, h4, h5, h6 {
+ margin-top: 0;
+ margin-bottom: 0.5rem;
+}
+
+p {
+ margin-top: 0;
+ margin-bottom: 1rem;
+}
+
+abbr[title],
+abbr[data-original-title] {
+ text-decoration: underline;
+ -webkit-text-decoration: underline dotted;
+ text-decoration: underline dotted;
+ cursor: help;
+ border-bottom: 0;
+}
+
+address {
+ margin-bottom: 1rem;
+ font-style: normal;
+ line-height: inherit;
+}
+
+ol,
+ul,
+dl {
+ margin-top: 0;
+ margin-bottom: 1rem;
+}
+
+ol ol,
+ul ul,
+ol ul,
+ul ol {
+ margin-bottom: 0;
+}
+
+dt {
+ font-weight: 700;
+}
+
+dd {
+ margin-bottom: .5rem;
+ margin-left: 0;
+}
+
+blockquote {
+ margin: 0 0 1rem;
+}
+
+dfn {
+ font-style: italic;
+}
+
+b,
+strong {
+ font-weight: bolder;
+}
+
+small {
+ font-size: 80%;
+}
+
+sub,
+sup {
+ position: relative;
+ font-size: 75%;
+ line-height: 0;
+ vertical-align: baseline;
+}
+
+sub {
+ bottom: -.25em;
+}
+
+sup {
+ top: -.5em;
+}
+
+a {
+ color: #007bff;
+ text-decoration: none;
+ background-color: transparent;
+ -webkit-text-decoration-skip: objects;
+}
+
+a:hover {
+ color: #0056b3;
+ text-decoration: underline;
+}
+
+a:not([href]):not([tabindex]) {
+ color: inherit;
+ text-decoration: none;
+}
+
+a:not([href]):not([tabindex]):hover, a:not([href]):not([tabindex]):focus {
+ color: inherit;
+ text-decoration: none;
+}
+
+a:not([href]):not([tabindex]):focus {
+ outline: 0;
+}
+
+pre,
+code,
+kbd,
+samp {
+ font-family: monospace, monospace;
+ font-size: 1em;
+}
+
+pre {
+ margin-top: 0;
+ margin-bottom: 1rem;
+ overflow: auto;
+ -ms-overflow-style: scrollbar;
+}
+
+figure {
+ margin: 0 0 1rem;
+}
+
+img {
+ vertical-align: middle;
+ border-style: none;
+}
+
+svg:not(:root) {
+ overflow: hidden;
+}
+
+table {
+ border-collapse: collapse;
+}
+
+caption {
+ padding-top: 0.75rem;
+ padding-bottom: 0.75rem;
+ color: #6c757d;
+ text-align: left;
+ caption-side: bottom;
+}
+
+th {
+ text-align: inherit;
+}
+
+label {
+ display: inline-block;
+ margin-bottom: .5rem;
+}
+
+button {
+ border-radius: 0;
+}
+
+button:focus {
+ outline: 1px dotted;
+ outline: 5px auto -webkit-focus-ring-color;
+}
+
+input,
+button,
+select,
+optgroup,
+textarea {
+ margin: 0;
+ font-family: inherit;
+ font-size: inherit;
+ line-height: inherit;
+}
+
+button,
+input {
+ overflow: visible;
+}
+
+button,
+select {
+ text-transform: none;
+}
+
+button,
+html [type="button"],
+[type="reset"],
+[type="submit"] {
+ -webkit-appearance: button;
+}
+
+button::-moz-focus-inner,
+[type="button"]::-moz-focus-inner,
+[type="reset"]::-moz-focus-inner,
+[type="submit"]::-moz-focus-inner {
+ padding: 0;
+ border-style: none;
+}
+
+input[type="radio"],
+input[type="checkbox"] {
+ box-sizing: border-box;
+ padding: 0;
+}
+
+input[type="date"],
+input[type="time"],
+input[type="datetime-local"],
+input[type="month"] {
+ -webkit-appearance: listbox;
+}
+
+textarea {
+ overflow: auto;
+ resize: vertical;
+}
+
+fieldset {
+ min-width: 0;
+ padding: 0;
+ margin: 0;
+ border: 0;
+}
+
+legend {
+ display: block;
+ width: 100%;
+ max-width: 100%;
+ padding: 0;
+ margin-bottom: .5rem;
+ font-size: 1.5rem;
+ line-height: inherit;
+ color: inherit;
+ white-space: normal;
+}
+
+progress {
+ vertical-align: baseline;
+}
+
+[type="number"]::-webkit-inner-spin-button,
+[type="number"]::-webkit-outer-spin-button {
+ height: auto;
+}
+
+[type="search"] {
+ outline-offset: -2px;
+ -webkit-appearance: none;
+}
+
+[type="search"]::-webkit-search-cancel-button,
+[type="search"]::-webkit-search-decoration {
+ -webkit-appearance: none;
+}
+
+::-webkit-file-upload-button {
+ font: inherit;
+ -webkit-appearance: button;
+}
+
+output {
+ display: inline-block;
+}
+
+summary {
+ display: list-item;
+ cursor: pointer;
+}
+
+template {
+ display: none;
+}
+
+[hidden] {
+ display: none !important;
+}
+
+h1, h2, h3, h4, h5, h6,
+.h1, .h2, .h3, .h4, .h5, .h6 {
+ margin-bottom: 0.5rem;
+ font-family: inherit;
+ font-weight: 500;
+ line-height: 1.2;
+ color: inherit;
+}
+
+h1, .h1 {
+ font-size: 2.5rem;
+}
+
+h2, .h2 {
+ font-size: 2rem;
+}
+
+h3, .h3 {
+ font-size: 1.75rem;
+}
+
+h4, .h4 {
+ font-size: 1.5rem;
+}
+
+h5, .h5 {
+ font-size: 1.25rem;
+}
+
+h6, .h6 {
+ font-size: 1rem;
+}
+
+.lead {
+ font-size: 1.25rem;
+ font-weight: 300;
+}
+
+.display-1 {
+ font-size: 6rem;
+ font-weight: 300;
+ line-height: 1.2;
+}
+
+.display-2 {
+ font-size: 5.5rem;
+ font-weight: 300;
+ line-height: 1.2;
+}
+
+.display-3 {
+ font-size: 4.5rem;
+ font-weight: 300;
+ line-height: 1.2;
+}
+
+.display-4 {
+ font-size: 3.5rem;
+ font-weight: 300;
+ line-height: 1.2;
+}
+
+hr {
+ margin-top: 1rem;
+ margin-bottom: 1rem;
+ border: 0;
+ border-top: 1px solid rgba(0, 0, 0, 0.1);
+}
+
+small,
+.small {
+ font-size: 80%;
+ font-weight: 400;
+}
+
+mark,
+.mark {
+ padding: 0.2em;
+ background-color: #fcf8e3;
+}
+
+.list-unstyled {
+ padding-left: 0;
+ list-style: none;
+}
+
+.list-inline {
+ padding-left: 0;
+ list-style: none;
+}
+
+.list-inline-item {
+ display: inline-block;
+}
+
+.list-inline-item:not(:last-child) {
+ margin-right: 0.5rem;
+}
+
+.initialism {
+ font-size: 90%;
+ text-transform: uppercase;
+}
+
+.blockquote {
+ margin-bottom: 1rem;
+ font-size: 1.25rem;
+}
+
+.blockquote-footer {
+ display: block;
+ font-size: 80%;
+ color: #6c757d;
+}
+
+.blockquote-footer::before {
+ content: "\2014 \00A0";
+}
+
+.img-fluid {
+ max-width: 100%;
+ height: auto;
+}
+
+.img-thumbnail {
+ padding: 0.25rem;
+ background-color: #fff;
+ border: 1px solid #dee2e6;
+ border-radius: 0.25rem;
+ max-width: 100%;
+ height: auto;
+}
+
+.figure {
+ display: inline-block;
+}
+
+.figure-img {
+ margin-bottom: 0.5rem;
+ line-height: 1;
+}
+
+.figure-caption {
+ font-size: 90%;
+ color: #6c757d;
+}
+
+code,
+kbd,
+pre,
+samp {
+ font-family: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
+}
+
+code {
+ font-size: 87.5%;
+ color: #e83e8c;
+ word-break: break-word;
+}
+
+a > code {
+ color: inherit;
+}
+
+kbd {
+ padding: 0.2rem 0.4rem;
+ font-size: 87.5%;
+ color: #fff;
+ background-color: #212529;
+ border-radius: 0.2rem;
+}
+
+kbd kbd {
+ padding: 0;
+ font-size: 100%;
+ font-weight: 700;
+}
+
+pre {
+ display: block;
+ font-size: 87.5%;
+ color: #212529;
+}
+
+pre code {
+ font-size: inherit;
+ color: inherit;
+ word-break: normal;
+}
+
+.pre-scrollable {
+ max-height: 340px;
+ overflow-y: scroll;
+}
+
+.container {
+ width: 100%;
+ padding-right: 15px;
+ padding-left: 15px;
+ margin-right: auto;
+ margin-left: auto;
+}
+
+@media (min-width: 576px) {
+ .container {
+ max-width: 540px;
+ }
+}
+
+@media (min-width: 768px) {
+ .container {
+ max-width: 720px;
+ }
+}
+
+@media (min-width: 992px) {
+ .container {
+ max-width: 960px;
+ }
+}
+
+@media (min-width: 1200px) {
+ .container {
+ max-width: 1140px;
+ }
+}
+
+.container-fluid {
+ width: 100%;
+ padding-right: 15px;
+ padding-left: 15px;
+ margin-right: auto;
+ margin-left: auto;
+}
+
+.row {
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -ms-flex-wrap: wrap;
+ flex-wrap: wrap;
+ margin-right: -15px;
+ margin-left: -15px;
+}
+
+.no-gutters {
+ margin-right: 0;
+ margin-left: 0;
+}
+
+.no-gutters > .col,
+.no-gutters > [class*="col-"] {
+ padding-right: 0;
+ padding-left: 0;
+}
+
+.col-1, .col-2, .col-3, .col-4, .col-5, .col-6, .col-7, .col-8, .col-9, .col-10, .col-11, .col-12, .col,
+.col-auto, .col-sm-1, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9, .col-sm-10, .col-sm-11, .col-sm-12, .col-sm,
+.col-sm-auto, .col-md-1, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9, .col-md-10, .col-md-11, .col-md-12, .col-md,
+.col-md-auto, .col-lg-1, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9, .col-lg-10, .col-lg-11, .col-lg-12, .col-lg,
+.col-lg-auto, .col-xl-1, .col-xl-2, .col-xl-3, .col-xl-4, .col-xl-5, .col-xl-6, .col-xl-7, .col-xl-8, .col-xl-9, .col-xl-10, .col-xl-11, .col-xl-12, .col-xl,
+.col-xl-auto {
+ position: relative;
+ width: 100%;
+ min-height: 1px;
+ padding-right: 15px;
+ padding-left: 15px;
+}
+
+.col {
+ -ms-flex-preferred-size: 0;
+ flex-basis: 0;
+ -webkit-box-flex: 1;
+ -ms-flex-positive: 1;
+ flex-grow: 1;
+ max-width: 100%;
+}
+
+.col-auto {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 auto;
+ flex: 0 0 auto;
+ width: auto;
+ max-width: none;
+}
+
+.col-1 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 8.333333%;
+ flex: 0 0 8.333333%;
+ max-width: 8.333333%;
+}
+
+.col-2 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 16.666667%;
+ flex: 0 0 16.666667%;
+ max-width: 16.666667%;
+}
+
+.col-3 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 25%;
+ flex: 0 0 25%;
+ max-width: 25%;
+}
+
+.col-4 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 33.333333%;
+ flex: 0 0 33.333333%;
+ max-width: 33.333333%;
+}
+
+.col-5 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 41.666667%;
+ flex: 0 0 41.666667%;
+ max-width: 41.666667%;
+}
+
+.col-6 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 50%;
+ flex: 0 0 50%;
+ max-width: 50%;
+}
+
+.col-7 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 58.333333%;
+ flex: 0 0 58.333333%;
+ max-width: 58.333333%;
+}
+
+.col-8 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 66.666667%;
+ flex: 0 0 66.666667%;
+ max-width: 66.666667%;
+}
+
+.col-9 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 75%;
+ flex: 0 0 75%;
+ max-width: 75%;
+}
+
+.col-10 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 83.333333%;
+ flex: 0 0 83.333333%;
+ max-width: 83.333333%;
+}
+
+.col-11 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 91.666667%;
+ flex: 0 0 91.666667%;
+ max-width: 91.666667%;
+}
+
+.col-12 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 100%;
+ flex: 0 0 100%;
+ max-width: 100%;
+}
+
+.order-first {
+ -webkit-box-ordinal-group: 0;
+ -ms-flex-order: -1;
+ order: -1;
+}
+
+.order-last {
+ -webkit-box-ordinal-group: 14;
+ -ms-flex-order: 13;
+ order: 13;
+}
+
+.order-0 {
+ -webkit-box-ordinal-group: 1;
+ -ms-flex-order: 0;
+ order: 0;
+}
+
+.order-1 {
+ -webkit-box-ordinal-group: 2;
+ -ms-flex-order: 1;
+ order: 1;
+}
+
+.order-2 {
+ -webkit-box-ordinal-group: 3;
+ -ms-flex-order: 2;
+ order: 2;
+}
+
+.order-3 {
+ -webkit-box-ordinal-group: 4;
+ -ms-flex-order: 3;
+ order: 3;
+}
+
+.order-4 {
+ -webkit-box-ordinal-group: 5;
+ -ms-flex-order: 4;
+ order: 4;
+}
+
+.order-5 {
+ -webkit-box-ordinal-group: 6;
+ -ms-flex-order: 5;
+ order: 5;
+}
+
+.order-6 {
+ -webkit-box-ordinal-group: 7;
+ -ms-flex-order: 6;
+ order: 6;
+}
+
+.order-7 {
+ -webkit-box-ordinal-group: 8;
+ -ms-flex-order: 7;
+ order: 7;
+}
+
+.order-8 {
+ -webkit-box-ordinal-group: 9;
+ -ms-flex-order: 8;
+ order: 8;
+}
+
+.order-9 {
+ -webkit-box-ordinal-group: 10;
+ -ms-flex-order: 9;
+ order: 9;
+}
+
+.order-10 {
+ -webkit-box-ordinal-group: 11;
+ -ms-flex-order: 10;
+ order: 10;
+}
+
+.order-11 {
+ -webkit-box-ordinal-group: 12;
+ -ms-flex-order: 11;
+ order: 11;
+}
+
+.order-12 {
+ -webkit-box-ordinal-group: 13;
+ -ms-flex-order: 12;
+ order: 12;
+}
+
+.offset-1 {
+ margin-left: 8.333333%;
+}
+
+.offset-2 {
+ margin-left: 16.666667%;
+}
+
+.offset-3 {
+ margin-left: 25%;
+}
+
+.offset-4 {
+ margin-left: 33.333333%;
+}
+
+.offset-5 {
+ margin-left: 41.666667%;
+}
+
+.offset-6 {
+ margin-left: 50%;
+}
+
+.offset-7 {
+ margin-left: 58.333333%;
+}
+
+.offset-8 {
+ margin-left: 66.666667%;
+}
+
+.offset-9 {
+ margin-left: 75%;
+}
+
+.offset-10 {
+ margin-left: 83.333333%;
+}
+
+.offset-11 {
+ margin-left: 91.666667%;
+}
+
+@media (min-width: 576px) {
+ .col-sm {
+ -ms-flex-preferred-size: 0;
+ flex-basis: 0;
+ -webkit-box-flex: 1;
+ -ms-flex-positive: 1;
+ flex-grow: 1;
+ max-width: 100%;
+ }
+ .col-sm-auto {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 auto;
+ flex: 0 0 auto;
+ width: auto;
+ max-width: none;
+ }
+ .col-sm-1 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 8.333333%;
+ flex: 0 0 8.333333%;
+ max-width: 8.333333%;
+ }
+ .col-sm-2 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 16.666667%;
+ flex: 0 0 16.666667%;
+ max-width: 16.666667%;
+ }
+ .col-sm-3 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 25%;
+ flex: 0 0 25%;
+ max-width: 25%;
+ }
+ .col-sm-4 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 33.333333%;
+ flex: 0 0 33.333333%;
+ max-width: 33.333333%;
+ }
+ .col-sm-5 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 41.666667%;
+ flex: 0 0 41.666667%;
+ max-width: 41.666667%;
+ }
+ .col-sm-6 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 50%;
+ flex: 0 0 50%;
+ max-width: 50%;
+ }
+ .col-sm-7 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 58.333333%;
+ flex: 0 0 58.333333%;
+ max-width: 58.333333%;
+ }
+ .col-sm-8 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 66.666667%;
+ flex: 0 0 66.666667%;
+ max-width: 66.666667%;
+ }
+ .col-sm-9 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 75%;
+ flex: 0 0 75%;
+ max-width: 75%;
+ }
+ .col-sm-10 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 83.333333%;
+ flex: 0 0 83.333333%;
+ max-width: 83.333333%;
+ }
+ .col-sm-11 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 91.666667%;
+ flex: 0 0 91.666667%;
+ max-width: 91.666667%;
+ }
+ .col-sm-12 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 100%;
+ flex: 0 0 100%;
+ max-width: 100%;
+ }
+ .order-sm-first {
+ -webkit-box-ordinal-group: 0;
+ -ms-flex-order: -1;
+ order: -1;
+ }
+ .order-sm-last {
+ -webkit-box-ordinal-group: 14;
+ -ms-flex-order: 13;
+ order: 13;
+ }
+ .order-sm-0 {
+ -webkit-box-ordinal-group: 1;
+ -ms-flex-order: 0;
+ order: 0;
+ }
+ .order-sm-1 {
+ -webkit-box-ordinal-group: 2;
+ -ms-flex-order: 1;
+ order: 1;
+ }
+ .order-sm-2 {
+ -webkit-box-ordinal-group: 3;
+ -ms-flex-order: 2;
+ order: 2;
+ }
+ .order-sm-3 {
+ -webkit-box-ordinal-group: 4;
+ -ms-flex-order: 3;
+ order: 3;
+ }
+ .order-sm-4 {
+ -webkit-box-ordinal-group: 5;
+ -ms-flex-order: 4;
+ order: 4;
+ }
+ .order-sm-5 {
+ -webkit-box-ordinal-group: 6;
+ -ms-flex-order: 5;
+ order: 5;
+ }
+ .order-sm-6 {
+ -webkit-box-ordinal-group: 7;
+ -ms-flex-order: 6;
+ order: 6;
+ }
+ .order-sm-7 {
+ -webkit-box-ordinal-group: 8;
+ -ms-flex-order: 7;
+ order: 7;
+ }
+ .order-sm-8 {
+ -webkit-box-ordinal-group: 9;
+ -ms-flex-order: 8;
+ order: 8;
+ }
+ .order-sm-9 {
+ -webkit-box-ordinal-group: 10;
+ -ms-flex-order: 9;
+ order: 9;
+ }
+ .order-sm-10 {
+ -webkit-box-ordinal-group: 11;
+ -ms-flex-order: 10;
+ order: 10;
+ }
+ .order-sm-11 {
+ -webkit-box-ordinal-group: 12;
+ -ms-flex-order: 11;
+ order: 11;
+ }
+ .order-sm-12 {
+ -webkit-box-ordinal-group: 13;
+ -ms-flex-order: 12;
+ order: 12;
+ }
+ .offset-sm-0 {
+ margin-left: 0;
+ }
+ .offset-sm-1 {
+ margin-left: 8.333333%;
+ }
+ .offset-sm-2 {
+ margin-left: 16.666667%;
+ }
+ .offset-sm-3 {
+ margin-left: 25%;
+ }
+ .offset-sm-4 {
+ margin-left: 33.333333%;
+ }
+ .offset-sm-5 {
+ margin-left: 41.666667%;
+ }
+ .offset-sm-6 {
+ margin-left: 50%;
+ }
+ .offset-sm-7 {
+ margin-left: 58.333333%;
+ }
+ .offset-sm-8 {
+ margin-left: 66.666667%;
+ }
+ .offset-sm-9 {
+ margin-left: 75%;
+ }
+ .offset-sm-10 {
+ margin-left: 83.333333%;
+ }
+ .offset-sm-11 {
+ margin-left: 91.666667%;
+ }
+}
+
+@media (min-width: 768px) {
+ .col-md {
+ -ms-flex-preferred-size: 0;
+ flex-basis: 0;
+ -webkit-box-flex: 1;
+ -ms-flex-positive: 1;
+ flex-grow: 1;
+ max-width: 100%;
+ }
+ .col-md-auto {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 auto;
+ flex: 0 0 auto;
+ width: auto;
+ max-width: none;
+ }
+ .col-md-1 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 8.333333%;
+ flex: 0 0 8.333333%;
+ max-width: 8.333333%;
+ }
+ .col-md-2 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 16.666667%;
+ flex: 0 0 16.666667%;
+ max-width: 16.666667%;
+ }
+ .col-md-3 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 25%;
+ flex: 0 0 25%;
+ max-width: 25%;
+ }
+ .col-md-4 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 33.333333%;
+ flex: 0 0 33.333333%;
+ max-width: 33.333333%;
+ }
+ .col-md-5 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 41.666667%;
+ flex: 0 0 41.666667%;
+ max-width: 41.666667%;
+ }
+ .col-md-6 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 50%;
+ flex: 0 0 50%;
+ max-width: 50%;
+ }
+ .col-md-7 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 58.333333%;
+ flex: 0 0 58.333333%;
+ max-width: 58.333333%;
+ }
+ .col-md-8 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 66.666667%;
+ flex: 0 0 66.666667%;
+ max-width: 66.666667%;
+ }
+ .col-md-9 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 75%;
+ flex: 0 0 75%;
+ max-width: 75%;
+ }
+ .col-md-10 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 83.333333%;
+ flex: 0 0 83.333333%;
+ max-width: 83.333333%;
+ }
+ .col-md-11 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 91.666667%;
+ flex: 0 0 91.666667%;
+ max-width: 91.666667%;
+ }
+ .col-md-12 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 100%;
+ flex: 0 0 100%;
+ max-width: 100%;
+ }
+ .order-md-first {
+ -webkit-box-ordinal-group: 0;
+ -ms-flex-order: -1;
+ order: -1;
+ }
+ .order-md-last {
+ -webkit-box-ordinal-group: 14;
+ -ms-flex-order: 13;
+ order: 13;
+ }
+ .order-md-0 {
+ -webkit-box-ordinal-group: 1;
+ -ms-flex-order: 0;
+ order: 0;
+ }
+ .order-md-1 {
+ -webkit-box-ordinal-group: 2;
+ -ms-flex-order: 1;
+ order: 1;
+ }
+ .order-md-2 {
+ -webkit-box-ordinal-group: 3;
+ -ms-flex-order: 2;
+ order: 2;
+ }
+ .order-md-3 {
+ -webkit-box-ordinal-group: 4;
+ -ms-flex-order: 3;
+ order: 3;
+ }
+ .order-md-4 {
+ -webkit-box-ordinal-group: 5;
+ -ms-flex-order: 4;
+ order: 4;
+ }
+ .order-md-5 {
+ -webkit-box-ordinal-group: 6;
+ -ms-flex-order: 5;
+ order: 5;
+ }
+ .order-md-6 {
+ -webkit-box-ordinal-group: 7;
+ -ms-flex-order: 6;
+ order: 6;
+ }
+ .order-md-7 {
+ -webkit-box-ordinal-group: 8;
+ -ms-flex-order: 7;
+ order: 7;
+ }
+ .order-md-8 {
+ -webkit-box-ordinal-group: 9;
+ -ms-flex-order: 8;
+ order: 8;
+ }
+ .order-md-9 {
+ -webkit-box-ordinal-group: 10;
+ -ms-flex-order: 9;
+ order: 9;
+ }
+ .order-md-10 {
+ -webkit-box-ordinal-group: 11;
+ -ms-flex-order: 10;
+ order: 10;
+ }
+ .order-md-11 {
+ -webkit-box-ordinal-group: 12;
+ -ms-flex-order: 11;
+ order: 11;
+ }
+ .order-md-12 {
+ -webkit-box-ordinal-group: 13;
+ -ms-flex-order: 12;
+ order: 12;
+ }
+ .offset-md-0 {
+ margin-left: 0;
+ }
+ .offset-md-1 {
+ margin-left: 8.333333%;
+ }
+ .offset-md-2 {
+ margin-left: 16.666667%;
+ }
+ .offset-md-3 {
+ margin-left: 25%;
+ }
+ .offset-md-4 {
+ margin-left: 33.333333%;
+ }
+ .offset-md-5 {
+ margin-left: 41.666667%;
+ }
+ .offset-md-6 {
+ margin-left: 50%;
+ }
+ .offset-md-7 {
+ margin-left: 58.333333%;
+ }
+ .offset-md-8 {
+ margin-left: 66.666667%;
+ }
+ .offset-md-9 {
+ margin-left: 75%;
+ }
+ .offset-md-10 {
+ margin-left: 83.333333%;
+ }
+ .offset-md-11 {
+ margin-left: 91.666667%;
+ }
+}
+
+@media (min-width: 992px) {
+ .col-lg {
+ -ms-flex-preferred-size: 0;
+ flex-basis: 0;
+ -webkit-box-flex: 1;
+ -ms-flex-positive: 1;
+ flex-grow: 1;
+ max-width: 100%;
+ }
+ .col-lg-auto {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 auto;
+ flex: 0 0 auto;
+ width: auto;
+ max-width: none;
+ }
+ .col-lg-1 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 8.333333%;
+ flex: 0 0 8.333333%;
+ max-width: 8.333333%;
+ }
+ .col-lg-2 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 16.666667%;
+ flex: 0 0 16.666667%;
+ max-width: 16.666667%;
+ }
+ .col-lg-3 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 25%;
+ flex: 0 0 25%;
+ max-width: 25%;
+ }
+ .col-lg-4 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 33.333333%;
+ flex: 0 0 33.333333%;
+ max-width: 33.333333%;
+ }
+ .col-lg-5 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 41.666667%;
+ flex: 0 0 41.666667%;
+ max-width: 41.666667%;
+ }
+ .col-lg-6 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 50%;
+ flex: 0 0 50%;
+ max-width: 50%;
+ }
+ .col-lg-7 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 58.333333%;
+ flex: 0 0 58.333333%;
+ max-width: 58.333333%;
+ }
+ .col-lg-8 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 66.666667%;
+ flex: 0 0 66.666667%;
+ max-width: 66.666667%;
+ }
+ .col-lg-9 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 75%;
+ flex: 0 0 75%;
+ max-width: 75%;
+ }
+ .col-lg-10 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 83.333333%;
+ flex: 0 0 83.333333%;
+ max-width: 83.333333%;
+ }
+ .col-lg-11 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 91.666667%;
+ flex: 0 0 91.666667%;
+ max-width: 91.666667%;
+ }
+ .col-lg-12 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 100%;
+ flex: 0 0 100%;
+ max-width: 100%;
+ }
+ .order-lg-first {
+ -webkit-box-ordinal-group: 0;
+ -ms-flex-order: -1;
+ order: -1;
+ }
+ .order-lg-last {
+ -webkit-box-ordinal-group: 14;
+ -ms-flex-order: 13;
+ order: 13;
+ }
+ .order-lg-0 {
+ -webkit-box-ordinal-group: 1;
+ -ms-flex-order: 0;
+ order: 0;
+ }
+ .order-lg-1 {
+ -webkit-box-ordinal-group: 2;
+ -ms-flex-order: 1;
+ order: 1;
+ }
+ .order-lg-2 {
+ -webkit-box-ordinal-group: 3;
+ -ms-flex-order: 2;
+ order: 2;
+ }
+ .order-lg-3 {
+ -webkit-box-ordinal-group: 4;
+ -ms-flex-order: 3;
+ order: 3;
+ }
+ .order-lg-4 {
+ -webkit-box-ordinal-group: 5;
+ -ms-flex-order: 4;
+ order: 4;
+ }
+ .order-lg-5 {
+ -webkit-box-ordinal-group: 6;
+ -ms-flex-order: 5;
+ order: 5;
+ }
+ .order-lg-6 {
+ -webkit-box-ordinal-group: 7;
+ -ms-flex-order: 6;
+ order: 6;
+ }
+ .order-lg-7 {
+ -webkit-box-ordinal-group: 8;
+ -ms-flex-order: 7;
+ order: 7;
+ }
+ .order-lg-8 {
+ -webkit-box-ordinal-group: 9;
+ -ms-flex-order: 8;
+ order: 8;
+ }
+ .order-lg-9 {
+ -webkit-box-ordinal-group: 10;
+ -ms-flex-order: 9;
+ order: 9;
+ }
+ .order-lg-10 {
+ -webkit-box-ordinal-group: 11;
+ -ms-flex-order: 10;
+ order: 10;
+ }
+ .order-lg-11 {
+ -webkit-box-ordinal-group: 12;
+ -ms-flex-order: 11;
+ order: 11;
+ }
+ .order-lg-12 {
+ -webkit-box-ordinal-group: 13;
+ -ms-flex-order: 12;
+ order: 12;
+ }
+ .offset-lg-0 {
+ margin-left: 0;
+ }
+ .offset-lg-1 {
+ margin-left: 8.333333%;
+ }
+ .offset-lg-2 {
+ margin-left: 16.666667%;
+ }
+ .offset-lg-3 {
+ margin-left: 25%;
+ }
+ .offset-lg-4 {
+ margin-left: 33.333333%;
+ }
+ .offset-lg-5 {
+ margin-left: 41.666667%;
+ }
+ .offset-lg-6 {
+ margin-left: 50%;
+ }
+ .offset-lg-7 {
+ margin-left: 58.333333%;
+ }
+ .offset-lg-8 {
+ margin-left: 66.666667%;
+ }
+ .offset-lg-9 {
+ margin-left: 75%;
+ }
+ .offset-lg-10 {
+ margin-left: 83.333333%;
+ }
+ .offset-lg-11 {
+ margin-left: 91.666667%;
+ }
+}
+
+@media (min-width: 1200px) {
+ .col-xl {
+ -ms-flex-preferred-size: 0;
+ flex-basis: 0;
+ -webkit-box-flex: 1;
+ -ms-flex-positive: 1;
+ flex-grow: 1;
+ max-width: 100%;
+ }
+ .col-xl-auto {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 auto;
+ flex: 0 0 auto;
+ width: auto;
+ max-width: none;
+ }
+ .col-xl-1 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 8.333333%;
+ flex: 0 0 8.333333%;
+ max-width: 8.333333%;
+ }
+ .col-xl-2 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 16.666667%;
+ flex: 0 0 16.666667%;
+ max-width: 16.666667%;
+ }
+ .col-xl-3 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 25%;
+ flex: 0 0 25%;
+ max-width: 25%;
+ }
+ .col-xl-4 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 33.333333%;
+ flex: 0 0 33.333333%;
+ max-width: 33.333333%;
+ }
+ .col-xl-5 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 41.666667%;
+ flex: 0 0 41.666667%;
+ max-width: 41.666667%;
+ }
+ .col-xl-6 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 50%;
+ flex: 0 0 50%;
+ max-width: 50%;
+ }
+ .col-xl-7 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 58.333333%;
+ flex: 0 0 58.333333%;
+ max-width: 58.333333%;
+ }
+ .col-xl-8 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 66.666667%;
+ flex: 0 0 66.666667%;
+ max-width: 66.666667%;
+ }
+ .col-xl-9 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 75%;
+ flex: 0 0 75%;
+ max-width: 75%;
+ }
+ .col-xl-10 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 83.333333%;
+ flex: 0 0 83.333333%;
+ max-width: 83.333333%;
+ }
+ .col-xl-11 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 91.666667%;
+ flex: 0 0 91.666667%;
+ max-width: 91.666667%;
+ }
+ .col-xl-12 {
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 100%;
+ flex: 0 0 100%;
+ max-width: 100%;
+ }
+ .order-xl-first {
+ -webkit-box-ordinal-group: 0;
+ -ms-flex-order: -1;
+ order: -1;
+ }
+ .order-xl-last {
+ -webkit-box-ordinal-group: 14;
+ -ms-flex-order: 13;
+ order: 13;
+ }
+ .order-xl-0 {
+ -webkit-box-ordinal-group: 1;
+ -ms-flex-order: 0;
+ order: 0;
+ }
+ .order-xl-1 {
+ -webkit-box-ordinal-group: 2;
+ -ms-flex-order: 1;
+ order: 1;
+ }
+ .order-xl-2 {
+ -webkit-box-ordinal-group: 3;
+ -ms-flex-order: 2;
+ order: 2;
+ }
+ .order-xl-3 {
+ -webkit-box-ordinal-group: 4;
+ -ms-flex-order: 3;
+ order: 3;
+ }
+ .order-xl-4 {
+ -webkit-box-ordinal-group: 5;
+ -ms-flex-order: 4;
+ order: 4;
+ }
+ .order-xl-5 {
+ -webkit-box-ordinal-group: 6;
+ -ms-flex-order: 5;
+ order: 5;
+ }
+ .order-xl-6 {
+ -webkit-box-ordinal-group: 7;
+ -ms-flex-order: 6;
+ order: 6;
+ }
+ .order-xl-7 {
+ -webkit-box-ordinal-group: 8;
+ -ms-flex-order: 7;
+ order: 7;
+ }
+ .order-xl-8 {
+ -webkit-box-ordinal-group: 9;
+ -ms-flex-order: 8;
+ order: 8;
+ }
+ .order-xl-9 {
+ -webkit-box-ordinal-group: 10;
+ -ms-flex-order: 9;
+ order: 9;
+ }
+ .order-xl-10 {
+ -webkit-box-ordinal-group: 11;
+ -ms-flex-order: 10;
+ order: 10;
+ }
+ .order-xl-11 {
+ -webkit-box-ordinal-group: 12;
+ -ms-flex-order: 11;
+ order: 11;
+ }
+ .order-xl-12 {
+ -webkit-box-ordinal-group: 13;
+ -ms-flex-order: 12;
+ order: 12;
+ }
+ .offset-xl-0 {
+ margin-left: 0;
+ }
+ .offset-xl-1 {
+ margin-left: 8.333333%;
+ }
+ .offset-xl-2 {
+ margin-left: 16.666667%;
+ }
+ .offset-xl-3 {
+ margin-left: 25%;
+ }
+ .offset-xl-4 {
+ margin-left: 33.333333%;
+ }
+ .offset-xl-5 {
+ margin-left: 41.666667%;
+ }
+ .offset-xl-6 {
+ margin-left: 50%;
+ }
+ .offset-xl-7 {
+ margin-left: 58.333333%;
+ }
+ .offset-xl-8 {
+ margin-left: 66.666667%;
+ }
+ .offset-xl-9 {
+ margin-left: 75%;
+ }
+ .offset-xl-10 {
+ margin-left: 83.333333%;
+ }
+ .offset-xl-11 {
+ margin-left: 91.666667%;
+ }
+}
+
+.table {
+ width: 100%;
+ max-width: 100%;
+ margin-bottom: 1rem;
+ background-color: transparent;
+}
+
+.table th,
+.table td {
+ padding: 0.75rem;
+ vertical-align: top;
+ border-top: 1px solid #dee2e6;
+}
+
+.table thead th {
+ vertical-align: bottom;
+ border-bottom: 2px solid #dee2e6;
+}
+
+.table tbody + tbody {
+ border-top: 2px solid #dee2e6;
+}
+
+.table .table {
+ background-color: #fff;
+}
+
+.table-sm th,
+.table-sm td {
+ padding: 0.3rem;
+}
+
+.table-bordered {
+ border: 1px solid #dee2e6;
+}
+
+.table-bordered th,
+.table-bordered td {
+ border: 1px solid #dee2e6;
+}
+
+.table-bordered thead th,
+.table-bordered thead td {
+ border-bottom-width: 2px;
+}
+
+.table-striped tbody tr:nth-of-type(odd) {
+ background-color: rgba(0, 0, 0, 0.05);
+}
+
+.table-hover tbody tr:hover {
+ background-color: rgba(0, 0, 0, 0.075);
+}
+
+.table-primary,
+.table-primary > th,
+.table-primary > td {
+ background-color: #b8daff;
+}
+
+.table-hover .table-primary:hover {
+ background-color: #9fcdff;
+}
+
+.table-hover .table-primary:hover > td,
+.table-hover .table-primary:hover > th {
+ background-color: #9fcdff;
+}
+
+.table-secondary,
+.table-secondary > th,
+.table-secondary > td {
+ background-color: #d6d8db;
+}
+
+.table-hover .table-secondary:hover {
+ background-color: #c8cbcf;
+}
+
+.table-hover .table-secondary:hover > td,
+.table-hover .table-secondary:hover > th {
+ background-color: #c8cbcf;
+}
+
+.table-success,
+.table-success > th,
+.table-success > td {
+ background-color: #c3e6cb;
+}
+
+.table-hover .table-success:hover {
+ background-color: #b1dfbb;
+}
+
+.table-hover .table-success:hover > td,
+.table-hover .table-success:hover > th {
+ background-color: #b1dfbb;
+}
+
+.table-info,
+.table-info > th,
+.table-info > td {
+ background-color: #bee5eb;
+}
+
+.table-hover .table-info:hover {
+ background-color: #abdde5;
+}
+
+.table-hover .table-info:hover > td,
+.table-hover .table-info:hover > th {
+ background-color: #abdde5;
+}
+
+.table-warning,
+.table-warning > th,
+.table-warning > td {
+ background-color: #ffeeba;
+}
+
+.table-hover .table-warning:hover {
+ background-color: #ffe8a1;
+}
+
+.table-hover .table-warning:hover > td,
+.table-hover .table-warning:hover > th {
+ background-color: #ffe8a1;
+}
+
+.table-danger,
+.table-danger > th,
+.table-danger > td {
+ background-color: #f5c6cb;
+}
+
+.table-hover .table-danger:hover {
+ background-color: #f1b0b7;
+}
+
+.table-hover .table-danger:hover > td,
+.table-hover .table-danger:hover > th {
+ background-color: #f1b0b7;
+}
+
+.table-light,
+.table-light > th,
+.table-light > td {
+ background-color: #fdfdfe;
+}
+
+.table-hover .table-light:hover {
+ background-color: #ececf6;
+}
+
+.table-hover .table-light:hover > td,
+.table-hover .table-light:hover > th {
+ background-color: #ececf6;
+}
+
+.table-dark,
+.table-dark > th,
+.table-dark > td {
+ background-color: #c6c8ca;
+}
+
+.table-hover .table-dark:hover {
+ background-color: #b9bbbe;
+}
+
+.table-hover .table-dark:hover > td,
+.table-hover .table-dark:hover > th {
+ background-color: #b9bbbe;
+}
+
+.table-active,
+.table-active > th,
+.table-active > td {
+ background-color: rgba(0, 0, 0, 0.075);
+}
+
+.table-hover .table-active:hover {
+ background-color: rgba(0, 0, 0, 0.075);
+}
+
+.table-hover .table-active:hover > td,
+.table-hover .table-active:hover > th {
+ background-color: rgba(0, 0, 0, 0.075);
+}
+
+.table .thead-dark th {
+ color: #fff;
+ background-color: #212529;
+ border-color: #32383e;
+}
+
+.table .thead-light th {
+ color: #495057;
+ background-color: #e9ecef;
+ border-color: #dee2e6;
+}
+
+.table-dark {
+ color: #fff;
+ background-color: #212529;
+}
+
+.table-dark th,
+.table-dark td,
+.table-dark thead th {
+ border-color: #32383e;
+}
+
+.table-dark.table-bordered {
+ border: 0;
+}
+
+.table-dark.table-striped tbody tr:nth-of-type(odd) {
+ background-color: rgba(255, 255, 255, 0.05);
+}
+
+.table-dark.table-hover tbody tr:hover {
+ background-color: rgba(255, 255, 255, 0.075);
+}
+
+@media (max-width: 575.98px) {
+ .table-responsive-sm {
+ display: block;
+ width: 100%;
+ overflow-x: auto;
+ -webkit-overflow-scrolling: touch;
+ -ms-overflow-style: -ms-autohiding-scrollbar;
+ }
+ .table-responsive-sm > .table-bordered {
+ border: 0;
+ }
+}
+
+@media (max-width: 767.98px) {
+ .table-responsive-md {
+ display: block;
+ width: 100%;
+ overflow-x: auto;
+ -webkit-overflow-scrolling: touch;
+ -ms-overflow-style: -ms-autohiding-scrollbar;
+ }
+ .table-responsive-md > .table-bordered {
+ border: 0;
+ }
+}
+
+@media (max-width: 991.98px) {
+ .table-responsive-lg {
+ display: block;
+ width: 100%;
+ overflow-x: auto;
+ -webkit-overflow-scrolling: touch;
+ -ms-overflow-style: -ms-autohiding-scrollbar;
+ }
+ .table-responsive-lg > .table-bordered {
+ border: 0;
+ }
+}
+
+@media (max-width: 1199.98px) {
+ .table-responsive-xl {
+ display: block;
+ width: 100%;
+ overflow-x: auto;
+ -webkit-overflow-scrolling: touch;
+ -ms-overflow-style: -ms-autohiding-scrollbar;
+ }
+ .table-responsive-xl > .table-bordered {
+ border: 0;
+ }
+}
+
+.table-responsive {
+ display: block;
+ width: 100%;
+ overflow-x: auto;
+ -webkit-overflow-scrolling: touch;
+ -ms-overflow-style: -ms-autohiding-scrollbar;
+}
+
+.table-responsive > .table-bordered {
+ border: 0;
+}
+
+.form-control {
+ display: block;
+ width: 100%;
+ padding: 0.375rem 0.75rem;
+ font-size: 1rem;
+ line-height: 1.5;
+ color: #495057;
+ background-color: #fff;
+ background-clip: padding-box;
+ border: 1px solid #ced4da;
+ border-radius: 0.25rem;
+ transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
+}
+
+.form-control::-ms-expand {
+ background-color: transparent;
+ border: 0;
+}
+
+.form-control:focus {
+ color: #495057;
+ background-color: #fff;
+ border-color: #80bdff;
+ outline: 0;
+ box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
+}
+
+.form-control::-webkit-input-placeholder {
+ color: #6c757d;
+ opacity: 1;
+}
+
+.form-control::-moz-placeholder {
+ color: #6c757d;
+ opacity: 1;
+}
+
+.form-control:-ms-input-placeholder {
+ color: #6c757d;
+ opacity: 1;
+}
+
+.form-control::-ms-input-placeholder {
+ color: #6c757d;
+ opacity: 1;
+}
+
+.form-control::placeholder {
+ color: #6c757d;
+ opacity: 1;
+}
+
+.form-control:disabled, .form-control[readonly] {
+ background-color: #e9ecef;
+ opacity: 1;
+}
+
+select.form-control:not([size]):not([multiple]) {
+ height: calc(2.25rem + 2px);
+}
+
+select.form-control:focus::-ms-value {
+ color: #495057;
+ background-color: #fff;
+}
+
+.form-control-file,
+.form-control-range {
+ display: block;
+ width: 100%;
+}
+
+.col-form-label {
+ padding-top: calc(0.375rem + 1px);
+ padding-bottom: calc(0.375rem + 1px);
+ margin-bottom: 0;
+ font-size: inherit;
+ line-height: 1.5;
+}
+
+.col-form-label-lg {
+ padding-top: calc(0.5rem + 1px);
+ padding-bottom: calc(0.5rem + 1px);
+ font-size: 1.25rem;
+ line-height: 1.5;
+}
+
+.col-form-label-sm {
+ padding-top: calc(0.25rem + 1px);
+ padding-bottom: calc(0.25rem + 1px);
+ font-size: 0.875rem;
+ line-height: 1.5;
+}
+
+.form-control-plaintext {
+ display: block;
+ width: 100%;
+ padding-top: 0.375rem;
+ padding-bottom: 0.375rem;
+ margin-bottom: 0;
+ line-height: 1.5;
+ background-color: transparent;
+ border: solid transparent;
+ border-width: 1px 0;
+}
+
+.form-control-plaintext.form-control-sm, .input-group-sm > .form-control-plaintext.form-control,
+.input-group-sm > .input-group-prepend > .form-control-plaintext.input-group-text,
+.input-group-sm > .input-group-append > .form-control-plaintext.input-group-text,
+.input-group-sm > .input-group-prepend > .form-control-plaintext.btn,
+.input-group-sm > .input-group-append > .form-control-plaintext.btn, .form-control-plaintext.form-control-lg, .input-group-lg > .form-control-plaintext.form-control,
+.input-group-lg > .input-group-prepend > .form-control-plaintext.input-group-text,
+.input-group-lg > .input-group-append > .form-control-plaintext.input-group-text,
+.input-group-lg > .input-group-prepend > .form-control-plaintext.btn,
+.input-group-lg > .input-group-append > .form-control-plaintext.btn {
+ padding-right: 0;
+ padding-left: 0;
+}
+
+.form-control-sm, .input-group-sm > .form-control,
+.input-group-sm > .input-group-prepend > .input-group-text,
+.input-group-sm > .input-group-append > .input-group-text,
+.input-group-sm > .input-group-prepend > .btn,
+.input-group-sm > .input-group-append > .btn {
+ padding: 0.25rem 0.5rem;
+ font-size: 0.875rem;
+ line-height: 1.5;
+ border-radius: 0.2rem;
+}
+
+select.form-control-sm:not([size]):not([multiple]), .input-group-sm > select.form-control:not([size]):not([multiple]),
+.input-group-sm > .input-group-prepend > select.input-group-text:not([size]):not([multiple]),
+.input-group-sm > .input-group-append > select.input-group-text:not([size]):not([multiple]),
+.input-group-sm > .input-group-prepend > select.btn:not([size]):not([multiple]),
+.input-group-sm > .input-group-append > select.btn:not([size]):not([multiple]) {
+ height: calc(1.8125rem + 2px);
+}
+
+.form-control-lg, .input-group-lg > .form-control,
+.input-group-lg > .input-group-prepend > .input-group-text,
+.input-group-lg > .input-group-append > .input-group-text,
+.input-group-lg > .input-group-prepend > .btn,
+.input-group-lg > .input-group-append > .btn {
+ padding: 0.5rem 1rem;
+ font-size: 1.25rem;
+ line-height: 1.5;
+ border-radius: 0.3rem;
+}
+
+select.form-control-lg:not([size]):not([multiple]), .input-group-lg > select.form-control:not([size]):not([multiple]),
+.input-group-lg > .input-group-prepend > select.input-group-text:not([size]):not([multiple]),
+.input-group-lg > .input-group-append > select.input-group-text:not([size]):not([multiple]),
+.input-group-lg > .input-group-prepend > select.btn:not([size]):not([multiple]),
+.input-group-lg > .input-group-append > select.btn:not([size]):not([multiple]) {
+ height: calc(2.875rem + 2px);
+}
+
+.form-group {
+ margin-bottom: 1rem;
+}
+
+.form-text {
+ display: block;
+ margin-top: 0.25rem;
+}
+
+.form-row {
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -ms-flex-wrap: wrap;
+ flex-wrap: wrap;
+ margin-right: -5px;
+ margin-left: -5px;
+}
+
+.form-row > .col,
+.form-row > [class*="col-"] {
+ padding-right: 5px;
+ padding-left: 5px;
+}
+
+.form-check {
+ position: relative;
+ display: block;
+ padding-left: 1.25rem;
+}
+
+.form-check-input {
+ position: absolute;
+ margin-top: 0.3rem;
+ margin-left: -1.25rem;
+}
+
+.form-check-input:disabled ~ .form-check-label {
+ color: #6c757d;
+}
+
+.form-check-label {
+ margin-bottom: 0;
+}
+
+.form-check-inline {
+ display: -webkit-inline-box;
+ display: -ms-inline-flexbox;
+ display: inline-flex;
+ -webkit-box-align: center;
+ -ms-flex-align: center;
+ align-items: center;
+ padding-left: 0;
+ margin-right: 0.75rem;
+}
+
+.form-check-inline .form-check-input {
+ position: static;
+ margin-top: 0;
+ margin-right: 0.3125rem;
+ margin-left: 0;
+}
+
+.valid-feedback {
+ display: none;
+ width: 100%;
+ margin-top: 0.25rem;
+ font-size: 80%;
+ color: #28a745;
+}
+
+.valid-tooltip {
+ position: absolute;
+ top: 100%;
+ z-index: 5;
+ display: none;
+ max-width: 100%;
+ padding: .5rem;
+ margin-top: .1rem;
+ font-size: .875rem;
+ line-height: 1;
+ color: #fff;
+ background-color: rgba(40, 167, 69, 0.8);
+ border-radius: .2rem;
+}
+
+.was-validated .form-control:valid, .form-control.is-valid, .was-validated
+.custom-select:valid,
+.custom-select.is-valid {
+ border-color: #28a745;
+}
+
+.was-validated .form-control:valid:focus, .form-control.is-valid:focus, .was-validated
+.custom-select:valid:focus,
+.custom-select.is-valid:focus {
+ border-color: #28a745;
+ box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.25);
+}
+
+.was-validated .form-control:valid ~ .valid-feedback,
+.was-validated .form-control:valid ~ .valid-tooltip, .form-control.is-valid ~ .valid-feedback,
+.form-control.is-valid ~ .valid-tooltip, .was-validated
+.custom-select:valid ~ .valid-feedback,
+.was-validated
+.custom-select:valid ~ .valid-tooltip,
+.custom-select.is-valid ~ .valid-feedback,
+.custom-select.is-valid ~ .valid-tooltip {
+ display: block;
+}
+
+.was-validated .form-check-input:valid ~ .form-check-label, .form-check-input.is-valid ~ .form-check-label {
+ color: #28a745;
+}
+
+.was-validated .form-check-input:valid ~ .valid-feedback,
+.was-validated .form-check-input:valid ~ .valid-tooltip, .form-check-input.is-valid ~ .valid-feedback,
+.form-check-input.is-valid ~ .valid-tooltip {
+ display: block;
+}
+
+.was-validated .custom-control-input:valid ~ .custom-control-label, .custom-control-input.is-valid ~ .custom-control-label {
+ color: #28a745;
+}
+
+.was-validated .custom-control-input:valid ~ .custom-control-label::before, .custom-control-input.is-valid ~ .custom-control-label::before {
+ background-color: #71dd8a;
+}
+
+.was-validated .custom-control-input:valid ~ .valid-feedback,
+.was-validated .custom-control-input:valid ~ .valid-tooltip, .custom-control-input.is-valid ~ .valid-feedback,
+.custom-control-input.is-valid ~ .valid-tooltip {
+ display: block;
+}
+
+.was-validated .custom-control-input:valid:checked ~ .custom-control-label::before, .custom-control-input.is-valid:checked ~ .custom-control-label::before {
+ background-color: #34ce57;
+}
+
+.was-validated .custom-control-input:valid:focus ~ .custom-control-label::before, .custom-control-input.is-valid:focus ~ .custom-control-label::before {
+ box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(40, 167, 69, 0.25);
+}
+
+.was-validated .custom-file-input:valid ~ .custom-file-label, .custom-file-input.is-valid ~ .custom-file-label {
+ border-color: #28a745;
+}
+
+.was-validated .custom-file-input:valid ~ .custom-file-label::before, .custom-file-input.is-valid ~ .custom-file-label::before {
+ border-color: inherit;
+}
+
+.was-validated .custom-file-input:valid ~ .valid-feedback,
+.was-validated .custom-file-input:valid ~ .valid-tooltip, .custom-file-input.is-valid ~ .valid-feedback,
+.custom-file-input.is-valid ~ .valid-tooltip {
+ display: block;
+}
+
+.was-validated .custom-file-input:valid:focus ~ .custom-file-label, .custom-file-input.is-valid:focus ~ .custom-file-label {
+ box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.25);
+}
+
+.invalid-feedback {
+ display: none;
+ width: 100%;
+ margin-top: 0.25rem;
+ font-size: 80%;
+ color: #dc3545;
+}
+
+.invalid-tooltip {
+ position: absolute;
+ top: 100%;
+ z-index: 5;
+ display: none;
+ max-width: 100%;
+ padding: .5rem;
+ margin-top: .1rem;
+ font-size: .875rem;
+ line-height: 1;
+ color: #fff;
+ background-color: rgba(220, 53, 69, 0.8);
+ border-radius: .2rem;
+}
+
+.was-validated .form-control:invalid, .form-control.is-invalid, .was-validated
+.custom-select:invalid,
+.custom-select.is-invalid {
+ border-color: #dc3545;
+}
+
+.was-validated .form-control:invalid:focus, .form-control.is-invalid:focus, .was-validated
+.custom-select:invalid:focus,
+.custom-select.is-invalid:focus {
+ border-color: #dc3545;
+ box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.25);
+}
+
+.was-validated .form-control:invalid ~ .invalid-feedback,
+.was-validated .form-control:invalid ~ .invalid-tooltip, .form-control.is-invalid ~ .invalid-feedback,
+.form-control.is-invalid ~ .invalid-tooltip, .was-validated
+.custom-select:invalid ~ .invalid-feedback,
+.was-validated
+.custom-select:invalid ~ .invalid-tooltip,
+.custom-select.is-invalid ~ .invalid-feedback,
+.custom-select.is-invalid ~ .invalid-tooltip {
+ display: block;
+}
+
+.was-validated .form-check-input:invalid ~ .form-check-label, .form-check-input.is-invalid ~ .form-check-label {
+ color: #dc3545;
+}
+
+.was-validated .form-check-input:invalid ~ .invalid-feedback,
+.was-validated .form-check-input:invalid ~ .invalid-tooltip, .form-check-input.is-invalid ~ .invalid-feedback,
+.form-check-input.is-invalid ~ .invalid-tooltip {
+ display: block;
+}
+
+.was-validated .custom-control-input:invalid ~ .custom-control-label, .custom-control-input.is-invalid ~ .custom-control-label {
+ color: #dc3545;
+}
+
+.was-validated .custom-control-input:invalid ~ .custom-control-label::before, .custom-control-input.is-invalid ~ .custom-control-label::before {
+ background-color: #efa2a9;
+}
+
+.was-validated .custom-control-input:invalid ~ .invalid-feedback,
+.was-validated .custom-control-input:invalid ~ .invalid-tooltip, .custom-control-input.is-invalid ~ .invalid-feedback,
+.custom-control-input.is-invalid ~ .invalid-tooltip {
+ display: block;
+}
+
+.was-validated .custom-control-input:invalid:checked ~ .custom-control-label::before, .custom-control-input.is-invalid:checked ~ .custom-control-label::before {
+ background-color: #e4606d;
+}
+
+.was-validated .custom-control-input:invalid:focus ~ .custom-control-label::before, .custom-control-input.is-invalid:focus ~ .custom-control-label::before {
+ box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(220, 53, 69, 0.25);
+}
+
+.was-validated .custom-file-input:invalid ~ .custom-file-label, .custom-file-input.is-invalid ~ .custom-file-label {
+ border-color: #dc3545;
+}
+
+.was-validated .custom-file-input:invalid ~ .custom-file-label::before, .custom-file-input.is-invalid ~ .custom-file-label::before {
+ border-color: inherit;
+}
+
+.was-validated .custom-file-input:invalid ~ .invalid-feedback,
+.was-validated .custom-file-input:invalid ~ .invalid-tooltip, .custom-file-input.is-invalid ~ .invalid-feedback,
+.custom-file-input.is-invalid ~ .invalid-tooltip {
+ display: block;
+}
+
+.was-validated .custom-file-input:invalid:focus ~ .custom-file-label, .custom-file-input.is-invalid:focus ~ .custom-file-label {
+ box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.25);
+}
+
+.form-inline {
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -webkit-box-orient: horizontal;
+ -webkit-box-direction: normal;
+ -ms-flex-flow: row wrap;
+ flex-flow: row wrap;
+ -webkit-box-align: center;
+ -ms-flex-align: center;
+ align-items: center;
+}
+
+.form-inline .form-check {
+ width: 100%;
+}
+
+@media (min-width: 576px) {
+ .form-inline label {
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -webkit-box-align: center;
+ -ms-flex-align: center;
+ align-items: center;
+ -webkit-box-pack: center;
+ -ms-flex-pack: center;
+ justify-content: center;
+ margin-bottom: 0;
+ }
+ .form-inline .form-group {
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -webkit-box-flex: 0;
+ -ms-flex: 0 0 auto;
+ flex: 0 0 auto;
+ -webkit-box-orient: horizontal;
+ -webkit-box-direction: normal;
+ -ms-flex-flow: row wrap;
+ flex-flow: row wrap;
+ -webkit-box-align: center;
+ -ms-flex-align: center;
+ align-items: center;
+ margin-bottom: 0;
+ }
+ .form-inline .form-control {
+ display: inline-block;
+ width: auto;
+ vertical-align: middle;
+ }
+ .form-inline .form-control-plaintext {
+ display: inline-block;
+ }
+ .form-inline .input-group {
+ width: auto;
+ }
+ .form-inline .form-check {
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -webkit-box-align: center;
+ -ms-flex-align: center;
+ align-items: center;
+ -webkit-box-pack: center;
+ -ms-flex-pack: center;
+ justify-content: center;
+ width: auto;
+ padding-left: 0;
+ }
+ .form-inline .form-check-input {
+ position: relative;
+ margin-top: 0;
+ margin-right: 0.25rem;
+ margin-left: 0;
+ }
+ .form-inline .custom-control {
+ -webkit-box-align: center;
+ -ms-flex-align: center;
+ align-items: center;
+ -webkit-box-pack: center;
+ -ms-flex-pack: center;
+ justify-content: center;
+ }
+ .form-inline .custom-control-label {
+ margin-bottom: 0;
+ }
+}
+
+.btn {
+ display: inline-block;
+ font-weight: 400;
+ text-align: center;
+ white-space: nowrap;
+ vertical-align: middle;
+ -webkit-user-select: none;
+ -moz-user-select: none;
+ -ms-user-select: none;
+ user-select: none;
+ border: 1px solid transparent;
+ padding: 0.375rem 0.75rem;
+ font-size: 1rem;
+ line-height: 1.5;
+ border-radius: 0.25rem;
+ transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
+}
+
+.btn:hover, .btn:focus {
+ text-decoration: none;
+}
+
+.btn:focus, .btn.focus {
+ outline: 0;
+ box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
+}
+
+.btn.disabled, .btn:disabled {
+ opacity: 0.65;
+}
+
+.btn:not(:disabled):not(.disabled) {
+ cursor: pointer;
+}
+
+.btn:not(:disabled):not(.disabled):active, .btn:not(:disabled):not(.disabled).active {
+ background-image: none;
+}
+
+a.btn.disabled,
+fieldset:disabled a.btn {
+ pointer-events: none;
+}
+
+.btn-primary {
+ color: #fff;
+ background-color: #007bff;
+ border-color: #007bff;
+}
+
+.btn-primary:hover {
+ color: #fff;
+ background-color: #0069d9;
+ border-color: #0062cc;
+}
+
+.btn-primary:focus, .btn-primary.focus {
+ box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.5);
+}
+
+.btn-primary.disabled, .btn-primary:disabled {
+ color: #fff;
+ background-color: #007bff;
+ border-color: #007bff;
+}
+
+.btn-primary:not(:disabled):not(.disabled):active, .btn-primary:not(:disabled):not(.disabled).active,
+.show > .btn-primary.dropdown-toggle {
+ color: #fff;
+ background-color: #0062cc;
+ border-color: #005cbf;
+}
+
+.btn-primary:not(:disabled):not(.disabled):active:focus, .btn-primary:not(:disabled):not(.disabled).active:focus,
+.show > .btn-primary.dropdown-toggle:focus {
+ box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.5);
+}
+
+.btn-secondary {
+ color: #fff;
+ background-color: #6c757d;
+ border-color: #6c757d;
+}
+
+.btn-secondary:hover {
+ color: #fff;
+ background-color: #5a6268;
+ border-color: #545b62;
+}
+
+.btn-secondary:focus, .btn-secondary.focus {
+ box-shadow: 0 0 0 0.2rem rgba(108, 117, 125, 0.5);
+}
+
+.btn-secondary.disabled, .btn-secondary:disabled {
+ color: #fff;
+ background-color: #6c757d;
+ border-color: #6c757d;
+}
+
+.btn-secondary:not(:disabled):not(.disabled):active, .btn-secondary:not(:disabled):not(.disabled).active,
+.show > .btn-secondary.dropdown-toggle {
+ color: #fff;
+ background-color: #545b62;
+ border-color: #4e555b;
+}
+
+.btn-secondary:not(:disabled):not(.disabled):active:focus, .btn-secondary:not(:disabled):not(.disabled).active:focus,
+.show > .btn-secondary.dropdown-toggle:focus {
+ box-shadow: 0 0 0 0.2rem rgba(108, 117, 125, 0.5);
+}
+
+.btn-success {
+ color: #fff;
+ background-color: #28a745;
+ border-color: #28a745;
+}
+
+.btn-success:hover {
+ color: #fff;
+ background-color: #218838;
+ border-color: #1e7e34;
+}
+
+.btn-success:focus, .btn-success.focus {
+ box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.5);
+}
+
+.btn-success.disabled, .btn-success:disabled {
+ color: #fff;
+ background-color: #28a745;
+ border-color: #28a745;
+}
+
+.btn-success:not(:disabled):not(.disabled):active, .btn-success:not(:disabled):not(.disabled).active,
+.show > .btn-success.dropdown-toggle {
+ color: #fff;
+ background-color: #1e7e34;
+ border-color: #1c7430;
+}
+
+.btn-success:not(:disabled):not(.disabled):active:focus, .btn-success:not(:disabled):not(.disabled).active:focus,
+.show > .btn-success.dropdown-toggle:focus {
+ box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.5);
+}
+
+.btn-info {
+ color: #fff;
+ background-color: #17a2b8;
+ border-color: #17a2b8;
+}
+
+.btn-info:hover {
+ color: #fff;
+ background-color: #138496;
+ border-color: #117a8b;
+}
+
+.btn-info:focus, .btn-info.focus {
+ box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5);
+}
+
+.btn-info.disabled, .btn-info:disabled {
+ color: #fff;
+ background-color: #17a2b8;
+ border-color: #17a2b8;
+}
+
+.btn-info:not(:disabled):not(.disabled):active, .btn-info:not(:disabled):not(.disabled).active,
+.show > .btn-info.dropdown-toggle {
+ color: #fff;
+ background-color: #117a8b;
+ border-color: #10707f;
+}
+
+.btn-info:not(:disabled):not(.disabled):active:focus, .btn-info:not(:disabled):not(.disabled).active:focus,
+.show > .btn-info.dropdown-toggle:focus {
+ box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5);
+}
+
+.btn-warning {
+ color: #212529;
+ background-color: #ffc107;
+ border-color: #ffc107;
+}
+
+.btn-warning:hover {
+ color: #212529;
+ background-color: #e0a800;
+ border-color: #d39e00;
+}
+
+.btn-warning:focus, .btn-warning.focus {
+ box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.5);
+}
+
+.btn-warning.disabled, .btn-warning:disabled {
+ color: #212529;
+ background-color: #ffc107;
+ border-color: #ffc107;
+}
+
+.btn-warning:not(:disabled):not(.disabled):active, .btn-warning:not(:disabled):not(.disabled).active,
+.show > .btn-warning.dropdown-toggle {
+ color: #212529;
+ background-color: #d39e00;
+ border-color: #c69500;
+}
+
+.btn-warning:not(:disabled):not(.disabled):active:focus, .btn-warning:not(:disabled):not(.disabled).active:focus,
+.show > .btn-warning.dropdown-toggle:focus {
+ box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.5);
+}
+
+.btn-danger {
+ color: #fff;
+ background-color: #dc3545;
+ border-color: #dc3545;
+}
+
+.btn-danger:hover {
+ color: #fff;
+ background-color: #c82333;
+ border-color: #bd2130;
+}
+
+.btn-danger:focus, .btn-danger.focus {
+ box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.5);
+}
+
+.btn-danger.disabled, .btn-danger:disabled {
+ color: #fff;
+ background-color: #dc3545;
+ border-color: #dc3545;
+}
+
+.btn-danger:not(:disabled):not(.disabled):active, .btn-danger:not(:disabled):not(.disabled).active,
+.show > .btn-danger.dropdown-toggle {
+ color: #fff;
+ background-color: #bd2130;
+ border-color: #b21f2d;
+}
+
+.btn-danger:not(:disabled):not(.disabled):active:focus, .btn-danger:not(:disabled):not(.disabled).active:focus,
+.show > .btn-danger.dropdown-toggle:focus {
+ box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.5);
+}
+
+.btn-light {
+ color: #212529;
+ background-color: #f8f9fa;
+ border-color: #f8f9fa;
+}
+
+.btn-light:hover {
+ color: #212529;
+ background-color: #e2e6ea;
+ border-color: #dae0e5;
+}
+
+.btn-light:focus, .btn-light.focus {
+ box-shadow: 0 0 0 0.2rem rgba(248, 249, 250, 0.5);
+}
+
+.btn-light.disabled, .btn-light:disabled {
+ color: #212529;
+ background-color: #f8f9fa;
+ border-color: #f8f9fa;
+}
+
+.btn-light:not(:disabled):not(.disabled):active, .btn-light:not(:disabled):not(.disabled).active,
+.show > .btn-light.dropdown-toggle {
+ color: #212529;
+ background-color: #dae0e5;
+ border-color: #d3d9df;
+}
+
+.btn-light:not(:disabled):not(.disabled):active:focus, .btn-light:not(:disabled):not(.disabled).active:focus,
+.show > .btn-light.dropdown-toggle:focus {
+ box-shadow: 0 0 0 0.2rem rgba(248, 249, 250, 0.5);
+}
+
+.btn-dark {
+ color: #fff;
+ background-color: #343a40;
+ border-color: #343a40;
+}
+
+.btn-dark:hover {
+ color: #fff;
+ background-color: #23272b;
+ border-color: #1d2124;
+}
+
+.btn-dark:focus, .btn-dark.focus {
+ box-shadow: 0 0 0 0.2rem rgba(52, 58, 64, 0.5);
+}
+
+.btn-dark.disabled, .btn-dark:disabled {
+ color: #fff;
+ background-color: #343a40;
+ border-color: #343a40;
+}
+
+.btn-dark:not(:disabled):not(.disabled):active, .btn-dark:not(:disabled):not(.disabled).active,
+.show > .btn-dark.dropdown-toggle {
+ color: #fff;
+ background-color: #1d2124;
+ border-color: #171a1d;
+}
+
+.btn-dark:not(:disabled):not(.disabled):active:focus, .btn-dark:not(:disabled):not(.disabled).active:focus,
+.show > .btn-dark.dropdown-toggle:focus {
+ box-shadow: 0 0 0 0.2rem rgba(52, 58, 64, 0.5);
+}
+
+.btn-outline-primary {
+ color: #007bff;
+ background-color: transparent;
+ background-image: none;
+ border-color: #007bff;
+}
+
+.btn-outline-primary:hover {
+ color: #fff;
+ background-color: #007bff;
+ border-color: #007bff;
+}
+
+.btn-outline-primary:focus, .btn-outline-primary.focus {
+ box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.5);
+}
+
+.btn-outline-primary.disabled, .btn-outline-primary:disabled {
+ color: #007bff;
+ background-color: transparent;
+}
+
+.btn-outline-primary:not(:disabled):not(.disabled):active, .btn-outline-primary:not(:disabled):not(.disabled).active,
+.show > .btn-outline-primary.dropdown-toggle {
+ color: #fff;
+ background-color: #007bff;
+ border-color: #007bff;
+}
+
+.btn-outline-primary:not(:disabled):not(.disabled):active:focus, .btn-outline-primary:not(:disabled):not(.disabled).active:focus,
+.show > .btn-outline-primary.dropdown-toggle:focus {
+ box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.5);
+}
+
+.btn-outline-secondary {
+ color: #6c757d;
+ background-color: transparent;
+ background-image: none;
+ border-color: #6c757d;
+}
+
+.btn-outline-secondary:hover {
+ color: #fff;
+ background-color: #6c757d;
+ border-color: #6c757d;
+}
+
+.btn-outline-secondary:focus, .btn-outline-secondary.focus {
+ box-shadow: 0 0 0 0.2rem rgba(108, 117, 125, 0.5);
+}
+
+.btn-outline-secondary.disabled, .btn-outline-secondary:disabled {
+ color: #6c757d;
+ background-color: transparent;
+}
+
+.btn-outline-secondary:not(:disabled):not(.disabled):active, .btn-outline-secondary:not(:disabled):not(.disabled).active,
+.show > .btn-outline-secondary.dropdown-toggle {
+ color: #fff;
+ background-color: #6c757d;
+ border-color: #6c757d;
+}
+
+.btn-outline-secondary:not(:disabled):not(.disabled):active:focus, .btn-outline-secondary:not(:disabled):not(.disabled).active:focus,
+.show > .btn-outline-secondary.dropdown-toggle:focus {
+ box-shadow: 0 0 0 0.2rem rgba(108, 117, 125, 0.5);
+}
+
+.btn-outline-success {
+ color: #28a745;
+ background-color: transparent;
+ background-image: none;
+ border-color: #28a745;
+}
+
+.btn-outline-success:hover {
+ color: #fff;
+ background-color: #28a745;
+ border-color: #28a745;
+}
+
+.btn-outline-success:focus, .btn-outline-success.focus {
+ box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.5);
+}
+
+.btn-outline-success.disabled, .btn-outline-success:disabled {
+ color: #28a745;
+ background-color: transparent;
+}
+
+.btn-outline-success:not(:disabled):not(.disabled):active, .btn-outline-success:not(:disabled):not(.disabled).active,
+.show > .btn-outline-success.dropdown-toggle {
+ color: #fff;
+ background-color: #28a745;
+ border-color: #28a745;
+}
+
+.btn-outline-success:not(:disabled):not(.disabled):active:focus, .btn-outline-success:not(:disabled):not(.disabled).active:focus,
+.show > .btn-outline-success.dropdown-toggle:focus {
+ box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.5);
+}
+
+.btn-outline-info {
+ color: #17a2b8;
+ background-color: transparent;
+ background-image: none;
+ border-color: #17a2b8;
+}
+
+.btn-outline-info:hover {
+ color: #fff;
+ background-color: #17a2b8;
+ border-color: #17a2b8;
+}
+
+.btn-outline-info:focus, .btn-outline-info.focus {
+ box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5);
+}
+
+.btn-outline-info.disabled, .btn-outline-info:disabled {
+ color: #17a2b8;
+ background-color: transparent;
+}
+
+.btn-outline-info:not(:disabled):not(.disabled):active, .btn-outline-info:not(:disabled):not(.disabled).active,
+.show > .btn-outline-info.dropdown-toggle {
+ color: #fff;
+ background-color: #17a2b8;
+ border-color: #17a2b8;
+}
+
+.btn-outline-info:not(:disabled):not(.disabled):active:focus, .btn-outline-info:not(:disabled):not(.disabled).active:focus,
+.show > .btn-outline-info.dropdown-toggle:focus {
+ box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5);
+}
+
+.btn-outline-warning {
+ color: #ffc107;
+ background-color: transparent;
+ background-image: none;
+ border-color: #ffc107;
+}
+
+.btn-outline-warning:hover {
+ color: #212529;
+ background-color: #ffc107;
+ border-color: #ffc107;
+}
+
+.btn-outline-warning:focus, .btn-outline-warning.focus {
+ box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.5);
+}
+
+.btn-outline-warning.disabled, .btn-outline-warning:disabled {
+ color: #ffc107;
+ background-color: transparent;
+}
+
+.btn-outline-warning:not(:disabled):not(.disabled):active, .btn-outline-warning:not(:disabled):not(.disabled).active,
+.show > .btn-outline-warning.dropdown-toggle {
+ color: #212529;
+ background-color: #ffc107;
+ border-color: #ffc107;
+}
+
+.btn-outline-warning:not(:disabled):not(.disabled):active:focus, .btn-outline-warning:not(:disabled):not(.disabled).active:focus,
+.show > .btn-outline-warning.dropdown-toggle:focus {
+ box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.5);
+}
+
+.btn-outline-danger {
+ color: #dc3545;
+ background-color: transparent;
+ background-image: none;
+ border-color: #dc3545;
+}
+
+.btn-outline-danger:hover {
+ color: #fff;
+ background-color: #dc3545;
+ border-color: #dc3545;
+}
+
+.btn-outline-danger:focus, .btn-outline-danger.focus {
+ box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.5);
+}
+
+.btn-outline-danger.disabled, .btn-outline-danger:disabled {
+ color: #dc3545;
+ background-color: transparent;
+}
+
+.btn-outline-danger:not(:disabled):not(.disabled):active, .btn-outline-danger:not(:disabled):not(.disabled).active,
+.show > .btn-outline-danger.dropdown-toggle {
+ color: #fff;
+ background-color: #dc3545;
+ border-color: #dc3545;
+}
+
+.btn-outline-danger:not(:disabled):not(.disabled):active:focus, .btn-outline-danger:not(:disabled):not(.disabled).active:focus,
+.show > .btn-outline-danger.dropdown-toggle:focus {
+ box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.5);
+}
+
+.btn-outline-light {
+ color: #f8f9fa;
+ background-color: transparent;
+ background-image: none;
+ border-color: #f8f9fa;
+}
+
+.btn-outline-light:hover {
+ color: #212529;
+ background-color: #f8f9fa;
+ border-color: #f8f9fa;
+}
+
+.btn-outline-light:focus, .btn-outline-light.focus {
+ box-shadow: 0 0 0 0.2rem rgba(248, 249, 250, 0.5);
+}
+
+.btn-outline-light.disabled, .btn-outline-light:disabled {
+ color: #f8f9fa;
+ background-color: transparent;
+}
+
+.btn-outline-light:not(:disabled):not(.disabled):active, .btn-outline-light:not(:disabled):not(.disabled).active,
+.show > .btn-outline-light.dropdown-toggle {
+ color: #212529;
+ background-color: #f8f9fa;
+ border-color: #f8f9fa;
+}
+
+.btn-outline-light:not(:disabled):not(.disabled):active:focus, .btn-outline-light:not(:disabled):not(.disabled).active:focus,
+.show > .btn-outline-light.dropdown-toggle:focus {
+ box-shadow: 0 0 0 0.2rem rgba(248, 249, 250, 0.5);
+}
+
+.btn-outline-dark {
+ color: #343a40;
+ background-color: transparent;
+ background-image: none;
+ border-color: #343a40;
+}
+
+.btn-outline-dark:hover {
+ color: #fff;
+ background-color: #343a40;
+ border-color: #343a40;
+}
+
+.btn-outline-dark:focus, .btn-outline-dark.focus {
+ box-shadow: 0 0 0 0.2rem rgba(52, 58, 64, 0.5);
+}
+
+.btn-outline-dark.disabled, .btn-outline-dark:disabled {
+ color: #343a40;
+ background-color: transparent;
+}
+
+.btn-outline-dark:not(:disabled):not(.disabled):active, .btn-outline-dark:not(:disabled):not(.disabled).active,
+.show > .btn-outline-dark.dropdown-toggle {
+ color: #fff;
+ background-color: #343a40;
+ border-color: #343a40;
+}
+
+.btn-outline-dark:not(:disabled):not(.disabled):active:focus, .btn-outline-dark:not(:disabled):not(.disabled).active:focus,
+.show > .btn-outline-dark.dropdown-toggle:focus {
+ box-shadow: 0 0 0 0.2rem rgba(52, 58, 64, 0.5);
+}
+
+.btn-link {
+ font-weight: 400;
+ color: #007bff;
+ background-color: transparent;
+}
+
+.btn-link:hover {
+ color: #0056b3;
+ text-decoration: underline;
+ background-color: transparent;
+ border-color: transparent;
+}
+
+.btn-link:focus, .btn-link.focus {
+ text-decoration: underline;
+ border-color: transparent;
+ box-shadow: none;
+}
+
+.btn-link:disabled, .btn-link.disabled {
+ color: #6c757d;
+}
+
+.btn-lg, .btn-group-lg > .btn {
+ padding: 0.5rem 1rem;
+ font-size: 1.25rem;
+ line-height: 1.5;
+ border-radius: 0.3rem;
+}
+
+.btn-sm, .btn-group-sm > .btn {
+ padding: 0.25rem 0.5rem;
+ font-size: 0.875rem;
+ line-height: 1.5;
+ border-radius: 0.2rem;
+}
+
+.btn-block {
+ display: block;
+ width: 100%;
+}
+
+.btn-block + .btn-block {
+ margin-top: 0.5rem;
+}
+
+input[type="submit"].btn-block,
+input[type="reset"].btn-block,
+input[type="button"].btn-block {
+ width: 100%;
+}
+
+.fade {
+ opacity: 0;
+ transition: opacity 0.15s linear;
+}
+
+.fade.show {
+ opacity: 1;
+}
+
+.collapse {
+ display: none;
+}
+
+.collapse.show {
+ display: block;
+}
+
+tr.collapse.show {
+ display: table-row;
+}
+
+tbody.collapse.show {
+ display: table-row-group;
+}
+
+.collapsing {
+ position: relative;
+ height: 0;
+ overflow: hidden;
+ transition: height 0.35s ease;
+}
+
+.dropup,
+.dropdown {
+ position: relative;
+}
+
+.dropdown-toggle::after {
+ display: inline-block;
+ width: 0;
+ height: 0;
+ margin-left: 0.255em;
+ vertical-align: 0.255em;
+ content: "";
+ border-top: 0.3em solid;
+ border-right: 0.3em solid transparent;
+ border-bottom: 0;
+ border-left: 0.3em solid transparent;
+}
+
+.dropdown-toggle:empty::after {
+ margin-left: 0;
+}
+
+.dropdown-menu {
+ position: absolute;
+ top: 100%;
+ left: 0;
+ z-index: 1000;
+ display: none;
+ float: left;
+ min-width: 10rem;
+ padding: 0.5rem 0;
+ margin: 0.125rem 0 0;
+ font-size: 1rem;
+ color: #212529;
+ text-align: left;
+ list-style: none;
+ background-color: #fff;
+ background-clip: padding-box;
+ border: 1px solid rgba(0, 0, 0, 0.15);
+ border-radius: 0.25rem;
+}
+
+.dropup .dropdown-menu {
+ margin-top: 0;
+ margin-bottom: 0.125rem;
+}
+
+.dropup .dropdown-toggle::after {
+ display: inline-block;
+ width: 0;
+ height: 0;
+ margin-left: 0.255em;
+ vertical-align: 0.255em;
+ content: "";
+ border-top: 0;
+ border-right: 0.3em solid transparent;
+ border-bottom: 0.3em solid;
+ border-left: 0.3em solid transparent;
+}
+
+.dropup .dropdown-toggle:empty::after {
+ margin-left: 0;
+}
+
+.dropright .dropdown-menu {
+ margin-top: 0;
+ margin-left: 0.125rem;
+}
+
+.dropright .dropdown-toggle::after {
+ display: inline-block;
+ width: 0;
+ height: 0;
+ margin-left: 0.255em;
+ vertical-align: 0.255em;
+ content: "";
+ border-top: 0.3em solid transparent;
+ border-bottom: 0.3em solid transparent;
+ border-left: 0.3em solid;
+}
+
+.dropright .dropdown-toggle:empty::after {
+ margin-left: 0;
+}
+
+.dropright .dropdown-toggle::after {
+ vertical-align: 0;
+}
+
+.dropleft .dropdown-menu {
+ margin-top: 0;
+ margin-right: 0.125rem;
+}
+
+.dropleft .dropdown-toggle::after {
+ display: inline-block;
+ width: 0;
+ height: 0;
+ margin-left: 0.255em;
+ vertical-align: 0.255em;
+ content: "";
+}
+
+.dropleft .dropdown-toggle::after {
+ display: none;
+}
+
+.dropleft .dropdown-toggle::before {
+ display: inline-block;
+ width: 0;
+ height: 0;
+ margin-right: 0.255em;
+ vertical-align: 0.255em;
+ content: "";
+ border-top: 0.3em solid transparent;
+ border-right: 0.3em solid;
+ border-bottom: 0.3em solid transparent;
+}
+
+.dropleft .dropdown-toggle:empty::after {
+ margin-left: 0;
+}
+
+.dropleft .dropdown-toggle::before {
+ vertical-align: 0;
+}
+
+.dropdown-divider {
+ height: 0;
+ margin: 0.5rem 0;
+ overflow: hidden;
+ border-top: 1px solid #e9ecef;
+}
+
+.dropdown-item {
+ display: block;
+ width: 100%;
+ padding: 0.25rem 1.5rem;
+ clear: both;
+ font-weight: 400;
+ color: #212529;
+ text-align: inherit;
+ white-space: nowrap;
+ background-color: transparent;
+ border: 0;
+}
+
+.dropdown-item:hover, .dropdown-item:focus {
+ color: #16181b;
+ text-decoration: none;
+ background-color: #f8f9fa;
+}
+
+.dropdown-item.active, .dropdown-item:active {
+ color: #fff;
+ text-decoration: none;
+ background-color: #007bff;
+}
+
+.dropdown-item.disabled, .dropdown-item:disabled {
+ color: #6c757d;
+ background-color: transparent;
+}
+
+.dropdown-menu.show {
+ display: block;
+}
+
+.dropdown-header {
+ display: block;
+ padding: 0.5rem 1.5rem;
+ margin-bottom: 0;
+ font-size: 0.875rem;
+ color: #6c757d;
+ white-space: nowrap;
+}
+
+.btn-group,
+.btn-group-vertical {
+ position: relative;
+ display: -webkit-inline-box;
+ display: -ms-inline-flexbox;
+ display: inline-flex;
+ vertical-align: middle;
+}
+
+.btn-group > .btn,
+.btn-group-vertical > .btn {
+ position: relative;
+ -webkit-box-flex: 0;
+ -ms-flex: 0 1 auto;
+ flex: 0 1 auto;
+}
+
+.btn-group > .btn:hover,
+.btn-group-vertical > .btn:hover {
+ z-index: 1;
+}
+
+.btn-group > .btn:focus, .btn-group > .btn:active, .btn-group > .btn.active,
+.btn-group-vertical > .btn:focus,
+.btn-group-vertical > .btn:active,
+.btn-group-vertical > .btn.active {
+ z-index: 1;
+}
+
+.btn-group .btn + .btn,
+.btn-group .btn + .btn-group,
+.btn-group .btn-group + .btn,
+.btn-group .btn-group + .btn-group,
+.btn-group-vertical .btn + .btn,
+.btn-group-vertical .btn + .btn-group,
+.btn-group-vertical .btn-group + .btn,
+.btn-group-vertical .btn-group + .btn-group {
+ margin-left: -1px;
+}
+
+.btn-toolbar {
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -ms-flex-wrap: wrap;
+ flex-wrap: wrap;
+ -webkit-box-pack: start;
+ -ms-flex-pack: start;
+ justify-content: flex-start;
+}
+
+.btn-toolbar .input-group {
+ width: auto;
+}
+
+.btn-group > .btn:first-child {
+ margin-left: 0;
+}
+
+.btn-group > .btn:not(:last-child):not(.dropdown-toggle),
+.btn-group > .btn-group:not(:last-child) > .btn {
+ border-top-right-radius: 0;
+ border-bottom-right-radius: 0;
+}
+
+.btn-group > .btn:not(:first-child),
+.btn-group > .btn-group:not(:first-child) > .btn {
+ border-top-left-radius: 0;
+ border-bottom-left-radius: 0;
+}
+
+.dropdown-toggle-split {
+ padding-right: 0.5625rem;
+ padding-left: 0.5625rem;
+}
+
+.dropdown-toggle-split::after {
+ margin-left: 0;
+}
+
+.btn-sm + .dropdown-toggle-split, .btn-group-sm > .btn + .dropdown-toggle-split {
+ padding-right: 0.375rem;
+ padding-left: 0.375rem;
+}
+
+.btn-lg + .dropdown-toggle-split, .btn-group-lg > .btn + .dropdown-toggle-split {
+ padding-right: 0.75rem;
+ padding-left: 0.75rem;
+}
+
+.btn-group-vertical {
+ -webkit-box-orient: vertical;
+ -webkit-box-direction: normal;
+ -ms-flex-direction: column;
+ flex-direction: column;
+ -webkit-box-align: start;
+ -ms-flex-align: start;
+ align-items: flex-start;
+ -webkit-box-pack: center;
+ -ms-flex-pack: center;
+ justify-content: center;
+}
+
+.btn-group-vertical .btn,
+.btn-group-vertical .btn-group {
+ width: 100%;
+}
+
+.btn-group-vertical > .btn + .btn,
+.btn-group-vertical > .btn + .btn-group,
+.btn-group-vertical > .btn-group + .btn,
+.btn-group-vertical > .btn-group + .btn-group {
+ margin-top: -1px;
+ margin-left: 0;
+}
+
+.btn-group-vertical > .btn:not(:last-child):not(.dropdown-toggle),
+.btn-group-vertical > .btn-group:not(:last-child) > .btn {
+ border-bottom-right-radius: 0;
+ border-bottom-left-radius: 0;
+}
+
+.btn-group-vertical > .btn:not(:first-child),
+.btn-group-vertical > .btn-group:not(:first-child) > .btn {
+ border-top-left-radius: 0;
+ border-top-right-radius: 0;
+}
+
+.btn-group-toggle > .btn,
+.btn-group-toggle > .btn-group > .btn {
+ margin-bottom: 0;
+}
+
+.btn-group-toggle > .btn input[type="radio"],
+.btn-group-toggle > .btn input[type="checkbox"],
+.btn-group-toggle > .btn-group > .btn input[type="radio"],
+.btn-group-toggle > .btn-group > .btn input[type="checkbox"] {
+ position: absolute;
+ clip: rect(0, 0, 0, 0);
+ pointer-events: none;
+}
+
+.input-group {
+ position: relative;
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -ms-flex-wrap: wrap;
+ flex-wrap: wrap;
+ -webkit-box-align: stretch;
+ -ms-flex-align: stretch;
+ align-items: stretch;
+ width: 100%;
+}
+
+.input-group > .form-control,
+.input-group > .custom-select,
+.input-group > .custom-file {
+ position: relative;
+ -webkit-box-flex: 1;
+ -ms-flex: 1 1 auto;
+ flex: 1 1 auto;
+ width: 1%;
+ margin-bottom: 0;
+}
+
+.input-group > .form-control:focus,
+.input-group > .custom-select:focus,
+.input-group > .custom-file:focus {
+ z-index: 3;
+}
+
+.input-group > .form-control + .form-control,
+.input-group > .form-control + .custom-select,
+.input-group > .form-control + .custom-file,
+.input-group > .custom-select + .form-control,
+.input-group > .custom-select + .custom-select,
+.input-group > .custom-select + .custom-file,
+.input-group > .custom-file + .form-control,
+.input-group > .custom-file + .custom-select,
+.input-group > .custom-file + .custom-file {
+ margin-left: -1px;
+}
+
+.input-group > .form-control:not(:last-child),
+.input-group > .custom-select:not(:last-child) {
+ border-top-right-radius: 0;
+ border-bottom-right-radius: 0;
+}
+
+.input-group > .form-control:not(:first-child),
+.input-group > .custom-select:not(:first-child) {
+ border-top-left-radius: 0;
+ border-bottom-left-radius: 0;
+}
+
+.input-group > .custom-file {
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -webkit-box-align: center;
+ -ms-flex-align: center;
+ align-items: center;
+}
+
+.input-group > .custom-file:not(:last-child) .custom-file-label,
+.input-group > .custom-file:not(:last-child) .custom-file-label::before {
+ border-top-right-radius: 0;
+ border-bottom-right-radius: 0;
+}
+
+.input-group > .custom-file:not(:first-child) .custom-file-label,
+.input-group > .custom-file:not(:first-child) .custom-file-label::before {
+ border-top-left-radius: 0;
+ border-bottom-left-radius: 0;
+}
+
+.input-group-prepend,
+.input-group-append {
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+}
+
+.input-group-prepend .btn,
+.input-group-append .btn {
+ position: relative;
+ z-index: 2;
+}
+
+.input-group-prepend .btn + .btn,
+.input-group-prepend .btn + .input-group-text,
+.input-group-prepend .input-group-text + .input-group-text,
+.input-group-prepend .input-group-text + .btn,
+.input-group-append .btn + .btn,
+.input-group-append .btn + .input-group-text,
+.input-group-append .input-group-text + .input-group-text,
+.input-group-append .input-group-text + .btn {
+ margin-left: -1px;
+}
+
+.input-group-prepend {
+ margin-right: -1px;
+}
+
+.input-group-append {
+ margin-left: -1px;
+}
+
+.input-group-text {
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -webkit-box-align: center;
+ -ms-flex-align: center;
+ align-items: center;
+ padding: 0.375rem 0.75rem;
+ margin-bottom: 0;
+ font-size: 1rem;
+ font-weight: 400;
+ line-height: 1.5;
+ color: #495057;
+ text-align: center;
+ white-space: nowrap;
+ background-color: #e9ecef;
+ border: 1px solid #ced4da;
+ border-radius: 0.25rem;
+}
+
+.input-group-text input[type="radio"],
+.input-group-text input[type="checkbox"] {
+ margin-top: 0;
+}
+
+.input-group > .input-group-prepend > .btn,
+.input-group > .input-group-prepend > .input-group-text,
+.input-group > .input-group-append:not(:last-child) > .btn,
+.input-group > .input-group-append:not(:last-child) > .input-group-text,
+.input-group > .input-group-append:last-child > .btn:not(:last-child):not(.dropdown-toggle),
+.input-group > .input-group-append:last-child > .input-group-text:not(:last-child) {
+ border-top-right-radius: 0;
+ border-bottom-right-radius: 0;
+}
+
+.input-group > .input-group-append > .btn,
+.input-group > .input-group-append > .input-group-text,
+.input-group > .input-group-prepend:not(:first-child) > .btn,
+.input-group > .input-group-prepend:not(:first-child) > .input-group-text,
+.input-group > .input-group-prepend:first-child > .btn:not(:first-child),
+.input-group > .input-group-prepend:first-child > .input-group-text:not(:first-child) {
+ border-top-left-radius: 0;
+ border-bottom-left-radius: 0;
+}
+
+.custom-control {
+ position: relative;
+ display: block;
+ min-height: 1.5rem;
+ padding-left: 1.5rem;
+}
+
+.custom-control-inline {
+ display: -webkit-inline-box;
+ display: -ms-inline-flexbox;
+ display: inline-flex;
+ margin-right: 1rem;
+}
+
+.custom-control-input {
+ position: absolute;
+ z-index: -1;
+ opacity: 0;
+}
+
+.custom-control-input:checked ~ .custom-control-label::before {
+ color: #fff;
+ background-color: #007bff;
+}
+
+.custom-control-input:focus ~ .custom-control-label::before {
+ box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
+}
+
+.custom-control-input:active ~ .custom-control-label::before {
+ color: #fff;
+ background-color: #b3d7ff;
+}
+
+.custom-control-input:disabled ~ .custom-control-label {
+ color: #6c757d;
+}
+
+.custom-control-input:disabled ~ .custom-control-label::before {
+ background-color: #e9ecef;
+}
+
+.custom-control-label {
+ margin-bottom: 0;
+}
+
+.custom-control-label::before {
+ position: absolute;
+ top: 0.25rem;
+ left: 0;
+ display: block;
+ width: 1rem;
+ height: 1rem;
+ pointer-events: none;
+ content: "";
+ -webkit-user-select: none;
+ -moz-user-select: none;
+ -ms-user-select: none;
+ user-select: none;
+ background-color: #dee2e6;
+}
+
+.custom-control-label::after {
+ position: absolute;
+ top: 0.25rem;
+ left: 0;
+ display: block;
+ width: 1rem;
+ height: 1rem;
+ content: "";
+ background-repeat: no-repeat;
+ background-position: center center;
+ background-size: 50% 50%;
+}
+
+.custom-checkbox .custom-control-label::before {
+ border-radius: 0.25rem;
+}
+
+.custom-checkbox .custom-control-input:checked ~ .custom-control-label::before {
+ background-color: #007bff;
+}
+
+.custom-checkbox .custom-control-input:checked ~ .custom-control-label::after {
+ background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3E%3C/svg%3E");
+}
+
+.custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::before {
+ background-color: #007bff;
+}
+
+.custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::after {
+ background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 4'%3E%3Cpath stroke='%23fff' d='M0 2h4'/%3E%3C/svg%3E");
+}
+
+.custom-checkbox .custom-control-input:disabled:checked ~ .custom-control-label::before {
+ background-color: rgba(0, 123, 255, 0.5);
+}
+
+.custom-checkbox .custom-control-input:disabled:indeterminate ~ .custom-control-label::before {
+ background-color: rgba(0, 123, 255, 0.5);
+}
+
+.custom-radio .custom-control-label::before {
+ border-radius: 50%;
+}
+
+.custom-radio .custom-control-input:checked ~ .custom-control-label::before {
+ background-color: #007bff;
+}
+
+.custom-radio .custom-control-input:checked ~ .custom-control-label::after {
+ background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3E%3Ccircle r='3' fill='%23fff'/%3E%3C/svg%3E");
+}
+
+.custom-radio .custom-control-input:disabled:checked ~ .custom-control-label::before {
+ background-color: rgba(0, 123, 255, 0.5);
+}
+
+.custom-select {
+ display: inline-block;
+ width: 100%;
+ height: calc(2.25rem + 2px);
+ padding: 0.375rem 1.75rem 0.375rem 0.75rem;
+ line-height: 1.5;
+ color: #495057;
+ vertical-align: middle;
+ background: #fff url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3E%3Cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3E%3C/svg%3E") no-repeat right 0.75rem center;
+ background-size: 8px 10px;
+ border: 1px solid #ced4da;
+ border-radius: 0.25rem;
+ -webkit-appearance: none;
+ -moz-appearance: none;
+ appearance: none;
+}
+
+.custom-select:focus {
+ border-color: #80bdff;
+ outline: 0;
+ box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.075), 0 0 5px rgba(128, 189, 255, 0.5);
+}
+
+.custom-select:focus::-ms-value {
+ color: #495057;
+ background-color: #fff;
+}
+
+.custom-select[multiple], .custom-select[size]:not([size="1"]) {
+ height: auto;
+ padding-right: 0.75rem;
+ background-image: none;
+}
+
+.custom-select:disabled {
+ color: #6c757d;
+ background-color: #e9ecef;
+}
+
+.custom-select::-ms-expand {
+ opacity: 0;
+}
+
+.custom-select-sm {
+ height: calc(1.8125rem + 2px);
+ padding-top: 0.375rem;
+ padding-bottom: 0.375rem;
+ font-size: 75%;
+}
+
+.custom-select-lg {
+ height: calc(2.875rem + 2px);
+ padding-top: 0.375rem;
+ padding-bottom: 0.375rem;
+ font-size: 125%;
+}
+
+.custom-file {
+ position: relative;
+ display: inline-block;
+ width: 100%;
+ height: calc(2.25rem + 2px);
+ margin-bottom: 0;
+}
+
+.custom-file-input {
+ position: relative;
+ z-index: 2;
+ width: 100%;
+ height: calc(2.25rem + 2px);
+ margin: 0;
+ opacity: 0;
+}
+
+.custom-file-input:focus ~ .custom-file-control {
+ border-color: #80bdff;
+ box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
+}
+
+.custom-file-input:focus ~ .custom-file-control::before {
+ border-color: #80bdff;
+}
+
+.custom-file-input:lang(en) ~ .custom-file-label::after {
+ content: "Browse";
+}
+
+.custom-file-label {
+ position: absolute;
+ top: 0;
+ right: 0;
+ left: 0;
+ z-index: 1;
+ height: calc(2.25rem + 2px);
+ padding: 0.375rem 0.75rem;
+ line-height: 1.5;
+ color: #495057;
+ background-color: #fff;
+ border: 1px solid #ced4da;
+ border-radius: 0.25rem;
+}
+
+.custom-file-label::after {
+ position: absolute;
+ top: 0;
+ right: 0;
+ bottom: 0;
+ z-index: 3;
+ display: block;
+ height: calc(calc(2.25rem + 2px) - 1px * 2);
+ padding: 0.375rem 0.75rem;
+ line-height: 1.5;
+ color: #495057;
+ content: "Browse";
+ background-color: #e9ecef;
+ border-left: 1px solid #ced4da;
+ border-radius: 0 0.25rem 0.25rem 0;
+}
+
+.nav {
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -ms-flex-wrap: wrap;
+ flex-wrap: wrap;
+ padding-left: 0;
+ margin-bottom: 0;
+ list-style: none;
+}
+
+.nav-link {
+ display: block;
+ padding: 0.5rem 1rem;
+}
+
+.nav-link:hover, .nav-link:focus {
+ text-decoration: none;
+}
+
+.nav-link.disabled {
+ color: #6c757d;
+}
+
+.nav-tabs {
+ border-bottom: 1px solid #dee2e6;
+}
+
+.nav-tabs .nav-item {
+ margin-bottom: -1px;
+}
+
+.nav-tabs .nav-link {
+ border: 1px solid transparent;
+ border-top-left-radius: 0.25rem;
+ border-top-right-radius: 0.25rem;
+}
+
+.nav-tabs .nav-link:hover, .nav-tabs .nav-link:focus {
+ border-color: #e9ecef #e9ecef #dee2e6;
+}
+
+.nav-tabs .nav-link.disabled {
+ color: #6c757d;
+ background-color: transparent;
+ border-color: transparent;
+}
+
+.nav-tabs .nav-link.active,
+.nav-tabs .nav-item.show .nav-link {
+ color: #495057;
+ background-color: #fff;
+ border-color: #dee2e6 #dee2e6 #fff;
+}
+
+.nav-tabs .dropdown-menu {
+ margin-top: -1px;
+ border-top-left-radius: 0;
+ border-top-right-radius: 0;
+}
+
+.nav-pills .nav-link {
+ border-radius: 0.25rem;
+}
+
+.nav-pills .nav-link.active,
+.nav-pills .show > .nav-link {
+ color: #fff;
+ background-color: #007bff;
+}
+
+.nav-fill .nav-item {
+ -webkit-box-flex: 1;
+ -ms-flex: 1 1 auto;
+ flex: 1 1 auto;
+ text-align: center;
+}
+
+.nav-justified .nav-item {
+ -ms-flex-preferred-size: 0;
+ flex-basis: 0;
+ -webkit-box-flex: 1;
+ -ms-flex-positive: 1;
+ flex-grow: 1;
+ text-align: center;
+}
+
+.tab-content > .tab-pane {
+ display: none;
+}
+
+.tab-content > .active {
+ display: block;
+}
+
+.navbar {
+ position: relative;
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -ms-flex-wrap: wrap;
+ flex-wrap: wrap;
+ -webkit-box-align: center;
+ -ms-flex-align: center;
+ align-items: center;
+ -webkit-box-pack: justify;
+ -ms-flex-pack: justify;
+ justify-content: space-between;
+ padding: 0.5rem 1rem;
+}
+
+.navbar > .container,
+.navbar > .container-fluid {
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -ms-flex-wrap: wrap;
+ flex-wrap: wrap;
+ -webkit-box-align: center;
+ -ms-flex-align: center;
+ align-items: center;
+ -webkit-box-pack: justify;
+ -ms-flex-pack: justify;
+ justify-content: space-between;
+}
+
+.navbar-brand {
+ display: inline-block;
+ padding-top: 0.3125rem;
+ padding-bottom: 0.3125rem;
+ margin-right: 1rem;
+ font-size: 1.25rem;
+ line-height: inherit;
+ white-space: nowrap;
+}
+
+.navbar-brand:hover, .navbar-brand:focus {
+ text-decoration: none;
+}
+
+.navbar-nav {
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -webkit-box-orient: vertical;
+ -webkit-box-direction: normal;
+ -ms-flex-direction: column;
+ flex-direction: column;
+ padding-left: 0;
+ margin-bottom: 0;
+ list-style: none;
+}
+
+.navbar-nav .nav-link {
+ padding-right: 0;
+ padding-left: 0;
+}
+
+.navbar-nav .dropdown-menu {
+ position: static;
+ float: none;
+}
+
+.navbar-text {
+ display: inline-block;
+ padding-top: 0.5rem;
+ padding-bottom: 0.5rem;
+}
+
+.navbar-collapse {
+ -ms-flex-preferred-size: 100%;
+ flex-basis: 100%;
+ -webkit-box-flex: 1;
+ -ms-flex-positive: 1;
+ flex-grow: 1;
+ -webkit-box-align: center;
+ -ms-flex-align: center;
+ align-items: center;
+}
+
+.navbar-toggler {
+ padding: 0.25rem 0.75rem;
+ font-size: 1.25rem;
+ line-height: 1;
+ background-color: transparent;
+ border: 1px solid transparent;
+ border-radius: 0.25rem;
+}
+
+.navbar-toggler:hover, .navbar-toggler:focus {
+ text-decoration: none;
+}
+
+.navbar-toggler:not(:disabled):not(.disabled) {
+ cursor: pointer;
+}
+
+.navbar-toggler-icon {
+ display: inline-block;
+ width: 1.5em;
+ height: 1.5em;
+ vertical-align: middle;
+ content: "";
+ background: no-repeat center center;
+ background-size: 100% 100%;
+}
+
+@media (max-width: 575.98px) {
+ .navbar-expand-sm > .container,
+ .navbar-expand-sm > .container-fluid {
+ padding-right: 0;
+ padding-left: 0;
+ }
+}
+
+@media (min-width: 576px) {
+ .navbar-expand-sm {
+ -webkit-box-orient: horizontal;
+ -webkit-box-direction: normal;
+ -ms-flex-flow: row nowrap;
+ flex-flow: row nowrap;
+ -webkit-box-pack: start;
+ -ms-flex-pack: start;
+ justify-content: flex-start;
+ }
+ .navbar-expand-sm .navbar-nav {
+ -webkit-box-orient: horizontal;
+ -webkit-box-direction: normal;
+ -ms-flex-direction: row;
+ flex-direction: row;
+ }
+ .navbar-expand-sm .navbar-nav .dropdown-menu {
+ position: absolute;
+ }
+ .navbar-expand-sm .navbar-nav .dropdown-menu-right {
+ right: 0;
+ left: auto;
+ }
+ .navbar-expand-sm .navbar-nav .nav-link {
+ padding-right: 0.5rem;
+ padding-left: 0.5rem;
+ }
+ .navbar-expand-sm > .container,
+ .navbar-expand-sm > .container-fluid {
+ -ms-flex-wrap: nowrap;
+ flex-wrap: nowrap;
+ }
+ .navbar-expand-sm .navbar-collapse {
+ display: -webkit-box !important;
+ display: -ms-flexbox !important;
+ display: flex !important;
+ -ms-flex-preferred-size: auto;
+ flex-basis: auto;
+ }
+ .navbar-expand-sm .navbar-toggler {
+ display: none;
+ }
+ .navbar-expand-sm .dropup .dropdown-menu {
+ top: auto;
+ bottom: 100%;
+ }
+}
+
+@media (max-width: 767.98px) {
+ .navbar-expand-md > .container,
+ .navbar-expand-md > .container-fluid {
+ padding-right: 0;
+ padding-left: 0;
+ }
+}
+
+@media (min-width: 768px) {
+ .navbar-expand-md {
+ -webkit-box-orient: horizontal;
+ -webkit-box-direction: normal;
+ -ms-flex-flow: row nowrap;
+ flex-flow: row nowrap;
+ -webkit-box-pack: start;
+ -ms-flex-pack: start;
+ justify-content: flex-start;
+ }
+ .navbar-expand-md .navbar-nav {
+ -webkit-box-orient: horizontal;
+ -webkit-box-direction: normal;
+ -ms-flex-direction: row;
+ flex-direction: row;
+ }
+ .navbar-expand-md .navbar-nav .dropdown-menu {
+ position: absolute;
+ }
+ .navbar-expand-md .navbar-nav .dropdown-menu-right {
+ right: 0;
+ left: auto;
+ }
+ .navbar-expand-md .navbar-nav .nav-link {
+ padding-right: 0.5rem;
+ padding-left: 0.5rem;
+ }
+ .navbar-expand-md > .container,
+ .navbar-expand-md > .container-fluid {
+ -ms-flex-wrap: nowrap;
+ flex-wrap: nowrap;
+ }
+ .navbar-expand-md .navbar-collapse {
+ display: -webkit-box !important;
+ display: -ms-flexbox !important;
+ display: flex !important;
+ -ms-flex-preferred-size: auto;
+ flex-basis: auto;
+ }
+ .navbar-expand-md .navbar-toggler {
+ display: none;
+ }
+ .navbar-expand-md .dropup .dropdown-menu {
+ top: auto;
+ bottom: 100%;
+ }
+}
+
+@media (max-width: 991.98px) {
+ .navbar-expand-lg > .container,
+ .navbar-expand-lg > .container-fluid {
+ padding-right: 0;
+ padding-left: 0;
+ }
+}
+
+@media (min-width: 992px) {
+ .navbar-expand-lg {
+ -webkit-box-orient: horizontal;
+ -webkit-box-direction: normal;
+ -ms-flex-flow: row nowrap;
+ flex-flow: row nowrap;
+ -webkit-box-pack: start;
+ -ms-flex-pack: start;
+ justify-content: flex-start;
+ }
+ .navbar-expand-lg .navbar-nav {
+ -webkit-box-orient: horizontal;
+ -webkit-box-direction: normal;
+ -ms-flex-direction: row;
+ flex-direction: row;
+ }
+ .navbar-expand-lg .navbar-nav .dropdown-menu {
+ position: absolute;
+ }
+ .navbar-expand-lg .navbar-nav .dropdown-menu-right {
+ right: 0;
+ left: auto;
+ }
+ .navbar-expand-lg .navbar-nav .nav-link {
+ padding-right: 0.5rem;
+ padding-left: 0.5rem;
+ }
+ .navbar-expand-lg > .container,
+ .navbar-expand-lg > .container-fluid {
+ -ms-flex-wrap: nowrap;
+ flex-wrap: nowrap;
+ }
+ .navbar-expand-lg .navbar-collapse {
+ display: -webkit-box !important;
+ display: -ms-flexbox !important;
+ display: flex !important;
+ -ms-flex-preferred-size: auto;
+ flex-basis: auto;
+ }
+ .navbar-expand-lg .navbar-toggler {
+ display: none;
+ }
+ .navbar-expand-lg .dropup .dropdown-menu {
+ top: auto;
+ bottom: 100%;
+ }
+}
+
+@media (max-width: 1199.98px) {
+ .navbar-expand-xl > .container,
+ .navbar-expand-xl > .container-fluid {
+ padding-right: 0;
+ padding-left: 0;
+ }
+}
+
+@media (min-width: 1200px) {
+ .navbar-expand-xl {
+ -webkit-box-orient: horizontal;
+ -webkit-box-direction: normal;
+ -ms-flex-flow: row nowrap;
+ flex-flow: row nowrap;
+ -webkit-box-pack: start;
+ -ms-flex-pack: start;
+ justify-content: flex-start;
+ }
+ .navbar-expand-xl .navbar-nav {
+ -webkit-box-orient: horizontal;
+ -webkit-box-direction: normal;
+ -ms-flex-direction: row;
+ flex-direction: row;
+ }
+ .navbar-expand-xl .navbar-nav .dropdown-menu {
+ position: absolute;
+ }
+ .navbar-expand-xl .navbar-nav .dropdown-menu-right {
+ right: 0;
+ left: auto;
+ }
+ .navbar-expand-xl .navbar-nav .nav-link {
+ padding-right: 0.5rem;
+ padding-left: 0.5rem;
+ }
+ .navbar-expand-xl > .container,
+ .navbar-expand-xl > .container-fluid {
+ -ms-flex-wrap: nowrap;
+ flex-wrap: nowrap;
+ }
+ .navbar-expand-xl .navbar-collapse {
+ display: -webkit-box !important;
+ display: -ms-flexbox !important;
+ display: flex !important;
+ -ms-flex-preferred-size: auto;
+ flex-basis: auto;
+ }
+ .navbar-expand-xl .navbar-toggler {
+ display: none;
+ }
+ .navbar-expand-xl .dropup .dropdown-menu {
+ top: auto;
+ bottom: 100%;
+ }
+}
+
+.navbar-expand {
+ -webkit-box-orient: horizontal;
+ -webkit-box-direction: normal;
+ -ms-flex-flow: row nowrap;
+ flex-flow: row nowrap;
+ -webkit-box-pack: start;
+ -ms-flex-pack: start;
+ justify-content: flex-start;
+}
+
+.navbar-expand > .container,
+.navbar-expand > .container-fluid {
+ padding-right: 0;
+ padding-left: 0;
+}
+
+.navbar-expand .navbar-nav {
+ -webkit-box-orient: horizontal;
+ -webkit-box-direction: normal;
+ -ms-flex-direction: row;
+ flex-direction: row;
+}
+
+.navbar-expand .navbar-nav .dropdown-menu {
+ position: absolute;
+}
+
+.navbar-expand .navbar-nav .dropdown-menu-right {
+ right: 0;
+ left: auto;
+}
+
+.navbar-expand .navbar-nav .nav-link {
+ padding-right: 0.5rem;
+ padding-left: 0.5rem;
+}
+
+.navbar-expand > .container,
+.navbar-expand > .container-fluid {
+ -ms-flex-wrap: nowrap;
+ flex-wrap: nowrap;
+}
+
+.navbar-expand .navbar-collapse {
+ display: -webkit-box !important;
+ display: -ms-flexbox !important;
+ display: flex !important;
+ -ms-flex-preferred-size: auto;
+ flex-basis: auto;
+}
+
+.navbar-expand .navbar-toggler {
+ display: none;
+}
+
+.navbar-expand .dropup .dropdown-menu {
+ top: auto;
+ bottom: 100%;
+}
+
+.navbar-light .navbar-brand {
+ color: rgba(0, 0, 0, 0.9);
+}
+
+.navbar-light .navbar-brand:hover, .navbar-light .navbar-brand:focus {
+ color: rgba(0, 0, 0, 0.9);
+}
+
+.navbar-light .navbar-nav .nav-link {
+ color: rgba(0, 0, 0, 0.5);
+}
+
+.navbar-light .navbar-nav .nav-link:hover, .navbar-light .navbar-nav .nav-link:focus {
+ color: rgba(0, 0, 0, 0.7);
+}
+
+.navbar-light .navbar-nav .nav-link.disabled {
+ color: rgba(0, 0, 0, 0.3);
+}
+
+.navbar-light .navbar-nav .show > .nav-link,
+.navbar-light .navbar-nav .active > .nav-link,
+.navbar-light .navbar-nav .nav-link.show,
+.navbar-light .navbar-nav .nav-link.active {
+ color: rgba(0, 0, 0, 0.9);
+}
+
+.navbar-light .navbar-toggler {
+ color: rgba(0, 0, 0, 0.5);
+ border-color: rgba(0, 0, 0, 0.1);
+}
+
+.navbar-light .navbar-toggler-icon {
+ background-image: url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(0, 0, 0, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E");
+}
+
+.navbar-light .navbar-text {
+ color: rgba(0, 0, 0, 0.5);
+}
+
+.navbar-light .navbar-text a {
+ color: rgba(0, 0, 0, 0.9);
+}
+
+.navbar-light .navbar-text a:hover, .navbar-light .navbar-text a:focus {
+ color: rgba(0, 0, 0, 0.9);
+}
+
+.navbar-dark .navbar-brand {
+ color: #fff;
+}
+
+.navbar-dark .navbar-brand:hover, .navbar-dark .navbar-brand:focus {
+ color: #fff;
+}
+
+.navbar-dark .navbar-nav .nav-link {
+ color: rgba(255, 255, 255, 0.5);
+}
+
+.navbar-dark .navbar-nav .nav-link:hover, .navbar-dark .navbar-nav .nav-link:focus {
+ color: rgba(255, 255, 255, 0.75);
+}
+
+.navbar-dark .navbar-nav .nav-link.disabled {
+ color: rgba(255, 255, 255, 0.25);
+}
+
+.navbar-dark .navbar-nav .show > .nav-link,
+.navbar-dark .navbar-nav .active > .nav-link,
+.navbar-dark .navbar-nav .nav-link.show,
+.navbar-dark .navbar-nav .nav-link.active {
+ color: #fff;
+}
+
+.navbar-dark .navbar-toggler {
+ color: rgba(255, 255, 255, 0.5);
+ border-color: rgba(255, 255, 255, 0.1);
+}
+
+.navbar-dark .navbar-toggler-icon {
+ background-image: url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(255, 255, 255, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E");
+}
+
+.navbar-dark .navbar-text {
+ color: rgba(255, 255, 255, 0.5);
+}
+
+.navbar-dark .navbar-text a {
+ color: #fff;
+}
+
+.navbar-dark .navbar-text a:hover, .navbar-dark .navbar-text a:focus {
+ color: #fff;
+}
+
+.card {
+ position: relative;
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -webkit-box-orient: vertical;
+ -webkit-box-direction: normal;
+ -ms-flex-direction: column;
+ flex-direction: column;
+ min-width: 0;
+ word-wrap: break-word;
+ background-color: #fff;
+ background-clip: border-box;
+ border: 1px solid rgba(0, 0, 0, 0.125);
+ border-radius: 0.25rem;
+}
+
+.card > hr {
+ margin-right: 0;
+ margin-left: 0;
+}
+
+.card > .list-group:first-child .list-group-item:first-child {
+ border-top-left-radius: 0.25rem;
+ border-top-right-radius: 0.25rem;
+}
+
+.card > .list-group:last-child .list-group-item:last-child {
+ border-bottom-right-radius: 0.25rem;
+ border-bottom-left-radius: 0.25rem;
+}
+
+.card-body {
+ -webkit-box-flex: 1;
+ -ms-flex: 1 1 auto;
+ flex: 1 1 auto;
+ padding: 1.25rem;
+}
+
+.card-title {
+ margin-bottom: 0.75rem;
+}
+
+.card-subtitle {
+ margin-top: -0.375rem;
+ margin-bottom: 0;
+}
+
+.card-text:last-child {
+ margin-bottom: 0;
+}
+
+.card-link:hover {
+ text-decoration: none;
+}
+
+.card-link + .card-link {
+ margin-left: 1.25rem;
+}
+
+.card-header {
+ padding: 0.75rem 1.25rem;
+ margin-bottom: 0;
+ background-color: rgba(0, 0, 0, 0.03);
+ border-bottom: 1px solid rgba(0, 0, 0, 0.125);
+}
+
+.card-header:first-child {
+ border-radius: calc(0.25rem - 1px) calc(0.25rem - 1px) 0 0;
+}
+
+.card-header + .list-group .list-group-item:first-child {
+ border-top: 0;
+}
+
+.card-footer {
+ padding: 0.75rem 1.25rem;
+ background-color: rgba(0, 0, 0, 0.03);
+ border-top: 1px solid rgba(0, 0, 0, 0.125);
+}
+
+.card-footer:last-child {
+ border-radius: 0 0 calc(0.25rem - 1px) calc(0.25rem - 1px);
+}
+
+.card-header-tabs {
+ margin-right: -0.625rem;
+ margin-bottom: -0.75rem;
+ margin-left: -0.625rem;
+ border-bottom: 0;
+}
+
+.card-header-pills {
+ margin-right: -0.625rem;
+ margin-left: -0.625rem;
+}
+
+.card-img-overlay {
+ position: absolute;
+ top: 0;
+ right: 0;
+ bottom: 0;
+ left: 0;
+ padding: 1.25rem;
+}
+
+.card-img {
+ width: 100%;
+ border-radius: calc(0.25rem - 1px);
+}
+
+.card-img-top {
+ width: 100%;
+ border-top-left-radius: calc(0.25rem - 1px);
+ border-top-right-radius: calc(0.25rem - 1px);
+}
+
+.card-img-bottom {
+ width: 100%;
+ border-bottom-right-radius: calc(0.25rem - 1px);
+ border-bottom-left-radius: calc(0.25rem - 1px);
+}
+
+.card-deck {
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -webkit-box-orient: vertical;
+ -webkit-box-direction: normal;
+ -ms-flex-direction: column;
+ flex-direction: column;
+}
+
+.card-deck .card {
+ margin-bottom: 15px;
+}
+
+@media (min-width: 576px) {
+ .card-deck {
+ -webkit-box-orient: horizontal;
+ -webkit-box-direction: normal;
+ -ms-flex-flow: row wrap;
+ flex-flow: row wrap;
+ margin-right: -15px;
+ margin-left: -15px;
+ }
+ .card-deck .card {
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -webkit-box-flex: 1;
+ -ms-flex: 1 0 0%;
+ flex: 1 0 0%;
+ -webkit-box-orient: vertical;
+ -webkit-box-direction: normal;
+ -ms-flex-direction: column;
+ flex-direction: column;
+ margin-right: 15px;
+ margin-bottom: 0;
+ margin-left: 15px;
+ }
+}
+
+.card-group {
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -webkit-box-orient: vertical;
+ -webkit-box-direction: normal;
+ -ms-flex-direction: column;
+ flex-direction: column;
+}
+
+.card-group > .card {
+ margin-bottom: 15px;
+}
+
+@media (min-width: 576px) {
+ .card-group {
+ -webkit-box-orient: horizontal;
+ -webkit-box-direction: normal;
+ -ms-flex-flow: row wrap;
+ flex-flow: row wrap;
+ }
+ .card-group > .card {
+ -webkit-box-flex: 1;
+ -ms-flex: 1 0 0%;
+ flex: 1 0 0%;
+ margin-bottom: 0;
+ }
+ .card-group > .card + .card {
+ margin-left: 0;
+ border-left: 0;
+ }
+ .card-group > .card:first-child {
+ border-top-right-radius: 0;
+ border-bottom-right-radius: 0;
+ }
+ .card-group > .card:first-child .card-img-top,
+ .card-group > .card:first-child .card-header {
+ border-top-right-radius: 0;
+ }
+ .card-group > .card:first-child .card-img-bottom,
+ .card-group > .card:first-child .card-footer {
+ border-bottom-right-radius: 0;
+ }
+ .card-group > .card:last-child {
+ border-top-left-radius: 0;
+ border-bottom-left-radius: 0;
+ }
+ .card-group > .card:last-child .card-img-top,
+ .card-group > .card:last-child .card-header {
+ border-top-left-radius: 0;
+ }
+ .card-group > .card:last-child .card-img-bottom,
+ .card-group > .card:last-child .card-footer {
+ border-bottom-left-radius: 0;
+ }
+ .card-group > .card:only-child {
+ border-radius: 0.25rem;
+ }
+ .card-group > .card:only-child .card-img-top,
+ .card-group > .card:only-child .card-header {
+ border-top-left-radius: 0.25rem;
+ border-top-right-radius: 0.25rem;
+ }
+ .card-group > .card:only-child .card-img-bottom,
+ .card-group > .card:only-child .card-footer {
+ border-bottom-right-radius: 0.25rem;
+ border-bottom-left-radius: 0.25rem;
+ }
+ .card-group > .card:not(:first-child):not(:last-child):not(:only-child) {
+ border-radius: 0;
+ }
+ .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-img-top,
+ .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-img-bottom,
+ .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-header,
+ .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-footer {
+ border-radius: 0;
+ }
+}
+
+.card-columns .card {
+ margin-bottom: 0.75rem;
+}
+
+@media (min-width: 576px) {
+ .card-columns {
+ -webkit-column-count: 3;
+ -moz-column-count: 3;
+ column-count: 3;
+ -webkit-column-gap: 1.25rem;
+ -moz-column-gap: 1.25rem;
+ column-gap: 1.25rem;
+ }
+ .card-columns .card {
+ display: inline-block;
+ width: 100%;
+ }
+}
+
+.breadcrumb {
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -ms-flex-wrap: wrap;
+ flex-wrap: wrap;
+ padding: 0.75rem 1rem;
+ margin-bottom: 1rem;
+ list-style: none;
+ background-color: #e9ecef;
+ border-radius: 0.25rem;
+}
+
+.breadcrumb-item + .breadcrumb-item::before {
+ display: inline-block;
+ padding-right: 0.5rem;
+ padding-left: 0.5rem;
+ color: #6c757d;
+ content: "/";
+}
+
+.breadcrumb-item + .breadcrumb-item:hover::before {
+ text-decoration: underline;
+}
+
+.breadcrumb-item + .breadcrumb-item:hover::before {
+ text-decoration: none;
+}
+
+.breadcrumb-item.active {
+ color: #6c757d;
+}
+
+.pagination {
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ padding-left: 0;
+ list-style: none;
+ border-radius: 0.25rem;
+}
+
+.page-link {
+ position: relative;
+ display: block;
+ padding: 0.5rem 0.75rem;
+ margin-left: -1px;
+ line-height: 1.25;
+ color: #007bff;
+ background-color: #fff;
+ border: 1px solid #dee2e6;
+}
+
+.page-link:hover {
+ color: #0056b3;
+ text-decoration: none;
+ background-color: #e9ecef;
+ border-color: #dee2e6;
+}
+
+.page-link:focus {
+ z-index: 2;
+ outline: 0;
+ box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.25);
+}
+
+.page-link:not(:disabled):not(.disabled) {
+ cursor: pointer;
+}
+
+.page-item:first-child .page-link {
+ margin-left: 0;
+ border-top-left-radius: 0.25rem;
+ border-bottom-left-radius: 0.25rem;
+}
+
+.page-item:last-child .page-link {
+ border-top-right-radius: 0.25rem;
+ border-bottom-right-radius: 0.25rem;
+}
+
+.page-item.active .page-link {
+ z-index: 1;
+ color: #fff;
+ background-color: #007bff;
+ border-color: #007bff;
+}
+
+.page-item.disabled .page-link {
+ color: #6c757d;
+ pointer-events: none;
+ cursor: auto;
+ background-color: #fff;
+ border-color: #dee2e6;
+}
+
+.pagination-lg .page-link {
+ padding: 0.75rem 1.5rem;
+ font-size: 1.25rem;
+ line-height: 1.5;
+}
+
+.pagination-lg .page-item:first-child .page-link {
+ border-top-left-radius: 0.3rem;
+ border-bottom-left-radius: 0.3rem;
+}
+
+.pagination-lg .page-item:last-child .page-link {
+ border-top-right-radius: 0.3rem;
+ border-bottom-right-radius: 0.3rem;
+}
+
+.pagination-sm .page-link {
+ padding: 0.25rem 0.5rem;
+ font-size: 0.875rem;
+ line-height: 1.5;
+}
+
+.pagination-sm .page-item:first-child .page-link {
+ border-top-left-radius: 0.2rem;
+ border-bottom-left-radius: 0.2rem;
+}
+
+.pagination-sm .page-item:last-child .page-link {
+ border-top-right-radius: 0.2rem;
+ border-bottom-right-radius: 0.2rem;
+}
+
+.badge {
+ display: inline-block;
+ padding: 0.25em 0.4em;
+ font-size: 75%;
+ font-weight: 700;
+ line-height: 1;
+ text-align: center;
+ white-space: nowrap;
+ vertical-align: baseline;
+ border-radius: 0.25rem;
+}
+
+.badge:empty {
+ display: none;
+}
+
+.btn .badge {
+ position: relative;
+ top: -1px;
+}
+
+.badge-pill {
+ padding-right: 0.6em;
+ padding-left: 0.6em;
+ border-radius: 10rem;
+}
+
+.badge-primary {
+ color: #fff;
+ background-color: #007bff;
+}
+
+.badge-primary[href]:hover, .badge-primary[href]:focus {
+ color: #fff;
+ text-decoration: none;
+ background-color: #0062cc;
+}
+
+.badge-secondary {
+ color: #fff;
+ background-color: #6c757d;
+}
+
+.badge-secondary[href]:hover, .badge-secondary[href]:focus {
+ color: #fff;
+ text-decoration: none;
+ background-color: #545b62;
+}
+
+.badge-success {
+ color: #fff;
+ background-color: #28a745;
+}
+
+.badge-success[href]:hover, .badge-success[href]:focus {
+ color: #fff;
+ text-decoration: none;
+ background-color: #1e7e34;
+}
+
+.badge-info {
+ color: #fff;
+ background-color: #17a2b8;
+}
+
+.badge-info[href]:hover, .badge-info[href]:focus {
+ color: #fff;
+ text-decoration: none;
+ background-color: #117a8b;
+}
+
+.badge-warning {
+ color: #212529;
+ background-color: #ffc107;
+}
+
+.badge-warning[href]:hover, .badge-warning[href]:focus {
+ color: #212529;
+ text-decoration: none;
+ background-color: #d39e00;
+}
+
+.badge-danger {
+ color: #fff;
+ background-color: #dc3545;
+}
+
+.badge-danger[href]:hover, .badge-danger[href]:focus {
+ color: #fff;
+ text-decoration: none;
+ background-color: #bd2130;
+}
+
+.badge-light {
+ color: #212529;
+ background-color: #f8f9fa;
+}
+
+.badge-light[href]:hover, .badge-light[href]:focus {
+ color: #212529;
+ text-decoration: none;
+ background-color: #dae0e5;
+}
+
+.badge-dark {
+ color: #fff;
+ background-color: #343a40;
+}
+
+.badge-dark[href]:hover, .badge-dark[href]:focus {
+ color: #fff;
+ text-decoration: none;
+ background-color: #1d2124;
+}
+
+.jumbotron {
+ padding: 2rem 1rem;
+ margin-bottom: 2rem;
+ background-color: #e9ecef;
+ border-radius: 0.3rem;
+}
+
+@media (min-width: 576px) {
+ .jumbotron {
+ padding: 4rem 2rem;
+ }
+}
+
+.jumbotron-fluid {
+ padding-right: 0;
+ padding-left: 0;
+ border-radius: 0;
+}
+
+.alert {
+ position: relative;
+ padding: 0.75rem 1.25rem;
+ margin-bottom: 1rem;
+ border: 1px solid transparent;
+ border-radius: 0.25rem;
+}
+
+.alert-heading {
+ color: inherit;
+}
+
+.alert-link {
+ font-weight: 700;
+}
+
+.alert-dismissible {
+ padding-right: 4rem;
+}
+
+.alert-dismissible .close {
+ position: absolute;
+ top: 0;
+ right: 0;
+ padding: 0.75rem 1.25rem;
+ color: inherit;
+}
+
+.alert-primary {
+ color: #004085;
+ background-color: #cce5ff;
+ border-color: #b8daff;
+}
+
+.alert-primary hr {
+ border-top-color: #9fcdff;
+}
+
+.alert-primary .alert-link {
+ color: #002752;
+}
+
+.alert-secondary {
+ color: #383d41;
+ background-color: #e2e3e5;
+ border-color: #d6d8db;
+}
+
+.alert-secondary hr {
+ border-top-color: #c8cbcf;
+}
+
+.alert-secondary .alert-link {
+ color: #202326;
+}
+
+.alert-success {
+ color: #155724;
+ background-color: #d4edda;
+ border-color: #c3e6cb;
+}
+
+.alert-success hr {
+ border-top-color: #b1dfbb;
+}
+
+.alert-success .alert-link {
+ color: #0b2e13;
+}
+
+.alert-info {
+ color: #0c5460;
+ background-color: #d1ecf1;
+ border-color: #bee5eb;
+}
+
+.alert-info hr {
+ border-top-color: #abdde5;
+}
+
+.alert-info .alert-link {
+ color: #062c33;
+}
+
+.alert-warning {
+ color: #856404;
+ background-color: #fff3cd;
+ border-color: #ffeeba;
+}
+
+.alert-warning hr {
+ border-top-color: #ffe8a1;
+}
+
+.alert-warning .alert-link {
+ color: #533f03;
+}
+
+.alert-danger {
+ color: #721c24;
+ background-color: #f8d7da;
+ border-color: #f5c6cb;
+}
+
+.alert-danger hr {
+ border-top-color: #f1b0b7;
+}
+
+.alert-danger .alert-link {
+ color: #491217;
+}
+
+.alert-light {
+ color: #818182;
+ background-color: #fefefe;
+ border-color: #fdfdfe;
+}
+
+.alert-light hr {
+ border-top-color: #ececf6;
+}
+
+.alert-light .alert-link {
+ color: #686868;
+}
+
+.alert-dark {
+ color: #1b1e21;
+ background-color: #d6d8d9;
+ border-color: #c6c8ca;
+}
+
+.alert-dark hr {
+ border-top-color: #b9bbbe;
+}
+
+.alert-dark .alert-link {
+ color: #040505;
+}
+
+@-webkit-keyframes progress-bar-stripes {
+ from {
+ background-position: 1rem 0;
+ }
+ to {
+ background-position: 0 0;
+ }
+}
+
+@keyframes progress-bar-stripes {
+ from {
+ background-position: 1rem 0;
+ }
+ to {
+ background-position: 0 0;
+ }
+}
+
+.progress {
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ height: 1rem;
+ overflow: hidden;
+ font-size: 0.75rem;
+ background-color: #e9ecef;
+ border-radius: 0.25rem;
+}
+
+.progress-bar {
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -webkit-box-orient: vertical;
+ -webkit-box-direction: normal;
+ -ms-flex-direction: column;
+ flex-direction: column;
+ -webkit-box-pack: center;
+ -ms-flex-pack: center;
+ justify-content: center;
+ color: #fff;
+ text-align: center;
+ background-color: #007bff;
+ transition: width 0.6s ease;
+}
+
+.progress-bar-striped {
+ background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+ background-size: 1rem 1rem;
+}
+
+.progress-bar-animated {
+ -webkit-animation: progress-bar-stripes 1s linear infinite;
+ animation: progress-bar-stripes 1s linear infinite;
+}
+
+.media {
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -webkit-box-align: start;
+ -ms-flex-align: start;
+ align-items: flex-start;
+}
+
+.media-body {
+ -webkit-box-flex: 1;
+ -ms-flex: 1;
+ flex: 1;
+}
+
+.list-group {
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -webkit-box-orient: vertical;
+ -webkit-box-direction: normal;
+ -ms-flex-direction: column;
+ flex-direction: column;
+ padding-left: 0;
+ margin-bottom: 0;
+}
+
+.list-group-item-action {
+ width: 100%;
+ color: #495057;
+ text-align: inherit;
+}
+
+.list-group-item-action:hover, .list-group-item-action:focus {
+ color: #495057;
+ text-decoration: none;
+ background-color: #f8f9fa;
+}
+
+.list-group-item-action:active {
+ color: #212529;
+ background-color: #e9ecef;
+}
+
+.list-group-item {
+ position: relative;
+ display: block;
+ padding: 0.75rem 1.25rem;
+ margin-bottom: -1px;
+ background-color: #fff;
+ border: 1px solid rgba(0, 0, 0, 0.125);
+}
+
+.list-group-item:first-child {
+ border-top-left-radius: 0.25rem;
+ border-top-right-radius: 0.25rem;
+}
+
+.list-group-item:last-child {
+ margin-bottom: 0;
+ border-bottom-right-radius: 0.25rem;
+ border-bottom-left-radius: 0.25rem;
+}
+
+.list-group-item:hover, .list-group-item:focus {
+ z-index: 1;
+ text-decoration: none;
+}
+
+.list-group-item.disabled, .list-group-item:disabled {
+ color: #6c757d;
+ background-color: #fff;
+}
+
+.list-group-item.active {
+ z-index: 2;
+ color: #fff;
+ background-color: #007bff;
+ border-color: #007bff;
+}
+
+.list-group-flush .list-group-item {
+ border-right: 0;
+ border-left: 0;
+ border-radius: 0;
+}
+
+.list-group-flush:first-child .list-group-item:first-child {
+ border-top: 0;
+}
+
+.list-group-flush:last-child .list-group-item:last-child {
+ border-bottom: 0;
+}
+
+.list-group-item-primary {
+ color: #004085;
+ background-color: #b8daff;
+}
+
+.list-group-item-primary.list-group-item-action:hover, .list-group-item-primary.list-group-item-action:focus {
+ color: #004085;
+ background-color: #9fcdff;
+}
+
+.list-group-item-primary.list-group-item-action.active {
+ color: #fff;
+ background-color: #004085;
+ border-color: #004085;
+}
+
+.list-group-item-secondary {
+ color: #383d41;
+ background-color: #d6d8db;
+}
+
+.list-group-item-secondary.list-group-item-action:hover, .list-group-item-secondary.list-group-item-action:focus {
+ color: #383d41;
+ background-color: #c8cbcf;
+}
+
+.list-group-item-secondary.list-group-item-action.active {
+ color: #fff;
+ background-color: #383d41;
+ border-color: #383d41;
+}
+
+.list-group-item-success {
+ color: #155724;
+ background-color: #c3e6cb;
+}
+
+.list-group-item-success.list-group-item-action:hover, .list-group-item-success.list-group-item-action:focus {
+ color: #155724;
+ background-color: #b1dfbb;
+}
+
+.list-group-item-success.list-group-item-action.active {
+ color: #fff;
+ background-color: #155724;
+ border-color: #155724;
+}
+
+.list-group-item-info {
+ color: #0c5460;
+ background-color: #bee5eb;
+}
+
+.list-group-item-info.list-group-item-action:hover, .list-group-item-info.list-group-item-action:focus {
+ color: #0c5460;
+ background-color: #abdde5;
+}
+
+.list-group-item-info.list-group-item-action.active {
+ color: #fff;
+ background-color: #0c5460;
+ border-color: #0c5460;
+}
+
+.list-group-item-warning {
+ color: #856404;
+ background-color: #ffeeba;
+}
+
+.list-group-item-warning.list-group-item-action:hover, .list-group-item-warning.list-group-item-action:focus {
+ color: #856404;
+ background-color: #ffe8a1;
+}
+
+.list-group-item-warning.list-group-item-action.active {
+ color: #fff;
+ background-color: #856404;
+ border-color: #856404;
+}
+
+.list-group-item-danger {
+ color: #721c24;
+ background-color: #f5c6cb;
+}
+
+.list-group-item-danger.list-group-item-action:hover, .list-group-item-danger.list-group-item-action:focus {
+ color: #721c24;
+ background-color: #f1b0b7;
+}
+
+.list-group-item-danger.list-group-item-action.active {
+ color: #fff;
+ background-color: #721c24;
+ border-color: #721c24;
+}
+
+.list-group-item-light {
+ color: #818182;
+ background-color: #fdfdfe;
+}
+
+.list-group-item-light.list-group-item-action:hover, .list-group-item-light.list-group-item-action:focus {
+ color: #818182;
+ background-color: #ececf6;
+}
+
+.list-group-item-light.list-group-item-action.active {
+ color: #fff;
+ background-color: #818182;
+ border-color: #818182;
+}
+
+.list-group-item-dark {
+ color: #1b1e21;
+ background-color: #c6c8ca;
+}
+
+.list-group-item-dark.list-group-item-action:hover, .list-group-item-dark.list-group-item-action:focus {
+ color: #1b1e21;
+ background-color: #b9bbbe;
+}
+
+.list-group-item-dark.list-group-item-action.active {
+ color: #fff;
+ background-color: #1b1e21;
+ border-color: #1b1e21;
+}
+
+.close {
+ float: right;
+ font-size: 1.5rem;
+ font-weight: 700;
+ line-height: 1;
+ color: #000;
+ text-shadow: 0 1px 0 #fff;
+ opacity: .5;
+}
+
+.close:hover, .close:focus {
+ color: #000;
+ text-decoration: none;
+ opacity: .75;
+}
+
+.close:not(:disabled):not(.disabled) {
+ cursor: pointer;
+}
+
+button.close {
+ padding: 0;
+ background-color: transparent;
+ border: 0;
+ -webkit-appearance: none;
+}
+
+.modal-open {
+ overflow: hidden;
+}
+
+.modal {
+ position: fixed;
+ top: 0;
+ right: 0;
+ bottom: 0;
+ left: 0;
+ z-index: 1050;
+ display: none;
+ overflow: hidden;
+ outline: 0;
+}
+
+.modal-open .modal {
+ overflow-x: hidden;
+ overflow-y: auto;
+}
+
+.modal-dialog {
+ position: relative;
+ width: auto;
+ margin: 0.5rem;
+ pointer-events: none;
+}
+
+.modal.fade .modal-dialog {
+ transition: -webkit-transform 0.3s ease-out;
+ transition: transform 0.3s ease-out;
+ transition: transform 0.3s ease-out, -webkit-transform 0.3s ease-out;
+ -webkit-transform: translate(0, -25%);
+ transform: translate(0, -25%);
+}
+
+.modal.show .modal-dialog {
+ -webkit-transform: translate(0, 0);
+ transform: translate(0, 0);
+}
+
+.modal-dialog-centered {
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -webkit-box-align: center;
+ -ms-flex-align: center;
+ align-items: center;
+ min-height: calc(100% - (0.5rem * 2));
+}
+
+.modal-content {
+ position: relative;
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -webkit-box-orient: vertical;
+ -webkit-box-direction: normal;
+ -ms-flex-direction: column;
+ flex-direction: column;
+ width: 100%;
+ pointer-events: auto;
+ background-color: #fff;
+ background-clip: padding-box;
+ border: 1px solid rgba(0, 0, 0, 0.2);
+ border-radius: 0.3rem;
+ outline: 0;
+}
+
+.modal-backdrop {
+ position: fixed;
+ top: 0;
+ right: 0;
+ bottom: 0;
+ left: 0;
+ z-index: 1040;
+ background-color: #000;
+}
+
+.modal-backdrop.fade {
+ opacity: 0;
+}
+
+.modal-backdrop.show {
+ opacity: 0.5;
+}
+
+.modal-header {
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -webkit-box-align: start;
+ -ms-flex-align: start;
+ align-items: flex-start;
+ -webkit-box-pack: justify;
+ -ms-flex-pack: justify;
+ justify-content: space-between;
+ padding: 1rem;
+ border-bottom: 1px solid #e9ecef;
+ border-top-left-radius: 0.3rem;
+ border-top-right-radius: 0.3rem;
+}
+
+.modal-header .close {
+ padding: 1rem;
+ margin: -1rem -1rem -1rem auto;
+}
+
+.modal-title {
+ margin-bottom: 0;
+ line-height: 1.5;
+}
+
+.modal-body {
+ position: relative;
+ -webkit-box-flex: 1;
+ -ms-flex: 1 1 auto;
+ flex: 1 1 auto;
+ padding: 1rem;
+}
+
+.modal-footer {
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -webkit-box-align: center;
+ -ms-flex-align: center;
+ align-items: center;
+ -webkit-box-pack: end;
+ -ms-flex-pack: end;
+ justify-content: flex-end;
+ padding: 1rem;
+ border-top: 1px solid #e9ecef;
+}
+
+.modal-footer > :not(:first-child) {
+ margin-left: .25rem;
+}
+
+.modal-footer > :not(:last-child) {
+ margin-right: .25rem;
+}
+
+.modal-scrollbar-measure {
+ position: absolute;
+ top: -9999px;
+ width: 50px;
+ height: 50px;
+ overflow: scroll;
+}
+
+@media (min-width: 576px) {
+ .modal-dialog {
+ max-width: 500px;
+ margin: 1.75rem auto;
+ }
+ .modal-dialog-centered {
+ min-height: calc(100% - (1.75rem * 2));
+ }
+ .modal-sm {
+ max-width: 300px;
+ }
+}
+
+@media (min-width: 992px) {
+ .modal-lg {
+ max-width: 800px;
+ }
+}
+
+.tooltip {
+ position: absolute;
+ z-index: 1070;
+ display: block;
+ margin: 0;
+ font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol";
+ font-style: normal;
+ font-weight: 400;
+ line-height: 1.5;
+ text-align: left;
+ text-align: start;
+ text-decoration: none;
+ text-shadow: none;
+ text-transform: none;
+ letter-spacing: normal;
+ word-break: normal;
+ word-spacing: normal;
+ white-space: normal;
+ line-break: auto;
+ font-size: 0.875rem;
+ word-wrap: break-word;
+ opacity: 0;
+}
+
+.tooltip.show {
+ opacity: 0.9;
+}
+
+.tooltip .arrow {
+ position: absolute;
+ display: block;
+ width: 0.8rem;
+ height: 0.4rem;
+}
+
+.tooltip .arrow::before {
+ position: absolute;
+ content: "";
+ border-color: transparent;
+ border-style: solid;
+}
+
+.bs-tooltip-top, .bs-tooltip-auto[x-placement^="top"] {
+ padding: 0.4rem 0;
+}
+
+.bs-tooltip-top .arrow, .bs-tooltip-auto[x-placement^="top"] .arrow {
+ bottom: 0;
+}
+
+.bs-tooltip-top .arrow::before, .bs-tooltip-auto[x-placement^="top"] .arrow::before {
+ top: 0;
+ border-width: 0.4rem 0.4rem 0;
+ border-top-color: #000;
+}
+
+.bs-tooltip-right, .bs-tooltip-auto[x-placement^="right"] {
+ padding: 0 0.4rem;
+}
+
+.bs-tooltip-right .arrow, .bs-tooltip-auto[x-placement^="right"] .arrow {
+ left: 0;
+ width: 0.4rem;
+ height: 0.8rem;
+}
+
+.bs-tooltip-right .arrow::before, .bs-tooltip-auto[x-placement^="right"] .arrow::before {
+ right: 0;
+ border-width: 0.4rem 0.4rem 0.4rem 0;
+ border-right-color: #000;
+}
+
+.bs-tooltip-bottom, .bs-tooltip-auto[x-placement^="bottom"] {
+ padding: 0.4rem 0;
+}
+
+.bs-tooltip-bottom .arrow, .bs-tooltip-auto[x-placement^="bottom"] .arrow {
+ top: 0;
+}
+
+.bs-tooltip-bottom .arrow::before, .bs-tooltip-auto[x-placement^="bottom"] .arrow::before {
+ bottom: 0;
+ border-width: 0 0.4rem 0.4rem;
+ border-bottom-color: #000;
+}
+
+.bs-tooltip-left, .bs-tooltip-auto[x-placement^="left"] {
+ padding: 0 0.4rem;
+}
+
+.bs-tooltip-left .arrow, .bs-tooltip-auto[x-placement^="left"] .arrow {
+ right: 0;
+ width: 0.4rem;
+ height: 0.8rem;
+}
+
+.bs-tooltip-left .arrow::before, .bs-tooltip-auto[x-placement^="left"] .arrow::before {
+ left: 0;
+ border-width: 0.4rem 0 0.4rem 0.4rem;
+ border-left-color: #000;
+}
+
+.tooltip-inner {
+ max-width: 200px;
+ padding: 0.25rem 0.5rem;
+ color: #fff;
+ text-align: center;
+ background-color: #000;
+ border-radius: 0.25rem;
+}
+
+.popover {
+ position: absolute;
+ top: 0;
+ left: 0;
+ z-index: 1060;
+ display: block;
+ max-width: 276px;
+ font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol";
+ font-style: normal;
+ font-weight: 400;
+ line-height: 1.5;
+ text-align: left;
+ text-align: start;
+ text-decoration: none;
+ text-shadow: none;
+ text-transform: none;
+ letter-spacing: normal;
+ word-break: normal;
+ word-spacing: normal;
+ white-space: normal;
+ line-break: auto;
+ font-size: 0.875rem;
+ word-wrap: break-word;
+ background-color: #fff;
+ background-clip: padding-box;
+ border: 1px solid rgba(0, 0, 0, 0.2);
+ border-radius: 0.3rem;
+}
+
+.popover .arrow {
+ position: absolute;
+ display: block;
+ width: 1rem;
+ height: 0.5rem;
+ margin: 0 0.3rem;
+}
+
+.popover .arrow::before, .popover .arrow::after {
+ position: absolute;
+ display: block;
+ content: "";
+ border-color: transparent;
+ border-style: solid;
+}
+
+.bs-popover-top, .bs-popover-auto[x-placement^="top"] {
+ margin-bottom: 0.5rem;
+}
+
+.bs-popover-top .arrow, .bs-popover-auto[x-placement^="top"] .arrow {
+ bottom: calc((0.5rem + 1px) * -1);
+}
+
+.bs-popover-top .arrow::before, .bs-popover-auto[x-placement^="top"] .arrow::before,
+.bs-popover-top .arrow::after, .bs-popover-auto[x-placement^="top"] .arrow::after {
+ border-width: 0.5rem 0.5rem 0;
+}
+
+.bs-popover-top .arrow::before, .bs-popover-auto[x-placement^="top"] .arrow::before {
+ bottom: 0;
+ border-top-color: rgba(0, 0, 0, 0.25);
+}
+
+.bs-popover-top .arrow::after, .bs-popover-auto[x-placement^="top"] .arrow::after {
+ bottom: 1px;
+ border-top-color: #fff;
+}
+
+.bs-popover-right, .bs-popover-auto[x-placement^="right"] {
+ margin-left: 0.5rem;
+}
+
+.bs-popover-right .arrow, .bs-popover-auto[x-placement^="right"] .arrow {
+ left: calc((0.5rem + 1px) * -1);
+ width: 0.5rem;
+ height: 1rem;
+ margin: 0.3rem 0;
+}
+
+.bs-popover-right .arrow::before, .bs-popover-auto[x-placement^="right"] .arrow::before,
+.bs-popover-right .arrow::after, .bs-popover-auto[x-placement^="right"] .arrow::after {
+ border-width: 0.5rem 0.5rem 0.5rem 0;
+}
+
+.bs-popover-right .arrow::before, .bs-popover-auto[x-placement^="right"] .arrow::before {
+ left: 0;
+ border-right-color: rgba(0, 0, 0, 0.25);
+}
+
+.bs-popover-right .arrow::after, .bs-popover-auto[x-placement^="right"] .arrow::after {
+ left: 1px;
+ border-right-color: #fff;
+}
+
+.bs-popover-bottom, .bs-popover-auto[x-placement^="bottom"] {
+ margin-top: 0.5rem;
+}
+
+.bs-popover-bottom .arrow, .bs-popover-auto[x-placement^="bottom"] .arrow {
+ top: calc((0.5rem + 1px) * -1);
+}
+
+.bs-popover-bottom .arrow::before, .bs-popover-auto[x-placement^="bottom"] .arrow::before,
+.bs-popover-bottom .arrow::after, .bs-popover-auto[x-placement^="bottom"] .arrow::after {
+ border-width: 0 0.5rem 0.5rem 0.5rem;
+}
+
+.bs-popover-bottom .arrow::before, .bs-popover-auto[x-placement^="bottom"] .arrow::before {
+ top: 0;
+ border-bottom-color: rgba(0, 0, 0, 0.25);
+}
+
+.bs-popover-bottom .arrow::after, .bs-popover-auto[x-placement^="bottom"] .arrow::after {
+ top: 1px;
+ border-bottom-color: #fff;
+}
+
+.bs-popover-bottom .popover-header::before, .bs-popover-auto[x-placement^="bottom"] .popover-header::before {
+ position: absolute;
+ top: 0;
+ left: 50%;
+ display: block;
+ width: 1rem;
+ margin-left: -0.5rem;
+ content: "";
+ border-bottom: 1px solid #f7f7f7;
+}
+
+.bs-popover-left, .bs-popover-auto[x-placement^="left"] {
+ margin-right: 0.5rem;
+}
+
+.bs-popover-left .arrow, .bs-popover-auto[x-placement^="left"] .arrow {
+ right: calc((0.5rem + 1px) * -1);
+ width: 0.5rem;
+ height: 1rem;
+ margin: 0.3rem 0;
+}
+
+.bs-popover-left .arrow::before, .bs-popover-auto[x-placement^="left"] .arrow::before,
+.bs-popover-left .arrow::after, .bs-popover-auto[x-placement^="left"] .arrow::after {
+ border-width: 0.5rem 0 0.5rem 0.5rem;
+}
+
+.bs-popover-left .arrow::before, .bs-popover-auto[x-placement^="left"] .arrow::before {
+ right: 0;
+ border-left-color: rgba(0, 0, 0, 0.25);
+}
+
+.bs-popover-left .arrow::after, .bs-popover-auto[x-placement^="left"] .arrow::after {
+ right: 1px;
+ border-left-color: #fff;
+}
+
+.popover-header {
+ padding: 0.5rem 0.75rem;
+ margin-bottom: 0;
+ font-size: 1rem;
+ color: inherit;
+ background-color: #f7f7f7;
+ border-bottom: 1px solid #ebebeb;
+ border-top-left-radius: calc(0.3rem - 1px);
+ border-top-right-radius: calc(0.3rem - 1px);
+}
+
+.popover-header:empty {
+ display: none;
+}
+
+.popover-body {
+ padding: 0.5rem 0.75rem;
+ color: #212529;
+}
+
+.carousel {
+ position: relative;
+}
+
+.carousel-inner {
+ position: relative;
+ width: 100%;
+ overflow: hidden;
+}
+
+.carousel-item {
+ position: relative;
+ display: none;
+ -webkit-box-align: center;
+ -ms-flex-align: center;
+ align-items: center;
+ width: 100%;
+ transition: -webkit-transform 0.6s ease;
+ transition: transform 0.6s ease;
+ transition: transform 0.6s ease, -webkit-transform 0.6s ease;
+ -webkit-backface-visibility: hidden;
+ backface-visibility: hidden;
+ -webkit-perspective: 1000px;
+ perspective: 1000px;
+}
+
+.carousel-item.active,
+.carousel-item-next,
+.carousel-item-prev {
+ display: block;
+}
+
+.carousel-item-next,
+.carousel-item-prev {
+ position: absolute;
+ top: 0;
+}
+
+.carousel-item-next.carousel-item-left,
+.carousel-item-prev.carousel-item-right {
+ -webkit-transform: translateX(0);
+ transform: translateX(0);
+}
+
+@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) {
+ .carousel-item-next.carousel-item-left,
+ .carousel-item-prev.carousel-item-right {
+ -webkit-transform: translate3d(0, 0, 0);
+ transform: translate3d(0, 0, 0);
+ }
+}
+
+.carousel-item-next,
+.active.carousel-item-right {
+ -webkit-transform: translateX(100%);
+ transform: translateX(100%);
+}
+
+@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) {
+ .carousel-item-next,
+ .active.carousel-item-right {
+ -webkit-transform: translate3d(100%, 0, 0);
+ transform: translate3d(100%, 0, 0);
+ }
+}
+
+.carousel-item-prev,
+.active.carousel-item-left {
+ -webkit-transform: translateX(-100%);
+ transform: translateX(-100%);
+}
+
+@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) {
+ .carousel-item-prev,
+ .active.carousel-item-left {
+ -webkit-transform: translate3d(-100%, 0, 0);
+ transform: translate3d(-100%, 0, 0);
+ }
+}
+
+.carousel-control-prev,
+.carousel-control-next {
+ position: absolute;
+ top: 0;
+ bottom: 0;
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -webkit-box-align: center;
+ -ms-flex-align: center;
+ align-items: center;
+ -webkit-box-pack: center;
+ -ms-flex-pack: center;
+ justify-content: center;
+ width: 15%;
+ color: #fff;
+ text-align: center;
+ opacity: 0.5;
+}
+
+.carousel-control-prev:hover, .carousel-control-prev:focus,
+.carousel-control-next:hover,
+.carousel-control-next:focus {
+ color: #fff;
+ text-decoration: none;
+ outline: 0;
+ opacity: .9;
+}
+
+.carousel-control-prev {
+ left: 0;
+}
+
+.carousel-control-next {
+ right: 0;
+}
+
+.carousel-control-prev-icon,
+.carousel-control-next-icon {
+ display: inline-block;
+ width: 20px;
+ height: 20px;
+ background: transparent no-repeat center center;
+ background-size: 100% 100%;
+}
+
+.carousel-control-prev-icon {
+ background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M5.25 0l-4 4 4 4 1.5-1.5-2.5-2.5 2.5-2.5-1.5-1.5z'/%3E%3C/svg%3E");
+}
+
+.carousel-control-next-icon {
+ background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M2.75 0l-1.5 1.5 2.5 2.5-2.5 2.5 1.5 1.5 4-4-4-4z'/%3E%3C/svg%3E");
+}
+
+.carousel-indicators {
+ position: absolute;
+ right: 0;
+ bottom: 10px;
+ left: 0;
+ z-index: 15;
+ display: -webkit-box;
+ display: -ms-flexbox;
+ display: flex;
+ -webkit-box-pack: center;
+ -ms-flex-pack: center;
+ justify-content: center;
+ padding-left: 0;
+ margin-right: 15%;
+ margin-left: 15%;
+ list-style: none;
+}
+
+.carousel-indicators li {
+ position: relative;
+ -webkit-box-flex: 0;
+ -ms-flex: 0 1 auto;
+ flex: 0 1 auto;
+ width: 30px;
+ height: 3px;
+ margin-right: 3px;
+ margin-left: 3px;
+ text-indent: -999px;
+ background-color: rgba(255, 255, 255, 0.5);
+}
+
+.carousel-indicators li::before {
+ position: absolute;
+ top: -10px;
+ left: 0;
+ display: inline-block;
+ width: 100%;
+ height: 10px;
+ content: "";
+}
+
+.carousel-indicators li::after {
+ position: absolute;
+ bottom: -10px;
+ left: 0;
+ display: inline-block;
+ width: 100%;
+ height: 10px;
+ content: "";
+}
+
+.carousel-indicators .active {
+ background-color: #fff;
+}
+
+.carousel-caption {
+ position: absolute;
+ right: 15%;
+ bottom: 20px;
+ left: 15%;
+ z-index: 10;
+ padding-top: 20px;
+ padding-bottom: 20px;
+ color: #fff;
+ text-align: center;
+}
+
+.align-baseline {
+ vertical-align: baseline !important;
+}
+
+.align-top {
+ vertical-align: top !important;
+}
+
+.align-middle {
+ vertical-align: middle !important;
+}
+
+.align-bottom {
+ vertical-align: bottom !important;
+}
+
+.align-text-bottom {
+ vertical-align: text-bottom !important;
+}
+
+.align-text-top {
+ vertical-align: text-top !important;
+}
+
+.bg-primary {
+ background-color: #007bff !important;
+}
+
+a.bg-primary:hover, a.bg-primary:focus,
+button.bg-primary:hover,
+button.bg-primary:focus {
+ background-color: #0062cc !important;
+}
+
+.bg-secondary {
+ background-color: #6c757d !important;
+}
+
+a.bg-secondary:hover, a.bg-secondary:focus,
+button.bg-secondary:hover,
+button.bg-secondary:focus {
+ background-color: #545b62 !important;
+}
+
+.bg-success {
+ background-color: #28a745 !important;
+}
+
+a.bg-success:hover, a.bg-success:focus,
+button.bg-success:hover,
+button.bg-success:focus {
+ background-color: #1e7e34 !important;
+}
+
+.bg-info {
+ background-color: #17a2b8 !important;
+}
+
+a.bg-info:hover, a.bg-info:focus,
+button.bg-info:hover,
+button.bg-info:focus {
+ background-color: #117a8b !important;
+}
+
+.bg-warning {
+ background-color: #ffc107 !important;
+}
+
+a.bg-warning:hover, a.bg-warning:focus,
+button.bg-warning:hover,
+button.bg-warning:focus {
+ background-color: #d39e00 !important;
+}
+
+.bg-danger {
+ background-color: #dc3545 !important;
+}
+
+a.bg-danger:hover, a.bg-danger:focus,
+button.bg-danger:hover,
+button.bg-danger:focus {
+ background-color: #bd2130 !important;
+}
+
+.bg-light {
+ background-color: #f8f9fa !important;
+}
+
+a.bg-light:hover, a.bg-light:focus,
+button.bg-light:hover,
+button.bg-light:focus {
+ background-color: #dae0e5 !important;
+}
+
+.bg-dark {
+ background-color: #343a40 !important;
+}
+
+a.bg-dark:hover, a.bg-dark:focus,
+button.bg-dark:hover,
+button.bg-dark:focus {
+ background-color: #1d2124 !important;
+}
+
+.bg-white {
+ background-color: #fff !important;
+}
+
+.bg-transparent {
+ background-color: transparent !important;
+}
+
+.border {
+ border: 1px solid #dee2e6 !important;
+}
+
+.border-top {
+ border-top: 1px solid #dee2e6 !important;
+}
+
+.border-right {
+ border-right: 1px solid #dee2e6 !important;
+}
+
+.border-bottom {
+ border-bottom: 1px solid #dee2e6 !important;
+}
+
+.border-left {
+ border-left: 1px solid #dee2e6 !important;
+}
+
+.border-0 {
+ border: 0 !important;
+}
+
+.border-top-0 {
+ border-top: 0 !important;
+}
+
+.border-right-0 {
+ border-right: 0 !important;
+}
+
+.border-bottom-0 {
+ border-bottom: 0 !important;
+}
+
+.border-left-0 {
+ border-left: 0 !important;
+}
+
+.border-primary {
+ border-color: #007bff !important;
+}
+
+.border-secondary {
+ border-color: #6c757d !important;
+}
+
+.border-success {
+ border-color: #28a745 !important;
+}
+
+.border-info {
+ border-color: #17a2b8 !important;
+}
+
+.border-warning {
+ border-color: #ffc107 !important;
+}
+
+.border-danger {
+ border-color: #dc3545 !important;
+}
+
+.border-light {
+ border-color: #f8f9fa !important;
+}
+
+.border-dark {
+ border-color: #343a40 !important;
+}
+
+.border-white {
+ border-color: #fff !important;
+}
+
+.rounded {
+ border-radius: 0.25rem !important;
+}
+
+.rounded-top {
+ border-top-left-radius: 0.25rem !important;
+ border-top-right-radius: 0.25rem !important;
+}
+
+.rounded-right {
+ border-top-right-radius: 0.25rem !important;
+ border-bottom-right-radius: 0.25rem !important;
+}
+
+.rounded-bottom {
+ border-bottom-right-radius: 0.25rem !important;
+ border-bottom-left-radius: 0.25rem !important;
+}
+
+.rounded-left {
+ border-top-left-radius: 0.25rem !important;
+ border-bottom-left-radius: 0.25rem !important;
+}
+
+.rounded-circle {
+ border-radius: 50% !important;
+}
+
+.rounded-0 {
+ border-radius: 0 !important;
+}
+
+.clearfix::after {
+ display: block;
+ clear: both;
+ content: "";
+}
+
+.d-none {
+ display: none !important;
+}
+
+.d-inline {
+ display: inline !important;
+}
+
+.d-inline-block {
+ display: inline-block !important;
+}
+
+.d-block {
+ display: block !important;
+}
+
+.d-table {
+ display: table !important;
+}
+
+.d-table-row {
+ display: table-row !important;
+}
+
+.d-table-cell {
+ display: table-cell !important;
+}
+
+.d-flex {
+ display: -webkit-box !important;
+ display: -ms-flexbox !important;
+ display: flex !important;
+}
+
+.d-inline-flex {
+ display: -webkit-inline-box !important;
+ display: -ms-inline-flexbox !important;
+ display: inline-flex !important;
+}
+
+@media (min-width: 576px) {
+ .d-sm-none {
+ display: none !important;
+ }
+ .d-sm-inline {
+ display: inline !important;
+ }
+ .d-sm-inline-block {
+ display: inline-block !important;
+ }
+ .d-sm-block {
+ display: block !important;
+ }
+ .d-sm-table {
+ display: table !important;
+ }
+ .d-sm-table-row {
+ display: table-row !important;
+ }
+ .d-sm-table-cell {
+ display: table-cell !important;
+ }
+ .d-sm-flex {
+ display: -webkit-box !important;
+ display: -ms-flexbox !important;
+ display: flex !important;
+ }
+ .d-sm-inline-flex {
+ display: -webkit-inline-box !important;
+ display: -ms-inline-flexbox !important;
+ display: inline-flex !important;
+ }
+}
+
+@media (min-width: 768px) {
+ .d-md-none {
+ display: none !important;
+ }
+ .d-md-inline {
+ display: inline !important;
+ }
+ .d-md-inline-block {
+ display: inline-block !important;
+ }
+ .d-md-block {
+ display: block !important;
+ }
+ .d-md-table {
+ display: table !important;
+ }
+ .d-md-table-row {
+ display: table-row !important;
+ }
+ .d-md-table-cell {
+ display: table-cell !important;
+ }
+ .d-md-flex {
+ display: -webkit-box !important;
+ display: -ms-flexbox !important;
+ display: flex !important;
+ }
+ .d-md-inline-flex {
+ display: -webkit-inline-box !important;
+ display: -ms-inline-flexbox !important;
+ display: inline-flex !important;
+ }
+}
+
+@media (min-width: 992px) {
+ .d-lg-none {
+ display: none !important;
+ }
+ .d-lg-inline {
+ display: inline !important;
+ }
+ .d-lg-inline-block {
+ display: inline-block !important;
+ }
+ .d-lg-block {
+ display: block !important;
+ }
+ .d-lg-table {
+ display: table !important;
+ }
+ .d-lg-table-row {
+ display: table-row !important;
+ }
+ .d-lg-table-cell {
+ display: table-cell !important;
+ }
+ .d-lg-flex {
+ display: -webkit-box !important;
+ display: -ms-flexbox !important;
+ display: flex !important;
+ }
+ .d-lg-inline-flex {
+ display: -webkit-inline-box !important;
+ display: -ms-inline-flexbox !important;
+ display: inline-flex !important;
+ }
+}
+
+@media (min-width: 1200px) {
+ .d-xl-none {
+ display: none !important;
+ }
+ .d-xl-inline {
+ display: inline !important;
+ }
+ .d-xl-inline-block {
+ display: inline-block !important;
+ }
+ .d-xl-block {
+ display: block !important;
+ }
+ .d-xl-table {
+ display: table !important;
+ }
+ .d-xl-table-row {
+ display: table-row !important;
+ }
+ .d-xl-table-cell {
+ display: table-cell !important;
+ }
+ .d-xl-flex {
+ display: -webkit-box !important;
+ display: -ms-flexbox !important;
+ display: flex !important;
+ }
+ .d-xl-inline-flex {
+ display: -webkit-inline-box !important;
+ display: -ms-inline-flexbox !important;
+ display: inline-flex !important;
+ }
+}
+
+@media print {
+ .d-print-none {
+ display: none !important;
+ }
+ .d-print-inline {
+ display: inline !important;
+ }
+ .d-print-inline-block {
+ display: inline-block !important;
+ }
+ .d-print-block {
+ display: block !important;
+ }
+ .d-print-table {
+ display: table !important;
+ }
+ .d-print-table-row {
+ display: table-row !important;
+ }
+ .d-print-table-cell {
+ display: table-cell !important;
+ }
+ .d-print-flex {
+ display: -webkit-box !important;
+ display: -ms-flexbox !important;
+ display: flex !important;
+ }
+ .d-print-inline-flex {
+ display: -webkit-inline-box !important;
+ display: -ms-inline-flexbox !important;
+ display: inline-flex !important;
+ }
+}
+
+.embed-responsive {
+ position: relative;
+ display: block;
+ width: 100%;
+ padding: 0;
+ overflow: hidden;
+}
+
+.embed-responsive::before {
+ display: block;
+ content: "";
+}
+
+.embed-responsive .embed-responsive-item,
+.embed-responsive iframe,
+.embed-responsive embed,
+.embed-responsive object,
+.embed-responsive video {
+ position: absolute;
+ top: 0;
+ bottom: 0;
+ left: 0;
+ width: 100%;
+ height: 100%;
+ border: 0;
+}
+
+.embed-responsive-21by9::before {
+ padding-top: 42.857143%;
+}
+
+.embed-responsive-16by9::before {
+ padding-top: 56.25%;
+}
+
+.embed-responsive-4by3::before {
+ padding-top: 75%;
+}
+
+.embed-responsive-1by1::before {
+ padding-top: 100%;
+}
+
+.flex-row {
+ -webkit-box-orient: horizontal !important;
+ -webkit-box-direction: normal !important;
+ -ms-flex-direction: row !important;
+ flex-direction: row !important;
+}
+
+.flex-column {
+ -webkit-box-orient: vertical !important;
+ -webkit-box-direction: normal !important;
+ -ms-flex-direction: column !important;
+ flex-direction: column !important;
+}
+
+.flex-row-reverse {
+ -webkit-box-orient: horizontal !important;
+ -webkit-box-direction: reverse !important;
+ -ms-flex-direction: row-reverse !important;
+ flex-direction: row-reverse !important;
+}
+
+.flex-column-reverse {
+ -webkit-box-orient: vertical !important;
+ -webkit-box-direction: reverse !important;
+ -ms-flex-direction: column-reverse !important;
+ flex-direction: column-reverse !important;
+}
+
+.flex-wrap {
+ -ms-flex-wrap: wrap !important;
+ flex-wrap: wrap !important;
+}
+
+.flex-nowrap {
+ -ms-flex-wrap: nowrap !important;
+ flex-wrap: nowrap !important;
+}
+
+.flex-wrap-reverse {
+ -ms-flex-wrap: wrap-reverse !important;
+ flex-wrap: wrap-reverse !important;
+}
+
+.justify-content-start {
+ -webkit-box-pack: start !important;
+ -ms-flex-pack: start !important;
+ justify-content: flex-start !important;
+}
+
+.justify-content-end {
+ -webkit-box-pack: end !important;
+ -ms-flex-pack: end !important;
+ justify-content: flex-end !important;
+}
+
+.justify-content-center {
+ -webkit-box-pack: center !important;
+ -ms-flex-pack: center !important;
+ justify-content: center !important;
+}
+
+.justify-content-between {
+ -webkit-box-pack: justify !important;
+ -ms-flex-pack: justify !important;
+ justify-content: space-between !important;
+}
+
+.justify-content-around {
+ -ms-flex-pack: distribute !important;
+ justify-content: space-around !important;
+}
+
+.align-items-start {
+ -webkit-box-align: start !important;
+ -ms-flex-align: start !important;
+ align-items: flex-start !important;
+}
+
+.align-items-end {
+ -webkit-box-align: end !important;
+ -ms-flex-align: end !important;
+ align-items: flex-end !important;
+}
+
+.align-items-center {
+ -webkit-box-align: center !important;
+ -ms-flex-align: center !important;
+ align-items: center !important;
+}
+
+.align-items-baseline {
+ -webkit-box-align: baseline !important;
+ -ms-flex-align: baseline !important;
+ align-items: baseline !important;
+}
+
+.align-items-stretch {
+ -webkit-box-align: stretch !important;
+ -ms-flex-align: stretch !important;
+ align-items: stretch !important;
+}
+
+.align-content-start {
+ -ms-flex-line-pack: start !important;
+ align-content: flex-start !important;
+}
+
+.align-content-end {
+ -ms-flex-line-pack: end !important;
+ align-content: flex-end !important;
+}
+
+.align-content-center {
+ -ms-flex-line-pack: center !important;
+ align-content: center !important;
+}
+
+.align-content-between {
+ -ms-flex-line-pack: justify !important;
+ align-content: space-between !important;
+}
+
+.align-content-around {
+ -ms-flex-line-pack: distribute !important;
+ align-content: space-around !important;
+}
+
+.align-content-stretch {
+ -ms-flex-line-pack: stretch !important;
+ align-content: stretch !important;
+}
+
+.align-self-auto {
+ -ms-flex-item-align: auto !important;
+ align-self: auto !important;
+}
+
+.align-self-start {
+ -ms-flex-item-align: start !important;
+ align-self: flex-start !important;
+}
+
+.align-self-end {
+ -ms-flex-item-align: end !important;
+ align-self: flex-end !important;
+}
+
+.align-self-center {
+ -ms-flex-item-align: center !important;
+ align-self: center !important;
+}
+
+.align-self-baseline {
+ -ms-flex-item-align: baseline !important;
+ align-self: baseline !important;
+}
+
+.align-self-stretch {
+ -ms-flex-item-align: stretch !important;
+ align-self: stretch !important;
+}
+
+@media (min-width: 576px) {
+ .flex-sm-row {
+ -webkit-box-orient: horizontal !important;
+ -webkit-box-direction: normal !important;
+ -ms-flex-direction: row !important;
+ flex-direction: row !important;
+ }
+ .flex-sm-column {
+ -webkit-box-orient: vertical !important;
+ -webkit-box-direction: normal !important;
+ -ms-flex-direction: column !important;
+ flex-direction: column !important;
+ }
+ .flex-sm-row-reverse {
+ -webkit-box-orient: horizontal !important;
+ -webkit-box-direction: reverse !important;
+ -ms-flex-direction: row-reverse !important;
+ flex-direction: row-reverse !important;
+ }
+ .flex-sm-column-reverse {
+ -webkit-box-orient: vertical !important;
+ -webkit-box-direction: reverse !important;
+ -ms-flex-direction: column-reverse !important;
+ flex-direction: column-reverse !important;
+ }
+ .flex-sm-wrap {
+ -ms-flex-wrap: wrap !important;
+ flex-wrap: wrap !important;
+ }
+ .flex-sm-nowrap {
+ -ms-flex-wrap: nowrap !important;
+ flex-wrap: nowrap !important;
+ }
+ .flex-sm-wrap-reverse {
+ -ms-flex-wrap: wrap-reverse !important;
+ flex-wrap: wrap-reverse !important;
+ }
+ .justify-content-sm-start {
+ -webkit-box-pack: start !important;
+ -ms-flex-pack: start !important;
+ justify-content: flex-start !important;
+ }
+ .justify-content-sm-end {
+ -webkit-box-pack: end !important;
+ -ms-flex-pack: end !important;
+ justify-content: flex-end !important;
+ }
+ .justify-content-sm-center {
+ -webkit-box-pack: center !important;
+ -ms-flex-pack: center !important;
+ justify-content: center !important;
+ }
+ .justify-content-sm-between {
+ -webkit-box-pack: justify !important;
+ -ms-flex-pack: justify !important;
+ justify-content: space-between !important;
+ }
+ .justify-content-sm-around {
+ -ms-flex-pack: distribute !important;
+ justify-content: space-around !important;
+ }
+ .align-items-sm-start {
+ -webkit-box-align: start !important;
+ -ms-flex-align: start !important;
+ align-items: flex-start !important;
+ }
+ .align-items-sm-end {
+ -webkit-box-align: end !important;
+ -ms-flex-align: end !important;
+ align-items: flex-end !important;
+ }
+ .align-items-sm-center {
+ -webkit-box-align: center !important;
+ -ms-flex-align: center !important;
+ align-items: center !important;
+ }
+ .align-items-sm-baseline {
+ -webkit-box-align: baseline !important;
+ -ms-flex-align: baseline !important;
+ align-items: baseline !important;
+ }
+ .align-items-sm-stretch {
+ -webkit-box-align: stretch !important;
+ -ms-flex-align: stretch !important;
+ align-items: stretch !important;
+ }
+ .align-content-sm-start {
+ -ms-flex-line-pack: start !important;
+ align-content: flex-start !important;
+ }
+ .align-content-sm-end {
+ -ms-flex-line-pack: end !important;
+ align-content: flex-end !important;
+ }
+ .align-content-sm-center {
+ -ms-flex-line-pack: center !important;
+ align-content: center !important;
+ }
+ .align-content-sm-between {
+ -ms-flex-line-pack: justify !important;
+ align-content: space-between !important;
+ }
+ .align-content-sm-around {
+ -ms-flex-line-pack: distribute !important;
+ align-content: space-around !important;
+ }
+ .align-content-sm-stretch {
+ -ms-flex-line-pack: stretch !important;
+ align-content: stretch !important;
+ }
+ .align-self-sm-auto {
+ -ms-flex-item-align: auto !important;
+ align-self: auto !important;
+ }
+ .align-self-sm-start {
+ -ms-flex-item-align: start !important;
+ align-self: flex-start !important;
+ }
+ .align-self-sm-end {
+ -ms-flex-item-align: end !important;
+ align-self: flex-end !important;
+ }
+ .align-self-sm-center {
+ -ms-flex-item-align: center !important;
+ align-self: center !important;
+ }
+ .align-self-sm-baseline {
+ -ms-flex-item-align: baseline !important;
+ align-self: baseline !important;
+ }
+ .align-self-sm-stretch {
+ -ms-flex-item-align: stretch !important;
+ align-self: stretch !important;
+ }
+}
+
+@media (min-width: 768px) {
+ .flex-md-row {
+ -webkit-box-orient: horizontal !important;
+ -webkit-box-direction: normal !important;
+ -ms-flex-direction: row !important;
+ flex-direction: row !important;
+ }
+ .flex-md-column {
+ -webkit-box-orient: vertical !important;
+ -webkit-box-direction: normal !important;
+ -ms-flex-direction: column !important;
+ flex-direction: column !important;
+ }
+ .flex-md-row-reverse {
+ -webkit-box-orient: horizontal !important;
+ -webkit-box-direction: reverse !important;
+ -ms-flex-direction: row-reverse !important;
+ flex-direction: row-reverse !important;
+ }
+ .flex-md-column-reverse {
+ -webkit-box-orient: vertical !important;
+ -webkit-box-direction: reverse !important;
+ -ms-flex-direction: column-reverse !important;
+ flex-direction: column-reverse !important;
+ }
+ .flex-md-wrap {
+ -ms-flex-wrap: wrap !important;
+ flex-wrap: wrap !important;
+ }
+ .flex-md-nowrap {
+ -ms-flex-wrap: nowrap !important;
+ flex-wrap: nowrap !important;
+ }
+ .flex-md-wrap-reverse {
+ -ms-flex-wrap: wrap-reverse !important;
+ flex-wrap: wrap-reverse !important;
+ }
+ .justify-content-md-start {
+ -webkit-box-pack: start !important;
+ -ms-flex-pack: start !important;
+ justify-content: flex-start !important;
+ }
+ .justify-content-md-end {
+ -webkit-box-pack: end !important;
+ -ms-flex-pack: end !important;
+ justify-content: flex-end !important;
+ }
+ .justify-content-md-center {
+ -webkit-box-pack: center !important;
+ -ms-flex-pack: center !important;
+ justify-content: center !important;
+ }
+ .justify-content-md-between {
+ -webkit-box-pack: justify !important;
+ -ms-flex-pack: justify !important;
+ justify-content: space-between !important;
+ }
+ .justify-content-md-around {
+ -ms-flex-pack: distribute !important;
+ justify-content: space-around !important;
+ }
+ .align-items-md-start {
+ -webkit-box-align: start !important;
+ -ms-flex-align: start !important;
+ align-items: flex-start !important;
+ }
+ .align-items-md-end {
+ -webkit-box-align: end !important;
+ -ms-flex-align: end !important;
+ align-items: flex-end !important;
+ }
+ .align-items-md-center {
+ -webkit-box-align: center !important;
+ -ms-flex-align: center !important;
+ align-items: center !important;
+ }
+ .align-items-md-baseline {
+ -webkit-box-align: baseline !important;
+ -ms-flex-align: baseline !important;
+ align-items: baseline !important;
+ }
+ .align-items-md-stretch {
+ -webkit-box-align: stretch !important;
+ -ms-flex-align: stretch !important;
+ align-items: stretch !important;
+ }
+ .align-content-md-start {
+ -ms-flex-line-pack: start !important;
+ align-content: flex-start !important;
+ }
+ .align-content-md-end {
+ -ms-flex-line-pack: end !important;
+ align-content: flex-end !important;
+ }
+ .align-content-md-center {
+ -ms-flex-line-pack: center !important;
+ align-content: center !important;
+ }
+ .align-content-md-between {
+ -ms-flex-line-pack: justify !important;
+ align-content: space-between !important;
+ }
+ .align-content-md-around {
+ -ms-flex-line-pack: distribute !important;
+ align-content: space-around !important;
+ }
+ .align-content-md-stretch {
+ -ms-flex-line-pack: stretch !important;
+ align-content: stretch !important;
+ }
+ .align-self-md-auto {
+ -ms-flex-item-align: auto !important;
+ align-self: auto !important;
+ }
+ .align-self-md-start {
+ -ms-flex-item-align: start !important;
+ align-self: flex-start !important;
+ }
+ .align-self-md-end {
+ -ms-flex-item-align: end !important;
+ align-self: flex-end !important;
+ }
+ .align-self-md-center {
+ -ms-flex-item-align: center !important;
+ align-self: center !important;
+ }
+ .align-self-md-baseline {
+ -ms-flex-item-align: baseline !important;
+ align-self: baseline !important;
+ }
+ .align-self-md-stretch {
+ -ms-flex-item-align: stretch !important;
+ align-self: stretch !important;
+ }
+}
+
+@media (min-width: 992px) {
+ .flex-lg-row {
+ -webkit-box-orient: horizontal !important;
+ -webkit-box-direction: normal !important;
+ -ms-flex-direction: row !important;
+ flex-direction: row !important;
+ }
+ .flex-lg-column {
+ -webkit-box-orient: vertical !important;
+ -webkit-box-direction: normal !important;
+ -ms-flex-direction: column !important;
+ flex-direction: column !important;
+ }
+ .flex-lg-row-reverse {
+ -webkit-box-orient: horizontal !important;
+ -webkit-box-direction: reverse !important;
+ -ms-flex-direction: row-reverse !important;
+ flex-direction: row-reverse !important;
+ }
+ .flex-lg-column-reverse {
+ -webkit-box-orient: vertical !important;
+ -webkit-box-direction: reverse !important;
+ -ms-flex-direction: column-reverse !important;
+ flex-direction: column-reverse !important;
+ }
+ .flex-lg-wrap {
+ -ms-flex-wrap: wrap !important;
+ flex-wrap: wrap !important;
+ }
+ .flex-lg-nowrap {
+ -ms-flex-wrap: nowrap !important;
+ flex-wrap: nowrap !important;
+ }
+ .flex-lg-wrap-reverse {
+ -ms-flex-wrap: wrap-reverse !important;
+ flex-wrap: wrap-reverse !important;
+ }
+ .justify-content-lg-start {
+ -webkit-box-pack: start !important;
+ -ms-flex-pack: start !important;
+ justify-content: flex-start !important;
+ }
+ .justify-content-lg-end {
+ -webkit-box-pack: end !important;
+ -ms-flex-pack: end !important;
+ justify-content: flex-end !important;
+ }
+ .justify-content-lg-center {
+ -webkit-box-pack: center !important;
+ -ms-flex-pack: center !important;
+ justify-content: center !important;
+ }
+ .justify-content-lg-between {
+ -webkit-box-pack: justify !important;
+ -ms-flex-pack: justify !important;
+ justify-content: space-between !important;
+ }
+ .justify-content-lg-around {
+ -ms-flex-pack: distribute !important;
+ justify-content: space-around !important;
+ }
+ .align-items-lg-start {
+ -webkit-box-align: start !important;
+ -ms-flex-align: start !important;
+ align-items: flex-start !important;
+ }
+ .align-items-lg-end {
+ -webkit-box-align: end !important;
+ -ms-flex-align: end !important;
+ align-items: flex-end !important;
+ }
+ .align-items-lg-center {
+ -webkit-box-align: center !important;
+ -ms-flex-align: center !important;
+ align-items: center !important;
+ }
+ .align-items-lg-baseline {
+ -webkit-box-align: baseline !important;
+ -ms-flex-align: baseline !important;
+ align-items: baseline !important;
+ }
+ .align-items-lg-stretch {
+ -webkit-box-align: stretch !important;
+ -ms-flex-align: stretch !important;
+ align-items: stretch !important;
+ }
+ .align-content-lg-start {
+ -ms-flex-line-pack: start !important;
+ align-content: flex-start !important;
+ }
+ .align-content-lg-end {
+ -ms-flex-line-pack: end !important;
+ align-content: flex-end !important;
+ }
+ .align-content-lg-center {
+ -ms-flex-line-pack: center !important;
+ align-content: center !important;
+ }
+ .align-content-lg-between {
+ -ms-flex-line-pack: justify !important;
+ align-content: space-between !important;
+ }
+ .align-content-lg-around {
+ -ms-flex-line-pack: distribute !important;
+ align-content: space-around !important;
+ }
+ .align-content-lg-stretch {
+ -ms-flex-line-pack: stretch !important;
+ align-content: stretch !important;
+ }
+ .align-self-lg-auto {
+ -ms-flex-item-align: auto !important;
+ align-self: auto !important;
+ }
+ .align-self-lg-start {
+ -ms-flex-item-align: start !important;
+ align-self: flex-start !important;
+ }
+ .align-self-lg-end {
+ -ms-flex-item-align: end !important;
+ align-self: flex-end !important;
+ }
+ .align-self-lg-center {
+ -ms-flex-item-align: center !important;
+ align-self: center !important;
+ }
+ .align-self-lg-baseline {
+ -ms-flex-item-align: baseline !important;
+ align-self: baseline !important;
+ }
+ .align-self-lg-stretch {
+ -ms-flex-item-align: stretch !important;
+ align-self: stretch !important;
+ }
+}
+
+@media (min-width: 1200px) {
+ .flex-xl-row {
+ -webkit-box-orient: horizontal !important;
+ -webkit-box-direction: normal !important;
+ -ms-flex-direction: row !important;
+ flex-direction: row !important;
+ }
+ .flex-xl-column {
+ -webkit-box-orient: vertical !important;
+ -webkit-box-direction: normal !important;
+ -ms-flex-direction: column !important;
+ flex-direction: column !important;
+ }
+ .flex-xl-row-reverse {
+ -webkit-box-orient: horizontal !important;
+ -webkit-box-direction: reverse !important;
+ -ms-flex-direction: row-reverse !important;
+ flex-direction: row-reverse !important;
+ }
+ .flex-xl-column-reverse {
+ -webkit-box-orient: vertical !important;
+ -webkit-box-direction: reverse !important;
+ -ms-flex-direction: column-reverse !important;
+ flex-direction: column-reverse !important;
+ }
+ .flex-xl-wrap {
+ -ms-flex-wrap: wrap !important;
+ flex-wrap: wrap !important;
+ }
+ .flex-xl-nowrap {
+ -ms-flex-wrap: nowrap !important;
+ flex-wrap: nowrap !important;
+ }
+ .flex-xl-wrap-reverse {
+ -ms-flex-wrap: wrap-reverse !important;
+ flex-wrap: wrap-reverse !important;
+ }
+ .justify-content-xl-start {
+ -webkit-box-pack: start !important;
+ -ms-flex-pack: start !important;
+ justify-content: flex-start !important;
+ }
+ .justify-content-xl-end {
+ -webkit-box-pack: end !important;
+ -ms-flex-pack: end !important;
+ justify-content: flex-end !important;
+ }
+ .justify-content-xl-center {
+ -webkit-box-pack: center !important;
+ -ms-flex-pack: center !important;
+ justify-content: center !important;
+ }
+ .justify-content-xl-between {
+ -webkit-box-pack: justify !important;
+ -ms-flex-pack: justify !important;
+ justify-content: space-between !important;
+ }
+ .justify-content-xl-around {
+ -ms-flex-pack: distribute !important;
+ justify-content: space-around !important;
+ }
+ .align-items-xl-start {
+ -webkit-box-align: start !important;
+ -ms-flex-align: start !important;
+ align-items: flex-start !important;
+ }
+ .align-items-xl-end {
+ -webkit-box-align: end !important;
+ -ms-flex-align: end !important;
+ align-items: flex-end !important;
+ }
+ .align-items-xl-center {
+ -webkit-box-align: center !important;
+ -ms-flex-align: center !important;
+ align-items: center !important;
+ }
+ .align-items-xl-baseline {
+ -webkit-box-align: baseline !important;
+ -ms-flex-align: baseline !important;
+ align-items: baseline !important;
+ }
+ .align-items-xl-stretch {
+ -webkit-box-align: stretch !important;
+ -ms-flex-align: stretch !important;
+ align-items: stretch !important;
+ }
+ .align-content-xl-start {
+ -ms-flex-line-pack: start !important;
+ align-content: flex-start !important;
+ }
+ .align-content-xl-end {
+ -ms-flex-line-pack: end !important;
+ align-content: flex-end !important;
+ }
+ .align-content-xl-center {
+ -ms-flex-line-pack: center !important;
+ align-content: center !important;
+ }
+ .align-content-xl-between {
+ -ms-flex-line-pack: justify !important;
+ align-content: space-between !important;
+ }
+ .align-content-xl-around {
+ -ms-flex-line-pack: distribute !important;
+ align-content: space-around !important;
+ }
+ .align-content-xl-stretch {
+ -ms-flex-line-pack: stretch !important;
+ align-content: stretch !important;
+ }
+ .align-self-xl-auto {
+ -ms-flex-item-align: auto !important;
+ align-self: auto !important;
+ }
+ .align-self-xl-start {
+ -ms-flex-item-align: start !important;
+ align-self: flex-start !important;
+ }
+ .align-self-xl-end {
+ -ms-flex-item-align: end !important;
+ align-self: flex-end !important;
+ }
+ .align-self-xl-center {
+ -ms-flex-item-align: center !important;
+ align-self: center !important;
+ }
+ .align-self-xl-baseline {
+ -ms-flex-item-align: baseline !important;
+ align-self: baseline !important;
+ }
+ .align-self-xl-stretch {
+ -ms-flex-item-align: stretch !important;
+ align-self: stretch !important;
+ }
+}
+
+.float-left {
+ float: left !important;
+}
+
+.float-right {
+ float: right !important;
+}
+
+.float-none {
+ float: none !important;
+}
+
+@media (min-width: 576px) {
+ .float-sm-left {
+ float: left !important;
+ }
+ .float-sm-right {
+ float: right !important;
+ }
+ .float-sm-none {
+ float: none !important;
+ }
+}
+
+@media (min-width: 768px) {
+ .float-md-left {
+ float: left !important;
+ }
+ .float-md-right {
+ float: right !important;
+ }
+ .float-md-none {
+ float: none !important;
+ }
+}
+
+@media (min-width: 992px) {
+ .float-lg-left {
+ float: left !important;
+ }
+ .float-lg-right {
+ float: right !important;
+ }
+ .float-lg-none {
+ float: none !important;
+ }
+}
+
+@media (min-width: 1200px) {
+ .float-xl-left {
+ float: left !important;
+ }
+ .float-xl-right {
+ float: right !important;
+ }
+ .float-xl-none {
+ float: none !important;
+ }
+}
+
+.position-static {
+ position: static !important;
+}
+
+.position-relative {
+ position: relative !important;
+}
+
+.position-absolute {
+ position: absolute !important;
+}
+
+.position-fixed {
+ position: fixed !important;
+}
+
+.position-sticky {
+ position: -webkit-sticky !important;
+ position: sticky !important;
+}
+
+.fixed-top {
+ position: fixed;
+ top: 0;
+ right: 0;
+ left: 0;
+ z-index: 1030;
+}
+
+.fixed-bottom {
+ position: fixed;
+ right: 0;
+ bottom: 0;
+ left: 0;
+ z-index: 1030;
+}
+
+@supports ((position: -webkit-sticky) or (position: sticky)) {
+ .sticky-top {
+ position: -webkit-sticky;
+ position: sticky;
+ top: 0;
+ z-index: 1020;
+ }
+}
+
+.sr-only {
+ position: absolute;
+ width: 1px;
+ height: 1px;
+ padding: 0;
+ overflow: hidden;
+ clip: rect(0, 0, 0, 0);
+ white-space: nowrap;
+ -webkit-clip-path: inset(50%);
+ clip-path: inset(50%);
+ border: 0;
+}
+
+.sr-only-focusable:active, .sr-only-focusable:focus {
+ position: static;
+ width: auto;
+ height: auto;
+ overflow: visible;
+ clip: auto;
+ white-space: normal;
+ -webkit-clip-path: none;
+ clip-path: none;
+}
+
+.w-25 {
+ width: 25% !important;
+}
+
+.w-50 {
+ width: 50% !important;
+}
+
+.w-75 {
+ width: 75% !important;
+}
+
+.w-100 {
+ width: 100% !important;
+}
+
+.h-25 {
+ height: 25% !important;
+}
+
+.h-50 {
+ height: 50% !important;
+}
+
+.h-75 {
+ height: 75% !important;
+}
+
+.h-100 {
+ height: 100% !important;
+}
+
+.mw-100 {
+ max-width: 100% !important;
+}
+
+.mh-100 {
+ max-height: 100% !important;
+}
+
+.m-0 {
+ margin: 0 !important;
+}
+
+.mt-0,
+.my-0 {
+ margin-top: 0 !important;
+}
+
+.mr-0,
+.mx-0 {
+ margin-right: 0 !important;
+}
+
+.mb-0,
+.my-0 {
+ margin-bottom: 0 !important;
+}
+
+.ml-0,
+.mx-0 {
+ margin-left: 0 !important;
+}
+
+.m-1 {
+ margin: 0.25rem !important;
+}
+
+.mt-1,
+.my-1 {
+ margin-top: 0.25rem !important;
+}
+
+.mr-1,
+.mx-1 {
+ margin-right: 0.25rem !important;
+}
+
+.mb-1,
+.my-1 {
+ margin-bottom: 0.25rem !important;
+}
+
+.ml-1,
+.mx-1 {
+ margin-left: 0.25rem !important;
+}
+
+.m-2 {
+ margin: 0.5rem !important;
+}
+
+.mt-2,
+.my-2 {
+ margin-top: 0.5rem !important;
+}
+
+.mr-2,
+.mx-2 {
+ margin-right: 0.5rem !important;
+}
+
+.mb-2,
+.my-2 {
+ margin-bottom: 0.5rem !important;
+}
+
+.ml-2,
+.mx-2 {
+ margin-left: 0.5rem !important;
+}
+
+.m-3 {
+ margin: 1rem !important;
+}
+
+.mt-3,
+.my-3 {
+ margin-top: 1rem !important;
+}
+
+.mr-3,
+.mx-3 {
+ margin-right: 1rem !important;
+}
+
+.mb-3,
+.my-3 {
+ margin-bottom: 1rem !important;
+}
+
+.ml-3,
+.mx-3 {
+ margin-left: 1rem !important;
+}
+
+.m-4 {
+ margin: 1.5rem !important;
+}
+
+.mt-4,
+.my-4 {
+ margin-top: 1.5rem !important;
+}
+
+.mr-4,
+.mx-4 {
+ margin-right: 1.5rem !important;
+}
+
+.mb-4,
+.my-4 {
+ margin-bottom: 1.5rem !important;
+}
+
+.ml-4,
+.mx-4 {
+ margin-left: 1.5rem !important;
+}
+
+.m-5 {
+ margin: 3rem !important;
+}
+
+.mt-5,
+.my-5 {
+ margin-top: 3rem !important;
+}
+
+.mr-5,
+.mx-5 {
+ margin-right: 3rem !important;
+}
+
+.mb-5,
+.my-5 {
+ margin-bottom: 3rem !important;
+}
+
+.ml-5,
+.mx-5 {
+ margin-left: 3rem !important;
+}
+
+.p-0 {
+ padding: 0 !important;
+}
+
+.pt-0,
+.py-0 {
+ padding-top: 0 !important;
+}
+
+.pr-0,
+.px-0 {
+ padding-right: 0 !important;
+}
+
+.pb-0,
+.py-0 {
+ padding-bottom: 0 !important;
+}
+
+.pl-0,
+.px-0 {
+ padding-left: 0 !important;
+}
+
+.p-1 {
+ padding: 0.25rem !important;
+}
+
+.pt-1,
+.py-1 {
+ padding-top: 0.25rem !important;
+}
+
+.pr-1,
+.px-1 {
+ padding-right: 0.25rem !important;
+}
+
+.pb-1,
+.py-1 {
+ padding-bottom: 0.25rem !important;
+}
+
+.pl-1,
+.px-1 {
+ padding-left: 0.25rem !important;
+}
+
+.p-2 {
+ padding: 0.5rem !important;
+}
+
+.pt-2,
+.py-2 {
+ padding-top: 0.5rem !important;
+}
+
+.pr-2,
+.px-2 {
+ padding-right: 0.5rem !important;
+}
+
+.pb-2,
+.py-2 {
+ padding-bottom: 0.5rem !important;
+}
+
+.pl-2,
+.px-2 {
+ padding-left: 0.5rem !important;
+}
+
+.p-3 {
+ padding: 1rem !important;
+}
+
+.pt-3,
+.py-3 {
+ padding-top: 1rem !important;
+}
+
+.pr-3,
+.px-3 {
+ padding-right: 1rem !important;
+}
+
+.pb-3,
+.py-3 {
+ padding-bottom: 1rem !important;
+}
+
+.pl-3,
+.px-3 {
+ padding-left: 1rem !important;
+}
+
+.p-4 {
+ padding: 1.5rem !important;
+}
+
+.pt-4,
+.py-4 {
+ padding-top: 1.5rem !important;
+}
+
+.pr-4,
+.px-4 {
+ padding-right: 1.5rem !important;
+}
+
+.pb-4,
+.py-4 {
+ padding-bottom: 1.5rem !important;
+}
+
+.pl-4,
+.px-4 {
+ padding-left: 1.5rem !important;
+}
+
+.p-5 {
+ padding: 3rem !important;
+}
+
+.pt-5,
+.py-5 {
+ padding-top: 3rem !important;
+}
+
+.pr-5,
+.px-5 {
+ padding-right: 3rem !important;
+}
+
+.pb-5,
+.py-5 {
+ padding-bottom: 3rem !important;
+}
+
+.pl-5,
+.px-5 {
+ padding-left: 3rem !important;
+}
+
+.m-auto {
+ margin: auto !important;
+}
+
+.mt-auto,
+.my-auto {
+ margin-top: auto !important;
+}
+
+.mr-auto,
+.mx-auto {
+ margin-right: auto !important;
+}
+
+.mb-auto,
+.my-auto {
+ margin-bottom: auto !important;
+}
+
+.ml-auto,
+.mx-auto {
+ margin-left: auto !important;
+}
+
+@media (min-width: 576px) {
+ .m-sm-0 {
+ margin: 0 !important;
+ }
+ .mt-sm-0,
+ .my-sm-0 {
+ margin-top: 0 !important;
+ }
+ .mr-sm-0,
+ .mx-sm-0 {
+ margin-right: 0 !important;
+ }
+ .mb-sm-0,
+ .my-sm-0 {
+ margin-bottom: 0 !important;
+ }
+ .ml-sm-0,
+ .mx-sm-0 {
+ margin-left: 0 !important;
+ }
+ .m-sm-1 {
+ margin: 0.25rem !important;
+ }
+ .mt-sm-1,
+ .my-sm-1 {
+ margin-top: 0.25rem !important;
+ }
+ .mr-sm-1,
+ .mx-sm-1 {
+ margin-right: 0.25rem !important;
+ }
+ .mb-sm-1,
+ .my-sm-1 {
+ margin-bottom: 0.25rem !important;
+ }
+ .ml-sm-1,
+ .mx-sm-1 {
+ margin-left: 0.25rem !important;
+ }
+ .m-sm-2 {
+ margin: 0.5rem !important;
+ }
+ .mt-sm-2,
+ .my-sm-2 {
+ margin-top: 0.5rem !important;
+ }
+ .mr-sm-2,
+ .mx-sm-2 {
+ margin-right: 0.5rem !important;
+ }
+ .mb-sm-2,
+ .my-sm-2 {
+ margin-bottom: 0.5rem !important;
+ }
+ .ml-sm-2,
+ .mx-sm-2 {
+ margin-left: 0.5rem !important;
+ }
+ .m-sm-3 {
+ margin: 1rem !important;
+ }
+ .mt-sm-3,
+ .my-sm-3 {
+ margin-top: 1rem !important;
+ }
+ .mr-sm-3,
+ .mx-sm-3 {
+ margin-right: 1rem !important;
+ }
+ .mb-sm-3,
+ .my-sm-3 {
+ margin-bottom: 1rem !important;
+ }
+ .ml-sm-3,
+ .mx-sm-3 {
+ margin-left: 1rem !important;
+ }
+ .m-sm-4 {
+ margin: 1.5rem !important;
+ }
+ .mt-sm-4,
+ .my-sm-4 {
+ margin-top: 1.5rem !important;
+ }
+ .mr-sm-4,
+ .mx-sm-4 {
+ margin-right: 1.5rem !important;
+ }
+ .mb-sm-4,
+ .my-sm-4 {
+ margin-bottom: 1.5rem !important;
+ }
+ .ml-sm-4,
+ .mx-sm-4 {
+ margin-left: 1.5rem !important;
+ }
+ .m-sm-5 {
+ margin: 3rem !important;
+ }
+ .mt-sm-5,
+ .my-sm-5 {
+ margin-top: 3rem !important;
+ }
+ .mr-sm-5,
+ .mx-sm-5 {
+ margin-right: 3rem !important;
+ }
+ .mb-sm-5,
+ .my-sm-5 {
+ margin-bottom: 3rem !important;
+ }
+ .ml-sm-5,
+ .mx-sm-5 {
+ margin-left: 3rem !important;
+ }
+ .p-sm-0 {
+ padding: 0 !important;
+ }
+ .pt-sm-0,
+ .py-sm-0 {
+ padding-top: 0 !important;
+ }
+ .pr-sm-0,
+ .px-sm-0 {
+ padding-right: 0 !important;
+ }
+ .pb-sm-0,
+ .py-sm-0 {
+ padding-bottom: 0 !important;
+ }
+ .pl-sm-0,
+ .px-sm-0 {
+ padding-left: 0 !important;
+ }
+ .p-sm-1 {
+ padding: 0.25rem !important;
+ }
+ .pt-sm-1,
+ .py-sm-1 {
+ padding-top: 0.25rem !important;
+ }
+ .pr-sm-1,
+ .px-sm-1 {
+ padding-right: 0.25rem !important;
+ }
+ .pb-sm-1,
+ .py-sm-1 {
+ padding-bottom: 0.25rem !important;
+ }
+ .pl-sm-1,
+ .px-sm-1 {
+ padding-left: 0.25rem !important;
+ }
+ .p-sm-2 {
+ padding: 0.5rem !important;
+ }
+ .pt-sm-2,
+ .py-sm-2 {
+ padding-top: 0.5rem !important;
+ }
+ .pr-sm-2,
+ .px-sm-2 {
+ padding-right: 0.5rem !important;
+ }
+ .pb-sm-2,
+ .py-sm-2 {
+ padding-bottom: 0.5rem !important;
+ }
+ .pl-sm-2,
+ .px-sm-2 {
+ padding-left: 0.5rem !important;
+ }
+ .p-sm-3 {
+ padding: 1rem !important;
+ }
+ .pt-sm-3,
+ .py-sm-3 {
+ padding-top: 1rem !important;
+ }
+ .pr-sm-3,
+ .px-sm-3 {
+ padding-right: 1rem !important;
+ }
+ .pb-sm-3,
+ .py-sm-3 {
+ padding-bottom: 1rem !important;
+ }
+ .pl-sm-3,
+ .px-sm-3 {
+ padding-left: 1rem !important;
+ }
+ .p-sm-4 {
+ padding: 1.5rem !important;
+ }
+ .pt-sm-4,
+ .py-sm-4 {
+ padding-top: 1.5rem !important;
+ }
+ .pr-sm-4,
+ .px-sm-4 {
+ padding-right: 1.5rem !important;
+ }
+ .pb-sm-4,
+ .py-sm-4 {
+ padding-bottom: 1.5rem !important;
+ }
+ .pl-sm-4,
+ .px-sm-4 {
+ padding-left: 1.5rem !important;
+ }
+ .p-sm-5 {
+ padding: 3rem !important;
+ }
+ .pt-sm-5,
+ .py-sm-5 {
+ padding-top: 3rem !important;
+ }
+ .pr-sm-5,
+ .px-sm-5 {
+ padding-right: 3rem !important;
+ }
+ .pb-sm-5,
+ .py-sm-5 {
+ padding-bottom: 3rem !important;
+ }
+ .pl-sm-5,
+ .px-sm-5 {
+ padding-left: 3rem !important;
+ }
+ .m-sm-auto {
+ margin: auto !important;
+ }
+ .mt-sm-auto,
+ .my-sm-auto {
+ margin-top: auto !important;
+ }
+ .mr-sm-auto,
+ .mx-sm-auto {
+ margin-right: auto !important;
+ }
+ .mb-sm-auto,
+ .my-sm-auto {
+ margin-bottom: auto !important;
+ }
+ .ml-sm-auto,
+ .mx-sm-auto {
+ margin-left: auto !important;
+ }
+}
+
+@media (min-width: 768px) {
+ .m-md-0 {
+ margin: 0 !important;
+ }
+ .mt-md-0,
+ .my-md-0 {
+ margin-top: 0 !important;
+ }
+ .mr-md-0,
+ .mx-md-0 {
+ margin-right: 0 !important;
+ }
+ .mb-md-0,
+ .my-md-0 {
+ margin-bottom: 0 !important;
+ }
+ .ml-md-0,
+ .mx-md-0 {
+ margin-left: 0 !important;
+ }
+ .m-md-1 {
+ margin: 0.25rem !important;
+ }
+ .mt-md-1,
+ .my-md-1 {
+ margin-top: 0.25rem !important;
+ }
+ .mr-md-1,
+ .mx-md-1 {
+ margin-right: 0.25rem !important;
+ }
+ .mb-md-1,
+ .my-md-1 {
+ margin-bottom: 0.25rem !important;
+ }
+ .ml-md-1,
+ .mx-md-1 {
+ margin-left: 0.25rem !important;
+ }
+ .m-md-2 {
+ margin: 0.5rem !important;
+ }
+ .mt-md-2,
+ .my-md-2 {
+ margin-top: 0.5rem !important;
+ }
+ .mr-md-2,
+ .mx-md-2 {
+ margin-right: 0.5rem !important;
+ }
+ .mb-md-2,
+ .my-md-2 {
+ margin-bottom: 0.5rem !important;
+ }
+ .ml-md-2,
+ .mx-md-2 {
+ margin-left: 0.5rem !important;
+ }
+ .m-md-3 {
+ margin: 1rem !important;
+ }
+ .mt-md-3,
+ .my-md-3 {
+ margin-top: 1rem !important;
+ }
+ .mr-md-3,
+ .mx-md-3 {
+ margin-right: 1rem !important;
+ }
+ .mb-md-3,
+ .my-md-3 {
+ margin-bottom: 1rem !important;
+ }
+ .ml-md-3,
+ .mx-md-3 {
+ margin-left: 1rem !important;
+ }
+ .m-md-4 {
+ margin: 1.5rem !important;
+ }
+ .mt-md-4,
+ .my-md-4 {
+ margin-top: 1.5rem !important;
+ }
+ .mr-md-4,
+ .mx-md-4 {
+ margin-right: 1.5rem !important;
+ }
+ .mb-md-4,
+ .my-md-4 {
+ margin-bottom: 1.5rem !important;
+ }
+ .ml-md-4,
+ .mx-md-4 {
+ margin-left: 1.5rem !important;
+ }
+ .m-md-5 {
+ margin: 3rem !important;
+ }
+ .mt-md-5,
+ .my-md-5 {
+ margin-top: 3rem !important;
+ }
+ .mr-md-5,
+ .mx-md-5 {
+ margin-right: 3rem !important;
+ }
+ .mb-md-5,
+ .my-md-5 {
+ margin-bottom: 3rem !important;
+ }
+ .ml-md-5,
+ .mx-md-5 {
+ margin-left: 3rem !important;
+ }
+ .p-md-0 {
+ padding: 0 !important;
+ }
+ .pt-md-0,
+ .py-md-0 {
+ padding-top: 0 !important;
+ }
+ .pr-md-0,
+ .px-md-0 {
+ padding-right: 0 !important;
+ }
+ .pb-md-0,
+ .py-md-0 {
+ padding-bottom: 0 !important;
+ }
+ .pl-md-0,
+ .px-md-0 {
+ padding-left: 0 !important;
+ }
+ .p-md-1 {
+ padding: 0.25rem !important;
+ }
+ .pt-md-1,
+ .py-md-1 {
+ padding-top: 0.25rem !important;
+ }
+ .pr-md-1,
+ .px-md-1 {
+ padding-right: 0.25rem !important;
+ }
+ .pb-md-1,
+ .py-md-1 {
+ padding-bottom: 0.25rem !important;
+ }
+ .pl-md-1,
+ .px-md-1 {
+ padding-left: 0.25rem !important;
+ }
+ .p-md-2 {
+ padding: 0.5rem !important;
+ }
+ .pt-md-2,
+ .py-md-2 {
+ padding-top: 0.5rem !important;
+ }
+ .pr-md-2,
+ .px-md-2 {
+ padding-right: 0.5rem !important;
+ }
+ .pb-md-2,
+ .py-md-2 {
+ padding-bottom: 0.5rem !important;
+ }
+ .pl-md-2,
+ .px-md-2 {
+ padding-left: 0.5rem !important;
+ }
+ .p-md-3 {
+ padding: 1rem !important;
+ }
+ .pt-md-3,
+ .py-md-3 {
+ padding-top: 1rem !important;
+ }
+ .pr-md-3,
+ .px-md-3 {
+ padding-right: 1rem !important;
+ }
+ .pb-md-3,
+ .py-md-3 {
+ padding-bottom: 1rem !important;
+ }
+ .pl-md-3,
+ .px-md-3 {
+ padding-left: 1rem !important;
+ }
+ .p-md-4 {
+ padding: 1.5rem !important;
+ }
+ .pt-md-4,
+ .py-md-4 {
+ padding-top: 1.5rem !important;
+ }
+ .pr-md-4,
+ .px-md-4 {
+ padding-right: 1.5rem !important;
+ }
+ .pb-md-4,
+ .py-md-4 {
+ padding-bottom: 1.5rem !important;
+ }
+ .pl-md-4,
+ .px-md-4 {
+ padding-left: 1.5rem !important;
+ }
+ .p-md-5 {
+ padding: 3rem !important;
+ }
+ .pt-md-5,
+ .py-md-5 {
+ padding-top: 3rem !important;
+ }
+ .pr-md-5,
+ .px-md-5 {
+ padding-right: 3rem !important;
+ }
+ .pb-md-5,
+ .py-md-5 {
+ padding-bottom: 3rem !important;
+ }
+ .pl-md-5,
+ .px-md-5 {
+ padding-left: 3rem !important;
+ }
+ .m-md-auto {
+ margin: auto !important;
+ }
+ .mt-md-auto,
+ .my-md-auto {
+ margin-top: auto !important;
+ }
+ .mr-md-auto,
+ .mx-md-auto {
+ margin-right: auto !important;
+ }
+ .mb-md-auto,
+ .my-md-auto {
+ margin-bottom: auto !important;
+ }
+ .ml-md-auto,
+ .mx-md-auto {
+ margin-left: auto !important;
+ }
+}
+
+@media (min-width: 992px) {
+ .m-lg-0 {
+ margin: 0 !important;
+ }
+ .mt-lg-0,
+ .my-lg-0 {
+ margin-top: 0 !important;
+ }
+ .mr-lg-0,
+ .mx-lg-0 {
+ margin-right: 0 !important;
+ }
+ .mb-lg-0,
+ .my-lg-0 {
+ margin-bottom: 0 !important;
+ }
+ .ml-lg-0,
+ .mx-lg-0 {
+ margin-left: 0 !important;
+ }
+ .m-lg-1 {
+ margin: 0.25rem !important;
+ }
+ .mt-lg-1,
+ .my-lg-1 {
+ margin-top: 0.25rem !important;
+ }
+ .mr-lg-1,
+ .mx-lg-1 {
+ margin-right: 0.25rem !important;
+ }
+ .mb-lg-1,
+ .my-lg-1 {
+ margin-bottom: 0.25rem !important;
+ }
+ .ml-lg-1,
+ .mx-lg-1 {
+ margin-left: 0.25rem !important;
+ }
+ .m-lg-2 {
+ margin: 0.5rem !important;
+ }
+ .mt-lg-2,
+ .my-lg-2 {
+ margin-top: 0.5rem !important;
+ }
+ .mr-lg-2,
+ .mx-lg-2 {
+ margin-right: 0.5rem !important;
+ }
+ .mb-lg-2,
+ .my-lg-2 {
+ margin-bottom: 0.5rem !important;
+ }
+ .ml-lg-2,
+ .mx-lg-2 {
+ margin-left: 0.5rem !important;
+ }
+ .m-lg-3 {
+ margin: 1rem !important;
+ }
+ .mt-lg-3,
+ .my-lg-3 {
+ margin-top: 1rem !important;
+ }
+ .mr-lg-3,
+ .mx-lg-3 {
+ margin-right: 1rem !important;
+ }
+ .mb-lg-3,
+ .my-lg-3 {
+ margin-bottom: 1rem !important;
+ }
+ .ml-lg-3,
+ .mx-lg-3 {
+ margin-left: 1rem !important;
+ }
+ .m-lg-4 {
+ margin: 1.5rem !important;
+ }
+ .mt-lg-4,
+ .my-lg-4 {
+ margin-top: 1.5rem !important;
+ }
+ .mr-lg-4,
+ .mx-lg-4 {
+ margin-right: 1.5rem !important;
+ }
+ .mb-lg-4,
+ .my-lg-4 {
+ margin-bottom: 1.5rem !important;
+ }
+ .ml-lg-4,
+ .mx-lg-4 {
+ margin-left: 1.5rem !important;
+ }
+ .m-lg-5 {
+ margin: 3rem !important;
+ }
+ .mt-lg-5,
+ .my-lg-5 {
+ margin-top: 3rem !important;
+ }
+ .mr-lg-5,
+ .mx-lg-5 {
+ margin-right: 3rem !important;
+ }
+ .mb-lg-5,
+ .my-lg-5 {
+ margin-bottom: 3rem !important;
+ }
+ .ml-lg-5,
+ .mx-lg-5 {
+ margin-left: 3rem !important;
+ }
+ .p-lg-0 {
+ padding: 0 !important;
+ }
+ .pt-lg-0,
+ .py-lg-0 {
+ padding-top: 0 !important;
+ }
+ .pr-lg-0,
+ .px-lg-0 {
+ padding-right: 0 !important;
+ }
+ .pb-lg-0,
+ .py-lg-0 {
+ padding-bottom: 0 !important;
+ }
+ .pl-lg-0,
+ .px-lg-0 {
+ padding-left: 0 !important;
+ }
+ .p-lg-1 {
+ padding: 0.25rem !important;
+ }
+ .pt-lg-1,
+ .py-lg-1 {
+ padding-top: 0.25rem !important;
+ }
+ .pr-lg-1,
+ .px-lg-1 {
+ padding-right: 0.25rem !important;
+ }
+ .pb-lg-1,
+ .py-lg-1 {
+ padding-bottom: 0.25rem !important;
+ }
+ .pl-lg-1,
+ .px-lg-1 {
+ padding-left: 0.25rem !important;
+ }
+ .p-lg-2 {
+ padding: 0.5rem !important;
+ }
+ .pt-lg-2,
+ .py-lg-2 {
+ padding-top: 0.5rem !important;
+ }
+ .pr-lg-2,
+ .px-lg-2 {
+ padding-right: 0.5rem !important;
+ }
+ .pb-lg-2,
+ .py-lg-2 {
+ padding-bottom: 0.5rem !important;
+ }
+ .pl-lg-2,
+ .px-lg-2 {
+ padding-left: 0.5rem !important;
+ }
+ .p-lg-3 {
+ padding: 1rem !important;
+ }
+ .pt-lg-3,
+ .py-lg-3 {
+ padding-top: 1rem !important;
+ }
+ .pr-lg-3,
+ .px-lg-3 {
+ padding-right: 1rem !important;
+ }
+ .pb-lg-3,
+ .py-lg-3 {
+ padding-bottom: 1rem !important;
+ }
+ .pl-lg-3,
+ .px-lg-3 {
+ padding-left: 1rem !important;
+ }
+ .p-lg-4 {
+ padding: 1.5rem !important;
+ }
+ .pt-lg-4,
+ .py-lg-4 {
+ padding-top: 1.5rem !important;
+ }
+ .pr-lg-4,
+ .px-lg-4 {
+ padding-right: 1.5rem !important;
+ }
+ .pb-lg-4,
+ .py-lg-4 {
+ padding-bottom: 1.5rem !important;
+ }
+ .pl-lg-4,
+ .px-lg-4 {
+ padding-left: 1.5rem !important;
+ }
+ .p-lg-5 {
+ padding: 3rem !important;
+ }
+ .pt-lg-5,
+ .py-lg-5 {
+ padding-top: 3rem !important;
+ }
+ .pr-lg-5,
+ .px-lg-5 {
+ padding-right: 3rem !important;
+ }
+ .pb-lg-5,
+ .py-lg-5 {
+ padding-bottom: 3rem !important;
+ }
+ .pl-lg-5,
+ .px-lg-5 {
+ padding-left: 3rem !important;
+ }
+ .m-lg-auto {
+ margin: auto !important;
+ }
+ .mt-lg-auto,
+ .my-lg-auto {
+ margin-top: auto !important;
+ }
+ .mr-lg-auto,
+ .mx-lg-auto {
+ margin-right: auto !important;
+ }
+ .mb-lg-auto,
+ .my-lg-auto {
+ margin-bottom: auto !important;
+ }
+ .ml-lg-auto,
+ .mx-lg-auto {
+ margin-left: auto !important;
+ }
+}
+
+@media (min-width: 1200px) {
+ .m-xl-0 {
+ margin: 0 !important;
+ }
+ .mt-xl-0,
+ .my-xl-0 {
+ margin-top: 0 !important;
+ }
+ .mr-xl-0,
+ .mx-xl-0 {
+ margin-right: 0 !important;
+ }
+ .mb-xl-0,
+ .my-xl-0 {
+ margin-bottom: 0 !important;
+ }
+ .ml-xl-0,
+ .mx-xl-0 {
+ margin-left: 0 !important;
+ }
+ .m-xl-1 {
+ margin: 0.25rem !important;
+ }
+ .mt-xl-1,
+ .my-xl-1 {
+ margin-top: 0.25rem !important;
+ }
+ .mr-xl-1,
+ .mx-xl-1 {
+ margin-right: 0.25rem !important;
+ }
+ .mb-xl-1,
+ .my-xl-1 {
+ margin-bottom: 0.25rem !important;
+ }
+ .ml-xl-1,
+ .mx-xl-1 {
+ margin-left: 0.25rem !important;
+ }
+ .m-xl-2 {
+ margin: 0.5rem !important;
+ }
+ .mt-xl-2,
+ .my-xl-2 {
+ margin-top: 0.5rem !important;
+ }
+ .mr-xl-2,
+ .mx-xl-2 {
+ margin-right: 0.5rem !important;
+ }
+ .mb-xl-2,
+ .my-xl-2 {
+ margin-bottom: 0.5rem !important;
+ }
+ .ml-xl-2,
+ .mx-xl-2 {
+ margin-left: 0.5rem !important;
+ }
+ .m-xl-3 {
+ margin: 1rem !important;
+ }
+ .mt-xl-3,
+ .my-xl-3 {
+ margin-top: 1rem !important;
+ }
+ .mr-xl-3,
+ .mx-xl-3 {
+ margin-right: 1rem !important;
+ }
+ .mb-xl-3,
+ .my-xl-3 {
+ margin-bottom: 1rem !important;
+ }
+ .ml-xl-3,
+ .mx-xl-3 {
+ margin-left: 1rem !important;
+ }
+ .m-xl-4 {
+ margin: 1.5rem !important;
+ }
+ .mt-xl-4,
+ .my-xl-4 {
+ margin-top: 1.5rem !important;
+ }
+ .mr-xl-4,
+ .mx-xl-4 {
+ margin-right: 1.5rem !important;
+ }
+ .mb-xl-4,
+ .my-xl-4 {
+ margin-bottom: 1.5rem !important;
+ }
+ .ml-xl-4,
+ .mx-xl-4 {
+ margin-left: 1.5rem !important;
+ }
+ .m-xl-5 {
+ margin: 3rem !important;
+ }
+ .mt-xl-5,
+ .my-xl-5 {
+ margin-top: 3rem !important;
+ }
+ .mr-xl-5,
+ .mx-xl-5 {
+ margin-right: 3rem !important;
+ }
+ .mb-xl-5,
+ .my-xl-5 {
+ margin-bottom: 3rem !important;
+ }
+ .ml-xl-5,
+ .mx-xl-5 {
+ margin-left: 3rem !important;
+ }
+ .p-xl-0 {
+ padding: 0 !important;
+ }
+ .pt-xl-0,
+ .py-xl-0 {
+ padding-top: 0 !important;
+ }
+ .pr-xl-0,
+ .px-xl-0 {
+ padding-right: 0 !important;
+ }
+ .pb-xl-0,
+ .py-xl-0 {
+ padding-bottom: 0 !important;
+ }
+ .pl-xl-0,
+ .px-xl-0 {
+ padding-left: 0 !important;
+ }
+ .p-xl-1 {
+ padding: 0.25rem !important;
+ }
+ .pt-xl-1,
+ .py-xl-1 {
+ padding-top: 0.25rem !important;
+ }
+ .pr-xl-1,
+ .px-xl-1 {
+ padding-right: 0.25rem !important;
+ }
+ .pb-xl-1,
+ .py-xl-1 {
+ padding-bottom: 0.25rem !important;
+ }
+ .pl-xl-1,
+ .px-xl-1 {
+ padding-left: 0.25rem !important;
+ }
+ .p-xl-2 {
+ padding: 0.5rem !important;
+ }
+ .pt-xl-2,
+ .py-xl-2 {
+ padding-top: 0.5rem !important;
+ }
+ .pr-xl-2,
+ .px-xl-2 {
+ padding-right: 0.5rem !important;
+ }
+ .pb-xl-2,
+ .py-xl-2 {
+ padding-bottom: 0.5rem !important;
+ }
+ .pl-xl-2,
+ .px-xl-2 {
+ padding-left: 0.5rem !important;
+ }
+ .p-xl-3 {
+ padding: 1rem !important;
+ }
+ .pt-xl-3,
+ .py-xl-3 {
+ padding-top: 1rem !important;
+ }
+ .pr-xl-3,
+ .px-xl-3 {
+ padding-right: 1rem !important;
+ }
+ .pb-xl-3,
+ .py-xl-3 {
+ padding-bottom: 1rem !important;
+ }
+ .pl-xl-3,
+ .px-xl-3 {
+ padding-left: 1rem !important;
+ }
+ .p-xl-4 {
+ padding: 1.5rem !important;
+ }
+ .pt-xl-4,
+ .py-xl-4 {
+ padding-top: 1.5rem !important;
+ }
+ .pr-xl-4,
+ .px-xl-4 {
+ padding-right: 1.5rem !important;
+ }
+ .pb-xl-4,
+ .py-xl-4 {
+ padding-bottom: 1.5rem !important;
+ }
+ .pl-xl-4,
+ .px-xl-4 {
+ padding-left: 1.5rem !important;
+ }
+ .p-xl-5 {
+ padding: 3rem !important;
+ }
+ .pt-xl-5,
+ .py-xl-5 {
+ padding-top: 3rem !important;
+ }
+ .pr-xl-5,
+ .px-xl-5 {
+ padding-right: 3rem !important;
+ }
+ .pb-xl-5,
+ .py-xl-5 {
+ padding-bottom: 3rem !important;
+ }
+ .pl-xl-5,
+ .px-xl-5 {
+ padding-left: 3rem !important;
+ }
+ .m-xl-auto {
+ margin: auto !important;
+ }
+ .mt-xl-auto,
+ .my-xl-auto {
+ margin-top: auto !important;
+ }
+ .mr-xl-auto,
+ .mx-xl-auto {
+ margin-right: auto !important;
+ }
+ .mb-xl-auto,
+ .my-xl-auto {
+ margin-bottom: auto !important;
+ }
+ .ml-xl-auto,
+ .mx-xl-auto {
+ margin-left: auto !important;
+ }
+}
+
+.text-justify {
+ text-align: justify !important;
+}
+
+.text-nowrap {
+ white-space: nowrap !important;
+}
+
+.text-truncate {
+ overflow: hidden;
+ text-overflow: ellipsis;
+ white-space: nowrap;
+}
+
+.text-left {
+ text-align: left !important;
+}
+
+.text-right {
+ text-align: right !important;
+}
+
+.text-center {
+ text-align: center !important;
+}
+
+@media (min-width: 576px) {
+ .text-sm-left {
+ text-align: left !important;
+ }
+ .text-sm-right {
+ text-align: right !important;
+ }
+ .text-sm-center {
+ text-align: center !important;
+ }
+}
+
+@media (min-width: 768px) {
+ .text-md-left {
+ text-align: left !important;
+ }
+ .text-md-right {
+ text-align: right !important;
+ }
+ .text-md-center {
+ text-align: center !important;
+ }
+}
+
+@media (min-width: 992px) {
+ .text-lg-left {
+ text-align: left !important;
+ }
+ .text-lg-right {
+ text-align: right !important;
+ }
+ .text-lg-center {
+ text-align: center !important;
+ }
+}
+
+@media (min-width: 1200px) {
+ .text-xl-left {
+ text-align: left !important;
+ }
+ .text-xl-right {
+ text-align: right !important;
+ }
+ .text-xl-center {
+ text-align: center !important;
+ }
+}
+
+.text-lowercase {
+ text-transform: lowercase !important;
+}
+
+.text-uppercase {
+ text-transform: uppercase !important;
+}
+
+.text-capitalize {
+ text-transform: capitalize !important;
+}
+
+.font-weight-light {
+ font-weight: 300 !important;
+}
+
+.font-weight-normal {
+ font-weight: 400 !important;
+}
+
+.font-weight-bold {
+ font-weight: 700 !important;
+}
+
+.font-italic {
+ font-style: italic !important;
+}
+
+.text-white {
+ color: #fff !important;
+}
+
+.text-primary {
+ color: #007bff !important;
+}
+
+a.text-primary:hover, a.text-primary:focus {
+ color: #0062cc !important;
+}
+
+.text-secondary {
+ color: #6c757d !important;
+}
+
+a.text-secondary:hover, a.text-secondary:focus {
+ color: #545b62 !important;
+}
+
+.text-success {
+ color: #28a745 !important;
+}
+
+a.text-success:hover, a.text-success:focus {
+ color: #1e7e34 !important;
+}
+
+.text-info {
+ color: #17a2b8 !important;
+}
+
+a.text-info:hover, a.text-info:focus {
+ color: #117a8b !important;
+}
+
+.text-warning {
+ color: #ffc107 !important;
+}
+
+a.text-warning:hover, a.text-warning:focus {
+ color: #d39e00 !important;
+}
+
+.text-danger {
+ color: #dc3545 !important;
+}
+
+a.text-danger:hover, a.text-danger:focus {
+ color: #bd2130 !important;
+}
+
+.text-light {
+ color: #f8f9fa !important;
+}
+
+a.text-light:hover, a.text-light:focus {
+ color: #dae0e5 !important;
+}
+
+.text-dark {
+ color: #343a40 !important;
+}
+
+a.text-dark:hover, a.text-dark:focus {
+ color: #1d2124 !important;
+}
+
+.text-muted {
+ color: #6c757d !important;
+}
+
+.text-hide {
+ font: 0/0 a;
+ color: transparent;
+ text-shadow: none;
+ background-color: transparent;
+ border: 0;
+}
+
+.visible {
+ visibility: visible !important;
+}
+
+.invisible {
+ visibility: hidden !important;
+}
+
+@media print {
+ *,
+ *::before,
+ *::after {
+ text-shadow: none !important;
+ box-shadow: none !important;
+ }
+ a:not(.btn) {
+ text-decoration: underline;
+ }
+ abbr[title]::after {
+ content: " (" attr(title) ")";
+ }
+ pre {
+ white-space: pre-wrap !important;
+ }
+ pre,
+ blockquote {
+ border: 1px solid #999;
+ page-break-inside: avoid;
+ }
+ thead {
+ display: table-header-group;
+ }
+ tr,
+ img {
+ page-break-inside: avoid;
+ }
+ p,
+ h2,
+ h3 {
+ orphans: 3;
+ widows: 3;
+ }
+ h2,
+ h3 {
+ page-break-after: avoid;
+ }
+ @page {
+ size: a3;
+ }
+ body {
+ min-width: 992px !important;
+ }
+ .container {
+ min-width: 992px !important;
+ }
+ .navbar {
+ display: none;
+ }
+ .badge {
+ border: 1px solid #000;
+ }
+ .table {
+ border-collapse: collapse !important;
+ }
+ .table td,
+ .table th {
+ background-color: #fff !important;
+ }
+ .table-bordered th,
+ .table-bordered td {
+ border: 1px solid #ddd !important;
+ }
+}
+/*# sourceMappingURL=bootstrap.css.map */ \ No newline at end of file
diff --git a/chall/src/css/bootstrap.min.css b/chall/src/css/bootstrap.min.css
new file mode 100644
index 0000000..6561b6f
--- /dev/null
+++ b/chall/src/css/bootstrap.min.css
@@ -0,0 +1,7 @@
+/*!
+ * Bootstrap v4.0.0 (https://getbootstrap.com)
+ * Copyright 2011-2018 The Bootstrap Authors
+ * Copyright 2011-2018 Twitter, Inc.
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ */:root{--blue:#007bff;--indigo:#6610f2;--purple:#6f42c1;--pink:#e83e8c;--red:#dc3545;--orange:#fd7e14;--yellow:#ffc107;--green:#28a745;--teal:#20c997;--cyan:#17a2b8;--white:#fff;--gray:#6c757d;--gray-dark:#343a40;--primary:#007bff;--secondary:#6c757d;--success:#28a745;--info:#17a2b8;--warning:#ffc107;--danger:#dc3545;--light:#f8f9fa;--dark:#343a40;--breakpoint-xs:0;--breakpoint-sm:576px;--breakpoint-md:768px;--breakpoint-lg:992px;--breakpoint-xl:1200px;--font-family-sans-serif:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";--font-family-monospace:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace}*,::after,::before{box-sizing:border-box}html{font-family:sans-serif;line-height:1.15;-webkit-text-size-adjust:100%;-ms-text-size-adjust:100%;-ms-overflow-style:scrollbar;-webkit-tap-highlight-color:transparent}@-ms-viewport{width:device-width}article,aside,dialog,figcaption,figure,footer,header,hgroup,main,nav,section{display:block}body{margin:0;font-family:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";font-size:1rem;font-weight:400;line-height:1.5;color:#212529;text-align:left;background-color:#fff}[tabindex="-1"]:focus{outline:0!important}hr{box-sizing:content-box;height:0;overflow:visible}h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:.5rem}p{margin-top:0;margin-bottom:1rem}abbr[data-original-title],abbr[title]{text-decoration:underline;-webkit-text-decoration:underline dotted;text-decoration:underline dotted;cursor:help;border-bottom:0}address{margin-bottom:1rem;font-style:normal;line-height:inherit}dl,ol,ul{margin-top:0;margin-bottom:1rem}ol ol,ol ul,ul ol,ul ul{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem}dfn{font-style:italic}b,strong{font-weight:bolder}small{font-size:80%}sub,sup{position:relative;font-size:75%;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}a{color:#007bff;text-decoration:none;background-color:transparent;-webkit-text-decoration-skip:objects}a:hover{color:#0056b3;text-decoration:underline}a:not([href]):not([tabindex]){color:inherit;text-decoration:none}a:not([href]):not([tabindex]):focus,a:not([href]):not([tabindex]):hover{color:inherit;text-decoration:none}a:not([href]):not([tabindex]):focus{outline:0}code,kbd,pre,samp{font-family:monospace,monospace;font-size:1em}pre{margin-top:0;margin-bottom:1rem;overflow:auto;-ms-overflow-style:scrollbar}figure{margin:0 0 1rem}img{vertical-align:middle;border-style:none}svg:not(:root){overflow:hidden}table{border-collapse:collapse}caption{padding-top:.75rem;padding-bottom:.75rem;color:#6c757d;text-align:left;caption-side:bottom}th{text-align:inherit}label{display:inline-block;margin-bottom:.5rem}button{border-radius:0}button:focus{outline:1px dotted;outline:5px auto -webkit-focus-ring-color}button,input,optgroup,select,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,input{overflow:visible}button,select{text-transform:none}[type=reset],[type=submit],button,html [type=button]{-webkit-appearance:button}[type=button]::-moz-focus-inner,[type=reset]::-moz-focus-inner,[type=submit]::-moz-focus-inner,button::-moz-focus-inner{padding:0;border-style:none}input[type=checkbox],input[type=radio]{box-sizing:border-box;padding:0}input[type=date],input[type=datetime-local],input[type=month],input[type=time]{-webkit-appearance:listbox}textarea{overflow:auto;resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{display:block;width:100%;max-width:100%;padding:0;margin-bottom:.5rem;font-size:1.5rem;line-height:inherit;color:inherit;white-space:normal}progress{vertical-align:baseline}[type=number]::-webkit-inner-spin-button,[type=number]::-webkit-outer-spin-button{height:auto}[type=search]{outline-offset:-2px;-webkit-appearance:none}[type=search]::-webkit-search-cancel-button,[type=search]::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{font:inherit;-webkit-appearance:button}output{display:inline-block}summary{display:list-item;cursor:pointer}template{display:none}[hidden]{display:none!important}.h1,.h2,.h3,.h4,.h5,.h6,h1,h2,h3,h4,h5,h6{margin-bottom:.5rem;font-family:inherit;font-weight:500;line-height:1.2;color:inherit}.h1,h1{font-size:2.5rem}.h2,h2{font-size:2rem}.h3,h3{font-size:1.75rem}.h4,h4{font-size:1.5rem}.h5,h5{font-size:1.25rem}.h6,h6{font-size:1rem}.lead{font-size:1.25rem;font-weight:300}.display-1{font-size:6rem;font-weight:300;line-height:1.2}.display-2{font-size:5.5rem;font-weight:300;line-height:1.2}.display-3{font-size:4.5rem;font-weight:300;line-height:1.2}.display-4{font-size:3.5rem;font-weight:300;line-height:1.2}hr{margin-top:1rem;margin-bottom:1rem;border:0;border-top:1px solid rgba(0,0,0,.1)}.small,small{font-size:80%;font-weight:400}.mark,mark{padding:.2em;background-color:#fcf8e3}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:90%;text-transform:uppercase}.blockquote{margin-bottom:1rem;font-size:1.25rem}.blockquote-footer{display:block;font-size:80%;color:#6c757d}.blockquote-footer::before{content:"\2014 \00A0"}.img-fluid{max-width:100%;height:auto}.img-thumbnail{padding:.25rem;background-color:#fff;border:1px solid #dee2e6;border-radius:.25rem;max-width:100%;height:auto}.figure{display:inline-block}.figure-img{margin-bottom:.5rem;line-height:1}.figure-caption{font-size:90%;color:#6c757d}code,kbd,pre,samp{font-family:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace}code{font-size:87.5%;color:#e83e8c;word-break:break-word}a>code{color:inherit}kbd{padding:.2rem .4rem;font-size:87.5%;color:#fff;background-color:#212529;border-radius:.2rem}kbd kbd{padding:0;font-size:100%;font-weight:700}pre{display:block;font-size:87.5%;color:#212529}pre code{font-size:inherit;color:inherit;word-break:normal}.pre-scrollable{max-height:340px;overflow-y:scroll}.container{width:100%;padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}@media (min-width:576px){.container{max-width:540px}}@media (min-width:768px){.container{max-width:720px}}@media (min-width:992px){.container{max-width:960px}}@media (min-width:1200px){.container{max-width:1140px}}.container-fluid{width:100%;padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}.row{display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-right:-15px;margin-left:-15px}.no-gutters{margin-right:0;margin-left:0}.no-gutters>.col,.no-gutters>[class*=col-]{padding-right:0;padding-left:0}.col,.col-1,.col-10,.col-11,.col-12,.col-2,.col-3,.col-4,.col-5,.col-6,.col-7,.col-8,.col-9,.col-auto,.col-lg,.col-lg-1,.col-lg-10,.col-lg-11,.col-lg-12,.col-lg-2,.col-lg-3,.col-lg-4,.col-lg-5,.col-lg-6,.col-lg-7,.col-lg-8,.col-lg-9,.col-lg-auto,.col-md,.col-md-1,.col-md-10,.col-md-11,.col-md-12,.col-md-2,.col-md-3,.col-md-4,.col-md-5,.col-md-6,.col-md-7,.col-md-8,.col-md-9,.col-md-auto,.col-sm,.col-sm-1,.col-sm-10,.col-sm-11,.col-sm-12,.col-sm-2,.col-sm-3,.col-sm-4,.col-sm-5,.col-sm-6,.col-sm-7,.col-sm-8,.col-sm-9,.col-sm-auto,.col-xl,.col-xl-1,.col-xl-10,.col-xl-11,.col-xl-12,.col-xl-2,.col-xl-3,.col-xl-4,.col-xl-5,.col-xl-6,.col-xl-7,.col-xl-8,.col-xl-9,.col-xl-auto{position:relative;width:100%;min-height:1px;padding-right:15px;padding-left:15px}.col{-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-auto{-webkit-box-flex:0;-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-1{-webkit-box-flex:0;-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-2{-webkit-box-flex:0;-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-3{-webkit-box-flex:0;-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-4{-webkit-box-flex:0;-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-5{-webkit-box-flex:0;-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-6{-webkit-box-flex:0;-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-7{-webkit-box-flex:0;-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-8{-webkit-box-flex:0;-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-9{-webkit-box-flex:0;-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-10{-webkit-box-flex:0;-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-11{-webkit-box-flex:0;-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-12{-webkit-box-flex:0;-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-first{-webkit-box-ordinal-group:0;-ms-flex-order:-1;order:-1}.order-last{-webkit-box-ordinal-group:14;-ms-flex-order:13;order:13}.order-0{-webkit-box-ordinal-group:1;-ms-flex-order:0;order:0}.order-1{-webkit-box-ordinal-group:2;-ms-flex-order:1;order:1}.order-2{-webkit-box-ordinal-group:3;-ms-flex-order:2;order:2}.order-3{-webkit-box-ordinal-group:4;-ms-flex-order:3;order:3}.order-4{-webkit-box-ordinal-group:5;-ms-flex-order:4;order:4}.order-5{-webkit-box-ordinal-group:6;-ms-flex-order:5;order:5}.order-6{-webkit-box-ordinal-group:7;-ms-flex-order:6;order:6}.order-7{-webkit-box-ordinal-group:8;-ms-flex-order:7;order:7}.order-8{-webkit-box-ordinal-group:9;-ms-flex-order:8;order:8}.order-9{-webkit-box-ordinal-group:10;-ms-flex-order:9;order:9}.order-10{-webkit-box-ordinal-group:11;-ms-flex-order:10;order:10}.order-11{-webkit-box-ordinal-group:12;-ms-flex-order:11;order:11}.order-12{-webkit-box-ordinal-group:13;-ms-flex-order:12;order:12}.offset-1{margin-left:8.333333%}.offset-2{margin-left:16.666667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.333333%}.offset-5{margin-left:41.666667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.333333%}.offset-8{margin-left:66.666667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.333333%}.offset-11{margin-left:91.666667%}@media (min-width:576px){.col-sm{-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-sm-auto{-webkit-box-flex:0;-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-sm-1{-webkit-box-flex:0;-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-sm-2{-webkit-box-flex:0;-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-sm-3{-webkit-box-flex:0;-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-sm-4{-webkit-box-flex:0;-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-sm-5{-webkit-box-flex:0;-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-sm-6{-webkit-box-flex:0;-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-sm-7{-webkit-box-flex:0;-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-sm-8{-webkit-box-flex:0;-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-sm-9{-webkit-box-flex:0;-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-sm-10{-webkit-box-flex:0;-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-sm-11{-webkit-box-flex:0;-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-sm-12{-webkit-box-flex:0;-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-sm-first{-webkit-box-ordinal-group:0;-ms-flex-order:-1;order:-1}.order-sm-last{-webkit-box-ordinal-group:14;-ms-flex-order:13;order:13}.order-sm-0{-webkit-box-ordinal-group:1;-ms-flex-order:0;order:0}.order-sm-1{-webkit-box-ordinal-group:2;-ms-flex-order:1;order:1}.order-sm-2{-webkit-box-ordinal-group:3;-ms-flex-order:2;order:2}.order-sm-3{-webkit-box-ordinal-group:4;-ms-flex-order:3;order:3}.order-sm-4{-webkit-box-ordinal-group:5;-ms-flex-order:4;order:4}.order-sm-5{-webkit-box-ordinal-group:6;-ms-flex-order:5;order:5}.order-sm-6{-webkit-box-ordinal-group:7;-ms-flex-order:6;order:6}.order-sm-7{-webkit-box-ordinal-group:8;-ms-flex-order:7;order:7}.order-sm-8{-webkit-box-ordinal-group:9;-ms-flex-order:8;order:8}.order-sm-9{-webkit-box-ordinal-group:10;-ms-flex-order:9;order:9}.order-sm-10{-webkit-box-ordinal-group:11;-ms-flex-order:10;order:10}.order-sm-11{-webkit-box-ordinal-group:12;-ms-flex-order:11;order:11}.order-sm-12{-webkit-box-ordinal-group:13;-ms-flex-order:12;order:12}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.333333%}.offset-sm-2{margin-left:16.666667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.333333%}.offset-sm-5{margin-left:41.666667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.333333%}.offset-sm-8{margin-left:66.666667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.333333%}.offset-sm-11{margin-left:91.666667%}}@media (min-width:768px){.col-md{-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-md-auto{-webkit-box-flex:0;-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-md-1{-webkit-box-flex:0;-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-md-2{-webkit-box-flex:0;-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-md-3{-webkit-box-flex:0;-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-md-4{-webkit-box-flex:0;-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-md-5{-webkit-box-flex:0;-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-md-6{-webkit-box-flex:0;-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-md-7{-webkit-box-flex:0;-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-md-8{-webkit-box-flex:0;-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-md-9{-webkit-box-flex:0;-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-md-10{-webkit-box-flex:0;-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-md-11{-webkit-box-flex:0;-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-md-12{-webkit-box-flex:0;-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-md-first{-webkit-box-ordinal-group:0;-ms-flex-order:-1;order:-1}.order-md-last{-webkit-box-ordinal-group:14;-ms-flex-order:13;order:13}.order-md-0{-webkit-box-ordinal-group:1;-ms-flex-order:0;order:0}.order-md-1{-webkit-box-ordinal-group:2;-ms-flex-order:1;order:1}.order-md-2{-webkit-box-ordinal-group:3;-ms-flex-order:2;order:2}.order-md-3{-webkit-box-ordinal-group:4;-ms-flex-order:3;order:3}.order-md-4{-webkit-box-ordinal-group:5;-ms-flex-order:4;order:4}.order-md-5{-webkit-box-ordinal-group:6;-ms-flex-order:5;order:5}.order-md-6{-webkit-box-ordinal-group:7;-ms-flex-order:6;order:6}.order-md-7{-webkit-box-ordinal-group:8;-ms-flex-order:7;order:7}.order-md-8{-webkit-box-ordinal-group:9;-ms-flex-order:8;order:8}.order-md-9{-webkit-box-ordinal-group:10;-ms-flex-order:9;order:9}.order-md-10{-webkit-box-ordinal-group:11;-ms-flex-order:10;order:10}.order-md-11{-webkit-box-ordinal-group:12;-ms-flex-order:11;order:11}.order-md-12{-webkit-box-ordinal-group:13;-ms-flex-order:12;order:12}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.333333%}.offset-md-2{margin-left:16.666667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.333333%}.offset-md-5{margin-left:41.666667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.333333%}.offset-md-8{margin-left:66.666667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.333333%}.offset-md-11{margin-left:91.666667%}}@media (min-width:992px){.col-lg{-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-lg-auto{-webkit-box-flex:0;-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-lg-1{-webkit-box-flex:0;-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-lg-2{-webkit-box-flex:0;-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-lg-3{-webkit-box-flex:0;-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-lg-4{-webkit-box-flex:0;-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-lg-5{-webkit-box-flex:0;-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-lg-6{-webkit-box-flex:0;-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-lg-7{-webkit-box-flex:0;-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-lg-8{-webkit-box-flex:0;-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-lg-9{-webkit-box-flex:0;-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-lg-10{-webkit-box-flex:0;-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-lg-11{-webkit-box-flex:0;-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-lg-12{-webkit-box-flex:0;-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-lg-first{-webkit-box-ordinal-group:0;-ms-flex-order:-1;order:-1}.order-lg-last{-webkit-box-ordinal-group:14;-ms-flex-order:13;order:13}.order-lg-0{-webkit-box-ordinal-group:1;-ms-flex-order:0;order:0}.order-lg-1{-webkit-box-ordinal-group:2;-ms-flex-order:1;order:1}.order-lg-2{-webkit-box-ordinal-group:3;-ms-flex-order:2;order:2}.order-lg-3{-webkit-box-ordinal-group:4;-ms-flex-order:3;order:3}.order-lg-4{-webkit-box-ordinal-group:5;-ms-flex-order:4;order:4}.order-lg-5{-webkit-box-ordinal-group:6;-ms-flex-order:5;order:5}.order-lg-6{-webkit-box-ordinal-group:7;-ms-flex-order:6;order:6}.order-lg-7{-webkit-box-ordinal-group:8;-ms-flex-order:7;order:7}.order-lg-8{-webkit-box-ordinal-group:9;-ms-flex-order:8;order:8}.order-lg-9{-webkit-box-ordinal-group:10;-ms-flex-order:9;order:9}.order-lg-10{-webkit-box-ordinal-group:11;-ms-flex-order:10;order:10}.order-lg-11{-webkit-box-ordinal-group:12;-ms-flex-order:11;order:11}.order-lg-12{-webkit-box-ordinal-group:13;-ms-flex-order:12;order:12}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.333333%}.offset-lg-2{margin-left:16.666667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.333333%}.offset-lg-5{margin-left:41.666667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.333333%}.offset-lg-8{margin-left:66.666667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.333333%}.offset-lg-11{margin-left:91.666667%}}@media (min-width:1200px){.col-xl{-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-xl-auto{-webkit-box-flex:0;-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-xl-1{-webkit-box-flex:0;-ms-flex:0 0 8.333333%;flex:0 0 8.333333%;max-width:8.333333%}.col-xl-2{-webkit-box-flex:0;-ms-flex:0 0 16.666667%;flex:0 0 16.666667%;max-width:16.666667%}.col-xl-3{-webkit-box-flex:0;-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-xl-4{-webkit-box-flex:0;-ms-flex:0 0 33.333333%;flex:0 0 33.333333%;max-width:33.333333%}.col-xl-5{-webkit-box-flex:0;-ms-flex:0 0 41.666667%;flex:0 0 41.666667%;max-width:41.666667%}.col-xl-6{-webkit-box-flex:0;-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-xl-7{-webkit-box-flex:0;-ms-flex:0 0 58.333333%;flex:0 0 58.333333%;max-width:58.333333%}.col-xl-8{-webkit-box-flex:0;-ms-flex:0 0 66.666667%;flex:0 0 66.666667%;max-width:66.666667%}.col-xl-9{-webkit-box-flex:0;-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-xl-10{-webkit-box-flex:0;-ms-flex:0 0 83.333333%;flex:0 0 83.333333%;max-width:83.333333%}.col-xl-11{-webkit-box-flex:0;-ms-flex:0 0 91.666667%;flex:0 0 91.666667%;max-width:91.666667%}.col-xl-12{-webkit-box-flex:0;-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-xl-first{-webkit-box-ordinal-group:0;-ms-flex-order:-1;order:-1}.order-xl-last{-webkit-box-ordinal-group:14;-ms-flex-order:13;order:13}.order-xl-0{-webkit-box-ordinal-group:1;-ms-flex-order:0;order:0}.order-xl-1{-webkit-box-ordinal-group:2;-ms-flex-order:1;order:1}.order-xl-2{-webkit-box-ordinal-group:3;-ms-flex-order:2;order:2}.order-xl-3{-webkit-box-ordinal-group:4;-ms-flex-order:3;order:3}.order-xl-4{-webkit-box-ordinal-group:5;-ms-flex-order:4;order:4}.order-xl-5{-webkit-box-ordinal-group:6;-ms-flex-order:5;order:5}.order-xl-6{-webkit-box-ordinal-group:7;-ms-flex-order:6;order:6}.order-xl-7{-webkit-box-ordinal-group:8;-ms-flex-order:7;order:7}.order-xl-8{-webkit-box-ordinal-group:9;-ms-flex-order:8;order:8}.order-xl-9{-webkit-box-ordinal-group:10;-ms-flex-order:9;order:9}.order-xl-10{-webkit-box-ordinal-group:11;-ms-flex-order:10;order:10}.order-xl-11{-webkit-box-ordinal-group:12;-ms-flex-order:11;order:11}.order-xl-12{-webkit-box-ordinal-group:13;-ms-flex-order:12;order:12}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.333333%}.offset-xl-2{margin-left:16.666667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.333333%}.offset-xl-5{margin-left:41.666667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.333333%}.offset-xl-8{margin-left:66.666667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.333333%}.offset-xl-11{margin-left:91.666667%}}.table{width:100%;max-width:100%;margin-bottom:1rem;background-color:transparent}.table td,.table th{padding:.75rem;vertical-align:top;border-top:1px solid #dee2e6}.table thead th{vertical-align:bottom;border-bottom:2px solid #dee2e6}.table tbody+tbody{border-top:2px solid #dee2e6}.table .table{background-color:#fff}.table-sm td,.table-sm th{padding:.3rem}.table-bordered{border:1px solid #dee2e6}.table-bordered td,.table-bordered th{border:1px solid #dee2e6}.table-bordered thead td,.table-bordered thead th{border-bottom-width:2px}.table-striped tbody tr:nth-of-type(odd){background-color:rgba(0,0,0,.05)}.table-hover tbody tr:hover{background-color:rgba(0,0,0,.075)}.table-primary,.table-primary>td,.table-primary>th{background-color:#b8daff}.table-hover .table-primary:hover{background-color:#9fcdff}.table-hover .table-primary:hover>td,.table-hover .table-primary:hover>th{background-color:#9fcdff}.table-secondary,.table-secondary>td,.table-secondary>th{background-color:#d6d8db}.table-hover .table-secondary:hover{background-color:#c8cbcf}.table-hover .table-secondary:hover>td,.table-hover .table-secondary:hover>th{background-color:#c8cbcf}.table-success,.table-success>td,.table-success>th{background-color:#c3e6cb}.table-hover .table-success:hover{background-color:#b1dfbb}.table-hover .table-success:hover>td,.table-hover .table-success:hover>th{background-color:#b1dfbb}.table-info,.table-info>td,.table-info>th{background-color:#bee5eb}.table-hover .table-info:hover{background-color:#abdde5}.table-hover .table-info:hover>td,.table-hover .table-info:hover>th{background-color:#abdde5}.table-warning,.table-warning>td,.table-warning>th{background-color:#ffeeba}.table-hover .table-warning:hover{background-color:#ffe8a1}.table-hover .table-warning:hover>td,.table-hover .table-warning:hover>th{background-color:#ffe8a1}.table-danger,.table-danger>td,.table-danger>th{background-color:#f5c6cb}.table-hover .table-danger:hover{background-color:#f1b0b7}.table-hover .table-danger:hover>td,.table-hover .table-danger:hover>th{background-color:#f1b0b7}.table-light,.table-light>td,.table-light>th{background-color:#fdfdfe}.table-hover .table-light:hover{background-color:#ececf6}.table-hover .table-light:hover>td,.table-hover .table-light:hover>th{background-color:#ececf6}.table-dark,.table-dark>td,.table-dark>th{background-color:#c6c8ca}.table-hover .table-dark:hover{background-color:#b9bbbe}.table-hover .table-dark:hover>td,.table-hover .table-dark:hover>th{background-color:#b9bbbe}.table-active,.table-active>td,.table-active>th{background-color:rgba(0,0,0,.075)}.table-hover .table-active:hover{background-color:rgba(0,0,0,.075)}.table-hover .table-active:hover>td,.table-hover .table-active:hover>th{background-color:rgba(0,0,0,.075)}.table .thead-dark th{color:#fff;background-color:#212529;border-color:#32383e}.table .thead-light th{color:#495057;background-color:#e9ecef;border-color:#dee2e6}.table-dark{color:#fff;background-color:#212529}.table-dark td,.table-dark th,.table-dark thead th{border-color:#32383e}.table-dark.table-bordered{border:0}.table-dark.table-striped tbody tr:nth-of-type(odd){background-color:rgba(255,255,255,.05)}.table-dark.table-hover tbody tr:hover{background-color:rgba(255,255,255,.075)}@media (max-width:575.98px){.table-responsive-sm{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-sm>.table-bordered{border:0}}@media (max-width:767.98px){.table-responsive-md{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-md>.table-bordered{border:0}}@media (max-width:991.98px){.table-responsive-lg{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-lg>.table-bordered{border:0}}@media (max-width:1199.98px){.table-responsive-xl{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-xl>.table-bordered{border:0}}.table-responsive{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive>.table-bordered{border:0}.form-control{display:block;width:100%;padding:.375rem .75rem;font-size:1rem;line-height:1.5;color:#495057;background-color:#fff;background-clip:padding-box;border:1px solid #ced4da;border-radius:.25rem;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}.form-control::-ms-expand{background-color:transparent;border:0}.form-control:focus{color:#495057;background-color:#fff;border-color:#80bdff;outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.form-control::-webkit-input-placeholder{color:#6c757d;opacity:1}.form-control::-moz-placeholder{color:#6c757d;opacity:1}.form-control:-ms-input-placeholder{color:#6c757d;opacity:1}.form-control::-ms-input-placeholder{color:#6c757d;opacity:1}.form-control::placeholder{color:#6c757d;opacity:1}.form-control:disabled,.form-control[readonly]{background-color:#e9ecef;opacity:1}select.form-control:not([size]):not([multiple]){height:calc(2.25rem + 2px)}select.form-control:focus::-ms-value{color:#495057;background-color:#fff}.form-control-file,.form-control-range{display:block;width:100%}.col-form-label{padding-top:calc(.375rem + 1px);padding-bottom:calc(.375rem + 1px);margin-bottom:0;font-size:inherit;line-height:1.5}.col-form-label-lg{padding-top:calc(.5rem + 1px);padding-bottom:calc(.5rem + 1px);font-size:1.25rem;line-height:1.5}.col-form-label-sm{padding-top:calc(.25rem + 1px);padding-bottom:calc(.25rem + 1px);font-size:.875rem;line-height:1.5}.form-control-plaintext{display:block;width:100%;padding-top:.375rem;padding-bottom:.375rem;margin-bottom:0;line-height:1.5;background-color:transparent;border:solid transparent;border-width:1px 0}.form-control-plaintext.form-control-lg,.form-control-plaintext.form-control-sm,.input-group-lg>.form-control-plaintext.form-control,.input-group-lg>.input-group-append>.form-control-plaintext.btn,.input-group-lg>.input-group-append>.form-control-plaintext.input-group-text,.input-group-lg>.input-group-prepend>.form-control-plaintext.btn,.input-group-lg>.input-group-prepend>.form-control-plaintext.input-group-text,.input-group-sm>.form-control-plaintext.form-control,.input-group-sm>.input-group-append>.form-control-plaintext.btn,.input-group-sm>.input-group-append>.form-control-plaintext.input-group-text,.input-group-sm>.input-group-prepend>.form-control-plaintext.btn,.input-group-sm>.input-group-prepend>.form-control-plaintext.input-group-text{padding-right:0;padding-left:0}.form-control-sm,.input-group-sm>.form-control,.input-group-sm>.input-group-append>.btn,.input-group-sm>.input-group-append>.input-group-text,.input-group-sm>.input-group-prepend>.btn,.input-group-sm>.input-group-prepend>.input-group-text{padding:.25rem .5rem;font-size:.875rem;line-height:1.5;border-radius:.2rem}.input-group-sm>.input-group-append>select.btn:not([size]):not([multiple]),.input-group-sm>.input-group-append>select.input-group-text:not([size]):not([multiple]),.input-group-sm>.input-group-prepend>select.btn:not([size]):not([multiple]),.input-group-sm>.input-group-prepend>select.input-group-text:not([size]):not([multiple]),.input-group-sm>select.form-control:not([size]):not([multiple]),select.form-control-sm:not([size]):not([multiple]){height:calc(1.8125rem + 2px)}.form-control-lg,.input-group-lg>.form-control,.input-group-lg>.input-group-append>.btn,.input-group-lg>.input-group-append>.input-group-text,.input-group-lg>.input-group-prepend>.btn,.input-group-lg>.input-group-prepend>.input-group-text{padding:.5rem 1rem;font-size:1.25rem;line-height:1.5;border-radius:.3rem}.input-group-lg>.input-group-append>select.btn:not([size]):not([multiple]),.input-group-lg>.input-group-append>select.input-group-text:not([size]):not([multiple]),.input-group-lg>.input-group-prepend>select.btn:not([size]):not([multiple]),.input-group-lg>.input-group-prepend>select.input-group-text:not([size]):not([multiple]),.input-group-lg>select.form-control:not([size]):not([multiple]),select.form-control-lg:not([size]):not([multiple]){height:calc(2.875rem + 2px)}.form-group{margin-bottom:1rem}.form-text{display:block;margin-top:.25rem}.form-row{display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-right:-5px;margin-left:-5px}.form-row>.col,.form-row>[class*=col-]{padding-right:5px;padding-left:5px}.form-check{position:relative;display:block;padding-left:1.25rem}.form-check-input{position:absolute;margin-top:.3rem;margin-left:-1.25rem}.form-check-input:disabled~.form-check-label{color:#6c757d}.form-check-label{margin-bottom:0}.form-check-inline{display:-webkit-inline-box;display:-ms-inline-flexbox;display:inline-flex;-webkit-box-align:center;-ms-flex-align:center;align-items:center;padding-left:0;margin-right:.75rem}.form-check-inline .form-check-input{position:static;margin-top:0;margin-right:.3125rem;margin-left:0}.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:80%;color:#28a745}.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.5rem;margin-top:.1rem;font-size:.875rem;line-height:1;color:#fff;background-color:rgba(40,167,69,.8);border-radius:.2rem}.custom-select.is-valid,.form-control.is-valid,.was-validated .custom-select:valid,.was-validated .form-control:valid{border-color:#28a745}.custom-select.is-valid:focus,.form-control.is-valid:focus,.was-validated .custom-select:valid:focus,.was-validated .form-control:valid:focus{border-color:#28a745;box-shadow:0 0 0 .2rem rgba(40,167,69,.25)}.custom-select.is-valid~.valid-feedback,.custom-select.is-valid~.valid-tooltip,.form-control.is-valid~.valid-feedback,.form-control.is-valid~.valid-tooltip,.was-validated .custom-select:valid~.valid-feedback,.was-validated .custom-select:valid~.valid-tooltip,.was-validated .form-control:valid~.valid-feedback,.was-validated .form-control:valid~.valid-tooltip{display:block}.form-check-input.is-valid~.form-check-label,.was-validated .form-check-input:valid~.form-check-label{color:#28a745}.form-check-input.is-valid~.valid-feedback,.form-check-input.is-valid~.valid-tooltip,.was-validated .form-check-input:valid~.valid-feedback,.was-validated .form-check-input:valid~.valid-tooltip{display:block}.custom-control-input.is-valid~.custom-control-label,.was-validated .custom-control-input:valid~.custom-control-label{color:#28a745}.custom-control-input.is-valid~.custom-control-label::before,.was-validated .custom-control-input:valid~.custom-control-label::before{background-color:#71dd8a}.custom-control-input.is-valid~.valid-feedback,.custom-control-input.is-valid~.valid-tooltip,.was-validated .custom-control-input:valid~.valid-feedback,.was-validated .custom-control-input:valid~.valid-tooltip{display:block}.custom-control-input.is-valid:checked~.custom-control-label::before,.was-validated .custom-control-input:valid:checked~.custom-control-label::before{background-color:#34ce57}.custom-control-input.is-valid:focus~.custom-control-label::before,.was-validated .custom-control-input:valid:focus~.custom-control-label::before{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(40,167,69,.25)}.custom-file-input.is-valid~.custom-file-label,.was-validated .custom-file-input:valid~.custom-file-label{border-color:#28a745}.custom-file-input.is-valid~.custom-file-label::before,.was-validated .custom-file-input:valid~.custom-file-label::before{border-color:inherit}.custom-file-input.is-valid~.valid-feedback,.custom-file-input.is-valid~.valid-tooltip,.was-validated .custom-file-input:valid~.valid-feedback,.was-validated .custom-file-input:valid~.valid-tooltip{display:block}.custom-file-input.is-valid:focus~.custom-file-label,.was-validated .custom-file-input:valid:focus~.custom-file-label{box-shadow:0 0 0 .2rem rgba(40,167,69,.25)}.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:80%;color:#dc3545}.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.5rem;margin-top:.1rem;font-size:.875rem;line-height:1;color:#fff;background-color:rgba(220,53,69,.8);border-radius:.2rem}.custom-select.is-invalid,.form-control.is-invalid,.was-validated .custom-select:invalid,.was-validated .form-control:invalid{border-color:#dc3545}.custom-select.is-invalid:focus,.form-control.is-invalid:focus,.was-validated .custom-select:invalid:focus,.was-validated .form-control:invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .2rem rgba(220,53,69,.25)}.custom-select.is-invalid~.invalid-feedback,.custom-select.is-invalid~.invalid-tooltip,.form-control.is-invalid~.invalid-feedback,.form-control.is-invalid~.invalid-tooltip,.was-validated .custom-select:invalid~.invalid-feedback,.was-validated .custom-select:invalid~.invalid-tooltip,.was-validated .form-control:invalid~.invalid-feedback,.was-validated .form-control:invalid~.invalid-tooltip{display:block}.form-check-input.is-invalid~.form-check-label,.was-validated .form-check-input:invalid~.form-check-label{color:#dc3545}.form-check-input.is-invalid~.invalid-feedback,.form-check-input.is-invalid~.invalid-tooltip,.was-validated .form-check-input:invalid~.invalid-feedback,.was-validated .form-check-input:invalid~.invalid-tooltip{display:block}.custom-control-input.is-invalid~.custom-control-label,.was-validated .custom-control-input:invalid~.custom-control-label{color:#dc3545}.custom-control-input.is-invalid~.custom-control-label::before,.was-validated .custom-control-input:invalid~.custom-control-label::before{background-color:#efa2a9}.custom-control-input.is-invalid~.invalid-feedback,.custom-control-input.is-invalid~.invalid-tooltip,.was-validated .custom-control-input:invalid~.invalid-feedback,.was-validated .custom-control-input:invalid~.invalid-tooltip{display:block}.custom-control-input.is-invalid:checked~.custom-control-label::before,.was-validated .custom-control-input:invalid:checked~.custom-control-label::before{background-color:#e4606d}.custom-control-input.is-invalid:focus~.custom-control-label::before,.was-validated .custom-control-input:invalid:focus~.custom-control-label::before{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(220,53,69,.25)}.custom-file-input.is-invalid~.custom-file-label,.was-validated .custom-file-input:invalid~.custom-file-label{border-color:#dc3545}.custom-file-input.is-invalid~.custom-file-label::before,.was-validated .custom-file-input:invalid~.custom-file-label::before{border-color:inherit}.custom-file-input.is-invalid~.invalid-feedback,.custom-file-input.is-invalid~.invalid-tooltip,.was-validated .custom-file-input:invalid~.invalid-feedback,.was-validated .custom-file-input:invalid~.invalid-tooltip{display:block}.custom-file-input.is-invalid:focus~.custom-file-label,.was-validated .custom-file-input:invalid:focus~.custom-file-label{box-shadow:0 0 0 .2rem rgba(220,53,69,.25)}.form-inline{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row wrap;flex-flow:row wrap;-webkit-box-align:center;-ms-flex-align:center;align-items:center}.form-inline .form-check{width:100%}@media (min-width:576px){.form-inline label{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:center;-ms-flex-pack:center;justify-content:center;margin-bottom:0}.form-inline .form-group{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-flex:0;-ms-flex:0 0 auto;flex:0 0 auto;-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row wrap;flex-flow:row wrap;-webkit-box-align:center;-ms-flex-align:center;align-items:center;margin-bottom:0}.form-inline .form-control{display:inline-block;width:auto;vertical-align:middle}.form-inline .form-control-plaintext{display:inline-block}.form-inline .input-group{width:auto}.form-inline .form-check{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:center;-ms-flex-pack:center;justify-content:center;width:auto;padding-left:0}.form-inline .form-check-input{position:relative;margin-top:0;margin-right:.25rem;margin-left:0}.form-inline .custom-control{-webkit-box-align:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:center;-ms-flex-pack:center;justify-content:center}.form-inline .custom-control-label{margin-bottom:0}}.btn{display:inline-block;font-weight:400;text-align:center;white-space:nowrap;vertical-align:middle;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;border:1px solid transparent;padding:.375rem .75rem;font-size:1rem;line-height:1.5;border-radius:.25rem;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}.btn:focus,.btn:hover{text-decoration:none}.btn.focus,.btn:focus{outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.btn.disabled,.btn:disabled{opacity:.65}.btn:not(:disabled):not(.disabled){cursor:pointer}.btn:not(:disabled):not(.disabled).active,.btn:not(:disabled):not(.disabled):active{background-image:none}a.btn.disabled,fieldset:disabled a.btn{pointer-events:none}.btn-primary{color:#fff;background-color:#007bff;border-color:#007bff}.btn-primary:hover{color:#fff;background-color:#0069d9;border-color:#0062cc}.btn-primary.focus,.btn-primary:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-primary.disabled,.btn-primary:disabled{color:#fff;background-color:#007bff;border-color:#007bff}.btn-primary:not(:disabled):not(.disabled).active,.btn-primary:not(:disabled):not(.disabled):active,.show>.btn-primary.dropdown-toggle{color:#fff;background-color:#0062cc;border-color:#005cbf}.btn-primary:not(:disabled):not(.disabled).active:focus,.btn-primary:not(:disabled):not(.disabled):active:focus,.show>.btn-primary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-secondary{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-secondary:hover{color:#fff;background-color:#5a6268;border-color:#545b62}.btn-secondary.focus,.btn-secondary:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-secondary.disabled,.btn-secondary:disabled{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-secondary:not(:disabled):not(.disabled).active,.btn-secondary:not(:disabled):not(.disabled):active,.show>.btn-secondary.dropdown-toggle{color:#fff;background-color:#545b62;border-color:#4e555b}.btn-secondary:not(:disabled):not(.disabled).active:focus,.btn-secondary:not(:disabled):not(.disabled):active:focus,.show>.btn-secondary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-success{color:#fff;background-color:#28a745;border-color:#28a745}.btn-success:hover{color:#fff;background-color:#218838;border-color:#1e7e34}.btn-success.focus,.btn-success:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-success.disabled,.btn-success:disabled{color:#fff;background-color:#28a745;border-color:#28a745}.btn-success:not(:disabled):not(.disabled).active,.btn-success:not(:disabled):not(.disabled):active,.show>.btn-success.dropdown-toggle{color:#fff;background-color:#1e7e34;border-color:#1c7430}.btn-success:not(:disabled):not(.disabled).active:focus,.btn-success:not(:disabled):not(.disabled):active:focus,.show>.btn-success.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-info{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-info:hover{color:#fff;background-color:#138496;border-color:#117a8b}.btn-info.focus,.btn-info:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-info.disabled,.btn-info:disabled{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-info:not(:disabled):not(.disabled).active,.btn-info:not(:disabled):not(.disabled):active,.show>.btn-info.dropdown-toggle{color:#fff;background-color:#117a8b;border-color:#10707f}.btn-info:not(:disabled):not(.disabled).active:focus,.btn-info:not(:disabled):not(.disabled):active:focus,.show>.btn-info.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-warning{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-warning:hover{color:#212529;background-color:#e0a800;border-color:#d39e00}.btn-warning.focus,.btn-warning:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-warning.disabled,.btn-warning:disabled{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-warning:not(:disabled):not(.disabled).active,.btn-warning:not(:disabled):not(.disabled):active,.show>.btn-warning.dropdown-toggle{color:#212529;background-color:#d39e00;border-color:#c69500}.btn-warning:not(:disabled):not(.disabled).active:focus,.btn-warning:not(:disabled):not(.disabled):active:focus,.show>.btn-warning.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-danger{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-danger:hover{color:#fff;background-color:#c82333;border-color:#bd2130}.btn-danger.focus,.btn-danger:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-danger.disabled,.btn-danger:disabled{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-danger:not(:disabled):not(.disabled).active,.btn-danger:not(:disabled):not(.disabled):active,.show>.btn-danger.dropdown-toggle{color:#fff;background-color:#bd2130;border-color:#b21f2d}.btn-danger:not(:disabled):not(.disabled).active:focus,.btn-danger:not(:disabled):not(.disabled):active:focus,.show>.btn-danger.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-light{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-light:hover{color:#212529;background-color:#e2e6ea;border-color:#dae0e5}.btn-light.focus,.btn-light:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-light.disabled,.btn-light:disabled{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-light:not(:disabled):not(.disabled).active,.btn-light:not(:disabled):not(.disabled):active,.show>.btn-light.dropdown-toggle{color:#212529;background-color:#dae0e5;border-color:#d3d9df}.btn-light:not(:disabled):not(.disabled).active:focus,.btn-light:not(:disabled):not(.disabled):active:focus,.show>.btn-light.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-dark{color:#fff;background-color:#343a40;border-color:#343a40}.btn-dark:hover{color:#fff;background-color:#23272b;border-color:#1d2124}.btn-dark.focus,.btn-dark:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-dark.disabled,.btn-dark:disabled{color:#fff;background-color:#343a40;border-color:#343a40}.btn-dark:not(:disabled):not(.disabled).active,.btn-dark:not(:disabled):not(.disabled):active,.show>.btn-dark.dropdown-toggle{color:#fff;background-color:#1d2124;border-color:#171a1d}.btn-dark:not(:disabled):not(.disabled).active:focus,.btn-dark:not(:disabled):not(.disabled):active:focus,.show>.btn-dark.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-outline-primary{color:#007bff;background-color:transparent;background-image:none;border-color:#007bff}.btn-outline-primary:hover{color:#fff;background-color:#007bff;border-color:#007bff}.btn-outline-primary.focus,.btn-outline-primary:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-outline-primary.disabled,.btn-outline-primary:disabled{color:#007bff;background-color:transparent}.btn-outline-primary:not(:disabled):not(.disabled).active,.btn-outline-primary:not(:disabled):not(.disabled):active,.show>.btn-outline-primary.dropdown-toggle{color:#fff;background-color:#007bff;border-color:#007bff}.btn-outline-primary:not(:disabled):not(.disabled).active:focus,.btn-outline-primary:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-primary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-outline-secondary{color:#6c757d;background-color:transparent;background-image:none;border-color:#6c757d}.btn-outline-secondary:hover{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-outline-secondary.focus,.btn-outline-secondary:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-outline-secondary.disabled,.btn-outline-secondary:disabled{color:#6c757d;background-color:transparent}.btn-outline-secondary:not(:disabled):not(.disabled).active,.btn-outline-secondary:not(:disabled):not(.disabled):active,.show>.btn-outline-secondary.dropdown-toggle{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-outline-secondary:not(:disabled):not(.disabled).active:focus,.btn-outline-secondary:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-secondary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-outline-success{color:#28a745;background-color:transparent;background-image:none;border-color:#28a745}.btn-outline-success:hover{color:#fff;background-color:#28a745;border-color:#28a745}.btn-outline-success.focus,.btn-outline-success:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-outline-success.disabled,.btn-outline-success:disabled{color:#28a745;background-color:transparent}.btn-outline-success:not(:disabled):not(.disabled).active,.btn-outline-success:not(:disabled):not(.disabled):active,.show>.btn-outline-success.dropdown-toggle{color:#fff;background-color:#28a745;border-color:#28a745}.btn-outline-success:not(:disabled):not(.disabled).active:focus,.btn-outline-success:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-success.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-outline-info{color:#17a2b8;background-color:transparent;background-image:none;border-color:#17a2b8}.btn-outline-info:hover{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-outline-info.focus,.btn-outline-info:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-outline-info.disabled,.btn-outline-info:disabled{color:#17a2b8;background-color:transparent}.btn-outline-info:not(:disabled):not(.disabled).active,.btn-outline-info:not(:disabled):not(.disabled):active,.show>.btn-outline-info.dropdown-toggle{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-outline-info:not(:disabled):not(.disabled).active:focus,.btn-outline-info:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-info.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-outline-warning{color:#ffc107;background-color:transparent;background-image:none;border-color:#ffc107}.btn-outline-warning:hover{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-outline-warning.focus,.btn-outline-warning:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-outline-warning.disabled,.btn-outline-warning:disabled{color:#ffc107;background-color:transparent}.btn-outline-warning:not(:disabled):not(.disabled).active,.btn-outline-warning:not(:disabled):not(.disabled):active,.show>.btn-outline-warning.dropdown-toggle{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-outline-warning:not(:disabled):not(.disabled).active:focus,.btn-outline-warning:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-warning.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-outline-danger{color:#dc3545;background-color:transparent;background-image:none;border-color:#dc3545}.btn-outline-danger:hover{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-outline-danger.focus,.btn-outline-danger:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-outline-danger.disabled,.btn-outline-danger:disabled{color:#dc3545;background-color:transparent}.btn-outline-danger:not(:disabled):not(.disabled).active,.btn-outline-danger:not(:disabled):not(.disabled):active,.show>.btn-outline-danger.dropdown-toggle{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-outline-danger:not(:disabled):not(.disabled).active:focus,.btn-outline-danger:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-danger.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-outline-light{color:#f8f9fa;background-color:transparent;background-image:none;border-color:#f8f9fa}.btn-outline-light:hover{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-outline-light.focus,.btn-outline-light:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-outline-light.disabled,.btn-outline-light:disabled{color:#f8f9fa;background-color:transparent}.btn-outline-light:not(:disabled):not(.disabled).active,.btn-outline-light:not(:disabled):not(.disabled):active,.show>.btn-outline-light.dropdown-toggle{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-outline-light:not(:disabled):not(.disabled).active:focus,.btn-outline-light:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-light.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-outline-dark{color:#343a40;background-color:transparent;background-image:none;border-color:#343a40}.btn-outline-dark:hover{color:#fff;background-color:#343a40;border-color:#343a40}.btn-outline-dark.focus,.btn-outline-dark:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-outline-dark.disabled,.btn-outline-dark:disabled{color:#343a40;background-color:transparent}.btn-outline-dark:not(:disabled):not(.disabled).active,.btn-outline-dark:not(:disabled):not(.disabled):active,.show>.btn-outline-dark.dropdown-toggle{color:#fff;background-color:#343a40;border-color:#343a40}.btn-outline-dark:not(:disabled):not(.disabled).active:focus,.btn-outline-dark:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-dark.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-link{font-weight:400;color:#007bff;background-color:transparent}.btn-link:hover{color:#0056b3;text-decoration:underline;background-color:transparent;border-color:transparent}.btn-link.focus,.btn-link:focus{text-decoration:underline;border-color:transparent;box-shadow:none}.btn-link.disabled,.btn-link:disabled{color:#6c757d}.btn-group-lg>.btn,.btn-lg{padding:.5rem 1rem;font-size:1.25rem;line-height:1.5;border-radius:.3rem}.btn-group-sm>.btn,.btn-sm{padding:.25rem .5rem;font-size:.875rem;line-height:1.5;border-radius:.2rem}.btn-block{display:block;width:100%}.btn-block+.btn-block{margin-top:.5rem}input[type=button].btn-block,input[type=reset].btn-block,input[type=submit].btn-block{width:100%}.fade{opacity:0;transition:opacity .15s linear}.fade.show{opacity:1}.collapse{display:none}.collapse.show{display:block}tr.collapse.show{display:table-row}tbody.collapse.show{display:table-row-group}.collapsing{position:relative;height:0;overflow:hidden;transition:height .35s ease}.dropdown,.dropup{position:relative}.dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid transparent;border-bottom:0;border-left:.3em solid transparent}.dropdown-toggle:empty::after{margin-left:0}.dropdown-menu{position:absolute;top:100%;left:0;z-index:1000;display:none;float:left;min-width:10rem;padding:.5rem 0;margin:.125rem 0 0;font-size:1rem;color:#212529;text-align:left;list-style:none;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.15);border-radius:.25rem}.dropup .dropdown-menu{margin-top:0;margin-bottom:.125rem}.dropup .dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid transparent;border-bottom:.3em solid;border-left:.3em solid transparent}.dropup .dropdown-toggle:empty::after{margin-left:0}.dropright .dropdown-menu{margin-top:0;margin-left:.125rem}.dropright .dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-bottom:.3em solid transparent;border-left:.3em solid}.dropright .dropdown-toggle:empty::after{margin-left:0}.dropright .dropdown-toggle::after{vertical-align:0}.dropleft .dropdown-menu{margin-top:0;margin-right:.125rem}.dropleft .dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:""}.dropleft .dropdown-toggle::after{display:none}.dropleft .dropdown-toggle::before{display:inline-block;width:0;height:0;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:.3em solid;border-bottom:.3em solid transparent}.dropleft .dropdown-toggle:empty::after{margin-left:0}.dropleft .dropdown-toggle::before{vertical-align:0}.dropdown-divider{height:0;margin:.5rem 0;overflow:hidden;border-top:1px solid #e9ecef}.dropdown-item{display:block;width:100%;padding:.25rem 1.5rem;clear:both;font-weight:400;color:#212529;text-align:inherit;white-space:nowrap;background-color:transparent;border:0}.dropdown-item:focus,.dropdown-item:hover{color:#16181b;text-decoration:none;background-color:#f8f9fa}.dropdown-item.active,.dropdown-item:active{color:#fff;text-decoration:none;background-color:#007bff}.dropdown-item.disabled,.dropdown-item:disabled{color:#6c757d;background-color:transparent}.dropdown-menu.show{display:block}.dropdown-header{display:block;padding:.5rem 1.5rem;margin-bottom:0;font-size:.875rem;color:#6c757d;white-space:nowrap}.btn-group,.btn-group-vertical{position:relative;display:-webkit-inline-box;display:-ms-inline-flexbox;display:inline-flex;vertical-align:middle}.btn-group-vertical>.btn,.btn-group>.btn{position:relative;-webkit-box-flex:0;-ms-flex:0 1 auto;flex:0 1 auto}.btn-group-vertical>.btn:hover,.btn-group>.btn:hover{z-index:1}.btn-group-vertical>.btn.active,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn:focus,.btn-group>.btn.active,.btn-group>.btn:active,.btn-group>.btn:focus{z-index:1}.btn-group .btn+.btn,.btn-group .btn+.btn-group,.btn-group .btn-group+.btn,.btn-group .btn-group+.btn-group,.btn-group-vertical .btn+.btn,.btn-group-vertical .btn+.btn-group,.btn-group-vertical .btn-group+.btn,.btn-group-vertical .btn-group+.btn-group{margin-left:-1px}.btn-toolbar{display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-webkit-box-pack:start;-ms-flex-pack:start;justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group>.btn:first-child{margin-left:0}.btn-group>.btn-group:not(:last-child)>.btn,.btn-group>.btn:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn-group:not(:first-child)>.btn,.btn-group>.btn:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.dropdown-toggle-split{padding-right:.5625rem;padding-left:.5625rem}.dropdown-toggle-split::after{margin-left:0}.btn-group-sm>.btn+.dropdown-toggle-split,.btn-sm+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}.btn-group-lg>.btn+.dropdown-toggle-split,.btn-lg+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.btn-group-vertical{-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column;-webkit-box-align:start;-ms-flex-align:start;align-items:flex-start;-webkit-box-pack:center;-ms-flex-pack:center;justify-content:center}.btn-group-vertical .btn,.btn-group-vertical .btn-group{width:100%}.btn-group-vertical>.btn+.btn,.btn-group-vertical>.btn+.btn-group,.btn-group-vertical>.btn-group+.btn,.btn-group-vertical>.btn-group+.btn-group{margin-top:-1px;margin-left:0}.btn-group-vertical>.btn-group:not(:last-child)>.btn,.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle){border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn-group:not(:first-child)>.btn,.btn-group-vertical>.btn:not(:first-child){border-top-left-radius:0;border-top-right-radius:0}.btn-group-toggle>.btn,.btn-group-toggle>.btn-group>.btn{margin-bottom:0}.btn-group-toggle>.btn input[type=checkbox],.btn-group-toggle>.btn input[type=radio],.btn-group-toggle>.btn-group>.btn input[type=checkbox],.btn-group-toggle>.btn-group>.btn input[type=radio]{position:absolute;clip:rect(0,0,0,0);pointer-events:none}.input-group{position:relative;display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-webkit-box-align:stretch;-ms-flex-align:stretch;align-items:stretch;width:100%}.input-group>.custom-file,.input-group>.custom-select,.input-group>.form-control{position:relative;-webkit-box-flex:1;-ms-flex:1 1 auto;flex:1 1 auto;width:1%;margin-bottom:0}.input-group>.custom-file:focus,.input-group>.custom-select:focus,.input-group>.form-control:focus{z-index:3}.input-group>.custom-file+.custom-file,.input-group>.custom-file+.custom-select,.input-group>.custom-file+.form-control,.input-group>.custom-select+.custom-file,.input-group>.custom-select+.custom-select,.input-group>.custom-select+.form-control,.input-group>.form-control+.custom-file,.input-group>.form-control+.custom-select,.input-group>.form-control+.form-control{margin-left:-1px}.input-group>.custom-select:not(:last-child),.input-group>.form-control:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.custom-select:not(:first-child),.input-group>.form-control:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.input-group>.custom-file{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:center;-ms-flex-align:center;align-items:center}.input-group>.custom-file:not(:last-child) .custom-file-label,.input-group>.custom-file:not(:last-child) .custom-file-label::before{border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.custom-file:not(:first-child) .custom-file-label,.input-group>.custom-file:not(:first-child) .custom-file-label::before{border-top-left-radius:0;border-bottom-left-radius:0}.input-group-append,.input-group-prepend{display:-webkit-box;display:-ms-flexbox;display:flex}.input-group-append .btn,.input-group-prepend .btn{position:relative;z-index:2}.input-group-append .btn+.btn,.input-group-append .btn+.input-group-text,.input-group-append .input-group-text+.btn,.input-group-append .input-group-text+.input-group-text,.input-group-prepend .btn+.btn,.input-group-prepend .btn+.input-group-text,.input-group-prepend .input-group-text+.btn,.input-group-prepend .input-group-text+.input-group-text{margin-left:-1px}.input-group-prepend{margin-right:-1px}.input-group-append{margin-left:-1px}.input-group-text{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:center;-ms-flex-align:center;align-items:center;padding:.375rem .75rem;margin-bottom:0;font-size:1rem;font-weight:400;line-height:1.5;color:#495057;text-align:center;white-space:nowrap;background-color:#e9ecef;border:1px solid #ced4da;border-radius:.25rem}.input-group-text input[type=checkbox],.input-group-text input[type=radio]{margin-top:0}.input-group>.input-group-append:last-child>.btn:not(:last-child):not(.dropdown-toggle),.input-group>.input-group-append:last-child>.input-group-text:not(:last-child),.input-group>.input-group-append:not(:last-child)>.btn,.input-group>.input-group-append:not(:last-child)>.input-group-text,.input-group>.input-group-prepend>.btn,.input-group>.input-group-prepend>.input-group-text{border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.input-group-append>.btn,.input-group>.input-group-append>.input-group-text,.input-group>.input-group-prepend:first-child>.btn:not(:first-child),.input-group>.input-group-prepend:first-child>.input-group-text:not(:first-child),.input-group>.input-group-prepend:not(:first-child)>.btn,.input-group>.input-group-prepend:not(:first-child)>.input-group-text{border-top-left-radius:0;border-bottom-left-radius:0}.custom-control{position:relative;display:block;min-height:1.5rem;padding-left:1.5rem}.custom-control-inline{display:-webkit-inline-box;display:-ms-inline-flexbox;display:inline-flex;margin-right:1rem}.custom-control-input{position:absolute;z-index:-1;opacity:0}.custom-control-input:checked~.custom-control-label::before{color:#fff;background-color:#007bff}.custom-control-input:focus~.custom-control-label::before{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(0,123,255,.25)}.custom-control-input:active~.custom-control-label::before{color:#fff;background-color:#b3d7ff}.custom-control-input:disabled~.custom-control-label{color:#6c757d}.custom-control-input:disabled~.custom-control-label::before{background-color:#e9ecef}.custom-control-label{margin-bottom:0}.custom-control-label::before{position:absolute;top:.25rem;left:0;display:block;width:1rem;height:1rem;pointer-events:none;content:"";-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;background-color:#dee2e6}.custom-control-label::after{position:absolute;top:.25rem;left:0;display:block;width:1rem;height:1rem;content:"";background-repeat:no-repeat;background-position:center center;background-size:50% 50%}.custom-checkbox .custom-control-label::before{border-radius:.25rem}.custom-checkbox .custom-control-input:checked~.custom-control-label::before{background-color:#007bff}.custom-checkbox .custom-control-input:checked~.custom-control-label::after{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3E%3C/svg%3E")}.custom-checkbox .custom-control-input:indeterminate~.custom-control-label::before{background-color:#007bff}.custom-checkbox .custom-control-input:indeterminate~.custom-control-label::after{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 4'%3E%3Cpath stroke='%23fff' d='M0 2h4'/%3E%3C/svg%3E")}.custom-checkbox .custom-control-input:disabled:checked~.custom-control-label::before{background-color:rgba(0,123,255,.5)}.custom-checkbox .custom-control-input:disabled:indeterminate~.custom-control-label::before{background-color:rgba(0,123,255,.5)}.custom-radio .custom-control-label::before{border-radius:50%}.custom-radio .custom-control-input:checked~.custom-control-label::before{background-color:#007bff}.custom-radio .custom-control-input:checked~.custom-control-label::after{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3E%3Ccircle r='3' fill='%23fff'/%3E%3C/svg%3E")}.custom-radio .custom-control-input:disabled:checked~.custom-control-label::before{background-color:rgba(0,123,255,.5)}.custom-select{display:inline-block;width:100%;height:calc(2.25rem + 2px);padding:.375rem 1.75rem .375rem .75rem;line-height:1.5;color:#495057;vertical-align:middle;background:#fff url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3E%3Cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3E%3C/svg%3E") no-repeat right .75rem center;background-size:8px 10px;border:1px solid #ced4da;border-radius:.25rem;-webkit-appearance:none;-moz-appearance:none;appearance:none}.custom-select:focus{border-color:#80bdff;outline:0;box-shadow:inset 0 1px 2px rgba(0,0,0,.075),0 0 5px rgba(128,189,255,.5)}.custom-select:focus::-ms-value{color:#495057;background-color:#fff}.custom-select[multiple],.custom-select[size]:not([size="1"]){height:auto;padding-right:.75rem;background-image:none}.custom-select:disabled{color:#6c757d;background-color:#e9ecef}.custom-select::-ms-expand{opacity:0}.custom-select-sm{height:calc(1.8125rem + 2px);padding-top:.375rem;padding-bottom:.375rem;font-size:75%}.custom-select-lg{height:calc(2.875rem + 2px);padding-top:.375rem;padding-bottom:.375rem;font-size:125%}.custom-file{position:relative;display:inline-block;width:100%;height:calc(2.25rem + 2px);margin-bottom:0}.custom-file-input{position:relative;z-index:2;width:100%;height:calc(2.25rem + 2px);margin:0;opacity:0}.custom-file-input:focus~.custom-file-control{border-color:#80bdff;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.custom-file-input:focus~.custom-file-control::before{border-color:#80bdff}.custom-file-input:lang(en)~.custom-file-label::after{content:"Browse"}.custom-file-label{position:absolute;top:0;right:0;left:0;z-index:1;height:calc(2.25rem + 2px);padding:.375rem .75rem;line-height:1.5;color:#495057;background-color:#fff;border:1px solid #ced4da;border-radius:.25rem}.custom-file-label::after{position:absolute;top:0;right:0;bottom:0;z-index:3;display:block;height:calc(calc(2.25rem + 2px) - 1px * 2);padding:.375rem .75rem;line-height:1.5;color:#495057;content:"Browse";background-color:#e9ecef;border-left:1px solid #ced4da;border-radius:0 .25rem .25rem 0}.nav{display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:.5rem 1rem}.nav-link:focus,.nav-link:hover{text-decoration:none}.nav-link.disabled{color:#6c757d}.nav-tabs{border-bottom:1px solid #dee2e6}.nav-tabs .nav-item{margin-bottom:-1px}.nav-tabs .nav-link{border:1px solid transparent;border-top-left-radius:.25rem;border-top-right-radius:.25rem}.nav-tabs .nav-link:focus,.nav-tabs .nav-link:hover{border-color:#e9ecef #e9ecef #dee2e6}.nav-tabs .nav-link.disabled{color:#6c757d;background-color:transparent;border-color:transparent}.nav-tabs .nav-item.show .nav-link,.nav-tabs .nav-link.active{color:#495057;background-color:#fff;border-color:#dee2e6 #dee2e6 #fff}.nav-tabs .dropdown-menu{margin-top:-1px;border-top-left-radius:0;border-top-right-radius:0}.nav-pills .nav-link{border-radius:.25rem}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:#fff;background-color:#007bff}.nav-fill .nav-item{-webkit-box-flex:1;-ms-flex:1 1 auto;flex:1 1 auto;text-align:center}.nav-justified .nav-item{-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;text-align:center}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar{position:relative;display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-webkit-box-align:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:justify;-ms-flex-pack:justify;justify-content:space-between;padding:.5rem 1rem}.navbar>.container,.navbar>.container-fluid{display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;-webkit-box-align:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:justify;-ms-flex-pack:justify;justify-content:space-between}.navbar-brand{display:inline-block;padding-top:.3125rem;padding-bottom:.3125rem;margin-right:1rem;font-size:1.25rem;line-height:inherit;white-space:nowrap}.navbar-brand:focus,.navbar-brand:hover{text-decoration:none}.navbar-nav{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link{padding-right:0;padding-left:0}.navbar-nav .dropdown-menu{position:static;float:none}.navbar-text{display:inline-block;padding-top:.5rem;padding-bottom:.5rem}.navbar-collapse{-ms-flex-preferred-size:100%;flex-basis:100%;-webkit-box-flex:1;-ms-flex-positive:1;flex-grow:1;-webkit-box-align:center;-ms-flex-align:center;align-items:center}.navbar-toggler{padding:.25rem .75rem;font-size:1.25rem;line-height:1;background-color:transparent;border:1px solid transparent;border-radius:.25rem}.navbar-toggler:focus,.navbar-toggler:hover{text-decoration:none}.navbar-toggler:not(:disabled):not(.disabled){cursor:pointer}.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;content:"";background:no-repeat center center;background-size:100% 100%}@media (max-width:575.98px){.navbar-expand-sm>.container,.navbar-expand-sm>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:576px){.navbar-expand-sm{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row nowrap;flex-flow:row nowrap;-webkit-box-pack:start;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-sm .navbar-nav{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-direction:row;flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .dropdown-menu-right{right:0;left:auto}.navbar-expand-sm .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-sm>.container,.navbar-expand-sm>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-sm .navbar-collapse{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}.navbar-expand-sm .dropup .dropdown-menu{top:auto;bottom:100%}}@media (max-width:767.98px){.navbar-expand-md>.container,.navbar-expand-md>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:768px){.navbar-expand-md{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row nowrap;flex-flow:row nowrap;-webkit-box-pack:start;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-md .navbar-nav{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-direction:row;flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .dropdown-menu-right{right:0;left:auto}.navbar-expand-md .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-md>.container,.navbar-expand-md>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-md .navbar-collapse{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}.navbar-expand-md .dropup .dropdown-menu{top:auto;bottom:100%}}@media (max-width:991.98px){.navbar-expand-lg>.container,.navbar-expand-lg>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:992px){.navbar-expand-lg{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row nowrap;flex-flow:row nowrap;-webkit-box-pack:start;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-lg .navbar-nav{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-direction:row;flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .dropdown-menu-right{right:0;left:auto}.navbar-expand-lg .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-lg>.container,.navbar-expand-lg>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-lg .navbar-collapse{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}.navbar-expand-lg .dropup .dropdown-menu{top:auto;bottom:100%}}@media (max-width:1199.98px){.navbar-expand-xl>.container,.navbar-expand-xl>.container-fluid{padding-right:0;padding-left:0}}@media (min-width:1200px){.navbar-expand-xl{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row nowrap;flex-flow:row nowrap;-webkit-box-pack:start;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-xl .navbar-nav{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-direction:row;flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .dropdown-menu-right{right:0;left:auto}.navbar-expand-xl .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-xl>.container,.navbar-expand-xl>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-xl .navbar-collapse{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}.navbar-expand-xl .dropup .dropdown-menu{top:auto;bottom:100%}}.navbar-expand{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row nowrap;flex-flow:row nowrap;-webkit-box-pack:start;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand>.container,.navbar-expand>.container-fluid{padding-right:0;padding-left:0}.navbar-expand .navbar-nav{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-direction:row;flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .dropdown-menu-right{right:0;left:auto}.navbar-expand .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand>.container,.navbar-expand>.container-fluid{-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand .navbar-collapse{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-expand .dropup .dropdown-menu{top:auto;bottom:100%}.navbar-light .navbar-brand{color:rgba(0,0,0,.9)}.navbar-light .navbar-brand:focus,.navbar-light .navbar-brand:hover{color:rgba(0,0,0,.9)}.navbar-light .navbar-nav .nav-link{color:rgba(0,0,0,.5)}.navbar-light .navbar-nav .nav-link:focus,.navbar-light .navbar-nav .nav-link:hover{color:rgba(0,0,0,.7)}.navbar-light .navbar-nav .nav-link.disabled{color:rgba(0,0,0,.3)}.navbar-light .navbar-nav .active>.nav-link,.navbar-light .navbar-nav .nav-link.active,.navbar-light .navbar-nav .nav-link.show,.navbar-light .navbar-nav .show>.nav-link{color:rgba(0,0,0,.9)}.navbar-light .navbar-toggler{color:rgba(0,0,0,.5);border-color:rgba(0,0,0,.1)}.navbar-light .navbar-toggler-icon{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(0, 0, 0, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E")}.navbar-light .navbar-text{color:rgba(0,0,0,.5)}.navbar-light .navbar-text a{color:rgba(0,0,0,.9)}.navbar-light .navbar-text a:focus,.navbar-light .navbar-text a:hover{color:rgba(0,0,0,.9)}.navbar-dark .navbar-brand{color:#fff}.navbar-dark .navbar-brand:focus,.navbar-dark .navbar-brand:hover{color:#fff}.navbar-dark .navbar-nav .nav-link{color:rgba(255,255,255,.5)}.navbar-dark .navbar-nav .nav-link:focus,.navbar-dark .navbar-nav .nav-link:hover{color:rgba(255,255,255,.75)}.navbar-dark .navbar-nav .nav-link.disabled{color:rgba(255,255,255,.25)}.navbar-dark .navbar-nav .active>.nav-link,.navbar-dark .navbar-nav .nav-link.active,.navbar-dark .navbar-nav .nav-link.show,.navbar-dark .navbar-nav .show>.nav-link{color:#fff}.navbar-dark .navbar-toggler{color:rgba(255,255,255,.5);border-color:rgba(255,255,255,.1)}.navbar-dark .navbar-toggler-icon{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(255, 255, 255, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E")}.navbar-dark .navbar-text{color:rgba(255,255,255,.5)}.navbar-dark .navbar-text a{color:#fff}.navbar-dark .navbar-text a:focus,.navbar-dark .navbar-text a:hover{color:#fff}.card{position:relative;display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column;min-width:0;word-wrap:break-word;background-color:#fff;background-clip:border-box;border:1px solid rgba(0,0,0,.125);border-radius:.25rem}.card>hr{margin-right:0;margin-left:0}.card>.list-group:first-child .list-group-item:first-child{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.card>.list-group:last-child .list-group-item:last-child{border-bottom-right-radius:.25rem;border-bottom-left-radius:.25rem}.card-body{-webkit-box-flex:1;-ms-flex:1 1 auto;flex:1 1 auto;padding:1.25rem}.card-title{margin-bottom:.75rem}.card-subtitle{margin-top:-.375rem;margin-bottom:0}.card-text:last-child{margin-bottom:0}.card-link:hover{text-decoration:none}.card-link+.card-link{margin-left:1.25rem}.card-header{padding:.75rem 1.25rem;margin-bottom:0;background-color:rgba(0,0,0,.03);border-bottom:1px solid rgba(0,0,0,.125)}.card-header:first-child{border-radius:calc(.25rem - 1px) calc(.25rem - 1px) 0 0}.card-header+.list-group .list-group-item:first-child{border-top:0}.card-footer{padding:.75rem 1.25rem;background-color:rgba(0,0,0,.03);border-top:1px solid rgba(0,0,0,.125)}.card-footer:last-child{border-radius:0 0 calc(.25rem - 1px) calc(.25rem - 1px)}.card-header-tabs{margin-right:-.625rem;margin-bottom:-.75rem;margin-left:-.625rem;border-bottom:0}.card-header-pills{margin-right:-.625rem;margin-left:-.625rem}.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:1.25rem}.card-img{width:100%;border-radius:calc(.25rem - 1px)}.card-img-top{width:100%;border-top-left-radius:calc(.25rem - 1px);border-top-right-radius:calc(.25rem - 1px)}.card-img-bottom{width:100%;border-bottom-right-radius:calc(.25rem - 1px);border-bottom-left-radius:calc(.25rem - 1px)}.card-deck{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column}.card-deck .card{margin-bottom:15px}@media (min-width:576px){.card-deck{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row wrap;flex-flow:row wrap;margin-right:-15px;margin-left:-15px}.card-deck .card{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-flex:1;-ms-flex:1 0 0%;flex:1 0 0%;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column;margin-right:15px;margin-bottom:0;margin-left:15px}}.card-group{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column}.card-group>.card{margin-bottom:15px}@media (min-width:576px){.card-group{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-ms-flex-flow:row wrap;flex-flow:row wrap}.card-group>.card{-webkit-box-flex:1;-ms-flex:1 0 0%;flex:1 0 0%;margin-bottom:0}.card-group>.card+.card{margin-left:0;border-left:0}.card-group>.card:first-child{border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:first-child .card-header,.card-group>.card:first-child .card-img-top{border-top-right-radius:0}.card-group>.card:first-child .card-footer,.card-group>.card:first-child .card-img-bottom{border-bottom-right-radius:0}.card-group>.card:last-child{border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:last-child .card-header,.card-group>.card:last-child .card-img-top{border-top-left-radius:0}.card-group>.card:last-child .card-footer,.card-group>.card:last-child .card-img-bottom{border-bottom-left-radius:0}.card-group>.card:only-child{border-radius:.25rem}.card-group>.card:only-child .card-header,.card-group>.card:only-child .card-img-top{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.card-group>.card:only-child .card-footer,.card-group>.card:only-child .card-img-bottom{border-bottom-right-radius:.25rem;border-bottom-left-radius:.25rem}.card-group>.card:not(:first-child):not(:last-child):not(:only-child){border-radius:0}.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-footer,.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-header,.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-img-bottom,.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-img-top{border-radius:0}}.card-columns .card{margin-bottom:.75rem}@media (min-width:576px){.card-columns{-webkit-column-count:3;-moz-column-count:3;column-count:3;-webkit-column-gap:1.25rem;-moz-column-gap:1.25rem;column-gap:1.25rem}.card-columns .card{display:inline-block;width:100%}}.breadcrumb{display:-webkit-box;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;padding:.75rem 1rem;margin-bottom:1rem;list-style:none;background-color:#e9ecef;border-radius:.25rem}.breadcrumb-item+.breadcrumb-item::before{display:inline-block;padding-right:.5rem;padding-left:.5rem;color:#6c757d;content:"/"}.breadcrumb-item+.breadcrumb-item:hover::before{text-decoration:underline}.breadcrumb-item+.breadcrumb-item:hover::before{text-decoration:none}.breadcrumb-item.active{color:#6c757d}.pagination{display:-webkit-box;display:-ms-flexbox;display:flex;padding-left:0;list-style:none;border-radius:.25rem}.page-link{position:relative;display:block;padding:.5rem .75rem;margin-left:-1px;line-height:1.25;color:#007bff;background-color:#fff;border:1px solid #dee2e6}.page-link:hover{color:#0056b3;text-decoration:none;background-color:#e9ecef;border-color:#dee2e6}.page-link:focus{z-index:2;outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.page-link:not(:disabled):not(.disabled){cursor:pointer}.page-item:first-child .page-link{margin-left:0;border-top-left-radius:.25rem;border-bottom-left-radius:.25rem}.page-item:last-child .page-link{border-top-right-radius:.25rem;border-bottom-right-radius:.25rem}.page-item.active .page-link{z-index:1;color:#fff;background-color:#007bff;border-color:#007bff}.page-item.disabled .page-link{color:#6c757d;pointer-events:none;cursor:auto;background-color:#fff;border-color:#dee2e6}.pagination-lg .page-link{padding:.75rem 1.5rem;font-size:1.25rem;line-height:1.5}.pagination-lg .page-item:first-child .page-link{border-top-left-radius:.3rem;border-bottom-left-radius:.3rem}.pagination-lg .page-item:last-child .page-link{border-top-right-radius:.3rem;border-bottom-right-radius:.3rem}.pagination-sm .page-link{padding:.25rem .5rem;font-size:.875rem;line-height:1.5}.pagination-sm .page-item:first-child .page-link{border-top-left-radius:.2rem;border-bottom-left-radius:.2rem}.pagination-sm .page-item:last-child .page-link{border-top-right-radius:.2rem;border-bottom-right-radius:.2rem}.badge{display:inline-block;padding:.25em .4em;font-size:75%;font-weight:700;line-height:1;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25rem}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.badge-pill{padding-right:.6em;padding-left:.6em;border-radius:10rem}.badge-primary{color:#fff;background-color:#007bff}.badge-primary[href]:focus,.badge-primary[href]:hover{color:#fff;text-decoration:none;background-color:#0062cc}.badge-secondary{color:#fff;background-color:#6c757d}.badge-secondary[href]:focus,.badge-secondary[href]:hover{color:#fff;text-decoration:none;background-color:#545b62}.badge-success{color:#fff;background-color:#28a745}.badge-success[href]:focus,.badge-success[href]:hover{color:#fff;text-decoration:none;background-color:#1e7e34}.badge-info{color:#fff;background-color:#17a2b8}.badge-info[href]:focus,.badge-info[href]:hover{color:#fff;text-decoration:none;background-color:#117a8b}.badge-warning{color:#212529;background-color:#ffc107}.badge-warning[href]:focus,.badge-warning[href]:hover{color:#212529;text-decoration:none;background-color:#d39e00}.badge-danger{color:#fff;background-color:#dc3545}.badge-danger[href]:focus,.badge-danger[href]:hover{color:#fff;text-decoration:none;background-color:#bd2130}.badge-light{color:#212529;background-color:#f8f9fa}.badge-light[href]:focus,.badge-light[href]:hover{color:#212529;text-decoration:none;background-color:#dae0e5}.badge-dark{color:#fff;background-color:#343a40}.badge-dark[href]:focus,.badge-dark[href]:hover{color:#fff;text-decoration:none;background-color:#1d2124}.jumbotron{padding:2rem 1rem;margin-bottom:2rem;background-color:#e9ecef;border-radius:.3rem}@media (min-width:576px){.jumbotron{padding:4rem 2rem}}.jumbotron-fluid{padding-right:0;padding-left:0;border-radius:0}.alert{position:relative;padding:.75rem 1.25rem;margin-bottom:1rem;border:1px solid transparent;border-radius:.25rem}.alert-heading{color:inherit}.alert-link{font-weight:700}.alert-dismissible{padding-right:4rem}.alert-dismissible .close{position:absolute;top:0;right:0;padding:.75rem 1.25rem;color:inherit}.alert-primary{color:#004085;background-color:#cce5ff;border-color:#b8daff}.alert-primary hr{border-top-color:#9fcdff}.alert-primary .alert-link{color:#002752}.alert-secondary{color:#383d41;background-color:#e2e3e5;border-color:#d6d8db}.alert-secondary hr{border-top-color:#c8cbcf}.alert-secondary .alert-link{color:#202326}.alert-success{color:#155724;background-color:#d4edda;border-color:#c3e6cb}.alert-success hr{border-top-color:#b1dfbb}.alert-success .alert-link{color:#0b2e13}.alert-info{color:#0c5460;background-color:#d1ecf1;border-color:#bee5eb}.alert-info hr{border-top-color:#abdde5}.alert-info .alert-link{color:#062c33}.alert-warning{color:#856404;background-color:#fff3cd;border-color:#ffeeba}.alert-warning hr{border-top-color:#ffe8a1}.alert-warning .alert-link{color:#533f03}.alert-danger{color:#721c24;background-color:#f8d7da;border-color:#f5c6cb}.alert-danger hr{border-top-color:#f1b0b7}.alert-danger .alert-link{color:#491217}.alert-light{color:#818182;background-color:#fefefe;border-color:#fdfdfe}.alert-light hr{border-top-color:#ececf6}.alert-light .alert-link{color:#686868}.alert-dark{color:#1b1e21;background-color:#d6d8d9;border-color:#c6c8ca}.alert-dark hr{border-top-color:#b9bbbe}.alert-dark .alert-link{color:#040505}@-webkit-keyframes progress-bar-stripes{from{background-position:1rem 0}to{background-position:0 0}}@keyframes progress-bar-stripes{from{background-position:1rem 0}to{background-position:0 0}}.progress{display:-webkit-box;display:-ms-flexbox;display:flex;height:1rem;overflow:hidden;font-size:.75rem;background-color:#e9ecef;border-radius:.25rem}.progress-bar{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column;-webkit-box-pack:center;-ms-flex-pack:center;justify-content:center;color:#fff;text-align:center;background-color:#007bff;transition:width .6s ease}.progress-bar-striped{background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-size:1rem 1rem}.progress-bar-animated{-webkit-animation:progress-bar-stripes 1s linear infinite;animation:progress-bar-stripes 1s linear infinite}.media{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:start;-ms-flex-align:start;align-items:flex-start}.media-body{-webkit-box-flex:1;-ms-flex:1;flex:1}.list-group{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column;padding-left:0;margin-bottom:0}.list-group-item-action{width:100%;color:#495057;text-align:inherit}.list-group-item-action:focus,.list-group-item-action:hover{color:#495057;text-decoration:none;background-color:#f8f9fa}.list-group-item-action:active{color:#212529;background-color:#e9ecef}.list-group-item{position:relative;display:block;padding:.75rem 1.25rem;margin-bottom:-1px;background-color:#fff;border:1px solid rgba(0,0,0,.125)}.list-group-item:first-child{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.list-group-item:last-child{margin-bottom:0;border-bottom-right-radius:.25rem;border-bottom-left-radius:.25rem}.list-group-item:focus,.list-group-item:hover{z-index:1;text-decoration:none}.list-group-item.disabled,.list-group-item:disabled{color:#6c757d;background-color:#fff}.list-group-item.active{z-index:2;color:#fff;background-color:#007bff;border-color:#007bff}.list-group-flush .list-group-item{border-right:0;border-left:0;border-radius:0}.list-group-flush:first-child .list-group-item:first-child{border-top:0}.list-group-flush:last-child .list-group-item:last-child{border-bottom:0}.list-group-item-primary{color:#004085;background-color:#b8daff}.list-group-item-primary.list-group-item-action:focus,.list-group-item-primary.list-group-item-action:hover{color:#004085;background-color:#9fcdff}.list-group-item-primary.list-group-item-action.active{color:#fff;background-color:#004085;border-color:#004085}.list-group-item-secondary{color:#383d41;background-color:#d6d8db}.list-group-item-secondary.list-group-item-action:focus,.list-group-item-secondary.list-group-item-action:hover{color:#383d41;background-color:#c8cbcf}.list-group-item-secondary.list-group-item-action.active{color:#fff;background-color:#383d41;border-color:#383d41}.list-group-item-success{color:#155724;background-color:#c3e6cb}.list-group-item-success.list-group-item-action:focus,.list-group-item-success.list-group-item-action:hover{color:#155724;background-color:#b1dfbb}.list-group-item-success.list-group-item-action.active{color:#fff;background-color:#155724;border-color:#155724}.list-group-item-info{color:#0c5460;background-color:#bee5eb}.list-group-item-info.list-group-item-action:focus,.list-group-item-info.list-group-item-action:hover{color:#0c5460;background-color:#abdde5}.list-group-item-info.list-group-item-action.active{color:#fff;background-color:#0c5460;border-color:#0c5460}.list-group-item-warning{color:#856404;background-color:#ffeeba}.list-group-item-warning.list-group-item-action:focus,.list-group-item-warning.list-group-item-action:hover{color:#856404;background-color:#ffe8a1}.list-group-item-warning.list-group-item-action.active{color:#fff;background-color:#856404;border-color:#856404}.list-group-item-danger{color:#721c24;background-color:#f5c6cb}.list-group-item-danger.list-group-item-action:focus,.list-group-item-danger.list-group-item-action:hover{color:#721c24;background-color:#f1b0b7}.list-group-item-danger.list-group-item-action.active{color:#fff;background-color:#721c24;border-color:#721c24}.list-group-item-light{color:#818182;background-color:#fdfdfe}.list-group-item-light.list-group-item-action:focus,.list-group-item-light.list-group-item-action:hover{color:#818182;background-color:#ececf6}.list-group-item-light.list-group-item-action.active{color:#fff;background-color:#818182;border-color:#818182}.list-group-item-dark{color:#1b1e21;background-color:#c6c8ca}.list-group-item-dark.list-group-item-action:focus,.list-group-item-dark.list-group-item-action:hover{color:#1b1e21;background-color:#b9bbbe}.list-group-item-dark.list-group-item-action.active{color:#fff;background-color:#1b1e21;border-color:#1b1e21}.close{float:right;font-size:1.5rem;font-weight:700;line-height:1;color:#000;text-shadow:0 1px 0 #fff;opacity:.5}.close:focus,.close:hover{color:#000;text-decoration:none;opacity:.75}.close:not(:disabled):not(.disabled){cursor:pointer}button.close{padding:0;background-color:transparent;border:0;-webkit-appearance:none}.modal-open{overflow:hidden}.modal{position:fixed;top:0;right:0;bottom:0;left:0;z-index:1050;display:none;overflow:hidden;outline:0}.modal-open .modal{overflow-x:hidden;overflow-y:auto}.modal-dialog{position:relative;width:auto;margin:.5rem;pointer-events:none}.modal.fade .modal-dialog{transition:-webkit-transform .3s ease-out;transition:transform .3s ease-out;transition:transform .3s ease-out,-webkit-transform .3s ease-out;-webkit-transform:translate(0,-25%);transform:translate(0,-25%)}.modal.show .modal-dialog{-webkit-transform:translate(0,0);transform:translate(0,0)}.modal-dialog-centered{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:center;-ms-flex-align:center;align-items:center;min-height:calc(100% - (.5rem * 2))}.modal-content{position:relative;display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-ms-flex-direction:column;flex-direction:column;width:100%;pointer-events:auto;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.2);border-radius:.3rem;outline:0}.modal-backdrop{position:fixed;top:0;right:0;bottom:0;left:0;z-index:1040;background-color:#000}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:.5}.modal-header{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:start;-ms-flex-align:start;align-items:flex-start;-webkit-box-pack:justify;-ms-flex-pack:justify;justify-content:space-between;padding:1rem;border-bottom:1px solid #e9ecef;border-top-left-radius:.3rem;border-top-right-radius:.3rem}.modal-header .close{padding:1rem;margin:-1rem -1rem -1rem auto}.modal-title{margin-bottom:0;line-height:1.5}.modal-body{position:relative;-webkit-box-flex:1;-ms-flex:1 1 auto;flex:1 1 auto;padding:1rem}.modal-footer{display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:end;-ms-flex-pack:end;justify-content:flex-end;padding:1rem;border-top:1px solid #e9ecef}.modal-footer>:not(:first-child){margin-left:.25rem}.modal-footer>:not(:last-child){margin-right:.25rem}.modal-scrollbar-measure{position:absolute;top:-9999px;width:50px;height:50px;overflow:scroll}@media (min-width:576px){.modal-dialog{max-width:500px;margin:1.75rem auto}.modal-dialog-centered{min-height:calc(100% - (1.75rem * 2))}.modal-sm{max-width:300px}}@media (min-width:992px){.modal-lg{max-width:800px}}.tooltip{position:absolute;z-index:1070;display:block;margin:0;font-family:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;word-spacing:normal;white-space:normal;line-break:auto;font-size:.875rem;word-wrap:break-word;opacity:0}.tooltip.show{opacity:.9}.tooltip .arrow{position:absolute;display:block;width:.8rem;height:.4rem}.tooltip .arrow::before{position:absolute;content:"";border-color:transparent;border-style:solid}.bs-tooltip-auto[x-placement^=top],.bs-tooltip-top{padding:.4rem 0}.bs-tooltip-auto[x-placement^=top] .arrow,.bs-tooltip-top .arrow{bottom:0}.bs-tooltip-auto[x-placement^=top] .arrow::before,.bs-tooltip-top .arrow::before{top:0;border-width:.4rem .4rem 0;border-top-color:#000}.bs-tooltip-auto[x-placement^=right],.bs-tooltip-right{padding:0 .4rem}.bs-tooltip-auto[x-placement^=right] .arrow,.bs-tooltip-right .arrow{left:0;width:.4rem;height:.8rem}.bs-tooltip-auto[x-placement^=right] .arrow::before,.bs-tooltip-right .arrow::before{right:0;border-width:.4rem .4rem .4rem 0;border-right-color:#000}.bs-tooltip-auto[x-placement^=bottom],.bs-tooltip-bottom{padding:.4rem 0}.bs-tooltip-auto[x-placement^=bottom] .arrow,.bs-tooltip-bottom .arrow{top:0}.bs-tooltip-auto[x-placement^=bottom] .arrow::before,.bs-tooltip-bottom .arrow::before{bottom:0;border-width:0 .4rem .4rem;border-bottom-color:#000}.bs-tooltip-auto[x-placement^=left],.bs-tooltip-left{padding:0 .4rem}.bs-tooltip-auto[x-placement^=left] .arrow,.bs-tooltip-left .arrow{right:0;width:.4rem;height:.8rem}.bs-tooltip-auto[x-placement^=left] .arrow::before,.bs-tooltip-left .arrow::before{left:0;border-width:.4rem 0 .4rem .4rem;border-left-color:#000}.tooltip-inner{max-width:200px;padding:.25rem .5rem;color:#fff;text-align:center;background-color:#000;border-radius:.25rem}.popover{position:absolute;top:0;left:0;z-index:1060;display:block;max-width:276px;font-family:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;word-spacing:normal;white-space:normal;line-break:auto;font-size:.875rem;word-wrap:break-word;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.2);border-radius:.3rem}.popover .arrow{position:absolute;display:block;width:1rem;height:.5rem;margin:0 .3rem}.popover .arrow::after,.popover .arrow::before{position:absolute;display:block;content:"";border-color:transparent;border-style:solid}.bs-popover-auto[x-placement^=top],.bs-popover-top{margin-bottom:.5rem}.bs-popover-auto[x-placement^=top] .arrow,.bs-popover-top .arrow{bottom:calc((.5rem + 1px) * -1)}.bs-popover-auto[x-placement^=top] .arrow::after,.bs-popover-auto[x-placement^=top] .arrow::before,.bs-popover-top .arrow::after,.bs-popover-top .arrow::before{border-width:.5rem .5rem 0}.bs-popover-auto[x-placement^=top] .arrow::before,.bs-popover-top .arrow::before{bottom:0;border-top-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=top] .arrow::after,.bs-popover-top .arrow::after{bottom:1px;border-top-color:#fff}.bs-popover-auto[x-placement^=right],.bs-popover-right{margin-left:.5rem}.bs-popover-auto[x-placement^=right] .arrow,.bs-popover-right .arrow{left:calc((.5rem + 1px) * -1);width:.5rem;height:1rem;margin:.3rem 0}.bs-popover-auto[x-placement^=right] .arrow::after,.bs-popover-auto[x-placement^=right] .arrow::before,.bs-popover-right .arrow::after,.bs-popover-right .arrow::before{border-width:.5rem .5rem .5rem 0}.bs-popover-auto[x-placement^=right] .arrow::before,.bs-popover-right .arrow::before{left:0;border-right-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=right] .arrow::after,.bs-popover-right .arrow::after{left:1px;border-right-color:#fff}.bs-popover-auto[x-placement^=bottom],.bs-popover-bottom{margin-top:.5rem}.bs-popover-auto[x-placement^=bottom] .arrow,.bs-popover-bottom .arrow{top:calc((.5rem + 1px) * -1)}.bs-popover-auto[x-placement^=bottom] .arrow::after,.bs-popover-auto[x-placement^=bottom] .arrow::before,.bs-popover-bottom .arrow::after,.bs-popover-bottom .arrow::before{border-width:0 .5rem .5rem .5rem}.bs-popover-auto[x-placement^=bottom] .arrow::before,.bs-popover-bottom .arrow::before{top:0;border-bottom-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=bottom] .arrow::after,.bs-popover-bottom .arrow::after{top:1px;border-bottom-color:#fff}.bs-popover-auto[x-placement^=bottom] .popover-header::before,.bs-popover-bottom .popover-header::before{position:absolute;top:0;left:50%;display:block;width:1rem;margin-left:-.5rem;content:"";border-bottom:1px solid #f7f7f7}.bs-popover-auto[x-placement^=left],.bs-popover-left{margin-right:.5rem}.bs-popover-auto[x-placement^=left] .arrow,.bs-popover-left .arrow{right:calc((.5rem + 1px) * -1);width:.5rem;height:1rem;margin:.3rem 0}.bs-popover-auto[x-placement^=left] .arrow::after,.bs-popover-auto[x-placement^=left] .arrow::before,.bs-popover-left .arrow::after,.bs-popover-left .arrow::before{border-width:.5rem 0 .5rem .5rem}.bs-popover-auto[x-placement^=left] .arrow::before,.bs-popover-left .arrow::before{right:0;border-left-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=left] .arrow::after,.bs-popover-left .arrow::after{right:1px;border-left-color:#fff}.popover-header{padding:.5rem .75rem;margin-bottom:0;font-size:1rem;color:inherit;background-color:#f7f7f7;border-bottom:1px solid #ebebeb;border-top-left-radius:calc(.3rem - 1px);border-top-right-radius:calc(.3rem - 1px)}.popover-header:empty{display:none}.popover-body{padding:.5rem .75rem;color:#212529}.carousel{position:relative}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-item{position:relative;display:none;-webkit-box-align:center;-ms-flex-align:center;align-items:center;width:100%;transition:-webkit-transform .6s ease;transition:transform .6s ease;transition:transform .6s ease,-webkit-transform .6s ease;-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-perspective:1000px;perspective:1000px}.carousel-item-next,.carousel-item-prev,.carousel-item.active{display:block}.carousel-item-next,.carousel-item-prev{position:absolute;top:0}.carousel-item-next.carousel-item-left,.carousel-item-prev.carousel-item-right{-webkit-transform:translateX(0);transform:translateX(0)}@supports ((-webkit-transform-style:preserve-3d) or (transform-style:preserve-3d)){.carousel-item-next.carousel-item-left,.carousel-item-prev.carousel-item-right{-webkit-transform:translate3d(0,0,0);transform:translate3d(0,0,0)}}.active.carousel-item-right,.carousel-item-next{-webkit-transform:translateX(100%);transform:translateX(100%)}@supports ((-webkit-transform-style:preserve-3d) or (transform-style:preserve-3d)){.active.carousel-item-right,.carousel-item-next{-webkit-transform:translate3d(100%,0,0);transform:translate3d(100%,0,0)}}.active.carousel-item-left,.carousel-item-prev{-webkit-transform:translateX(-100%);transform:translateX(-100%)}@supports ((-webkit-transform-style:preserve-3d) or (transform-style:preserve-3d)){.active.carousel-item-left,.carousel-item-prev{-webkit-transform:translate3d(-100%,0,0);transform:translate3d(-100%,0,0)}}.carousel-control-next,.carousel-control-prev{position:absolute;top:0;bottom:0;display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-align:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:center;-ms-flex-pack:center;justify-content:center;width:15%;color:#fff;text-align:center;opacity:.5}.carousel-control-next:focus,.carousel-control-next:hover,.carousel-control-prev:focus,.carousel-control-prev:hover{color:#fff;text-decoration:none;outline:0;opacity:.9}.carousel-control-prev{left:0}.carousel-control-next{right:0}.carousel-control-next-icon,.carousel-control-prev-icon{display:inline-block;width:20px;height:20px;background:transparent no-repeat center center;background-size:100% 100%}.carousel-control-prev-icon{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M5.25 0l-4 4 4 4 1.5-1.5-2.5-2.5 2.5-2.5-1.5-1.5z'/%3E%3C/svg%3E")}.carousel-control-next-icon{background-image:url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M2.75 0l-1.5 1.5 2.5 2.5-2.5 2.5 1.5 1.5 4-4-4-4z'/%3E%3C/svg%3E")}.carousel-indicators{position:absolute;right:0;bottom:10px;left:0;z-index:15;display:-webkit-box;display:-ms-flexbox;display:flex;-webkit-box-pack:center;-ms-flex-pack:center;justify-content:center;padding-left:0;margin-right:15%;margin-left:15%;list-style:none}.carousel-indicators li{position:relative;-webkit-box-flex:0;-ms-flex:0 1 auto;flex:0 1 auto;width:30px;height:3px;margin-right:3px;margin-left:3px;text-indent:-999px;background-color:rgba(255,255,255,.5)}.carousel-indicators li::before{position:absolute;top:-10px;left:0;display:inline-block;width:100%;height:10px;content:""}.carousel-indicators li::after{position:absolute;bottom:-10px;left:0;display:inline-block;width:100%;height:10px;content:""}.carousel-indicators .active{background-color:#fff}.carousel-caption{position:absolute;right:15%;bottom:20px;left:15%;z-index:10;padding-top:20px;padding-bottom:20px;color:#fff;text-align:center}.align-baseline{vertical-align:baseline!important}.align-top{vertical-align:top!important}.align-middle{vertical-align:middle!important}.align-bottom{vertical-align:bottom!important}.align-text-bottom{vertical-align:text-bottom!important}.align-text-top{vertical-align:text-top!important}.bg-primary{background-color:#007bff!important}a.bg-primary:focus,a.bg-primary:hover,button.bg-primary:focus,button.bg-primary:hover{background-color:#0062cc!important}.bg-secondary{background-color:#6c757d!important}a.bg-secondary:focus,a.bg-secondary:hover,button.bg-secondary:focus,button.bg-secondary:hover{background-color:#545b62!important}.bg-success{background-color:#28a745!important}a.bg-success:focus,a.bg-success:hover,button.bg-success:focus,button.bg-success:hover{background-color:#1e7e34!important}.bg-info{background-color:#17a2b8!important}a.bg-info:focus,a.bg-info:hover,button.bg-info:focus,button.bg-info:hover{background-color:#117a8b!important}.bg-warning{background-color:#ffc107!important}a.bg-warning:focus,a.bg-warning:hover,button.bg-warning:focus,button.bg-warning:hover{background-color:#d39e00!important}.bg-danger{background-color:#dc3545!important}a.bg-danger:focus,a.bg-danger:hover,button.bg-danger:focus,button.bg-danger:hover{background-color:#bd2130!important}.bg-light{background-color:#f8f9fa!important}a.bg-light:focus,a.bg-light:hover,button.bg-light:focus,button.bg-light:hover{background-color:#dae0e5!important}.bg-dark{background-color:#343a40!important}a.bg-dark:focus,a.bg-dark:hover,button.bg-dark:focus,button.bg-dark:hover{background-color:#1d2124!important}.bg-white{background-color:#fff!important}.bg-transparent{background-color:transparent!important}.border{border:1px solid #dee2e6!important}.border-top{border-top:1px solid #dee2e6!important}.border-right{border-right:1px solid #dee2e6!important}.border-bottom{border-bottom:1px solid #dee2e6!important}.border-left{border-left:1px solid #dee2e6!important}.border-0{border:0!important}.border-top-0{border-top:0!important}.border-right-0{border-right:0!important}.border-bottom-0{border-bottom:0!important}.border-left-0{border-left:0!important}.border-primary{border-color:#007bff!important}.border-secondary{border-color:#6c757d!important}.border-success{border-color:#28a745!important}.border-info{border-color:#17a2b8!important}.border-warning{border-color:#ffc107!important}.border-danger{border-color:#dc3545!important}.border-light{border-color:#f8f9fa!important}.border-dark{border-color:#343a40!important}.border-white{border-color:#fff!important}.rounded{border-radius:.25rem!important}.rounded-top{border-top-left-radius:.25rem!important;border-top-right-radius:.25rem!important}.rounded-right{border-top-right-radius:.25rem!important;border-bottom-right-radius:.25rem!important}.rounded-bottom{border-bottom-right-radius:.25rem!important;border-bottom-left-radius:.25rem!important}.rounded-left{border-top-left-radius:.25rem!important;border-bottom-left-radius:.25rem!important}.rounded-circle{border-radius:50%!important}.rounded-0{border-radius:0!important}.clearfix::after{display:block;clear:both;content:""}.d-none{display:none!important}.d-inline{display:inline!important}.d-inline-block{display:inline-block!important}.d-block{display:block!important}.d-table{display:table!important}.d-table-row{display:table-row!important}.d-table-cell{display:table-cell!important}.d-flex{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important}.d-inline-flex{display:-webkit-inline-box!important;display:-ms-inline-flexbox!important;display:inline-flex!important}@media (min-width:576px){.d-sm-none{display:none!important}.d-sm-inline{display:inline!important}.d-sm-inline-block{display:inline-block!important}.d-sm-block{display:block!important}.d-sm-table{display:table!important}.d-sm-table-row{display:table-row!important}.d-sm-table-cell{display:table-cell!important}.d-sm-flex{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important}.d-sm-inline-flex{display:-webkit-inline-box!important;display:-ms-inline-flexbox!important;display:inline-flex!important}}@media (min-width:768px){.d-md-none{display:none!important}.d-md-inline{display:inline!important}.d-md-inline-block{display:inline-block!important}.d-md-block{display:block!important}.d-md-table{display:table!important}.d-md-table-row{display:table-row!important}.d-md-table-cell{display:table-cell!important}.d-md-flex{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important}.d-md-inline-flex{display:-webkit-inline-box!important;display:-ms-inline-flexbox!important;display:inline-flex!important}}@media (min-width:992px){.d-lg-none{display:none!important}.d-lg-inline{display:inline!important}.d-lg-inline-block{display:inline-block!important}.d-lg-block{display:block!important}.d-lg-table{display:table!important}.d-lg-table-row{display:table-row!important}.d-lg-table-cell{display:table-cell!important}.d-lg-flex{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important}.d-lg-inline-flex{display:-webkit-inline-box!important;display:-ms-inline-flexbox!important;display:inline-flex!important}}@media (min-width:1200px){.d-xl-none{display:none!important}.d-xl-inline{display:inline!important}.d-xl-inline-block{display:inline-block!important}.d-xl-block{display:block!important}.d-xl-table{display:table!important}.d-xl-table-row{display:table-row!important}.d-xl-table-cell{display:table-cell!important}.d-xl-flex{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important}.d-xl-inline-flex{display:-webkit-inline-box!important;display:-ms-inline-flexbox!important;display:inline-flex!important}}@media print{.d-print-none{display:none!important}.d-print-inline{display:inline!important}.d-print-inline-block{display:inline-block!important}.d-print-block{display:block!important}.d-print-table{display:table!important}.d-print-table-row{display:table-row!important}.d-print-table-cell{display:table-cell!important}.d-print-flex{display:-webkit-box!important;display:-ms-flexbox!important;display:flex!important}.d-print-inline-flex{display:-webkit-inline-box!important;display:-ms-inline-flexbox!important;display:inline-flex!important}}.embed-responsive{position:relative;display:block;width:100%;padding:0;overflow:hidden}.embed-responsive::before{display:block;content:""}.embed-responsive .embed-responsive-item,.embed-responsive embed,.embed-responsive iframe,.embed-responsive object,.embed-responsive video{position:absolute;top:0;bottom:0;left:0;width:100%;height:100%;border:0}.embed-responsive-21by9::before{padding-top:42.857143%}.embed-responsive-16by9::before{padding-top:56.25%}.embed-responsive-4by3::before{padding-top:75%}.embed-responsive-1by1::before{padding-top:100%}.flex-row{-webkit-box-orient:horizontal!important;-webkit-box-direction:normal!important;-ms-flex-direction:row!important;flex-direction:row!important}.flex-column{-webkit-box-orient:vertical!important;-webkit-box-direction:normal!important;-ms-flex-direction:column!important;flex-direction:column!important}.flex-row-reverse{-webkit-box-orient:horizontal!important;-webkit-box-direction:reverse!important;-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-column-reverse{-webkit-box-orient:vertical!important;-webkit-box-direction:reverse!important;-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.justify-content-start{-webkit-box-pack:start!important;-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-end{-webkit-box-pack:end!important;-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-center{-webkit-box-pack:center!important;-ms-flex-pack:center!important;justify-content:center!important}.justify-content-between{-webkit-box-pack:justify!important;-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-start{-webkit-box-align:start!important;-ms-flex-align:start!important;align-items:flex-start!important}.align-items-end{-webkit-box-align:end!important;-ms-flex-align:end!important;align-items:flex-end!important}.align-items-center{-webkit-box-align:center!important;-ms-flex-align:center!important;align-items:center!important}.align-items-baseline{-webkit-box-align:baseline!important;-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-stretch{-webkit-box-align:stretch!important;-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}@media (min-width:576px){.flex-sm-row{-webkit-box-orient:horizontal!important;-webkit-box-direction:normal!important;-ms-flex-direction:row!important;flex-direction:row!important}.flex-sm-column{-webkit-box-orient:vertical!important;-webkit-box-direction:normal!important;-ms-flex-direction:column!important;flex-direction:column!important}.flex-sm-row-reverse{-webkit-box-orient:horizontal!important;-webkit-box-direction:reverse!important;-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-sm-column-reverse{-webkit-box-orient:vertical!important;-webkit-box-direction:reverse!important;-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-sm-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-sm-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-sm-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.justify-content-sm-start{-webkit-box-pack:start!important;-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-sm-end{-webkit-box-pack:end!important;-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-sm-center{-webkit-box-pack:center!important;-ms-flex-pack:center!important;justify-content:center!important}.justify-content-sm-between{-webkit-box-pack:justify!important;-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-sm-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-sm-start{-webkit-box-align:start!important;-ms-flex-align:start!important;align-items:flex-start!important}.align-items-sm-end{-webkit-box-align:end!important;-ms-flex-align:end!important;align-items:flex-end!important}.align-items-sm-center{-webkit-box-align:center!important;-ms-flex-align:center!important;align-items:center!important}.align-items-sm-baseline{-webkit-box-align:baseline!important;-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-sm-stretch{-webkit-box-align:stretch!important;-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-sm-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-sm-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-sm-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-sm-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-sm-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-sm-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-sm-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-sm-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-sm-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-sm-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-sm-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-sm-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media (min-width:768px){.flex-md-row{-webkit-box-orient:horizontal!important;-webkit-box-direction:normal!important;-ms-flex-direction:row!important;flex-direction:row!important}.flex-md-column{-webkit-box-orient:vertical!important;-webkit-box-direction:normal!important;-ms-flex-direction:column!important;flex-direction:column!important}.flex-md-row-reverse{-webkit-box-orient:horizontal!important;-webkit-box-direction:reverse!important;-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-md-column-reverse{-webkit-box-orient:vertical!important;-webkit-box-direction:reverse!important;-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-md-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-md-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-md-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.justify-content-md-start{-webkit-box-pack:start!important;-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-md-end{-webkit-box-pack:end!important;-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-md-center{-webkit-box-pack:center!important;-ms-flex-pack:center!important;justify-content:center!important}.justify-content-md-between{-webkit-box-pack:justify!important;-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-md-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-md-start{-webkit-box-align:start!important;-ms-flex-align:start!important;align-items:flex-start!important}.align-items-md-end{-webkit-box-align:end!important;-ms-flex-align:end!important;align-items:flex-end!important}.align-items-md-center{-webkit-box-align:center!important;-ms-flex-align:center!important;align-items:center!important}.align-items-md-baseline{-webkit-box-align:baseline!important;-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-md-stretch{-webkit-box-align:stretch!important;-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-md-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-md-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-md-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-md-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-md-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-md-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-md-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-md-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-md-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-md-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-md-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-md-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media (min-width:992px){.flex-lg-row{-webkit-box-orient:horizontal!important;-webkit-box-direction:normal!important;-ms-flex-direction:row!important;flex-direction:row!important}.flex-lg-column{-webkit-box-orient:vertical!important;-webkit-box-direction:normal!important;-ms-flex-direction:column!important;flex-direction:column!important}.flex-lg-row-reverse{-webkit-box-orient:horizontal!important;-webkit-box-direction:reverse!important;-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-lg-column-reverse{-webkit-box-orient:vertical!important;-webkit-box-direction:reverse!important;-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-lg-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-lg-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-lg-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.justify-content-lg-start{-webkit-box-pack:start!important;-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-lg-end{-webkit-box-pack:end!important;-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-lg-center{-webkit-box-pack:center!important;-ms-flex-pack:center!important;justify-content:center!important}.justify-content-lg-between{-webkit-box-pack:justify!important;-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-lg-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-lg-start{-webkit-box-align:start!important;-ms-flex-align:start!important;align-items:flex-start!important}.align-items-lg-end{-webkit-box-align:end!important;-ms-flex-align:end!important;align-items:flex-end!important}.align-items-lg-center{-webkit-box-align:center!important;-ms-flex-align:center!important;align-items:center!important}.align-items-lg-baseline{-webkit-box-align:baseline!important;-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-lg-stretch{-webkit-box-align:stretch!important;-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-lg-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-lg-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-lg-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-lg-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-lg-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-lg-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-lg-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-lg-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-lg-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-lg-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-lg-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-lg-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media (min-width:1200px){.flex-xl-row{-webkit-box-orient:horizontal!important;-webkit-box-direction:normal!important;-ms-flex-direction:row!important;flex-direction:row!important}.flex-xl-column{-webkit-box-orient:vertical!important;-webkit-box-direction:normal!important;-ms-flex-direction:column!important;flex-direction:column!important}.flex-xl-row-reverse{-webkit-box-orient:horizontal!important;-webkit-box-direction:reverse!important;-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-xl-column-reverse{-webkit-box-orient:vertical!important;-webkit-box-direction:reverse!important;-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-xl-wrap{-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-xl-nowrap{-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-xl-wrap-reverse{-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.justify-content-xl-start{-webkit-box-pack:start!important;-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-xl-end{-webkit-box-pack:end!important;-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-xl-center{-webkit-box-pack:center!important;-ms-flex-pack:center!important;justify-content:center!important}.justify-content-xl-between{-webkit-box-pack:justify!important;-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-xl-around{-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-xl-start{-webkit-box-align:start!important;-ms-flex-align:start!important;align-items:flex-start!important}.align-items-xl-end{-webkit-box-align:end!important;-ms-flex-align:end!important;align-items:flex-end!important}.align-items-xl-center{-webkit-box-align:center!important;-ms-flex-align:center!important;align-items:center!important}.align-items-xl-baseline{-webkit-box-align:baseline!important;-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-xl-stretch{-webkit-box-align:stretch!important;-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-xl-start{-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-xl-end{-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-xl-center{-ms-flex-line-pack:center!important;align-content:center!important}.align-content-xl-between{-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-xl-around{-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-xl-stretch{-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-xl-auto{-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-xl-start{-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-xl-end{-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-xl-center{-ms-flex-item-align:center!important;align-self:center!important}.align-self-xl-baseline{-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-xl-stretch{-ms-flex-item-align:stretch!important;align-self:stretch!important}}.float-left{float:left!important}.float-right{float:right!important}.float-none{float:none!important}@media (min-width:576px){.float-sm-left{float:left!important}.float-sm-right{float:right!important}.float-sm-none{float:none!important}}@media (min-width:768px){.float-md-left{float:left!important}.float-md-right{float:right!important}.float-md-none{float:none!important}}@media (min-width:992px){.float-lg-left{float:left!important}.float-lg-right{float:right!important}.float-lg-none{float:none!important}}@media (min-width:1200px){.float-xl-left{float:left!important}.float-xl-right{float:right!important}.float-xl-none{float:none!important}}.position-static{position:static!important}.position-relative{position:relative!important}.position-absolute{position:absolute!important}.position-fixed{position:fixed!important}.position-sticky{position:-webkit-sticky!important;position:sticky!important}.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}.fixed-bottom{position:fixed;right:0;bottom:0;left:0;z-index:1030}@supports ((position:-webkit-sticky) or (position:sticky)){.sticky-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}}.sr-only{position:absolute;width:1px;height:1px;padding:0;overflow:hidden;clip:rect(0,0,0,0);white-space:nowrap;-webkit-clip-path:inset(50%);clip-path:inset(50%);border:0}.sr-only-focusable:active,.sr-only-focusable:focus{position:static;width:auto;height:auto;overflow:visible;clip:auto;white-space:normal;-webkit-clip-path:none;clip-path:none}.w-25{width:25%!important}.w-50{width:50%!important}.w-75{width:75%!important}.w-100{width:100%!important}.h-25{height:25%!important}.h-50{height:50%!important}.h-75{height:75%!important}.h-100{height:100%!important}.mw-100{max-width:100%!important}.mh-100{max-height:100%!important}.m-0{margin:0!important}.mt-0,.my-0{margin-top:0!important}.mr-0,.mx-0{margin-right:0!important}.mb-0,.my-0{margin-bottom:0!important}.ml-0,.mx-0{margin-left:0!important}.m-1{margin:.25rem!important}.mt-1,.my-1{margin-top:.25rem!important}.mr-1,.mx-1{margin-right:.25rem!important}.mb-1,.my-1{margin-bottom:.25rem!important}.ml-1,.mx-1{margin-left:.25rem!important}.m-2{margin:.5rem!important}.mt-2,.my-2{margin-top:.5rem!important}.mr-2,.mx-2{margin-right:.5rem!important}.mb-2,.my-2{margin-bottom:.5rem!important}.ml-2,.mx-2{margin-left:.5rem!important}.m-3{margin:1rem!important}.mt-3,.my-3{margin-top:1rem!important}.mr-3,.mx-3{margin-right:1rem!important}.mb-3,.my-3{margin-bottom:1rem!important}.ml-3,.mx-3{margin-left:1rem!important}.m-4{margin:1.5rem!important}.mt-4,.my-4{margin-top:1.5rem!important}.mr-4,.mx-4{margin-right:1.5rem!important}.mb-4,.my-4{margin-bottom:1.5rem!important}.ml-4,.mx-4{margin-left:1.5rem!important}.m-5{margin:3rem!important}.mt-5,.my-5{margin-top:3rem!important}.mr-5,.mx-5{margin-right:3rem!important}.mb-5,.my-5{margin-bottom:3rem!important}.ml-5,.mx-5{margin-left:3rem!important}.p-0{padding:0!important}.pt-0,.py-0{padding-top:0!important}.pr-0,.px-0{padding-right:0!important}.pb-0,.py-0{padding-bottom:0!important}.pl-0,.px-0{padding-left:0!important}.p-1{padding:.25rem!important}.pt-1,.py-1{padding-top:.25rem!important}.pr-1,.px-1{padding-right:.25rem!important}.pb-1,.py-1{padding-bottom:.25rem!important}.pl-1,.px-1{padding-left:.25rem!important}.p-2{padding:.5rem!important}.pt-2,.py-2{padding-top:.5rem!important}.pr-2,.px-2{padding-right:.5rem!important}.pb-2,.py-2{padding-bottom:.5rem!important}.pl-2,.px-2{padding-left:.5rem!important}.p-3{padding:1rem!important}.pt-3,.py-3{padding-top:1rem!important}.pr-3,.px-3{padding-right:1rem!important}.pb-3,.py-3{padding-bottom:1rem!important}.pl-3,.px-3{padding-left:1rem!important}.p-4{padding:1.5rem!important}.pt-4,.py-4{padding-top:1.5rem!important}.pr-4,.px-4{padding-right:1.5rem!important}.pb-4,.py-4{padding-bottom:1.5rem!important}.pl-4,.px-4{padding-left:1.5rem!important}.p-5{padding:3rem!important}.pt-5,.py-5{padding-top:3rem!important}.pr-5,.px-5{padding-right:3rem!important}.pb-5,.py-5{padding-bottom:3rem!important}.pl-5,.px-5{padding-left:3rem!important}.m-auto{margin:auto!important}.mt-auto,.my-auto{margin-top:auto!important}.mr-auto,.mx-auto{margin-right:auto!important}.mb-auto,.my-auto{margin-bottom:auto!important}.ml-auto,.mx-auto{margin-left:auto!important}@media (min-width:576px){.m-sm-0{margin:0!important}.mt-sm-0,.my-sm-0{margin-top:0!important}.mr-sm-0,.mx-sm-0{margin-right:0!important}.mb-sm-0,.my-sm-0{margin-bottom:0!important}.ml-sm-0,.mx-sm-0{margin-left:0!important}.m-sm-1{margin:.25rem!important}.mt-sm-1,.my-sm-1{margin-top:.25rem!important}.mr-sm-1,.mx-sm-1{margin-right:.25rem!important}.mb-sm-1,.my-sm-1{margin-bottom:.25rem!important}.ml-sm-1,.mx-sm-1{margin-left:.25rem!important}.m-sm-2{margin:.5rem!important}.mt-sm-2,.my-sm-2{margin-top:.5rem!important}.mr-sm-2,.mx-sm-2{margin-right:.5rem!important}.mb-sm-2,.my-sm-2{margin-bottom:.5rem!important}.ml-sm-2,.mx-sm-2{margin-left:.5rem!important}.m-sm-3{margin:1rem!important}.mt-sm-3,.my-sm-3{margin-top:1rem!important}.mr-sm-3,.mx-sm-3{margin-right:1rem!important}.mb-sm-3,.my-sm-3{margin-bottom:1rem!important}.ml-sm-3,.mx-sm-3{margin-left:1rem!important}.m-sm-4{margin:1.5rem!important}.mt-sm-4,.my-sm-4{margin-top:1.5rem!important}.mr-sm-4,.mx-sm-4{margin-right:1.5rem!important}.mb-sm-4,.my-sm-4{margin-bottom:1.5rem!important}.ml-sm-4,.mx-sm-4{margin-left:1.5rem!important}.m-sm-5{margin:3rem!important}.mt-sm-5,.my-sm-5{margin-top:3rem!important}.mr-sm-5,.mx-sm-5{margin-right:3rem!important}.mb-sm-5,.my-sm-5{margin-bottom:3rem!important}.ml-sm-5,.mx-sm-5{margin-left:3rem!important}.p-sm-0{padding:0!important}.pt-sm-0,.py-sm-0{padding-top:0!important}.pr-sm-0,.px-sm-0{padding-right:0!important}.pb-sm-0,.py-sm-0{padding-bottom:0!important}.pl-sm-0,.px-sm-0{padding-left:0!important}.p-sm-1{padding:.25rem!important}.pt-sm-1,.py-sm-1{padding-top:.25rem!important}.pr-sm-1,.px-sm-1{padding-right:.25rem!important}.pb-sm-1,.py-sm-1{padding-bottom:.25rem!important}.pl-sm-1,.px-sm-1{padding-left:.25rem!important}.p-sm-2{padding:.5rem!important}.pt-sm-2,.py-sm-2{padding-top:.5rem!important}.pr-sm-2,.px-sm-2{padding-right:.5rem!important}.pb-sm-2,.py-sm-2{padding-bottom:.5rem!important}.pl-sm-2,.px-sm-2{padding-left:.5rem!important}.p-sm-3{padding:1rem!important}.pt-sm-3,.py-sm-3{padding-top:1rem!important}.pr-sm-3,.px-sm-3{padding-right:1rem!important}.pb-sm-3,.py-sm-3{padding-bottom:1rem!important}.pl-sm-3,.px-sm-3{padding-left:1rem!important}.p-sm-4{padding:1.5rem!important}.pt-sm-4,.py-sm-4{padding-top:1.5rem!important}.pr-sm-4,.px-sm-4{padding-right:1.5rem!important}.pb-sm-4,.py-sm-4{padding-bottom:1.5rem!important}.pl-sm-4,.px-sm-4{padding-left:1.5rem!important}.p-sm-5{padding:3rem!important}.pt-sm-5,.py-sm-5{padding-top:3rem!important}.pr-sm-5,.px-sm-5{padding-right:3rem!important}.pb-sm-5,.py-sm-5{padding-bottom:3rem!important}.pl-sm-5,.px-sm-5{padding-left:3rem!important}.m-sm-auto{margin:auto!important}.mt-sm-auto,.my-sm-auto{margin-top:auto!important}.mr-sm-auto,.mx-sm-auto{margin-right:auto!important}.mb-sm-auto,.my-sm-auto{margin-bottom:auto!important}.ml-sm-auto,.mx-sm-auto{margin-left:auto!important}}@media (min-width:768px){.m-md-0{margin:0!important}.mt-md-0,.my-md-0{margin-top:0!important}.mr-md-0,.mx-md-0{margin-right:0!important}.mb-md-0,.my-md-0{margin-bottom:0!important}.ml-md-0,.mx-md-0{margin-left:0!important}.m-md-1{margin:.25rem!important}.mt-md-1,.my-md-1{margin-top:.25rem!important}.mr-md-1,.mx-md-1{margin-right:.25rem!important}.mb-md-1,.my-md-1{margin-bottom:.25rem!important}.ml-md-1,.mx-md-1{margin-left:.25rem!important}.m-md-2{margin:.5rem!important}.mt-md-2,.my-md-2{margin-top:.5rem!important}.mr-md-2,.mx-md-2{margin-right:.5rem!important}.mb-md-2,.my-md-2{margin-bottom:.5rem!important}.ml-md-2,.mx-md-2{margin-left:.5rem!important}.m-md-3{margin:1rem!important}.mt-md-3,.my-md-3{margin-top:1rem!important}.mr-md-3,.mx-md-3{margin-right:1rem!important}.mb-md-3,.my-md-3{margin-bottom:1rem!important}.ml-md-3,.mx-md-3{margin-left:1rem!important}.m-md-4{margin:1.5rem!important}.mt-md-4,.my-md-4{margin-top:1.5rem!important}.mr-md-4,.mx-md-4{margin-right:1.5rem!important}.mb-md-4,.my-md-4{margin-bottom:1.5rem!important}.ml-md-4,.mx-md-4{margin-left:1.5rem!important}.m-md-5{margin:3rem!important}.mt-md-5,.my-md-5{margin-top:3rem!important}.mr-md-5,.mx-md-5{margin-right:3rem!important}.mb-md-5,.my-md-5{margin-bottom:3rem!important}.ml-md-5,.mx-md-5{margin-left:3rem!important}.p-md-0{padding:0!important}.pt-md-0,.py-md-0{padding-top:0!important}.pr-md-0,.px-md-0{padding-right:0!important}.pb-md-0,.py-md-0{padding-bottom:0!important}.pl-md-0,.px-md-0{padding-left:0!important}.p-md-1{padding:.25rem!important}.pt-md-1,.py-md-1{padding-top:.25rem!important}.pr-md-1,.px-md-1{padding-right:.25rem!important}.pb-md-1,.py-md-1{padding-bottom:.25rem!important}.pl-md-1,.px-md-1{padding-left:.25rem!important}.p-md-2{padding:.5rem!important}.pt-md-2,.py-md-2{padding-top:.5rem!important}.pr-md-2,.px-md-2{padding-right:.5rem!important}.pb-md-2,.py-md-2{padding-bottom:.5rem!important}.pl-md-2,.px-md-2{padding-left:.5rem!important}.p-md-3{padding:1rem!important}.pt-md-3,.py-md-3{padding-top:1rem!important}.pr-md-3,.px-md-3{padding-right:1rem!important}.pb-md-3,.py-md-3{padding-bottom:1rem!important}.pl-md-3,.px-md-3{padding-left:1rem!important}.p-md-4{padding:1.5rem!important}.pt-md-4,.py-md-4{padding-top:1.5rem!important}.pr-md-4,.px-md-4{padding-right:1.5rem!important}.pb-md-4,.py-md-4{padding-bottom:1.5rem!important}.pl-md-4,.px-md-4{padding-left:1.5rem!important}.p-md-5{padding:3rem!important}.pt-md-5,.py-md-5{padding-top:3rem!important}.pr-md-5,.px-md-5{padding-right:3rem!important}.pb-md-5,.py-md-5{padding-bottom:3rem!important}.pl-md-5,.px-md-5{padding-left:3rem!important}.m-md-auto{margin:auto!important}.mt-md-auto,.my-md-auto{margin-top:auto!important}.mr-md-auto,.mx-md-auto{margin-right:auto!important}.mb-md-auto,.my-md-auto{margin-bottom:auto!important}.ml-md-auto,.mx-md-auto{margin-left:auto!important}}@media (min-width:992px){.m-lg-0{margin:0!important}.mt-lg-0,.my-lg-0{margin-top:0!important}.mr-lg-0,.mx-lg-0{margin-right:0!important}.mb-lg-0,.my-lg-0{margin-bottom:0!important}.ml-lg-0,.mx-lg-0{margin-left:0!important}.m-lg-1{margin:.25rem!important}.mt-lg-1,.my-lg-1{margin-top:.25rem!important}.mr-lg-1,.mx-lg-1{margin-right:.25rem!important}.mb-lg-1,.my-lg-1{margin-bottom:.25rem!important}.ml-lg-1,.mx-lg-1{margin-left:.25rem!important}.m-lg-2{margin:.5rem!important}.mt-lg-2,.my-lg-2{margin-top:.5rem!important}.mr-lg-2,.mx-lg-2{margin-right:.5rem!important}.mb-lg-2,.my-lg-2{margin-bottom:.5rem!important}.ml-lg-2,.mx-lg-2{margin-left:.5rem!important}.m-lg-3{margin:1rem!important}.mt-lg-3,.my-lg-3{margin-top:1rem!important}.mr-lg-3,.mx-lg-3{margin-right:1rem!important}.mb-lg-3,.my-lg-3{margin-bottom:1rem!important}.ml-lg-3,.mx-lg-3{margin-left:1rem!important}.m-lg-4{margin:1.5rem!important}.mt-lg-4,.my-lg-4{margin-top:1.5rem!important}.mr-lg-4,.mx-lg-4{margin-right:1.5rem!important}.mb-lg-4,.my-lg-4{margin-bottom:1.5rem!important}.ml-lg-4,.mx-lg-4{margin-left:1.5rem!important}.m-lg-5{margin:3rem!important}.mt-lg-5,.my-lg-5{margin-top:3rem!important}.mr-lg-5,.mx-lg-5{margin-right:3rem!important}.mb-lg-5,.my-lg-5{margin-bottom:3rem!important}.ml-lg-5,.mx-lg-5{margin-left:3rem!important}.p-lg-0{padding:0!important}.pt-lg-0,.py-lg-0{padding-top:0!important}.pr-lg-0,.px-lg-0{padding-right:0!important}.pb-lg-0,.py-lg-0{padding-bottom:0!important}.pl-lg-0,.px-lg-0{padding-left:0!important}.p-lg-1{padding:.25rem!important}.pt-lg-1,.py-lg-1{padding-top:.25rem!important}.pr-lg-1,.px-lg-1{padding-right:.25rem!important}.pb-lg-1,.py-lg-1{padding-bottom:.25rem!important}.pl-lg-1,.px-lg-1{padding-left:.25rem!important}.p-lg-2{padding:.5rem!important}.pt-lg-2,.py-lg-2{padding-top:.5rem!important}.pr-lg-2,.px-lg-2{padding-right:.5rem!important}.pb-lg-2,.py-lg-2{padding-bottom:.5rem!important}.pl-lg-2,.px-lg-2{padding-left:.5rem!important}.p-lg-3{padding:1rem!important}.pt-lg-3,.py-lg-3{padding-top:1rem!important}.pr-lg-3,.px-lg-3{padding-right:1rem!important}.pb-lg-3,.py-lg-3{padding-bottom:1rem!important}.pl-lg-3,.px-lg-3{padding-left:1rem!important}.p-lg-4{padding:1.5rem!important}.pt-lg-4,.py-lg-4{padding-top:1.5rem!important}.pr-lg-4,.px-lg-4{padding-right:1.5rem!important}.pb-lg-4,.py-lg-4{padding-bottom:1.5rem!important}.pl-lg-4,.px-lg-4{padding-left:1.5rem!important}.p-lg-5{padding:3rem!important}.pt-lg-5,.py-lg-5{padding-top:3rem!important}.pr-lg-5,.px-lg-5{padding-right:3rem!important}.pb-lg-5,.py-lg-5{padding-bottom:3rem!important}.pl-lg-5,.px-lg-5{padding-left:3rem!important}.m-lg-auto{margin:auto!important}.mt-lg-auto,.my-lg-auto{margin-top:auto!important}.mr-lg-auto,.mx-lg-auto{margin-right:auto!important}.mb-lg-auto,.my-lg-auto{margin-bottom:auto!important}.ml-lg-auto,.mx-lg-auto{margin-left:auto!important}}@media (min-width:1200px){.m-xl-0{margin:0!important}.mt-xl-0,.my-xl-0{margin-top:0!important}.mr-xl-0,.mx-xl-0{margin-right:0!important}.mb-xl-0,.my-xl-0{margin-bottom:0!important}.ml-xl-0,.mx-xl-0{margin-left:0!important}.m-xl-1{margin:.25rem!important}.mt-xl-1,.my-xl-1{margin-top:.25rem!important}.mr-xl-1,.mx-xl-1{margin-right:.25rem!important}.mb-xl-1,.my-xl-1{margin-bottom:.25rem!important}.ml-xl-1,.mx-xl-1{margin-left:.25rem!important}.m-xl-2{margin:.5rem!important}.mt-xl-2,.my-xl-2{margin-top:.5rem!important}.mr-xl-2,.mx-xl-2{margin-right:.5rem!important}.mb-xl-2,.my-xl-2{margin-bottom:.5rem!important}.ml-xl-2,.mx-xl-2{margin-left:.5rem!important}.m-xl-3{margin:1rem!important}.mt-xl-3,.my-xl-3{margin-top:1rem!important}.mr-xl-3,.mx-xl-3{margin-right:1rem!important}.mb-xl-3,.my-xl-3{margin-bottom:1rem!important}.ml-xl-3,.mx-xl-3{margin-left:1rem!important}.m-xl-4{margin:1.5rem!important}.mt-xl-4,.my-xl-4{margin-top:1.5rem!important}.mr-xl-4,.mx-xl-4{margin-right:1.5rem!important}.mb-xl-4,.my-xl-4{margin-bottom:1.5rem!important}.ml-xl-4,.mx-xl-4{margin-left:1.5rem!important}.m-xl-5{margin:3rem!important}.mt-xl-5,.my-xl-5{margin-top:3rem!important}.mr-xl-5,.mx-xl-5{margin-right:3rem!important}.mb-xl-5,.my-xl-5{margin-bottom:3rem!important}.ml-xl-5,.mx-xl-5{margin-left:3rem!important}.p-xl-0{padding:0!important}.pt-xl-0,.py-xl-0{padding-top:0!important}.pr-xl-0,.px-xl-0{padding-right:0!important}.pb-xl-0,.py-xl-0{padding-bottom:0!important}.pl-xl-0,.px-xl-0{padding-left:0!important}.p-xl-1{padding:.25rem!important}.pt-xl-1,.py-xl-1{padding-top:.25rem!important}.pr-xl-1,.px-xl-1{padding-right:.25rem!important}.pb-xl-1,.py-xl-1{padding-bottom:.25rem!important}.pl-xl-1,.px-xl-1{padding-left:.25rem!important}.p-xl-2{padding:.5rem!important}.pt-xl-2,.py-xl-2{padding-top:.5rem!important}.pr-xl-2,.px-xl-2{padding-right:.5rem!important}.pb-xl-2,.py-xl-2{padding-bottom:.5rem!important}.pl-xl-2,.px-xl-2{padding-left:.5rem!important}.p-xl-3{padding:1rem!important}.pt-xl-3,.py-xl-3{padding-top:1rem!important}.pr-xl-3,.px-xl-3{padding-right:1rem!important}.pb-xl-3,.py-xl-3{padding-bottom:1rem!important}.pl-xl-3,.px-xl-3{padding-left:1rem!important}.p-xl-4{padding:1.5rem!important}.pt-xl-4,.py-xl-4{padding-top:1.5rem!important}.pr-xl-4,.px-xl-4{padding-right:1.5rem!important}.pb-xl-4,.py-xl-4{padding-bottom:1.5rem!important}.pl-xl-4,.px-xl-4{padding-left:1.5rem!important}.p-xl-5{padding:3rem!important}.pt-xl-5,.py-xl-5{padding-top:3rem!important}.pr-xl-5,.px-xl-5{padding-right:3rem!important}.pb-xl-5,.py-xl-5{padding-bottom:3rem!important}.pl-xl-5,.px-xl-5{padding-left:3rem!important}.m-xl-auto{margin:auto!important}.mt-xl-auto,.my-xl-auto{margin-top:auto!important}.mr-xl-auto,.mx-xl-auto{margin-right:auto!important}.mb-xl-auto,.my-xl-auto{margin-bottom:auto!important}.ml-xl-auto,.mx-xl-auto{margin-left:auto!important}}.text-justify{text-align:justify!important}.text-nowrap{white-space:nowrap!important}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.text-left{text-align:left!important}.text-right{text-align:right!important}.text-center{text-align:center!important}@media (min-width:576px){.text-sm-left{text-align:left!important}.text-sm-right{text-align:right!important}.text-sm-center{text-align:center!important}}@media (min-width:768px){.text-md-left{text-align:left!important}.text-md-right{text-align:right!important}.text-md-center{text-align:center!important}}@media (min-width:992px){.text-lg-left{text-align:left!important}.text-lg-right{text-align:right!important}.text-lg-center{text-align:center!important}}@media (min-width:1200px){.text-xl-left{text-align:left!important}.text-xl-right{text-align:right!important}.text-xl-center{text-align:center!important}}.text-lowercase{text-transform:lowercase!important}.text-uppercase{text-transform:uppercase!important}.text-capitalize{text-transform:capitalize!important}.font-weight-light{font-weight:300!important}.font-weight-normal{font-weight:400!important}.font-weight-bold{font-weight:700!important}.font-italic{font-style:italic!important}.text-white{color:#fff!important}.text-primary{color:#007bff!important}a.text-primary:focus,a.text-primary:hover{color:#0062cc!important}.text-secondary{color:#6c757d!important}a.text-secondary:focus,a.text-secondary:hover{color:#545b62!important}.text-success{color:#28a745!important}a.text-success:focus,a.text-success:hover{color:#1e7e34!important}.text-info{color:#17a2b8!important}a.text-info:focus,a.text-info:hover{color:#117a8b!important}.text-warning{color:#ffc107!important}a.text-warning:focus,a.text-warning:hover{color:#d39e00!important}.text-danger{color:#dc3545!important}a.text-danger:focus,a.text-danger:hover{color:#bd2130!important}.text-light{color:#f8f9fa!important}a.text-light:focus,a.text-light:hover{color:#dae0e5!important}.text-dark{color:#343a40!important}a.text-dark:focus,a.text-dark:hover{color:#1d2124!important}.text-muted{color:#6c757d!important}.text-hide{font:0/0 a;color:transparent;text-shadow:none;background-color:transparent;border:0}.visible{visibility:visible!important}.invisible{visibility:hidden!important}@media print{*,::after,::before{text-shadow:none!important;box-shadow:none!important}a:not(.btn){text-decoration:underline}abbr[title]::after{content:" (" attr(title) ")"}pre{white-space:pre-wrap!important}blockquote,pre{border:1px solid #999;page-break-inside:avoid}thead{display:table-header-group}img,tr{page-break-inside:avoid}h2,h3,p{orphans:3;widows:3}h2,h3{page-break-after:avoid}@page{size:a3}body{min-width:992px!important}.container{min-width:992px!important}.navbar{display:none}.badge{border:1px solid #000}.table{border-collapse:collapse!important}.table td,.table th{background-color:#fff!important}.table-bordered td,.table-bordered th{border:1px solid #ddd!important}}
+/*# sourceMappingURL=bootstrap.min.css.map */ \ No newline at end of file
diff --git a/chall/src/css/custom.css b/chall/src/css/custom.css
new file mode 100644
index 0000000..6bea6c1
--- /dev/null
+++ b/chall/src/css/custom.css
@@ -0,0 +1,66 @@
+ .container.custom-container {
+ padding: 0 50px;
+ }
+
+.jumbotron {
+ font-family: Arial;
+ background-color: #000;
+ color: #fff;
+ }
+
+.container {
+ font-family: Arial;
+ background-color: #000;
+ color: #fff;
+}
+
+
+body {
+ font-family: Arial;
+ background-color: #000;
+ color: #fff;
+}
+
+main {
+ font-family: "Source Sans Pro", Verdana, Geneva, Tahoma, sans-serif;
+ font-weight: 300;
+ max-width: 720px;
+ margin: 10px auto;
+ background-color: #111;
+ box-sizing: border-box;
+ padding: 10px 32px;
+}
+
+textarea {
+ width: 100%;
+ height: 200px;
+ font-family: Consolas, "Courier New", Courier, monospace;
+ line-height: 1.2em;
+ padding: 8px;
+ box-sizing: border-box;
+ font-size: 0.9em;
+ border: 1px solid #fff;
+ background-color: #000;
+ color: #fff;
+}
+
+
+ p {
+ display: block;
+ margin-block-start: 1em;
+ margin-block-end: 1em;
+ margin-inline-start: 0px;
+ margin-inline-end: 0px;
+
+}
+
+
+input[type="button"] {
+ background-color: #600;
+ color: #fff;
+ font-weight: bold;
+ border: 3px solid #000;
+ font-size: 140%;
+ border-radius: 8px;
+ margin: 8px auto;
+} \ No newline at end of file
diff --git a/chall/src/form.php b/chall/src/form.php
new file mode 100644
index 0000000..b3cc3da
--- /dev/null
+++ b/chall/src/form.php
@@ -0,0 +1,24 @@
+<div class="jumbotron">
+ <div class="container custom-container">
+ <h1>LOLPython</h1>
+ <p>You finally landed on the mainframe and are soooo close to hack the world! But what is this? A <a href="http://www.dalkescientific.com/writings/diary/archive/2007/06/01/lolpython.html">LOLPython</a> interpreter in production?
+ Googling quickly reveals: Thats <a href="https://esolangs.org/wiki/Language_list">one of many esolangs</a> with hacker and l33t speak. Sounds cool, right?</p>
+ <p>Though, to solve this challenge, you have to take it to the next level: Not only code a program in this weird language, but escape the interpreter and execute the final payload. Go exploit it!</p>
+ </div>
+</div>
+<div class="container">
+ <main role="main">
+ <form>
+ <p>Type your LOLPython code here. We'll execute your file and you'll get the result</p>
+ <textarea placeholder="VISIBLE 'HAI WORLD!'" id="in">
+</textarea>
+ <input type="button" value="Transpile and Run!" id="rock-button" onclick="transpile();">
+
+ <br>
+ <p>Output:</p>
+ <textarea id="output"></textarea>
+ </form>
+ </main>
+
+</div>
+<br><br> \ No newline at end of file
diff --git a/chall/src/index.php b/chall/src/index.php
new file mode 100644
index 0000000..c0ead91
--- /dev/null
+++ b/chall/src/index.php
@@ -0,0 +1,58 @@
+<?php
+session_start();
+
+function generateRandomString($length = 24)
+{
+ $characters = '0123456789abcdefghijklmnopqrstuvwxyz';
+ $charactersLength = strlen($characters);
+ $randomString = '';
+ for ($i = 0; $i < $length; $i++) {
+ $randomString .= $characters[rand(0, $charactersLength - 1)];
+ }
+ return $randomString;
+}
+
+if (!isset($_SESSION['userid'])) {
+ $_SESSION['userid'] = generateRandomString();
+}
+?>
+
+<!doctype html>
+<html lang="en">
+
+<head>
+ <meta charset="utf-8">
+ <meta name="viewport" content="width=device-width, initial-scale=1, shrink-to-fit=no">
+ <meta name="description" content="">
+ <meta name="author" content="">
+ <link rel="icon" href="favicon.ico">
+
+ <title>LOLPython Transpiler Service</title>
+
+ <!-- Bootstrap core CSS -->
+ <link href="css/bootstrap.min.css" rel="stylesheet">
+
+ <link href="css/custom.css" rel="stylesheet">
+
+</head>
+
+<body>
+ <!-- Main jumbotron for a primary marketing message or call to action -->
+ <?php include("form.php") ?>
+ <footer class="container">
+ <p>&copy; LOLPython Transpiler Service 2024</p>
+ </footer>
+
+ <!-- Bootstrap core JavaScript
+ ================================================== -->
+ <!-- Placed at the end of the document so the pages load faster -->
+ <script
+ src="https://code.jquery.com/jquery-3.5.1.min.js"
+ integrity="sha256-9/aliU8dGd2tb6OSsuzixeV4y/faTqgFtohetphbbj0="
+ crossorigin="anonymous"></script>
+ <script src="js/vendor/popper.min.js"></script>
+ <script src="js/bootstrap.min.js"></script>
+ <script src="js/rockstar.js"></script>
+</body>
+
+</html> \ No newline at end of file
diff --git a/chall/src/js/bootstrap.bundle.js b/chall/src/js/bootstrap.bundle.js
new file mode 100644
index 0000000..45b357d
--- /dev/null
+++ b/chall/src/js/bootstrap.bundle.js
@@ -0,0 +1,6328 @@
+/*!
+ * Bootstrap v4.0.0 (https://getbootstrap.com)
+ * Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ */
+(function (global, factory) {
+ typeof exports === 'object' && typeof module !== 'undefined' ? factory(exports, require('jquery')) :
+ typeof define === 'function' && define.amd ? define(['exports', 'jquery'], factory) :
+ (factory((global.bootstrap = {}),global.jQuery));
+}(this, (function (exports,$) { 'use strict';
+
+$ = $ && $.hasOwnProperty('default') ? $['default'] : $;
+
+function _defineProperties(target, props) {
+ for (var i = 0; i < props.length; i++) {
+ var descriptor = props[i];
+ descriptor.enumerable = descriptor.enumerable || false;
+ descriptor.configurable = true;
+ if ("value" in descriptor) descriptor.writable = true;
+ Object.defineProperty(target, descriptor.key, descriptor);
+ }
+}
+
+function _createClass(Constructor, protoProps, staticProps) {
+ if (protoProps) _defineProperties(Constructor.prototype, protoProps);
+ if (staticProps) _defineProperties(Constructor, staticProps);
+ return Constructor;
+}
+
+function _extends() {
+ _extends = Object.assign || function (target) {
+ for (var i = 1; i < arguments.length; i++) {
+ var source = arguments[i];
+
+ for (var key in source) {
+ if (Object.prototype.hasOwnProperty.call(source, key)) {
+ target[key] = source[key];
+ }
+ }
+ }
+
+ return target;
+ };
+
+ return _extends.apply(this, arguments);
+}
+
+function _inheritsLoose(subClass, superClass) {
+ subClass.prototype = Object.create(superClass.prototype);
+ subClass.prototype.constructor = subClass;
+ subClass.__proto__ = superClass;
+}
+
+/**
+ * --------------------------------------------------------------------------
+ * Bootstrap (v4.0.0): util.js
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * --------------------------------------------------------------------------
+ */
+
+var Util = function ($$$1) {
+ /**
+ * ------------------------------------------------------------------------
+ * Private TransitionEnd Helpers
+ * ------------------------------------------------------------------------
+ */
+ var transition = false;
+ var MAX_UID = 1000000; // Shoutout AngusCroll (https://goo.gl/pxwQGp)
+
+ function toType(obj) {
+ return {}.toString.call(obj).match(/\s([a-zA-Z]+)/)[1].toLowerCase();
+ }
+
+ function getSpecialTransitionEndEvent() {
+ return {
+ bindType: transition.end,
+ delegateType: transition.end,
+ handle: function handle(event) {
+ if ($$$1(event.target).is(this)) {
+ return event.handleObj.handler.apply(this, arguments); // eslint-disable-line prefer-rest-params
+ }
+
+ return undefined; // eslint-disable-line no-undefined
+ }
+ };
+ }
+
+ function transitionEndTest() {
+ if (typeof window !== 'undefined' && window.QUnit) {
+ return false;
+ }
+
+ return {
+ end: 'transitionend'
+ };
+ }
+
+ function transitionEndEmulator(duration) {
+ var _this = this;
+
+ var called = false;
+ $$$1(this).one(Util.TRANSITION_END, function () {
+ called = true;
+ });
+ setTimeout(function () {
+ if (!called) {
+ Util.triggerTransitionEnd(_this);
+ }
+ }, duration);
+ return this;
+ }
+
+ function setTransitionEndSupport() {
+ transition = transitionEndTest();
+ $$$1.fn.emulateTransitionEnd = transitionEndEmulator;
+
+ if (Util.supportsTransitionEnd()) {
+ $$$1.event.special[Util.TRANSITION_END] = getSpecialTransitionEndEvent();
+ }
+ }
+
+ function escapeId(selector) {
+ // We escape IDs in case of special selectors (selector = '#myId:something')
+ // $.escapeSelector does not exist in jQuery < 3
+ selector = typeof $$$1.escapeSelector === 'function' ? $$$1.escapeSelector(selector).substr(1) : selector.replace(/(:|\.|\[|\]|,|=|@)/g, '\\$1');
+ return selector;
+ }
+ /**
+ * --------------------------------------------------------------------------
+ * Public Util Api
+ * --------------------------------------------------------------------------
+ */
+
+
+ var Util = {
+ TRANSITION_END: 'bsTransitionEnd',
+ getUID: function getUID(prefix) {
+ do {
+ // eslint-disable-next-line no-bitwise
+ prefix += ~~(Math.random() * MAX_UID); // "~~" acts like a faster Math.floor() here
+ } while (document.getElementById(prefix));
+
+ return prefix;
+ },
+ getSelectorFromElement: function getSelectorFromElement(element) {
+ var selector = element.getAttribute('data-target');
+
+ if (!selector || selector === '#') {
+ selector = element.getAttribute('href') || '';
+ } // If it's an ID
+
+
+ if (selector.charAt(0) === '#') {
+ selector = escapeId(selector);
+ }
+
+ try {
+ var $selector = $$$1(document).find(selector);
+ return $selector.length > 0 ? selector : null;
+ } catch (err) {
+ return null;
+ }
+ },
+ reflow: function reflow(element) {
+ return element.offsetHeight;
+ },
+ triggerTransitionEnd: function triggerTransitionEnd(element) {
+ $$$1(element).trigger(transition.end);
+ },
+ supportsTransitionEnd: function supportsTransitionEnd() {
+ return Boolean(transition);
+ },
+ isElement: function isElement(obj) {
+ return (obj[0] || obj).nodeType;
+ },
+ typeCheckConfig: function typeCheckConfig(componentName, config, configTypes) {
+ for (var property in configTypes) {
+ if (Object.prototype.hasOwnProperty.call(configTypes, property)) {
+ var expectedTypes = configTypes[property];
+ var value = config[property];
+ var valueType = value && Util.isElement(value) ? 'element' : toType(value);
+
+ if (!new RegExp(expectedTypes).test(valueType)) {
+ throw new Error(componentName.toUpperCase() + ": " + ("Option \"" + property + "\" provided type \"" + valueType + "\" ") + ("but expected type \"" + expectedTypes + "\"."));
+ }
+ }
+ }
+ }
+ };
+ setTransitionEndSupport();
+ return Util;
+}($);
+
+/**
+ * --------------------------------------------------------------------------
+ * Bootstrap (v4.0.0): alert.js
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * --------------------------------------------------------------------------
+ */
+
+var Alert = function ($$$1) {
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+ var NAME = 'alert';
+ var VERSION = '4.0.0';
+ var DATA_KEY = 'bs.alert';
+ var EVENT_KEY = "." + DATA_KEY;
+ var DATA_API_KEY = '.data-api';
+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
+ var TRANSITION_DURATION = 150;
+ var Selector = {
+ DISMISS: '[data-dismiss="alert"]'
+ };
+ var Event = {
+ CLOSE: "close" + EVENT_KEY,
+ CLOSED: "closed" + EVENT_KEY,
+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
+ };
+ var ClassName = {
+ ALERT: 'alert',
+ FADE: 'fade',
+ SHOW: 'show'
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Alert =
+ /*#__PURE__*/
+ function () {
+ function Alert(element) {
+ this._element = element;
+ } // Getters
+
+
+ var _proto = Alert.prototype;
+
+ // Public
+ _proto.close = function close(element) {
+ element = element || this._element;
+
+ var rootElement = this._getRootElement(element);
+
+ var customEvent = this._triggerCloseEvent(rootElement);
+
+ if (customEvent.isDefaultPrevented()) {
+ return;
+ }
+
+ this._removeElement(rootElement);
+ };
+
+ _proto.dispose = function dispose() {
+ $$$1.removeData(this._element, DATA_KEY);
+ this._element = null;
+ }; // Private
+
+
+ _proto._getRootElement = function _getRootElement(element) {
+ var selector = Util.getSelectorFromElement(element);
+ var parent = false;
+
+ if (selector) {
+ parent = $$$1(selector)[0];
+ }
+
+ if (!parent) {
+ parent = $$$1(element).closest("." + ClassName.ALERT)[0];
+ }
+
+ return parent;
+ };
+
+ _proto._triggerCloseEvent = function _triggerCloseEvent(element) {
+ var closeEvent = $$$1.Event(Event.CLOSE);
+ $$$1(element).trigger(closeEvent);
+ return closeEvent;
+ };
+
+ _proto._removeElement = function _removeElement(element) {
+ var _this = this;
+
+ $$$1(element).removeClass(ClassName.SHOW);
+
+ if (!Util.supportsTransitionEnd() || !$$$1(element).hasClass(ClassName.FADE)) {
+ this._destroyElement(element);
+
+ return;
+ }
+
+ $$$1(element).one(Util.TRANSITION_END, function (event) {
+ return _this._destroyElement(element, event);
+ }).emulateTransitionEnd(TRANSITION_DURATION);
+ };
+
+ _proto._destroyElement = function _destroyElement(element) {
+ $$$1(element).detach().trigger(Event.CLOSED).remove();
+ }; // Static
+
+
+ Alert._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var $element = $$$1(this);
+ var data = $element.data(DATA_KEY);
+
+ if (!data) {
+ data = new Alert(this);
+ $element.data(DATA_KEY, data);
+ }
+
+ if (config === 'close') {
+ data[config](this);
+ }
+ });
+ };
+
+ Alert._handleDismiss = function _handleDismiss(alertInstance) {
+ return function (event) {
+ if (event) {
+ event.preventDefault();
+ }
+
+ alertInstance.close(this);
+ };
+ };
+
+ _createClass(Alert, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION;
+ }
+ }]);
+ return Alert;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * Data Api implementation
+ * ------------------------------------------------------------------------
+ */
+
+
+ $$$1(document).on(Event.CLICK_DATA_API, Selector.DISMISS, Alert._handleDismiss(new Alert()));
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+ $$$1.fn[NAME] = Alert._jQueryInterface;
+ $$$1.fn[NAME].Constructor = Alert;
+
+ $$$1.fn[NAME].noConflict = function () {
+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
+ return Alert._jQueryInterface;
+ };
+
+ return Alert;
+}($);
+
+/**
+ * --------------------------------------------------------------------------
+ * Bootstrap (v4.0.0): button.js
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * --------------------------------------------------------------------------
+ */
+
+var Button = function ($$$1) {
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+ var NAME = 'button';
+ var VERSION = '4.0.0';
+ var DATA_KEY = 'bs.button';
+ var EVENT_KEY = "." + DATA_KEY;
+ var DATA_API_KEY = '.data-api';
+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
+ var ClassName = {
+ ACTIVE: 'active',
+ BUTTON: 'btn',
+ FOCUS: 'focus'
+ };
+ var Selector = {
+ DATA_TOGGLE_CARROT: '[data-toggle^="button"]',
+ DATA_TOGGLE: '[data-toggle="buttons"]',
+ INPUT: 'input',
+ ACTIVE: '.active',
+ BUTTON: '.btn'
+ };
+ var Event = {
+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY,
+ FOCUS_BLUR_DATA_API: "focus" + EVENT_KEY + DATA_API_KEY + " " + ("blur" + EVENT_KEY + DATA_API_KEY)
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Button =
+ /*#__PURE__*/
+ function () {
+ function Button(element) {
+ this._element = element;
+ } // Getters
+
+
+ var _proto = Button.prototype;
+
+ // Public
+ _proto.toggle = function toggle() {
+ var triggerChangeEvent = true;
+ var addAriaPressed = true;
+ var rootElement = $$$1(this._element).closest(Selector.DATA_TOGGLE)[0];
+
+ if (rootElement) {
+ var input = $$$1(this._element).find(Selector.INPUT)[0];
+
+ if (input) {
+ if (input.type === 'radio') {
+ if (input.checked && $$$1(this._element).hasClass(ClassName.ACTIVE)) {
+ triggerChangeEvent = false;
+ } else {
+ var activeElement = $$$1(rootElement).find(Selector.ACTIVE)[0];
+
+ if (activeElement) {
+ $$$1(activeElement).removeClass(ClassName.ACTIVE);
+ }
+ }
+ }
+
+ if (triggerChangeEvent) {
+ if (input.hasAttribute('disabled') || rootElement.hasAttribute('disabled') || input.classList.contains('disabled') || rootElement.classList.contains('disabled')) {
+ return;
+ }
+
+ input.checked = !$$$1(this._element).hasClass(ClassName.ACTIVE);
+ $$$1(input).trigger('change');
+ }
+
+ input.focus();
+ addAriaPressed = false;
+ }
+ }
+
+ if (addAriaPressed) {
+ this._element.setAttribute('aria-pressed', !$$$1(this._element).hasClass(ClassName.ACTIVE));
+ }
+
+ if (triggerChangeEvent) {
+ $$$1(this._element).toggleClass(ClassName.ACTIVE);
+ }
+ };
+
+ _proto.dispose = function dispose() {
+ $$$1.removeData(this._element, DATA_KEY);
+ this._element = null;
+ }; // Static
+
+
+ Button._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var data = $$$1(this).data(DATA_KEY);
+
+ if (!data) {
+ data = new Button(this);
+ $$$1(this).data(DATA_KEY, data);
+ }
+
+ if (config === 'toggle') {
+ data[config]();
+ }
+ });
+ };
+
+ _createClass(Button, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION;
+ }
+ }]);
+ return Button;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * Data Api implementation
+ * ------------------------------------------------------------------------
+ */
+
+
+ $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE_CARROT, function (event) {
+ event.preventDefault();
+ var button = event.target;
+
+ if (!$$$1(button).hasClass(ClassName.BUTTON)) {
+ button = $$$1(button).closest(Selector.BUTTON);
+ }
+
+ Button._jQueryInterface.call($$$1(button), 'toggle');
+ }).on(Event.FOCUS_BLUR_DATA_API, Selector.DATA_TOGGLE_CARROT, function (event) {
+ var button = $$$1(event.target).closest(Selector.BUTTON)[0];
+ $$$1(button).toggleClass(ClassName.FOCUS, /^focus(in)?$/.test(event.type));
+ });
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+ $$$1.fn[NAME] = Button._jQueryInterface;
+ $$$1.fn[NAME].Constructor = Button;
+
+ $$$1.fn[NAME].noConflict = function () {
+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
+ return Button._jQueryInterface;
+ };
+
+ return Button;
+}($);
+
+/**
+ * --------------------------------------------------------------------------
+ * Bootstrap (v4.0.0): carousel.js
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * --------------------------------------------------------------------------
+ */
+
+var Carousel = function ($$$1) {
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+ var NAME = 'carousel';
+ var VERSION = '4.0.0';
+ var DATA_KEY = 'bs.carousel';
+ var EVENT_KEY = "." + DATA_KEY;
+ var DATA_API_KEY = '.data-api';
+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
+ var TRANSITION_DURATION = 600;
+ var ARROW_LEFT_KEYCODE = 37; // KeyboardEvent.which value for left arrow key
+
+ var ARROW_RIGHT_KEYCODE = 39; // KeyboardEvent.which value for right arrow key
+
+ var TOUCHEVENT_COMPAT_WAIT = 500; // Time for mouse compat events to fire after touch
+
+ var Default = {
+ interval: 5000,
+ keyboard: true,
+ slide: false,
+ pause: 'hover',
+ wrap: true
+ };
+ var DefaultType = {
+ interval: '(number|boolean)',
+ keyboard: 'boolean',
+ slide: '(boolean|string)',
+ pause: '(string|boolean)',
+ wrap: 'boolean'
+ };
+ var Direction = {
+ NEXT: 'next',
+ PREV: 'prev',
+ LEFT: 'left',
+ RIGHT: 'right'
+ };
+ var Event = {
+ SLIDE: "slide" + EVENT_KEY,
+ SLID: "slid" + EVENT_KEY,
+ KEYDOWN: "keydown" + EVENT_KEY,
+ MOUSEENTER: "mouseenter" + EVENT_KEY,
+ MOUSELEAVE: "mouseleave" + EVENT_KEY,
+ TOUCHEND: "touchend" + EVENT_KEY,
+ LOAD_DATA_API: "load" + EVENT_KEY + DATA_API_KEY,
+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
+ };
+ var ClassName = {
+ CAROUSEL: 'carousel',
+ ACTIVE: 'active',
+ SLIDE: 'slide',
+ RIGHT: 'carousel-item-right',
+ LEFT: 'carousel-item-left',
+ NEXT: 'carousel-item-next',
+ PREV: 'carousel-item-prev',
+ ITEM: 'carousel-item'
+ };
+ var Selector = {
+ ACTIVE: '.active',
+ ACTIVE_ITEM: '.active.carousel-item',
+ ITEM: '.carousel-item',
+ NEXT_PREV: '.carousel-item-next, .carousel-item-prev',
+ INDICATORS: '.carousel-indicators',
+ DATA_SLIDE: '[data-slide], [data-slide-to]',
+ DATA_RIDE: '[data-ride="carousel"]'
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Carousel =
+ /*#__PURE__*/
+ function () {
+ function Carousel(element, config) {
+ this._items = null;
+ this._interval = null;
+ this._activeElement = null;
+ this._isPaused = false;
+ this._isSliding = false;
+ this.touchTimeout = null;
+ this._config = this._getConfig(config);
+ this._element = $$$1(element)[0];
+ this._indicatorsElement = $$$1(this._element).find(Selector.INDICATORS)[0];
+
+ this._addEventListeners();
+ } // Getters
+
+
+ var _proto = Carousel.prototype;
+
+ // Public
+ _proto.next = function next() {
+ if (!this._isSliding) {
+ this._slide(Direction.NEXT);
+ }
+ };
+
+ _proto.nextWhenVisible = function nextWhenVisible() {
+ // Don't call next when the page isn't visible
+ // or the carousel or its parent isn't visible
+ if (!document.hidden && $$$1(this._element).is(':visible') && $$$1(this._element).css('visibility') !== 'hidden') {
+ this.next();
+ }
+ };
+
+ _proto.prev = function prev() {
+ if (!this._isSliding) {
+ this._slide(Direction.PREV);
+ }
+ };
+
+ _proto.pause = function pause(event) {
+ if (!event) {
+ this._isPaused = true;
+ }
+
+ if ($$$1(this._element).find(Selector.NEXT_PREV)[0] && Util.supportsTransitionEnd()) {
+ Util.triggerTransitionEnd(this._element);
+ this.cycle(true);
+ }
+
+ clearInterval(this._interval);
+ this._interval = null;
+ };
+
+ _proto.cycle = function cycle(event) {
+ if (!event) {
+ this._isPaused = false;
+ }
+
+ if (this._interval) {
+ clearInterval(this._interval);
+ this._interval = null;
+ }
+
+ if (this._config.interval && !this._isPaused) {
+ this._interval = setInterval((document.visibilityState ? this.nextWhenVisible : this.next).bind(this), this._config.interval);
+ }
+ };
+
+ _proto.to = function to(index) {
+ var _this = this;
+
+ this._activeElement = $$$1(this._element).find(Selector.ACTIVE_ITEM)[0];
+
+ var activeIndex = this._getItemIndex(this._activeElement);
+
+ if (index > this._items.length - 1 || index < 0) {
+ return;
+ }
+
+ if (this._isSliding) {
+ $$$1(this._element).one(Event.SLID, function () {
+ return _this.to(index);
+ });
+ return;
+ }
+
+ if (activeIndex === index) {
+ this.pause();
+ this.cycle();
+ return;
+ }
+
+ var direction = index > activeIndex ? Direction.NEXT : Direction.PREV;
+
+ this._slide(direction, this._items[index]);
+ };
+
+ _proto.dispose = function dispose() {
+ $$$1(this._element).off(EVENT_KEY);
+ $$$1.removeData(this._element, DATA_KEY);
+ this._items = null;
+ this._config = null;
+ this._element = null;
+ this._interval = null;
+ this._isPaused = null;
+ this._isSliding = null;
+ this._activeElement = null;
+ this._indicatorsElement = null;
+ }; // Private
+
+
+ _proto._getConfig = function _getConfig(config) {
+ config = _extends({}, Default, config);
+ Util.typeCheckConfig(NAME, config, DefaultType);
+ return config;
+ };
+
+ _proto._addEventListeners = function _addEventListeners() {
+ var _this2 = this;
+
+ if (this._config.keyboard) {
+ $$$1(this._element).on(Event.KEYDOWN, function (event) {
+ return _this2._keydown(event);
+ });
+ }
+
+ if (this._config.pause === 'hover') {
+ $$$1(this._element).on(Event.MOUSEENTER, function (event) {
+ return _this2.pause(event);
+ }).on(Event.MOUSELEAVE, function (event) {
+ return _this2.cycle(event);
+ });
+
+ if ('ontouchstart' in document.documentElement) {
+ // If it's a touch-enabled device, mouseenter/leave are fired as
+ // part of the mouse compatibility events on first tap - the carousel
+ // would stop cycling until user tapped out of it;
+ // here, we listen for touchend, explicitly pause the carousel
+ // (as if it's the second time we tap on it, mouseenter compat event
+ // is NOT fired) and after a timeout (to allow for mouse compatibility
+ // events to fire) we explicitly restart cycling
+ $$$1(this._element).on(Event.TOUCHEND, function () {
+ _this2.pause();
+
+ if (_this2.touchTimeout) {
+ clearTimeout(_this2.touchTimeout);
+ }
+
+ _this2.touchTimeout = setTimeout(function (event) {
+ return _this2.cycle(event);
+ }, TOUCHEVENT_COMPAT_WAIT + _this2._config.interval);
+ });
+ }
+ }
+ };
+
+ _proto._keydown = function _keydown(event) {
+ if (/input|textarea/i.test(event.target.tagName)) {
+ return;
+ }
+
+ switch (event.which) {
+ case ARROW_LEFT_KEYCODE:
+ event.preventDefault();
+ this.prev();
+ break;
+
+ case ARROW_RIGHT_KEYCODE:
+ event.preventDefault();
+ this.next();
+ break;
+
+ default:
+ }
+ };
+
+ _proto._getItemIndex = function _getItemIndex(element) {
+ this._items = $$$1.makeArray($$$1(element).parent().find(Selector.ITEM));
+ return this._items.indexOf(element);
+ };
+
+ _proto._getItemByDirection = function _getItemByDirection(direction, activeElement) {
+ var isNextDirection = direction === Direction.NEXT;
+ var isPrevDirection = direction === Direction.PREV;
+
+ var activeIndex = this._getItemIndex(activeElement);
+
+ var lastItemIndex = this._items.length - 1;
+ var isGoingToWrap = isPrevDirection && activeIndex === 0 || isNextDirection && activeIndex === lastItemIndex;
+
+ if (isGoingToWrap && !this._config.wrap) {
+ return activeElement;
+ }
+
+ var delta = direction === Direction.PREV ? -1 : 1;
+ var itemIndex = (activeIndex + delta) % this._items.length;
+ return itemIndex === -1 ? this._items[this._items.length - 1] : this._items[itemIndex];
+ };
+
+ _proto._triggerSlideEvent = function _triggerSlideEvent(relatedTarget, eventDirectionName) {
+ var targetIndex = this._getItemIndex(relatedTarget);
+
+ var fromIndex = this._getItemIndex($$$1(this._element).find(Selector.ACTIVE_ITEM)[0]);
+
+ var slideEvent = $$$1.Event(Event.SLIDE, {
+ relatedTarget: relatedTarget,
+ direction: eventDirectionName,
+ from: fromIndex,
+ to: targetIndex
+ });
+ $$$1(this._element).trigger(slideEvent);
+ return slideEvent;
+ };
+
+ _proto._setActiveIndicatorElement = function _setActiveIndicatorElement(element) {
+ if (this._indicatorsElement) {
+ $$$1(this._indicatorsElement).find(Selector.ACTIVE).removeClass(ClassName.ACTIVE);
+
+ var nextIndicator = this._indicatorsElement.children[this._getItemIndex(element)];
+
+ if (nextIndicator) {
+ $$$1(nextIndicator).addClass(ClassName.ACTIVE);
+ }
+ }
+ };
+
+ _proto._slide = function _slide(direction, element) {
+ var _this3 = this;
+
+ var activeElement = $$$1(this._element).find(Selector.ACTIVE_ITEM)[0];
+
+ var activeElementIndex = this._getItemIndex(activeElement);
+
+ var nextElement = element || activeElement && this._getItemByDirection(direction, activeElement);
+
+ var nextElementIndex = this._getItemIndex(nextElement);
+
+ var isCycling = Boolean(this._interval);
+ var directionalClassName;
+ var orderClassName;
+ var eventDirectionName;
+
+ if (direction === Direction.NEXT) {
+ directionalClassName = ClassName.LEFT;
+ orderClassName = ClassName.NEXT;
+ eventDirectionName = Direction.LEFT;
+ } else {
+ directionalClassName = ClassName.RIGHT;
+ orderClassName = ClassName.PREV;
+ eventDirectionName = Direction.RIGHT;
+ }
+
+ if (nextElement && $$$1(nextElement).hasClass(ClassName.ACTIVE)) {
+ this._isSliding = false;
+ return;
+ }
+
+ var slideEvent = this._triggerSlideEvent(nextElement, eventDirectionName);
+
+ if (slideEvent.isDefaultPrevented()) {
+ return;
+ }
+
+ if (!activeElement || !nextElement) {
+ // Some weirdness is happening, so we bail
+ return;
+ }
+
+ this._isSliding = true;
+
+ if (isCycling) {
+ this.pause();
+ }
+
+ this._setActiveIndicatorElement(nextElement);
+
+ var slidEvent = $$$1.Event(Event.SLID, {
+ relatedTarget: nextElement,
+ direction: eventDirectionName,
+ from: activeElementIndex,
+ to: nextElementIndex
+ });
+
+ if (Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.SLIDE)) {
+ $$$1(nextElement).addClass(orderClassName);
+ Util.reflow(nextElement);
+ $$$1(activeElement).addClass(directionalClassName);
+ $$$1(nextElement).addClass(directionalClassName);
+ $$$1(activeElement).one(Util.TRANSITION_END, function () {
+ $$$1(nextElement).removeClass(directionalClassName + " " + orderClassName).addClass(ClassName.ACTIVE);
+ $$$1(activeElement).removeClass(ClassName.ACTIVE + " " + orderClassName + " " + directionalClassName);
+ _this3._isSliding = false;
+ setTimeout(function () {
+ return $$$1(_this3._element).trigger(slidEvent);
+ }, 0);
+ }).emulateTransitionEnd(TRANSITION_DURATION);
+ } else {
+ $$$1(activeElement).removeClass(ClassName.ACTIVE);
+ $$$1(nextElement).addClass(ClassName.ACTIVE);
+ this._isSliding = false;
+ $$$1(this._element).trigger(slidEvent);
+ }
+
+ if (isCycling) {
+ this.cycle();
+ }
+ }; // Static
+
+
+ Carousel._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var data = $$$1(this).data(DATA_KEY);
+
+ var _config = _extends({}, Default, $$$1(this).data());
+
+ if (typeof config === 'object') {
+ _config = _extends({}, _config, config);
+ }
+
+ var action = typeof config === 'string' ? config : _config.slide;
+
+ if (!data) {
+ data = new Carousel(this, _config);
+ $$$1(this).data(DATA_KEY, data);
+ }
+
+ if (typeof config === 'number') {
+ data.to(config);
+ } else if (typeof action === 'string') {
+ if (typeof data[action] === 'undefined') {
+ throw new TypeError("No method named \"" + action + "\"");
+ }
+
+ data[action]();
+ } else if (_config.interval) {
+ data.pause();
+ data.cycle();
+ }
+ });
+ };
+
+ Carousel._dataApiClickHandler = function _dataApiClickHandler(event) {
+ var selector = Util.getSelectorFromElement(this);
+
+ if (!selector) {
+ return;
+ }
+
+ var target = $$$1(selector)[0];
+
+ if (!target || !$$$1(target).hasClass(ClassName.CAROUSEL)) {
+ return;
+ }
+
+ var config = _extends({}, $$$1(target).data(), $$$1(this).data());
+ var slideIndex = this.getAttribute('data-slide-to');
+
+ if (slideIndex) {
+ config.interval = false;
+ }
+
+ Carousel._jQueryInterface.call($$$1(target), config);
+
+ if (slideIndex) {
+ $$$1(target).data(DATA_KEY).to(slideIndex);
+ }
+
+ event.preventDefault();
+ };
+
+ _createClass(Carousel, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION;
+ }
+ }, {
+ key: "Default",
+ get: function get() {
+ return Default;
+ }
+ }]);
+ return Carousel;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * Data Api implementation
+ * ------------------------------------------------------------------------
+ */
+
+
+ $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_SLIDE, Carousel._dataApiClickHandler);
+ $$$1(window).on(Event.LOAD_DATA_API, function () {
+ $$$1(Selector.DATA_RIDE).each(function () {
+ var $carousel = $$$1(this);
+
+ Carousel._jQueryInterface.call($carousel, $carousel.data());
+ });
+ });
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+ $$$1.fn[NAME] = Carousel._jQueryInterface;
+ $$$1.fn[NAME].Constructor = Carousel;
+
+ $$$1.fn[NAME].noConflict = function () {
+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
+ return Carousel._jQueryInterface;
+ };
+
+ return Carousel;
+}($);
+
+/**
+ * --------------------------------------------------------------------------
+ * Bootstrap (v4.0.0): collapse.js
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * --------------------------------------------------------------------------
+ */
+
+var Collapse = function ($$$1) {
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+ var NAME = 'collapse';
+ var VERSION = '4.0.0';
+ var DATA_KEY = 'bs.collapse';
+ var EVENT_KEY = "." + DATA_KEY;
+ var DATA_API_KEY = '.data-api';
+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
+ var TRANSITION_DURATION = 600;
+ var Default = {
+ toggle: true,
+ parent: ''
+ };
+ var DefaultType = {
+ toggle: 'boolean',
+ parent: '(string|element)'
+ };
+ var Event = {
+ SHOW: "show" + EVENT_KEY,
+ SHOWN: "shown" + EVENT_KEY,
+ HIDE: "hide" + EVENT_KEY,
+ HIDDEN: "hidden" + EVENT_KEY,
+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
+ };
+ var ClassName = {
+ SHOW: 'show',
+ COLLAPSE: 'collapse',
+ COLLAPSING: 'collapsing',
+ COLLAPSED: 'collapsed'
+ };
+ var Dimension = {
+ WIDTH: 'width',
+ HEIGHT: 'height'
+ };
+ var Selector = {
+ ACTIVES: '.show, .collapsing',
+ DATA_TOGGLE: '[data-toggle="collapse"]'
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Collapse =
+ /*#__PURE__*/
+ function () {
+ function Collapse(element, config) {
+ this._isTransitioning = false;
+ this._element = element;
+ this._config = this._getConfig(config);
+ this._triggerArray = $$$1.makeArray($$$1("[data-toggle=\"collapse\"][href=\"#" + element.id + "\"]," + ("[data-toggle=\"collapse\"][data-target=\"#" + element.id + "\"]")));
+ var tabToggles = $$$1(Selector.DATA_TOGGLE);
+
+ for (var i = 0; i < tabToggles.length; i++) {
+ var elem = tabToggles[i];
+ var selector = Util.getSelectorFromElement(elem);
+
+ if (selector !== null && $$$1(selector).filter(element).length > 0) {
+ this._selector = selector;
+
+ this._triggerArray.push(elem);
+ }
+ }
+
+ this._parent = this._config.parent ? this._getParent() : null;
+
+ if (!this._config.parent) {
+ this._addAriaAndCollapsedClass(this._element, this._triggerArray);
+ }
+
+ if (this._config.toggle) {
+ this.toggle();
+ }
+ } // Getters
+
+
+ var _proto = Collapse.prototype;
+
+ // Public
+ _proto.toggle = function toggle() {
+ if ($$$1(this._element).hasClass(ClassName.SHOW)) {
+ this.hide();
+ } else {
+ this.show();
+ }
+ };
+
+ _proto.show = function show() {
+ var _this = this;
+
+ if (this._isTransitioning || $$$1(this._element).hasClass(ClassName.SHOW)) {
+ return;
+ }
+
+ var actives;
+ var activesData;
+
+ if (this._parent) {
+ actives = $$$1.makeArray($$$1(this._parent).find(Selector.ACTIVES).filter("[data-parent=\"" + this._config.parent + "\"]"));
+
+ if (actives.length === 0) {
+ actives = null;
+ }
+ }
+
+ if (actives) {
+ activesData = $$$1(actives).not(this._selector).data(DATA_KEY);
+
+ if (activesData && activesData._isTransitioning) {
+ return;
+ }
+ }
+
+ var startEvent = $$$1.Event(Event.SHOW);
+ $$$1(this._element).trigger(startEvent);
+
+ if (startEvent.isDefaultPrevented()) {
+ return;
+ }
+
+ if (actives) {
+ Collapse._jQueryInterface.call($$$1(actives).not(this._selector), 'hide');
+
+ if (!activesData) {
+ $$$1(actives).data(DATA_KEY, null);
+ }
+ }
+
+ var dimension = this._getDimension();
+
+ $$$1(this._element).removeClass(ClassName.COLLAPSE).addClass(ClassName.COLLAPSING);
+ this._element.style[dimension] = 0;
+
+ if (this._triggerArray.length > 0) {
+ $$$1(this._triggerArray).removeClass(ClassName.COLLAPSED).attr('aria-expanded', true);
+ }
+
+ this.setTransitioning(true);
+
+ var complete = function complete() {
+ $$$1(_this._element).removeClass(ClassName.COLLAPSING).addClass(ClassName.COLLAPSE).addClass(ClassName.SHOW);
+ _this._element.style[dimension] = '';
+
+ _this.setTransitioning(false);
+
+ $$$1(_this._element).trigger(Event.SHOWN);
+ };
+
+ if (!Util.supportsTransitionEnd()) {
+ complete();
+ return;
+ }
+
+ var capitalizedDimension = dimension[0].toUpperCase() + dimension.slice(1);
+ var scrollSize = "scroll" + capitalizedDimension;
+ $$$1(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(TRANSITION_DURATION);
+ this._element.style[dimension] = this._element[scrollSize] + "px";
+ };
+
+ _proto.hide = function hide() {
+ var _this2 = this;
+
+ if (this._isTransitioning || !$$$1(this._element).hasClass(ClassName.SHOW)) {
+ return;
+ }
+
+ var startEvent = $$$1.Event(Event.HIDE);
+ $$$1(this._element).trigger(startEvent);
+
+ if (startEvent.isDefaultPrevented()) {
+ return;
+ }
+
+ var dimension = this._getDimension();
+
+ this._element.style[dimension] = this._element.getBoundingClientRect()[dimension] + "px";
+ Util.reflow(this._element);
+ $$$1(this._element).addClass(ClassName.COLLAPSING).removeClass(ClassName.COLLAPSE).removeClass(ClassName.SHOW);
+
+ if (this._triggerArray.length > 0) {
+ for (var i = 0; i < this._triggerArray.length; i++) {
+ var trigger = this._triggerArray[i];
+ var selector = Util.getSelectorFromElement(trigger);
+
+ if (selector !== null) {
+ var $elem = $$$1(selector);
+
+ if (!$elem.hasClass(ClassName.SHOW)) {
+ $$$1(trigger).addClass(ClassName.COLLAPSED).attr('aria-expanded', false);
+ }
+ }
+ }
+ }
+
+ this.setTransitioning(true);
+
+ var complete = function complete() {
+ _this2.setTransitioning(false);
+
+ $$$1(_this2._element).removeClass(ClassName.COLLAPSING).addClass(ClassName.COLLAPSE).trigger(Event.HIDDEN);
+ };
+
+ this._element.style[dimension] = '';
+
+ if (!Util.supportsTransitionEnd()) {
+ complete();
+ return;
+ }
+
+ $$$1(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(TRANSITION_DURATION);
+ };
+
+ _proto.setTransitioning = function setTransitioning(isTransitioning) {
+ this._isTransitioning = isTransitioning;
+ };
+
+ _proto.dispose = function dispose() {
+ $$$1.removeData(this._element, DATA_KEY);
+ this._config = null;
+ this._parent = null;
+ this._element = null;
+ this._triggerArray = null;
+ this._isTransitioning = null;
+ }; // Private
+
+
+ _proto._getConfig = function _getConfig(config) {
+ config = _extends({}, Default, config);
+ config.toggle = Boolean(config.toggle); // Coerce string values
+
+ Util.typeCheckConfig(NAME, config, DefaultType);
+ return config;
+ };
+
+ _proto._getDimension = function _getDimension() {
+ var hasWidth = $$$1(this._element).hasClass(Dimension.WIDTH);
+ return hasWidth ? Dimension.WIDTH : Dimension.HEIGHT;
+ };
+
+ _proto._getParent = function _getParent() {
+ var _this3 = this;
+
+ var parent = null;
+
+ if (Util.isElement(this._config.parent)) {
+ parent = this._config.parent; // It's a jQuery object
+
+ if (typeof this._config.parent.jquery !== 'undefined') {
+ parent = this._config.parent[0];
+ }
+ } else {
+ parent = $$$1(this._config.parent)[0];
+ }
+
+ var selector = "[data-toggle=\"collapse\"][data-parent=\"" + this._config.parent + "\"]";
+ $$$1(parent).find(selector).each(function (i, element) {
+ _this3._addAriaAndCollapsedClass(Collapse._getTargetFromElement(element), [element]);
+ });
+ return parent;
+ };
+
+ _proto._addAriaAndCollapsedClass = function _addAriaAndCollapsedClass(element, triggerArray) {
+ if (element) {
+ var isOpen = $$$1(element).hasClass(ClassName.SHOW);
+
+ if (triggerArray.length > 0) {
+ $$$1(triggerArray).toggleClass(ClassName.COLLAPSED, !isOpen).attr('aria-expanded', isOpen);
+ }
+ }
+ }; // Static
+
+
+ Collapse._getTargetFromElement = function _getTargetFromElement(element) {
+ var selector = Util.getSelectorFromElement(element);
+ return selector ? $$$1(selector)[0] : null;
+ };
+
+ Collapse._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var $this = $$$1(this);
+ var data = $this.data(DATA_KEY);
+
+ var _config = _extends({}, Default, $this.data(), typeof config === 'object' && config);
+
+ if (!data && _config.toggle && /show|hide/.test(config)) {
+ _config.toggle = false;
+ }
+
+ if (!data) {
+ data = new Collapse(this, _config);
+ $this.data(DATA_KEY, data);
+ }
+
+ if (typeof config === 'string') {
+ if (typeof data[config] === 'undefined') {
+ throw new TypeError("No method named \"" + config + "\"");
+ }
+
+ data[config]();
+ }
+ });
+ };
+
+ _createClass(Collapse, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION;
+ }
+ }, {
+ key: "Default",
+ get: function get() {
+ return Default;
+ }
+ }]);
+ return Collapse;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * Data Api implementation
+ * ------------------------------------------------------------------------
+ */
+
+
+ $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) {
+ // preventDefault only for <a> elements (which change the URL) not inside the collapsible element
+ if (event.currentTarget.tagName === 'A') {
+ event.preventDefault();
+ }
+
+ var $trigger = $$$1(this);
+ var selector = Util.getSelectorFromElement(this);
+ $$$1(selector).each(function () {
+ var $target = $$$1(this);
+ var data = $target.data(DATA_KEY);
+ var config = data ? 'toggle' : $trigger.data();
+
+ Collapse._jQueryInterface.call($target, config);
+ });
+ });
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+ $$$1.fn[NAME] = Collapse._jQueryInterface;
+ $$$1.fn[NAME].Constructor = Collapse;
+
+ $$$1.fn[NAME].noConflict = function () {
+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
+ return Collapse._jQueryInterface;
+ };
+
+ return Collapse;
+}($);
+
+/**!
+ * @fileOverview Kickass library to create and place poppers near their reference elements.
+ * @version 1.12.9
+ * @license
+ * Copyright (c) 2016 Federico Zivolo and contributors
+ *
+ * Permission is hereby granted, free of charge, to any person obtaining a copy
+ * of this software and associated documentation files (the "Software"), to deal
+ * in the Software without restriction, including without limitation the rights
+ * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+ * copies of the Software, and to permit persons to whom the Software is
+ * furnished to do so, subject to the following conditions:
+ *
+ * The above copyright notice and this permission notice shall be included in all
+ * copies or substantial portions of the Software.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+ * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+ * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+ * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+ * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+ * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+ * SOFTWARE.
+ */
+var isBrowser = typeof window !== 'undefined' && typeof document !== 'undefined';
+var longerTimeoutBrowsers = ['Edge', 'Trident', 'Firefox'];
+var timeoutDuration = 0;
+for (var i = 0; i < longerTimeoutBrowsers.length; i += 1) {
+ if (isBrowser && navigator.userAgent.indexOf(longerTimeoutBrowsers[i]) >= 0) {
+ timeoutDuration = 1;
+ break;
+ }
+}
+
+function microtaskDebounce(fn) {
+ var called = false;
+ return function () {
+ if (called) {
+ return;
+ }
+ called = true;
+ window.Promise.resolve().then(function () {
+ called = false;
+ fn();
+ });
+ };
+}
+
+function taskDebounce(fn) {
+ var scheduled = false;
+ return function () {
+ if (!scheduled) {
+ scheduled = true;
+ setTimeout(function () {
+ scheduled = false;
+ fn();
+ }, timeoutDuration);
+ }
+ };
+}
+
+var supportsMicroTasks = isBrowser && window.Promise;
+
+/**
+* Create a debounced version of a method, that's asynchronously deferred
+* but called in the minimum time possible.
+*
+* @method
+* @memberof Popper.Utils
+* @argument {Function} fn
+* @returns {Function}
+*/
+var debounce = supportsMicroTasks ? microtaskDebounce : taskDebounce;
+
+/**
+ * Check if the given variable is a function
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Any} functionToCheck - variable to check
+ * @returns {Boolean} answer to: is a function?
+ */
+function isFunction(functionToCheck) {
+ var getType = {};
+ return functionToCheck && getType.toString.call(functionToCheck) === '[object Function]';
+}
+
+/**
+ * Get CSS computed property of the given element
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Eement} element
+ * @argument {String} property
+ */
+function getStyleComputedProperty(element, property) {
+ if (element.nodeType !== 1) {
+ return [];
+ }
+ // NOTE: 1 DOM access here
+ var css = getComputedStyle(element, null);
+ return property ? css[property] : css;
+}
+
+/**
+ * Returns the parentNode or the host of the element
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Element} element
+ * @returns {Element} parent
+ */
+function getParentNode(element) {
+ if (element.nodeName === 'HTML') {
+ return element;
+ }
+ return element.parentNode || element.host;
+}
+
+/**
+ * Returns the scrolling parent of the given element
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Element} element
+ * @returns {Element} scroll parent
+ */
+function getScrollParent(element) {
+ // Return body, `getScroll` will take care to get the correct `scrollTop` from it
+ if (!element) {
+ return document.body;
+ }
+
+ switch (element.nodeName) {
+ case 'HTML':
+ case 'BODY':
+ return element.ownerDocument.body;
+ case '#document':
+ return element.body;
+ }
+
+ // Firefox want us to check `-x` and `-y` variations as well
+
+ var _getStyleComputedProp = getStyleComputedProperty(element),
+ overflow = _getStyleComputedProp.overflow,
+ overflowX = _getStyleComputedProp.overflowX,
+ overflowY = _getStyleComputedProp.overflowY;
+
+ if (/(auto|scroll)/.test(overflow + overflowY + overflowX)) {
+ return element;
+ }
+
+ return getScrollParent(getParentNode(element));
+}
+
+/**
+ * Returns the offset parent of the given element
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Element} element
+ * @returns {Element} offset parent
+ */
+function getOffsetParent(element) {
+ // NOTE: 1 DOM access here
+ var offsetParent = element && element.offsetParent;
+ var nodeName = offsetParent && offsetParent.nodeName;
+
+ if (!nodeName || nodeName === 'BODY' || nodeName === 'HTML') {
+ if (element) {
+ return element.ownerDocument.documentElement;
+ }
+
+ return document.documentElement;
+ }
+
+ // .offsetParent will return the closest TD or TABLE in case
+ // no offsetParent is present, I hate this job...
+ if (['TD', 'TABLE'].indexOf(offsetParent.nodeName) !== -1 && getStyleComputedProperty(offsetParent, 'position') === 'static') {
+ return getOffsetParent(offsetParent);
+ }
+
+ return offsetParent;
+}
+
+function isOffsetContainer(element) {
+ var nodeName = element.nodeName;
+
+ if (nodeName === 'BODY') {
+ return false;
+ }
+ return nodeName === 'HTML' || getOffsetParent(element.firstElementChild) === element;
+}
+
+/**
+ * Finds the root node (document, shadowDOM root) of the given element
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Element} node
+ * @returns {Element} root node
+ */
+function getRoot(node) {
+ if (node.parentNode !== null) {
+ return getRoot(node.parentNode);
+ }
+
+ return node;
+}
+
+/**
+ * Finds the offset parent common to the two provided nodes
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Element} element1
+ * @argument {Element} element2
+ * @returns {Element} common offset parent
+ */
+function findCommonOffsetParent(element1, element2) {
+ // This check is needed to avoid errors in case one of the elements isn't defined for any reason
+ if (!element1 || !element1.nodeType || !element2 || !element2.nodeType) {
+ return document.documentElement;
+ }
+
+ // Here we make sure to give as "start" the element that comes first in the DOM
+ var order = element1.compareDocumentPosition(element2) & Node.DOCUMENT_POSITION_FOLLOWING;
+ var start = order ? element1 : element2;
+ var end = order ? element2 : element1;
+
+ // Get common ancestor container
+ var range = document.createRange();
+ range.setStart(start, 0);
+ range.setEnd(end, 0);
+ var commonAncestorContainer = range.commonAncestorContainer;
+
+ // Both nodes are inside #document
+
+ if (element1 !== commonAncestorContainer && element2 !== commonAncestorContainer || start.contains(end)) {
+ if (isOffsetContainer(commonAncestorContainer)) {
+ return commonAncestorContainer;
+ }
+
+ return getOffsetParent(commonAncestorContainer);
+ }
+
+ // one of the nodes is inside shadowDOM, find which one
+ var element1root = getRoot(element1);
+ if (element1root.host) {
+ return findCommonOffsetParent(element1root.host, element2);
+ } else {
+ return findCommonOffsetParent(element1, getRoot(element2).host);
+ }
+}
+
+/**
+ * Gets the scroll value of the given element in the given side (top and left)
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Element} element
+ * @argument {String} side `top` or `left`
+ * @returns {number} amount of scrolled pixels
+ */
+function getScroll(element) {
+ var side = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'top';
+
+ var upperSide = side === 'top' ? 'scrollTop' : 'scrollLeft';
+ var nodeName = element.nodeName;
+
+ if (nodeName === 'BODY' || nodeName === 'HTML') {
+ var html = element.ownerDocument.documentElement;
+ var scrollingElement = element.ownerDocument.scrollingElement || html;
+ return scrollingElement[upperSide];
+ }
+
+ return element[upperSide];
+}
+
+/*
+ * Sum or subtract the element scroll values (left and top) from a given rect object
+ * @method
+ * @memberof Popper.Utils
+ * @param {Object} rect - Rect object you want to change
+ * @param {HTMLElement} element - The element from the function reads the scroll values
+ * @param {Boolean} subtract - set to true if you want to subtract the scroll values
+ * @return {Object} rect - The modifier rect object
+ */
+function includeScroll(rect, element) {
+ var subtract = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false;
+
+ var scrollTop = getScroll(element, 'top');
+ var scrollLeft = getScroll(element, 'left');
+ var modifier = subtract ? -1 : 1;
+ rect.top += scrollTop * modifier;
+ rect.bottom += scrollTop * modifier;
+ rect.left += scrollLeft * modifier;
+ rect.right += scrollLeft * modifier;
+ return rect;
+}
+
+/*
+ * Helper to detect borders of a given element
+ * @method
+ * @memberof Popper.Utils
+ * @param {CSSStyleDeclaration} styles
+ * Result of `getStyleComputedProperty` on the given element
+ * @param {String} axis - `x` or `y`
+ * @return {number} borders - The borders size of the given axis
+ */
+
+function getBordersSize(styles, axis) {
+ var sideA = axis === 'x' ? 'Left' : 'Top';
+ var sideB = sideA === 'Left' ? 'Right' : 'Bottom';
+
+ return parseFloat(styles['border' + sideA + 'Width'], 10) + parseFloat(styles['border' + sideB + 'Width'], 10);
+}
+
+/**
+ * Tells if you are running Internet Explorer 10
+ * @method
+ * @memberof Popper.Utils
+ * @returns {Boolean} isIE10
+ */
+var isIE10 = undefined;
+
+var isIE10$1 = function () {
+ if (isIE10 === undefined) {
+ isIE10 = navigator.appVersion.indexOf('MSIE 10') !== -1;
+ }
+ return isIE10;
+};
+
+function getSize(axis, body, html, computedStyle) {
+ return Math.max(body['offset' + axis], body['scroll' + axis], html['client' + axis], html['offset' + axis], html['scroll' + axis], isIE10$1() ? html['offset' + axis] + computedStyle['margin' + (axis === 'Height' ? 'Top' : 'Left')] + computedStyle['margin' + (axis === 'Height' ? 'Bottom' : 'Right')] : 0);
+}
+
+function getWindowSizes() {
+ var body = document.body;
+ var html = document.documentElement;
+ var computedStyle = isIE10$1() && getComputedStyle(html);
+
+ return {
+ height: getSize('Height', body, html, computedStyle),
+ width: getSize('Width', body, html, computedStyle)
+ };
+}
+
+var classCallCheck = function (instance, Constructor) {
+ if (!(instance instanceof Constructor)) {
+ throw new TypeError("Cannot call a class as a function");
+ }
+};
+
+var createClass = function () {
+ function defineProperties(target, props) {
+ for (var i = 0; i < props.length; i++) {
+ var descriptor = props[i];
+ descriptor.enumerable = descriptor.enumerable || false;
+ descriptor.configurable = true;
+ if ("value" in descriptor) descriptor.writable = true;
+ Object.defineProperty(target, descriptor.key, descriptor);
+ }
+ }
+
+ return function (Constructor, protoProps, staticProps) {
+ if (protoProps) defineProperties(Constructor.prototype, protoProps);
+ if (staticProps) defineProperties(Constructor, staticProps);
+ return Constructor;
+ };
+}();
+
+
+
+
+
+var defineProperty = function (obj, key, value) {
+ if (key in obj) {
+ Object.defineProperty(obj, key, {
+ value: value,
+ enumerable: true,
+ configurable: true,
+ writable: true
+ });
+ } else {
+ obj[key] = value;
+ }
+
+ return obj;
+};
+
+var _extends$1 = Object.assign || function (target) {
+ for (var i = 1; i < arguments.length; i++) {
+ var source = arguments[i];
+
+ for (var key in source) {
+ if (Object.prototype.hasOwnProperty.call(source, key)) {
+ target[key] = source[key];
+ }
+ }
+ }
+
+ return target;
+};
+
+/**
+ * Given element offsets, generate an output similar to getBoundingClientRect
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Object} offsets
+ * @returns {Object} ClientRect like output
+ */
+function getClientRect(offsets) {
+ return _extends$1({}, offsets, {
+ right: offsets.left + offsets.width,
+ bottom: offsets.top + offsets.height
+ });
+}
+
+/**
+ * Get bounding client rect of given element
+ * @method
+ * @memberof Popper.Utils
+ * @param {HTMLElement} element
+ * @return {Object} client rect
+ */
+function getBoundingClientRect(element) {
+ var rect = {};
+
+ // IE10 10 FIX: Please, don't ask, the element isn't
+ // considered in DOM in some circumstances...
+ // This isn't reproducible in IE10 compatibility mode of IE11
+ if (isIE10$1()) {
+ try {
+ rect = element.getBoundingClientRect();
+ var scrollTop = getScroll(element, 'top');
+ var scrollLeft = getScroll(element, 'left');
+ rect.top += scrollTop;
+ rect.left += scrollLeft;
+ rect.bottom += scrollTop;
+ rect.right += scrollLeft;
+ } catch (err) {}
+ } else {
+ rect = element.getBoundingClientRect();
+ }
+
+ var result = {
+ left: rect.left,
+ top: rect.top,
+ width: rect.right - rect.left,
+ height: rect.bottom - rect.top
+ };
+
+ // subtract scrollbar size from sizes
+ var sizes = element.nodeName === 'HTML' ? getWindowSizes() : {};
+ var width = sizes.width || element.clientWidth || result.right - result.left;
+ var height = sizes.height || element.clientHeight || result.bottom - result.top;
+
+ var horizScrollbar = element.offsetWidth - width;
+ var vertScrollbar = element.offsetHeight - height;
+
+ // if an hypothetical scrollbar is detected, we must be sure it's not a `border`
+ // we make this check conditional for performance reasons
+ if (horizScrollbar || vertScrollbar) {
+ var styles = getStyleComputedProperty(element);
+ horizScrollbar -= getBordersSize(styles, 'x');
+ vertScrollbar -= getBordersSize(styles, 'y');
+
+ result.width -= horizScrollbar;
+ result.height -= vertScrollbar;
+ }
+
+ return getClientRect(result);
+}
+
+function getOffsetRectRelativeToArbitraryNode(children, parent) {
+ var isIE10 = isIE10$1();
+ var isHTML = parent.nodeName === 'HTML';
+ var childrenRect = getBoundingClientRect(children);
+ var parentRect = getBoundingClientRect(parent);
+ var scrollParent = getScrollParent(children);
+
+ var styles = getStyleComputedProperty(parent);
+ var borderTopWidth = parseFloat(styles.borderTopWidth, 10);
+ var borderLeftWidth = parseFloat(styles.borderLeftWidth, 10);
+
+ var offsets = getClientRect({
+ top: childrenRect.top - parentRect.top - borderTopWidth,
+ left: childrenRect.left - parentRect.left - borderLeftWidth,
+ width: childrenRect.width,
+ height: childrenRect.height
+ });
+ offsets.marginTop = 0;
+ offsets.marginLeft = 0;
+
+ // Subtract margins of documentElement in case it's being used as parent
+ // we do this only on HTML because it's the only element that behaves
+ // differently when margins are applied to it. The margins are included in
+ // the box of the documentElement, in the other cases not.
+ if (!isIE10 && isHTML) {
+ var marginTop = parseFloat(styles.marginTop, 10);
+ var marginLeft = parseFloat(styles.marginLeft, 10);
+
+ offsets.top -= borderTopWidth - marginTop;
+ offsets.bottom -= borderTopWidth - marginTop;
+ offsets.left -= borderLeftWidth - marginLeft;
+ offsets.right -= borderLeftWidth - marginLeft;
+
+ // Attach marginTop and marginLeft because in some circumstances we may need them
+ offsets.marginTop = marginTop;
+ offsets.marginLeft = marginLeft;
+ }
+
+ if (isIE10 ? parent.contains(scrollParent) : parent === scrollParent && scrollParent.nodeName !== 'BODY') {
+ offsets = includeScroll(offsets, parent);
+ }
+
+ return offsets;
+}
+
+function getViewportOffsetRectRelativeToArtbitraryNode(element) {
+ var html = element.ownerDocument.documentElement;
+ var relativeOffset = getOffsetRectRelativeToArbitraryNode(element, html);
+ var width = Math.max(html.clientWidth, window.innerWidth || 0);
+ var height = Math.max(html.clientHeight, window.innerHeight || 0);
+
+ var scrollTop = getScroll(html);
+ var scrollLeft = getScroll(html, 'left');
+
+ var offset = {
+ top: scrollTop - relativeOffset.top + relativeOffset.marginTop,
+ left: scrollLeft - relativeOffset.left + relativeOffset.marginLeft,
+ width: width,
+ height: height
+ };
+
+ return getClientRect(offset);
+}
+
+/**
+ * Check if the given element is fixed or is inside a fixed parent
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Element} element
+ * @argument {Element} customContainer
+ * @returns {Boolean} answer to "isFixed?"
+ */
+function isFixed(element) {
+ var nodeName = element.nodeName;
+ if (nodeName === 'BODY' || nodeName === 'HTML') {
+ return false;
+ }
+ if (getStyleComputedProperty(element, 'position') === 'fixed') {
+ return true;
+ }
+ return isFixed(getParentNode(element));
+}
+
+/**
+ * Computed the boundaries limits and return them
+ * @method
+ * @memberof Popper.Utils
+ * @param {HTMLElement} popper
+ * @param {HTMLElement} reference
+ * @param {number} padding
+ * @param {HTMLElement} boundariesElement - Element used to define the boundaries
+ * @returns {Object} Coordinates of the boundaries
+ */
+function getBoundaries(popper, reference, padding, boundariesElement) {
+ // NOTE: 1 DOM access here
+ var boundaries = { top: 0, left: 0 };
+ var offsetParent = findCommonOffsetParent(popper, reference);
+
+ // Handle viewport case
+ if (boundariesElement === 'viewport') {
+ boundaries = getViewportOffsetRectRelativeToArtbitraryNode(offsetParent);
+ } else {
+ // Handle other cases based on DOM element used as boundaries
+ var boundariesNode = void 0;
+ if (boundariesElement === 'scrollParent') {
+ boundariesNode = getScrollParent(getParentNode(reference));
+ if (boundariesNode.nodeName === 'BODY') {
+ boundariesNode = popper.ownerDocument.documentElement;
+ }
+ } else if (boundariesElement === 'window') {
+ boundariesNode = popper.ownerDocument.documentElement;
+ } else {
+ boundariesNode = boundariesElement;
+ }
+
+ var offsets = getOffsetRectRelativeToArbitraryNode(boundariesNode, offsetParent);
+
+ // In case of HTML, we need a different computation
+ if (boundariesNode.nodeName === 'HTML' && !isFixed(offsetParent)) {
+ var _getWindowSizes = getWindowSizes(),
+ height = _getWindowSizes.height,
+ width = _getWindowSizes.width;
+
+ boundaries.top += offsets.top - offsets.marginTop;
+ boundaries.bottom = height + offsets.top;
+ boundaries.left += offsets.left - offsets.marginLeft;
+ boundaries.right = width + offsets.left;
+ } else {
+ // for all the other DOM elements, this one is good
+ boundaries = offsets;
+ }
+ }
+
+ // Add paddings
+ boundaries.left += padding;
+ boundaries.top += padding;
+ boundaries.right -= padding;
+ boundaries.bottom -= padding;
+
+ return boundaries;
+}
+
+function getArea(_ref) {
+ var width = _ref.width,
+ height = _ref.height;
+
+ return width * height;
+}
+
+/**
+ * Utility used to transform the `auto` placement to the placement with more
+ * available space.
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Object} data - The data object generated by update method
+ * @argument {Object} options - Modifiers configuration and options
+ * @returns {Object} The data object, properly modified
+ */
+function computeAutoPlacement(placement, refRect, popper, reference, boundariesElement) {
+ var padding = arguments.length > 5 && arguments[5] !== undefined ? arguments[5] : 0;
+
+ if (placement.indexOf('auto') === -1) {
+ return placement;
+ }
+
+ var boundaries = getBoundaries(popper, reference, padding, boundariesElement);
+
+ var rects = {
+ top: {
+ width: boundaries.width,
+ height: refRect.top - boundaries.top
+ },
+ right: {
+ width: boundaries.right - refRect.right,
+ height: boundaries.height
+ },
+ bottom: {
+ width: boundaries.width,
+ height: boundaries.bottom - refRect.bottom
+ },
+ left: {
+ width: refRect.left - boundaries.left,
+ height: boundaries.height
+ }
+ };
+
+ var sortedAreas = Object.keys(rects).map(function (key) {
+ return _extends$1({
+ key: key
+ }, rects[key], {
+ area: getArea(rects[key])
+ });
+ }).sort(function (a, b) {
+ return b.area - a.area;
+ });
+
+ var filteredAreas = sortedAreas.filter(function (_ref2) {
+ var width = _ref2.width,
+ height = _ref2.height;
+ return width >= popper.clientWidth && height >= popper.clientHeight;
+ });
+
+ var computedPlacement = filteredAreas.length > 0 ? filteredAreas[0].key : sortedAreas[0].key;
+
+ var variation = placement.split('-')[1];
+
+ return computedPlacement + (variation ? '-' + variation : '');
+}
+
+/**
+ * Get offsets to the reference element
+ * @method
+ * @memberof Popper.Utils
+ * @param {Object} state
+ * @param {Element} popper - the popper element
+ * @param {Element} reference - the reference element (the popper will be relative to this)
+ * @returns {Object} An object containing the offsets which will be applied to the popper
+ */
+function getReferenceOffsets(state, popper, reference) {
+ var commonOffsetParent = findCommonOffsetParent(popper, reference);
+ return getOffsetRectRelativeToArbitraryNode(reference, commonOffsetParent);
+}
+
+/**
+ * Get the outer sizes of the given element (offset size + margins)
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Element} element
+ * @returns {Object} object containing width and height properties
+ */
+function getOuterSizes(element) {
+ var styles = getComputedStyle(element);
+ var x = parseFloat(styles.marginTop) + parseFloat(styles.marginBottom);
+ var y = parseFloat(styles.marginLeft) + parseFloat(styles.marginRight);
+ var result = {
+ width: element.offsetWidth + y,
+ height: element.offsetHeight + x
+ };
+ return result;
+}
+
+/**
+ * Get the opposite placement of the given one
+ * @method
+ * @memberof Popper.Utils
+ * @argument {String} placement
+ * @returns {String} flipped placement
+ */
+function getOppositePlacement(placement) {
+ var hash = { left: 'right', right: 'left', bottom: 'top', top: 'bottom' };
+ return placement.replace(/left|right|bottom|top/g, function (matched) {
+ return hash[matched];
+ });
+}
+
+/**
+ * Get offsets to the popper
+ * @method
+ * @memberof Popper.Utils
+ * @param {Object} position - CSS position the Popper will get applied
+ * @param {HTMLElement} popper - the popper element
+ * @param {Object} referenceOffsets - the reference offsets (the popper will be relative to this)
+ * @param {String} placement - one of the valid placement options
+ * @returns {Object} popperOffsets - An object containing the offsets which will be applied to the popper
+ */
+function getPopperOffsets(popper, referenceOffsets, placement) {
+ placement = placement.split('-')[0];
+
+ // Get popper node sizes
+ var popperRect = getOuterSizes(popper);
+
+ // Add position, width and height to our offsets object
+ var popperOffsets = {
+ width: popperRect.width,
+ height: popperRect.height
+ };
+
+ // depending by the popper placement we have to compute its offsets slightly differently
+ var isHoriz = ['right', 'left'].indexOf(placement) !== -1;
+ var mainSide = isHoriz ? 'top' : 'left';
+ var secondarySide = isHoriz ? 'left' : 'top';
+ var measurement = isHoriz ? 'height' : 'width';
+ var secondaryMeasurement = !isHoriz ? 'height' : 'width';
+
+ popperOffsets[mainSide] = referenceOffsets[mainSide] + referenceOffsets[measurement] / 2 - popperRect[measurement] / 2;
+ if (placement === secondarySide) {
+ popperOffsets[secondarySide] = referenceOffsets[secondarySide] - popperRect[secondaryMeasurement];
+ } else {
+ popperOffsets[secondarySide] = referenceOffsets[getOppositePlacement(secondarySide)];
+ }
+
+ return popperOffsets;
+}
+
+/**
+ * Mimics the `find` method of Array
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Array} arr
+ * @argument prop
+ * @argument value
+ * @returns index or -1
+ */
+function find(arr, check) {
+ // use native find if supported
+ if (Array.prototype.find) {
+ return arr.find(check);
+ }
+
+ // use `filter` to obtain the same behavior of `find`
+ return arr.filter(check)[0];
+}
+
+/**
+ * Return the index of the matching object
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Array} arr
+ * @argument prop
+ * @argument value
+ * @returns index or -1
+ */
+function findIndex(arr, prop, value) {
+ // use native findIndex if supported
+ if (Array.prototype.findIndex) {
+ return arr.findIndex(function (cur) {
+ return cur[prop] === value;
+ });
+ }
+
+ // use `find` + `indexOf` if `findIndex` isn't supported
+ var match = find(arr, function (obj) {
+ return obj[prop] === value;
+ });
+ return arr.indexOf(match);
+}
+
+/**
+ * Loop trough the list of modifiers and run them in order,
+ * each of them will then edit the data object.
+ * @method
+ * @memberof Popper.Utils
+ * @param {dataObject} data
+ * @param {Array} modifiers
+ * @param {String} ends - Optional modifier name used as stopper
+ * @returns {dataObject}
+ */
+function runModifiers(modifiers, data, ends) {
+ var modifiersToRun = ends === undefined ? modifiers : modifiers.slice(0, findIndex(modifiers, 'name', ends));
+
+ modifiersToRun.forEach(function (modifier) {
+ if (modifier['function']) {
+ // eslint-disable-line dot-notation
+ console.warn('`modifier.function` is deprecated, use `modifier.fn`!');
+ }
+ var fn = modifier['function'] || modifier.fn; // eslint-disable-line dot-notation
+ if (modifier.enabled && isFunction(fn)) {
+ // Add properties to offsets to make them a complete clientRect object
+ // we do this before each modifier to make sure the previous one doesn't
+ // mess with these values
+ data.offsets.popper = getClientRect(data.offsets.popper);
+ data.offsets.reference = getClientRect(data.offsets.reference);
+
+ data = fn(data, modifier);
+ }
+ });
+
+ return data;
+}
+
+/**
+ * Updates the position of the popper, computing the new offsets and applying
+ * the new style.<br />
+ * Prefer `scheduleUpdate` over `update` because of performance reasons.
+ * @method
+ * @memberof Popper
+ */
+function update() {
+ // if popper is destroyed, don't perform any further update
+ if (this.state.isDestroyed) {
+ return;
+ }
+
+ var data = {
+ instance: this,
+ styles: {},
+ arrowStyles: {},
+ attributes: {},
+ flipped: false,
+ offsets: {}
+ };
+
+ // compute reference element offsets
+ data.offsets.reference = getReferenceOffsets(this.state, this.popper, this.reference);
+
+ // compute auto placement, store placement inside the data object,
+ // modifiers will be able to edit `placement` if needed
+ // and refer to originalPlacement to know the original value
+ data.placement = computeAutoPlacement(this.options.placement, data.offsets.reference, this.popper, this.reference, this.options.modifiers.flip.boundariesElement, this.options.modifiers.flip.padding);
+
+ // store the computed placement inside `originalPlacement`
+ data.originalPlacement = data.placement;
+
+ // compute the popper offsets
+ data.offsets.popper = getPopperOffsets(this.popper, data.offsets.reference, data.placement);
+ data.offsets.popper.position = 'absolute';
+
+ // run the modifiers
+ data = runModifiers(this.modifiers, data);
+
+ // the first `update` will call `onCreate` callback
+ // the other ones will call `onUpdate` callback
+ if (!this.state.isCreated) {
+ this.state.isCreated = true;
+ this.options.onCreate(data);
+ } else {
+ this.options.onUpdate(data);
+ }
+}
+
+/**
+ * Helper used to know if the given modifier is enabled.
+ * @method
+ * @memberof Popper.Utils
+ * @returns {Boolean}
+ */
+function isModifierEnabled(modifiers, modifierName) {
+ return modifiers.some(function (_ref) {
+ var name = _ref.name,
+ enabled = _ref.enabled;
+ return enabled && name === modifierName;
+ });
+}
+
+/**
+ * Get the prefixed supported property name
+ * @method
+ * @memberof Popper.Utils
+ * @argument {String} property (camelCase)
+ * @returns {String} prefixed property (camelCase or PascalCase, depending on the vendor prefix)
+ */
+function getSupportedPropertyName(property) {
+ var prefixes = [false, 'ms', 'Webkit', 'Moz', 'O'];
+ var upperProp = property.charAt(0).toUpperCase() + property.slice(1);
+
+ for (var i = 0; i < prefixes.length - 1; i++) {
+ var prefix = prefixes[i];
+ var toCheck = prefix ? '' + prefix + upperProp : property;
+ if (typeof document.body.style[toCheck] !== 'undefined') {
+ return toCheck;
+ }
+ }
+ return null;
+}
+
+/**
+ * Destroy the popper
+ * @method
+ * @memberof Popper
+ */
+function destroy() {
+ this.state.isDestroyed = true;
+
+ // touch DOM only if `applyStyle` modifier is enabled
+ if (isModifierEnabled(this.modifiers, 'applyStyle')) {
+ this.popper.removeAttribute('x-placement');
+ this.popper.style.left = '';
+ this.popper.style.position = '';
+ this.popper.style.top = '';
+ this.popper.style[getSupportedPropertyName('transform')] = '';
+ }
+
+ this.disableEventListeners();
+
+ // remove the popper if user explicity asked for the deletion on destroy
+ // do not use `remove` because IE11 doesn't support it
+ if (this.options.removeOnDestroy) {
+ this.popper.parentNode.removeChild(this.popper);
+ }
+ return this;
+}
+
+/**
+ * Get the window associated with the element
+ * @argument {Element} element
+ * @returns {Window}
+ */
+function getWindow(element) {
+ var ownerDocument = element.ownerDocument;
+ return ownerDocument ? ownerDocument.defaultView : window;
+}
+
+function attachToScrollParents(scrollParent, event, callback, scrollParents) {
+ var isBody = scrollParent.nodeName === 'BODY';
+ var target = isBody ? scrollParent.ownerDocument.defaultView : scrollParent;
+ target.addEventListener(event, callback, { passive: true });
+
+ if (!isBody) {
+ attachToScrollParents(getScrollParent(target.parentNode), event, callback, scrollParents);
+ }
+ scrollParents.push(target);
+}
+
+/**
+ * Setup needed event listeners used to update the popper position
+ * @method
+ * @memberof Popper.Utils
+ * @private
+ */
+function setupEventListeners(reference, options, state, updateBound) {
+ // Resize event listener on window
+ state.updateBound = updateBound;
+ getWindow(reference).addEventListener('resize', state.updateBound, { passive: true });
+
+ // Scroll event listener on scroll parents
+ var scrollElement = getScrollParent(reference);
+ attachToScrollParents(scrollElement, 'scroll', state.updateBound, state.scrollParents);
+ state.scrollElement = scrollElement;
+ state.eventsEnabled = true;
+
+ return state;
+}
+
+/**
+ * It will add resize/scroll events and start recalculating
+ * position of the popper element when they are triggered.
+ * @method
+ * @memberof Popper
+ */
+function enableEventListeners() {
+ if (!this.state.eventsEnabled) {
+ this.state = setupEventListeners(this.reference, this.options, this.state, this.scheduleUpdate);
+ }
+}
+
+/**
+ * Remove event listeners used to update the popper position
+ * @method
+ * @memberof Popper.Utils
+ * @private
+ */
+function removeEventListeners(reference, state) {
+ // Remove resize event listener on window
+ getWindow(reference).removeEventListener('resize', state.updateBound);
+
+ // Remove scroll event listener on scroll parents
+ state.scrollParents.forEach(function (target) {
+ target.removeEventListener('scroll', state.updateBound);
+ });
+
+ // Reset state
+ state.updateBound = null;
+ state.scrollParents = [];
+ state.scrollElement = null;
+ state.eventsEnabled = false;
+ return state;
+}
+
+/**
+ * It will remove resize/scroll events and won't recalculate popper position
+ * when they are triggered. It also won't trigger onUpdate callback anymore,
+ * unless you call `update` method manually.
+ * @method
+ * @memberof Popper
+ */
+function disableEventListeners() {
+ if (this.state.eventsEnabled) {
+ cancelAnimationFrame(this.scheduleUpdate);
+ this.state = removeEventListeners(this.reference, this.state);
+ }
+}
+
+/**
+ * Tells if a given input is a number
+ * @method
+ * @memberof Popper.Utils
+ * @param {*} input to check
+ * @return {Boolean}
+ */
+function isNumeric(n) {
+ return n !== '' && !isNaN(parseFloat(n)) && isFinite(n);
+}
+
+/**
+ * Set the style to the given popper
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Element} element - Element to apply the style to
+ * @argument {Object} styles
+ * Object with a list of properties and values which will be applied to the element
+ */
+function setStyles(element, styles) {
+ Object.keys(styles).forEach(function (prop) {
+ var unit = '';
+ // add unit if the value is numeric and is one of the following
+ if (['width', 'height', 'top', 'right', 'bottom', 'left'].indexOf(prop) !== -1 && isNumeric(styles[prop])) {
+ unit = 'px';
+ }
+ element.style[prop] = styles[prop] + unit;
+ });
+}
+
+/**
+ * Set the attributes to the given popper
+ * @method
+ * @memberof Popper.Utils
+ * @argument {Element} element - Element to apply the attributes to
+ * @argument {Object} styles
+ * Object with a list of properties and values which will be applied to the element
+ */
+function setAttributes(element, attributes) {
+ Object.keys(attributes).forEach(function (prop) {
+ var value = attributes[prop];
+ if (value !== false) {
+ element.setAttribute(prop, attributes[prop]);
+ } else {
+ element.removeAttribute(prop);
+ }
+ });
+}
+
+/**
+ * @function
+ * @memberof Modifiers
+ * @argument {Object} data - The data object generated by `update` method
+ * @argument {Object} data.styles - List of style properties - values to apply to popper element
+ * @argument {Object} data.attributes - List of attribute properties - values to apply to popper element
+ * @argument {Object} options - Modifiers configuration and options
+ * @returns {Object} The same data object
+ */
+function applyStyle(data) {
+ // any property present in `data.styles` will be applied to the popper,
+ // in this way we can make the 3rd party modifiers add custom styles to it
+ // Be aware, modifiers could override the properties defined in the previous
+ // lines of this modifier!
+ setStyles(data.instance.popper, data.styles);
+
+ // any property present in `data.attributes` will be applied to the popper,
+ // they will be set as HTML attributes of the element
+ setAttributes(data.instance.popper, data.attributes);
+
+ // if arrowElement is defined and arrowStyles has some properties
+ if (data.arrowElement && Object.keys(data.arrowStyles).length) {
+ setStyles(data.arrowElement, data.arrowStyles);
+ }
+
+ return data;
+}
+
+/**
+ * Set the x-placement attribute before everything else because it could be used
+ * to add margins to the popper margins needs to be calculated to get the
+ * correct popper offsets.
+ * @method
+ * @memberof Popper.modifiers
+ * @param {HTMLElement} reference - The reference element used to position the popper
+ * @param {HTMLElement} popper - The HTML element used as popper.
+ * @param {Object} options - Popper.js options
+ */
+function applyStyleOnLoad(reference, popper, options, modifierOptions, state) {
+ // compute reference element offsets
+ var referenceOffsets = getReferenceOffsets(state, popper, reference);
+
+ // compute auto placement, store placement inside the data object,
+ // modifiers will be able to edit `placement` if needed
+ // and refer to originalPlacement to know the original value
+ var placement = computeAutoPlacement(options.placement, referenceOffsets, popper, reference, options.modifiers.flip.boundariesElement, options.modifiers.flip.padding);
+
+ popper.setAttribute('x-placement', placement);
+
+ // Apply `position` to popper before anything else because
+ // without the position applied we can't guarantee correct computations
+ setStyles(popper, { position: 'absolute' });
+
+ return options;
+}
+
+/**
+ * @function
+ * @memberof Modifiers
+ * @argument {Object} data - The data object generated by `update` method
+ * @argument {Object} options - Modifiers configuration and options
+ * @returns {Object} The data object, properly modified
+ */
+function computeStyle(data, options) {
+ var x = options.x,
+ y = options.y;
+ var popper = data.offsets.popper;
+
+ // Remove this legacy support in Popper.js v2
+
+ var legacyGpuAccelerationOption = find(data.instance.modifiers, function (modifier) {
+ return modifier.name === 'applyStyle';
+ }).gpuAcceleration;
+ if (legacyGpuAccelerationOption !== undefined) {
+ console.warn('WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!');
+ }
+ var gpuAcceleration = legacyGpuAccelerationOption !== undefined ? legacyGpuAccelerationOption : options.gpuAcceleration;
+
+ var offsetParent = getOffsetParent(data.instance.popper);
+ var offsetParentRect = getBoundingClientRect(offsetParent);
+
+ // Styles
+ var styles = {
+ position: popper.position
+ };
+
+ // floor sides to avoid blurry text
+ var offsets = {
+ left: Math.floor(popper.left),
+ top: Math.floor(popper.top),
+ bottom: Math.floor(popper.bottom),
+ right: Math.floor(popper.right)
+ };
+
+ var sideA = x === 'bottom' ? 'top' : 'bottom';
+ var sideB = y === 'right' ? 'left' : 'right';
+
+ // if gpuAcceleration is set to `true` and transform is supported,
+ // we use `translate3d` to apply the position to the popper we
+ // automatically use the supported prefixed version if needed
+ var prefixedProperty = getSupportedPropertyName('transform');
+
+ // now, let's make a step back and look at this code closely (wtf?)
+ // If the content of the popper grows once it's been positioned, it
+ // may happen that the popper gets misplaced because of the new content
+ // overflowing its reference element
+ // To avoid this problem, we provide two options (x and y), which allow
+ // the consumer to define the offset origin.
+ // If we position a popper on top of a reference element, we can set
+ // `x` to `top` to make the popper grow towards its top instead of
+ // its bottom.
+ var left = void 0,
+ top = void 0;
+ if (sideA === 'bottom') {
+ top = -offsetParentRect.height + offsets.bottom;
+ } else {
+ top = offsets.top;
+ }
+ if (sideB === 'right') {
+ left = -offsetParentRect.width + offsets.right;
+ } else {
+ left = offsets.left;
+ }
+ if (gpuAcceleration && prefixedProperty) {
+ styles[prefixedProperty] = 'translate3d(' + left + 'px, ' + top + 'px, 0)';
+ styles[sideA] = 0;
+ styles[sideB] = 0;
+ styles.willChange = 'transform';
+ } else {
+ // othwerise, we use the standard `top`, `left`, `bottom` and `right` properties
+ var invertTop = sideA === 'bottom' ? -1 : 1;
+ var invertLeft = sideB === 'right' ? -1 : 1;
+ styles[sideA] = top * invertTop;
+ styles[sideB] = left * invertLeft;
+ styles.willChange = sideA + ', ' + sideB;
+ }
+
+ // Attributes
+ var attributes = {
+ 'x-placement': data.placement
+ };
+
+ // Update `data` attributes, styles and arrowStyles
+ data.attributes = _extends$1({}, attributes, data.attributes);
+ data.styles = _extends$1({}, styles, data.styles);
+ data.arrowStyles = _extends$1({}, data.offsets.arrow, data.arrowStyles);
+
+ return data;
+}
+
+/**
+ * Helper used to know if the given modifier depends from another one.<br />
+ * It checks if the needed modifier is listed and enabled.
+ * @method
+ * @memberof Popper.Utils
+ * @param {Array} modifiers - list of modifiers
+ * @param {String} requestingName - name of requesting modifier
+ * @param {String} requestedName - name of requested modifier
+ * @returns {Boolean}
+ */
+function isModifierRequired(modifiers, requestingName, requestedName) {
+ var requesting = find(modifiers, function (_ref) {
+ var name = _ref.name;
+ return name === requestingName;
+ });
+
+ var isRequired = !!requesting && modifiers.some(function (modifier) {
+ return modifier.name === requestedName && modifier.enabled && modifier.order < requesting.order;
+ });
+
+ if (!isRequired) {
+ var _requesting = '`' + requestingName + '`';
+ var requested = '`' + requestedName + '`';
+ console.warn(requested + ' modifier is required by ' + _requesting + ' modifier in order to work, be sure to include it before ' + _requesting + '!');
+ }
+ return isRequired;
+}
+
+/**
+ * @function
+ * @memberof Modifiers
+ * @argument {Object} data - The data object generated by update method
+ * @argument {Object} options - Modifiers configuration and options
+ * @returns {Object} The data object, properly modified
+ */
+function arrow(data, options) {
+ var _data$offsets$arrow;
+
+ // arrow depends on keepTogether in order to work
+ if (!isModifierRequired(data.instance.modifiers, 'arrow', 'keepTogether')) {
+ return data;
+ }
+
+ var arrowElement = options.element;
+
+ // if arrowElement is a string, suppose it's a CSS selector
+ if (typeof arrowElement === 'string') {
+ arrowElement = data.instance.popper.querySelector(arrowElement);
+
+ // if arrowElement is not found, don't run the modifier
+ if (!arrowElement) {
+ return data;
+ }
+ } else {
+ // if the arrowElement isn't a query selector we must check that the
+ // provided DOM node is child of its popper node
+ if (!data.instance.popper.contains(arrowElement)) {
+ console.warn('WARNING: `arrow.element` must be child of its popper element!');
+ return data;
+ }
+ }
+
+ var placement = data.placement.split('-')[0];
+ var _data$offsets = data.offsets,
+ popper = _data$offsets.popper,
+ reference = _data$offsets.reference;
+
+ var isVertical = ['left', 'right'].indexOf(placement) !== -1;
+
+ var len = isVertical ? 'height' : 'width';
+ var sideCapitalized = isVertical ? 'Top' : 'Left';
+ var side = sideCapitalized.toLowerCase();
+ var altSide = isVertical ? 'left' : 'top';
+ var opSide = isVertical ? 'bottom' : 'right';
+ var arrowElementSize = getOuterSizes(arrowElement)[len];
+
+ //
+ // extends keepTogether behavior making sure the popper and its
+ // reference have enough pixels in conjuction
+ //
+
+ // top/left side
+ if (reference[opSide] - arrowElementSize < popper[side]) {
+ data.offsets.popper[side] -= popper[side] - (reference[opSide] - arrowElementSize);
+ }
+ // bottom/right side
+ if (reference[side] + arrowElementSize > popper[opSide]) {
+ data.offsets.popper[side] += reference[side] + arrowElementSize - popper[opSide];
+ }
+ data.offsets.popper = getClientRect(data.offsets.popper);
+
+ // compute center of the popper
+ var center = reference[side] + reference[len] / 2 - arrowElementSize / 2;
+
+ // Compute the sideValue using the updated popper offsets
+ // take popper margin in account because we don't have this info available
+ var css = getStyleComputedProperty(data.instance.popper);
+ var popperMarginSide = parseFloat(css['margin' + sideCapitalized], 10);
+ var popperBorderSide = parseFloat(css['border' + sideCapitalized + 'Width'], 10);
+ var sideValue = center - data.offsets.popper[side] - popperMarginSide - popperBorderSide;
+
+ // prevent arrowElement from being placed not contiguously to its popper
+ sideValue = Math.max(Math.min(popper[len] - arrowElementSize, sideValue), 0);
+
+ data.arrowElement = arrowElement;
+ data.offsets.arrow = (_data$offsets$arrow = {}, defineProperty(_data$offsets$arrow, side, Math.round(sideValue)), defineProperty(_data$offsets$arrow, altSide, ''), _data$offsets$arrow);
+
+ return data;
+}
+
+/**
+ * Get the opposite placement variation of the given one
+ * @method
+ * @memberof Popper.Utils
+ * @argument {String} placement variation
+ * @returns {String} flipped placement variation
+ */
+function getOppositeVariation(variation) {
+ if (variation === 'end') {
+ return 'start';
+ } else if (variation === 'start') {
+ return 'end';
+ }
+ return variation;
+}
+
+/**
+ * List of accepted placements to use as values of the `placement` option.<br />
+ * Valid placements are:
+ * - `auto`
+ * - `top`
+ * - `right`
+ * - `bottom`
+ * - `left`
+ *
+ * Each placement can have a variation from this list:
+ * - `-start`
+ * - `-end`
+ *
+ * Variations are interpreted easily if you think of them as the left to right
+ * written languages. Horizontally (`top` and `bottom`), `start` is left and `end`
+ * is right.<br />
+ * Vertically (`left` and `right`), `start` is top and `end` is bottom.
+ *
+ * Some valid examples are:
+ * - `top-end` (on top of reference, right aligned)
+ * - `right-start` (on right of reference, top aligned)
+ * - `bottom` (on bottom, centered)
+ * - `auto-right` (on the side with more space available, alignment depends by placement)
+ *
+ * @static
+ * @type {Array}
+ * @enum {String}
+ * @readonly
+ * @method placements
+ * @memberof Popper
+ */
+var placements = ['auto-start', 'auto', 'auto-end', 'top-start', 'top', 'top-end', 'right-start', 'right', 'right-end', 'bottom-end', 'bottom', 'bottom-start', 'left-end', 'left', 'left-start'];
+
+// Get rid of `auto` `auto-start` and `auto-end`
+var validPlacements = placements.slice(3);
+
+/**
+ * Given an initial placement, returns all the subsequent placements
+ * clockwise (or counter-clockwise).
+ *
+ * @method
+ * @memberof Popper.Utils
+ * @argument {String} placement - A valid placement (it accepts variations)
+ * @argument {Boolean} counter - Set to true to walk the placements counterclockwise
+ * @returns {Array} placements including their variations
+ */
+function clockwise(placement) {
+ var counter = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false;
+
+ var index = validPlacements.indexOf(placement);
+ var arr = validPlacements.slice(index + 1).concat(validPlacements.slice(0, index));
+ return counter ? arr.reverse() : arr;
+}
+
+var BEHAVIORS = {
+ FLIP: 'flip',
+ CLOCKWISE: 'clockwise',
+ COUNTERCLOCKWISE: 'counterclockwise'
+};
+
+/**
+ * @function
+ * @memberof Modifiers
+ * @argument {Object} data - The data object generated by update method
+ * @argument {Object} options - Modifiers configuration and options
+ * @returns {Object} The data object, properly modified
+ */
+function flip(data, options) {
+ // if `inner` modifier is enabled, we can't use the `flip` modifier
+ if (isModifierEnabled(data.instance.modifiers, 'inner')) {
+ return data;
+ }
+
+ if (data.flipped && data.placement === data.originalPlacement) {
+ // seems like flip is trying to loop, probably there's not enough space on any of the flippable sides
+ return data;
+ }
+
+ var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options.padding, options.boundariesElement);
+
+ var placement = data.placement.split('-')[0];
+ var placementOpposite = getOppositePlacement(placement);
+ var variation = data.placement.split('-')[1] || '';
+
+ var flipOrder = [];
+
+ switch (options.behavior) {
+ case BEHAVIORS.FLIP:
+ flipOrder = [placement, placementOpposite];
+ break;
+ case BEHAVIORS.CLOCKWISE:
+ flipOrder = clockwise(placement);
+ break;
+ case BEHAVIORS.COUNTERCLOCKWISE:
+ flipOrder = clockwise(placement, true);
+ break;
+ default:
+ flipOrder = options.behavior;
+ }
+
+ flipOrder.forEach(function (step, index) {
+ if (placement !== step || flipOrder.length === index + 1) {
+ return data;
+ }
+
+ placement = data.placement.split('-')[0];
+ placementOpposite = getOppositePlacement(placement);
+
+ var popperOffsets = data.offsets.popper;
+ var refOffsets = data.offsets.reference;
+
+ // using floor because the reference offsets may contain decimals we are not going to consider here
+ var floor = Math.floor;
+ var overlapsRef = placement === 'left' && floor(popperOffsets.right) > floor(refOffsets.left) || placement === 'right' && floor(popperOffsets.left) < floor(refOffsets.right) || placement === 'top' && floor(popperOffsets.bottom) > floor(refOffsets.top) || placement === 'bottom' && floor(popperOffsets.top) < floor(refOffsets.bottom);
+
+ var overflowsLeft = floor(popperOffsets.left) < floor(boundaries.left);
+ var overflowsRight = floor(popperOffsets.right) > floor(boundaries.right);
+ var overflowsTop = floor(popperOffsets.top) < floor(boundaries.top);
+ var overflowsBottom = floor(popperOffsets.bottom) > floor(boundaries.bottom);
+
+ var overflowsBoundaries = placement === 'left' && overflowsLeft || placement === 'right' && overflowsRight || placement === 'top' && overflowsTop || placement === 'bottom' && overflowsBottom;
+
+ // flip the variation if required
+ var isVertical = ['top', 'bottom'].indexOf(placement) !== -1;
+ var flippedVariation = !!options.flipVariations && (isVertical && variation === 'start' && overflowsLeft || isVertical && variation === 'end' && overflowsRight || !isVertical && variation === 'start' && overflowsTop || !isVertical && variation === 'end' && overflowsBottom);
+
+ if (overlapsRef || overflowsBoundaries || flippedVariation) {
+ // this boolean to detect any flip loop
+ data.flipped = true;
+
+ if (overlapsRef || overflowsBoundaries) {
+ placement = flipOrder[index + 1];
+ }
+
+ if (flippedVariation) {
+ variation = getOppositeVariation(variation);
+ }
+
+ data.placement = placement + (variation ? '-' + variation : '');
+
+ // this object contains `position`, we want to preserve it along with
+ // any additional property we may add in the future
+ data.offsets.popper = _extends$1({}, data.offsets.popper, getPopperOffsets(data.instance.popper, data.offsets.reference, data.placement));
+
+ data = runModifiers(data.instance.modifiers, data, 'flip');
+ }
+ });
+ return data;
+}
+
+/**
+ * @function
+ * @memberof Modifiers
+ * @argument {Object} data - The data object generated by update method
+ * @argument {Object} options - Modifiers configuration and options
+ * @returns {Object} The data object, properly modified
+ */
+function keepTogether(data) {
+ var _data$offsets = data.offsets,
+ popper = _data$offsets.popper,
+ reference = _data$offsets.reference;
+
+ var placement = data.placement.split('-')[0];
+ var floor = Math.floor;
+ var isVertical = ['top', 'bottom'].indexOf(placement) !== -1;
+ var side = isVertical ? 'right' : 'bottom';
+ var opSide = isVertical ? 'left' : 'top';
+ var measurement = isVertical ? 'width' : 'height';
+
+ if (popper[side] < floor(reference[opSide])) {
+ data.offsets.popper[opSide] = floor(reference[opSide]) - popper[measurement];
+ }
+ if (popper[opSide] > floor(reference[side])) {
+ data.offsets.popper[opSide] = floor(reference[side]);
+ }
+
+ return data;
+}
+
+/**
+ * Converts a string containing value + unit into a px value number
+ * @function
+ * @memberof {modifiers~offset}
+ * @private
+ * @argument {String} str - Value + unit string
+ * @argument {String} measurement - `height` or `width`
+ * @argument {Object} popperOffsets
+ * @argument {Object} referenceOffsets
+ * @returns {Number|String}
+ * Value in pixels, or original string if no values were extracted
+ */
+function toValue(str, measurement, popperOffsets, referenceOffsets) {
+ // separate value from unit
+ var split = str.match(/((?:\-|\+)?\d*\.?\d*)(.*)/);
+ var value = +split[1];
+ var unit = split[2];
+
+ // If it's not a number it's an operator, I guess
+ if (!value) {
+ return str;
+ }
+
+ if (unit.indexOf('%') === 0) {
+ var element = void 0;
+ switch (unit) {
+ case '%p':
+ element = popperOffsets;
+ break;
+ case '%':
+ case '%r':
+ default:
+ element = referenceOffsets;
+ }
+
+ var rect = getClientRect(element);
+ return rect[measurement] / 100 * value;
+ } else if (unit === 'vh' || unit === 'vw') {
+ // if is a vh or vw, we calculate the size based on the viewport
+ var size = void 0;
+ if (unit === 'vh') {
+ size = Math.max(document.documentElement.clientHeight, window.innerHeight || 0);
+ } else {
+ size = Math.max(document.documentElement.clientWidth, window.innerWidth || 0);
+ }
+ return size / 100 * value;
+ } else {
+ // if is an explicit pixel unit, we get rid of the unit and keep the value
+ // if is an implicit unit, it's px, and we return just the value
+ return value;
+ }
+}
+
+/**
+ * Parse an `offset` string to extrapolate `x` and `y` numeric offsets.
+ * @function
+ * @memberof {modifiers~offset}
+ * @private
+ * @argument {String} offset
+ * @argument {Object} popperOffsets
+ * @argument {Object} referenceOffsets
+ * @argument {String} basePlacement
+ * @returns {Array} a two cells array with x and y offsets in numbers
+ */
+function parseOffset(offset, popperOffsets, referenceOffsets, basePlacement) {
+ var offsets = [0, 0];
+
+ // Use height if placement is left or right and index is 0 otherwise use width
+ // in this way the first offset will use an axis and the second one
+ // will use the other one
+ var useHeight = ['right', 'left'].indexOf(basePlacement) !== -1;
+
+ // Split the offset string to obtain a list of values and operands
+ // The regex addresses values with the plus or minus sign in front (+10, -20, etc)
+ var fragments = offset.split(/(\+|\-)/).map(function (frag) {
+ return frag.trim();
+ });
+
+ // Detect if the offset string contains a pair of values or a single one
+ // they could be separated by comma or space
+ var divider = fragments.indexOf(find(fragments, function (frag) {
+ return frag.search(/,|\s/) !== -1;
+ }));
+
+ if (fragments[divider] && fragments[divider].indexOf(',') === -1) {
+ console.warn('Offsets separated by white space(s) are deprecated, use a comma (,) instead.');
+ }
+
+ // If divider is found, we divide the list of values and operands to divide
+ // them by ofset X and Y.
+ var splitRegex = /\s*,\s*|\s+/;
+ var ops = divider !== -1 ? [fragments.slice(0, divider).concat([fragments[divider].split(splitRegex)[0]]), [fragments[divider].split(splitRegex)[1]].concat(fragments.slice(divider + 1))] : [fragments];
+
+ // Convert the values with units to absolute pixels to allow our computations
+ ops = ops.map(function (op, index) {
+ // Most of the units rely on the orientation of the popper
+ var measurement = (index === 1 ? !useHeight : useHeight) ? 'height' : 'width';
+ var mergeWithPrevious = false;
+ return op
+ // This aggregates any `+` or `-` sign that aren't considered operators
+ // e.g.: 10 + +5 => [10, +, +5]
+ .reduce(function (a, b) {
+ if (a[a.length - 1] === '' && ['+', '-'].indexOf(b) !== -1) {
+ a[a.length - 1] = b;
+ mergeWithPrevious = true;
+ return a;
+ } else if (mergeWithPrevious) {
+ a[a.length - 1] += b;
+ mergeWithPrevious = false;
+ return a;
+ } else {
+ return a.concat(b);
+ }
+ }, [])
+ // Here we convert the string values into number values (in px)
+ .map(function (str) {
+ return toValue(str, measurement, popperOffsets, referenceOffsets);
+ });
+ });
+
+ // Loop trough the offsets arrays and execute the operations
+ ops.forEach(function (op, index) {
+ op.forEach(function (frag, index2) {
+ if (isNumeric(frag)) {
+ offsets[index] += frag * (op[index2 - 1] === '-' ? -1 : 1);
+ }
+ });
+ });
+ return offsets;
+}
+
+/**
+ * @function
+ * @memberof Modifiers
+ * @argument {Object} data - The data object generated by update method
+ * @argument {Object} options - Modifiers configuration and options
+ * @argument {Number|String} options.offset=0
+ * The offset value as described in the modifier description
+ * @returns {Object} The data object, properly modified
+ */
+function offset(data, _ref) {
+ var offset = _ref.offset;
+ var placement = data.placement,
+ _data$offsets = data.offsets,
+ popper = _data$offsets.popper,
+ reference = _data$offsets.reference;
+
+ var basePlacement = placement.split('-')[0];
+
+ var offsets = void 0;
+ if (isNumeric(+offset)) {
+ offsets = [+offset, 0];
+ } else {
+ offsets = parseOffset(offset, popper, reference, basePlacement);
+ }
+
+ if (basePlacement === 'left') {
+ popper.top += offsets[0];
+ popper.left -= offsets[1];
+ } else if (basePlacement === 'right') {
+ popper.top += offsets[0];
+ popper.left += offsets[1];
+ } else if (basePlacement === 'top') {
+ popper.left += offsets[0];
+ popper.top -= offsets[1];
+ } else if (basePlacement === 'bottom') {
+ popper.left += offsets[0];
+ popper.top += offsets[1];
+ }
+
+ data.popper = popper;
+ return data;
+}
+
+/**
+ * @function
+ * @memberof Modifiers
+ * @argument {Object} data - The data object generated by `update` method
+ * @argument {Object} options - Modifiers configuration and options
+ * @returns {Object} The data object, properly modified
+ */
+function preventOverflow(data, options) {
+ var boundariesElement = options.boundariesElement || getOffsetParent(data.instance.popper);
+
+ // If offsetParent is the reference element, we really want to
+ // go one step up and use the next offsetParent as reference to
+ // avoid to make this modifier completely useless and look like broken
+ if (data.instance.reference === boundariesElement) {
+ boundariesElement = getOffsetParent(boundariesElement);
+ }
+
+ var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options.padding, boundariesElement);
+ options.boundaries = boundaries;
+
+ var order = options.priority;
+ var popper = data.offsets.popper;
+
+ var check = {
+ primary: function primary(placement) {
+ var value = popper[placement];
+ if (popper[placement] < boundaries[placement] && !options.escapeWithReference) {
+ value = Math.max(popper[placement], boundaries[placement]);
+ }
+ return defineProperty({}, placement, value);
+ },
+ secondary: function secondary(placement) {
+ var mainSide = placement === 'right' ? 'left' : 'top';
+ var value = popper[mainSide];
+ if (popper[placement] > boundaries[placement] && !options.escapeWithReference) {
+ value = Math.min(popper[mainSide], boundaries[placement] - (placement === 'right' ? popper.width : popper.height));
+ }
+ return defineProperty({}, mainSide, value);
+ }
+ };
+
+ order.forEach(function (placement) {
+ var side = ['left', 'top'].indexOf(placement) !== -1 ? 'primary' : 'secondary';
+ popper = _extends$1({}, popper, check[side](placement));
+ });
+
+ data.offsets.popper = popper;
+
+ return data;
+}
+
+/**
+ * @function
+ * @memberof Modifiers
+ * @argument {Object} data - The data object generated by `update` method
+ * @argument {Object} options - Modifiers configuration and options
+ * @returns {Object} The data object, properly modified
+ */
+function shift(data) {
+ var placement = data.placement;
+ var basePlacement = placement.split('-')[0];
+ var shiftvariation = placement.split('-')[1];
+
+ // if shift shiftvariation is specified, run the modifier
+ if (shiftvariation) {
+ var _data$offsets = data.offsets,
+ reference = _data$offsets.reference,
+ popper = _data$offsets.popper;
+
+ var isVertical = ['bottom', 'top'].indexOf(basePlacement) !== -1;
+ var side = isVertical ? 'left' : 'top';
+ var measurement = isVertical ? 'width' : 'height';
+
+ var shiftOffsets = {
+ start: defineProperty({}, side, reference[side]),
+ end: defineProperty({}, side, reference[side] + reference[measurement] - popper[measurement])
+ };
+
+ data.offsets.popper = _extends$1({}, popper, shiftOffsets[shiftvariation]);
+ }
+
+ return data;
+}
+
+/**
+ * @function
+ * @memberof Modifiers
+ * @argument {Object} data - The data object generated by update method
+ * @argument {Object} options - Modifiers configuration and options
+ * @returns {Object} The data object, properly modified
+ */
+function hide(data) {
+ if (!isModifierRequired(data.instance.modifiers, 'hide', 'preventOverflow')) {
+ return data;
+ }
+
+ var refRect = data.offsets.reference;
+ var bound = find(data.instance.modifiers, function (modifier) {
+ return modifier.name === 'preventOverflow';
+ }).boundaries;
+
+ if (refRect.bottom < bound.top || refRect.left > bound.right || refRect.top > bound.bottom || refRect.right < bound.left) {
+ // Avoid unnecessary DOM access if visibility hasn't changed
+ if (data.hide === true) {
+ return data;
+ }
+
+ data.hide = true;
+ data.attributes['x-out-of-boundaries'] = '';
+ } else {
+ // Avoid unnecessary DOM access if visibility hasn't changed
+ if (data.hide === false) {
+ return data;
+ }
+
+ data.hide = false;
+ data.attributes['x-out-of-boundaries'] = false;
+ }
+
+ return data;
+}
+
+/**
+ * @function
+ * @memberof Modifiers
+ * @argument {Object} data - The data object generated by `update` method
+ * @argument {Object} options - Modifiers configuration and options
+ * @returns {Object} The data object, properly modified
+ */
+function inner(data) {
+ var placement = data.placement;
+ var basePlacement = placement.split('-')[0];
+ var _data$offsets = data.offsets,
+ popper = _data$offsets.popper,
+ reference = _data$offsets.reference;
+
+ var isHoriz = ['left', 'right'].indexOf(basePlacement) !== -1;
+
+ var subtractLength = ['top', 'left'].indexOf(basePlacement) === -1;
+
+ popper[isHoriz ? 'left' : 'top'] = reference[basePlacement] - (subtractLength ? popper[isHoriz ? 'width' : 'height'] : 0);
+
+ data.placement = getOppositePlacement(placement);
+ data.offsets.popper = getClientRect(popper);
+
+ return data;
+}
+
+/**
+ * Modifier function, each modifier can have a function of this type assigned
+ * to its `fn` property.<br />
+ * These functions will be called on each update, this means that you must
+ * make sure they are performant enough to avoid performance bottlenecks.
+ *
+ * @function ModifierFn
+ * @argument {dataObject} data - The data object generated by `update` method
+ * @argument {Object} options - Modifiers configuration and options
+ * @returns {dataObject} The data object, properly modified
+ */
+
+/**
+ * Modifiers are plugins used to alter the behavior of your poppers.<br />
+ * Popper.js uses a set of 9 modifiers to provide all the basic functionalities
+ * needed by the library.
+ *
+ * Usually you don't want to override the `order`, `fn` and `onLoad` props.
+ * All the other properties are configurations that could be tweaked.
+ * @namespace modifiers
+ */
+var modifiers = {
+ /**
+ * Modifier used to shift the popper on the start or end of its reference
+ * element.<br />
+ * It will read the variation of the `placement` property.<br />
+ * It can be one either `-end` or `-start`.
+ * @memberof modifiers
+ * @inner
+ */
+ shift: {
+ /** @prop {number} order=100 - Index used to define the order of execution */
+ order: 100,
+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+ enabled: true,
+ /** @prop {ModifierFn} */
+ fn: shift
+ },
+
+ /**
+ * The `offset` modifier can shift your popper on both its axis.
+ *
+ * It accepts the following units:
+ * - `px` or unitless, interpreted as pixels
+ * - `%` or `%r`, percentage relative to the length of the reference element
+ * - `%p`, percentage relative to the length of the popper element
+ * - `vw`, CSS viewport width unit
+ * - `vh`, CSS viewport height unit
+ *
+ * For length is intended the main axis relative to the placement of the popper.<br />
+ * This means that if the placement is `top` or `bottom`, the length will be the
+ * `width`. In case of `left` or `right`, it will be the height.
+ *
+ * You can provide a single value (as `Number` or `String`), or a pair of values
+ * as `String` divided by a comma or one (or more) white spaces.<br />
+ * The latter is a deprecated method because it leads to confusion and will be
+ * removed in v2.<br />
+ * Additionally, it accepts additions and subtractions between different units.
+ * Note that multiplications and divisions aren't supported.
+ *
+ * Valid examples are:
+ * ```
+ * 10
+ * '10%'
+ * '10, 10'
+ * '10%, 10'
+ * '10 + 10%'
+ * '10 - 5vh + 3%'
+ * '-10px + 5vh, 5px - 6%'
+ * ```
+ * > **NB**: If you desire to apply offsets to your poppers in a way that may make them overlap
+ * > with their reference element, unfortunately, you will have to disable the `flip` modifier.
+ * > More on this [reading this issue](https://github.com/FezVrasta/popper.js/issues/373)
+ *
+ * @memberof modifiers
+ * @inner
+ */
+ offset: {
+ /** @prop {number} order=200 - Index used to define the order of execution */
+ order: 200,
+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+ enabled: true,
+ /** @prop {ModifierFn} */
+ fn: offset,
+ /** @prop {Number|String} offset=0
+ * The offset value as described in the modifier description
+ */
+ offset: 0
+ },
+
+ /**
+ * Modifier used to prevent the popper from being positioned outside the boundary.
+ *
+ * An scenario exists where the reference itself is not within the boundaries.<br />
+ * We can say it has "escaped the boundaries" — or just "escaped".<br />
+ * In this case we need to decide whether the popper should either:
+ *
+ * - detach from the reference and remain "trapped" in the boundaries, or
+ * - if it should ignore the boundary and "escape with its reference"
+ *
+ * When `escapeWithReference` is set to`true` and reference is completely
+ * outside its boundaries, the popper will overflow (or completely leave)
+ * the boundaries in order to remain attached to the edge of the reference.
+ *
+ * @memberof modifiers
+ * @inner
+ */
+ preventOverflow: {
+ /** @prop {number} order=300 - Index used to define the order of execution */
+ order: 300,
+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+ enabled: true,
+ /** @prop {ModifierFn} */
+ fn: preventOverflow,
+ /**
+ * @prop {Array} [priority=['left','right','top','bottom']]
+ * Popper will try to prevent overflow following these priorities by default,
+ * then, it could overflow on the left and on top of the `boundariesElement`
+ */
+ priority: ['left', 'right', 'top', 'bottom'],
+ /**
+ * @prop {number} padding=5
+ * Amount of pixel used to define a minimum distance between the boundaries
+ * and the popper this makes sure the popper has always a little padding
+ * between the edges of its container
+ */
+ padding: 5,
+ /**
+ * @prop {String|HTMLElement} boundariesElement='scrollParent'
+ * Boundaries used by the modifier, can be `scrollParent`, `window`,
+ * `viewport` or any DOM element.
+ */
+ boundariesElement: 'scrollParent'
+ },
+
+ /**
+ * Modifier used to make sure the reference and its popper stay near eachothers
+ * without leaving any gap between the two. Expecially useful when the arrow is
+ * enabled and you want to assure it to point to its reference element.
+ * It cares only about the first axis, you can still have poppers with margin
+ * between the popper and its reference element.
+ * @memberof modifiers
+ * @inner
+ */
+ keepTogether: {
+ /** @prop {number} order=400 - Index used to define the order of execution */
+ order: 400,
+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+ enabled: true,
+ /** @prop {ModifierFn} */
+ fn: keepTogether
+ },
+
+ /**
+ * This modifier is used to move the `arrowElement` of the popper to make
+ * sure it is positioned between the reference element and its popper element.
+ * It will read the outer size of the `arrowElement` node to detect how many
+ * pixels of conjuction are needed.
+ *
+ * It has no effect if no `arrowElement` is provided.
+ * @memberof modifiers
+ * @inner
+ */
+ arrow: {
+ /** @prop {number} order=500 - Index used to define the order of execution */
+ order: 500,
+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+ enabled: true,
+ /** @prop {ModifierFn} */
+ fn: arrow,
+ /** @prop {String|HTMLElement} element='[x-arrow]' - Selector or node used as arrow */
+ element: '[x-arrow]'
+ },
+
+ /**
+ * Modifier used to flip the popper's placement when it starts to overlap its
+ * reference element.
+ *
+ * Requires the `preventOverflow` modifier before it in order to work.
+ *
+ * **NOTE:** this modifier will interrupt the current update cycle and will
+ * restart it if it detects the need to flip the placement.
+ * @memberof modifiers
+ * @inner
+ */
+ flip: {
+ /** @prop {number} order=600 - Index used to define the order of execution */
+ order: 600,
+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+ enabled: true,
+ /** @prop {ModifierFn} */
+ fn: flip,
+ /**
+ * @prop {String|Array} behavior='flip'
+ * The behavior used to change the popper's placement. It can be one of
+ * `flip`, `clockwise`, `counterclockwise` or an array with a list of valid
+ * placements (with optional variations).
+ */
+ behavior: 'flip',
+ /**
+ * @prop {number} padding=5
+ * The popper will flip if it hits the edges of the `boundariesElement`
+ */
+ padding: 5,
+ /**
+ * @prop {String|HTMLElement} boundariesElement='viewport'
+ * The element which will define the boundaries of the popper position,
+ * the popper will never be placed outside of the defined boundaries
+ * (except if keepTogether is enabled)
+ */
+ boundariesElement: 'viewport'
+ },
+
+ /**
+ * Modifier used to make the popper flow toward the inner of the reference element.
+ * By default, when this modifier is disabled, the popper will be placed outside
+ * the reference element.
+ * @memberof modifiers
+ * @inner
+ */
+ inner: {
+ /** @prop {number} order=700 - Index used to define the order of execution */
+ order: 700,
+ /** @prop {Boolean} enabled=false - Whether the modifier is enabled or not */
+ enabled: false,
+ /** @prop {ModifierFn} */
+ fn: inner
+ },
+
+ /**
+ * Modifier used to hide the popper when its reference element is outside of the
+ * popper boundaries. It will set a `x-out-of-boundaries` attribute which can
+ * be used to hide with a CSS selector the popper when its reference is
+ * out of boundaries.
+ *
+ * Requires the `preventOverflow` modifier before it in order to work.
+ * @memberof modifiers
+ * @inner
+ */
+ hide: {
+ /** @prop {number} order=800 - Index used to define the order of execution */
+ order: 800,
+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+ enabled: true,
+ /** @prop {ModifierFn} */
+ fn: hide
+ },
+
+ /**
+ * Computes the style that will be applied to the popper element to gets
+ * properly positioned.
+ *
+ * Note that this modifier will not touch the DOM, it just prepares the styles
+ * so that `applyStyle` modifier can apply it. This separation is useful
+ * in case you need to replace `applyStyle` with a custom implementation.
+ *
+ * This modifier has `850` as `order` value to maintain backward compatibility
+ * with previous versions of Popper.js. Expect the modifiers ordering method
+ * to change in future major versions of the library.
+ *
+ * @memberof modifiers
+ * @inner
+ */
+ computeStyle: {
+ /** @prop {number} order=850 - Index used to define the order of execution */
+ order: 850,
+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+ enabled: true,
+ /** @prop {ModifierFn} */
+ fn: computeStyle,
+ /**
+ * @prop {Boolean} gpuAcceleration=true
+ * If true, it uses the CSS 3d transformation to position the popper.
+ * Otherwise, it will use the `top` and `left` properties.
+ */
+ gpuAcceleration: true,
+ /**
+ * @prop {string} [x='bottom']
+ * Where to anchor the X axis (`bottom` or `top`). AKA X offset origin.
+ * Change this if your popper should grow in a direction different from `bottom`
+ */
+ x: 'bottom',
+ /**
+ * @prop {string} [x='left']
+ * Where to anchor the Y axis (`left` or `right`). AKA Y offset origin.
+ * Change this if your popper should grow in a direction different from `right`
+ */
+ y: 'right'
+ },
+
+ /**
+ * Applies the computed styles to the popper element.
+ *
+ * All the DOM manipulations are limited to this modifier. This is useful in case
+ * you want to integrate Popper.js inside a framework or view library and you
+ * want to delegate all the DOM manipulations to it.
+ *
+ * Note that if you disable this modifier, you must make sure the popper element
+ * has its position set to `absolute` before Popper.js can do its work!
+ *
+ * Just disable this modifier and define you own to achieve the desired effect.
+ *
+ * @memberof modifiers
+ * @inner
+ */
+ applyStyle: {
+ /** @prop {number} order=900 - Index used to define the order of execution */
+ order: 900,
+ /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */
+ enabled: true,
+ /** @prop {ModifierFn} */
+ fn: applyStyle,
+ /** @prop {Function} */
+ onLoad: applyStyleOnLoad,
+ /**
+ * @deprecated since version 1.10.0, the property moved to `computeStyle` modifier
+ * @prop {Boolean} gpuAcceleration=true
+ * If true, it uses the CSS 3d transformation to position the popper.
+ * Otherwise, it will use the `top` and `left` properties.
+ */
+ gpuAcceleration: undefined
+ }
+};
+
+/**
+ * The `dataObject` is an object containing all the informations used by Popper.js
+ * this object get passed to modifiers and to the `onCreate` and `onUpdate` callbacks.
+ * @name dataObject
+ * @property {Object} data.instance The Popper.js instance
+ * @property {String} data.placement Placement applied to popper
+ * @property {String} data.originalPlacement Placement originally defined on init
+ * @property {Boolean} data.flipped True if popper has been flipped by flip modifier
+ * @property {Boolean} data.hide True if the reference element is out of boundaries, useful to know when to hide the popper.
+ * @property {HTMLElement} data.arrowElement Node used as arrow by arrow modifier
+ * @property {Object} data.styles Any CSS property defined here will be applied to the popper, it expects the JavaScript nomenclature (eg. `marginBottom`)
+ * @property {Object} data.arrowStyles Any CSS property defined here will be applied to the popper arrow, it expects the JavaScript nomenclature (eg. `marginBottom`)
+ * @property {Object} data.boundaries Offsets of the popper boundaries
+ * @property {Object} data.offsets The measurements of popper, reference and arrow elements.
+ * @property {Object} data.offsets.popper `top`, `left`, `width`, `height` values
+ * @property {Object} data.offsets.reference `top`, `left`, `width`, `height` values
+ * @property {Object} data.offsets.arrow] `top` and `left` offsets, only one of them will be different from 0
+ */
+
+/**
+ * Default options provided to Popper.js constructor.<br />
+ * These can be overriden using the `options` argument of Popper.js.<br />
+ * To override an option, simply pass as 3rd argument an object with the same
+ * structure of this object, example:
+ * ```
+ * new Popper(ref, pop, {
+ * modifiers: {
+ * preventOverflow: { enabled: false }
+ * }
+ * })
+ * ```
+ * @type {Object}
+ * @static
+ * @memberof Popper
+ */
+var Defaults = {
+ /**
+ * Popper's placement
+ * @prop {Popper.placements} placement='bottom'
+ */
+ placement: 'bottom',
+
+ /**
+ * Whether events (resize, scroll) are initially enabled
+ * @prop {Boolean} eventsEnabled=true
+ */
+ eventsEnabled: true,
+
+ /**
+ * Set to true if you want to automatically remove the popper when
+ * you call the `destroy` method.
+ * @prop {Boolean} removeOnDestroy=false
+ */
+ removeOnDestroy: false,
+
+ /**
+ * Callback called when the popper is created.<br />
+ * By default, is set to no-op.<br />
+ * Access Popper.js instance with `data.instance`.
+ * @prop {onCreate}
+ */
+ onCreate: function onCreate() {},
+
+ /**
+ * Callback called when the popper is updated, this callback is not called
+ * on the initialization/creation of the popper, but only on subsequent
+ * updates.<br />
+ * By default, is set to no-op.<br />
+ * Access Popper.js instance with `data.instance`.
+ * @prop {onUpdate}
+ */
+ onUpdate: function onUpdate() {},
+
+ /**
+ * List of modifiers used to modify the offsets before they are applied to the popper.
+ * They provide most of the functionalities of Popper.js
+ * @prop {modifiers}
+ */
+ modifiers: modifiers
+};
+
+/**
+ * @callback onCreate
+ * @param {dataObject} data
+ */
+
+/**
+ * @callback onUpdate
+ * @param {dataObject} data
+ */
+
+// Utils
+// Methods
+var Popper = function () {
+ /**
+ * Create a new Popper.js instance
+ * @class Popper
+ * @param {HTMLElement|referenceObject} reference - The reference element used to position the popper
+ * @param {HTMLElement} popper - The HTML element used as popper.
+ * @param {Object} options - Your custom options to override the ones defined in [Defaults](#defaults)
+ * @return {Object} instance - The generated Popper.js instance
+ */
+ function Popper(reference, popper) {
+ var _this = this;
+
+ var options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {};
+ classCallCheck(this, Popper);
+
+ this.scheduleUpdate = function () {
+ return requestAnimationFrame(_this.update);
+ };
+
+ // make update() debounced, so that it only runs at most once-per-tick
+ this.update = debounce(this.update.bind(this));
+
+ // with {} we create a new object with the options inside it
+ this.options = _extends$1({}, Popper.Defaults, options);
+
+ // init state
+ this.state = {
+ isDestroyed: false,
+ isCreated: false,
+ scrollParents: []
+ };
+
+ // get reference and popper elements (allow jQuery wrappers)
+ this.reference = reference && reference.jquery ? reference[0] : reference;
+ this.popper = popper && popper.jquery ? popper[0] : popper;
+
+ // Deep merge modifiers options
+ this.options.modifiers = {};
+ Object.keys(_extends$1({}, Popper.Defaults.modifiers, options.modifiers)).forEach(function (name) {
+ _this.options.modifiers[name] = _extends$1({}, Popper.Defaults.modifiers[name] || {}, options.modifiers ? options.modifiers[name] : {});
+ });
+
+ // Refactoring modifiers' list (Object => Array)
+ this.modifiers = Object.keys(this.options.modifiers).map(function (name) {
+ return _extends$1({
+ name: name
+ }, _this.options.modifiers[name]);
+ })
+ // sort the modifiers by order
+ .sort(function (a, b) {
+ return a.order - b.order;
+ });
+
+ // modifiers have the ability to execute arbitrary code when Popper.js get inited
+ // such code is executed in the same order of its modifier
+ // they could add new properties to their options configuration
+ // BE AWARE: don't add options to `options.modifiers.name` but to `modifierOptions`!
+ this.modifiers.forEach(function (modifierOptions) {
+ if (modifierOptions.enabled && isFunction(modifierOptions.onLoad)) {
+ modifierOptions.onLoad(_this.reference, _this.popper, _this.options, modifierOptions, _this.state);
+ }
+ });
+
+ // fire the first update to position the popper in the right place
+ this.update();
+
+ var eventsEnabled = this.options.eventsEnabled;
+ if (eventsEnabled) {
+ // setup event listeners, they will take care of update the position in specific situations
+ this.enableEventListeners();
+ }
+
+ this.state.eventsEnabled = eventsEnabled;
+ }
+
+ // We can't use class properties because they don't get listed in the
+ // class prototype and break stuff like Sinon stubs
+
+
+ createClass(Popper, [{
+ key: 'update',
+ value: function update$$1() {
+ return update.call(this);
+ }
+ }, {
+ key: 'destroy',
+ value: function destroy$$1() {
+ return destroy.call(this);
+ }
+ }, {
+ key: 'enableEventListeners',
+ value: function enableEventListeners$$1() {
+ return enableEventListeners.call(this);
+ }
+ }, {
+ key: 'disableEventListeners',
+ value: function disableEventListeners$$1() {
+ return disableEventListeners.call(this);
+ }
+
+ /**
+ * Schedule an update, it will run on the next UI update available
+ * @method scheduleUpdate
+ * @memberof Popper
+ */
+
+
+ /**
+ * Collection of utilities useful when writing custom modifiers.
+ * Starting from version 1.7, this method is available only if you
+ * include `popper-utils.js` before `popper.js`.
+ *
+ * **DEPRECATION**: This way to access PopperUtils is deprecated
+ * and will be removed in v2! Use the PopperUtils module directly instead.
+ * Due to the high instability of the methods contained in Utils, we can't
+ * guarantee them to follow semver. Use them at your own risk!
+ * @static
+ * @private
+ * @type {Object}
+ * @deprecated since version 1.8
+ * @member Utils
+ * @memberof Popper
+ */
+
+ }]);
+ return Popper;
+}();
+
+/**
+ * The `referenceObject` is an object that provides an interface compatible with Popper.js
+ * and lets you use it as replacement of a real DOM node.<br />
+ * You can use this method to position a popper relatively to a set of coordinates
+ * in case you don't have a DOM node to use as reference.
+ *
+ * ```
+ * new Popper(referenceObject, popperNode);
+ * ```
+ *
+ * NB: This feature isn't supported in Internet Explorer 10
+ * @name referenceObject
+ * @property {Function} data.getBoundingClientRect
+ * A function that returns a set of coordinates compatible with the native `getBoundingClientRect` method.
+ * @property {number} data.clientWidth
+ * An ES6 getter that will return the width of the virtual reference element.
+ * @property {number} data.clientHeight
+ * An ES6 getter that will return the height of the virtual reference element.
+ */
+
+
+Popper.Utils = (typeof window !== 'undefined' ? window : global).PopperUtils;
+Popper.placements = placements;
+Popper.Defaults = Defaults;
+
+/**
+ * --------------------------------------------------------------------------
+ * Bootstrap (v4.0.0): dropdown.js
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * --------------------------------------------------------------------------
+ */
+
+var Dropdown = function ($$$1) {
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+ var NAME = 'dropdown';
+ var VERSION = '4.0.0';
+ var DATA_KEY = 'bs.dropdown';
+ var EVENT_KEY = "." + DATA_KEY;
+ var DATA_API_KEY = '.data-api';
+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
+ var ESCAPE_KEYCODE = 27; // KeyboardEvent.which value for Escape (Esc) key
+
+ var SPACE_KEYCODE = 32; // KeyboardEvent.which value for space key
+
+ var TAB_KEYCODE = 9; // KeyboardEvent.which value for tab key
+
+ var ARROW_UP_KEYCODE = 38; // KeyboardEvent.which value for up arrow key
+
+ var ARROW_DOWN_KEYCODE = 40; // KeyboardEvent.which value for down arrow key
+
+ var RIGHT_MOUSE_BUTTON_WHICH = 3; // MouseEvent.which value for the right button (assuming a right-handed mouse)
+
+ var REGEXP_KEYDOWN = new RegExp(ARROW_UP_KEYCODE + "|" + ARROW_DOWN_KEYCODE + "|" + ESCAPE_KEYCODE);
+ var Event = {
+ HIDE: "hide" + EVENT_KEY,
+ HIDDEN: "hidden" + EVENT_KEY,
+ SHOW: "show" + EVENT_KEY,
+ SHOWN: "shown" + EVENT_KEY,
+ CLICK: "click" + EVENT_KEY,
+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY,
+ KEYDOWN_DATA_API: "keydown" + EVENT_KEY + DATA_API_KEY,
+ KEYUP_DATA_API: "keyup" + EVENT_KEY + DATA_API_KEY
+ };
+ var ClassName = {
+ DISABLED: 'disabled',
+ SHOW: 'show',
+ DROPUP: 'dropup',
+ DROPRIGHT: 'dropright',
+ DROPLEFT: 'dropleft',
+ MENURIGHT: 'dropdown-menu-right',
+ MENULEFT: 'dropdown-menu-left',
+ POSITION_STATIC: 'position-static'
+ };
+ var Selector = {
+ DATA_TOGGLE: '[data-toggle="dropdown"]',
+ FORM_CHILD: '.dropdown form',
+ MENU: '.dropdown-menu',
+ NAVBAR_NAV: '.navbar-nav',
+ VISIBLE_ITEMS: '.dropdown-menu .dropdown-item:not(.disabled)'
+ };
+ var AttachmentMap = {
+ TOP: 'top-start',
+ TOPEND: 'top-end',
+ BOTTOM: 'bottom-start',
+ BOTTOMEND: 'bottom-end',
+ RIGHT: 'right-start',
+ RIGHTEND: 'right-end',
+ LEFT: 'left-start',
+ LEFTEND: 'left-end'
+ };
+ var Default = {
+ offset: 0,
+ flip: true,
+ boundary: 'scrollParent'
+ };
+ var DefaultType = {
+ offset: '(number|string|function)',
+ flip: 'boolean',
+ boundary: '(string|element)'
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Dropdown =
+ /*#__PURE__*/
+ function () {
+ function Dropdown(element, config) {
+ this._element = element;
+ this._popper = null;
+ this._config = this._getConfig(config);
+ this._menu = this._getMenuElement();
+ this._inNavbar = this._detectNavbar();
+
+ this._addEventListeners();
+ } // Getters
+
+
+ var _proto = Dropdown.prototype;
+
+ // Public
+ _proto.toggle = function toggle() {
+ if (this._element.disabled || $$$1(this._element).hasClass(ClassName.DISABLED)) {
+ return;
+ }
+
+ var parent = Dropdown._getParentFromElement(this._element);
+
+ var isActive = $$$1(this._menu).hasClass(ClassName.SHOW);
+
+ Dropdown._clearMenus();
+
+ if (isActive) {
+ return;
+ }
+
+ var relatedTarget = {
+ relatedTarget: this._element
+ };
+ var showEvent = $$$1.Event(Event.SHOW, relatedTarget);
+ $$$1(parent).trigger(showEvent);
+
+ if (showEvent.isDefaultPrevented()) {
+ return;
+ } // Disable totally Popper.js for Dropdown in Navbar
+
+
+ if (!this._inNavbar) {
+ /**
+ * Check for Popper dependency
+ * Popper - https://popper.js.org
+ */
+ if (typeof Popper === 'undefined') {
+ throw new TypeError('Bootstrap dropdown require Popper.js (https://popper.js.org)');
+ }
+
+ var element = this._element; // For dropup with alignment we use the parent as popper container
+
+ if ($$$1(parent).hasClass(ClassName.DROPUP)) {
+ if ($$$1(this._menu).hasClass(ClassName.MENULEFT) || $$$1(this._menu).hasClass(ClassName.MENURIGHT)) {
+ element = parent;
+ }
+ } // If boundary is not `scrollParent`, then set position to `static`
+ // to allow the menu to "escape" the scroll parent's boundaries
+ // https://github.com/twbs/bootstrap/issues/24251
+
+
+ if (this._config.boundary !== 'scrollParent') {
+ $$$1(parent).addClass(ClassName.POSITION_STATIC);
+ }
+
+ this._popper = new Popper(element, this._menu, this._getPopperConfig());
+ } // If this is a touch-enabled device we add extra
+ // empty mouseover listeners to the body's immediate children;
+ // only needed because of broken event delegation on iOS
+ // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html
+
+
+ if ('ontouchstart' in document.documentElement && $$$1(parent).closest(Selector.NAVBAR_NAV).length === 0) {
+ $$$1('body').children().on('mouseover', null, $$$1.noop);
+ }
+
+ this._element.focus();
+
+ this._element.setAttribute('aria-expanded', true);
+
+ $$$1(this._menu).toggleClass(ClassName.SHOW);
+ $$$1(parent).toggleClass(ClassName.SHOW).trigger($$$1.Event(Event.SHOWN, relatedTarget));
+ };
+
+ _proto.dispose = function dispose() {
+ $$$1.removeData(this._element, DATA_KEY);
+ $$$1(this._element).off(EVENT_KEY);
+ this._element = null;
+ this._menu = null;
+
+ if (this._popper !== null) {
+ this._popper.destroy();
+
+ this._popper = null;
+ }
+ };
+
+ _proto.update = function update() {
+ this._inNavbar = this._detectNavbar();
+
+ if (this._popper !== null) {
+ this._popper.scheduleUpdate();
+ }
+ }; // Private
+
+
+ _proto._addEventListeners = function _addEventListeners() {
+ var _this = this;
+
+ $$$1(this._element).on(Event.CLICK, function (event) {
+ event.preventDefault();
+ event.stopPropagation();
+
+ _this.toggle();
+ });
+ };
+
+ _proto._getConfig = function _getConfig(config) {
+ config = _extends({}, this.constructor.Default, $$$1(this._element).data(), config);
+ Util.typeCheckConfig(NAME, config, this.constructor.DefaultType);
+ return config;
+ };
+
+ _proto._getMenuElement = function _getMenuElement() {
+ if (!this._menu) {
+ var parent = Dropdown._getParentFromElement(this._element);
+
+ this._menu = $$$1(parent).find(Selector.MENU)[0];
+ }
+
+ return this._menu;
+ };
+
+ _proto._getPlacement = function _getPlacement() {
+ var $parentDropdown = $$$1(this._element).parent();
+ var placement = AttachmentMap.BOTTOM; // Handle dropup
+
+ if ($parentDropdown.hasClass(ClassName.DROPUP)) {
+ placement = AttachmentMap.TOP;
+
+ if ($$$1(this._menu).hasClass(ClassName.MENURIGHT)) {
+ placement = AttachmentMap.TOPEND;
+ }
+ } else if ($parentDropdown.hasClass(ClassName.DROPRIGHT)) {
+ placement = AttachmentMap.RIGHT;
+ } else if ($parentDropdown.hasClass(ClassName.DROPLEFT)) {
+ placement = AttachmentMap.LEFT;
+ } else if ($$$1(this._menu).hasClass(ClassName.MENURIGHT)) {
+ placement = AttachmentMap.BOTTOMEND;
+ }
+
+ return placement;
+ };
+
+ _proto._detectNavbar = function _detectNavbar() {
+ return $$$1(this._element).closest('.navbar').length > 0;
+ };
+
+ _proto._getPopperConfig = function _getPopperConfig() {
+ var _this2 = this;
+
+ var offsetConf = {};
+
+ if (typeof this._config.offset === 'function') {
+ offsetConf.fn = function (data) {
+ data.offsets = _extends({}, data.offsets, _this2._config.offset(data.offsets) || {});
+ return data;
+ };
+ } else {
+ offsetConf.offset = this._config.offset;
+ }
+
+ var popperConfig = {
+ placement: this._getPlacement(),
+ modifiers: {
+ offset: offsetConf,
+ flip: {
+ enabled: this._config.flip
+ },
+ preventOverflow: {
+ boundariesElement: this._config.boundary
+ }
+ }
+ };
+ return popperConfig;
+ }; // Static
+
+
+ Dropdown._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var data = $$$1(this).data(DATA_KEY);
+
+ var _config = typeof config === 'object' ? config : null;
+
+ if (!data) {
+ data = new Dropdown(this, _config);
+ $$$1(this).data(DATA_KEY, data);
+ }
+
+ if (typeof config === 'string') {
+ if (typeof data[config] === 'undefined') {
+ throw new TypeError("No method named \"" + config + "\"");
+ }
+
+ data[config]();
+ }
+ });
+ };
+
+ Dropdown._clearMenus = function _clearMenus(event) {
+ if (event && (event.which === RIGHT_MOUSE_BUTTON_WHICH || event.type === 'keyup' && event.which !== TAB_KEYCODE)) {
+ return;
+ }
+
+ var toggles = $$$1.makeArray($$$1(Selector.DATA_TOGGLE));
+
+ for (var i = 0; i < toggles.length; i++) {
+ var parent = Dropdown._getParentFromElement(toggles[i]);
+
+ var context = $$$1(toggles[i]).data(DATA_KEY);
+ var relatedTarget = {
+ relatedTarget: toggles[i]
+ };
+
+ if (!context) {
+ continue;
+ }
+
+ var dropdownMenu = context._menu;
+
+ if (!$$$1(parent).hasClass(ClassName.SHOW)) {
+ continue;
+ }
+
+ if (event && (event.type === 'click' && /input|textarea/i.test(event.target.tagName) || event.type === 'keyup' && event.which === TAB_KEYCODE) && $$$1.contains(parent, event.target)) {
+ continue;
+ }
+
+ var hideEvent = $$$1.Event(Event.HIDE, relatedTarget);
+ $$$1(parent).trigger(hideEvent);
+
+ if (hideEvent.isDefaultPrevented()) {
+ continue;
+ } // If this is a touch-enabled device we remove the extra
+ // empty mouseover listeners we added for iOS support
+
+
+ if ('ontouchstart' in document.documentElement) {
+ $$$1('body').children().off('mouseover', null, $$$1.noop);
+ }
+
+ toggles[i].setAttribute('aria-expanded', 'false');
+ $$$1(dropdownMenu).removeClass(ClassName.SHOW);
+ $$$1(parent).removeClass(ClassName.SHOW).trigger($$$1.Event(Event.HIDDEN, relatedTarget));
+ }
+ };
+
+ Dropdown._getParentFromElement = function _getParentFromElement(element) {
+ var parent;
+ var selector = Util.getSelectorFromElement(element);
+
+ if (selector) {
+ parent = $$$1(selector)[0];
+ }
+
+ return parent || element.parentNode;
+ }; // eslint-disable-next-line complexity
+
+
+ Dropdown._dataApiKeydownHandler = function _dataApiKeydownHandler(event) {
+ // If not input/textarea:
+ // - And not a key in REGEXP_KEYDOWN => not a dropdown command
+ // If input/textarea:
+ // - If space key => not a dropdown command
+ // - If key is other than escape
+ // - If key is not up or down => not a dropdown command
+ // - If trigger inside the menu => not a dropdown command
+ if (/input|textarea/i.test(event.target.tagName) ? event.which === SPACE_KEYCODE || event.which !== ESCAPE_KEYCODE && (event.which !== ARROW_DOWN_KEYCODE && event.which !== ARROW_UP_KEYCODE || $$$1(event.target).closest(Selector.MENU).length) : !REGEXP_KEYDOWN.test(event.which)) {
+ return;
+ }
+
+ event.preventDefault();
+ event.stopPropagation();
+
+ if (this.disabled || $$$1(this).hasClass(ClassName.DISABLED)) {
+ return;
+ }
+
+ var parent = Dropdown._getParentFromElement(this);
+
+ var isActive = $$$1(parent).hasClass(ClassName.SHOW);
+
+ if (!isActive && (event.which !== ESCAPE_KEYCODE || event.which !== SPACE_KEYCODE) || isActive && (event.which === ESCAPE_KEYCODE || event.which === SPACE_KEYCODE)) {
+ if (event.which === ESCAPE_KEYCODE) {
+ var toggle = $$$1(parent).find(Selector.DATA_TOGGLE)[0];
+ $$$1(toggle).trigger('focus');
+ }
+
+ $$$1(this).trigger('click');
+ return;
+ }
+
+ var items = $$$1(parent).find(Selector.VISIBLE_ITEMS).get();
+
+ if (items.length === 0) {
+ return;
+ }
+
+ var index = items.indexOf(event.target);
+
+ if (event.which === ARROW_UP_KEYCODE && index > 0) {
+ // Up
+ index--;
+ }
+
+ if (event.which === ARROW_DOWN_KEYCODE && index < items.length - 1) {
+ // Down
+ index++;
+ }
+
+ if (index < 0) {
+ index = 0;
+ }
+
+ items[index].focus();
+ };
+
+ _createClass(Dropdown, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION;
+ }
+ }, {
+ key: "Default",
+ get: function get() {
+ return Default;
+ }
+ }, {
+ key: "DefaultType",
+ get: function get() {
+ return DefaultType;
+ }
+ }]);
+ return Dropdown;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * Data Api implementation
+ * ------------------------------------------------------------------------
+ */
+
+
+ $$$1(document).on(Event.KEYDOWN_DATA_API, Selector.DATA_TOGGLE, Dropdown._dataApiKeydownHandler).on(Event.KEYDOWN_DATA_API, Selector.MENU, Dropdown._dataApiKeydownHandler).on(Event.CLICK_DATA_API + " " + Event.KEYUP_DATA_API, Dropdown._clearMenus).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) {
+ event.preventDefault();
+ event.stopPropagation();
+
+ Dropdown._jQueryInterface.call($$$1(this), 'toggle');
+ }).on(Event.CLICK_DATA_API, Selector.FORM_CHILD, function (e) {
+ e.stopPropagation();
+ });
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+ $$$1.fn[NAME] = Dropdown._jQueryInterface;
+ $$$1.fn[NAME].Constructor = Dropdown;
+
+ $$$1.fn[NAME].noConflict = function () {
+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
+ return Dropdown._jQueryInterface;
+ };
+
+ return Dropdown;
+}($, Popper);
+
+/**
+ * --------------------------------------------------------------------------
+ * Bootstrap (v4.0.0): modal.js
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * --------------------------------------------------------------------------
+ */
+
+var Modal = function ($$$1) {
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+ var NAME = 'modal';
+ var VERSION = '4.0.0';
+ var DATA_KEY = 'bs.modal';
+ var EVENT_KEY = "." + DATA_KEY;
+ var DATA_API_KEY = '.data-api';
+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
+ var TRANSITION_DURATION = 300;
+ var BACKDROP_TRANSITION_DURATION = 150;
+ var ESCAPE_KEYCODE = 27; // KeyboardEvent.which value for Escape (Esc) key
+
+ var Default = {
+ backdrop: true,
+ keyboard: true,
+ focus: true,
+ show: true
+ };
+ var DefaultType = {
+ backdrop: '(boolean|string)',
+ keyboard: 'boolean',
+ focus: 'boolean',
+ show: 'boolean'
+ };
+ var Event = {
+ HIDE: "hide" + EVENT_KEY,
+ HIDDEN: "hidden" + EVENT_KEY,
+ SHOW: "show" + EVENT_KEY,
+ SHOWN: "shown" + EVENT_KEY,
+ FOCUSIN: "focusin" + EVENT_KEY,
+ RESIZE: "resize" + EVENT_KEY,
+ CLICK_DISMISS: "click.dismiss" + EVENT_KEY,
+ KEYDOWN_DISMISS: "keydown.dismiss" + EVENT_KEY,
+ MOUSEUP_DISMISS: "mouseup.dismiss" + EVENT_KEY,
+ MOUSEDOWN_DISMISS: "mousedown.dismiss" + EVENT_KEY,
+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
+ };
+ var ClassName = {
+ SCROLLBAR_MEASURER: 'modal-scrollbar-measure',
+ BACKDROP: 'modal-backdrop',
+ OPEN: 'modal-open',
+ FADE: 'fade',
+ SHOW: 'show'
+ };
+ var Selector = {
+ DIALOG: '.modal-dialog',
+ DATA_TOGGLE: '[data-toggle="modal"]',
+ DATA_DISMISS: '[data-dismiss="modal"]',
+ FIXED_CONTENT: '.fixed-top, .fixed-bottom, .is-fixed, .sticky-top',
+ STICKY_CONTENT: '.sticky-top',
+ NAVBAR_TOGGLER: '.navbar-toggler'
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Modal =
+ /*#__PURE__*/
+ function () {
+ function Modal(element, config) {
+ this._config = this._getConfig(config);
+ this._element = element;
+ this._dialog = $$$1(element).find(Selector.DIALOG)[0];
+ this._backdrop = null;
+ this._isShown = false;
+ this._isBodyOverflowing = false;
+ this._ignoreBackdropClick = false;
+ this._originalBodyPadding = 0;
+ this._scrollbarWidth = 0;
+ } // Getters
+
+
+ var _proto = Modal.prototype;
+
+ // Public
+ _proto.toggle = function toggle(relatedTarget) {
+ return this._isShown ? this.hide() : this.show(relatedTarget);
+ };
+
+ _proto.show = function show(relatedTarget) {
+ var _this = this;
+
+ if (this._isTransitioning || this._isShown) {
+ return;
+ }
+
+ if (Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.FADE)) {
+ this._isTransitioning = true;
+ }
+
+ var showEvent = $$$1.Event(Event.SHOW, {
+ relatedTarget: relatedTarget
+ });
+ $$$1(this._element).trigger(showEvent);
+
+ if (this._isShown || showEvent.isDefaultPrevented()) {
+ return;
+ }
+
+ this._isShown = true;
+
+ this._checkScrollbar();
+
+ this._setScrollbar();
+
+ this._adjustDialog();
+
+ $$$1(document.body).addClass(ClassName.OPEN);
+
+ this._setEscapeEvent();
+
+ this._setResizeEvent();
+
+ $$$1(this._element).on(Event.CLICK_DISMISS, Selector.DATA_DISMISS, function (event) {
+ return _this.hide(event);
+ });
+ $$$1(this._dialog).on(Event.MOUSEDOWN_DISMISS, function () {
+ $$$1(_this._element).one(Event.MOUSEUP_DISMISS, function (event) {
+ if ($$$1(event.target).is(_this._element)) {
+ _this._ignoreBackdropClick = true;
+ }
+ });
+ });
+
+ this._showBackdrop(function () {
+ return _this._showElement(relatedTarget);
+ });
+ };
+
+ _proto.hide = function hide(event) {
+ var _this2 = this;
+
+ if (event) {
+ event.preventDefault();
+ }
+
+ if (this._isTransitioning || !this._isShown) {
+ return;
+ }
+
+ var hideEvent = $$$1.Event(Event.HIDE);
+ $$$1(this._element).trigger(hideEvent);
+
+ if (!this._isShown || hideEvent.isDefaultPrevented()) {
+ return;
+ }
+
+ this._isShown = false;
+ var transition = Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.FADE);
+
+ if (transition) {
+ this._isTransitioning = true;
+ }
+
+ this._setEscapeEvent();
+
+ this._setResizeEvent();
+
+ $$$1(document).off(Event.FOCUSIN);
+ $$$1(this._element).removeClass(ClassName.SHOW);
+ $$$1(this._element).off(Event.CLICK_DISMISS);
+ $$$1(this._dialog).off(Event.MOUSEDOWN_DISMISS);
+
+ if (transition) {
+ $$$1(this._element).one(Util.TRANSITION_END, function (event) {
+ return _this2._hideModal(event);
+ }).emulateTransitionEnd(TRANSITION_DURATION);
+ } else {
+ this._hideModal();
+ }
+ };
+
+ _proto.dispose = function dispose() {
+ $$$1.removeData(this._element, DATA_KEY);
+ $$$1(window, document, this._element, this._backdrop).off(EVENT_KEY);
+ this._config = null;
+ this._element = null;
+ this._dialog = null;
+ this._backdrop = null;
+ this._isShown = null;
+ this._isBodyOverflowing = null;
+ this._ignoreBackdropClick = null;
+ this._scrollbarWidth = null;
+ };
+
+ _proto.handleUpdate = function handleUpdate() {
+ this._adjustDialog();
+ }; // Private
+
+
+ _proto._getConfig = function _getConfig(config) {
+ config = _extends({}, Default, config);
+ Util.typeCheckConfig(NAME, config, DefaultType);
+ return config;
+ };
+
+ _proto._showElement = function _showElement(relatedTarget) {
+ var _this3 = this;
+
+ var transition = Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.FADE);
+
+ if (!this._element.parentNode || this._element.parentNode.nodeType !== Node.ELEMENT_NODE) {
+ // Don't move modal's DOM position
+ document.body.appendChild(this._element);
+ }
+
+ this._element.style.display = 'block';
+
+ this._element.removeAttribute('aria-hidden');
+
+ this._element.scrollTop = 0;
+
+ if (transition) {
+ Util.reflow(this._element);
+ }
+
+ $$$1(this._element).addClass(ClassName.SHOW);
+
+ if (this._config.focus) {
+ this._enforceFocus();
+ }
+
+ var shownEvent = $$$1.Event(Event.SHOWN, {
+ relatedTarget: relatedTarget
+ });
+
+ var transitionComplete = function transitionComplete() {
+ if (_this3._config.focus) {
+ _this3._element.focus();
+ }
+
+ _this3._isTransitioning = false;
+ $$$1(_this3._element).trigger(shownEvent);
+ };
+
+ if (transition) {
+ $$$1(this._dialog).one(Util.TRANSITION_END, transitionComplete).emulateTransitionEnd(TRANSITION_DURATION);
+ } else {
+ transitionComplete();
+ }
+ };
+
+ _proto._enforceFocus = function _enforceFocus() {
+ var _this4 = this;
+
+ $$$1(document).off(Event.FOCUSIN) // Guard against infinite focus loop
+ .on(Event.FOCUSIN, function (event) {
+ if (document !== event.target && _this4._element !== event.target && $$$1(_this4._element).has(event.target).length === 0) {
+ _this4._element.focus();
+ }
+ });
+ };
+
+ _proto._setEscapeEvent = function _setEscapeEvent() {
+ var _this5 = this;
+
+ if (this._isShown && this._config.keyboard) {
+ $$$1(this._element).on(Event.KEYDOWN_DISMISS, function (event) {
+ if (event.which === ESCAPE_KEYCODE) {
+ event.preventDefault();
+
+ _this5.hide();
+ }
+ });
+ } else if (!this._isShown) {
+ $$$1(this._element).off(Event.KEYDOWN_DISMISS);
+ }
+ };
+
+ _proto._setResizeEvent = function _setResizeEvent() {
+ var _this6 = this;
+
+ if (this._isShown) {
+ $$$1(window).on(Event.RESIZE, function (event) {
+ return _this6.handleUpdate(event);
+ });
+ } else {
+ $$$1(window).off(Event.RESIZE);
+ }
+ };
+
+ _proto._hideModal = function _hideModal() {
+ var _this7 = this;
+
+ this._element.style.display = 'none';
+
+ this._element.setAttribute('aria-hidden', true);
+
+ this._isTransitioning = false;
+
+ this._showBackdrop(function () {
+ $$$1(document.body).removeClass(ClassName.OPEN);
+
+ _this7._resetAdjustments();
+
+ _this7._resetScrollbar();
+
+ $$$1(_this7._element).trigger(Event.HIDDEN);
+ });
+ };
+
+ _proto._removeBackdrop = function _removeBackdrop() {
+ if (this._backdrop) {
+ $$$1(this._backdrop).remove();
+ this._backdrop = null;
+ }
+ };
+
+ _proto._showBackdrop = function _showBackdrop(callback) {
+ var _this8 = this;
+
+ var animate = $$$1(this._element).hasClass(ClassName.FADE) ? ClassName.FADE : '';
+
+ if (this._isShown && this._config.backdrop) {
+ var doAnimate = Util.supportsTransitionEnd() && animate;
+ this._backdrop = document.createElement('div');
+ this._backdrop.className = ClassName.BACKDROP;
+
+ if (animate) {
+ $$$1(this._backdrop).addClass(animate);
+ }
+
+ $$$1(this._backdrop).appendTo(document.body);
+ $$$1(this._element).on(Event.CLICK_DISMISS, function (event) {
+ if (_this8._ignoreBackdropClick) {
+ _this8._ignoreBackdropClick = false;
+ return;
+ }
+
+ if (event.target !== event.currentTarget) {
+ return;
+ }
+
+ if (_this8._config.backdrop === 'static') {
+ _this8._element.focus();
+ } else {
+ _this8.hide();
+ }
+ });
+
+ if (doAnimate) {
+ Util.reflow(this._backdrop);
+ }
+
+ $$$1(this._backdrop).addClass(ClassName.SHOW);
+
+ if (!callback) {
+ return;
+ }
+
+ if (!doAnimate) {
+ callback();
+ return;
+ }
+
+ $$$1(this._backdrop).one(Util.TRANSITION_END, callback).emulateTransitionEnd(BACKDROP_TRANSITION_DURATION);
+ } else if (!this._isShown && this._backdrop) {
+ $$$1(this._backdrop).removeClass(ClassName.SHOW);
+
+ var callbackRemove = function callbackRemove() {
+ _this8._removeBackdrop();
+
+ if (callback) {
+ callback();
+ }
+ };
+
+ if (Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.FADE)) {
+ $$$1(this._backdrop).one(Util.TRANSITION_END, callbackRemove).emulateTransitionEnd(BACKDROP_TRANSITION_DURATION);
+ } else {
+ callbackRemove();
+ }
+ } else if (callback) {
+ callback();
+ }
+ }; // ----------------------------------------------------------------------
+ // the following methods are used to handle overflowing modals
+ // todo (fat): these should probably be refactored out of modal.js
+ // ----------------------------------------------------------------------
+
+
+ _proto._adjustDialog = function _adjustDialog() {
+ var isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight;
+
+ if (!this._isBodyOverflowing && isModalOverflowing) {
+ this._element.style.paddingLeft = this._scrollbarWidth + "px";
+ }
+
+ if (this._isBodyOverflowing && !isModalOverflowing) {
+ this._element.style.paddingRight = this._scrollbarWidth + "px";
+ }
+ };
+
+ _proto._resetAdjustments = function _resetAdjustments() {
+ this._element.style.paddingLeft = '';
+ this._element.style.paddingRight = '';
+ };
+
+ _proto._checkScrollbar = function _checkScrollbar() {
+ var rect = document.body.getBoundingClientRect();
+ this._isBodyOverflowing = rect.left + rect.right < window.innerWidth;
+ this._scrollbarWidth = this._getScrollbarWidth();
+ };
+
+ _proto._setScrollbar = function _setScrollbar() {
+ var _this9 = this;
+
+ if (this._isBodyOverflowing) {
+ // Note: DOMNode.style.paddingRight returns the actual value or '' if not set
+ // while $(DOMNode).css('padding-right') returns the calculated value or 0 if not set
+ // Adjust fixed content padding
+ $$$1(Selector.FIXED_CONTENT).each(function (index, element) {
+ var actualPadding = $$$1(element)[0].style.paddingRight;
+ var calculatedPadding = $$$1(element).css('padding-right');
+ $$$1(element).data('padding-right', actualPadding).css('padding-right', parseFloat(calculatedPadding) + _this9._scrollbarWidth + "px");
+ }); // Adjust sticky content margin
+
+ $$$1(Selector.STICKY_CONTENT).each(function (index, element) {
+ var actualMargin = $$$1(element)[0].style.marginRight;
+ var calculatedMargin = $$$1(element).css('margin-right');
+ $$$1(element).data('margin-right', actualMargin).css('margin-right', parseFloat(calculatedMargin) - _this9._scrollbarWidth + "px");
+ }); // Adjust navbar-toggler margin
+
+ $$$1(Selector.NAVBAR_TOGGLER).each(function (index, element) {
+ var actualMargin = $$$1(element)[0].style.marginRight;
+ var calculatedMargin = $$$1(element).css('margin-right');
+ $$$1(element).data('margin-right', actualMargin).css('margin-right', parseFloat(calculatedMargin) + _this9._scrollbarWidth + "px");
+ }); // Adjust body padding
+
+ var actualPadding = document.body.style.paddingRight;
+ var calculatedPadding = $$$1('body').css('padding-right');
+ $$$1('body').data('padding-right', actualPadding).css('padding-right', parseFloat(calculatedPadding) + this._scrollbarWidth + "px");
+ }
+ };
+
+ _proto._resetScrollbar = function _resetScrollbar() {
+ // Restore fixed content padding
+ $$$1(Selector.FIXED_CONTENT).each(function (index, element) {
+ var padding = $$$1(element).data('padding-right');
+
+ if (typeof padding !== 'undefined') {
+ $$$1(element).css('padding-right', padding).removeData('padding-right');
+ }
+ }); // Restore sticky content and navbar-toggler margin
+
+ $$$1(Selector.STICKY_CONTENT + ", " + Selector.NAVBAR_TOGGLER).each(function (index, element) {
+ var margin = $$$1(element).data('margin-right');
+
+ if (typeof margin !== 'undefined') {
+ $$$1(element).css('margin-right', margin).removeData('margin-right');
+ }
+ }); // Restore body padding
+
+ var padding = $$$1('body').data('padding-right');
+
+ if (typeof padding !== 'undefined') {
+ $$$1('body').css('padding-right', padding).removeData('padding-right');
+ }
+ };
+
+ _proto._getScrollbarWidth = function _getScrollbarWidth() {
+ // thx d.walsh
+ var scrollDiv = document.createElement('div');
+ scrollDiv.className = ClassName.SCROLLBAR_MEASURER;
+ document.body.appendChild(scrollDiv);
+ var scrollbarWidth = scrollDiv.getBoundingClientRect().width - scrollDiv.clientWidth;
+ document.body.removeChild(scrollDiv);
+ return scrollbarWidth;
+ }; // Static
+
+
+ Modal._jQueryInterface = function _jQueryInterface(config, relatedTarget) {
+ return this.each(function () {
+ var data = $$$1(this).data(DATA_KEY);
+
+ var _config = _extends({}, Modal.Default, $$$1(this).data(), typeof config === 'object' && config);
+
+ if (!data) {
+ data = new Modal(this, _config);
+ $$$1(this).data(DATA_KEY, data);
+ }
+
+ if (typeof config === 'string') {
+ if (typeof data[config] === 'undefined') {
+ throw new TypeError("No method named \"" + config + "\"");
+ }
+
+ data[config](relatedTarget);
+ } else if (_config.show) {
+ data.show(relatedTarget);
+ }
+ });
+ };
+
+ _createClass(Modal, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION;
+ }
+ }, {
+ key: "Default",
+ get: function get() {
+ return Default;
+ }
+ }]);
+ return Modal;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * Data Api implementation
+ * ------------------------------------------------------------------------
+ */
+
+
+ $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) {
+ var _this10 = this;
+
+ var target;
+ var selector = Util.getSelectorFromElement(this);
+
+ if (selector) {
+ target = $$$1(selector)[0];
+ }
+
+ var config = $$$1(target).data(DATA_KEY) ? 'toggle' : _extends({}, $$$1(target).data(), $$$1(this).data());
+
+ if (this.tagName === 'A' || this.tagName === 'AREA') {
+ event.preventDefault();
+ }
+
+ var $target = $$$1(target).one(Event.SHOW, function (showEvent) {
+ if (showEvent.isDefaultPrevented()) {
+ // Only register focus restorer if modal will actually get shown
+ return;
+ }
+
+ $target.one(Event.HIDDEN, function () {
+ if ($$$1(_this10).is(':visible')) {
+ _this10.focus();
+ }
+ });
+ });
+
+ Modal._jQueryInterface.call($$$1(target), config, this);
+ });
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+ $$$1.fn[NAME] = Modal._jQueryInterface;
+ $$$1.fn[NAME].Constructor = Modal;
+
+ $$$1.fn[NAME].noConflict = function () {
+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
+ return Modal._jQueryInterface;
+ };
+
+ return Modal;
+}($);
+
+/**
+ * --------------------------------------------------------------------------
+ * Bootstrap (v4.0.0): tooltip.js
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * --------------------------------------------------------------------------
+ */
+
+var Tooltip = function ($$$1) {
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+ var NAME = 'tooltip';
+ var VERSION = '4.0.0';
+ var DATA_KEY = 'bs.tooltip';
+ var EVENT_KEY = "." + DATA_KEY;
+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
+ var TRANSITION_DURATION = 150;
+ var CLASS_PREFIX = 'bs-tooltip';
+ var BSCLS_PREFIX_REGEX = new RegExp("(^|\\s)" + CLASS_PREFIX + "\\S+", 'g');
+ var DefaultType = {
+ animation: 'boolean',
+ template: 'string',
+ title: '(string|element|function)',
+ trigger: 'string',
+ delay: '(number|object)',
+ html: 'boolean',
+ selector: '(string|boolean)',
+ placement: '(string|function)',
+ offset: '(number|string)',
+ container: '(string|element|boolean)',
+ fallbackPlacement: '(string|array)',
+ boundary: '(string|element)'
+ };
+ var AttachmentMap = {
+ AUTO: 'auto',
+ TOP: 'top',
+ RIGHT: 'right',
+ BOTTOM: 'bottom',
+ LEFT: 'left'
+ };
+ var Default = {
+ animation: true,
+ template: '<div class="tooltip" role="tooltip">' + '<div class="arrow"></div>' + '<div class="tooltip-inner"></div></div>',
+ trigger: 'hover focus',
+ title: '',
+ delay: 0,
+ html: false,
+ selector: false,
+ placement: 'top',
+ offset: 0,
+ container: false,
+ fallbackPlacement: 'flip',
+ boundary: 'scrollParent'
+ };
+ var HoverState = {
+ SHOW: 'show',
+ OUT: 'out'
+ };
+ var Event = {
+ HIDE: "hide" + EVENT_KEY,
+ HIDDEN: "hidden" + EVENT_KEY,
+ SHOW: "show" + EVENT_KEY,
+ SHOWN: "shown" + EVENT_KEY,
+ INSERTED: "inserted" + EVENT_KEY,
+ CLICK: "click" + EVENT_KEY,
+ FOCUSIN: "focusin" + EVENT_KEY,
+ FOCUSOUT: "focusout" + EVENT_KEY,
+ MOUSEENTER: "mouseenter" + EVENT_KEY,
+ MOUSELEAVE: "mouseleave" + EVENT_KEY
+ };
+ var ClassName = {
+ FADE: 'fade',
+ SHOW: 'show'
+ };
+ var Selector = {
+ TOOLTIP: '.tooltip',
+ TOOLTIP_INNER: '.tooltip-inner',
+ ARROW: '.arrow'
+ };
+ var Trigger = {
+ HOVER: 'hover',
+ FOCUS: 'focus',
+ CLICK: 'click',
+ MANUAL: 'manual'
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Tooltip =
+ /*#__PURE__*/
+ function () {
+ function Tooltip(element, config) {
+ /**
+ * Check for Popper dependency
+ * Popper - https://popper.js.org
+ */
+ if (typeof Popper === 'undefined') {
+ throw new TypeError('Bootstrap tooltips require Popper.js (https://popper.js.org)');
+ } // private
+
+
+ this._isEnabled = true;
+ this._timeout = 0;
+ this._hoverState = '';
+ this._activeTrigger = {};
+ this._popper = null; // Protected
+
+ this.element = element;
+ this.config = this._getConfig(config);
+ this.tip = null;
+
+ this._setListeners();
+ } // Getters
+
+
+ var _proto = Tooltip.prototype;
+
+ // Public
+ _proto.enable = function enable() {
+ this._isEnabled = true;
+ };
+
+ _proto.disable = function disable() {
+ this._isEnabled = false;
+ };
+
+ _proto.toggleEnabled = function toggleEnabled() {
+ this._isEnabled = !this._isEnabled;
+ };
+
+ _proto.toggle = function toggle(event) {
+ if (!this._isEnabled) {
+ return;
+ }
+
+ if (event) {
+ var dataKey = this.constructor.DATA_KEY;
+ var context = $$$1(event.currentTarget).data(dataKey);
+
+ if (!context) {
+ context = new this.constructor(event.currentTarget, this._getDelegateConfig());
+ $$$1(event.currentTarget).data(dataKey, context);
+ }
+
+ context._activeTrigger.click = !context._activeTrigger.click;
+
+ if (context._isWithActiveTrigger()) {
+ context._enter(null, context);
+ } else {
+ context._leave(null, context);
+ }
+ } else {
+ if ($$$1(this.getTipElement()).hasClass(ClassName.SHOW)) {
+ this._leave(null, this);
+
+ return;
+ }
+
+ this._enter(null, this);
+ }
+ };
+
+ _proto.dispose = function dispose() {
+ clearTimeout(this._timeout);
+ $$$1.removeData(this.element, this.constructor.DATA_KEY);
+ $$$1(this.element).off(this.constructor.EVENT_KEY);
+ $$$1(this.element).closest('.modal').off('hide.bs.modal');
+
+ if (this.tip) {
+ $$$1(this.tip).remove();
+ }
+
+ this._isEnabled = null;
+ this._timeout = null;
+ this._hoverState = null;
+ this._activeTrigger = null;
+
+ if (this._popper !== null) {
+ this._popper.destroy();
+ }
+
+ this._popper = null;
+ this.element = null;
+ this.config = null;
+ this.tip = null;
+ };
+
+ _proto.show = function show() {
+ var _this = this;
+
+ if ($$$1(this.element).css('display') === 'none') {
+ throw new Error('Please use show on visible elements');
+ }
+
+ var showEvent = $$$1.Event(this.constructor.Event.SHOW);
+
+ if (this.isWithContent() && this._isEnabled) {
+ $$$1(this.element).trigger(showEvent);
+ var isInTheDom = $$$1.contains(this.element.ownerDocument.documentElement, this.element);
+
+ if (showEvent.isDefaultPrevented() || !isInTheDom) {
+ return;
+ }
+
+ var tip = this.getTipElement();
+ var tipId = Util.getUID(this.constructor.NAME);
+ tip.setAttribute('id', tipId);
+ this.element.setAttribute('aria-describedby', tipId);
+ this.setContent();
+
+ if (this.config.animation) {
+ $$$1(tip).addClass(ClassName.FADE);
+ }
+
+ var placement = typeof this.config.placement === 'function' ? this.config.placement.call(this, tip, this.element) : this.config.placement;
+
+ var attachment = this._getAttachment(placement);
+
+ this.addAttachmentClass(attachment);
+ var container = this.config.container === false ? document.body : $$$1(this.config.container);
+ $$$1(tip).data(this.constructor.DATA_KEY, this);
+
+ if (!$$$1.contains(this.element.ownerDocument.documentElement, this.tip)) {
+ $$$1(tip).appendTo(container);
+ }
+
+ $$$1(this.element).trigger(this.constructor.Event.INSERTED);
+ this._popper = new Popper(this.element, tip, {
+ placement: attachment,
+ modifiers: {
+ offset: {
+ offset: this.config.offset
+ },
+ flip: {
+ behavior: this.config.fallbackPlacement
+ },
+ arrow: {
+ element: Selector.ARROW
+ },
+ preventOverflow: {
+ boundariesElement: this.config.boundary
+ }
+ },
+ onCreate: function onCreate(data) {
+ if (data.originalPlacement !== data.placement) {
+ _this._handlePopperPlacementChange(data);
+ }
+ },
+ onUpdate: function onUpdate(data) {
+ _this._handlePopperPlacementChange(data);
+ }
+ });
+ $$$1(tip).addClass(ClassName.SHOW); // If this is a touch-enabled device we add extra
+ // empty mouseover listeners to the body's immediate children;
+ // only needed because of broken event delegation on iOS
+ // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html
+
+ if ('ontouchstart' in document.documentElement) {
+ $$$1('body').children().on('mouseover', null, $$$1.noop);
+ }
+
+ var complete = function complete() {
+ if (_this.config.animation) {
+ _this._fixTransition();
+ }
+
+ var prevHoverState = _this._hoverState;
+ _this._hoverState = null;
+ $$$1(_this.element).trigger(_this.constructor.Event.SHOWN);
+
+ if (prevHoverState === HoverState.OUT) {
+ _this._leave(null, _this);
+ }
+ };
+
+ if (Util.supportsTransitionEnd() && $$$1(this.tip).hasClass(ClassName.FADE)) {
+ $$$1(this.tip).one(Util.TRANSITION_END, complete).emulateTransitionEnd(Tooltip._TRANSITION_DURATION);
+ } else {
+ complete();
+ }
+ }
+ };
+
+ _proto.hide = function hide(callback) {
+ var _this2 = this;
+
+ var tip = this.getTipElement();
+ var hideEvent = $$$1.Event(this.constructor.Event.HIDE);
+
+ var complete = function complete() {
+ if (_this2._hoverState !== HoverState.SHOW && tip.parentNode) {
+ tip.parentNode.removeChild(tip);
+ }
+
+ _this2._cleanTipClass();
+
+ _this2.element.removeAttribute('aria-describedby');
+
+ $$$1(_this2.element).trigger(_this2.constructor.Event.HIDDEN);
+
+ if (_this2._popper !== null) {
+ _this2._popper.destroy();
+ }
+
+ if (callback) {
+ callback();
+ }
+ };
+
+ $$$1(this.element).trigger(hideEvent);
+
+ if (hideEvent.isDefaultPrevented()) {
+ return;
+ }
+
+ $$$1(tip).removeClass(ClassName.SHOW); // If this is a touch-enabled device we remove the extra
+ // empty mouseover listeners we added for iOS support
+
+ if ('ontouchstart' in document.documentElement) {
+ $$$1('body').children().off('mouseover', null, $$$1.noop);
+ }
+
+ this._activeTrigger[Trigger.CLICK] = false;
+ this._activeTrigger[Trigger.FOCUS] = false;
+ this._activeTrigger[Trigger.HOVER] = false;
+
+ if (Util.supportsTransitionEnd() && $$$1(this.tip).hasClass(ClassName.FADE)) {
+ $$$1(tip).one(Util.TRANSITION_END, complete).emulateTransitionEnd(TRANSITION_DURATION);
+ } else {
+ complete();
+ }
+
+ this._hoverState = '';
+ };
+
+ _proto.update = function update() {
+ if (this._popper !== null) {
+ this._popper.scheduleUpdate();
+ }
+ }; // Protected
+
+
+ _proto.isWithContent = function isWithContent() {
+ return Boolean(this.getTitle());
+ };
+
+ _proto.addAttachmentClass = function addAttachmentClass(attachment) {
+ $$$1(this.getTipElement()).addClass(CLASS_PREFIX + "-" + attachment);
+ };
+
+ _proto.getTipElement = function getTipElement() {
+ this.tip = this.tip || $$$1(this.config.template)[0];
+ return this.tip;
+ };
+
+ _proto.setContent = function setContent() {
+ var $tip = $$$1(this.getTipElement());
+ this.setElementContent($tip.find(Selector.TOOLTIP_INNER), this.getTitle());
+ $tip.removeClass(ClassName.FADE + " " + ClassName.SHOW);
+ };
+
+ _proto.setElementContent = function setElementContent($element, content) {
+ var html = this.config.html;
+
+ if (typeof content === 'object' && (content.nodeType || content.jquery)) {
+ // Content is a DOM node or a jQuery
+ if (html) {
+ if (!$$$1(content).parent().is($element)) {
+ $element.empty().append(content);
+ }
+ } else {
+ $element.text($$$1(content).text());
+ }
+ } else {
+ $element[html ? 'html' : 'text'](content);
+ }
+ };
+
+ _proto.getTitle = function getTitle() {
+ var title = this.element.getAttribute('data-original-title');
+
+ if (!title) {
+ title = typeof this.config.title === 'function' ? this.config.title.call(this.element) : this.config.title;
+ }
+
+ return title;
+ }; // Private
+
+
+ _proto._getAttachment = function _getAttachment(placement) {
+ return AttachmentMap[placement.toUpperCase()];
+ };
+
+ _proto._setListeners = function _setListeners() {
+ var _this3 = this;
+
+ var triggers = this.config.trigger.split(' ');
+ triggers.forEach(function (trigger) {
+ if (trigger === 'click') {
+ $$$1(_this3.element).on(_this3.constructor.Event.CLICK, _this3.config.selector, function (event) {
+ return _this3.toggle(event);
+ });
+ } else if (trigger !== Trigger.MANUAL) {
+ var eventIn = trigger === Trigger.HOVER ? _this3.constructor.Event.MOUSEENTER : _this3.constructor.Event.FOCUSIN;
+ var eventOut = trigger === Trigger.HOVER ? _this3.constructor.Event.MOUSELEAVE : _this3.constructor.Event.FOCUSOUT;
+ $$$1(_this3.element).on(eventIn, _this3.config.selector, function (event) {
+ return _this3._enter(event);
+ }).on(eventOut, _this3.config.selector, function (event) {
+ return _this3._leave(event);
+ });
+ }
+
+ $$$1(_this3.element).closest('.modal').on('hide.bs.modal', function () {
+ return _this3.hide();
+ });
+ });
+
+ if (this.config.selector) {
+ this.config = _extends({}, this.config, {
+ trigger: 'manual',
+ selector: ''
+ });
+ } else {
+ this._fixTitle();
+ }
+ };
+
+ _proto._fixTitle = function _fixTitle() {
+ var titleType = typeof this.element.getAttribute('data-original-title');
+
+ if (this.element.getAttribute('title') || titleType !== 'string') {
+ this.element.setAttribute('data-original-title', this.element.getAttribute('title') || '');
+ this.element.setAttribute('title', '');
+ }
+ };
+
+ _proto._enter = function _enter(event, context) {
+ var dataKey = this.constructor.DATA_KEY;
+ context = context || $$$1(event.currentTarget).data(dataKey);
+
+ if (!context) {
+ context = new this.constructor(event.currentTarget, this._getDelegateConfig());
+ $$$1(event.currentTarget).data(dataKey, context);
+ }
+
+ if (event) {
+ context._activeTrigger[event.type === 'focusin' ? Trigger.FOCUS : Trigger.HOVER] = true;
+ }
+
+ if ($$$1(context.getTipElement()).hasClass(ClassName.SHOW) || context._hoverState === HoverState.SHOW) {
+ context._hoverState = HoverState.SHOW;
+ return;
+ }
+
+ clearTimeout(context._timeout);
+ context._hoverState = HoverState.SHOW;
+
+ if (!context.config.delay || !context.config.delay.show) {
+ context.show();
+ return;
+ }
+
+ context._timeout = setTimeout(function () {
+ if (context._hoverState === HoverState.SHOW) {
+ context.show();
+ }
+ }, context.config.delay.show);
+ };
+
+ _proto._leave = function _leave(event, context) {
+ var dataKey = this.constructor.DATA_KEY;
+ context = context || $$$1(event.currentTarget).data(dataKey);
+
+ if (!context) {
+ context = new this.constructor(event.currentTarget, this._getDelegateConfig());
+ $$$1(event.currentTarget).data(dataKey, context);
+ }
+
+ if (event) {
+ context._activeTrigger[event.type === 'focusout' ? Trigger.FOCUS : Trigger.HOVER] = false;
+ }
+
+ if (context._isWithActiveTrigger()) {
+ return;
+ }
+
+ clearTimeout(context._timeout);
+ context._hoverState = HoverState.OUT;
+
+ if (!context.config.delay || !context.config.delay.hide) {
+ context.hide();
+ return;
+ }
+
+ context._timeout = setTimeout(function () {
+ if (context._hoverState === HoverState.OUT) {
+ context.hide();
+ }
+ }, context.config.delay.hide);
+ };
+
+ _proto._isWithActiveTrigger = function _isWithActiveTrigger() {
+ for (var trigger in this._activeTrigger) {
+ if (this._activeTrigger[trigger]) {
+ return true;
+ }
+ }
+
+ return false;
+ };
+
+ _proto._getConfig = function _getConfig(config) {
+ config = _extends({}, this.constructor.Default, $$$1(this.element).data(), config);
+
+ if (typeof config.delay === 'number') {
+ config.delay = {
+ show: config.delay,
+ hide: config.delay
+ };
+ }
+
+ if (typeof config.title === 'number') {
+ config.title = config.title.toString();
+ }
+
+ if (typeof config.content === 'number') {
+ config.content = config.content.toString();
+ }
+
+ Util.typeCheckConfig(NAME, config, this.constructor.DefaultType);
+ return config;
+ };
+
+ _proto._getDelegateConfig = function _getDelegateConfig() {
+ var config = {};
+
+ if (this.config) {
+ for (var key in this.config) {
+ if (this.constructor.Default[key] !== this.config[key]) {
+ config[key] = this.config[key];
+ }
+ }
+ }
+
+ return config;
+ };
+
+ _proto._cleanTipClass = function _cleanTipClass() {
+ var $tip = $$$1(this.getTipElement());
+ var tabClass = $tip.attr('class').match(BSCLS_PREFIX_REGEX);
+
+ if (tabClass !== null && tabClass.length > 0) {
+ $tip.removeClass(tabClass.join(''));
+ }
+ };
+
+ _proto._handlePopperPlacementChange = function _handlePopperPlacementChange(data) {
+ this._cleanTipClass();
+
+ this.addAttachmentClass(this._getAttachment(data.placement));
+ };
+
+ _proto._fixTransition = function _fixTransition() {
+ var tip = this.getTipElement();
+ var initConfigAnimation = this.config.animation;
+
+ if (tip.getAttribute('x-placement') !== null) {
+ return;
+ }
+
+ $$$1(tip).removeClass(ClassName.FADE);
+ this.config.animation = false;
+ this.hide();
+ this.show();
+ this.config.animation = initConfigAnimation;
+ }; // Static
+
+
+ Tooltip._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var data = $$$1(this).data(DATA_KEY);
+
+ var _config = typeof config === 'object' && config;
+
+ if (!data && /dispose|hide/.test(config)) {
+ return;
+ }
+
+ if (!data) {
+ data = new Tooltip(this, _config);
+ $$$1(this).data(DATA_KEY, data);
+ }
+
+ if (typeof config === 'string') {
+ if (typeof data[config] === 'undefined') {
+ throw new TypeError("No method named \"" + config + "\"");
+ }
+
+ data[config]();
+ }
+ });
+ };
+
+ _createClass(Tooltip, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION;
+ }
+ }, {
+ key: "Default",
+ get: function get() {
+ return Default;
+ }
+ }, {
+ key: "NAME",
+ get: function get() {
+ return NAME;
+ }
+ }, {
+ key: "DATA_KEY",
+ get: function get() {
+ return DATA_KEY;
+ }
+ }, {
+ key: "Event",
+ get: function get() {
+ return Event;
+ }
+ }, {
+ key: "EVENT_KEY",
+ get: function get() {
+ return EVENT_KEY;
+ }
+ }, {
+ key: "DefaultType",
+ get: function get() {
+ return DefaultType;
+ }
+ }]);
+ return Tooltip;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+
+ $$$1.fn[NAME] = Tooltip._jQueryInterface;
+ $$$1.fn[NAME].Constructor = Tooltip;
+
+ $$$1.fn[NAME].noConflict = function () {
+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
+ return Tooltip._jQueryInterface;
+ };
+
+ return Tooltip;
+}($, Popper);
+
+/**
+ * --------------------------------------------------------------------------
+ * Bootstrap (v4.0.0): popover.js
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * --------------------------------------------------------------------------
+ */
+
+var Popover = function ($$$1) {
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+ var NAME = 'popover';
+ var VERSION = '4.0.0';
+ var DATA_KEY = 'bs.popover';
+ var EVENT_KEY = "." + DATA_KEY;
+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
+ var CLASS_PREFIX = 'bs-popover';
+ var BSCLS_PREFIX_REGEX = new RegExp("(^|\\s)" + CLASS_PREFIX + "\\S+", 'g');
+ var Default = _extends({}, Tooltip.Default, {
+ placement: 'right',
+ trigger: 'click',
+ content: '',
+ template: '<div class="popover" role="tooltip">' + '<div class="arrow"></div>' + '<h3 class="popover-header"></h3>' + '<div class="popover-body"></div></div>'
+ });
+ var DefaultType = _extends({}, Tooltip.DefaultType, {
+ content: '(string|element|function)'
+ });
+ var ClassName = {
+ FADE: 'fade',
+ SHOW: 'show'
+ };
+ var Selector = {
+ TITLE: '.popover-header',
+ CONTENT: '.popover-body'
+ };
+ var Event = {
+ HIDE: "hide" + EVENT_KEY,
+ HIDDEN: "hidden" + EVENT_KEY,
+ SHOW: "show" + EVENT_KEY,
+ SHOWN: "shown" + EVENT_KEY,
+ INSERTED: "inserted" + EVENT_KEY,
+ CLICK: "click" + EVENT_KEY,
+ FOCUSIN: "focusin" + EVENT_KEY,
+ FOCUSOUT: "focusout" + EVENT_KEY,
+ MOUSEENTER: "mouseenter" + EVENT_KEY,
+ MOUSELEAVE: "mouseleave" + EVENT_KEY
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Popover =
+ /*#__PURE__*/
+ function (_Tooltip) {
+ _inheritsLoose(Popover, _Tooltip);
+
+ function Popover() {
+ return _Tooltip.apply(this, arguments) || this;
+ }
+
+ var _proto = Popover.prototype;
+
+ // Overrides
+ _proto.isWithContent = function isWithContent() {
+ return this.getTitle() || this._getContent();
+ };
+
+ _proto.addAttachmentClass = function addAttachmentClass(attachment) {
+ $$$1(this.getTipElement()).addClass(CLASS_PREFIX + "-" + attachment);
+ };
+
+ _proto.getTipElement = function getTipElement() {
+ this.tip = this.tip || $$$1(this.config.template)[0];
+ return this.tip;
+ };
+
+ _proto.setContent = function setContent() {
+ var $tip = $$$1(this.getTipElement()); // We use append for html objects to maintain js events
+
+ this.setElementContent($tip.find(Selector.TITLE), this.getTitle());
+
+ var content = this._getContent();
+
+ if (typeof content === 'function') {
+ content = content.call(this.element);
+ }
+
+ this.setElementContent($tip.find(Selector.CONTENT), content);
+ $tip.removeClass(ClassName.FADE + " " + ClassName.SHOW);
+ }; // Private
+
+
+ _proto._getContent = function _getContent() {
+ return this.element.getAttribute('data-content') || this.config.content;
+ };
+
+ _proto._cleanTipClass = function _cleanTipClass() {
+ var $tip = $$$1(this.getTipElement());
+ var tabClass = $tip.attr('class').match(BSCLS_PREFIX_REGEX);
+
+ if (tabClass !== null && tabClass.length > 0) {
+ $tip.removeClass(tabClass.join(''));
+ }
+ }; // Static
+
+
+ Popover._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var data = $$$1(this).data(DATA_KEY);
+
+ var _config = typeof config === 'object' ? config : null;
+
+ if (!data && /destroy|hide/.test(config)) {
+ return;
+ }
+
+ if (!data) {
+ data = new Popover(this, _config);
+ $$$1(this).data(DATA_KEY, data);
+ }
+
+ if (typeof config === 'string') {
+ if (typeof data[config] === 'undefined') {
+ throw new TypeError("No method named \"" + config + "\"");
+ }
+
+ data[config]();
+ }
+ });
+ };
+
+ _createClass(Popover, null, [{
+ key: "VERSION",
+ // Getters
+ get: function get() {
+ return VERSION;
+ }
+ }, {
+ key: "Default",
+ get: function get() {
+ return Default;
+ }
+ }, {
+ key: "NAME",
+ get: function get() {
+ return NAME;
+ }
+ }, {
+ key: "DATA_KEY",
+ get: function get() {
+ return DATA_KEY;
+ }
+ }, {
+ key: "Event",
+ get: function get() {
+ return Event;
+ }
+ }, {
+ key: "EVENT_KEY",
+ get: function get() {
+ return EVENT_KEY;
+ }
+ }, {
+ key: "DefaultType",
+ get: function get() {
+ return DefaultType;
+ }
+ }]);
+ return Popover;
+ }(Tooltip);
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+
+ $$$1.fn[NAME] = Popover._jQueryInterface;
+ $$$1.fn[NAME].Constructor = Popover;
+
+ $$$1.fn[NAME].noConflict = function () {
+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
+ return Popover._jQueryInterface;
+ };
+
+ return Popover;
+}($);
+
+/**
+ * --------------------------------------------------------------------------
+ * Bootstrap (v4.0.0): scrollspy.js
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * --------------------------------------------------------------------------
+ */
+
+var ScrollSpy = function ($$$1) {
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+ var NAME = 'scrollspy';
+ var VERSION = '4.0.0';
+ var DATA_KEY = 'bs.scrollspy';
+ var EVENT_KEY = "." + DATA_KEY;
+ var DATA_API_KEY = '.data-api';
+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
+ var Default = {
+ offset: 10,
+ method: 'auto',
+ target: ''
+ };
+ var DefaultType = {
+ offset: 'number',
+ method: 'string',
+ target: '(string|element)'
+ };
+ var Event = {
+ ACTIVATE: "activate" + EVENT_KEY,
+ SCROLL: "scroll" + EVENT_KEY,
+ LOAD_DATA_API: "load" + EVENT_KEY + DATA_API_KEY
+ };
+ var ClassName = {
+ DROPDOWN_ITEM: 'dropdown-item',
+ DROPDOWN_MENU: 'dropdown-menu',
+ ACTIVE: 'active'
+ };
+ var Selector = {
+ DATA_SPY: '[data-spy="scroll"]',
+ ACTIVE: '.active',
+ NAV_LIST_GROUP: '.nav, .list-group',
+ NAV_LINKS: '.nav-link',
+ NAV_ITEMS: '.nav-item',
+ LIST_ITEMS: '.list-group-item',
+ DROPDOWN: '.dropdown',
+ DROPDOWN_ITEMS: '.dropdown-item',
+ DROPDOWN_TOGGLE: '.dropdown-toggle'
+ };
+ var OffsetMethod = {
+ OFFSET: 'offset',
+ POSITION: 'position'
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var ScrollSpy =
+ /*#__PURE__*/
+ function () {
+ function ScrollSpy(element, config) {
+ var _this = this;
+
+ this._element = element;
+ this._scrollElement = element.tagName === 'BODY' ? window : element;
+ this._config = this._getConfig(config);
+ this._selector = this._config.target + " " + Selector.NAV_LINKS + "," + (this._config.target + " " + Selector.LIST_ITEMS + ",") + (this._config.target + " " + Selector.DROPDOWN_ITEMS);
+ this._offsets = [];
+ this._targets = [];
+ this._activeTarget = null;
+ this._scrollHeight = 0;
+ $$$1(this._scrollElement).on(Event.SCROLL, function (event) {
+ return _this._process(event);
+ });
+ this.refresh();
+
+ this._process();
+ } // Getters
+
+
+ var _proto = ScrollSpy.prototype;
+
+ // Public
+ _proto.refresh = function refresh() {
+ var _this2 = this;
+
+ var autoMethod = this._scrollElement === this._scrollElement.window ? OffsetMethod.OFFSET : OffsetMethod.POSITION;
+ var offsetMethod = this._config.method === 'auto' ? autoMethod : this._config.method;
+ var offsetBase = offsetMethod === OffsetMethod.POSITION ? this._getScrollTop() : 0;
+ this._offsets = [];
+ this._targets = [];
+ this._scrollHeight = this._getScrollHeight();
+ var targets = $$$1.makeArray($$$1(this._selector));
+ targets.map(function (element) {
+ var target;
+ var targetSelector = Util.getSelectorFromElement(element);
+
+ if (targetSelector) {
+ target = $$$1(targetSelector)[0];
+ }
+
+ if (target) {
+ var targetBCR = target.getBoundingClientRect();
+
+ if (targetBCR.width || targetBCR.height) {
+ // TODO (fat): remove sketch reliance on jQuery position/offset
+ return [$$$1(target)[offsetMethod]().top + offsetBase, targetSelector];
+ }
+ }
+
+ return null;
+ }).filter(function (item) {
+ return item;
+ }).sort(function (a, b) {
+ return a[0] - b[0];
+ }).forEach(function (item) {
+ _this2._offsets.push(item[0]);
+
+ _this2._targets.push(item[1]);
+ });
+ };
+
+ _proto.dispose = function dispose() {
+ $$$1.removeData(this._element, DATA_KEY);
+ $$$1(this._scrollElement).off(EVENT_KEY);
+ this._element = null;
+ this._scrollElement = null;
+ this._config = null;
+ this._selector = null;
+ this._offsets = null;
+ this._targets = null;
+ this._activeTarget = null;
+ this._scrollHeight = null;
+ }; // Private
+
+
+ _proto._getConfig = function _getConfig(config) {
+ config = _extends({}, Default, config);
+
+ if (typeof config.target !== 'string') {
+ var id = $$$1(config.target).attr('id');
+
+ if (!id) {
+ id = Util.getUID(NAME);
+ $$$1(config.target).attr('id', id);
+ }
+
+ config.target = "#" + id;
+ }
+
+ Util.typeCheckConfig(NAME, config, DefaultType);
+ return config;
+ };
+
+ _proto._getScrollTop = function _getScrollTop() {
+ return this._scrollElement === window ? this._scrollElement.pageYOffset : this._scrollElement.scrollTop;
+ };
+
+ _proto._getScrollHeight = function _getScrollHeight() {
+ return this._scrollElement.scrollHeight || Math.max(document.body.scrollHeight, document.documentElement.scrollHeight);
+ };
+
+ _proto._getOffsetHeight = function _getOffsetHeight() {
+ return this._scrollElement === window ? window.innerHeight : this._scrollElement.getBoundingClientRect().height;
+ };
+
+ _proto._process = function _process() {
+ var scrollTop = this._getScrollTop() + this._config.offset;
+
+ var scrollHeight = this._getScrollHeight();
+
+ var maxScroll = this._config.offset + scrollHeight - this._getOffsetHeight();
+
+ if (this._scrollHeight !== scrollHeight) {
+ this.refresh();
+ }
+
+ if (scrollTop >= maxScroll) {
+ var target = this._targets[this._targets.length - 1];
+
+ if (this._activeTarget !== target) {
+ this._activate(target);
+ }
+
+ return;
+ }
+
+ if (this._activeTarget && scrollTop < this._offsets[0] && this._offsets[0] > 0) {
+ this._activeTarget = null;
+
+ this._clear();
+
+ return;
+ }
+
+ for (var i = this._offsets.length; i--;) {
+ var isActiveTarget = this._activeTarget !== this._targets[i] && scrollTop >= this._offsets[i] && (typeof this._offsets[i + 1] === 'undefined' || scrollTop < this._offsets[i + 1]);
+
+ if (isActiveTarget) {
+ this._activate(this._targets[i]);
+ }
+ }
+ };
+
+ _proto._activate = function _activate(target) {
+ this._activeTarget = target;
+
+ this._clear();
+
+ var queries = this._selector.split(','); // eslint-disable-next-line arrow-body-style
+
+
+ queries = queries.map(function (selector) {
+ return selector + "[data-target=\"" + target + "\"]," + (selector + "[href=\"" + target + "\"]");
+ });
+ var $link = $$$1(queries.join(','));
+
+ if ($link.hasClass(ClassName.DROPDOWN_ITEM)) {
+ $link.closest(Selector.DROPDOWN).find(Selector.DROPDOWN_TOGGLE).addClass(ClassName.ACTIVE);
+ $link.addClass(ClassName.ACTIVE);
+ } else {
+ // Set triggered link as active
+ $link.addClass(ClassName.ACTIVE); // Set triggered links parents as active
+ // With both <ul> and <nav> markup a parent is the previous sibling of any nav ancestor
+
+ $link.parents(Selector.NAV_LIST_GROUP).prev(Selector.NAV_LINKS + ", " + Selector.LIST_ITEMS).addClass(ClassName.ACTIVE); // Handle special case when .nav-link is inside .nav-item
+
+ $link.parents(Selector.NAV_LIST_GROUP).prev(Selector.NAV_ITEMS).children(Selector.NAV_LINKS).addClass(ClassName.ACTIVE);
+ }
+
+ $$$1(this._scrollElement).trigger(Event.ACTIVATE, {
+ relatedTarget: target
+ });
+ };
+
+ _proto._clear = function _clear() {
+ $$$1(this._selector).filter(Selector.ACTIVE).removeClass(ClassName.ACTIVE);
+ }; // Static
+
+
+ ScrollSpy._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var data = $$$1(this).data(DATA_KEY);
+
+ var _config = typeof config === 'object' && config;
+
+ if (!data) {
+ data = new ScrollSpy(this, _config);
+ $$$1(this).data(DATA_KEY, data);
+ }
+
+ if (typeof config === 'string') {
+ if (typeof data[config] === 'undefined') {
+ throw new TypeError("No method named \"" + config + "\"");
+ }
+
+ data[config]();
+ }
+ });
+ };
+
+ _createClass(ScrollSpy, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION;
+ }
+ }, {
+ key: "Default",
+ get: function get() {
+ return Default;
+ }
+ }]);
+ return ScrollSpy;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * Data Api implementation
+ * ------------------------------------------------------------------------
+ */
+
+
+ $$$1(window).on(Event.LOAD_DATA_API, function () {
+ var scrollSpys = $$$1.makeArray($$$1(Selector.DATA_SPY));
+
+ for (var i = scrollSpys.length; i--;) {
+ var $spy = $$$1(scrollSpys[i]);
+
+ ScrollSpy._jQueryInterface.call($spy, $spy.data());
+ }
+ });
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+ $$$1.fn[NAME] = ScrollSpy._jQueryInterface;
+ $$$1.fn[NAME].Constructor = ScrollSpy;
+
+ $$$1.fn[NAME].noConflict = function () {
+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
+ return ScrollSpy._jQueryInterface;
+ };
+
+ return ScrollSpy;
+}($);
+
+/**
+ * --------------------------------------------------------------------------
+ * Bootstrap (v4.0.0): tab.js
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * --------------------------------------------------------------------------
+ */
+
+var Tab = function ($$$1) {
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+ var NAME = 'tab';
+ var VERSION = '4.0.0';
+ var DATA_KEY = 'bs.tab';
+ var EVENT_KEY = "." + DATA_KEY;
+ var DATA_API_KEY = '.data-api';
+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
+ var TRANSITION_DURATION = 150;
+ var Event = {
+ HIDE: "hide" + EVENT_KEY,
+ HIDDEN: "hidden" + EVENT_KEY,
+ SHOW: "show" + EVENT_KEY,
+ SHOWN: "shown" + EVENT_KEY,
+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
+ };
+ var ClassName = {
+ DROPDOWN_MENU: 'dropdown-menu',
+ ACTIVE: 'active',
+ DISABLED: 'disabled',
+ FADE: 'fade',
+ SHOW: 'show'
+ };
+ var Selector = {
+ DROPDOWN: '.dropdown',
+ NAV_LIST_GROUP: '.nav, .list-group',
+ ACTIVE: '.active',
+ ACTIVE_UL: '> li > .active',
+ DATA_TOGGLE: '[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]',
+ DROPDOWN_TOGGLE: '.dropdown-toggle',
+ DROPDOWN_ACTIVE_CHILD: '> .dropdown-menu .active'
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Tab =
+ /*#__PURE__*/
+ function () {
+ function Tab(element) {
+ this._element = element;
+ } // Getters
+
+
+ var _proto = Tab.prototype;
+
+ // Public
+ _proto.show = function show() {
+ var _this = this;
+
+ if (this._element.parentNode && this._element.parentNode.nodeType === Node.ELEMENT_NODE && $$$1(this._element).hasClass(ClassName.ACTIVE) || $$$1(this._element).hasClass(ClassName.DISABLED)) {
+ return;
+ }
+
+ var target;
+ var previous;
+ var listElement = $$$1(this._element).closest(Selector.NAV_LIST_GROUP)[0];
+ var selector = Util.getSelectorFromElement(this._element);
+
+ if (listElement) {
+ var itemSelector = listElement.nodeName === 'UL' ? Selector.ACTIVE_UL : Selector.ACTIVE;
+ previous = $$$1.makeArray($$$1(listElement).find(itemSelector));
+ previous = previous[previous.length - 1];
+ }
+
+ var hideEvent = $$$1.Event(Event.HIDE, {
+ relatedTarget: this._element
+ });
+ var showEvent = $$$1.Event(Event.SHOW, {
+ relatedTarget: previous
+ });
+
+ if (previous) {
+ $$$1(previous).trigger(hideEvent);
+ }
+
+ $$$1(this._element).trigger(showEvent);
+
+ if (showEvent.isDefaultPrevented() || hideEvent.isDefaultPrevented()) {
+ return;
+ }
+
+ if (selector) {
+ target = $$$1(selector)[0];
+ }
+
+ this._activate(this._element, listElement);
+
+ var complete = function complete() {
+ var hiddenEvent = $$$1.Event(Event.HIDDEN, {
+ relatedTarget: _this._element
+ });
+ var shownEvent = $$$1.Event(Event.SHOWN, {
+ relatedTarget: previous
+ });
+ $$$1(previous).trigger(hiddenEvent);
+ $$$1(_this._element).trigger(shownEvent);
+ };
+
+ if (target) {
+ this._activate(target, target.parentNode, complete);
+ } else {
+ complete();
+ }
+ };
+
+ _proto.dispose = function dispose() {
+ $$$1.removeData(this._element, DATA_KEY);
+ this._element = null;
+ }; // Private
+
+
+ _proto._activate = function _activate(element, container, callback) {
+ var _this2 = this;
+
+ var activeElements;
+
+ if (container.nodeName === 'UL') {
+ activeElements = $$$1(container).find(Selector.ACTIVE_UL);
+ } else {
+ activeElements = $$$1(container).children(Selector.ACTIVE);
+ }
+
+ var active = activeElements[0];
+ var isTransitioning = callback && Util.supportsTransitionEnd() && active && $$$1(active).hasClass(ClassName.FADE);
+
+ var complete = function complete() {
+ return _this2._transitionComplete(element, active, callback);
+ };
+
+ if (active && isTransitioning) {
+ $$$1(active).one(Util.TRANSITION_END, complete).emulateTransitionEnd(TRANSITION_DURATION);
+ } else {
+ complete();
+ }
+ };
+
+ _proto._transitionComplete = function _transitionComplete(element, active, callback) {
+ if (active) {
+ $$$1(active).removeClass(ClassName.SHOW + " " + ClassName.ACTIVE);
+ var dropdownChild = $$$1(active.parentNode).find(Selector.DROPDOWN_ACTIVE_CHILD)[0];
+
+ if (dropdownChild) {
+ $$$1(dropdownChild).removeClass(ClassName.ACTIVE);
+ }
+
+ if (active.getAttribute('role') === 'tab') {
+ active.setAttribute('aria-selected', false);
+ }
+ }
+
+ $$$1(element).addClass(ClassName.ACTIVE);
+
+ if (element.getAttribute('role') === 'tab') {
+ element.setAttribute('aria-selected', true);
+ }
+
+ Util.reflow(element);
+ $$$1(element).addClass(ClassName.SHOW);
+
+ if (element.parentNode && $$$1(element.parentNode).hasClass(ClassName.DROPDOWN_MENU)) {
+ var dropdownElement = $$$1(element).closest(Selector.DROPDOWN)[0];
+
+ if (dropdownElement) {
+ $$$1(dropdownElement).find(Selector.DROPDOWN_TOGGLE).addClass(ClassName.ACTIVE);
+ }
+
+ element.setAttribute('aria-expanded', true);
+ }
+
+ if (callback) {
+ callback();
+ }
+ }; // Static
+
+
+ Tab._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var $this = $$$1(this);
+ var data = $this.data(DATA_KEY);
+
+ if (!data) {
+ data = new Tab(this);
+ $this.data(DATA_KEY, data);
+ }
+
+ if (typeof config === 'string') {
+ if (typeof data[config] === 'undefined') {
+ throw new TypeError("No method named \"" + config + "\"");
+ }
+
+ data[config]();
+ }
+ });
+ };
+
+ _createClass(Tab, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION;
+ }
+ }]);
+ return Tab;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * Data Api implementation
+ * ------------------------------------------------------------------------
+ */
+
+
+ $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) {
+ event.preventDefault();
+
+ Tab._jQueryInterface.call($$$1(this), 'show');
+ });
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+ $$$1.fn[NAME] = Tab._jQueryInterface;
+ $$$1.fn[NAME].Constructor = Tab;
+
+ $$$1.fn[NAME].noConflict = function () {
+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
+ return Tab._jQueryInterface;
+ };
+
+ return Tab;
+}($);
+
+/**
+ * --------------------------------------------------------------------------
+ * Bootstrap (v4.0.0-alpha.6): index.js
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * --------------------------------------------------------------------------
+ */
+
+(function ($$$1) {
+ if (typeof $$$1 === 'undefined') {
+ throw new TypeError('Bootstrap\'s JavaScript requires jQuery. jQuery must be included before Bootstrap\'s JavaScript.');
+ }
+
+ var version = $$$1.fn.jquery.split(' ')[0].split('.');
+ var minMajor = 1;
+ var ltMajor = 2;
+ var minMinor = 9;
+ var minPatch = 1;
+ var maxMajor = 4;
+
+ if (version[0] < ltMajor && version[1] < minMinor || version[0] === minMajor && version[1] === minMinor && version[2] < minPatch || version[0] >= maxMajor) {
+ throw new Error('Bootstrap\'s JavaScript requires at least jQuery v1.9.1 but less than v4.0.0');
+ }
+})($);
+
+exports.Util = Util;
+exports.Alert = Alert;
+exports.Button = Button;
+exports.Carousel = Carousel;
+exports.Collapse = Collapse;
+exports.Dropdown = Dropdown;
+exports.Modal = Modal;
+exports.Popover = Popover;
+exports.Scrollspy = ScrollSpy;
+exports.Tab = Tab;
+exports.Tooltip = Tooltip;
+
+Object.defineProperty(exports, '__esModule', { value: true });
+
+})));
+//# sourceMappingURL=bootstrap.bundle.js.map
diff --git a/chall/src/js/bootstrap.bundle.min.js b/chall/src/js/bootstrap.bundle.min.js
new file mode 100644
index 0000000..7d50e87
--- /dev/null
+++ b/chall/src/js/bootstrap.bundle.min.js
@@ -0,0 +1,7 @@
+/*!
+ * Bootstrap v4.0.0 (https://getbootstrap.com)
+ * Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ */
+!function(t,e){"object"==typeof exports&&"undefined"!=typeof module?e(exports,require("jquery")):"function"==typeof define&&define.amd?define(["exports","jquery"],e):e(t.bootstrap={},t.jQuery)}(this,function(t,e){"use strict";function n(t,e){for(var n=0;n<e.length;n++){var i=e[n];i.enumerable=i.enumerable||!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(t,i.key,i)}}function i(t,e,i){return e&&n(t.prototype,e),i&&n(t,i),t}function r(){return(r=Object.assign||function(t){for(var e=1;e<arguments.length;e++){var n=arguments[e];for(var i in n)Object.prototype.hasOwnProperty.call(n,i)&&(t[i]=n[i])}return t}).apply(this,arguments)}for(var o,s,a,l,c,h,f,u,d,p,g,m,_,v,E,y,b,T,C,w,I,A,D,S,O,N,k=function(t){var e=!1;function n(e){var n=this,r=!1;return t(this).one(i.TRANSITION_END,function(){r=!0}),setTimeout(function(){r||i.triggerTransitionEnd(n)},e),this}var i={TRANSITION_END:"bsTransitionEnd",getUID:function(t){do{t+=~~(1e6*Math.random())}while(document.getElementById(t));return t},getSelectorFromElement:function(e){var n,i=e.getAttribute("data-target");i&&"#"!==i||(i=e.getAttribute("href")||""),"#"===i.charAt(0)&&(n=i,i=n="function"==typeof t.escapeSelector?t.escapeSelector(n).substr(1):n.replace(/(:|\.|\[|\]|,|=|@)/g,"\\$1"));try{return t(document).find(i).length>0?i:null}catch(t){return null}},reflow:function(t){return t.offsetHeight},triggerTransitionEnd:function(n){t(n).trigger(e.end)},supportsTransitionEnd:function(){return Boolean(e)},isElement:function(t){return(t[0]||t).nodeType},typeCheckConfig:function(t,e,n){for(var r in n)if(Object.prototype.hasOwnProperty.call(n,r)){var o=n[r],s=e[r],a=s&&i.isElement(s)?"element":(l=s,{}.toString.call(l).match(/\s([a-zA-Z]+)/)[1].toLowerCase());if(!new RegExp(o).test(a))throw new Error(t.toUpperCase()+': Option "'+r+'" provided type "'+a+'" but expected type "'+o+'".')}var l}};return e=("undefined"==typeof window||!window.QUnit)&&{end:"transitionend"},t.fn.emulateTransitionEnd=n,i.supportsTransitionEnd()&&(t.event.special[i.TRANSITION_END]={bindType:e.end,delegateType:e.end,handle:function(e){if(t(e.target).is(this))return e.handleObj.handler.apply(this,arguments)}}),i}(e=e&&e.hasOwnProperty("default")?e.default:e),L=(s="alert",l="."+(a="bs.alert"),c=(o=e).fn[s],h={CLOSE:"close"+l,CLOSED:"closed"+l,CLICK_DATA_API:"click"+l+".data-api"},f="alert",u="fade",d="show",p=function(){function t(t){this._element=t}var e=t.prototype;return e.close=function(t){t=t||this._element;var e=this._getRootElement(t);this._triggerCloseEvent(e).isDefaultPrevented()||this._removeElement(e)},e.dispose=function(){o.removeData(this._element,a),this._element=null},e._getRootElement=function(t){var e=k.getSelectorFromElement(t),n=!1;return e&&(n=o(e)[0]),n||(n=o(t).closest("."+f)[0]),n},e._triggerCloseEvent=function(t){var e=o.Event(h.CLOSE);return o(t).trigger(e),e},e._removeElement=function(t){var e=this;o(t).removeClass(d),k.supportsTransitionEnd()&&o(t).hasClass(u)?o(t).one(k.TRANSITION_END,function(n){return e._destroyElement(t,n)}).emulateTransitionEnd(150):this._destroyElement(t)},e._destroyElement=function(t){o(t).detach().trigger(h.CLOSED).remove()},t._jQueryInterface=function(e){return this.each(function(){var n=o(this),i=n.data(a);i||(i=new t(this),n.data(a,i)),"close"===e&&i[e](this)})},t._handleDismiss=function(t){return function(e){e&&e.preventDefault(),t.close(this)}},i(t,null,[{key:"VERSION",get:function(){return"4.0.0"}}]),t}(),o(document).on(h.CLICK_DATA_API,'[data-dismiss="alert"]',p._handleDismiss(new p)),o.fn[s]=p._jQueryInterface,o.fn[s].Constructor=p,o.fn[s].noConflict=function(){return o.fn[s]=c,p._jQueryInterface},p),P=(m="button",v="."+(_="bs.button"),E=".data-api",y=(g=e).fn[m],b="active",T="btn",C="focus",w='[data-toggle^="button"]',I='[data-toggle="buttons"]',A="input",D=".active",S=".btn",O={CLICK_DATA_API:"click"+v+E,FOCUS_BLUR_DATA_API:"focus"+v+E+" blur"+v+E},N=function(){function t(t){this._element=t}var e=t.prototype;return e.toggle=function(){var t=!0,e=!0,n=g(this._element).closest(I)[0];if(n){var i=g(this._element).find(A)[0];if(i){if("radio"===i.type)if(i.checked&&g(this._element).hasClass(b))t=!1;else{var r=g(n).find(D)[0];r&&g(r).removeClass(b)}if(t){if(i.hasAttribute("disabled")||n.hasAttribute("disabled")||i.classList.contains("disabled")||n.classList.contains("disabled"))return;i.checked=!g(this._element).hasClass(b),g(i).trigger("change")}i.focus(),e=!1}}e&&this._element.setAttribute("aria-pressed",!g(this._element).hasClass(b)),t&&g(this._element).toggleClass(b)},e.dispose=function(){g.removeData(this._element,_),this._element=null},t._jQueryInterface=function(e){return this.each(function(){var n=g(this).data(_);n||(n=new t(this),g(this).data(_,n)),"toggle"===e&&n[e]()})},i(t,null,[{key:"VERSION",get:function(){return"4.0.0"}}]),t}(),g(document).on(O.CLICK_DATA_API,w,function(t){t.preventDefault();var e=t.target;g(e).hasClass(T)||(e=g(e).closest(S)),N._jQueryInterface.call(g(e),"toggle")}).on(O.FOCUS_BLUR_DATA_API,w,function(t){var e=g(t.target).closest(S)[0];g(e).toggleClass(C,/^focus(in)?$/.test(t.type))}),g.fn[m]=N._jQueryInterface,g.fn[m].Constructor=N,g.fn[m].noConflict=function(){return g.fn[m]=y,N._jQueryInterface},N),x=function(t){var e="carousel",n="bs.carousel",o="."+n,s=t.fn[e],a={interval:5e3,keyboard:!0,slide:!1,pause:"hover",wrap:!0},l={interval:"(number|boolean)",keyboard:"boolean",slide:"(boolean|string)",pause:"(string|boolean)",wrap:"boolean"},c="next",h="prev",f="left",u="right",d={SLIDE:"slide"+o,SLID:"slid"+o,KEYDOWN:"keydown"+o,MOUSEENTER:"mouseenter"+o,MOUSELEAVE:"mouseleave"+o,TOUCHEND:"touchend"+o,LOAD_DATA_API:"load"+o+".data-api",CLICK_DATA_API:"click"+o+".data-api"},p="carousel",g="active",m="slide",_="carousel-item-right",v="carousel-item-left",E="carousel-item-next",y="carousel-item-prev",b={ACTIVE:".active",ACTIVE_ITEM:".active.carousel-item",ITEM:".carousel-item",NEXT_PREV:".carousel-item-next, .carousel-item-prev",INDICATORS:".carousel-indicators",DATA_SLIDE:"[data-slide], [data-slide-to]",DATA_RIDE:'[data-ride="carousel"]'},T=function(){function s(e,n){this._items=null,this._interval=null,this._activeElement=null,this._isPaused=!1,this._isSliding=!1,this.touchTimeout=null,this._config=this._getConfig(n),this._element=t(e)[0],this._indicatorsElement=t(this._element).find(b.INDICATORS)[0],this._addEventListeners()}var T=s.prototype;return T.next=function(){this._isSliding||this._slide(c)},T.nextWhenVisible=function(){!document.hidden&&t(this._element).is(":visible")&&"hidden"!==t(this._element).css("visibility")&&this.next()},T.prev=function(){this._isSliding||this._slide(h)},T.pause=function(e){e||(this._isPaused=!0),t(this._element).find(b.NEXT_PREV)[0]&&k.supportsTransitionEnd()&&(k.triggerTransitionEnd(this._element),this.cycle(!0)),clearInterval(this._interval),this._interval=null},T.cycle=function(t){t||(this._isPaused=!1),this._interval&&(clearInterval(this._interval),this._interval=null),this._config.interval&&!this._isPaused&&(this._interval=setInterval((document.visibilityState?this.nextWhenVisible:this.next).bind(this),this._config.interval))},T.to=function(e){var n=this;this._activeElement=t(this._element).find(b.ACTIVE_ITEM)[0];var i=this._getItemIndex(this._activeElement);if(!(e>this._items.length-1||e<0))if(this._isSliding)t(this._element).one(d.SLID,function(){return n.to(e)});else{if(i===e)return this.pause(),void this.cycle();var r=e>i?c:h;this._slide(r,this._items[e])}},T.dispose=function(){t(this._element).off(o),t.removeData(this._element,n),this._items=null,this._config=null,this._element=null,this._interval=null,this._isPaused=null,this._isSliding=null,this._activeElement=null,this._indicatorsElement=null},T._getConfig=function(t){return t=r({},a,t),k.typeCheckConfig(e,t,l),t},T._addEventListeners=function(){var e=this;this._config.keyboard&&t(this._element).on(d.KEYDOWN,function(t){return e._keydown(t)}),"hover"===this._config.pause&&(t(this._element).on(d.MOUSEENTER,function(t){return e.pause(t)}).on(d.MOUSELEAVE,function(t){return e.cycle(t)}),"ontouchstart"in document.documentElement&&t(this._element).on(d.TOUCHEND,function(){e.pause(),e.touchTimeout&&clearTimeout(e.touchTimeout),e.touchTimeout=setTimeout(function(t){return e.cycle(t)},500+e._config.interval)}))},T._keydown=function(t){if(!/input|textarea/i.test(t.target.tagName))switch(t.which){case 37:t.preventDefault(),this.prev();break;case 39:t.preventDefault(),this.next()}},T._getItemIndex=function(e){return this._items=t.makeArray(t(e).parent().find(b.ITEM)),this._items.indexOf(e)},T._getItemByDirection=function(t,e){var n=t===c,i=t===h,r=this._getItemIndex(e),o=this._items.length-1;if((i&&0===r||n&&r===o)&&!this._config.wrap)return e;var s=(r+(t===h?-1:1))%this._items.length;return-1===s?this._items[this._items.length-1]:this._items[s]},T._triggerSlideEvent=function(e,n){var i=this._getItemIndex(e),r=this._getItemIndex(t(this._element).find(b.ACTIVE_ITEM)[0]),o=t.Event(d.SLIDE,{relatedTarget:e,direction:n,from:r,to:i});return t(this._element).trigger(o),o},T._setActiveIndicatorElement=function(e){if(this._indicatorsElement){t(this._indicatorsElement).find(b.ACTIVE).removeClass(g);var n=this._indicatorsElement.children[this._getItemIndex(e)];n&&t(n).addClass(g)}},T._slide=function(e,n){var i,r,o,s=this,a=t(this._element).find(b.ACTIVE_ITEM)[0],l=this._getItemIndex(a),h=n||a&&this._getItemByDirection(e,a),p=this._getItemIndex(h),T=Boolean(this._interval);if(e===c?(i=v,r=E,o=f):(i=_,r=y,o=u),h&&t(h).hasClass(g))this._isSliding=!1;else if(!this._triggerSlideEvent(h,o).isDefaultPrevented()&&a&&h){this._isSliding=!0,T&&this.pause(),this._setActiveIndicatorElement(h);var C=t.Event(d.SLID,{relatedTarget:h,direction:o,from:l,to:p});k.supportsTransitionEnd()&&t(this._element).hasClass(m)?(t(h).addClass(r),k.reflow(h),t(a).addClass(i),t(h).addClass(i),t(a).one(k.TRANSITION_END,function(){t(h).removeClass(i+" "+r).addClass(g),t(a).removeClass(g+" "+r+" "+i),s._isSliding=!1,setTimeout(function(){return t(s._element).trigger(C)},0)}).emulateTransitionEnd(600)):(t(a).removeClass(g),t(h).addClass(g),this._isSliding=!1,t(this._element).trigger(C)),T&&this.cycle()}},s._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n),o=r({},a,t(this).data());"object"==typeof e&&(o=r({},o,e));var l="string"==typeof e?e:o.slide;if(i||(i=new s(this,o),t(this).data(n,i)),"number"==typeof e)i.to(e);else if("string"==typeof l){if("undefined"==typeof i[l])throw new TypeError('No method named "'+l+'"');i[l]()}else o.interval&&(i.pause(),i.cycle())})},s._dataApiClickHandler=function(e){var i=k.getSelectorFromElement(this);if(i){var o=t(i)[0];if(o&&t(o).hasClass(p)){var a=r({},t(o).data(),t(this).data()),l=this.getAttribute("data-slide-to");l&&(a.interval=!1),s._jQueryInterface.call(t(o),a),l&&t(o).data(n).to(l),e.preventDefault()}}},i(s,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return a}}]),s}();return t(document).on(d.CLICK_DATA_API,b.DATA_SLIDE,T._dataApiClickHandler),t(window).on(d.LOAD_DATA_API,function(){t(b.DATA_RIDE).each(function(){var e=t(this);T._jQueryInterface.call(e,e.data())})}),t.fn[e]=T._jQueryInterface,t.fn[e].Constructor=T,t.fn[e].noConflict=function(){return t.fn[e]=s,T._jQueryInterface},T}(e),R=function(t){var e="collapse",n="bs.collapse",o="."+n,s=t.fn[e],a={toggle:!0,parent:""},l={toggle:"boolean",parent:"(string|element)"},c={SHOW:"show"+o,SHOWN:"shown"+o,HIDE:"hide"+o,HIDDEN:"hidden"+o,CLICK_DATA_API:"click"+o+".data-api"},h="show",f="collapse",u="collapsing",d="collapsed",p="width",g="height",m={ACTIVES:".show, .collapsing",DATA_TOGGLE:'[data-toggle="collapse"]'},_=function(){function o(e,n){this._isTransitioning=!1,this._element=e,this._config=this._getConfig(n),this._triggerArray=t.makeArray(t('[data-toggle="collapse"][href="#'+e.id+'"],[data-toggle="collapse"][data-target="#'+e.id+'"]'));for(var i=t(m.DATA_TOGGLE),r=0;r<i.length;r++){var o=i[r],s=k.getSelectorFromElement(o);null!==s&&t(s).filter(e).length>0&&(this._selector=s,this._triggerArray.push(o))}this._parent=this._config.parent?this._getParent():null,this._config.parent||this._addAriaAndCollapsedClass(this._element,this._triggerArray),this._config.toggle&&this.toggle()}var s=o.prototype;return s.toggle=function(){t(this._element).hasClass(h)?this.hide():this.show()},s.show=function(){var e,i,r=this;if(!this._isTransitioning&&!t(this._element).hasClass(h)&&(this._parent&&0===(e=t.makeArray(t(this._parent).find(m.ACTIVES).filter('[data-parent="'+this._config.parent+'"]'))).length&&(e=null),!(e&&(i=t(e).not(this._selector).data(n))&&i._isTransitioning))){var s=t.Event(c.SHOW);if(t(this._element).trigger(s),!s.isDefaultPrevented()){e&&(o._jQueryInterface.call(t(e).not(this._selector),"hide"),i||t(e).data(n,null));var a=this._getDimension();t(this._element).removeClass(f).addClass(u),this._element.style[a]=0,this._triggerArray.length>0&&t(this._triggerArray).removeClass(d).attr("aria-expanded",!0),this.setTransitioning(!0);var l=function(){t(r._element).removeClass(u).addClass(f).addClass(h),r._element.style[a]="",r.setTransitioning(!1),t(r._element).trigger(c.SHOWN)};if(k.supportsTransitionEnd()){var p="scroll"+(a[0].toUpperCase()+a.slice(1));t(this._element).one(k.TRANSITION_END,l).emulateTransitionEnd(600),this._element.style[a]=this._element[p]+"px"}else l()}}},s.hide=function(){var e=this;if(!this._isTransitioning&&t(this._element).hasClass(h)){var n=t.Event(c.HIDE);if(t(this._element).trigger(n),!n.isDefaultPrevented()){var i=this._getDimension();if(this._element.style[i]=this._element.getBoundingClientRect()[i]+"px",k.reflow(this._element),t(this._element).addClass(u).removeClass(f).removeClass(h),this._triggerArray.length>0)for(var r=0;r<this._triggerArray.length;r++){var o=this._triggerArray[r],s=k.getSelectorFromElement(o);if(null!==s)t(s).hasClass(h)||t(o).addClass(d).attr("aria-expanded",!1)}this.setTransitioning(!0);var a=function(){e.setTransitioning(!1),t(e._element).removeClass(u).addClass(f).trigger(c.HIDDEN)};this._element.style[i]="",k.supportsTransitionEnd()?t(this._element).one(k.TRANSITION_END,a).emulateTransitionEnd(600):a()}}},s.setTransitioning=function(t){this._isTransitioning=t},s.dispose=function(){t.removeData(this._element,n),this._config=null,this._parent=null,this._element=null,this._triggerArray=null,this._isTransitioning=null},s._getConfig=function(t){return(t=r({},a,t)).toggle=Boolean(t.toggle),k.typeCheckConfig(e,t,l),t},s._getDimension=function(){return t(this._element).hasClass(p)?p:g},s._getParent=function(){var e=this,n=null;k.isElement(this._config.parent)?(n=this._config.parent,"undefined"!=typeof this._config.parent.jquery&&(n=this._config.parent[0])):n=t(this._config.parent)[0];var i='[data-toggle="collapse"][data-parent="'+this._config.parent+'"]';return t(n).find(i).each(function(t,n){e._addAriaAndCollapsedClass(o._getTargetFromElement(n),[n])}),n},s._addAriaAndCollapsedClass=function(e,n){if(e){var i=t(e).hasClass(h);n.length>0&&t(n).toggleClass(d,!i).attr("aria-expanded",i)}},o._getTargetFromElement=function(e){var n=k.getSelectorFromElement(e);return n?t(n)[0]:null},o._jQueryInterface=function(e){return this.each(function(){var i=t(this),s=i.data(n),l=r({},a,i.data(),"object"==typeof e&&e);if(!s&&l.toggle&&/show|hide/.test(e)&&(l.toggle=!1),s||(s=new o(this,l),i.data(n,s)),"string"==typeof e){if("undefined"==typeof s[e])throw new TypeError('No method named "'+e+'"');s[e]()}})},i(o,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return a}}]),o}();return t(document).on(c.CLICK_DATA_API,m.DATA_TOGGLE,function(e){"A"===e.currentTarget.tagName&&e.preventDefault();var i=t(this),r=k.getSelectorFromElement(this);t(r).each(function(){var e=t(this),r=e.data(n)?"toggle":i.data();_._jQueryInterface.call(e,r)})}),t.fn[e]=_._jQueryInterface,t.fn[e].Constructor=_,t.fn[e].noConflict=function(){return t.fn[e]=s,_._jQueryInterface},_}(e),j="undefined"!=typeof window&&"undefined"!=typeof document,H=["Edge","Trident","Firefox"],M=0,W=0;W<H.length;W+=1)if(j&&navigator.userAgent.indexOf(H[W])>=0){M=1;break}var U=j&&window.Promise?function(t){var e=!1;return function(){e||(e=!0,window.Promise.resolve().then(function(){e=!1,t()}))}}:function(t){var e=!1;return function(){e||(e=!0,setTimeout(function(){e=!1,t()},M))}};function B(t){return t&&"[object Function]"==={}.toString.call(t)}function F(t,e){if(1!==t.nodeType)return[];var n=getComputedStyle(t,null);return e?n[e]:n}function K(t){return"HTML"===t.nodeName?t:t.parentNode||t.host}function V(t){if(!t)return document.body;switch(t.nodeName){case"HTML":case"BODY":return t.ownerDocument.body;case"#document":return t.body}var e=F(t),n=e.overflow,i=e.overflowX,r=e.overflowY;return/(auto|scroll)/.test(n+r+i)?t:V(K(t))}function Q(t){var e=t&&t.offsetParent,n=e&&e.nodeName;return n&&"BODY"!==n&&"HTML"!==n?-1!==["TD","TABLE"].indexOf(e.nodeName)&&"static"===F(e,"position")?Q(e):e:t?t.ownerDocument.documentElement:document.documentElement}function Y(t){return null!==t.parentNode?Y(t.parentNode):t}function G(t,e){if(!(t&&t.nodeType&&e&&e.nodeType))return document.documentElement;var n=t.compareDocumentPosition(e)&Node.DOCUMENT_POSITION_FOLLOWING,i=n?t:e,r=n?e:t,o=document.createRange();o.setStart(i,0),o.setEnd(r,0);var s,a,l=o.commonAncestorContainer;if(t!==l&&e!==l||i.contains(r))return"BODY"===(a=(s=l).nodeName)||"HTML"!==a&&Q(s.firstElementChild)!==s?Q(l):l;var c=Y(t);return c.host?G(c.host,e):G(t,Y(e).host)}function q(t){var e="top"===(arguments.length>1&&void 0!==arguments[1]?arguments[1]:"top")?"scrollTop":"scrollLeft",n=t.nodeName;if("BODY"===n||"HTML"===n){var i=t.ownerDocument.documentElement;return(t.ownerDocument.scrollingElement||i)[e]}return t[e]}function z(t,e){var n="x"===e?"Left":"Top",i="Left"===n?"Right":"Bottom";return parseFloat(t["border"+n+"Width"],10)+parseFloat(t["border"+i+"Width"],10)}var X=void 0,Z=function(){return void 0===X&&(X=-1!==navigator.appVersion.indexOf("MSIE 10")),X};function J(t,e,n,i){return Math.max(e["offset"+t],e["scroll"+t],n["client"+t],n["offset"+t],n["scroll"+t],Z()?n["offset"+t]+i["margin"+("Height"===t?"Top":"Left")]+i["margin"+("Height"===t?"Bottom":"Right")]:0)}function $(){var t=document.body,e=document.documentElement,n=Z()&&getComputedStyle(e);return{height:J("Height",t,e,n),width:J("Width",t,e,n)}}var tt=function(t,e){if(!(t instanceof e))throw new TypeError("Cannot call a class as a function")},et=function(){function t(t,e){for(var n=0;n<e.length;n++){var i=e[n];i.enumerable=i.enumerable||!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(t,i.key,i)}}return function(e,n,i){return n&&t(e.prototype,n),i&&t(e,i),e}}(),nt=function(t,e,n){return e in t?Object.defineProperty(t,e,{value:n,enumerable:!0,configurable:!0,writable:!0}):t[e]=n,t},it=Object.assign||function(t){for(var e=1;e<arguments.length;e++){var n=arguments[e];for(var i in n)Object.prototype.hasOwnProperty.call(n,i)&&(t[i]=n[i])}return t};function rt(t){return it({},t,{right:t.left+t.width,bottom:t.top+t.height})}function ot(t){var e={};if(Z())try{e=t.getBoundingClientRect();var n=q(t,"top"),i=q(t,"left");e.top+=n,e.left+=i,e.bottom+=n,e.right+=i}catch(t){}else e=t.getBoundingClientRect();var r={left:e.left,top:e.top,width:e.right-e.left,height:e.bottom-e.top},o="HTML"===t.nodeName?$():{},s=o.width||t.clientWidth||r.right-r.left,a=o.height||t.clientHeight||r.bottom-r.top,l=t.offsetWidth-s,c=t.offsetHeight-a;if(l||c){var h=F(t);l-=z(h,"x"),c-=z(h,"y"),r.width-=l,r.height-=c}return rt(r)}function st(t,e){var n=Z(),i="HTML"===e.nodeName,r=ot(t),o=ot(e),s=V(t),a=F(e),l=parseFloat(a.borderTopWidth,10),c=parseFloat(a.borderLeftWidth,10),h=rt({top:r.top-o.top-l,left:r.left-o.left-c,width:r.width,height:r.height});if(h.marginTop=0,h.marginLeft=0,!n&&i){var f=parseFloat(a.marginTop,10),u=parseFloat(a.marginLeft,10);h.top-=l-f,h.bottom-=l-f,h.left-=c-u,h.right-=c-u,h.marginTop=f,h.marginLeft=u}return(n?e.contains(s):e===s&&"BODY"!==s.nodeName)&&(h=function(t,e){var n=arguments.length>2&&void 0!==arguments[2]&&arguments[2],i=q(e,"top"),r=q(e,"left"),o=n?-1:1;return t.top+=i*o,t.bottom+=i*o,t.left+=r*o,t.right+=r*o,t}(h,e)),h}function at(t,e,n,i){var r,o,s,a,l,c,h,f={top:0,left:0},u=G(t,e);if("viewport"===i)o=(r=u).ownerDocument.documentElement,s=st(r,o),a=Math.max(o.clientWidth,window.innerWidth||0),l=Math.max(o.clientHeight,window.innerHeight||0),c=q(o),h=q(o,"left"),f=rt({top:c-s.top+s.marginTop,left:h-s.left+s.marginLeft,width:a,height:l});else{var d=void 0;"scrollParent"===i?"BODY"===(d=V(K(e))).nodeName&&(d=t.ownerDocument.documentElement):d="window"===i?t.ownerDocument.documentElement:i;var p=st(d,u);if("HTML"!==d.nodeName||function t(e){var n=e.nodeName;return"BODY"!==n&&"HTML"!==n&&("fixed"===F(e,"position")||t(K(e)))}(u))f=p;else{var g=$(),m=g.height,_=g.width;f.top+=p.top-p.marginTop,f.bottom=m+p.top,f.left+=p.left-p.marginLeft,f.right=_+p.left}}return f.left+=n,f.top+=n,f.right-=n,f.bottom-=n,f}function lt(t,e,n,i,r){var o=arguments.length>5&&void 0!==arguments[5]?arguments[5]:0;if(-1===t.indexOf("auto"))return t;var s=at(n,i,o,r),a={top:{width:s.width,height:e.top-s.top},right:{width:s.right-e.right,height:s.height},bottom:{width:s.width,height:s.bottom-e.bottom},left:{width:e.left-s.left,height:s.height}},l=Object.keys(a).map(function(t){return it({key:t},a[t],{area:(e=a[t],e.width*e.height)});var e}).sort(function(t,e){return e.area-t.area}),c=l.filter(function(t){var e=t.width,i=t.height;return e>=n.clientWidth&&i>=n.clientHeight}),h=c.length>0?c[0].key:l[0].key,f=t.split("-")[1];return h+(f?"-"+f:"")}function ct(t,e,n){return st(n,G(e,n))}function ht(t){var e=getComputedStyle(t),n=parseFloat(e.marginTop)+parseFloat(e.marginBottom),i=parseFloat(e.marginLeft)+parseFloat(e.marginRight);return{width:t.offsetWidth+i,height:t.offsetHeight+n}}function ft(t){var e={left:"right",right:"left",bottom:"top",top:"bottom"};return t.replace(/left|right|bottom|top/g,function(t){return e[t]})}function ut(t,e,n){n=n.split("-")[0];var i=ht(t),r={width:i.width,height:i.height},o=-1!==["right","left"].indexOf(n),s=o?"top":"left",a=o?"left":"top",l=o?"height":"width",c=o?"width":"height";return r[s]=e[s]+e[l]/2-i[l]/2,r[a]=n===a?e[a]-i[c]:e[ft(a)],r}function dt(t,e){return Array.prototype.find?t.find(e):t.filter(e)[0]}function pt(t,e,n){return(void 0===n?t:t.slice(0,function(t,e,n){if(Array.prototype.findIndex)return t.findIndex(function(t){return t[e]===n});var i=dt(t,function(t){return t[e]===n});return t.indexOf(i)}(t,"name",n))).forEach(function(t){t.function&&console.warn("`modifier.function` is deprecated, use `modifier.fn`!");var n=t.function||t.fn;t.enabled&&B(n)&&(e.offsets.popper=rt(e.offsets.popper),e.offsets.reference=rt(e.offsets.reference),e=n(e,t))}),e}function gt(t,e){return t.some(function(t){var n=t.name;return t.enabled&&n===e})}function mt(t){for(var e=[!1,"ms","Webkit","Moz","O"],n=t.charAt(0).toUpperCase()+t.slice(1),i=0;i<e.length-1;i++){var r=e[i],o=r?""+r+n:t;if("undefined"!=typeof document.body.style[o])return o}return null}function _t(t){var e=t.ownerDocument;return e?e.defaultView:window}function vt(t,e,n,i){n.updateBound=i,_t(t).addEventListener("resize",n.updateBound,{passive:!0});var r=V(t);return function t(e,n,i,r){var o="BODY"===e.nodeName,s=o?e.ownerDocument.defaultView:e;s.addEventListener(n,i,{passive:!0}),o||t(V(s.parentNode),n,i,r),r.push(s)}(r,"scroll",n.updateBound,n.scrollParents),n.scrollElement=r,n.eventsEnabled=!0,n}function Et(){var t,e;this.state.eventsEnabled&&(cancelAnimationFrame(this.scheduleUpdate),this.state=(t=this.reference,e=this.state,_t(t).removeEventListener("resize",e.updateBound),e.scrollParents.forEach(function(t){t.removeEventListener("scroll",e.updateBound)}),e.updateBound=null,e.scrollParents=[],e.scrollElement=null,e.eventsEnabled=!1,e))}function yt(t){return""!==t&&!isNaN(parseFloat(t))&&isFinite(t)}function bt(t,e){Object.keys(e).forEach(function(n){var i="";-1!==["width","height","top","right","bottom","left"].indexOf(n)&&yt(e[n])&&(i="px"),t.style[n]=e[n]+i})}function Tt(t,e,n){var i=dt(t,function(t){return t.name===e}),r=!!i&&t.some(function(t){return t.name===n&&t.enabled&&t.order<i.order});if(!r){var o="`"+e+"`",s="`"+n+"`";console.warn(s+" modifier is required by "+o+" modifier in order to work, be sure to include it before "+o+"!")}return r}var Ct=["auto-start","auto","auto-end","top-start","top","top-end","right-start","right","right-end","bottom-end","bottom","bottom-start","left-end","left","left-start"],wt=Ct.slice(3);function It(t){var e=arguments.length>1&&void 0!==arguments[1]&&arguments[1],n=wt.indexOf(t),i=wt.slice(n+1).concat(wt.slice(0,n));return e?i.reverse():i}var At={FLIP:"flip",CLOCKWISE:"clockwise",COUNTERCLOCKWISE:"counterclockwise"};function Dt(t,e,n,i){var r=[0,0],o=-1!==["right","left"].indexOf(i),s=t.split(/(\+|\-)/).map(function(t){return t.trim()}),a=s.indexOf(dt(s,function(t){return-1!==t.search(/,|\s/)}));s[a]&&-1===s[a].indexOf(",")&&console.warn("Offsets separated by white space(s) are deprecated, use a comma (,) instead.");var l=/\s*,\s*|\s+/,c=-1!==a?[s.slice(0,a).concat([s[a].split(l)[0]]),[s[a].split(l)[1]].concat(s.slice(a+1))]:[s];return(c=c.map(function(t,i){var r=(1===i?!o:o)?"height":"width",s=!1;return t.reduce(function(t,e){return""===t[t.length-1]&&-1!==["+","-"].indexOf(e)?(t[t.length-1]=e,s=!0,t):s?(t[t.length-1]+=e,s=!1,t):t.concat(e)},[]).map(function(t){return function(t,e,n,i){var r=t.match(/((?:\-|\+)?\d*\.?\d*)(.*)/),o=+r[1],s=r[2];if(!o)return t;if(0===s.indexOf("%")){var a=void 0;switch(s){case"%p":a=n;break;case"%":case"%r":default:a=i}return rt(a)[e]/100*o}if("vh"===s||"vw"===s)return("vh"===s?Math.max(document.documentElement.clientHeight,window.innerHeight||0):Math.max(document.documentElement.clientWidth,window.innerWidth||0))/100*o;return o}(t,r,e,n)})})).forEach(function(t,e){t.forEach(function(n,i){yt(n)&&(r[e]+=n*("-"===t[i-1]?-1:1))})}),r}var St={placement:"bottom",eventsEnabled:!0,removeOnDestroy:!1,onCreate:function(){},onUpdate:function(){},modifiers:{shift:{order:100,enabled:!0,fn:function(t){var e=t.placement,n=e.split("-")[0],i=e.split("-")[1];if(i){var r=t.offsets,o=r.reference,s=r.popper,a=-1!==["bottom","top"].indexOf(n),l=a?"left":"top",c=a?"width":"height",h={start:nt({},l,o[l]),end:nt({},l,o[l]+o[c]-s[c])};t.offsets.popper=it({},s,h[i])}return t}},offset:{order:200,enabled:!0,fn:function(t,e){var n=e.offset,i=t.placement,r=t.offsets,o=r.popper,s=r.reference,a=i.split("-")[0],l=void 0;return l=yt(+n)?[+n,0]:Dt(n,o,s,a),"left"===a?(o.top+=l[0],o.left-=l[1]):"right"===a?(o.top+=l[0],o.left+=l[1]):"top"===a?(o.left+=l[0],o.top-=l[1]):"bottom"===a&&(o.left+=l[0],o.top+=l[1]),t.popper=o,t},offset:0},preventOverflow:{order:300,enabled:!0,fn:function(t,e){var n=e.boundariesElement||Q(t.instance.popper);t.instance.reference===n&&(n=Q(n));var i=at(t.instance.popper,t.instance.reference,e.padding,n);e.boundaries=i;var r=e.priority,o=t.offsets.popper,s={primary:function(t){var n=o[t];return o[t]<i[t]&&!e.escapeWithReference&&(n=Math.max(o[t],i[t])),nt({},t,n)},secondary:function(t){var n="right"===t?"left":"top",r=o[n];return o[t]>i[t]&&!e.escapeWithReference&&(r=Math.min(o[n],i[t]-("right"===t?o.width:o.height))),nt({},n,r)}};return r.forEach(function(t){var e=-1!==["left","top"].indexOf(t)?"primary":"secondary";o=it({},o,s[e](t))}),t.offsets.popper=o,t},priority:["left","right","top","bottom"],padding:5,boundariesElement:"scrollParent"},keepTogether:{order:400,enabled:!0,fn:function(t){var e=t.offsets,n=e.popper,i=e.reference,r=t.placement.split("-")[0],o=Math.floor,s=-1!==["top","bottom"].indexOf(r),a=s?"right":"bottom",l=s?"left":"top",c=s?"width":"height";return n[a]<o(i[l])&&(t.offsets.popper[l]=o(i[l])-n[c]),n[l]>o(i[a])&&(t.offsets.popper[l]=o(i[a])),t}},arrow:{order:500,enabled:!0,fn:function(t,e){var n;if(!Tt(t.instance.modifiers,"arrow","keepTogether"))return t;var i=e.element;if("string"==typeof i){if(!(i=t.instance.popper.querySelector(i)))return t}else if(!t.instance.popper.contains(i))return console.warn("WARNING: `arrow.element` must be child of its popper element!"),t;var r=t.placement.split("-")[0],o=t.offsets,s=o.popper,a=o.reference,l=-1!==["left","right"].indexOf(r),c=l?"height":"width",h=l?"Top":"Left",f=h.toLowerCase(),u=l?"left":"top",d=l?"bottom":"right",p=ht(i)[c];a[d]-p<s[f]&&(t.offsets.popper[f]-=s[f]-(a[d]-p)),a[f]+p>s[d]&&(t.offsets.popper[f]+=a[f]+p-s[d]),t.offsets.popper=rt(t.offsets.popper);var g=a[f]+a[c]/2-p/2,m=F(t.instance.popper),_=parseFloat(m["margin"+h],10),v=parseFloat(m["border"+h+"Width"],10),E=g-t.offsets.popper[f]-_-v;return E=Math.max(Math.min(s[c]-p,E),0),t.arrowElement=i,t.offsets.arrow=(nt(n={},f,Math.round(E)),nt(n,u,""),n),t},element:"[x-arrow]"},flip:{order:600,enabled:!0,fn:function(t,e){if(gt(t.instance.modifiers,"inner"))return t;if(t.flipped&&t.placement===t.originalPlacement)return t;var n=at(t.instance.popper,t.instance.reference,e.padding,e.boundariesElement),i=t.placement.split("-")[0],r=ft(i),o=t.placement.split("-")[1]||"",s=[];switch(e.behavior){case At.FLIP:s=[i,r];break;case At.CLOCKWISE:s=It(i);break;case At.COUNTERCLOCKWISE:s=It(i,!0);break;default:s=e.behavior}return s.forEach(function(a,l){if(i!==a||s.length===l+1)return t;i=t.placement.split("-")[0],r=ft(i);var c,h=t.offsets.popper,f=t.offsets.reference,u=Math.floor,d="left"===i&&u(h.right)>u(f.left)||"right"===i&&u(h.left)<u(f.right)||"top"===i&&u(h.bottom)>u(f.top)||"bottom"===i&&u(h.top)<u(f.bottom),p=u(h.left)<u(n.left),g=u(h.right)>u(n.right),m=u(h.top)<u(n.top),_=u(h.bottom)>u(n.bottom),v="left"===i&&p||"right"===i&&g||"top"===i&&m||"bottom"===i&&_,E=-1!==["top","bottom"].indexOf(i),y=!!e.flipVariations&&(E&&"start"===o&&p||E&&"end"===o&&g||!E&&"start"===o&&m||!E&&"end"===o&&_);(d||v||y)&&(t.flipped=!0,(d||v)&&(i=s[l+1]),y&&(o="end"===(c=o)?"start":"start"===c?"end":c),t.placement=i+(o?"-"+o:""),t.offsets.popper=it({},t.offsets.popper,ut(t.instance.popper,t.offsets.reference,t.placement)),t=pt(t.instance.modifiers,t,"flip"))}),t},behavior:"flip",padding:5,boundariesElement:"viewport"},inner:{order:700,enabled:!1,fn:function(t){var e=t.placement,n=e.split("-")[0],i=t.offsets,r=i.popper,o=i.reference,s=-1!==["left","right"].indexOf(n),a=-1===["top","left"].indexOf(n);return r[s?"left":"top"]=o[n]-(a?r[s?"width":"height"]:0),t.placement=ft(e),t.offsets.popper=rt(r),t}},hide:{order:800,enabled:!0,fn:function(t){if(!Tt(t.instance.modifiers,"hide","preventOverflow"))return t;var e=t.offsets.reference,n=dt(t.instance.modifiers,function(t){return"preventOverflow"===t.name}).boundaries;if(e.bottom<n.top||e.left>n.right||e.top>n.bottom||e.right<n.left){if(!0===t.hide)return t;t.hide=!0,t.attributes["x-out-of-boundaries"]=""}else{if(!1===t.hide)return t;t.hide=!1,t.attributes["x-out-of-boundaries"]=!1}return t}},computeStyle:{order:850,enabled:!0,fn:function(t,e){var n=e.x,i=e.y,r=t.offsets.popper,o=dt(t.instance.modifiers,function(t){return"applyStyle"===t.name}).gpuAcceleration;void 0!==o&&console.warn("WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!");var s=void 0!==o?o:e.gpuAcceleration,a=ot(Q(t.instance.popper)),l={position:r.position},c={left:Math.floor(r.left),top:Math.floor(r.top),bottom:Math.floor(r.bottom),right:Math.floor(r.right)},h="bottom"===n?"top":"bottom",f="right"===i?"left":"right",u=mt("transform"),d=void 0,p=void 0;if(p="bottom"===h?-a.height+c.bottom:c.top,d="right"===f?-a.width+c.right:c.left,s&&u)l[u]="translate3d("+d+"px, "+p+"px, 0)",l[h]=0,l[f]=0,l.willChange="transform";else{var g="bottom"===h?-1:1,m="right"===f?-1:1;l[h]=p*g,l[f]=d*m,l.willChange=h+", "+f}var _={"x-placement":t.placement};return t.attributes=it({},_,t.attributes),t.styles=it({},l,t.styles),t.arrowStyles=it({},t.offsets.arrow,t.arrowStyles),t},gpuAcceleration:!0,x:"bottom",y:"right"},applyStyle:{order:900,enabled:!0,fn:function(t){var e,n;return bt(t.instance.popper,t.styles),e=t.instance.popper,n=t.attributes,Object.keys(n).forEach(function(t){!1!==n[t]?e.setAttribute(t,n[t]):e.removeAttribute(t)}),t.arrowElement&&Object.keys(t.arrowStyles).length&&bt(t.arrowElement,t.arrowStyles),t},onLoad:function(t,e,n,i,r){var o=ct(0,e,t),s=lt(n.placement,o,e,t,n.modifiers.flip.boundariesElement,n.modifiers.flip.padding);return e.setAttribute("x-placement",s),bt(e,{position:"absolute"}),n},gpuAcceleration:void 0}}},Ot=function(){function t(e,n){var i=this,r=arguments.length>2&&void 0!==arguments[2]?arguments[2]:{};tt(this,t),this.scheduleUpdate=function(){return requestAnimationFrame(i.update)},this.update=U(this.update.bind(this)),this.options=it({},t.Defaults,r),this.state={isDestroyed:!1,isCreated:!1,scrollParents:[]},this.reference=e&&e.jquery?e[0]:e,this.popper=n&&n.jquery?n[0]:n,this.options.modifiers={},Object.keys(it({},t.Defaults.modifiers,r.modifiers)).forEach(function(e){i.options.modifiers[e]=it({},t.Defaults.modifiers[e]||{},r.modifiers?r.modifiers[e]:{})}),this.modifiers=Object.keys(this.options.modifiers).map(function(t){return it({name:t},i.options.modifiers[t])}).sort(function(t,e){return t.order-e.order}),this.modifiers.forEach(function(t){t.enabled&&B(t.onLoad)&&t.onLoad(i.reference,i.popper,i.options,t,i.state)}),this.update();var o=this.options.eventsEnabled;o&&this.enableEventListeners(),this.state.eventsEnabled=o}return et(t,[{key:"update",value:function(){return function(){if(!this.state.isDestroyed){var t={instance:this,styles:{},arrowStyles:{},attributes:{},flipped:!1,offsets:{}};t.offsets.reference=ct(this.state,this.popper,this.reference),t.placement=lt(this.options.placement,t.offsets.reference,this.popper,this.reference,this.options.modifiers.flip.boundariesElement,this.options.modifiers.flip.padding),t.originalPlacement=t.placement,t.offsets.popper=ut(this.popper,t.offsets.reference,t.placement),t.offsets.popper.position="absolute",t=pt(this.modifiers,t),this.state.isCreated?this.options.onUpdate(t):(this.state.isCreated=!0,this.options.onCreate(t))}}.call(this)}},{key:"destroy",value:function(){return function(){return this.state.isDestroyed=!0,gt(this.modifiers,"applyStyle")&&(this.popper.removeAttribute("x-placement"),this.popper.style.left="",this.popper.style.position="",this.popper.style.top="",this.popper.style[mt("transform")]=""),this.disableEventListeners(),this.options.removeOnDestroy&&this.popper.parentNode.removeChild(this.popper),this}.call(this)}},{key:"enableEventListeners",value:function(){return function(){this.state.eventsEnabled||(this.state=vt(this.reference,this.options,this.state,this.scheduleUpdate))}.call(this)}},{key:"disableEventListeners",value:function(){return Et.call(this)}}]),t}();Ot.Utils=("undefined"!=typeof window?window:global).PopperUtils,Ot.placements=Ct,Ot.Defaults=St;var Nt=function(t){var e="dropdown",n="bs.dropdown",o="."+n,s=t.fn[e],a=new RegExp("38|40|27"),l={HIDE:"hide"+o,HIDDEN:"hidden"+o,SHOW:"show"+o,SHOWN:"shown"+o,CLICK:"click"+o,CLICK_DATA_API:"click"+o+".data-api",KEYDOWN_DATA_API:"keydown"+o+".data-api",KEYUP_DATA_API:"keyup"+o+".data-api"},c="disabled",h="show",f="dropup",u="dropright",d="dropleft",p="dropdown-menu-right",g="dropdown-menu-left",m="position-static",_='[data-toggle="dropdown"]',v=".dropdown form",E=".dropdown-menu",y=".navbar-nav",b=".dropdown-menu .dropdown-item:not(.disabled)",T="top-start",C="top-end",w="bottom-start",I="bottom-end",A="right-start",D="left-start",S={offset:0,flip:!0,boundary:"scrollParent"},O={offset:"(number|string|function)",flip:"boolean",boundary:"(string|element)"},N=function(){function s(t,e){this._element=t,this._popper=null,this._config=this._getConfig(e),this._menu=this._getMenuElement(),this._inNavbar=this._detectNavbar(),this._addEventListeners()}var v=s.prototype;return v.toggle=function(){if(!this._element.disabled&&!t(this._element).hasClass(c)){var e=s._getParentFromElement(this._element),n=t(this._menu).hasClass(h);if(s._clearMenus(),!n){var i={relatedTarget:this._element},r=t.Event(l.SHOW,i);if(t(e).trigger(r),!r.isDefaultPrevented()){if(!this._inNavbar){if("undefined"==typeof Ot)throw new TypeError("Bootstrap dropdown require Popper.js (https://popper.js.org)");var o=this._element;t(e).hasClass(f)&&(t(this._menu).hasClass(g)||t(this._menu).hasClass(p))&&(o=e),"scrollParent"!==this._config.boundary&&t(e).addClass(m),this._popper=new Ot(o,this._menu,this._getPopperConfig())}"ontouchstart"in document.documentElement&&0===t(e).closest(y).length&&t("body").children().on("mouseover",null,t.noop),this._element.focus(),this._element.setAttribute("aria-expanded",!0),t(this._menu).toggleClass(h),t(e).toggleClass(h).trigger(t.Event(l.SHOWN,i))}}}},v.dispose=function(){t.removeData(this._element,n),t(this._element).off(o),this._element=null,this._menu=null,null!==this._popper&&(this._popper.destroy(),this._popper=null)},v.update=function(){this._inNavbar=this._detectNavbar(),null!==this._popper&&this._popper.scheduleUpdate()},v._addEventListeners=function(){var e=this;t(this._element).on(l.CLICK,function(t){t.preventDefault(),t.stopPropagation(),e.toggle()})},v._getConfig=function(n){return n=r({},this.constructor.Default,t(this._element).data(),n),k.typeCheckConfig(e,n,this.constructor.DefaultType),n},v._getMenuElement=function(){if(!this._menu){var e=s._getParentFromElement(this._element);this._menu=t(e).find(E)[0]}return this._menu},v._getPlacement=function(){var e=t(this._element).parent(),n=w;return e.hasClass(f)?(n=T,t(this._menu).hasClass(p)&&(n=C)):e.hasClass(u)?n=A:e.hasClass(d)?n=D:t(this._menu).hasClass(p)&&(n=I),n},v._detectNavbar=function(){return t(this._element).closest(".navbar").length>0},v._getPopperConfig=function(){var t=this,e={};return"function"==typeof this._config.offset?e.fn=function(e){return e.offsets=r({},e.offsets,t._config.offset(e.offsets)||{}),e}:e.offset=this._config.offset,{placement:this._getPlacement(),modifiers:{offset:e,flip:{enabled:this._config.flip},preventOverflow:{boundariesElement:this._config.boundary}}}},s._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n);if(i||(i=new s(this,"object"==typeof e?e:null),t(this).data(n,i)),"string"==typeof e){if("undefined"==typeof i[e])throw new TypeError('No method named "'+e+'"');i[e]()}})},s._clearMenus=function(e){if(!e||3!==e.which&&("keyup"!==e.type||9===e.which))for(var i=t.makeArray(t(_)),r=0;r<i.length;r++){var o=s._getParentFromElement(i[r]),a=t(i[r]).data(n),c={relatedTarget:i[r]};if(a){var f=a._menu;if(t(o).hasClass(h)&&!(e&&("click"===e.type&&/input|textarea/i.test(e.target.tagName)||"keyup"===e.type&&9===e.which)&&t.contains(o,e.target))){var u=t.Event(l.HIDE,c);t(o).trigger(u),u.isDefaultPrevented()||("ontouchstart"in document.documentElement&&t("body").children().off("mouseover",null,t.noop),i[r].setAttribute("aria-expanded","false"),t(f).removeClass(h),t(o).removeClass(h).trigger(t.Event(l.HIDDEN,c)))}}}},s._getParentFromElement=function(e){var n,i=k.getSelectorFromElement(e);return i&&(n=t(i)[0]),n||e.parentNode},s._dataApiKeydownHandler=function(e){if((/input|textarea/i.test(e.target.tagName)?!(32===e.which||27!==e.which&&(40!==e.which&&38!==e.which||t(e.target).closest(E).length)):a.test(e.which))&&(e.preventDefault(),e.stopPropagation(),!this.disabled&&!t(this).hasClass(c))){var n=s._getParentFromElement(this),i=t(n).hasClass(h);if((i||27===e.which&&32===e.which)&&(!i||27!==e.which&&32!==e.which)){var r=t(n).find(b).get();if(0!==r.length){var o=r.indexOf(e.target);38===e.which&&o>0&&o--,40===e.which&&o<r.length-1&&o++,o<0&&(o=0),r[o].focus()}}else{if(27===e.which){var l=t(n).find(_)[0];t(l).trigger("focus")}t(this).trigger("click")}}},i(s,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return S}},{key:"DefaultType",get:function(){return O}}]),s}();return t(document).on(l.KEYDOWN_DATA_API,_,N._dataApiKeydownHandler).on(l.KEYDOWN_DATA_API,E,N._dataApiKeydownHandler).on(l.CLICK_DATA_API+" "+l.KEYUP_DATA_API,N._clearMenus).on(l.CLICK_DATA_API,_,function(e){e.preventDefault(),e.stopPropagation(),N._jQueryInterface.call(t(this),"toggle")}).on(l.CLICK_DATA_API,v,function(t){t.stopPropagation()}),t.fn[e]=N._jQueryInterface,t.fn[e].Constructor=N,t.fn[e].noConflict=function(){return t.fn[e]=s,N._jQueryInterface},N}(e),kt=function(t){var e="bs.modal",n="."+e,o=t.fn.modal,s={backdrop:!0,keyboard:!0,focus:!0,show:!0},a={backdrop:"(boolean|string)",keyboard:"boolean",focus:"boolean",show:"boolean"},l={HIDE:"hide"+n,HIDDEN:"hidden"+n,SHOW:"show"+n,SHOWN:"shown"+n,FOCUSIN:"focusin"+n,RESIZE:"resize"+n,CLICK_DISMISS:"click.dismiss"+n,KEYDOWN_DISMISS:"keydown.dismiss"+n,MOUSEUP_DISMISS:"mouseup.dismiss"+n,MOUSEDOWN_DISMISS:"mousedown.dismiss"+n,CLICK_DATA_API:"click.bs.modal.data-api"},c="modal-scrollbar-measure",h="modal-backdrop",f="modal-open",u="fade",d="show",p={DIALOG:".modal-dialog",DATA_TOGGLE:'[data-toggle="modal"]',DATA_DISMISS:'[data-dismiss="modal"]',FIXED_CONTENT:".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",STICKY_CONTENT:".sticky-top",NAVBAR_TOGGLER:".navbar-toggler"},g=function(){function o(e,n){this._config=this._getConfig(n),this._element=e,this._dialog=t(e).find(p.DIALOG)[0],this._backdrop=null,this._isShown=!1,this._isBodyOverflowing=!1,this._ignoreBackdropClick=!1,this._originalBodyPadding=0,this._scrollbarWidth=0}var g=o.prototype;return g.toggle=function(t){return this._isShown?this.hide():this.show(t)},g.show=function(e){var n=this;if(!this._isTransitioning&&!this._isShown){k.supportsTransitionEnd()&&t(this._element).hasClass(u)&&(this._isTransitioning=!0);var i=t.Event(l.SHOW,{relatedTarget:e});t(this._element).trigger(i),this._isShown||i.isDefaultPrevented()||(this._isShown=!0,this._checkScrollbar(),this._setScrollbar(),this._adjustDialog(),t(document.body).addClass(f),this._setEscapeEvent(),this._setResizeEvent(),t(this._element).on(l.CLICK_DISMISS,p.DATA_DISMISS,function(t){return n.hide(t)}),t(this._dialog).on(l.MOUSEDOWN_DISMISS,function(){t(n._element).one(l.MOUSEUP_DISMISS,function(e){t(e.target).is(n._element)&&(n._ignoreBackdropClick=!0)})}),this._showBackdrop(function(){return n._showElement(e)}))}},g.hide=function(e){var n=this;if(e&&e.preventDefault(),!this._isTransitioning&&this._isShown){var i=t.Event(l.HIDE);if(t(this._element).trigger(i),this._isShown&&!i.isDefaultPrevented()){this._isShown=!1;var r=k.supportsTransitionEnd()&&t(this._element).hasClass(u);r&&(this._isTransitioning=!0),this._setEscapeEvent(),this._setResizeEvent(),t(document).off(l.FOCUSIN),t(this._element).removeClass(d),t(this._element).off(l.CLICK_DISMISS),t(this._dialog).off(l.MOUSEDOWN_DISMISS),r?t(this._element).one(k.TRANSITION_END,function(t){return n._hideModal(t)}).emulateTransitionEnd(300):this._hideModal()}}},g.dispose=function(){t.removeData(this._element,e),t(window,document,this._element,this._backdrop).off(n),this._config=null,this._element=null,this._dialog=null,this._backdrop=null,this._isShown=null,this._isBodyOverflowing=null,this._ignoreBackdropClick=null,this._scrollbarWidth=null},g.handleUpdate=function(){this._adjustDialog()},g._getConfig=function(t){return t=r({},s,t),k.typeCheckConfig("modal",t,a),t},g._showElement=function(e){var n=this,i=k.supportsTransitionEnd()&&t(this._element).hasClass(u);this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE||document.body.appendChild(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.scrollTop=0,i&&k.reflow(this._element),t(this._element).addClass(d),this._config.focus&&this._enforceFocus();var r=t.Event(l.SHOWN,{relatedTarget:e}),o=function(){n._config.focus&&n._element.focus(),n._isTransitioning=!1,t(n._element).trigger(r)};i?t(this._dialog).one(k.TRANSITION_END,o).emulateTransitionEnd(300):o()},g._enforceFocus=function(){var e=this;t(document).off(l.FOCUSIN).on(l.FOCUSIN,function(n){document!==n.target&&e._element!==n.target&&0===t(e._element).has(n.target).length&&e._element.focus()})},g._setEscapeEvent=function(){var e=this;this._isShown&&this._config.keyboard?t(this._element).on(l.KEYDOWN_DISMISS,function(t){27===t.which&&(t.preventDefault(),e.hide())}):this._isShown||t(this._element).off(l.KEYDOWN_DISMISS)},g._setResizeEvent=function(){var e=this;this._isShown?t(window).on(l.RESIZE,function(t){return e.handleUpdate(t)}):t(window).off(l.RESIZE)},g._hideModal=function(){var e=this;this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._isTransitioning=!1,this._showBackdrop(function(){t(document.body).removeClass(f),e._resetAdjustments(),e._resetScrollbar(),t(e._element).trigger(l.HIDDEN)})},g._removeBackdrop=function(){this._backdrop&&(t(this._backdrop).remove(),this._backdrop=null)},g._showBackdrop=function(e){var n=this,i=t(this._element).hasClass(u)?u:"";if(this._isShown&&this._config.backdrop){var r=k.supportsTransitionEnd()&&i;if(this._backdrop=document.createElement("div"),this._backdrop.className=h,i&&t(this._backdrop).addClass(i),t(this._backdrop).appendTo(document.body),t(this._element).on(l.CLICK_DISMISS,function(t){n._ignoreBackdropClick?n._ignoreBackdropClick=!1:t.target===t.currentTarget&&("static"===n._config.backdrop?n._element.focus():n.hide())}),r&&k.reflow(this._backdrop),t(this._backdrop).addClass(d),!e)return;if(!r)return void e();t(this._backdrop).one(k.TRANSITION_END,e).emulateTransitionEnd(150)}else if(!this._isShown&&this._backdrop){t(this._backdrop).removeClass(d);var o=function(){n._removeBackdrop(),e&&e()};k.supportsTransitionEnd()&&t(this._element).hasClass(u)?t(this._backdrop).one(k.TRANSITION_END,o).emulateTransitionEnd(150):o()}else e&&e()},g._adjustDialog=function(){var t=this._element.scrollHeight>document.documentElement.clientHeight;!this._isBodyOverflowing&&t&&(this._element.style.paddingLeft=this._scrollbarWidth+"px"),this._isBodyOverflowing&&!t&&(this._element.style.paddingRight=this._scrollbarWidth+"px")},g._resetAdjustments=function(){this._element.style.paddingLeft="",this._element.style.paddingRight=""},g._checkScrollbar=function(){var t=document.body.getBoundingClientRect();this._isBodyOverflowing=t.left+t.right<window.innerWidth,this._scrollbarWidth=this._getScrollbarWidth()},g._setScrollbar=function(){var e=this;if(this._isBodyOverflowing){t(p.FIXED_CONTENT).each(function(n,i){var r=t(i)[0].style.paddingRight,o=t(i).css("padding-right");t(i).data("padding-right",r).css("padding-right",parseFloat(o)+e._scrollbarWidth+"px")}),t(p.STICKY_CONTENT).each(function(n,i){var r=t(i)[0].style.marginRight,o=t(i).css("margin-right");t(i).data("margin-right",r).css("margin-right",parseFloat(o)-e._scrollbarWidth+"px")}),t(p.NAVBAR_TOGGLER).each(function(n,i){var r=t(i)[0].style.marginRight,o=t(i).css("margin-right");t(i).data("margin-right",r).css("margin-right",parseFloat(o)+e._scrollbarWidth+"px")});var n=document.body.style.paddingRight,i=t("body").css("padding-right");t("body").data("padding-right",n).css("padding-right",parseFloat(i)+this._scrollbarWidth+"px")}},g._resetScrollbar=function(){t(p.FIXED_CONTENT).each(function(e,n){var i=t(n).data("padding-right");"undefined"!=typeof i&&t(n).css("padding-right",i).removeData("padding-right")}),t(p.STICKY_CONTENT+", "+p.NAVBAR_TOGGLER).each(function(e,n){var i=t(n).data("margin-right");"undefined"!=typeof i&&t(n).css("margin-right",i).removeData("margin-right")});var e=t("body").data("padding-right");"undefined"!=typeof e&&t("body").css("padding-right",e).removeData("padding-right")},g._getScrollbarWidth=function(){var t=document.createElement("div");t.className=c,document.body.appendChild(t);var e=t.getBoundingClientRect().width-t.clientWidth;return document.body.removeChild(t),e},o._jQueryInterface=function(n,i){return this.each(function(){var s=t(this).data(e),a=r({},o.Default,t(this).data(),"object"==typeof n&&n);if(s||(s=new o(this,a),t(this).data(e,s)),"string"==typeof n){if("undefined"==typeof s[n])throw new TypeError('No method named "'+n+'"');s[n](i)}else a.show&&s.show(i)})},i(o,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return s}}]),o}();return t(document).on(l.CLICK_DATA_API,p.DATA_TOGGLE,function(n){var i,o=this,s=k.getSelectorFromElement(this);s&&(i=t(s)[0]);var a=t(i).data(e)?"toggle":r({},t(i).data(),t(this).data());"A"!==this.tagName&&"AREA"!==this.tagName||n.preventDefault();var c=t(i).one(l.SHOW,function(e){e.isDefaultPrevented()||c.one(l.HIDDEN,function(){t(o).is(":visible")&&o.focus()})});g._jQueryInterface.call(t(i),a,this)}),t.fn.modal=g._jQueryInterface,t.fn.modal.Constructor=g,t.fn.modal.noConflict=function(){return t.fn.modal=o,g._jQueryInterface},g}(e),Lt=function(t){var e="tooltip",n="bs.tooltip",o="."+n,s=t.fn[e],a=new RegExp("(^|\\s)bs-tooltip\\S+","g"),l={animation:"boolean",template:"string",title:"(string|element|function)",trigger:"string",delay:"(number|object)",html:"boolean",selector:"(string|boolean)",placement:"(string|function)",offset:"(number|string)",container:"(string|element|boolean)",fallbackPlacement:"(string|array)",boundary:"(string|element)"},c={AUTO:"auto",TOP:"top",RIGHT:"right",BOTTOM:"bottom",LEFT:"left"},h={animation:!0,template:'<div class="tooltip" role="tooltip"><div class="arrow"></div><div class="tooltip-inner"></div></div>',trigger:"hover focus",title:"",delay:0,html:!1,selector:!1,placement:"top",offset:0,container:!1,fallbackPlacement:"flip",boundary:"scrollParent"},f="show",u="out",d={HIDE:"hide"+o,HIDDEN:"hidden"+o,SHOW:"show"+o,SHOWN:"shown"+o,INSERTED:"inserted"+o,CLICK:"click"+o,FOCUSIN:"focusin"+o,FOCUSOUT:"focusout"+o,MOUSEENTER:"mouseenter"+o,MOUSELEAVE:"mouseleave"+o},p="fade",g="show",m=".tooltip-inner",_=".arrow",v="hover",E="focus",y="click",b="manual",T=function(){function s(t,e){if("undefined"==typeof Ot)throw new TypeError("Bootstrap tooltips require Popper.js (https://popper.js.org)");this._isEnabled=!0,this._timeout=0,this._hoverState="",this._activeTrigger={},this._popper=null,this.element=t,this.config=this._getConfig(e),this.tip=null,this._setListeners()}var T=s.prototype;return T.enable=function(){this._isEnabled=!0},T.disable=function(){this._isEnabled=!1},T.toggleEnabled=function(){this._isEnabled=!this._isEnabled},T.toggle=function(e){if(this._isEnabled)if(e){var n=this.constructor.DATA_KEY,i=t(e.currentTarget).data(n);i||(i=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(n,i)),i._activeTrigger.click=!i._activeTrigger.click,i._isWithActiveTrigger()?i._enter(null,i):i._leave(null,i)}else{if(t(this.getTipElement()).hasClass(g))return void this._leave(null,this);this._enter(null,this)}},T.dispose=function(){clearTimeout(this._timeout),t.removeData(this.element,this.constructor.DATA_KEY),t(this.element).off(this.constructor.EVENT_KEY),t(this.element).closest(".modal").off("hide.bs.modal"),this.tip&&t(this.tip).remove(),this._isEnabled=null,this._timeout=null,this._hoverState=null,this._activeTrigger=null,null!==this._popper&&this._popper.destroy(),this._popper=null,this.element=null,this.config=null,this.tip=null},T.show=function(){var e=this;if("none"===t(this.element).css("display"))throw new Error("Please use show on visible elements");var n=t.Event(this.constructor.Event.SHOW);if(this.isWithContent()&&this._isEnabled){t(this.element).trigger(n);var i=t.contains(this.element.ownerDocument.documentElement,this.element);if(n.isDefaultPrevented()||!i)return;var r=this.getTipElement(),o=k.getUID(this.constructor.NAME);r.setAttribute("id",o),this.element.setAttribute("aria-describedby",o),this.setContent(),this.config.animation&&t(r).addClass(p);var a="function"==typeof this.config.placement?this.config.placement.call(this,r,this.element):this.config.placement,l=this._getAttachment(a);this.addAttachmentClass(l);var c=!1===this.config.container?document.body:t(this.config.container);t(r).data(this.constructor.DATA_KEY,this),t.contains(this.element.ownerDocument.documentElement,this.tip)||t(r).appendTo(c),t(this.element).trigger(this.constructor.Event.INSERTED),this._popper=new Ot(this.element,r,{placement:l,modifiers:{offset:{offset:this.config.offset},flip:{behavior:this.config.fallbackPlacement},arrow:{element:_},preventOverflow:{boundariesElement:this.config.boundary}},onCreate:function(t){t.originalPlacement!==t.placement&&e._handlePopperPlacementChange(t)},onUpdate:function(t){e._handlePopperPlacementChange(t)}}),t(r).addClass(g),"ontouchstart"in document.documentElement&&t("body").children().on("mouseover",null,t.noop);var h=function(){e.config.animation&&e._fixTransition();var n=e._hoverState;e._hoverState=null,t(e.element).trigger(e.constructor.Event.SHOWN),n===u&&e._leave(null,e)};k.supportsTransitionEnd()&&t(this.tip).hasClass(p)?t(this.tip).one(k.TRANSITION_END,h).emulateTransitionEnd(s._TRANSITION_DURATION):h()}},T.hide=function(e){var n=this,i=this.getTipElement(),r=t.Event(this.constructor.Event.HIDE),o=function(){n._hoverState!==f&&i.parentNode&&i.parentNode.removeChild(i),n._cleanTipClass(),n.element.removeAttribute("aria-describedby"),t(n.element).trigger(n.constructor.Event.HIDDEN),null!==n._popper&&n._popper.destroy(),e&&e()};t(this.element).trigger(r),r.isDefaultPrevented()||(t(i).removeClass(g),"ontouchstart"in document.documentElement&&t("body").children().off("mouseover",null,t.noop),this._activeTrigger[y]=!1,this._activeTrigger[E]=!1,this._activeTrigger[v]=!1,k.supportsTransitionEnd()&&t(this.tip).hasClass(p)?t(i).one(k.TRANSITION_END,o).emulateTransitionEnd(150):o(),this._hoverState="")},T.update=function(){null!==this._popper&&this._popper.scheduleUpdate()},T.isWithContent=function(){return Boolean(this.getTitle())},T.addAttachmentClass=function(e){t(this.getTipElement()).addClass("bs-tooltip-"+e)},T.getTipElement=function(){return this.tip=this.tip||t(this.config.template)[0],this.tip},T.setContent=function(){var e=t(this.getTipElement());this.setElementContent(e.find(m),this.getTitle()),e.removeClass(p+" "+g)},T.setElementContent=function(e,n){var i=this.config.html;"object"==typeof n&&(n.nodeType||n.jquery)?i?t(n).parent().is(e)||e.empty().append(n):e.text(t(n).text()):e[i?"html":"text"](n)},T.getTitle=function(){var t=this.element.getAttribute("data-original-title");return t||(t="function"==typeof this.config.title?this.config.title.call(this.element):this.config.title),t},T._getAttachment=function(t){return c[t.toUpperCase()]},T._setListeners=function(){var e=this;this.config.trigger.split(" ").forEach(function(n){if("click"===n)t(e.element).on(e.constructor.Event.CLICK,e.config.selector,function(t){return e.toggle(t)});else if(n!==b){var i=n===v?e.constructor.Event.MOUSEENTER:e.constructor.Event.FOCUSIN,r=n===v?e.constructor.Event.MOUSELEAVE:e.constructor.Event.FOCUSOUT;t(e.element).on(i,e.config.selector,function(t){return e._enter(t)}).on(r,e.config.selector,function(t){return e._leave(t)})}t(e.element).closest(".modal").on("hide.bs.modal",function(){return e.hide()})}),this.config.selector?this.config=r({},this.config,{trigger:"manual",selector:""}):this._fixTitle()},T._fixTitle=function(){var t=typeof this.element.getAttribute("data-original-title");(this.element.getAttribute("title")||"string"!==t)&&(this.element.setAttribute("data-original-title",this.element.getAttribute("title")||""),this.element.setAttribute("title",""))},T._enter=function(e,n){var i=this.constructor.DATA_KEY;(n=n||t(e.currentTarget).data(i))||(n=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(i,n)),e&&(n._activeTrigger["focusin"===e.type?E:v]=!0),t(n.getTipElement()).hasClass(g)||n._hoverState===f?n._hoverState=f:(clearTimeout(n._timeout),n._hoverState=f,n.config.delay&&n.config.delay.show?n._timeout=setTimeout(function(){n._hoverState===f&&n.show()},n.config.delay.show):n.show())},T._leave=function(e,n){var i=this.constructor.DATA_KEY;(n=n||t(e.currentTarget).data(i))||(n=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(i,n)),e&&(n._activeTrigger["focusout"===e.type?E:v]=!1),n._isWithActiveTrigger()||(clearTimeout(n._timeout),n._hoverState=u,n.config.delay&&n.config.delay.hide?n._timeout=setTimeout(function(){n._hoverState===u&&n.hide()},n.config.delay.hide):n.hide())},T._isWithActiveTrigger=function(){for(var t in this._activeTrigger)if(this._activeTrigger[t])return!0;return!1},T._getConfig=function(n){return"number"==typeof(n=r({},this.constructor.Default,t(this.element).data(),n)).delay&&(n.delay={show:n.delay,hide:n.delay}),"number"==typeof n.title&&(n.title=n.title.toString()),"number"==typeof n.content&&(n.content=n.content.toString()),k.typeCheckConfig(e,n,this.constructor.DefaultType),n},T._getDelegateConfig=function(){var t={};if(this.config)for(var e in this.config)this.constructor.Default[e]!==this.config[e]&&(t[e]=this.config[e]);return t},T._cleanTipClass=function(){var e=t(this.getTipElement()),n=e.attr("class").match(a);null!==n&&n.length>0&&e.removeClass(n.join(""))},T._handlePopperPlacementChange=function(t){this._cleanTipClass(),this.addAttachmentClass(this._getAttachment(t.placement))},T._fixTransition=function(){var e=this.getTipElement(),n=this.config.animation;null===e.getAttribute("x-placement")&&(t(e).removeClass(p),this.config.animation=!1,this.hide(),this.show(),this.config.animation=n)},s._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n),r="object"==typeof e&&e;if((i||!/dispose|hide/.test(e))&&(i||(i=new s(this,r),t(this).data(n,i)),"string"==typeof e)){if("undefined"==typeof i[e])throw new TypeError('No method named "'+e+'"');i[e]()}})},i(s,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return h}},{key:"NAME",get:function(){return e}},{key:"DATA_KEY",get:function(){return n}},{key:"Event",get:function(){return d}},{key:"EVENT_KEY",get:function(){return o}},{key:"DefaultType",get:function(){return l}}]),s}();return t.fn[e]=T._jQueryInterface,t.fn[e].Constructor=T,t.fn[e].noConflict=function(){return t.fn[e]=s,T._jQueryInterface},T}(e),Pt=function(t){var e="popover",n="bs.popover",o="."+n,s=t.fn[e],a=new RegExp("(^|\\s)bs-popover\\S+","g"),l=r({},Lt.Default,{placement:"right",trigger:"click",content:"",template:'<div class="popover" role="tooltip"><div class="arrow"></div><h3 class="popover-header"></h3><div class="popover-body"></div></div>'}),c=r({},Lt.DefaultType,{content:"(string|element|function)"}),h="fade",f="show",u=".popover-header",d=".popover-body",p={HIDE:"hide"+o,HIDDEN:"hidden"+o,SHOW:"show"+o,SHOWN:"shown"+o,INSERTED:"inserted"+o,CLICK:"click"+o,FOCUSIN:"focusin"+o,FOCUSOUT:"focusout"+o,MOUSEENTER:"mouseenter"+o,MOUSELEAVE:"mouseleave"+o},g=function(r){var s,g;function m(){return r.apply(this,arguments)||this}g=r,(s=m).prototype=Object.create(g.prototype),s.prototype.constructor=s,s.__proto__=g;var _=m.prototype;return _.isWithContent=function(){return this.getTitle()||this._getContent()},_.addAttachmentClass=function(e){t(this.getTipElement()).addClass("bs-popover-"+e)},_.getTipElement=function(){return this.tip=this.tip||t(this.config.template)[0],this.tip},_.setContent=function(){var e=t(this.getTipElement());this.setElementContent(e.find(u),this.getTitle());var n=this._getContent();"function"==typeof n&&(n=n.call(this.element)),this.setElementContent(e.find(d),n),e.removeClass(h+" "+f)},_._getContent=function(){return this.element.getAttribute("data-content")||this.config.content},_._cleanTipClass=function(){var e=t(this.getTipElement()),n=e.attr("class").match(a);null!==n&&n.length>0&&e.removeClass(n.join(""))},m._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n),r="object"==typeof e?e:null;if((i||!/destroy|hide/.test(e))&&(i||(i=new m(this,r),t(this).data(n,i)),"string"==typeof e)){if("undefined"==typeof i[e])throw new TypeError('No method named "'+e+'"');i[e]()}})},i(m,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return l}},{key:"NAME",get:function(){return e}},{key:"DATA_KEY",get:function(){return n}},{key:"Event",get:function(){return p}},{key:"EVENT_KEY",get:function(){return o}},{key:"DefaultType",get:function(){return c}}]),m}(Lt);return t.fn[e]=g._jQueryInterface,t.fn[e].Constructor=g,t.fn[e].noConflict=function(){return t.fn[e]=s,g._jQueryInterface},g}(e),xt=function(t){var e="scrollspy",n="bs.scrollspy",o="."+n,s=t.fn[e],a={offset:10,method:"auto",target:""},l={offset:"number",method:"string",target:"(string|element)"},c={ACTIVATE:"activate"+o,SCROLL:"scroll"+o,LOAD_DATA_API:"load"+o+".data-api"},h="dropdown-item",f="active",u={DATA_SPY:'[data-spy="scroll"]',ACTIVE:".active",NAV_LIST_GROUP:".nav, .list-group",NAV_LINKS:".nav-link",NAV_ITEMS:".nav-item",LIST_ITEMS:".list-group-item",DROPDOWN:".dropdown",DROPDOWN_ITEMS:".dropdown-item",DROPDOWN_TOGGLE:".dropdown-toggle"},d="offset",p="position",g=function(){function s(e,n){var i=this;this._element=e,this._scrollElement="BODY"===e.tagName?window:e,this._config=this._getConfig(n),this._selector=this._config.target+" "+u.NAV_LINKS+","+this._config.target+" "+u.LIST_ITEMS+","+this._config.target+" "+u.DROPDOWN_ITEMS,this._offsets=[],this._targets=[],this._activeTarget=null,this._scrollHeight=0,t(this._scrollElement).on(c.SCROLL,function(t){return i._process(t)}),this.refresh(),this._process()}var g=s.prototype;return g.refresh=function(){var e=this,n=this._scrollElement===this._scrollElement.window?d:p,i="auto"===this._config.method?n:this._config.method,r=i===p?this._getScrollTop():0;this._offsets=[],this._targets=[],this._scrollHeight=this._getScrollHeight(),t.makeArray(t(this._selector)).map(function(e){var n,o=k.getSelectorFromElement(e);if(o&&(n=t(o)[0]),n){var s=n.getBoundingClientRect();if(s.width||s.height)return[t(n)[i]().top+r,o]}return null}).filter(function(t){return t}).sort(function(t,e){return t[0]-e[0]}).forEach(function(t){e._offsets.push(t[0]),e._targets.push(t[1])})},g.dispose=function(){t.removeData(this._element,n),t(this._scrollElement).off(o),this._element=null,this._scrollElement=null,this._config=null,this._selector=null,this._offsets=null,this._targets=null,this._activeTarget=null,this._scrollHeight=null},g._getConfig=function(n){if("string"!=typeof(n=r({},a,n)).target){var i=t(n.target).attr("id");i||(i=k.getUID(e),t(n.target).attr("id",i)),n.target="#"+i}return k.typeCheckConfig(e,n,l),n},g._getScrollTop=function(){return this._scrollElement===window?this._scrollElement.pageYOffset:this._scrollElement.scrollTop},g._getScrollHeight=function(){return this._scrollElement.scrollHeight||Math.max(document.body.scrollHeight,document.documentElement.scrollHeight)},g._getOffsetHeight=function(){return this._scrollElement===window?window.innerHeight:this._scrollElement.getBoundingClientRect().height},g._process=function(){var t=this._getScrollTop()+this._config.offset,e=this._getScrollHeight(),n=this._config.offset+e-this._getOffsetHeight();if(this._scrollHeight!==e&&this.refresh(),t>=n){var i=this._targets[this._targets.length-1];this._activeTarget!==i&&this._activate(i)}else{if(this._activeTarget&&t<this._offsets[0]&&this._offsets[0]>0)return this._activeTarget=null,void this._clear();for(var r=this._offsets.length;r--;){this._activeTarget!==this._targets[r]&&t>=this._offsets[r]&&("undefined"==typeof this._offsets[r+1]||t<this._offsets[r+1])&&this._activate(this._targets[r])}}},g._activate=function(e){this._activeTarget=e,this._clear();var n=this._selector.split(",");n=n.map(function(t){return t+'[data-target="'+e+'"],'+t+'[href="'+e+'"]'});var i=t(n.join(","));i.hasClass(h)?(i.closest(u.DROPDOWN).find(u.DROPDOWN_TOGGLE).addClass(f),i.addClass(f)):(i.addClass(f),i.parents(u.NAV_LIST_GROUP).prev(u.NAV_LINKS+", "+u.LIST_ITEMS).addClass(f),i.parents(u.NAV_LIST_GROUP).prev(u.NAV_ITEMS).children(u.NAV_LINKS).addClass(f)),t(this._scrollElement).trigger(c.ACTIVATE,{relatedTarget:e})},g._clear=function(){t(this._selector).filter(u.ACTIVE).removeClass(f)},s._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n);if(i||(i=new s(this,"object"==typeof e&&e),t(this).data(n,i)),"string"==typeof e){if("undefined"==typeof i[e])throw new TypeError('No method named "'+e+'"');i[e]()}})},i(s,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return a}}]),s}();return t(window).on(c.LOAD_DATA_API,function(){for(var e=t.makeArray(t(u.DATA_SPY)),n=e.length;n--;){var i=t(e[n]);g._jQueryInterface.call(i,i.data())}}),t.fn[e]=g._jQueryInterface,t.fn[e].Constructor=g,t.fn[e].noConflict=function(){return t.fn[e]=s,g._jQueryInterface},g}(e),Rt=function(t){var e=".bs.tab",n=t.fn.tab,r={HIDE:"hide"+e,HIDDEN:"hidden"+e,SHOW:"show"+e,SHOWN:"shown"+e,CLICK_DATA_API:"click.bs.tab.data-api"},o="dropdown-menu",s="active",a="disabled",l="fade",c="show",h=".dropdown",f=".nav, .list-group",u=".active",d="> li > .active",p='[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]',g=".dropdown-toggle",m="> .dropdown-menu .active",_=function(){function e(t){this._element=t}var n=e.prototype;return n.show=function(){var e=this;if(!(this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE&&t(this._element).hasClass(s)||t(this._element).hasClass(a))){var n,i,o=t(this._element).closest(f)[0],l=k.getSelectorFromElement(this._element);if(o){var c="UL"===o.nodeName?d:u;i=(i=t.makeArray(t(o).find(c)))[i.length-1]}var h=t.Event(r.HIDE,{relatedTarget:this._element}),p=t.Event(r.SHOW,{relatedTarget:i});if(i&&t(i).trigger(h),t(this._element).trigger(p),!p.isDefaultPrevented()&&!h.isDefaultPrevented()){l&&(n=t(l)[0]),this._activate(this._element,o);var g=function(){var n=t.Event(r.HIDDEN,{relatedTarget:e._element}),o=t.Event(r.SHOWN,{relatedTarget:i});t(i).trigger(n),t(e._element).trigger(o)};n?this._activate(n,n.parentNode,g):g()}}},n.dispose=function(){t.removeData(this._element,"bs.tab"),this._element=null},n._activate=function(e,n,i){var r=this,o=("UL"===n.nodeName?t(n).find(d):t(n).children(u))[0],s=i&&k.supportsTransitionEnd()&&o&&t(o).hasClass(l),a=function(){return r._transitionComplete(e,o,i)};o&&s?t(o).one(k.TRANSITION_END,a).emulateTransitionEnd(150):a()},n._transitionComplete=function(e,n,i){if(n){t(n).removeClass(c+" "+s);var r=t(n.parentNode).find(m)[0];r&&t(r).removeClass(s),"tab"===n.getAttribute("role")&&n.setAttribute("aria-selected",!1)}if(t(e).addClass(s),"tab"===e.getAttribute("role")&&e.setAttribute("aria-selected",!0),k.reflow(e),t(e).addClass(c),e.parentNode&&t(e.parentNode).hasClass(o)){var a=t(e).closest(h)[0];a&&t(a).find(g).addClass(s),e.setAttribute("aria-expanded",!0)}i&&i()},e._jQueryInterface=function(n){return this.each(function(){var i=t(this),r=i.data("bs.tab");if(r||(r=new e(this),i.data("bs.tab",r)),"string"==typeof n){if("undefined"==typeof r[n])throw new TypeError('No method named "'+n+'"');r[n]()}})},i(e,null,[{key:"VERSION",get:function(){return"4.0.0"}}]),e}();return t(document).on(r.CLICK_DATA_API,p,function(e){e.preventDefault(),_._jQueryInterface.call(t(this),"show")}),t.fn.tab=_._jQueryInterface,t.fn.tab.Constructor=_,t.fn.tab.noConflict=function(){return t.fn.tab=n,_._jQueryInterface},_}(e);!function(t){if("undefined"==typeof t)throw new TypeError("Bootstrap's JavaScript requires jQuery. jQuery must be included before Bootstrap's JavaScript.");var e=t.fn.jquery.split(" ")[0].split(".");if(e[0]<2&&e[1]<9||1===e[0]&&9===e[1]&&e[2]<1||e[0]>=4)throw new Error("Bootstrap's JavaScript requires at least jQuery v1.9.1 but less than v4.0.0")}(e),t.Util=k,t.Alert=L,t.Button=P,t.Carousel=x,t.Collapse=R,t.Dropdown=Nt,t.Modal=kt,t.Popover=Pt,t.Scrollspy=xt,t.Tab=Rt,t.Tooltip=Lt,Object.defineProperty(t,"__esModule",{value:!0})});
+//# sourceMappingURL=bootstrap.bundle.min.js.map \ No newline at end of file
diff --git a/chall/src/js/bootstrap.js b/chall/src/js/bootstrap.js
new file mode 100644
index 0000000..6d9549d
--- /dev/null
+++ b/chall/src/js/bootstrap.js
@@ -0,0 +1,3894 @@
+/*!
+ * Bootstrap v4.0.0 (https://getbootstrap.com)
+ * Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ */
+(function (global, factory) {
+ typeof exports === 'object' && typeof module !== 'undefined' ? factory(exports, require('jquery'), require('popper.js')) :
+ typeof define === 'function' && define.amd ? define(['exports', 'jquery', 'popper.js'], factory) :
+ (factory((global.bootstrap = {}),global.jQuery,global.Popper));
+}(this, (function (exports,$,Popper) { 'use strict';
+
+$ = $ && $.hasOwnProperty('default') ? $['default'] : $;
+Popper = Popper && Popper.hasOwnProperty('default') ? Popper['default'] : Popper;
+
+function _defineProperties(target, props) {
+ for (var i = 0; i < props.length; i++) {
+ var descriptor = props[i];
+ descriptor.enumerable = descriptor.enumerable || false;
+ descriptor.configurable = true;
+ if ("value" in descriptor) descriptor.writable = true;
+ Object.defineProperty(target, descriptor.key, descriptor);
+ }
+}
+
+function _createClass(Constructor, protoProps, staticProps) {
+ if (protoProps) _defineProperties(Constructor.prototype, protoProps);
+ if (staticProps) _defineProperties(Constructor, staticProps);
+ return Constructor;
+}
+
+function _extends() {
+ _extends = Object.assign || function (target) {
+ for (var i = 1; i < arguments.length; i++) {
+ var source = arguments[i];
+
+ for (var key in source) {
+ if (Object.prototype.hasOwnProperty.call(source, key)) {
+ target[key] = source[key];
+ }
+ }
+ }
+
+ return target;
+ };
+
+ return _extends.apply(this, arguments);
+}
+
+function _inheritsLoose(subClass, superClass) {
+ subClass.prototype = Object.create(superClass.prototype);
+ subClass.prototype.constructor = subClass;
+ subClass.__proto__ = superClass;
+}
+
+/**
+ * --------------------------------------------------------------------------
+ * Bootstrap (v4.0.0): util.js
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * --------------------------------------------------------------------------
+ */
+
+var Util = function ($$$1) {
+ /**
+ * ------------------------------------------------------------------------
+ * Private TransitionEnd Helpers
+ * ------------------------------------------------------------------------
+ */
+ var transition = false;
+ var MAX_UID = 1000000; // Shoutout AngusCroll (https://goo.gl/pxwQGp)
+
+ function toType(obj) {
+ return {}.toString.call(obj).match(/\s([a-zA-Z]+)/)[1].toLowerCase();
+ }
+
+ function getSpecialTransitionEndEvent() {
+ return {
+ bindType: transition.end,
+ delegateType: transition.end,
+ handle: function handle(event) {
+ if ($$$1(event.target).is(this)) {
+ return event.handleObj.handler.apply(this, arguments); // eslint-disable-line prefer-rest-params
+ }
+
+ return undefined; // eslint-disable-line no-undefined
+ }
+ };
+ }
+
+ function transitionEndTest() {
+ if (typeof window !== 'undefined' && window.QUnit) {
+ return false;
+ }
+
+ return {
+ end: 'transitionend'
+ };
+ }
+
+ function transitionEndEmulator(duration) {
+ var _this = this;
+
+ var called = false;
+ $$$1(this).one(Util.TRANSITION_END, function () {
+ called = true;
+ });
+ setTimeout(function () {
+ if (!called) {
+ Util.triggerTransitionEnd(_this);
+ }
+ }, duration);
+ return this;
+ }
+
+ function setTransitionEndSupport() {
+ transition = transitionEndTest();
+ $$$1.fn.emulateTransitionEnd = transitionEndEmulator;
+
+ if (Util.supportsTransitionEnd()) {
+ $$$1.event.special[Util.TRANSITION_END] = getSpecialTransitionEndEvent();
+ }
+ }
+
+ function escapeId(selector) {
+ // We escape IDs in case of special selectors (selector = '#myId:something')
+ // $.escapeSelector does not exist in jQuery < 3
+ selector = typeof $$$1.escapeSelector === 'function' ? $$$1.escapeSelector(selector).substr(1) : selector.replace(/(:|\.|\[|\]|,|=|@)/g, '\\$1');
+ return selector;
+ }
+ /**
+ * --------------------------------------------------------------------------
+ * Public Util Api
+ * --------------------------------------------------------------------------
+ */
+
+
+ var Util = {
+ TRANSITION_END: 'bsTransitionEnd',
+ getUID: function getUID(prefix) {
+ do {
+ // eslint-disable-next-line no-bitwise
+ prefix += ~~(Math.random() * MAX_UID); // "~~" acts like a faster Math.floor() here
+ } while (document.getElementById(prefix));
+
+ return prefix;
+ },
+ getSelectorFromElement: function getSelectorFromElement(element) {
+ var selector = element.getAttribute('data-target');
+
+ if (!selector || selector === '#') {
+ selector = element.getAttribute('href') || '';
+ } // If it's an ID
+
+
+ if (selector.charAt(0) === '#') {
+ selector = escapeId(selector);
+ }
+
+ try {
+ var $selector = $$$1(document).find(selector);
+ return $selector.length > 0 ? selector : null;
+ } catch (err) {
+ return null;
+ }
+ },
+ reflow: function reflow(element) {
+ return element.offsetHeight;
+ },
+ triggerTransitionEnd: function triggerTransitionEnd(element) {
+ $$$1(element).trigger(transition.end);
+ },
+ supportsTransitionEnd: function supportsTransitionEnd() {
+ return Boolean(transition);
+ },
+ isElement: function isElement(obj) {
+ return (obj[0] || obj).nodeType;
+ },
+ typeCheckConfig: function typeCheckConfig(componentName, config, configTypes) {
+ for (var property in configTypes) {
+ if (Object.prototype.hasOwnProperty.call(configTypes, property)) {
+ var expectedTypes = configTypes[property];
+ var value = config[property];
+ var valueType = value && Util.isElement(value) ? 'element' : toType(value);
+
+ if (!new RegExp(expectedTypes).test(valueType)) {
+ throw new Error(componentName.toUpperCase() + ": " + ("Option \"" + property + "\" provided type \"" + valueType + "\" ") + ("but expected type \"" + expectedTypes + "\"."));
+ }
+ }
+ }
+ }
+ };
+ setTransitionEndSupport();
+ return Util;
+}($);
+
+/**
+ * --------------------------------------------------------------------------
+ * Bootstrap (v4.0.0): alert.js
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * --------------------------------------------------------------------------
+ */
+
+var Alert = function ($$$1) {
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+ var NAME = 'alert';
+ var VERSION = '4.0.0';
+ var DATA_KEY = 'bs.alert';
+ var EVENT_KEY = "." + DATA_KEY;
+ var DATA_API_KEY = '.data-api';
+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
+ var TRANSITION_DURATION = 150;
+ var Selector = {
+ DISMISS: '[data-dismiss="alert"]'
+ };
+ var Event = {
+ CLOSE: "close" + EVENT_KEY,
+ CLOSED: "closed" + EVENT_KEY,
+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
+ };
+ var ClassName = {
+ ALERT: 'alert',
+ FADE: 'fade',
+ SHOW: 'show'
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Alert =
+ /*#__PURE__*/
+ function () {
+ function Alert(element) {
+ this._element = element;
+ } // Getters
+
+
+ var _proto = Alert.prototype;
+
+ // Public
+ _proto.close = function close(element) {
+ element = element || this._element;
+
+ var rootElement = this._getRootElement(element);
+
+ var customEvent = this._triggerCloseEvent(rootElement);
+
+ if (customEvent.isDefaultPrevented()) {
+ return;
+ }
+
+ this._removeElement(rootElement);
+ };
+
+ _proto.dispose = function dispose() {
+ $$$1.removeData(this._element, DATA_KEY);
+ this._element = null;
+ }; // Private
+
+
+ _proto._getRootElement = function _getRootElement(element) {
+ var selector = Util.getSelectorFromElement(element);
+ var parent = false;
+
+ if (selector) {
+ parent = $$$1(selector)[0];
+ }
+
+ if (!parent) {
+ parent = $$$1(element).closest("." + ClassName.ALERT)[0];
+ }
+
+ return parent;
+ };
+
+ _proto._triggerCloseEvent = function _triggerCloseEvent(element) {
+ var closeEvent = $$$1.Event(Event.CLOSE);
+ $$$1(element).trigger(closeEvent);
+ return closeEvent;
+ };
+
+ _proto._removeElement = function _removeElement(element) {
+ var _this = this;
+
+ $$$1(element).removeClass(ClassName.SHOW);
+
+ if (!Util.supportsTransitionEnd() || !$$$1(element).hasClass(ClassName.FADE)) {
+ this._destroyElement(element);
+
+ return;
+ }
+
+ $$$1(element).one(Util.TRANSITION_END, function (event) {
+ return _this._destroyElement(element, event);
+ }).emulateTransitionEnd(TRANSITION_DURATION);
+ };
+
+ _proto._destroyElement = function _destroyElement(element) {
+ $$$1(element).detach().trigger(Event.CLOSED).remove();
+ }; // Static
+
+
+ Alert._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var $element = $$$1(this);
+ var data = $element.data(DATA_KEY);
+
+ if (!data) {
+ data = new Alert(this);
+ $element.data(DATA_KEY, data);
+ }
+
+ if (config === 'close') {
+ data[config](this);
+ }
+ });
+ };
+
+ Alert._handleDismiss = function _handleDismiss(alertInstance) {
+ return function (event) {
+ if (event) {
+ event.preventDefault();
+ }
+
+ alertInstance.close(this);
+ };
+ };
+
+ _createClass(Alert, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION;
+ }
+ }]);
+ return Alert;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * Data Api implementation
+ * ------------------------------------------------------------------------
+ */
+
+
+ $$$1(document).on(Event.CLICK_DATA_API, Selector.DISMISS, Alert._handleDismiss(new Alert()));
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+ $$$1.fn[NAME] = Alert._jQueryInterface;
+ $$$1.fn[NAME].Constructor = Alert;
+
+ $$$1.fn[NAME].noConflict = function () {
+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
+ return Alert._jQueryInterface;
+ };
+
+ return Alert;
+}($);
+
+/**
+ * --------------------------------------------------------------------------
+ * Bootstrap (v4.0.0): button.js
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * --------------------------------------------------------------------------
+ */
+
+var Button = function ($$$1) {
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+ var NAME = 'button';
+ var VERSION = '4.0.0';
+ var DATA_KEY = 'bs.button';
+ var EVENT_KEY = "." + DATA_KEY;
+ var DATA_API_KEY = '.data-api';
+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
+ var ClassName = {
+ ACTIVE: 'active',
+ BUTTON: 'btn',
+ FOCUS: 'focus'
+ };
+ var Selector = {
+ DATA_TOGGLE_CARROT: '[data-toggle^="button"]',
+ DATA_TOGGLE: '[data-toggle="buttons"]',
+ INPUT: 'input',
+ ACTIVE: '.active',
+ BUTTON: '.btn'
+ };
+ var Event = {
+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY,
+ FOCUS_BLUR_DATA_API: "focus" + EVENT_KEY + DATA_API_KEY + " " + ("blur" + EVENT_KEY + DATA_API_KEY)
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Button =
+ /*#__PURE__*/
+ function () {
+ function Button(element) {
+ this._element = element;
+ } // Getters
+
+
+ var _proto = Button.prototype;
+
+ // Public
+ _proto.toggle = function toggle() {
+ var triggerChangeEvent = true;
+ var addAriaPressed = true;
+ var rootElement = $$$1(this._element).closest(Selector.DATA_TOGGLE)[0];
+
+ if (rootElement) {
+ var input = $$$1(this._element).find(Selector.INPUT)[0];
+
+ if (input) {
+ if (input.type === 'radio') {
+ if (input.checked && $$$1(this._element).hasClass(ClassName.ACTIVE)) {
+ triggerChangeEvent = false;
+ } else {
+ var activeElement = $$$1(rootElement).find(Selector.ACTIVE)[0];
+
+ if (activeElement) {
+ $$$1(activeElement).removeClass(ClassName.ACTIVE);
+ }
+ }
+ }
+
+ if (triggerChangeEvent) {
+ if (input.hasAttribute('disabled') || rootElement.hasAttribute('disabled') || input.classList.contains('disabled') || rootElement.classList.contains('disabled')) {
+ return;
+ }
+
+ input.checked = !$$$1(this._element).hasClass(ClassName.ACTIVE);
+ $$$1(input).trigger('change');
+ }
+
+ input.focus();
+ addAriaPressed = false;
+ }
+ }
+
+ if (addAriaPressed) {
+ this._element.setAttribute('aria-pressed', !$$$1(this._element).hasClass(ClassName.ACTIVE));
+ }
+
+ if (triggerChangeEvent) {
+ $$$1(this._element).toggleClass(ClassName.ACTIVE);
+ }
+ };
+
+ _proto.dispose = function dispose() {
+ $$$1.removeData(this._element, DATA_KEY);
+ this._element = null;
+ }; // Static
+
+
+ Button._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var data = $$$1(this).data(DATA_KEY);
+
+ if (!data) {
+ data = new Button(this);
+ $$$1(this).data(DATA_KEY, data);
+ }
+
+ if (config === 'toggle') {
+ data[config]();
+ }
+ });
+ };
+
+ _createClass(Button, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION;
+ }
+ }]);
+ return Button;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * Data Api implementation
+ * ------------------------------------------------------------------------
+ */
+
+
+ $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE_CARROT, function (event) {
+ event.preventDefault();
+ var button = event.target;
+
+ if (!$$$1(button).hasClass(ClassName.BUTTON)) {
+ button = $$$1(button).closest(Selector.BUTTON);
+ }
+
+ Button._jQueryInterface.call($$$1(button), 'toggle');
+ }).on(Event.FOCUS_BLUR_DATA_API, Selector.DATA_TOGGLE_CARROT, function (event) {
+ var button = $$$1(event.target).closest(Selector.BUTTON)[0];
+ $$$1(button).toggleClass(ClassName.FOCUS, /^focus(in)?$/.test(event.type));
+ });
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+ $$$1.fn[NAME] = Button._jQueryInterface;
+ $$$1.fn[NAME].Constructor = Button;
+
+ $$$1.fn[NAME].noConflict = function () {
+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
+ return Button._jQueryInterface;
+ };
+
+ return Button;
+}($);
+
+/**
+ * --------------------------------------------------------------------------
+ * Bootstrap (v4.0.0): carousel.js
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * --------------------------------------------------------------------------
+ */
+
+var Carousel = function ($$$1) {
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+ var NAME = 'carousel';
+ var VERSION = '4.0.0';
+ var DATA_KEY = 'bs.carousel';
+ var EVENT_KEY = "." + DATA_KEY;
+ var DATA_API_KEY = '.data-api';
+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
+ var TRANSITION_DURATION = 600;
+ var ARROW_LEFT_KEYCODE = 37; // KeyboardEvent.which value for left arrow key
+
+ var ARROW_RIGHT_KEYCODE = 39; // KeyboardEvent.which value for right arrow key
+
+ var TOUCHEVENT_COMPAT_WAIT = 500; // Time for mouse compat events to fire after touch
+
+ var Default = {
+ interval: 5000,
+ keyboard: true,
+ slide: false,
+ pause: 'hover',
+ wrap: true
+ };
+ var DefaultType = {
+ interval: '(number|boolean)',
+ keyboard: 'boolean',
+ slide: '(boolean|string)',
+ pause: '(string|boolean)',
+ wrap: 'boolean'
+ };
+ var Direction = {
+ NEXT: 'next',
+ PREV: 'prev',
+ LEFT: 'left',
+ RIGHT: 'right'
+ };
+ var Event = {
+ SLIDE: "slide" + EVENT_KEY,
+ SLID: "slid" + EVENT_KEY,
+ KEYDOWN: "keydown" + EVENT_KEY,
+ MOUSEENTER: "mouseenter" + EVENT_KEY,
+ MOUSELEAVE: "mouseleave" + EVENT_KEY,
+ TOUCHEND: "touchend" + EVENT_KEY,
+ LOAD_DATA_API: "load" + EVENT_KEY + DATA_API_KEY,
+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
+ };
+ var ClassName = {
+ CAROUSEL: 'carousel',
+ ACTIVE: 'active',
+ SLIDE: 'slide',
+ RIGHT: 'carousel-item-right',
+ LEFT: 'carousel-item-left',
+ NEXT: 'carousel-item-next',
+ PREV: 'carousel-item-prev',
+ ITEM: 'carousel-item'
+ };
+ var Selector = {
+ ACTIVE: '.active',
+ ACTIVE_ITEM: '.active.carousel-item',
+ ITEM: '.carousel-item',
+ NEXT_PREV: '.carousel-item-next, .carousel-item-prev',
+ INDICATORS: '.carousel-indicators',
+ DATA_SLIDE: '[data-slide], [data-slide-to]',
+ DATA_RIDE: '[data-ride="carousel"]'
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Carousel =
+ /*#__PURE__*/
+ function () {
+ function Carousel(element, config) {
+ this._items = null;
+ this._interval = null;
+ this._activeElement = null;
+ this._isPaused = false;
+ this._isSliding = false;
+ this.touchTimeout = null;
+ this._config = this._getConfig(config);
+ this._element = $$$1(element)[0];
+ this._indicatorsElement = $$$1(this._element).find(Selector.INDICATORS)[0];
+
+ this._addEventListeners();
+ } // Getters
+
+
+ var _proto = Carousel.prototype;
+
+ // Public
+ _proto.next = function next() {
+ if (!this._isSliding) {
+ this._slide(Direction.NEXT);
+ }
+ };
+
+ _proto.nextWhenVisible = function nextWhenVisible() {
+ // Don't call next when the page isn't visible
+ // or the carousel or its parent isn't visible
+ if (!document.hidden && $$$1(this._element).is(':visible') && $$$1(this._element).css('visibility') !== 'hidden') {
+ this.next();
+ }
+ };
+
+ _proto.prev = function prev() {
+ if (!this._isSliding) {
+ this._slide(Direction.PREV);
+ }
+ };
+
+ _proto.pause = function pause(event) {
+ if (!event) {
+ this._isPaused = true;
+ }
+
+ if ($$$1(this._element).find(Selector.NEXT_PREV)[0] && Util.supportsTransitionEnd()) {
+ Util.triggerTransitionEnd(this._element);
+ this.cycle(true);
+ }
+
+ clearInterval(this._interval);
+ this._interval = null;
+ };
+
+ _proto.cycle = function cycle(event) {
+ if (!event) {
+ this._isPaused = false;
+ }
+
+ if (this._interval) {
+ clearInterval(this._interval);
+ this._interval = null;
+ }
+
+ if (this._config.interval && !this._isPaused) {
+ this._interval = setInterval((document.visibilityState ? this.nextWhenVisible : this.next).bind(this), this._config.interval);
+ }
+ };
+
+ _proto.to = function to(index) {
+ var _this = this;
+
+ this._activeElement = $$$1(this._element).find(Selector.ACTIVE_ITEM)[0];
+
+ var activeIndex = this._getItemIndex(this._activeElement);
+
+ if (index > this._items.length - 1 || index < 0) {
+ return;
+ }
+
+ if (this._isSliding) {
+ $$$1(this._element).one(Event.SLID, function () {
+ return _this.to(index);
+ });
+ return;
+ }
+
+ if (activeIndex === index) {
+ this.pause();
+ this.cycle();
+ return;
+ }
+
+ var direction = index > activeIndex ? Direction.NEXT : Direction.PREV;
+
+ this._slide(direction, this._items[index]);
+ };
+
+ _proto.dispose = function dispose() {
+ $$$1(this._element).off(EVENT_KEY);
+ $$$1.removeData(this._element, DATA_KEY);
+ this._items = null;
+ this._config = null;
+ this._element = null;
+ this._interval = null;
+ this._isPaused = null;
+ this._isSliding = null;
+ this._activeElement = null;
+ this._indicatorsElement = null;
+ }; // Private
+
+
+ _proto._getConfig = function _getConfig(config) {
+ config = _extends({}, Default, config);
+ Util.typeCheckConfig(NAME, config, DefaultType);
+ return config;
+ };
+
+ _proto._addEventListeners = function _addEventListeners() {
+ var _this2 = this;
+
+ if (this._config.keyboard) {
+ $$$1(this._element).on(Event.KEYDOWN, function (event) {
+ return _this2._keydown(event);
+ });
+ }
+
+ if (this._config.pause === 'hover') {
+ $$$1(this._element).on(Event.MOUSEENTER, function (event) {
+ return _this2.pause(event);
+ }).on(Event.MOUSELEAVE, function (event) {
+ return _this2.cycle(event);
+ });
+
+ if ('ontouchstart' in document.documentElement) {
+ // If it's a touch-enabled device, mouseenter/leave are fired as
+ // part of the mouse compatibility events on first tap - the carousel
+ // would stop cycling until user tapped out of it;
+ // here, we listen for touchend, explicitly pause the carousel
+ // (as if it's the second time we tap on it, mouseenter compat event
+ // is NOT fired) and after a timeout (to allow for mouse compatibility
+ // events to fire) we explicitly restart cycling
+ $$$1(this._element).on(Event.TOUCHEND, function () {
+ _this2.pause();
+
+ if (_this2.touchTimeout) {
+ clearTimeout(_this2.touchTimeout);
+ }
+
+ _this2.touchTimeout = setTimeout(function (event) {
+ return _this2.cycle(event);
+ }, TOUCHEVENT_COMPAT_WAIT + _this2._config.interval);
+ });
+ }
+ }
+ };
+
+ _proto._keydown = function _keydown(event) {
+ if (/input|textarea/i.test(event.target.tagName)) {
+ return;
+ }
+
+ switch (event.which) {
+ case ARROW_LEFT_KEYCODE:
+ event.preventDefault();
+ this.prev();
+ break;
+
+ case ARROW_RIGHT_KEYCODE:
+ event.preventDefault();
+ this.next();
+ break;
+
+ default:
+ }
+ };
+
+ _proto._getItemIndex = function _getItemIndex(element) {
+ this._items = $$$1.makeArray($$$1(element).parent().find(Selector.ITEM));
+ return this._items.indexOf(element);
+ };
+
+ _proto._getItemByDirection = function _getItemByDirection(direction, activeElement) {
+ var isNextDirection = direction === Direction.NEXT;
+ var isPrevDirection = direction === Direction.PREV;
+
+ var activeIndex = this._getItemIndex(activeElement);
+
+ var lastItemIndex = this._items.length - 1;
+ var isGoingToWrap = isPrevDirection && activeIndex === 0 || isNextDirection && activeIndex === lastItemIndex;
+
+ if (isGoingToWrap && !this._config.wrap) {
+ return activeElement;
+ }
+
+ var delta = direction === Direction.PREV ? -1 : 1;
+ var itemIndex = (activeIndex + delta) % this._items.length;
+ return itemIndex === -1 ? this._items[this._items.length - 1] : this._items[itemIndex];
+ };
+
+ _proto._triggerSlideEvent = function _triggerSlideEvent(relatedTarget, eventDirectionName) {
+ var targetIndex = this._getItemIndex(relatedTarget);
+
+ var fromIndex = this._getItemIndex($$$1(this._element).find(Selector.ACTIVE_ITEM)[0]);
+
+ var slideEvent = $$$1.Event(Event.SLIDE, {
+ relatedTarget: relatedTarget,
+ direction: eventDirectionName,
+ from: fromIndex,
+ to: targetIndex
+ });
+ $$$1(this._element).trigger(slideEvent);
+ return slideEvent;
+ };
+
+ _proto._setActiveIndicatorElement = function _setActiveIndicatorElement(element) {
+ if (this._indicatorsElement) {
+ $$$1(this._indicatorsElement).find(Selector.ACTIVE).removeClass(ClassName.ACTIVE);
+
+ var nextIndicator = this._indicatorsElement.children[this._getItemIndex(element)];
+
+ if (nextIndicator) {
+ $$$1(nextIndicator).addClass(ClassName.ACTIVE);
+ }
+ }
+ };
+
+ _proto._slide = function _slide(direction, element) {
+ var _this3 = this;
+
+ var activeElement = $$$1(this._element).find(Selector.ACTIVE_ITEM)[0];
+
+ var activeElementIndex = this._getItemIndex(activeElement);
+
+ var nextElement = element || activeElement && this._getItemByDirection(direction, activeElement);
+
+ var nextElementIndex = this._getItemIndex(nextElement);
+
+ var isCycling = Boolean(this._interval);
+ var directionalClassName;
+ var orderClassName;
+ var eventDirectionName;
+
+ if (direction === Direction.NEXT) {
+ directionalClassName = ClassName.LEFT;
+ orderClassName = ClassName.NEXT;
+ eventDirectionName = Direction.LEFT;
+ } else {
+ directionalClassName = ClassName.RIGHT;
+ orderClassName = ClassName.PREV;
+ eventDirectionName = Direction.RIGHT;
+ }
+
+ if (nextElement && $$$1(nextElement).hasClass(ClassName.ACTIVE)) {
+ this._isSliding = false;
+ return;
+ }
+
+ var slideEvent = this._triggerSlideEvent(nextElement, eventDirectionName);
+
+ if (slideEvent.isDefaultPrevented()) {
+ return;
+ }
+
+ if (!activeElement || !nextElement) {
+ // Some weirdness is happening, so we bail
+ return;
+ }
+
+ this._isSliding = true;
+
+ if (isCycling) {
+ this.pause();
+ }
+
+ this._setActiveIndicatorElement(nextElement);
+
+ var slidEvent = $$$1.Event(Event.SLID, {
+ relatedTarget: nextElement,
+ direction: eventDirectionName,
+ from: activeElementIndex,
+ to: nextElementIndex
+ });
+
+ if (Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.SLIDE)) {
+ $$$1(nextElement).addClass(orderClassName);
+ Util.reflow(nextElement);
+ $$$1(activeElement).addClass(directionalClassName);
+ $$$1(nextElement).addClass(directionalClassName);
+ $$$1(activeElement).one(Util.TRANSITION_END, function () {
+ $$$1(nextElement).removeClass(directionalClassName + " " + orderClassName).addClass(ClassName.ACTIVE);
+ $$$1(activeElement).removeClass(ClassName.ACTIVE + " " + orderClassName + " " + directionalClassName);
+ _this3._isSliding = false;
+ setTimeout(function () {
+ return $$$1(_this3._element).trigger(slidEvent);
+ }, 0);
+ }).emulateTransitionEnd(TRANSITION_DURATION);
+ } else {
+ $$$1(activeElement).removeClass(ClassName.ACTIVE);
+ $$$1(nextElement).addClass(ClassName.ACTIVE);
+ this._isSliding = false;
+ $$$1(this._element).trigger(slidEvent);
+ }
+
+ if (isCycling) {
+ this.cycle();
+ }
+ }; // Static
+
+
+ Carousel._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var data = $$$1(this).data(DATA_KEY);
+
+ var _config = _extends({}, Default, $$$1(this).data());
+
+ if (typeof config === 'object') {
+ _config = _extends({}, _config, config);
+ }
+
+ var action = typeof config === 'string' ? config : _config.slide;
+
+ if (!data) {
+ data = new Carousel(this, _config);
+ $$$1(this).data(DATA_KEY, data);
+ }
+
+ if (typeof config === 'number') {
+ data.to(config);
+ } else if (typeof action === 'string') {
+ if (typeof data[action] === 'undefined') {
+ throw new TypeError("No method named \"" + action + "\"");
+ }
+
+ data[action]();
+ } else if (_config.interval) {
+ data.pause();
+ data.cycle();
+ }
+ });
+ };
+
+ Carousel._dataApiClickHandler = function _dataApiClickHandler(event) {
+ var selector = Util.getSelectorFromElement(this);
+
+ if (!selector) {
+ return;
+ }
+
+ var target = $$$1(selector)[0];
+
+ if (!target || !$$$1(target).hasClass(ClassName.CAROUSEL)) {
+ return;
+ }
+
+ var config = _extends({}, $$$1(target).data(), $$$1(this).data());
+ var slideIndex = this.getAttribute('data-slide-to');
+
+ if (slideIndex) {
+ config.interval = false;
+ }
+
+ Carousel._jQueryInterface.call($$$1(target), config);
+
+ if (slideIndex) {
+ $$$1(target).data(DATA_KEY).to(slideIndex);
+ }
+
+ event.preventDefault();
+ };
+
+ _createClass(Carousel, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION;
+ }
+ }, {
+ key: "Default",
+ get: function get() {
+ return Default;
+ }
+ }]);
+ return Carousel;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * Data Api implementation
+ * ------------------------------------------------------------------------
+ */
+
+
+ $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_SLIDE, Carousel._dataApiClickHandler);
+ $$$1(window).on(Event.LOAD_DATA_API, function () {
+ $$$1(Selector.DATA_RIDE).each(function () {
+ var $carousel = $$$1(this);
+
+ Carousel._jQueryInterface.call($carousel, $carousel.data());
+ });
+ });
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+ $$$1.fn[NAME] = Carousel._jQueryInterface;
+ $$$1.fn[NAME].Constructor = Carousel;
+
+ $$$1.fn[NAME].noConflict = function () {
+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
+ return Carousel._jQueryInterface;
+ };
+
+ return Carousel;
+}($);
+
+/**
+ * --------------------------------------------------------------------------
+ * Bootstrap (v4.0.0): collapse.js
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * --------------------------------------------------------------------------
+ */
+
+var Collapse = function ($$$1) {
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+ var NAME = 'collapse';
+ var VERSION = '4.0.0';
+ var DATA_KEY = 'bs.collapse';
+ var EVENT_KEY = "." + DATA_KEY;
+ var DATA_API_KEY = '.data-api';
+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
+ var TRANSITION_DURATION = 600;
+ var Default = {
+ toggle: true,
+ parent: ''
+ };
+ var DefaultType = {
+ toggle: 'boolean',
+ parent: '(string|element)'
+ };
+ var Event = {
+ SHOW: "show" + EVENT_KEY,
+ SHOWN: "shown" + EVENT_KEY,
+ HIDE: "hide" + EVENT_KEY,
+ HIDDEN: "hidden" + EVENT_KEY,
+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
+ };
+ var ClassName = {
+ SHOW: 'show',
+ COLLAPSE: 'collapse',
+ COLLAPSING: 'collapsing',
+ COLLAPSED: 'collapsed'
+ };
+ var Dimension = {
+ WIDTH: 'width',
+ HEIGHT: 'height'
+ };
+ var Selector = {
+ ACTIVES: '.show, .collapsing',
+ DATA_TOGGLE: '[data-toggle="collapse"]'
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Collapse =
+ /*#__PURE__*/
+ function () {
+ function Collapse(element, config) {
+ this._isTransitioning = false;
+ this._element = element;
+ this._config = this._getConfig(config);
+ this._triggerArray = $$$1.makeArray($$$1("[data-toggle=\"collapse\"][href=\"#" + element.id + "\"]," + ("[data-toggle=\"collapse\"][data-target=\"#" + element.id + "\"]")));
+ var tabToggles = $$$1(Selector.DATA_TOGGLE);
+
+ for (var i = 0; i < tabToggles.length; i++) {
+ var elem = tabToggles[i];
+ var selector = Util.getSelectorFromElement(elem);
+
+ if (selector !== null && $$$1(selector).filter(element).length > 0) {
+ this._selector = selector;
+
+ this._triggerArray.push(elem);
+ }
+ }
+
+ this._parent = this._config.parent ? this._getParent() : null;
+
+ if (!this._config.parent) {
+ this._addAriaAndCollapsedClass(this._element, this._triggerArray);
+ }
+
+ if (this._config.toggle) {
+ this.toggle();
+ }
+ } // Getters
+
+
+ var _proto = Collapse.prototype;
+
+ // Public
+ _proto.toggle = function toggle() {
+ if ($$$1(this._element).hasClass(ClassName.SHOW)) {
+ this.hide();
+ } else {
+ this.show();
+ }
+ };
+
+ _proto.show = function show() {
+ var _this = this;
+
+ if (this._isTransitioning || $$$1(this._element).hasClass(ClassName.SHOW)) {
+ return;
+ }
+
+ var actives;
+ var activesData;
+
+ if (this._parent) {
+ actives = $$$1.makeArray($$$1(this._parent).find(Selector.ACTIVES).filter("[data-parent=\"" + this._config.parent + "\"]"));
+
+ if (actives.length === 0) {
+ actives = null;
+ }
+ }
+
+ if (actives) {
+ activesData = $$$1(actives).not(this._selector).data(DATA_KEY);
+
+ if (activesData && activesData._isTransitioning) {
+ return;
+ }
+ }
+
+ var startEvent = $$$1.Event(Event.SHOW);
+ $$$1(this._element).trigger(startEvent);
+
+ if (startEvent.isDefaultPrevented()) {
+ return;
+ }
+
+ if (actives) {
+ Collapse._jQueryInterface.call($$$1(actives).not(this._selector), 'hide');
+
+ if (!activesData) {
+ $$$1(actives).data(DATA_KEY, null);
+ }
+ }
+
+ var dimension = this._getDimension();
+
+ $$$1(this._element).removeClass(ClassName.COLLAPSE).addClass(ClassName.COLLAPSING);
+ this._element.style[dimension] = 0;
+
+ if (this._triggerArray.length > 0) {
+ $$$1(this._triggerArray).removeClass(ClassName.COLLAPSED).attr('aria-expanded', true);
+ }
+
+ this.setTransitioning(true);
+
+ var complete = function complete() {
+ $$$1(_this._element).removeClass(ClassName.COLLAPSING).addClass(ClassName.COLLAPSE).addClass(ClassName.SHOW);
+ _this._element.style[dimension] = '';
+
+ _this.setTransitioning(false);
+
+ $$$1(_this._element).trigger(Event.SHOWN);
+ };
+
+ if (!Util.supportsTransitionEnd()) {
+ complete();
+ return;
+ }
+
+ var capitalizedDimension = dimension[0].toUpperCase() + dimension.slice(1);
+ var scrollSize = "scroll" + capitalizedDimension;
+ $$$1(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(TRANSITION_DURATION);
+ this._element.style[dimension] = this._element[scrollSize] + "px";
+ };
+
+ _proto.hide = function hide() {
+ var _this2 = this;
+
+ if (this._isTransitioning || !$$$1(this._element).hasClass(ClassName.SHOW)) {
+ return;
+ }
+
+ var startEvent = $$$1.Event(Event.HIDE);
+ $$$1(this._element).trigger(startEvent);
+
+ if (startEvent.isDefaultPrevented()) {
+ return;
+ }
+
+ var dimension = this._getDimension();
+
+ this._element.style[dimension] = this._element.getBoundingClientRect()[dimension] + "px";
+ Util.reflow(this._element);
+ $$$1(this._element).addClass(ClassName.COLLAPSING).removeClass(ClassName.COLLAPSE).removeClass(ClassName.SHOW);
+
+ if (this._triggerArray.length > 0) {
+ for (var i = 0; i < this._triggerArray.length; i++) {
+ var trigger = this._triggerArray[i];
+ var selector = Util.getSelectorFromElement(trigger);
+
+ if (selector !== null) {
+ var $elem = $$$1(selector);
+
+ if (!$elem.hasClass(ClassName.SHOW)) {
+ $$$1(trigger).addClass(ClassName.COLLAPSED).attr('aria-expanded', false);
+ }
+ }
+ }
+ }
+
+ this.setTransitioning(true);
+
+ var complete = function complete() {
+ _this2.setTransitioning(false);
+
+ $$$1(_this2._element).removeClass(ClassName.COLLAPSING).addClass(ClassName.COLLAPSE).trigger(Event.HIDDEN);
+ };
+
+ this._element.style[dimension] = '';
+
+ if (!Util.supportsTransitionEnd()) {
+ complete();
+ return;
+ }
+
+ $$$1(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(TRANSITION_DURATION);
+ };
+
+ _proto.setTransitioning = function setTransitioning(isTransitioning) {
+ this._isTransitioning = isTransitioning;
+ };
+
+ _proto.dispose = function dispose() {
+ $$$1.removeData(this._element, DATA_KEY);
+ this._config = null;
+ this._parent = null;
+ this._element = null;
+ this._triggerArray = null;
+ this._isTransitioning = null;
+ }; // Private
+
+
+ _proto._getConfig = function _getConfig(config) {
+ config = _extends({}, Default, config);
+ config.toggle = Boolean(config.toggle); // Coerce string values
+
+ Util.typeCheckConfig(NAME, config, DefaultType);
+ return config;
+ };
+
+ _proto._getDimension = function _getDimension() {
+ var hasWidth = $$$1(this._element).hasClass(Dimension.WIDTH);
+ return hasWidth ? Dimension.WIDTH : Dimension.HEIGHT;
+ };
+
+ _proto._getParent = function _getParent() {
+ var _this3 = this;
+
+ var parent = null;
+
+ if (Util.isElement(this._config.parent)) {
+ parent = this._config.parent; // It's a jQuery object
+
+ if (typeof this._config.parent.jquery !== 'undefined') {
+ parent = this._config.parent[0];
+ }
+ } else {
+ parent = $$$1(this._config.parent)[0];
+ }
+
+ var selector = "[data-toggle=\"collapse\"][data-parent=\"" + this._config.parent + "\"]";
+ $$$1(parent).find(selector).each(function (i, element) {
+ _this3._addAriaAndCollapsedClass(Collapse._getTargetFromElement(element), [element]);
+ });
+ return parent;
+ };
+
+ _proto._addAriaAndCollapsedClass = function _addAriaAndCollapsedClass(element, triggerArray) {
+ if (element) {
+ var isOpen = $$$1(element).hasClass(ClassName.SHOW);
+
+ if (triggerArray.length > 0) {
+ $$$1(triggerArray).toggleClass(ClassName.COLLAPSED, !isOpen).attr('aria-expanded', isOpen);
+ }
+ }
+ }; // Static
+
+
+ Collapse._getTargetFromElement = function _getTargetFromElement(element) {
+ var selector = Util.getSelectorFromElement(element);
+ return selector ? $$$1(selector)[0] : null;
+ };
+
+ Collapse._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var $this = $$$1(this);
+ var data = $this.data(DATA_KEY);
+
+ var _config = _extends({}, Default, $this.data(), typeof config === 'object' && config);
+
+ if (!data && _config.toggle && /show|hide/.test(config)) {
+ _config.toggle = false;
+ }
+
+ if (!data) {
+ data = new Collapse(this, _config);
+ $this.data(DATA_KEY, data);
+ }
+
+ if (typeof config === 'string') {
+ if (typeof data[config] === 'undefined') {
+ throw new TypeError("No method named \"" + config + "\"");
+ }
+
+ data[config]();
+ }
+ });
+ };
+
+ _createClass(Collapse, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION;
+ }
+ }, {
+ key: "Default",
+ get: function get() {
+ return Default;
+ }
+ }]);
+ return Collapse;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * Data Api implementation
+ * ------------------------------------------------------------------------
+ */
+
+
+ $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) {
+ // preventDefault only for <a> elements (which change the URL) not inside the collapsible element
+ if (event.currentTarget.tagName === 'A') {
+ event.preventDefault();
+ }
+
+ var $trigger = $$$1(this);
+ var selector = Util.getSelectorFromElement(this);
+ $$$1(selector).each(function () {
+ var $target = $$$1(this);
+ var data = $target.data(DATA_KEY);
+ var config = data ? 'toggle' : $trigger.data();
+
+ Collapse._jQueryInterface.call($target, config);
+ });
+ });
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+ $$$1.fn[NAME] = Collapse._jQueryInterface;
+ $$$1.fn[NAME].Constructor = Collapse;
+
+ $$$1.fn[NAME].noConflict = function () {
+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
+ return Collapse._jQueryInterface;
+ };
+
+ return Collapse;
+}($);
+
+/**
+ * --------------------------------------------------------------------------
+ * Bootstrap (v4.0.0): dropdown.js
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * --------------------------------------------------------------------------
+ */
+
+var Dropdown = function ($$$1) {
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+ var NAME = 'dropdown';
+ var VERSION = '4.0.0';
+ var DATA_KEY = 'bs.dropdown';
+ var EVENT_KEY = "." + DATA_KEY;
+ var DATA_API_KEY = '.data-api';
+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
+ var ESCAPE_KEYCODE = 27; // KeyboardEvent.which value for Escape (Esc) key
+
+ var SPACE_KEYCODE = 32; // KeyboardEvent.which value for space key
+
+ var TAB_KEYCODE = 9; // KeyboardEvent.which value for tab key
+
+ var ARROW_UP_KEYCODE = 38; // KeyboardEvent.which value for up arrow key
+
+ var ARROW_DOWN_KEYCODE = 40; // KeyboardEvent.which value for down arrow key
+
+ var RIGHT_MOUSE_BUTTON_WHICH = 3; // MouseEvent.which value for the right button (assuming a right-handed mouse)
+
+ var REGEXP_KEYDOWN = new RegExp(ARROW_UP_KEYCODE + "|" + ARROW_DOWN_KEYCODE + "|" + ESCAPE_KEYCODE);
+ var Event = {
+ HIDE: "hide" + EVENT_KEY,
+ HIDDEN: "hidden" + EVENT_KEY,
+ SHOW: "show" + EVENT_KEY,
+ SHOWN: "shown" + EVENT_KEY,
+ CLICK: "click" + EVENT_KEY,
+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY,
+ KEYDOWN_DATA_API: "keydown" + EVENT_KEY + DATA_API_KEY,
+ KEYUP_DATA_API: "keyup" + EVENT_KEY + DATA_API_KEY
+ };
+ var ClassName = {
+ DISABLED: 'disabled',
+ SHOW: 'show',
+ DROPUP: 'dropup',
+ DROPRIGHT: 'dropright',
+ DROPLEFT: 'dropleft',
+ MENURIGHT: 'dropdown-menu-right',
+ MENULEFT: 'dropdown-menu-left',
+ POSITION_STATIC: 'position-static'
+ };
+ var Selector = {
+ DATA_TOGGLE: '[data-toggle="dropdown"]',
+ FORM_CHILD: '.dropdown form',
+ MENU: '.dropdown-menu',
+ NAVBAR_NAV: '.navbar-nav',
+ VISIBLE_ITEMS: '.dropdown-menu .dropdown-item:not(.disabled)'
+ };
+ var AttachmentMap = {
+ TOP: 'top-start',
+ TOPEND: 'top-end',
+ BOTTOM: 'bottom-start',
+ BOTTOMEND: 'bottom-end',
+ RIGHT: 'right-start',
+ RIGHTEND: 'right-end',
+ LEFT: 'left-start',
+ LEFTEND: 'left-end'
+ };
+ var Default = {
+ offset: 0,
+ flip: true,
+ boundary: 'scrollParent'
+ };
+ var DefaultType = {
+ offset: '(number|string|function)',
+ flip: 'boolean',
+ boundary: '(string|element)'
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Dropdown =
+ /*#__PURE__*/
+ function () {
+ function Dropdown(element, config) {
+ this._element = element;
+ this._popper = null;
+ this._config = this._getConfig(config);
+ this._menu = this._getMenuElement();
+ this._inNavbar = this._detectNavbar();
+
+ this._addEventListeners();
+ } // Getters
+
+
+ var _proto = Dropdown.prototype;
+
+ // Public
+ _proto.toggle = function toggle() {
+ if (this._element.disabled || $$$1(this._element).hasClass(ClassName.DISABLED)) {
+ return;
+ }
+
+ var parent = Dropdown._getParentFromElement(this._element);
+
+ var isActive = $$$1(this._menu).hasClass(ClassName.SHOW);
+
+ Dropdown._clearMenus();
+
+ if (isActive) {
+ return;
+ }
+
+ var relatedTarget = {
+ relatedTarget: this._element
+ };
+ var showEvent = $$$1.Event(Event.SHOW, relatedTarget);
+ $$$1(parent).trigger(showEvent);
+
+ if (showEvent.isDefaultPrevented()) {
+ return;
+ } // Disable totally Popper.js for Dropdown in Navbar
+
+
+ if (!this._inNavbar) {
+ /**
+ * Check for Popper dependency
+ * Popper - https://popper.js.org
+ */
+ if (typeof Popper === 'undefined') {
+ throw new TypeError('Bootstrap dropdown require Popper.js (https://popper.js.org)');
+ }
+
+ var element = this._element; // For dropup with alignment we use the parent as popper container
+
+ if ($$$1(parent).hasClass(ClassName.DROPUP)) {
+ if ($$$1(this._menu).hasClass(ClassName.MENULEFT) || $$$1(this._menu).hasClass(ClassName.MENURIGHT)) {
+ element = parent;
+ }
+ } // If boundary is not `scrollParent`, then set position to `static`
+ // to allow the menu to "escape" the scroll parent's boundaries
+ // https://github.com/twbs/bootstrap/issues/24251
+
+
+ if (this._config.boundary !== 'scrollParent') {
+ $$$1(parent).addClass(ClassName.POSITION_STATIC);
+ }
+
+ this._popper = new Popper(element, this._menu, this._getPopperConfig());
+ } // If this is a touch-enabled device we add extra
+ // empty mouseover listeners to the body's immediate children;
+ // only needed because of broken event delegation on iOS
+ // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html
+
+
+ if ('ontouchstart' in document.documentElement && $$$1(parent).closest(Selector.NAVBAR_NAV).length === 0) {
+ $$$1('body').children().on('mouseover', null, $$$1.noop);
+ }
+
+ this._element.focus();
+
+ this._element.setAttribute('aria-expanded', true);
+
+ $$$1(this._menu).toggleClass(ClassName.SHOW);
+ $$$1(parent).toggleClass(ClassName.SHOW).trigger($$$1.Event(Event.SHOWN, relatedTarget));
+ };
+
+ _proto.dispose = function dispose() {
+ $$$1.removeData(this._element, DATA_KEY);
+ $$$1(this._element).off(EVENT_KEY);
+ this._element = null;
+ this._menu = null;
+
+ if (this._popper !== null) {
+ this._popper.destroy();
+
+ this._popper = null;
+ }
+ };
+
+ _proto.update = function update() {
+ this._inNavbar = this._detectNavbar();
+
+ if (this._popper !== null) {
+ this._popper.scheduleUpdate();
+ }
+ }; // Private
+
+
+ _proto._addEventListeners = function _addEventListeners() {
+ var _this = this;
+
+ $$$1(this._element).on(Event.CLICK, function (event) {
+ event.preventDefault();
+ event.stopPropagation();
+
+ _this.toggle();
+ });
+ };
+
+ _proto._getConfig = function _getConfig(config) {
+ config = _extends({}, this.constructor.Default, $$$1(this._element).data(), config);
+ Util.typeCheckConfig(NAME, config, this.constructor.DefaultType);
+ return config;
+ };
+
+ _proto._getMenuElement = function _getMenuElement() {
+ if (!this._menu) {
+ var parent = Dropdown._getParentFromElement(this._element);
+
+ this._menu = $$$1(parent).find(Selector.MENU)[0];
+ }
+
+ return this._menu;
+ };
+
+ _proto._getPlacement = function _getPlacement() {
+ var $parentDropdown = $$$1(this._element).parent();
+ var placement = AttachmentMap.BOTTOM; // Handle dropup
+
+ if ($parentDropdown.hasClass(ClassName.DROPUP)) {
+ placement = AttachmentMap.TOP;
+
+ if ($$$1(this._menu).hasClass(ClassName.MENURIGHT)) {
+ placement = AttachmentMap.TOPEND;
+ }
+ } else if ($parentDropdown.hasClass(ClassName.DROPRIGHT)) {
+ placement = AttachmentMap.RIGHT;
+ } else if ($parentDropdown.hasClass(ClassName.DROPLEFT)) {
+ placement = AttachmentMap.LEFT;
+ } else if ($$$1(this._menu).hasClass(ClassName.MENURIGHT)) {
+ placement = AttachmentMap.BOTTOMEND;
+ }
+
+ return placement;
+ };
+
+ _proto._detectNavbar = function _detectNavbar() {
+ return $$$1(this._element).closest('.navbar').length > 0;
+ };
+
+ _proto._getPopperConfig = function _getPopperConfig() {
+ var _this2 = this;
+
+ var offsetConf = {};
+
+ if (typeof this._config.offset === 'function') {
+ offsetConf.fn = function (data) {
+ data.offsets = _extends({}, data.offsets, _this2._config.offset(data.offsets) || {});
+ return data;
+ };
+ } else {
+ offsetConf.offset = this._config.offset;
+ }
+
+ var popperConfig = {
+ placement: this._getPlacement(),
+ modifiers: {
+ offset: offsetConf,
+ flip: {
+ enabled: this._config.flip
+ },
+ preventOverflow: {
+ boundariesElement: this._config.boundary
+ }
+ }
+ };
+ return popperConfig;
+ }; // Static
+
+
+ Dropdown._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var data = $$$1(this).data(DATA_KEY);
+
+ var _config = typeof config === 'object' ? config : null;
+
+ if (!data) {
+ data = new Dropdown(this, _config);
+ $$$1(this).data(DATA_KEY, data);
+ }
+
+ if (typeof config === 'string') {
+ if (typeof data[config] === 'undefined') {
+ throw new TypeError("No method named \"" + config + "\"");
+ }
+
+ data[config]();
+ }
+ });
+ };
+
+ Dropdown._clearMenus = function _clearMenus(event) {
+ if (event && (event.which === RIGHT_MOUSE_BUTTON_WHICH || event.type === 'keyup' && event.which !== TAB_KEYCODE)) {
+ return;
+ }
+
+ var toggles = $$$1.makeArray($$$1(Selector.DATA_TOGGLE));
+
+ for (var i = 0; i < toggles.length; i++) {
+ var parent = Dropdown._getParentFromElement(toggles[i]);
+
+ var context = $$$1(toggles[i]).data(DATA_KEY);
+ var relatedTarget = {
+ relatedTarget: toggles[i]
+ };
+
+ if (!context) {
+ continue;
+ }
+
+ var dropdownMenu = context._menu;
+
+ if (!$$$1(parent).hasClass(ClassName.SHOW)) {
+ continue;
+ }
+
+ if (event && (event.type === 'click' && /input|textarea/i.test(event.target.tagName) || event.type === 'keyup' && event.which === TAB_KEYCODE) && $$$1.contains(parent, event.target)) {
+ continue;
+ }
+
+ var hideEvent = $$$1.Event(Event.HIDE, relatedTarget);
+ $$$1(parent).trigger(hideEvent);
+
+ if (hideEvent.isDefaultPrevented()) {
+ continue;
+ } // If this is a touch-enabled device we remove the extra
+ // empty mouseover listeners we added for iOS support
+
+
+ if ('ontouchstart' in document.documentElement) {
+ $$$1('body').children().off('mouseover', null, $$$1.noop);
+ }
+
+ toggles[i].setAttribute('aria-expanded', 'false');
+ $$$1(dropdownMenu).removeClass(ClassName.SHOW);
+ $$$1(parent).removeClass(ClassName.SHOW).trigger($$$1.Event(Event.HIDDEN, relatedTarget));
+ }
+ };
+
+ Dropdown._getParentFromElement = function _getParentFromElement(element) {
+ var parent;
+ var selector = Util.getSelectorFromElement(element);
+
+ if (selector) {
+ parent = $$$1(selector)[0];
+ }
+
+ return parent || element.parentNode;
+ }; // eslint-disable-next-line complexity
+
+
+ Dropdown._dataApiKeydownHandler = function _dataApiKeydownHandler(event) {
+ // If not input/textarea:
+ // - And not a key in REGEXP_KEYDOWN => not a dropdown command
+ // If input/textarea:
+ // - If space key => not a dropdown command
+ // - If key is other than escape
+ // - If key is not up or down => not a dropdown command
+ // - If trigger inside the menu => not a dropdown command
+ if (/input|textarea/i.test(event.target.tagName) ? event.which === SPACE_KEYCODE || event.which !== ESCAPE_KEYCODE && (event.which !== ARROW_DOWN_KEYCODE && event.which !== ARROW_UP_KEYCODE || $$$1(event.target).closest(Selector.MENU).length) : !REGEXP_KEYDOWN.test(event.which)) {
+ return;
+ }
+
+ event.preventDefault();
+ event.stopPropagation();
+
+ if (this.disabled || $$$1(this).hasClass(ClassName.DISABLED)) {
+ return;
+ }
+
+ var parent = Dropdown._getParentFromElement(this);
+
+ var isActive = $$$1(parent).hasClass(ClassName.SHOW);
+
+ if (!isActive && (event.which !== ESCAPE_KEYCODE || event.which !== SPACE_KEYCODE) || isActive && (event.which === ESCAPE_KEYCODE || event.which === SPACE_KEYCODE)) {
+ if (event.which === ESCAPE_KEYCODE) {
+ var toggle = $$$1(parent).find(Selector.DATA_TOGGLE)[0];
+ $$$1(toggle).trigger('focus');
+ }
+
+ $$$1(this).trigger('click');
+ return;
+ }
+
+ var items = $$$1(parent).find(Selector.VISIBLE_ITEMS).get();
+
+ if (items.length === 0) {
+ return;
+ }
+
+ var index = items.indexOf(event.target);
+
+ if (event.which === ARROW_UP_KEYCODE && index > 0) {
+ // Up
+ index--;
+ }
+
+ if (event.which === ARROW_DOWN_KEYCODE && index < items.length - 1) {
+ // Down
+ index++;
+ }
+
+ if (index < 0) {
+ index = 0;
+ }
+
+ items[index].focus();
+ };
+
+ _createClass(Dropdown, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION;
+ }
+ }, {
+ key: "Default",
+ get: function get() {
+ return Default;
+ }
+ }, {
+ key: "DefaultType",
+ get: function get() {
+ return DefaultType;
+ }
+ }]);
+ return Dropdown;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * Data Api implementation
+ * ------------------------------------------------------------------------
+ */
+
+
+ $$$1(document).on(Event.KEYDOWN_DATA_API, Selector.DATA_TOGGLE, Dropdown._dataApiKeydownHandler).on(Event.KEYDOWN_DATA_API, Selector.MENU, Dropdown._dataApiKeydownHandler).on(Event.CLICK_DATA_API + " " + Event.KEYUP_DATA_API, Dropdown._clearMenus).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) {
+ event.preventDefault();
+ event.stopPropagation();
+
+ Dropdown._jQueryInterface.call($$$1(this), 'toggle');
+ }).on(Event.CLICK_DATA_API, Selector.FORM_CHILD, function (e) {
+ e.stopPropagation();
+ });
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+ $$$1.fn[NAME] = Dropdown._jQueryInterface;
+ $$$1.fn[NAME].Constructor = Dropdown;
+
+ $$$1.fn[NAME].noConflict = function () {
+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
+ return Dropdown._jQueryInterface;
+ };
+
+ return Dropdown;
+}($, Popper);
+
+/**
+ * --------------------------------------------------------------------------
+ * Bootstrap (v4.0.0): modal.js
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * --------------------------------------------------------------------------
+ */
+
+var Modal = function ($$$1) {
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+ var NAME = 'modal';
+ var VERSION = '4.0.0';
+ var DATA_KEY = 'bs.modal';
+ var EVENT_KEY = "." + DATA_KEY;
+ var DATA_API_KEY = '.data-api';
+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
+ var TRANSITION_DURATION = 300;
+ var BACKDROP_TRANSITION_DURATION = 150;
+ var ESCAPE_KEYCODE = 27; // KeyboardEvent.which value for Escape (Esc) key
+
+ var Default = {
+ backdrop: true,
+ keyboard: true,
+ focus: true,
+ show: true
+ };
+ var DefaultType = {
+ backdrop: '(boolean|string)',
+ keyboard: 'boolean',
+ focus: 'boolean',
+ show: 'boolean'
+ };
+ var Event = {
+ HIDE: "hide" + EVENT_KEY,
+ HIDDEN: "hidden" + EVENT_KEY,
+ SHOW: "show" + EVENT_KEY,
+ SHOWN: "shown" + EVENT_KEY,
+ FOCUSIN: "focusin" + EVENT_KEY,
+ RESIZE: "resize" + EVENT_KEY,
+ CLICK_DISMISS: "click.dismiss" + EVENT_KEY,
+ KEYDOWN_DISMISS: "keydown.dismiss" + EVENT_KEY,
+ MOUSEUP_DISMISS: "mouseup.dismiss" + EVENT_KEY,
+ MOUSEDOWN_DISMISS: "mousedown.dismiss" + EVENT_KEY,
+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
+ };
+ var ClassName = {
+ SCROLLBAR_MEASURER: 'modal-scrollbar-measure',
+ BACKDROP: 'modal-backdrop',
+ OPEN: 'modal-open',
+ FADE: 'fade',
+ SHOW: 'show'
+ };
+ var Selector = {
+ DIALOG: '.modal-dialog',
+ DATA_TOGGLE: '[data-toggle="modal"]',
+ DATA_DISMISS: '[data-dismiss="modal"]',
+ FIXED_CONTENT: '.fixed-top, .fixed-bottom, .is-fixed, .sticky-top',
+ STICKY_CONTENT: '.sticky-top',
+ NAVBAR_TOGGLER: '.navbar-toggler'
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Modal =
+ /*#__PURE__*/
+ function () {
+ function Modal(element, config) {
+ this._config = this._getConfig(config);
+ this._element = element;
+ this._dialog = $$$1(element).find(Selector.DIALOG)[0];
+ this._backdrop = null;
+ this._isShown = false;
+ this._isBodyOverflowing = false;
+ this._ignoreBackdropClick = false;
+ this._originalBodyPadding = 0;
+ this._scrollbarWidth = 0;
+ } // Getters
+
+
+ var _proto = Modal.prototype;
+
+ // Public
+ _proto.toggle = function toggle(relatedTarget) {
+ return this._isShown ? this.hide() : this.show(relatedTarget);
+ };
+
+ _proto.show = function show(relatedTarget) {
+ var _this = this;
+
+ if (this._isTransitioning || this._isShown) {
+ return;
+ }
+
+ if (Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.FADE)) {
+ this._isTransitioning = true;
+ }
+
+ var showEvent = $$$1.Event(Event.SHOW, {
+ relatedTarget: relatedTarget
+ });
+ $$$1(this._element).trigger(showEvent);
+
+ if (this._isShown || showEvent.isDefaultPrevented()) {
+ return;
+ }
+
+ this._isShown = true;
+
+ this._checkScrollbar();
+
+ this._setScrollbar();
+
+ this._adjustDialog();
+
+ $$$1(document.body).addClass(ClassName.OPEN);
+
+ this._setEscapeEvent();
+
+ this._setResizeEvent();
+
+ $$$1(this._element).on(Event.CLICK_DISMISS, Selector.DATA_DISMISS, function (event) {
+ return _this.hide(event);
+ });
+ $$$1(this._dialog).on(Event.MOUSEDOWN_DISMISS, function () {
+ $$$1(_this._element).one(Event.MOUSEUP_DISMISS, function (event) {
+ if ($$$1(event.target).is(_this._element)) {
+ _this._ignoreBackdropClick = true;
+ }
+ });
+ });
+
+ this._showBackdrop(function () {
+ return _this._showElement(relatedTarget);
+ });
+ };
+
+ _proto.hide = function hide(event) {
+ var _this2 = this;
+
+ if (event) {
+ event.preventDefault();
+ }
+
+ if (this._isTransitioning || !this._isShown) {
+ return;
+ }
+
+ var hideEvent = $$$1.Event(Event.HIDE);
+ $$$1(this._element).trigger(hideEvent);
+
+ if (!this._isShown || hideEvent.isDefaultPrevented()) {
+ return;
+ }
+
+ this._isShown = false;
+ var transition = Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.FADE);
+
+ if (transition) {
+ this._isTransitioning = true;
+ }
+
+ this._setEscapeEvent();
+
+ this._setResizeEvent();
+
+ $$$1(document).off(Event.FOCUSIN);
+ $$$1(this._element).removeClass(ClassName.SHOW);
+ $$$1(this._element).off(Event.CLICK_DISMISS);
+ $$$1(this._dialog).off(Event.MOUSEDOWN_DISMISS);
+
+ if (transition) {
+ $$$1(this._element).one(Util.TRANSITION_END, function (event) {
+ return _this2._hideModal(event);
+ }).emulateTransitionEnd(TRANSITION_DURATION);
+ } else {
+ this._hideModal();
+ }
+ };
+
+ _proto.dispose = function dispose() {
+ $$$1.removeData(this._element, DATA_KEY);
+ $$$1(window, document, this._element, this._backdrop).off(EVENT_KEY);
+ this._config = null;
+ this._element = null;
+ this._dialog = null;
+ this._backdrop = null;
+ this._isShown = null;
+ this._isBodyOverflowing = null;
+ this._ignoreBackdropClick = null;
+ this._scrollbarWidth = null;
+ };
+
+ _proto.handleUpdate = function handleUpdate() {
+ this._adjustDialog();
+ }; // Private
+
+
+ _proto._getConfig = function _getConfig(config) {
+ config = _extends({}, Default, config);
+ Util.typeCheckConfig(NAME, config, DefaultType);
+ return config;
+ };
+
+ _proto._showElement = function _showElement(relatedTarget) {
+ var _this3 = this;
+
+ var transition = Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.FADE);
+
+ if (!this._element.parentNode || this._element.parentNode.nodeType !== Node.ELEMENT_NODE) {
+ // Don't move modal's DOM position
+ document.body.appendChild(this._element);
+ }
+
+ this._element.style.display = 'block';
+
+ this._element.removeAttribute('aria-hidden');
+
+ this._element.scrollTop = 0;
+
+ if (transition) {
+ Util.reflow(this._element);
+ }
+
+ $$$1(this._element).addClass(ClassName.SHOW);
+
+ if (this._config.focus) {
+ this._enforceFocus();
+ }
+
+ var shownEvent = $$$1.Event(Event.SHOWN, {
+ relatedTarget: relatedTarget
+ });
+
+ var transitionComplete = function transitionComplete() {
+ if (_this3._config.focus) {
+ _this3._element.focus();
+ }
+
+ _this3._isTransitioning = false;
+ $$$1(_this3._element).trigger(shownEvent);
+ };
+
+ if (transition) {
+ $$$1(this._dialog).one(Util.TRANSITION_END, transitionComplete).emulateTransitionEnd(TRANSITION_DURATION);
+ } else {
+ transitionComplete();
+ }
+ };
+
+ _proto._enforceFocus = function _enforceFocus() {
+ var _this4 = this;
+
+ $$$1(document).off(Event.FOCUSIN) // Guard against infinite focus loop
+ .on(Event.FOCUSIN, function (event) {
+ if (document !== event.target && _this4._element !== event.target && $$$1(_this4._element).has(event.target).length === 0) {
+ _this4._element.focus();
+ }
+ });
+ };
+
+ _proto._setEscapeEvent = function _setEscapeEvent() {
+ var _this5 = this;
+
+ if (this._isShown && this._config.keyboard) {
+ $$$1(this._element).on(Event.KEYDOWN_DISMISS, function (event) {
+ if (event.which === ESCAPE_KEYCODE) {
+ event.preventDefault();
+
+ _this5.hide();
+ }
+ });
+ } else if (!this._isShown) {
+ $$$1(this._element).off(Event.KEYDOWN_DISMISS);
+ }
+ };
+
+ _proto._setResizeEvent = function _setResizeEvent() {
+ var _this6 = this;
+
+ if (this._isShown) {
+ $$$1(window).on(Event.RESIZE, function (event) {
+ return _this6.handleUpdate(event);
+ });
+ } else {
+ $$$1(window).off(Event.RESIZE);
+ }
+ };
+
+ _proto._hideModal = function _hideModal() {
+ var _this7 = this;
+
+ this._element.style.display = 'none';
+
+ this._element.setAttribute('aria-hidden', true);
+
+ this._isTransitioning = false;
+
+ this._showBackdrop(function () {
+ $$$1(document.body).removeClass(ClassName.OPEN);
+
+ _this7._resetAdjustments();
+
+ _this7._resetScrollbar();
+
+ $$$1(_this7._element).trigger(Event.HIDDEN);
+ });
+ };
+
+ _proto._removeBackdrop = function _removeBackdrop() {
+ if (this._backdrop) {
+ $$$1(this._backdrop).remove();
+ this._backdrop = null;
+ }
+ };
+
+ _proto._showBackdrop = function _showBackdrop(callback) {
+ var _this8 = this;
+
+ var animate = $$$1(this._element).hasClass(ClassName.FADE) ? ClassName.FADE : '';
+
+ if (this._isShown && this._config.backdrop) {
+ var doAnimate = Util.supportsTransitionEnd() && animate;
+ this._backdrop = document.createElement('div');
+ this._backdrop.className = ClassName.BACKDROP;
+
+ if (animate) {
+ $$$1(this._backdrop).addClass(animate);
+ }
+
+ $$$1(this._backdrop).appendTo(document.body);
+ $$$1(this._element).on(Event.CLICK_DISMISS, function (event) {
+ if (_this8._ignoreBackdropClick) {
+ _this8._ignoreBackdropClick = false;
+ return;
+ }
+
+ if (event.target !== event.currentTarget) {
+ return;
+ }
+
+ if (_this8._config.backdrop === 'static') {
+ _this8._element.focus();
+ } else {
+ _this8.hide();
+ }
+ });
+
+ if (doAnimate) {
+ Util.reflow(this._backdrop);
+ }
+
+ $$$1(this._backdrop).addClass(ClassName.SHOW);
+
+ if (!callback) {
+ return;
+ }
+
+ if (!doAnimate) {
+ callback();
+ return;
+ }
+
+ $$$1(this._backdrop).one(Util.TRANSITION_END, callback).emulateTransitionEnd(BACKDROP_TRANSITION_DURATION);
+ } else if (!this._isShown && this._backdrop) {
+ $$$1(this._backdrop).removeClass(ClassName.SHOW);
+
+ var callbackRemove = function callbackRemove() {
+ _this8._removeBackdrop();
+
+ if (callback) {
+ callback();
+ }
+ };
+
+ if (Util.supportsTransitionEnd() && $$$1(this._element).hasClass(ClassName.FADE)) {
+ $$$1(this._backdrop).one(Util.TRANSITION_END, callbackRemove).emulateTransitionEnd(BACKDROP_TRANSITION_DURATION);
+ } else {
+ callbackRemove();
+ }
+ } else if (callback) {
+ callback();
+ }
+ }; // ----------------------------------------------------------------------
+ // the following methods are used to handle overflowing modals
+ // todo (fat): these should probably be refactored out of modal.js
+ // ----------------------------------------------------------------------
+
+
+ _proto._adjustDialog = function _adjustDialog() {
+ var isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight;
+
+ if (!this._isBodyOverflowing && isModalOverflowing) {
+ this._element.style.paddingLeft = this._scrollbarWidth + "px";
+ }
+
+ if (this._isBodyOverflowing && !isModalOverflowing) {
+ this._element.style.paddingRight = this._scrollbarWidth + "px";
+ }
+ };
+
+ _proto._resetAdjustments = function _resetAdjustments() {
+ this._element.style.paddingLeft = '';
+ this._element.style.paddingRight = '';
+ };
+
+ _proto._checkScrollbar = function _checkScrollbar() {
+ var rect = document.body.getBoundingClientRect();
+ this._isBodyOverflowing = rect.left + rect.right < window.innerWidth;
+ this._scrollbarWidth = this._getScrollbarWidth();
+ };
+
+ _proto._setScrollbar = function _setScrollbar() {
+ var _this9 = this;
+
+ if (this._isBodyOverflowing) {
+ // Note: DOMNode.style.paddingRight returns the actual value or '' if not set
+ // while $(DOMNode).css('padding-right') returns the calculated value or 0 if not set
+ // Adjust fixed content padding
+ $$$1(Selector.FIXED_CONTENT).each(function (index, element) {
+ var actualPadding = $$$1(element)[0].style.paddingRight;
+ var calculatedPadding = $$$1(element).css('padding-right');
+ $$$1(element).data('padding-right', actualPadding).css('padding-right', parseFloat(calculatedPadding) + _this9._scrollbarWidth + "px");
+ }); // Adjust sticky content margin
+
+ $$$1(Selector.STICKY_CONTENT).each(function (index, element) {
+ var actualMargin = $$$1(element)[0].style.marginRight;
+ var calculatedMargin = $$$1(element).css('margin-right');
+ $$$1(element).data('margin-right', actualMargin).css('margin-right', parseFloat(calculatedMargin) - _this9._scrollbarWidth + "px");
+ }); // Adjust navbar-toggler margin
+
+ $$$1(Selector.NAVBAR_TOGGLER).each(function (index, element) {
+ var actualMargin = $$$1(element)[0].style.marginRight;
+ var calculatedMargin = $$$1(element).css('margin-right');
+ $$$1(element).data('margin-right', actualMargin).css('margin-right', parseFloat(calculatedMargin) + _this9._scrollbarWidth + "px");
+ }); // Adjust body padding
+
+ var actualPadding = document.body.style.paddingRight;
+ var calculatedPadding = $$$1('body').css('padding-right');
+ $$$1('body').data('padding-right', actualPadding).css('padding-right', parseFloat(calculatedPadding) + this._scrollbarWidth + "px");
+ }
+ };
+
+ _proto._resetScrollbar = function _resetScrollbar() {
+ // Restore fixed content padding
+ $$$1(Selector.FIXED_CONTENT).each(function (index, element) {
+ var padding = $$$1(element).data('padding-right');
+
+ if (typeof padding !== 'undefined') {
+ $$$1(element).css('padding-right', padding).removeData('padding-right');
+ }
+ }); // Restore sticky content and navbar-toggler margin
+
+ $$$1(Selector.STICKY_CONTENT + ", " + Selector.NAVBAR_TOGGLER).each(function (index, element) {
+ var margin = $$$1(element).data('margin-right');
+
+ if (typeof margin !== 'undefined') {
+ $$$1(element).css('margin-right', margin).removeData('margin-right');
+ }
+ }); // Restore body padding
+
+ var padding = $$$1('body').data('padding-right');
+
+ if (typeof padding !== 'undefined') {
+ $$$1('body').css('padding-right', padding).removeData('padding-right');
+ }
+ };
+
+ _proto._getScrollbarWidth = function _getScrollbarWidth() {
+ // thx d.walsh
+ var scrollDiv = document.createElement('div');
+ scrollDiv.className = ClassName.SCROLLBAR_MEASURER;
+ document.body.appendChild(scrollDiv);
+ var scrollbarWidth = scrollDiv.getBoundingClientRect().width - scrollDiv.clientWidth;
+ document.body.removeChild(scrollDiv);
+ return scrollbarWidth;
+ }; // Static
+
+
+ Modal._jQueryInterface = function _jQueryInterface(config, relatedTarget) {
+ return this.each(function () {
+ var data = $$$1(this).data(DATA_KEY);
+
+ var _config = _extends({}, Modal.Default, $$$1(this).data(), typeof config === 'object' && config);
+
+ if (!data) {
+ data = new Modal(this, _config);
+ $$$1(this).data(DATA_KEY, data);
+ }
+
+ if (typeof config === 'string') {
+ if (typeof data[config] === 'undefined') {
+ throw new TypeError("No method named \"" + config + "\"");
+ }
+
+ data[config](relatedTarget);
+ } else if (_config.show) {
+ data.show(relatedTarget);
+ }
+ });
+ };
+
+ _createClass(Modal, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION;
+ }
+ }, {
+ key: "Default",
+ get: function get() {
+ return Default;
+ }
+ }]);
+ return Modal;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * Data Api implementation
+ * ------------------------------------------------------------------------
+ */
+
+
+ $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) {
+ var _this10 = this;
+
+ var target;
+ var selector = Util.getSelectorFromElement(this);
+
+ if (selector) {
+ target = $$$1(selector)[0];
+ }
+
+ var config = $$$1(target).data(DATA_KEY) ? 'toggle' : _extends({}, $$$1(target).data(), $$$1(this).data());
+
+ if (this.tagName === 'A' || this.tagName === 'AREA') {
+ event.preventDefault();
+ }
+
+ var $target = $$$1(target).one(Event.SHOW, function (showEvent) {
+ if (showEvent.isDefaultPrevented()) {
+ // Only register focus restorer if modal will actually get shown
+ return;
+ }
+
+ $target.one(Event.HIDDEN, function () {
+ if ($$$1(_this10).is(':visible')) {
+ _this10.focus();
+ }
+ });
+ });
+
+ Modal._jQueryInterface.call($$$1(target), config, this);
+ });
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+ $$$1.fn[NAME] = Modal._jQueryInterface;
+ $$$1.fn[NAME].Constructor = Modal;
+
+ $$$1.fn[NAME].noConflict = function () {
+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
+ return Modal._jQueryInterface;
+ };
+
+ return Modal;
+}($);
+
+/**
+ * --------------------------------------------------------------------------
+ * Bootstrap (v4.0.0): tooltip.js
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * --------------------------------------------------------------------------
+ */
+
+var Tooltip = function ($$$1) {
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+ var NAME = 'tooltip';
+ var VERSION = '4.0.0';
+ var DATA_KEY = 'bs.tooltip';
+ var EVENT_KEY = "." + DATA_KEY;
+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
+ var TRANSITION_DURATION = 150;
+ var CLASS_PREFIX = 'bs-tooltip';
+ var BSCLS_PREFIX_REGEX = new RegExp("(^|\\s)" + CLASS_PREFIX + "\\S+", 'g');
+ var DefaultType = {
+ animation: 'boolean',
+ template: 'string',
+ title: '(string|element|function)',
+ trigger: 'string',
+ delay: '(number|object)',
+ html: 'boolean',
+ selector: '(string|boolean)',
+ placement: '(string|function)',
+ offset: '(number|string)',
+ container: '(string|element|boolean)',
+ fallbackPlacement: '(string|array)',
+ boundary: '(string|element)'
+ };
+ var AttachmentMap = {
+ AUTO: 'auto',
+ TOP: 'top',
+ RIGHT: 'right',
+ BOTTOM: 'bottom',
+ LEFT: 'left'
+ };
+ var Default = {
+ animation: true,
+ template: '<div class="tooltip" role="tooltip">' + '<div class="arrow"></div>' + '<div class="tooltip-inner"></div></div>',
+ trigger: 'hover focus',
+ title: '',
+ delay: 0,
+ html: false,
+ selector: false,
+ placement: 'top',
+ offset: 0,
+ container: false,
+ fallbackPlacement: 'flip',
+ boundary: 'scrollParent'
+ };
+ var HoverState = {
+ SHOW: 'show',
+ OUT: 'out'
+ };
+ var Event = {
+ HIDE: "hide" + EVENT_KEY,
+ HIDDEN: "hidden" + EVENT_KEY,
+ SHOW: "show" + EVENT_KEY,
+ SHOWN: "shown" + EVENT_KEY,
+ INSERTED: "inserted" + EVENT_KEY,
+ CLICK: "click" + EVENT_KEY,
+ FOCUSIN: "focusin" + EVENT_KEY,
+ FOCUSOUT: "focusout" + EVENT_KEY,
+ MOUSEENTER: "mouseenter" + EVENT_KEY,
+ MOUSELEAVE: "mouseleave" + EVENT_KEY
+ };
+ var ClassName = {
+ FADE: 'fade',
+ SHOW: 'show'
+ };
+ var Selector = {
+ TOOLTIP: '.tooltip',
+ TOOLTIP_INNER: '.tooltip-inner',
+ ARROW: '.arrow'
+ };
+ var Trigger = {
+ HOVER: 'hover',
+ FOCUS: 'focus',
+ CLICK: 'click',
+ MANUAL: 'manual'
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Tooltip =
+ /*#__PURE__*/
+ function () {
+ function Tooltip(element, config) {
+ /**
+ * Check for Popper dependency
+ * Popper - https://popper.js.org
+ */
+ if (typeof Popper === 'undefined') {
+ throw new TypeError('Bootstrap tooltips require Popper.js (https://popper.js.org)');
+ } // private
+
+
+ this._isEnabled = true;
+ this._timeout = 0;
+ this._hoverState = '';
+ this._activeTrigger = {};
+ this._popper = null; // Protected
+
+ this.element = element;
+ this.config = this._getConfig(config);
+ this.tip = null;
+
+ this._setListeners();
+ } // Getters
+
+
+ var _proto = Tooltip.prototype;
+
+ // Public
+ _proto.enable = function enable() {
+ this._isEnabled = true;
+ };
+
+ _proto.disable = function disable() {
+ this._isEnabled = false;
+ };
+
+ _proto.toggleEnabled = function toggleEnabled() {
+ this._isEnabled = !this._isEnabled;
+ };
+
+ _proto.toggle = function toggle(event) {
+ if (!this._isEnabled) {
+ return;
+ }
+
+ if (event) {
+ var dataKey = this.constructor.DATA_KEY;
+ var context = $$$1(event.currentTarget).data(dataKey);
+
+ if (!context) {
+ context = new this.constructor(event.currentTarget, this._getDelegateConfig());
+ $$$1(event.currentTarget).data(dataKey, context);
+ }
+
+ context._activeTrigger.click = !context._activeTrigger.click;
+
+ if (context._isWithActiveTrigger()) {
+ context._enter(null, context);
+ } else {
+ context._leave(null, context);
+ }
+ } else {
+ if ($$$1(this.getTipElement()).hasClass(ClassName.SHOW)) {
+ this._leave(null, this);
+
+ return;
+ }
+
+ this._enter(null, this);
+ }
+ };
+
+ _proto.dispose = function dispose() {
+ clearTimeout(this._timeout);
+ $$$1.removeData(this.element, this.constructor.DATA_KEY);
+ $$$1(this.element).off(this.constructor.EVENT_KEY);
+ $$$1(this.element).closest('.modal').off('hide.bs.modal');
+
+ if (this.tip) {
+ $$$1(this.tip).remove();
+ }
+
+ this._isEnabled = null;
+ this._timeout = null;
+ this._hoverState = null;
+ this._activeTrigger = null;
+
+ if (this._popper !== null) {
+ this._popper.destroy();
+ }
+
+ this._popper = null;
+ this.element = null;
+ this.config = null;
+ this.tip = null;
+ };
+
+ _proto.show = function show() {
+ var _this = this;
+
+ if ($$$1(this.element).css('display') === 'none') {
+ throw new Error('Please use show on visible elements');
+ }
+
+ var showEvent = $$$1.Event(this.constructor.Event.SHOW);
+
+ if (this.isWithContent() && this._isEnabled) {
+ $$$1(this.element).trigger(showEvent);
+ var isInTheDom = $$$1.contains(this.element.ownerDocument.documentElement, this.element);
+
+ if (showEvent.isDefaultPrevented() || !isInTheDom) {
+ return;
+ }
+
+ var tip = this.getTipElement();
+ var tipId = Util.getUID(this.constructor.NAME);
+ tip.setAttribute('id', tipId);
+ this.element.setAttribute('aria-describedby', tipId);
+ this.setContent();
+
+ if (this.config.animation) {
+ $$$1(tip).addClass(ClassName.FADE);
+ }
+
+ var placement = typeof this.config.placement === 'function' ? this.config.placement.call(this, tip, this.element) : this.config.placement;
+
+ var attachment = this._getAttachment(placement);
+
+ this.addAttachmentClass(attachment);
+ var container = this.config.container === false ? document.body : $$$1(this.config.container);
+ $$$1(tip).data(this.constructor.DATA_KEY, this);
+
+ if (!$$$1.contains(this.element.ownerDocument.documentElement, this.tip)) {
+ $$$1(tip).appendTo(container);
+ }
+
+ $$$1(this.element).trigger(this.constructor.Event.INSERTED);
+ this._popper = new Popper(this.element, tip, {
+ placement: attachment,
+ modifiers: {
+ offset: {
+ offset: this.config.offset
+ },
+ flip: {
+ behavior: this.config.fallbackPlacement
+ },
+ arrow: {
+ element: Selector.ARROW
+ },
+ preventOverflow: {
+ boundariesElement: this.config.boundary
+ }
+ },
+ onCreate: function onCreate(data) {
+ if (data.originalPlacement !== data.placement) {
+ _this._handlePopperPlacementChange(data);
+ }
+ },
+ onUpdate: function onUpdate(data) {
+ _this._handlePopperPlacementChange(data);
+ }
+ });
+ $$$1(tip).addClass(ClassName.SHOW); // If this is a touch-enabled device we add extra
+ // empty mouseover listeners to the body's immediate children;
+ // only needed because of broken event delegation on iOS
+ // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html
+
+ if ('ontouchstart' in document.documentElement) {
+ $$$1('body').children().on('mouseover', null, $$$1.noop);
+ }
+
+ var complete = function complete() {
+ if (_this.config.animation) {
+ _this._fixTransition();
+ }
+
+ var prevHoverState = _this._hoverState;
+ _this._hoverState = null;
+ $$$1(_this.element).trigger(_this.constructor.Event.SHOWN);
+
+ if (prevHoverState === HoverState.OUT) {
+ _this._leave(null, _this);
+ }
+ };
+
+ if (Util.supportsTransitionEnd() && $$$1(this.tip).hasClass(ClassName.FADE)) {
+ $$$1(this.tip).one(Util.TRANSITION_END, complete).emulateTransitionEnd(Tooltip._TRANSITION_DURATION);
+ } else {
+ complete();
+ }
+ }
+ };
+
+ _proto.hide = function hide(callback) {
+ var _this2 = this;
+
+ var tip = this.getTipElement();
+ var hideEvent = $$$1.Event(this.constructor.Event.HIDE);
+
+ var complete = function complete() {
+ if (_this2._hoverState !== HoverState.SHOW && tip.parentNode) {
+ tip.parentNode.removeChild(tip);
+ }
+
+ _this2._cleanTipClass();
+
+ _this2.element.removeAttribute('aria-describedby');
+
+ $$$1(_this2.element).trigger(_this2.constructor.Event.HIDDEN);
+
+ if (_this2._popper !== null) {
+ _this2._popper.destroy();
+ }
+
+ if (callback) {
+ callback();
+ }
+ };
+
+ $$$1(this.element).trigger(hideEvent);
+
+ if (hideEvent.isDefaultPrevented()) {
+ return;
+ }
+
+ $$$1(tip).removeClass(ClassName.SHOW); // If this is a touch-enabled device we remove the extra
+ // empty mouseover listeners we added for iOS support
+
+ if ('ontouchstart' in document.documentElement) {
+ $$$1('body').children().off('mouseover', null, $$$1.noop);
+ }
+
+ this._activeTrigger[Trigger.CLICK] = false;
+ this._activeTrigger[Trigger.FOCUS] = false;
+ this._activeTrigger[Trigger.HOVER] = false;
+
+ if (Util.supportsTransitionEnd() && $$$1(this.tip).hasClass(ClassName.FADE)) {
+ $$$1(tip).one(Util.TRANSITION_END, complete).emulateTransitionEnd(TRANSITION_DURATION);
+ } else {
+ complete();
+ }
+
+ this._hoverState = '';
+ };
+
+ _proto.update = function update() {
+ if (this._popper !== null) {
+ this._popper.scheduleUpdate();
+ }
+ }; // Protected
+
+
+ _proto.isWithContent = function isWithContent() {
+ return Boolean(this.getTitle());
+ };
+
+ _proto.addAttachmentClass = function addAttachmentClass(attachment) {
+ $$$1(this.getTipElement()).addClass(CLASS_PREFIX + "-" + attachment);
+ };
+
+ _proto.getTipElement = function getTipElement() {
+ this.tip = this.tip || $$$1(this.config.template)[0];
+ return this.tip;
+ };
+
+ _proto.setContent = function setContent() {
+ var $tip = $$$1(this.getTipElement());
+ this.setElementContent($tip.find(Selector.TOOLTIP_INNER), this.getTitle());
+ $tip.removeClass(ClassName.FADE + " " + ClassName.SHOW);
+ };
+
+ _proto.setElementContent = function setElementContent($element, content) {
+ var html = this.config.html;
+
+ if (typeof content === 'object' && (content.nodeType || content.jquery)) {
+ // Content is a DOM node or a jQuery
+ if (html) {
+ if (!$$$1(content).parent().is($element)) {
+ $element.empty().append(content);
+ }
+ } else {
+ $element.text($$$1(content).text());
+ }
+ } else {
+ $element[html ? 'html' : 'text'](content);
+ }
+ };
+
+ _proto.getTitle = function getTitle() {
+ var title = this.element.getAttribute('data-original-title');
+
+ if (!title) {
+ title = typeof this.config.title === 'function' ? this.config.title.call(this.element) : this.config.title;
+ }
+
+ return title;
+ }; // Private
+
+
+ _proto._getAttachment = function _getAttachment(placement) {
+ return AttachmentMap[placement.toUpperCase()];
+ };
+
+ _proto._setListeners = function _setListeners() {
+ var _this3 = this;
+
+ var triggers = this.config.trigger.split(' ');
+ triggers.forEach(function (trigger) {
+ if (trigger === 'click') {
+ $$$1(_this3.element).on(_this3.constructor.Event.CLICK, _this3.config.selector, function (event) {
+ return _this3.toggle(event);
+ });
+ } else if (trigger !== Trigger.MANUAL) {
+ var eventIn = trigger === Trigger.HOVER ? _this3.constructor.Event.MOUSEENTER : _this3.constructor.Event.FOCUSIN;
+ var eventOut = trigger === Trigger.HOVER ? _this3.constructor.Event.MOUSELEAVE : _this3.constructor.Event.FOCUSOUT;
+ $$$1(_this3.element).on(eventIn, _this3.config.selector, function (event) {
+ return _this3._enter(event);
+ }).on(eventOut, _this3.config.selector, function (event) {
+ return _this3._leave(event);
+ });
+ }
+
+ $$$1(_this3.element).closest('.modal').on('hide.bs.modal', function () {
+ return _this3.hide();
+ });
+ });
+
+ if (this.config.selector) {
+ this.config = _extends({}, this.config, {
+ trigger: 'manual',
+ selector: ''
+ });
+ } else {
+ this._fixTitle();
+ }
+ };
+
+ _proto._fixTitle = function _fixTitle() {
+ var titleType = typeof this.element.getAttribute('data-original-title');
+
+ if (this.element.getAttribute('title') || titleType !== 'string') {
+ this.element.setAttribute('data-original-title', this.element.getAttribute('title') || '');
+ this.element.setAttribute('title', '');
+ }
+ };
+
+ _proto._enter = function _enter(event, context) {
+ var dataKey = this.constructor.DATA_KEY;
+ context = context || $$$1(event.currentTarget).data(dataKey);
+
+ if (!context) {
+ context = new this.constructor(event.currentTarget, this._getDelegateConfig());
+ $$$1(event.currentTarget).data(dataKey, context);
+ }
+
+ if (event) {
+ context._activeTrigger[event.type === 'focusin' ? Trigger.FOCUS : Trigger.HOVER] = true;
+ }
+
+ if ($$$1(context.getTipElement()).hasClass(ClassName.SHOW) || context._hoverState === HoverState.SHOW) {
+ context._hoverState = HoverState.SHOW;
+ return;
+ }
+
+ clearTimeout(context._timeout);
+ context._hoverState = HoverState.SHOW;
+
+ if (!context.config.delay || !context.config.delay.show) {
+ context.show();
+ return;
+ }
+
+ context._timeout = setTimeout(function () {
+ if (context._hoverState === HoverState.SHOW) {
+ context.show();
+ }
+ }, context.config.delay.show);
+ };
+
+ _proto._leave = function _leave(event, context) {
+ var dataKey = this.constructor.DATA_KEY;
+ context = context || $$$1(event.currentTarget).data(dataKey);
+
+ if (!context) {
+ context = new this.constructor(event.currentTarget, this._getDelegateConfig());
+ $$$1(event.currentTarget).data(dataKey, context);
+ }
+
+ if (event) {
+ context._activeTrigger[event.type === 'focusout' ? Trigger.FOCUS : Trigger.HOVER] = false;
+ }
+
+ if (context._isWithActiveTrigger()) {
+ return;
+ }
+
+ clearTimeout(context._timeout);
+ context._hoverState = HoverState.OUT;
+
+ if (!context.config.delay || !context.config.delay.hide) {
+ context.hide();
+ return;
+ }
+
+ context._timeout = setTimeout(function () {
+ if (context._hoverState === HoverState.OUT) {
+ context.hide();
+ }
+ }, context.config.delay.hide);
+ };
+
+ _proto._isWithActiveTrigger = function _isWithActiveTrigger() {
+ for (var trigger in this._activeTrigger) {
+ if (this._activeTrigger[trigger]) {
+ return true;
+ }
+ }
+
+ return false;
+ };
+
+ _proto._getConfig = function _getConfig(config) {
+ config = _extends({}, this.constructor.Default, $$$1(this.element).data(), config);
+
+ if (typeof config.delay === 'number') {
+ config.delay = {
+ show: config.delay,
+ hide: config.delay
+ };
+ }
+
+ if (typeof config.title === 'number') {
+ config.title = config.title.toString();
+ }
+
+ if (typeof config.content === 'number') {
+ config.content = config.content.toString();
+ }
+
+ Util.typeCheckConfig(NAME, config, this.constructor.DefaultType);
+ return config;
+ };
+
+ _proto._getDelegateConfig = function _getDelegateConfig() {
+ var config = {};
+
+ if (this.config) {
+ for (var key in this.config) {
+ if (this.constructor.Default[key] !== this.config[key]) {
+ config[key] = this.config[key];
+ }
+ }
+ }
+
+ return config;
+ };
+
+ _proto._cleanTipClass = function _cleanTipClass() {
+ var $tip = $$$1(this.getTipElement());
+ var tabClass = $tip.attr('class').match(BSCLS_PREFIX_REGEX);
+
+ if (tabClass !== null && tabClass.length > 0) {
+ $tip.removeClass(tabClass.join(''));
+ }
+ };
+
+ _proto._handlePopperPlacementChange = function _handlePopperPlacementChange(data) {
+ this._cleanTipClass();
+
+ this.addAttachmentClass(this._getAttachment(data.placement));
+ };
+
+ _proto._fixTransition = function _fixTransition() {
+ var tip = this.getTipElement();
+ var initConfigAnimation = this.config.animation;
+
+ if (tip.getAttribute('x-placement') !== null) {
+ return;
+ }
+
+ $$$1(tip).removeClass(ClassName.FADE);
+ this.config.animation = false;
+ this.hide();
+ this.show();
+ this.config.animation = initConfigAnimation;
+ }; // Static
+
+
+ Tooltip._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var data = $$$1(this).data(DATA_KEY);
+
+ var _config = typeof config === 'object' && config;
+
+ if (!data && /dispose|hide/.test(config)) {
+ return;
+ }
+
+ if (!data) {
+ data = new Tooltip(this, _config);
+ $$$1(this).data(DATA_KEY, data);
+ }
+
+ if (typeof config === 'string') {
+ if (typeof data[config] === 'undefined') {
+ throw new TypeError("No method named \"" + config + "\"");
+ }
+
+ data[config]();
+ }
+ });
+ };
+
+ _createClass(Tooltip, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION;
+ }
+ }, {
+ key: "Default",
+ get: function get() {
+ return Default;
+ }
+ }, {
+ key: "NAME",
+ get: function get() {
+ return NAME;
+ }
+ }, {
+ key: "DATA_KEY",
+ get: function get() {
+ return DATA_KEY;
+ }
+ }, {
+ key: "Event",
+ get: function get() {
+ return Event;
+ }
+ }, {
+ key: "EVENT_KEY",
+ get: function get() {
+ return EVENT_KEY;
+ }
+ }, {
+ key: "DefaultType",
+ get: function get() {
+ return DefaultType;
+ }
+ }]);
+ return Tooltip;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+
+ $$$1.fn[NAME] = Tooltip._jQueryInterface;
+ $$$1.fn[NAME].Constructor = Tooltip;
+
+ $$$1.fn[NAME].noConflict = function () {
+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
+ return Tooltip._jQueryInterface;
+ };
+
+ return Tooltip;
+}($, Popper);
+
+/**
+ * --------------------------------------------------------------------------
+ * Bootstrap (v4.0.0): popover.js
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * --------------------------------------------------------------------------
+ */
+
+var Popover = function ($$$1) {
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+ var NAME = 'popover';
+ var VERSION = '4.0.0';
+ var DATA_KEY = 'bs.popover';
+ var EVENT_KEY = "." + DATA_KEY;
+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
+ var CLASS_PREFIX = 'bs-popover';
+ var BSCLS_PREFIX_REGEX = new RegExp("(^|\\s)" + CLASS_PREFIX + "\\S+", 'g');
+ var Default = _extends({}, Tooltip.Default, {
+ placement: 'right',
+ trigger: 'click',
+ content: '',
+ template: '<div class="popover" role="tooltip">' + '<div class="arrow"></div>' + '<h3 class="popover-header"></h3>' + '<div class="popover-body"></div></div>'
+ });
+ var DefaultType = _extends({}, Tooltip.DefaultType, {
+ content: '(string|element|function)'
+ });
+ var ClassName = {
+ FADE: 'fade',
+ SHOW: 'show'
+ };
+ var Selector = {
+ TITLE: '.popover-header',
+ CONTENT: '.popover-body'
+ };
+ var Event = {
+ HIDE: "hide" + EVENT_KEY,
+ HIDDEN: "hidden" + EVENT_KEY,
+ SHOW: "show" + EVENT_KEY,
+ SHOWN: "shown" + EVENT_KEY,
+ INSERTED: "inserted" + EVENT_KEY,
+ CLICK: "click" + EVENT_KEY,
+ FOCUSIN: "focusin" + EVENT_KEY,
+ FOCUSOUT: "focusout" + EVENT_KEY,
+ MOUSEENTER: "mouseenter" + EVENT_KEY,
+ MOUSELEAVE: "mouseleave" + EVENT_KEY
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Popover =
+ /*#__PURE__*/
+ function (_Tooltip) {
+ _inheritsLoose(Popover, _Tooltip);
+
+ function Popover() {
+ return _Tooltip.apply(this, arguments) || this;
+ }
+
+ var _proto = Popover.prototype;
+
+ // Overrides
+ _proto.isWithContent = function isWithContent() {
+ return this.getTitle() || this._getContent();
+ };
+
+ _proto.addAttachmentClass = function addAttachmentClass(attachment) {
+ $$$1(this.getTipElement()).addClass(CLASS_PREFIX + "-" + attachment);
+ };
+
+ _proto.getTipElement = function getTipElement() {
+ this.tip = this.tip || $$$1(this.config.template)[0];
+ return this.tip;
+ };
+
+ _proto.setContent = function setContent() {
+ var $tip = $$$1(this.getTipElement()); // We use append for html objects to maintain js events
+
+ this.setElementContent($tip.find(Selector.TITLE), this.getTitle());
+
+ var content = this._getContent();
+
+ if (typeof content === 'function') {
+ content = content.call(this.element);
+ }
+
+ this.setElementContent($tip.find(Selector.CONTENT), content);
+ $tip.removeClass(ClassName.FADE + " " + ClassName.SHOW);
+ }; // Private
+
+
+ _proto._getContent = function _getContent() {
+ return this.element.getAttribute('data-content') || this.config.content;
+ };
+
+ _proto._cleanTipClass = function _cleanTipClass() {
+ var $tip = $$$1(this.getTipElement());
+ var tabClass = $tip.attr('class').match(BSCLS_PREFIX_REGEX);
+
+ if (tabClass !== null && tabClass.length > 0) {
+ $tip.removeClass(tabClass.join(''));
+ }
+ }; // Static
+
+
+ Popover._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var data = $$$1(this).data(DATA_KEY);
+
+ var _config = typeof config === 'object' ? config : null;
+
+ if (!data && /destroy|hide/.test(config)) {
+ return;
+ }
+
+ if (!data) {
+ data = new Popover(this, _config);
+ $$$1(this).data(DATA_KEY, data);
+ }
+
+ if (typeof config === 'string') {
+ if (typeof data[config] === 'undefined') {
+ throw new TypeError("No method named \"" + config + "\"");
+ }
+
+ data[config]();
+ }
+ });
+ };
+
+ _createClass(Popover, null, [{
+ key: "VERSION",
+ // Getters
+ get: function get() {
+ return VERSION;
+ }
+ }, {
+ key: "Default",
+ get: function get() {
+ return Default;
+ }
+ }, {
+ key: "NAME",
+ get: function get() {
+ return NAME;
+ }
+ }, {
+ key: "DATA_KEY",
+ get: function get() {
+ return DATA_KEY;
+ }
+ }, {
+ key: "Event",
+ get: function get() {
+ return Event;
+ }
+ }, {
+ key: "EVENT_KEY",
+ get: function get() {
+ return EVENT_KEY;
+ }
+ }, {
+ key: "DefaultType",
+ get: function get() {
+ return DefaultType;
+ }
+ }]);
+ return Popover;
+ }(Tooltip);
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+
+ $$$1.fn[NAME] = Popover._jQueryInterface;
+ $$$1.fn[NAME].Constructor = Popover;
+
+ $$$1.fn[NAME].noConflict = function () {
+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
+ return Popover._jQueryInterface;
+ };
+
+ return Popover;
+}($);
+
+/**
+ * --------------------------------------------------------------------------
+ * Bootstrap (v4.0.0): scrollspy.js
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * --------------------------------------------------------------------------
+ */
+
+var ScrollSpy = function ($$$1) {
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+ var NAME = 'scrollspy';
+ var VERSION = '4.0.0';
+ var DATA_KEY = 'bs.scrollspy';
+ var EVENT_KEY = "." + DATA_KEY;
+ var DATA_API_KEY = '.data-api';
+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
+ var Default = {
+ offset: 10,
+ method: 'auto',
+ target: ''
+ };
+ var DefaultType = {
+ offset: 'number',
+ method: 'string',
+ target: '(string|element)'
+ };
+ var Event = {
+ ACTIVATE: "activate" + EVENT_KEY,
+ SCROLL: "scroll" + EVENT_KEY,
+ LOAD_DATA_API: "load" + EVENT_KEY + DATA_API_KEY
+ };
+ var ClassName = {
+ DROPDOWN_ITEM: 'dropdown-item',
+ DROPDOWN_MENU: 'dropdown-menu',
+ ACTIVE: 'active'
+ };
+ var Selector = {
+ DATA_SPY: '[data-spy="scroll"]',
+ ACTIVE: '.active',
+ NAV_LIST_GROUP: '.nav, .list-group',
+ NAV_LINKS: '.nav-link',
+ NAV_ITEMS: '.nav-item',
+ LIST_ITEMS: '.list-group-item',
+ DROPDOWN: '.dropdown',
+ DROPDOWN_ITEMS: '.dropdown-item',
+ DROPDOWN_TOGGLE: '.dropdown-toggle'
+ };
+ var OffsetMethod = {
+ OFFSET: 'offset',
+ POSITION: 'position'
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var ScrollSpy =
+ /*#__PURE__*/
+ function () {
+ function ScrollSpy(element, config) {
+ var _this = this;
+
+ this._element = element;
+ this._scrollElement = element.tagName === 'BODY' ? window : element;
+ this._config = this._getConfig(config);
+ this._selector = this._config.target + " " + Selector.NAV_LINKS + "," + (this._config.target + " " + Selector.LIST_ITEMS + ",") + (this._config.target + " " + Selector.DROPDOWN_ITEMS);
+ this._offsets = [];
+ this._targets = [];
+ this._activeTarget = null;
+ this._scrollHeight = 0;
+ $$$1(this._scrollElement).on(Event.SCROLL, function (event) {
+ return _this._process(event);
+ });
+ this.refresh();
+
+ this._process();
+ } // Getters
+
+
+ var _proto = ScrollSpy.prototype;
+
+ // Public
+ _proto.refresh = function refresh() {
+ var _this2 = this;
+
+ var autoMethod = this._scrollElement === this._scrollElement.window ? OffsetMethod.OFFSET : OffsetMethod.POSITION;
+ var offsetMethod = this._config.method === 'auto' ? autoMethod : this._config.method;
+ var offsetBase = offsetMethod === OffsetMethod.POSITION ? this._getScrollTop() : 0;
+ this._offsets = [];
+ this._targets = [];
+ this._scrollHeight = this._getScrollHeight();
+ var targets = $$$1.makeArray($$$1(this._selector));
+ targets.map(function (element) {
+ var target;
+ var targetSelector = Util.getSelectorFromElement(element);
+
+ if (targetSelector) {
+ target = $$$1(targetSelector)[0];
+ }
+
+ if (target) {
+ var targetBCR = target.getBoundingClientRect();
+
+ if (targetBCR.width || targetBCR.height) {
+ // TODO (fat): remove sketch reliance on jQuery position/offset
+ return [$$$1(target)[offsetMethod]().top + offsetBase, targetSelector];
+ }
+ }
+
+ return null;
+ }).filter(function (item) {
+ return item;
+ }).sort(function (a, b) {
+ return a[0] - b[0];
+ }).forEach(function (item) {
+ _this2._offsets.push(item[0]);
+
+ _this2._targets.push(item[1]);
+ });
+ };
+
+ _proto.dispose = function dispose() {
+ $$$1.removeData(this._element, DATA_KEY);
+ $$$1(this._scrollElement).off(EVENT_KEY);
+ this._element = null;
+ this._scrollElement = null;
+ this._config = null;
+ this._selector = null;
+ this._offsets = null;
+ this._targets = null;
+ this._activeTarget = null;
+ this._scrollHeight = null;
+ }; // Private
+
+
+ _proto._getConfig = function _getConfig(config) {
+ config = _extends({}, Default, config);
+
+ if (typeof config.target !== 'string') {
+ var id = $$$1(config.target).attr('id');
+
+ if (!id) {
+ id = Util.getUID(NAME);
+ $$$1(config.target).attr('id', id);
+ }
+
+ config.target = "#" + id;
+ }
+
+ Util.typeCheckConfig(NAME, config, DefaultType);
+ return config;
+ };
+
+ _proto._getScrollTop = function _getScrollTop() {
+ return this._scrollElement === window ? this._scrollElement.pageYOffset : this._scrollElement.scrollTop;
+ };
+
+ _proto._getScrollHeight = function _getScrollHeight() {
+ return this._scrollElement.scrollHeight || Math.max(document.body.scrollHeight, document.documentElement.scrollHeight);
+ };
+
+ _proto._getOffsetHeight = function _getOffsetHeight() {
+ return this._scrollElement === window ? window.innerHeight : this._scrollElement.getBoundingClientRect().height;
+ };
+
+ _proto._process = function _process() {
+ var scrollTop = this._getScrollTop() + this._config.offset;
+
+ var scrollHeight = this._getScrollHeight();
+
+ var maxScroll = this._config.offset + scrollHeight - this._getOffsetHeight();
+
+ if (this._scrollHeight !== scrollHeight) {
+ this.refresh();
+ }
+
+ if (scrollTop >= maxScroll) {
+ var target = this._targets[this._targets.length - 1];
+
+ if (this._activeTarget !== target) {
+ this._activate(target);
+ }
+
+ return;
+ }
+
+ if (this._activeTarget && scrollTop < this._offsets[0] && this._offsets[0] > 0) {
+ this._activeTarget = null;
+
+ this._clear();
+
+ return;
+ }
+
+ for (var i = this._offsets.length; i--;) {
+ var isActiveTarget = this._activeTarget !== this._targets[i] && scrollTop >= this._offsets[i] && (typeof this._offsets[i + 1] === 'undefined' || scrollTop < this._offsets[i + 1]);
+
+ if (isActiveTarget) {
+ this._activate(this._targets[i]);
+ }
+ }
+ };
+
+ _proto._activate = function _activate(target) {
+ this._activeTarget = target;
+
+ this._clear();
+
+ var queries = this._selector.split(','); // eslint-disable-next-line arrow-body-style
+
+
+ queries = queries.map(function (selector) {
+ return selector + "[data-target=\"" + target + "\"]," + (selector + "[href=\"" + target + "\"]");
+ });
+ var $link = $$$1(queries.join(','));
+
+ if ($link.hasClass(ClassName.DROPDOWN_ITEM)) {
+ $link.closest(Selector.DROPDOWN).find(Selector.DROPDOWN_TOGGLE).addClass(ClassName.ACTIVE);
+ $link.addClass(ClassName.ACTIVE);
+ } else {
+ // Set triggered link as active
+ $link.addClass(ClassName.ACTIVE); // Set triggered links parents as active
+ // With both <ul> and <nav> markup a parent is the previous sibling of any nav ancestor
+
+ $link.parents(Selector.NAV_LIST_GROUP).prev(Selector.NAV_LINKS + ", " + Selector.LIST_ITEMS).addClass(ClassName.ACTIVE); // Handle special case when .nav-link is inside .nav-item
+
+ $link.parents(Selector.NAV_LIST_GROUP).prev(Selector.NAV_ITEMS).children(Selector.NAV_LINKS).addClass(ClassName.ACTIVE);
+ }
+
+ $$$1(this._scrollElement).trigger(Event.ACTIVATE, {
+ relatedTarget: target
+ });
+ };
+
+ _proto._clear = function _clear() {
+ $$$1(this._selector).filter(Selector.ACTIVE).removeClass(ClassName.ACTIVE);
+ }; // Static
+
+
+ ScrollSpy._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var data = $$$1(this).data(DATA_KEY);
+
+ var _config = typeof config === 'object' && config;
+
+ if (!data) {
+ data = new ScrollSpy(this, _config);
+ $$$1(this).data(DATA_KEY, data);
+ }
+
+ if (typeof config === 'string') {
+ if (typeof data[config] === 'undefined') {
+ throw new TypeError("No method named \"" + config + "\"");
+ }
+
+ data[config]();
+ }
+ });
+ };
+
+ _createClass(ScrollSpy, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION;
+ }
+ }, {
+ key: "Default",
+ get: function get() {
+ return Default;
+ }
+ }]);
+ return ScrollSpy;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * Data Api implementation
+ * ------------------------------------------------------------------------
+ */
+
+
+ $$$1(window).on(Event.LOAD_DATA_API, function () {
+ var scrollSpys = $$$1.makeArray($$$1(Selector.DATA_SPY));
+
+ for (var i = scrollSpys.length; i--;) {
+ var $spy = $$$1(scrollSpys[i]);
+
+ ScrollSpy._jQueryInterface.call($spy, $spy.data());
+ }
+ });
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+ $$$1.fn[NAME] = ScrollSpy._jQueryInterface;
+ $$$1.fn[NAME].Constructor = ScrollSpy;
+
+ $$$1.fn[NAME].noConflict = function () {
+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
+ return ScrollSpy._jQueryInterface;
+ };
+
+ return ScrollSpy;
+}($);
+
+/**
+ * --------------------------------------------------------------------------
+ * Bootstrap (v4.0.0): tab.js
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * --------------------------------------------------------------------------
+ */
+
+var Tab = function ($$$1) {
+ /**
+ * ------------------------------------------------------------------------
+ * Constants
+ * ------------------------------------------------------------------------
+ */
+ var NAME = 'tab';
+ var VERSION = '4.0.0';
+ var DATA_KEY = 'bs.tab';
+ var EVENT_KEY = "." + DATA_KEY;
+ var DATA_API_KEY = '.data-api';
+ var JQUERY_NO_CONFLICT = $$$1.fn[NAME];
+ var TRANSITION_DURATION = 150;
+ var Event = {
+ HIDE: "hide" + EVENT_KEY,
+ HIDDEN: "hidden" + EVENT_KEY,
+ SHOW: "show" + EVENT_KEY,
+ SHOWN: "shown" + EVENT_KEY,
+ CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY
+ };
+ var ClassName = {
+ DROPDOWN_MENU: 'dropdown-menu',
+ ACTIVE: 'active',
+ DISABLED: 'disabled',
+ FADE: 'fade',
+ SHOW: 'show'
+ };
+ var Selector = {
+ DROPDOWN: '.dropdown',
+ NAV_LIST_GROUP: '.nav, .list-group',
+ ACTIVE: '.active',
+ ACTIVE_UL: '> li > .active',
+ DATA_TOGGLE: '[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]',
+ DROPDOWN_TOGGLE: '.dropdown-toggle',
+ DROPDOWN_ACTIVE_CHILD: '> .dropdown-menu .active'
+ /**
+ * ------------------------------------------------------------------------
+ * Class Definition
+ * ------------------------------------------------------------------------
+ */
+
+ };
+
+ var Tab =
+ /*#__PURE__*/
+ function () {
+ function Tab(element) {
+ this._element = element;
+ } // Getters
+
+
+ var _proto = Tab.prototype;
+
+ // Public
+ _proto.show = function show() {
+ var _this = this;
+
+ if (this._element.parentNode && this._element.parentNode.nodeType === Node.ELEMENT_NODE && $$$1(this._element).hasClass(ClassName.ACTIVE) || $$$1(this._element).hasClass(ClassName.DISABLED)) {
+ return;
+ }
+
+ var target;
+ var previous;
+ var listElement = $$$1(this._element).closest(Selector.NAV_LIST_GROUP)[0];
+ var selector = Util.getSelectorFromElement(this._element);
+
+ if (listElement) {
+ var itemSelector = listElement.nodeName === 'UL' ? Selector.ACTIVE_UL : Selector.ACTIVE;
+ previous = $$$1.makeArray($$$1(listElement).find(itemSelector));
+ previous = previous[previous.length - 1];
+ }
+
+ var hideEvent = $$$1.Event(Event.HIDE, {
+ relatedTarget: this._element
+ });
+ var showEvent = $$$1.Event(Event.SHOW, {
+ relatedTarget: previous
+ });
+
+ if (previous) {
+ $$$1(previous).trigger(hideEvent);
+ }
+
+ $$$1(this._element).trigger(showEvent);
+
+ if (showEvent.isDefaultPrevented() || hideEvent.isDefaultPrevented()) {
+ return;
+ }
+
+ if (selector) {
+ target = $$$1(selector)[0];
+ }
+
+ this._activate(this._element, listElement);
+
+ var complete = function complete() {
+ var hiddenEvent = $$$1.Event(Event.HIDDEN, {
+ relatedTarget: _this._element
+ });
+ var shownEvent = $$$1.Event(Event.SHOWN, {
+ relatedTarget: previous
+ });
+ $$$1(previous).trigger(hiddenEvent);
+ $$$1(_this._element).trigger(shownEvent);
+ };
+
+ if (target) {
+ this._activate(target, target.parentNode, complete);
+ } else {
+ complete();
+ }
+ };
+
+ _proto.dispose = function dispose() {
+ $$$1.removeData(this._element, DATA_KEY);
+ this._element = null;
+ }; // Private
+
+
+ _proto._activate = function _activate(element, container, callback) {
+ var _this2 = this;
+
+ var activeElements;
+
+ if (container.nodeName === 'UL') {
+ activeElements = $$$1(container).find(Selector.ACTIVE_UL);
+ } else {
+ activeElements = $$$1(container).children(Selector.ACTIVE);
+ }
+
+ var active = activeElements[0];
+ var isTransitioning = callback && Util.supportsTransitionEnd() && active && $$$1(active).hasClass(ClassName.FADE);
+
+ var complete = function complete() {
+ return _this2._transitionComplete(element, active, callback);
+ };
+
+ if (active && isTransitioning) {
+ $$$1(active).one(Util.TRANSITION_END, complete).emulateTransitionEnd(TRANSITION_DURATION);
+ } else {
+ complete();
+ }
+ };
+
+ _proto._transitionComplete = function _transitionComplete(element, active, callback) {
+ if (active) {
+ $$$1(active).removeClass(ClassName.SHOW + " " + ClassName.ACTIVE);
+ var dropdownChild = $$$1(active.parentNode).find(Selector.DROPDOWN_ACTIVE_CHILD)[0];
+
+ if (dropdownChild) {
+ $$$1(dropdownChild).removeClass(ClassName.ACTIVE);
+ }
+
+ if (active.getAttribute('role') === 'tab') {
+ active.setAttribute('aria-selected', false);
+ }
+ }
+
+ $$$1(element).addClass(ClassName.ACTIVE);
+
+ if (element.getAttribute('role') === 'tab') {
+ element.setAttribute('aria-selected', true);
+ }
+
+ Util.reflow(element);
+ $$$1(element).addClass(ClassName.SHOW);
+
+ if (element.parentNode && $$$1(element.parentNode).hasClass(ClassName.DROPDOWN_MENU)) {
+ var dropdownElement = $$$1(element).closest(Selector.DROPDOWN)[0];
+
+ if (dropdownElement) {
+ $$$1(dropdownElement).find(Selector.DROPDOWN_TOGGLE).addClass(ClassName.ACTIVE);
+ }
+
+ element.setAttribute('aria-expanded', true);
+ }
+
+ if (callback) {
+ callback();
+ }
+ }; // Static
+
+
+ Tab._jQueryInterface = function _jQueryInterface(config) {
+ return this.each(function () {
+ var $this = $$$1(this);
+ var data = $this.data(DATA_KEY);
+
+ if (!data) {
+ data = new Tab(this);
+ $this.data(DATA_KEY, data);
+ }
+
+ if (typeof config === 'string') {
+ if (typeof data[config] === 'undefined') {
+ throw new TypeError("No method named \"" + config + "\"");
+ }
+
+ data[config]();
+ }
+ });
+ };
+
+ _createClass(Tab, null, [{
+ key: "VERSION",
+ get: function get() {
+ return VERSION;
+ }
+ }]);
+ return Tab;
+ }();
+ /**
+ * ------------------------------------------------------------------------
+ * Data Api implementation
+ * ------------------------------------------------------------------------
+ */
+
+
+ $$$1(document).on(Event.CLICK_DATA_API, Selector.DATA_TOGGLE, function (event) {
+ event.preventDefault();
+
+ Tab._jQueryInterface.call($$$1(this), 'show');
+ });
+ /**
+ * ------------------------------------------------------------------------
+ * jQuery
+ * ------------------------------------------------------------------------
+ */
+
+ $$$1.fn[NAME] = Tab._jQueryInterface;
+ $$$1.fn[NAME].Constructor = Tab;
+
+ $$$1.fn[NAME].noConflict = function () {
+ $$$1.fn[NAME] = JQUERY_NO_CONFLICT;
+ return Tab._jQueryInterface;
+ };
+
+ return Tab;
+}($);
+
+/**
+ * --------------------------------------------------------------------------
+ * Bootstrap (v4.0.0-alpha.6): index.js
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ * --------------------------------------------------------------------------
+ */
+
+(function ($$$1) {
+ if (typeof $$$1 === 'undefined') {
+ throw new TypeError('Bootstrap\'s JavaScript requires jQuery. jQuery must be included before Bootstrap\'s JavaScript.');
+ }
+
+ var version = $$$1.fn.jquery.split(' ')[0].split('.');
+ var minMajor = 1;
+ var ltMajor = 2;
+ var minMinor = 9;
+ var minPatch = 1;
+ var maxMajor = 4;
+
+ if (version[0] < ltMajor && version[1] < minMinor || version[0] === minMajor && version[1] === minMinor && version[2] < minPatch || version[0] >= maxMajor) {
+ throw new Error('Bootstrap\'s JavaScript requires at least jQuery v1.9.1 but less than v4.0.0');
+ }
+})($);
+
+exports.Util = Util;
+exports.Alert = Alert;
+exports.Button = Button;
+exports.Carousel = Carousel;
+exports.Collapse = Collapse;
+exports.Dropdown = Dropdown;
+exports.Modal = Modal;
+exports.Popover = Popover;
+exports.Scrollspy = ScrollSpy;
+exports.Tab = Tab;
+exports.Tooltip = Tooltip;
+
+Object.defineProperty(exports, '__esModule', { value: true });
+
+})));
+//# sourceMappingURL=bootstrap.js.map
diff --git a/chall/src/js/bootstrap.min.js b/chall/src/js/bootstrap.min.js
new file mode 100644
index 0000000..534d533
--- /dev/null
+++ b/chall/src/js/bootstrap.min.js
@@ -0,0 +1,7 @@
+/*!
+ * Bootstrap v4.0.0 (https://getbootstrap.com)
+ * Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ */
+!function(t,e){"object"==typeof exports&&"undefined"!=typeof module?e(exports,require("jquery"),require("popper.js")):"function"==typeof define&&define.amd?define(["exports","jquery","popper.js"],e):e(t.bootstrap={},t.jQuery,t.Popper)}(this,function(t,e,n){"use strict";function i(t,e){for(var n=0;n<e.length;n++){var i=e[n];i.enumerable=i.enumerable||!1,i.configurable=!0,"value"in i&&(i.writable=!0),Object.defineProperty(t,i.key,i)}}function s(t,e,n){return e&&i(t.prototype,e),n&&i(t,n),t}function r(){return(r=Object.assign||function(t){for(var e=1;e<arguments.length;e++){var n=arguments[e];for(var i in n)Object.prototype.hasOwnProperty.call(n,i)&&(t[i]=n[i])}return t}).apply(this,arguments)}e=e&&e.hasOwnProperty("default")?e.default:e,n=n&&n.hasOwnProperty("default")?n.default:n;var o,a,l,h,c,u,f,d,_,g,p,m,v,E,T,y,C,I,A,b,D,S,w,N,O,k,P=function(t){var e=!1;function n(e){var n=this,s=!1;return t(this).one(i.TRANSITION_END,function(){s=!0}),setTimeout(function(){s||i.triggerTransitionEnd(n)},e),this}var i={TRANSITION_END:"bsTransitionEnd",getUID:function(t){do{t+=~~(1e6*Math.random())}while(document.getElementById(t));return t},getSelectorFromElement:function(e){var n,i=e.getAttribute("data-target");i&&"#"!==i||(i=e.getAttribute("href")||""),"#"===i.charAt(0)&&(n=i,i=n="function"==typeof t.escapeSelector?t.escapeSelector(n).substr(1):n.replace(/(:|\.|\[|\]|,|=|@)/g,"\\$1"));try{return t(document).find(i).length>0?i:null}catch(t){return null}},reflow:function(t){return t.offsetHeight},triggerTransitionEnd:function(n){t(n).trigger(e.end)},supportsTransitionEnd:function(){return Boolean(e)},isElement:function(t){return(t[0]||t).nodeType},typeCheckConfig:function(t,e,n){for(var s in n)if(Object.prototype.hasOwnProperty.call(n,s)){var r=n[s],o=e[s],a=o&&i.isElement(o)?"element":(l=o,{}.toString.call(l).match(/\s([a-zA-Z]+)/)[1].toLowerCase());if(!new RegExp(r).test(a))throw new Error(t.toUpperCase()+': Option "'+s+'" provided type "'+a+'" but expected type "'+r+'".')}var l}};return e=("undefined"==typeof window||!window.QUnit)&&{end:"transitionend"},t.fn.emulateTransitionEnd=n,i.supportsTransitionEnd()&&(t.event.special[i.TRANSITION_END]={bindType:e.end,delegateType:e.end,handle:function(e){if(t(e.target).is(this))return e.handleObj.handler.apply(this,arguments)}}),i}(e),L=(a="alert",h="."+(l="bs.alert"),c=(o=e).fn[a],u={CLOSE:"close"+h,CLOSED:"closed"+h,CLICK_DATA_API:"click"+h+".data-api"},f="alert",d="fade",_="show",g=function(){function t(t){this._element=t}var e=t.prototype;return e.close=function(t){t=t||this._element;var e=this._getRootElement(t);this._triggerCloseEvent(e).isDefaultPrevented()||this._removeElement(e)},e.dispose=function(){o.removeData(this._element,l),this._element=null},e._getRootElement=function(t){var e=P.getSelectorFromElement(t),n=!1;return e&&(n=o(e)[0]),n||(n=o(t).closest("."+f)[0]),n},e._triggerCloseEvent=function(t){var e=o.Event(u.CLOSE);return o(t).trigger(e),e},e._removeElement=function(t){var e=this;o(t).removeClass(_),P.supportsTransitionEnd()&&o(t).hasClass(d)?o(t).one(P.TRANSITION_END,function(n){return e._destroyElement(t,n)}).emulateTransitionEnd(150):this._destroyElement(t)},e._destroyElement=function(t){o(t).detach().trigger(u.CLOSED).remove()},t._jQueryInterface=function(e){return this.each(function(){var n=o(this),i=n.data(l);i||(i=new t(this),n.data(l,i)),"close"===e&&i[e](this)})},t._handleDismiss=function(t){return function(e){e&&e.preventDefault(),t.close(this)}},s(t,null,[{key:"VERSION",get:function(){return"4.0.0"}}]),t}(),o(document).on(u.CLICK_DATA_API,'[data-dismiss="alert"]',g._handleDismiss(new g)),o.fn[a]=g._jQueryInterface,o.fn[a].Constructor=g,o.fn[a].noConflict=function(){return o.fn[a]=c,g._jQueryInterface},g),R=(m="button",E="."+(v="bs.button"),T=".data-api",y=(p=e).fn[m],C="active",I="btn",A="focus",b='[data-toggle^="button"]',D='[data-toggle="buttons"]',S="input",w=".active",N=".btn",O={CLICK_DATA_API:"click"+E+T,FOCUS_BLUR_DATA_API:"focus"+E+T+" blur"+E+T},k=function(){function t(t){this._element=t}var e=t.prototype;return e.toggle=function(){var t=!0,e=!0,n=p(this._element).closest(D)[0];if(n){var i=p(this._element).find(S)[0];if(i){if("radio"===i.type)if(i.checked&&p(this._element).hasClass(C))t=!1;else{var s=p(n).find(w)[0];s&&p(s).removeClass(C)}if(t){if(i.hasAttribute("disabled")||n.hasAttribute("disabled")||i.classList.contains("disabled")||n.classList.contains("disabled"))return;i.checked=!p(this._element).hasClass(C),p(i).trigger("change")}i.focus(),e=!1}}e&&this._element.setAttribute("aria-pressed",!p(this._element).hasClass(C)),t&&p(this._element).toggleClass(C)},e.dispose=function(){p.removeData(this._element,v),this._element=null},t._jQueryInterface=function(e){return this.each(function(){var n=p(this).data(v);n||(n=new t(this),p(this).data(v,n)),"toggle"===e&&n[e]()})},s(t,null,[{key:"VERSION",get:function(){return"4.0.0"}}]),t}(),p(document).on(O.CLICK_DATA_API,b,function(t){t.preventDefault();var e=t.target;p(e).hasClass(I)||(e=p(e).closest(N)),k._jQueryInterface.call(p(e),"toggle")}).on(O.FOCUS_BLUR_DATA_API,b,function(t){var e=p(t.target).closest(N)[0];p(e).toggleClass(A,/^focus(in)?$/.test(t.type))}),p.fn[m]=k._jQueryInterface,p.fn[m].Constructor=k,p.fn[m].noConflict=function(){return p.fn[m]=y,k._jQueryInterface},k),j=function(t){var e="carousel",n="bs.carousel",i="."+n,o=t.fn[e],a={interval:5e3,keyboard:!0,slide:!1,pause:"hover",wrap:!0},l={interval:"(number|boolean)",keyboard:"boolean",slide:"(boolean|string)",pause:"(string|boolean)",wrap:"boolean"},h="next",c="prev",u="left",f="right",d={SLIDE:"slide"+i,SLID:"slid"+i,KEYDOWN:"keydown"+i,MOUSEENTER:"mouseenter"+i,MOUSELEAVE:"mouseleave"+i,TOUCHEND:"touchend"+i,LOAD_DATA_API:"load"+i+".data-api",CLICK_DATA_API:"click"+i+".data-api"},_="carousel",g="active",p="slide",m="carousel-item-right",v="carousel-item-left",E="carousel-item-next",T="carousel-item-prev",y={ACTIVE:".active",ACTIVE_ITEM:".active.carousel-item",ITEM:".carousel-item",NEXT_PREV:".carousel-item-next, .carousel-item-prev",INDICATORS:".carousel-indicators",DATA_SLIDE:"[data-slide], [data-slide-to]",DATA_RIDE:'[data-ride="carousel"]'},C=function(){function o(e,n){this._items=null,this._interval=null,this._activeElement=null,this._isPaused=!1,this._isSliding=!1,this.touchTimeout=null,this._config=this._getConfig(n),this._element=t(e)[0],this._indicatorsElement=t(this._element).find(y.INDICATORS)[0],this._addEventListeners()}var C=o.prototype;return C.next=function(){this._isSliding||this._slide(h)},C.nextWhenVisible=function(){!document.hidden&&t(this._element).is(":visible")&&"hidden"!==t(this._element).css("visibility")&&this.next()},C.prev=function(){this._isSliding||this._slide(c)},C.pause=function(e){e||(this._isPaused=!0),t(this._element).find(y.NEXT_PREV)[0]&&P.supportsTransitionEnd()&&(P.triggerTransitionEnd(this._element),this.cycle(!0)),clearInterval(this._interval),this._interval=null},C.cycle=function(t){t||(this._isPaused=!1),this._interval&&(clearInterval(this._interval),this._interval=null),this._config.interval&&!this._isPaused&&(this._interval=setInterval((document.visibilityState?this.nextWhenVisible:this.next).bind(this),this._config.interval))},C.to=function(e){var n=this;this._activeElement=t(this._element).find(y.ACTIVE_ITEM)[0];var i=this._getItemIndex(this._activeElement);if(!(e>this._items.length-1||e<0))if(this._isSliding)t(this._element).one(d.SLID,function(){return n.to(e)});else{if(i===e)return this.pause(),void this.cycle();var s=e>i?h:c;this._slide(s,this._items[e])}},C.dispose=function(){t(this._element).off(i),t.removeData(this._element,n),this._items=null,this._config=null,this._element=null,this._interval=null,this._isPaused=null,this._isSliding=null,this._activeElement=null,this._indicatorsElement=null},C._getConfig=function(t){return t=r({},a,t),P.typeCheckConfig(e,t,l),t},C._addEventListeners=function(){var e=this;this._config.keyboard&&t(this._element).on(d.KEYDOWN,function(t){return e._keydown(t)}),"hover"===this._config.pause&&(t(this._element).on(d.MOUSEENTER,function(t){return e.pause(t)}).on(d.MOUSELEAVE,function(t){return e.cycle(t)}),"ontouchstart"in document.documentElement&&t(this._element).on(d.TOUCHEND,function(){e.pause(),e.touchTimeout&&clearTimeout(e.touchTimeout),e.touchTimeout=setTimeout(function(t){return e.cycle(t)},500+e._config.interval)}))},C._keydown=function(t){if(!/input|textarea/i.test(t.target.tagName))switch(t.which){case 37:t.preventDefault(),this.prev();break;case 39:t.preventDefault(),this.next()}},C._getItemIndex=function(e){return this._items=t.makeArray(t(e).parent().find(y.ITEM)),this._items.indexOf(e)},C._getItemByDirection=function(t,e){var n=t===h,i=t===c,s=this._getItemIndex(e),r=this._items.length-1;if((i&&0===s||n&&s===r)&&!this._config.wrap)return e;var o=(s+(t===c?-1:1))%this._items.length;return-1===o?this._items[this._items.length-1]:this._items[o]},C._triggerSlideEvent=function(e,n){var i=this._getItemIndex(e),s=this._getItemIndex(t(this._element).find(y.ACTIVE_ITEM)[0]),r=t.Event(d.SLIDE,{relatedTarget:e,direction:n,from:s,to:i});return t(this._element).trigger(r),r},C._setActiveIndicatorElement=function(e){if(this._indicatorsElement){t(this._indicatorsElement).find(y.ACTIVE).removeClass(g);var n=this._indicatorsElement.children[this._getItemIndex(e)];n&&t(n).addClass(g)}},C._slide=function(e,n){var i,s,r,o=this,a=t(this._element).find(y.ACTIVE_ITEM)[0],l=this._getItemIndex(a),c=n||a&&this._getItemByDirection(e,a),_=this._getItemIndex(c),C=Boolean(this._interval);if(e===h?(i=v,s=E,r=u):(i=m,s=T,r=f),c&&t(c).hasClass(g))this._isSliding=!1;else if(!this._triggerSlideEvent(c,r).isDefaultPrevented()&&a&&c){this._isSliding=!0,C&&this.pause(),this._setActiveIndicatorElement(c);var I=t.Event(d.SLID,{relatedTarget:c,direction:r,from:l,to:_});P.supportsTransitionEnd()&&t(this._element).hasClass(p)?(t(c).addClass(s),P.reflow(c),t(a).addClass(i),t(c).addClass(i),t(a).one(P.TRANSITION_END,function(){t(c).removeClass(i+" "+s).addClass(g),t(a).removeClass(g+" "+s+" "+i),o._isSliding=!1,setTimeout(function(){return t(o._element).trigger(I)},0)}).emulateTransitionEnd(600)):(t(a).removeClass(g),t(c).addClass(g),this._isSliding=!1,t(this._element).trigger(I)),C&&this.cycle()}},o._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n),s=r({},a,t(this).data());"object"==typeof e&&(s=r({},s,e));var l="string"==typeof e?e:s.slide;if(i||(i=new o(this,s),t(this).data(n,i)),"number"==typeof e)i.to(e);else if("string"==typeof l){if("undefined"==typeof i[l])throw new TypeError('No method named "'+l+'"');i[l]()}else s.interval&&(i.pause(),i.cycle())})},o._dataApiClickHandler=function(e){var i=P.getSelectorFromElement(this);if(i){var s=t(i)[0];if(s&&t(s).hasClass(_)){var a=r({},t(s).data(),t(this).data()),l=this.getAttribute("data-slide-to");l&&(a.interval=!1),o._jQueryInterface.call(t(s),a),l&&t(s).data(n).to(l),e.preventDefault()}}},s(o,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return a}}]),o}();return t(document).on(d.CLICK_DATA_API,y.DATA_SLIDE,C._dataApiClickHandler),t(window).on(d.LOAD_DATA_API,function(){t(y.DATA_RIDE).each(function(){var e=t(this);C._jQueryInterface.call(e,e.data())})}),t.fn[e]=C._jQueryInterface,t.fn[e].Constructor=C,t.fn[e].noConflict=function(){return t.fn[e]=o,C._jQueryInterface},C}(e),H=function(t){var e="collapse",n="bs.collapse",i="."+n,o=t.fn[e],a={toggle:!0,parent:""},l={toggle:"boolean",parent:"(string|element)"},h={SHOW:"show"+i,SHOWN:"shown"+i,HIDE:"hide"+i,HIDDEN:"hidden"+i,CLICK_DATA_API:"click"+i+".data-api"},c="show",u="collapse",f="collapsing",d="collapsed",_="width",g="height",p={ACTIVES:".show, .collapsing",DATA_TOGGLE:'[data-toggle="collapse"]'},m=function(){function i(e,n){this._isTransitioning=!1,this._element=e,this._config=this._getConfig(n),this._triggerArray=t.makeArray(t('[data-toggle="collapse"][href="#'+e.id+'"],[data-toggle="collapse"][data-target="#'+e.id+'"]'));for(var i=t(p.DATA_TOGGLE),s=0;s<i.length;s++){var r=i[s],o=P.getSelectorFromElement(r);null!==o&&t(o).filter(e).length>0&&(this._selector=o,this._triggerArray.push(r))}this._parent=this._config.parent?this._getParent():null,this._config.parent||this._addAriaAndCollapsedClass(this._element,this._triggerArray),this._config.toggle&&this.toggle()}var o=i.prototype;return o.toggle=function(){t(this._element).hasClass(c)?this.hide():this.show()},o.show=function(){var e,s,r=this;if(!this._isTransitioning&&!t(this._element).hasClass(c)&&(this._parent&&0===(e=t.makeArray(t(this._parent).find(p.ACTIVES).filter('[data-parent="'+this._config.parent+'"]'))).length&&(e=null),!(e&&(s=t(e).not(this._selector).data(n))&&s._isTransitioning))){var o=t.Event(h.SHOW);if(t(this._element).trigger(o),!o.isDefaultPrevented()){e&&(i._jQueryInterface.call(t(e).not(this._selector),"hide"),s||t(e).data(n,null));var a=this._getDimension();t(this._element).removeClass(u).addClass(f),this._element.style[a]=0,this._triggerArray.length>0&&t(this._triggerArray).removeClass(d).attr("aria-expanded",!0),this.setTransitioning(!0);var l=function(){t(r._element).removeClass(f).addClass(u).addClass(c),r._element.style[a]="",r.setTransitioning(!1),t(r._element).trigger(h.SHOWN)};if(P.supportsTransitionEnd()){var _="scroll"+(a[0].toUpperCase()+a.slice(1));t(this._element).one(P.TRANSITION_END,l).emulateTransitionEnd(600),this._element.style[a]=this._element[_]+"px"}else l()}}},o.hide=function(){var e=this;if(!this._isTransitioning&&t(this._element).hasClass(c)){var n=t.Event(h.HIDE);if(t(this._element).trigger(n),!n.isDefaultPrevented()){var i=this._getDimension();if(this._element.style[i]=this._element.getBoundingClientRect()[i]+"px",P.reflow(this._element),t(this._element).addClass(f).removeClass(u).removeClass(c),this._triggerArray.length>0)for(var s=0;s<this._triggerArray.length;s++){var r=this._triggerArray[s],o=P.getSelectorFromElement(r);if(null!==o)t(o).hasClass(c)||t(r).addClass(d).attr("aria-expanded",!1)}this.setTransitioning(!0);var a=function(){e.setTransitioning(!1),t(e._element).removeClass(f).addClass(u).trigger(h.HIDDEN)};this._element.style[i]="",P.supportsTransitionEnd()?t(this._element).one(P.TRANSITION_END,a).emulateTransitionEnd(600):a()}}},o.setTransitioning=function(t){this._isTransitioning=t},o.dispose=function(){t.removeData(this._element,n),this._config=null,this._parent=null,this._element=null,this._triggerArray=null,this._isTransitioning=null},o._getConfig=function(t){return(t=r({},a,t)).toggle=Boolean(t.toggle),P.typeCheckConfig(e,t,l),t},o._getDimension=function(){return t(this._element).hasClass(_)?_:g},o._getParent=function(){var e=this,n=null;P.isElement(this._config.parent)?(n=this._config.parent,"undefined"!=typeof this._config.parent.jquery&&(n=this._config.parent[0])):n=t(this._config.parent)[0];var s='[data-toggle="collapse"][data-parent="'+this._config.parent+'"]';return t(n).find(s).each(function(t,n){e._addAriaAndCollapsedClass(i._getTargetFromElement(n),[n])}),n},o._addAriaAndCollapsedClass=function(e,n){if(e){var i=t(e).hasClass(c);n.length>0&&t(n).toggleClass(d,!i).attr("aria-expanded",i)}},i._getTargetFromElement=function(e){var n=P.getSelectorFromElement(e);return n?t(n)[0]:null},i._jQueryInterface=function(e){return this.each(function(){var s=t(this),o=s.data(n),l=r({},a,s.data(),"object"==typeof e&&e);if(!o&&l.toggle&&/show|hide/.test(e)&&(l.toggle=!1),o||(o=new i(this,l),s.data(n,o)),"string"==typeof e){if("undefined"==typeof o[e])throw new TypeError('No method named "'+e+'"');o[e]()}})},s(i,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return a}}]),i}();return t(document).on(h.CLICK_DATA_API,p.DATA_TOGGLE,function(e){"A"===e.currentTarget.tagName&&e.preventDefault();var i=t(this),s=P.getSelectorFromElement(this);t(s).each(function(){var e=t(this),s=e.data(n)?"toggle":i.data();m._jQueryInterface.call(e,s)})}),t.fn[e]=m._jQueryInterface,t.fn[e].Constructor=m,t.fn[e].noConflict=function(){return t.fn[e]=o,m._jQueryInterface},m}(e),W=function(t){var e="dropdown",i="bs.dropdown",o="."+i,a=".data-api",l=t.fn[e],h=new RegExp("38|40|27"),c={HIDE:"hide"+o,HIDDEN:"hidden"+o,SHOW:"show"+o,SHOWN:"shown"+o,CLICK:"click"+o,CLICK_DATA_API:"click"+o+a,KEYDOWN_DATA_API:"keydown"+o+a,KEYUP_DATA_API:"keyup"+o+a},u="disabled",f="show",d="dropup",_="dropright",g="dropleft",p="dropdown-menu-right",m="dropdown-menu-left",v="position-static",E='[data-toggle="dropdown"]',T=".dropdown form",y=".dropdown-menu",C=".navbar-nav",I=".dropdown-menu .dropdown-item:not(.disabled)",A="top-start",b="top-end",D="bottom-start",S="bottom-end",w="right-start",N="left-start",O={offset:0,flip:!0,boundary:"scrollParent"},k={offset:"(number|string|function)",flip:"boolean",boundary:"(string|element)"},L=function(){function a(t,e){this._element=t,this._popper=null,this._config=this._getConfig(e),this._menu=this._getMenuElement(),this._inNavbar=this._detectNavbar(),this._addEventListeners()}var l=a.prototype;return l.toggle=function(){if(!this._element.disabled&&!t(this._element).hasClass(u)){var e=a._getParentFromElement(this._element),i=t(this._menu).hasClass(f);if(a._clearMenus(),!i){var s={relatedTarget:this._element},r=t.Event(c.SHOW,s);if(t(e).trigger(r),!r.isDefaultPrevented()){if(!this._inNavbar){if("undefined"==typeof n)throw new TypeError("Bootstrap dropdown require Popper.js (https://popper.js.org)");var o=this._element;t(e).hasClass(d)&&(t(this._menu).hasClass(m)||t(this._menu).hasClass(p))&&(o=e),"scrollParent"!==this._config.boundary&&t(e).addClass(v),this._popper=new n(o,this._menu,this._getPopperConfig())}"ontouchstart"in document.documentElement&&0===t(e).closest(C).length&&t("body").children().on("mouseover",null,t.noop),this._element.focus(),this._element.setAttribute("aria-expanded",!0),t(this._menu).toggleClass(f),t(e).toggleClass(f).trigger(t.Event(c.SHOWN,s))}}}},l.dispose=function(){t.removeData(this._element,i),t(this._element).off(o),this._element=null,this._menu=null,null!==this._popper&&(this._popper.destroy(),this._popper=null)},l.update=function(){this._inNavbar=this._detectNavbar(),null!==this._popper&&this._popper.scheduleUpdate()},l._addEventListeners=function(){var e=this;t(this._element).on(c.CLICK,function(t){t.preventDefault(),t.stopPropagation(),e.toggle()})},l._getConfig=function(n){return n=r({},this.constructor.Default,t(this._element).data(),n),P.typeCheckConfig(e,n,this.constructor.DefaultType),n},l._getMenuElement=function(){if(!this._menu){var e=a._getParentFromElement(this._element);this._menu=t(e).find(y)[0]}return this._menu},l._getPlacement=function(){var e=t(this._element).parent(),n=D;return e.hasClass(d)?(n=A,t(this._menu).hasClass(p)&&(n=b)):e.hasClass(_)?n=w:e.hasClass(g)?n=N:t(this._menu).hasClass(p)&&(n=S),n},l._detectNavbar=function(){return t(this._element).closest(".navbar").length>0},l._getPopperConfig=function(){var t=this,e={};return"function"==typeof this._config.offset?e.fn=function(e){return e.offsets=r({},e.offsets,t._config.offset(e.offsets)||{}),e}:e.offset=this._config.offset,{placement:this._getPlacement(),modifiers:{offset:e,flip:{enabled:this._config.flip},preventOverflow:{boundariesElement:this._config.boundary}}}},a._jQueryInterface=function(e){return this.each(function(){var n=t(this).data(i);if(n||(n=new a(this,"object"==typeof e?e:null),t(this).data(i,n)),"string"==typeof e){if("undefined"==typeof n[e])throw new TypeError('No method named "'+e+'"');n[e]()}})},a._clearMenus=function(e){if(!e||3!==e.which&&("keyup"!==e.type||9===e.which))for(var n=t.makeArray(t(E)),s=0;s<n.length;s++){var r=a._getParentFromElement(n[s]),o=t(n[s]).data(i),l={relatedTarget:n[s]};if(o){var h=o._menu;if(t(r).hasClass(f)&&!(e&&("click"===e.type&&/input|textarea/i.test(e.target.tagName)||"keyup"===e.type&&9===e.which)&&t.contains(r,e.target))){var u=t.Event(c.HIDE,l);t(r).trigger(u),u.isDefaultPrevented()||("ontouchstart"in document.documentElement&&t("body").children().off("mouseover",null,t.noop),n[s].setAttribute("aria-expanded","false"),t(h).removeClass(f),t(r).removeClass(f).trigger(t.Event(c.HIDDEN,l)))}}}},a._getParentFromElement=function(e){var n,i=P.getSelectorFromElement(e);return i&&(n=t(i)[0]),n||e.parentNode},a._dataApiKeydownHandler=function(e){if((/input|textarea/i.test(e.target.tagName)?!(32===e.which||27!==e.which&&(40!==e.which&&38!==e.which||t(e.target).closest(y).length)):h.test(e.which))&&(e.preventDefault(),e.stopPropagation(),!this.disabled&&!t(this).hasClass(u))){var n=a._getParentFromElement(this),i=t(n).hasClass(f);if((i||27===e.which&&32===e.which)&&(!i||27!==e.which&&32!==e.which)){var s=t(n).find(I).get();if(0!==s.length){var r=s.indexOf(e.target);38===e.which&&r>0&&r--,40===e.which&&r<s.length-1&&r++,r<0&&(r=0),s[r].focus()}}else{if(27===e.which){var o=t(n).find(E)[0];t(o).trigger("focus")}t(this).trigger("click")}}},s(a,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return O}},{key:"DefaultType",get:function(){return k}}]),a}();return t(document).on(c.KEYDOWN_DATA_API,E,L._dataApiKeydownHandler).on(c.KEYDOWN_DATA_API,y,L._dataApiKeydownHandler).on(c.CLICK_DATA_API+" "+c.KEYUP_DATA_API,L._clearMenus).on(c.CLICK_DATA_API,E,function(e){e.preventDefault(),e.stopPropagation(),L._jQueryInterface.call(t(this),"toggle")}).on(c.CLICK_DATA_API,T,function(t){t.stopPropagation()}),t.fn[e]=L._jQueryInterface,t.fn[e].Constructor=L,t.fn[e].noConflict=function(){return t.fn[e]=l,L._jQueryInterface},L}(e),M=function(t){var e="modal",n="bs.modal",i="."+n,o=t.fn.modal,a={backdrop:!0,keyboard:!0,focus:!0,show:!0},l={backdrop:"(boolean|string)",keyboard:"boolean",focus:"boolean",show:"boolean"},h={HIDE:"hide"+i,HIDDEN:"hidden"+i,SHOW:"show"+i,SHOWN:"shown"+i,FOCUSIN:"focusin"+i,RESIZE:"resize"+i,CLICK_DISMISS:"click.dismiss"+i,KEYDOWN_DISMISS:"keydown.dismiss"+i,MOUSEUP_DISMISS:"mouseup.dismiss"+i,MOUSEDOWN_DISMISS:"mousedown.dismiss"+i,CLICK_DATA_API:"click"+i+".data-api"},c="modal-scrollbar-measure",u="modal-backdrop",f="modal-open",d="fade",_="show",g={DIALOG:".modal-dialog",DATA_TOGGLE:'[data-toggle="modal"]',DATA_DISMISS:'[data-dismiss="modal"]',FIXED_CONTENT:".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",STICKY_CONTENT:".sticky-top",NAVBAR_TOGGLER:".navbar-toggler"},p=function(){function o(e,n){this._config=this._getConfig(n),this._element=e,this._dialog=t(e).find(g.DIALOG)[0],this._backdrop=null,this._isShown=!1,this._isBodyOverflowing=!1,this._ignoreBackdropClick=!1,this._originalBodyPadding=0,this._scrollbarWidth=0}var p=o.prototype;return p.toggle=function(t){return this._isShown?this.hide():this.show(t)},p.show=function(e){var n=this;if(!this._isTransitioning&&!this._isShown){P.supportsTransitionEnd()&&t(this._element).hasClass(d)&&(this._isTransitioning=!0);var i=t.Event(h.SHOW,{relatedTarget:e});t(this._element).trigger(i),this._isShown||i.isDefaultPrevented()||(this._isShown=!0,this._checkScrollbar(),this._setScrollbar(),this._adjustDialog(),t(document.body).addClass(f),this._setEscapeEvent(),this._setResizeEvent(),t(this._element).on(h.CLICK_DISMISS,g.DATA_DISMISS,function(t){return n.hide(t)}),t(this._dialog).on(h.MOUSEDOWN_DISMISS,function(){t(n._element).one(h.MOUSEUP_DISMISS,function(e){t(e.target).is(n._element)&&(n._ignoreBackdropClick=!0)})}),this._showBackdrop(function(){return n._showElement(e)}))}},p.hide=function(e){var n=this;if(e&&e.preventDefault(),!this._isTransitioning&&this._isShown){var i=t.Event(h.HIDE);if(t(this._element).trigger(i),this._isShown&&!i.isDefaultPrevented()){this._isShown=!1;var s=P.supportsTransitionEnd()&&t(this._element).hasClass(d);s&&(this._isTransitioning=!0),this._setEscapeEvent(),this._setResizeEvent(),t(document).off(h.FOCUSIN),t(this._element).removeClass(_),t(this._element).off(h.CLICK_DISMISS),t(this._dialog).off(h.MOUSEDOWN_DISMISS),s?t(this._element).one(P.TRANSITION_END,function(t){return n._hideModal(t)}).emulateTransitionEnd(300):this._hideModal()}}},p.dispose=function(){t.removeData(this._element,n),t(window,document,this._element,this._backdrop).off(i),this._config=null,this._element=null,this._dialog=null,this._backdrop=null,this._isShown=null,this._isBodyOverflowing=null,this._ignoreBackdropClick=null,this._scrollbarWidth=null},p.handleUpdate=function(){this._adjustDialog()},p._getConfig=function(t){return t=r({},a,t),P.typeCheckConfig(e,t,l),t},p._showElement=function(e){var n=this,i=P.supportsTransitionEnd()&&t(this._element).hasClass(d);this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE||document.body.appendChild(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.scrollTop=0,i&&P.reflow(this._element),t(this._element).addClass(_),this._config.focus&&this._enforceFocus();var s=t.Event(h.SHOWN,{relatedTarget:e}),r=function(){n._config.focus&&n._element.focus(),n._isTransitioning=!1,t(n._element).trigger(s)};i?t(this._dialog).one(P.TRANSITION_END,r).emulateTransitionEnd(300):r()},p._enforceFocus=function(){var e=this;t(document).off(h.FOCUSIN).on(h.FOCUSIN,function(n){document!==n.target&&e._element!==n.target&&0===t(e._element).has(n.target).length&&e._element.focus()})},p._setEscapeEvent=function(){var e=this;this._isShown&&this._config.keyboard?t(this._element).on(h.KEYDOWN_DISMISS,function(t){27===t.which&&(t.preventDefault(),e.hide())}):this._isShown||t(this._element).off(h.KEYDOWN_DISMISS)},p._setResizeEvent=function(){var e=this;this._isShown?t(window).on(h.RESIZE,function(t){return e.handleUpdate(t)}):t(window).off(h.RESIZE)},p._hideModal=function(){var e=this;this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._isTransitioning=!1,this._showBackdrop(function(){t(document.body).removeClass(f),e._resetAdjustments(),e._resetScrollbar(),t(e._element).trigger(h.HIDDEN)})},p._removeBackdrop=function(){this._backdrop&&(t(this._backdrop).remove(),this._backdrop=null)},p._showBackdrop=function(e){var n=this,i=t(this._element).hasClass(d)?d:"";if(this._isShown&&this._config.backdrop){var s=P.supportsTransitionEnd()&&i;if(this._backdrop=document.createElement("div"),this._backdrop.className=u,i&&t(this._backdrop).addClass(i),t(this._backdrop).appendTo(document.body),t(this._element).on(h.CLICK_DISMISS,function(t){n._ignoreBackdropClick?n._ignoreBackdropClick=!1:t.target===t.currentTarget&&("static"===n._config.backdrop?n._element.focus():n.hide())}),s&&P.reflow(this._backdrop),t(this._backdrop).addClass(_),!e)return;if(!s)return void e();t(this._backdrop).one(P.TRANSITION_END,e).emulateTransitionEnd(150)}else if(!this._isShown&&this._backdrop){t(this._backdrop).removeClass(_);var r=function(){n._removeBackdrop(),e&&e()};P.supportsTransitionEnd()&&t(this._element).hasClass(d)?t(this._backdrop).one(P.TRANSITION_END,r).emulateTransitionEnd(150):r()}else e&&e()},p._adjustDialog=function(){var t=this._element.scrollHeight>document.documentElement.clientHeight;!this._isBodyOverflowing&&t&&(this._element.style.paddingLeft=this._scrollbarWidth+"px"),this._isBodyOverflowing&&!t&&(this._element.style.paddingRight=this._scrollbarWidth+"px")},p._resetAdjustments=function(){this._element.style.paddingLeft="",this._element.style.paddingRight=""},p._checkScrollbar=function(){var t=document.body.getBoundingClientRect();this._isBodyOverflowing=t.left+t.right<window.innerWidth,this._scrollbarWidth=this._getScrollbarWidth()},p._setScrollbar=function(){var e=this;if(this._isBodyOverflowing){t(g.FIXED_CONTENT).each(function(n,i){var s=t(i)[0].style.paddingRight,r=t(i).css("padding-right");t(i).data("padding-right",s).css("padding-right",parseFloat(r)+e._scrollbarWidth+"px")}),t(g.STICKY_CONTENT).each(function(n,i){var s=t(i)[0].style.marginRight,r=t(i).css("margin-right");t(i).data("margin-right",s).css("margin-right",parseFloat(r)-e._scrollbarWidth+"px")}),t(g.NAVBAR_TOGGLER).each(function(n,i){var s=t(i)[0].style.marginRight,r=t(i).css("margin-right");t(i).data("margin-right",s).css("margin-right",parseFloat(r)+e._scrollbarWidth+"px")});var n=document.body.style.paddingRight,i=t("body").css("padding-right");t("body").data("padding-right",n).css("padding-right",parseFloat(i)+this._scrollbarWidth+"px")}},p._resetScrollbar=function(){t(g.FIXED_CONTENT).each(function(e,n){var i=t(n).data("padding-right");"undefined"!=typeof i&&t(n).css("padding-right",i).removeData("padding-right")}),t(g.STICKY_CONTENT+", "+g.NAVBAR_TOGGLER).each(function(e,n){var i=t(n).data("margin-right");"undefined"!=typeof i&&t(n).css("margin-right",i).removeData("margin-right")});var e=t("body").data("padding-right");"undefined"!=typeof e&&t("body").css("padding-right",e).removeData("padding-right")},p._getScrollbarWidth=function(){var t=document.createElement("div");t.className=c,document.body.appendChild(t);var e=t.getBoundingClientRect().width-t.clientWidth;return document.body.removeChild(t),e},o._jQueryInterface=function(e,i){return this.each(function(){var s=t(this).data(n),a=r({},o.Default,t(this).data(),"object"==typeof e&&e);if(s||(s=new o(this,a),t(this).data(n,s)),"string"==typeof e){if("undefined"==typeof s[e])throw new TypeError('No method named "'+e+'"');s[e](i)}else a.show&&s.show(i)})},s(o,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return a}}]),o}();return t(document).on(h.CLICK_DATA_API,g.DATA_TOGGLE,function(e){var i,s=this,o=P.getSelectorFromElement(this);o&&(i=t(o)[0]);var a=t(i).data(n)?"toggle":r({},t(i).data(),t(this).data());"A"!==this.tagName&&"AREA"!==this.tagName||e.preventDefault();var l=t(i).one(h.SHOW,function(e){e.isDefaultPrevented()||l.one(h.HIDDEN,function(){t(s).is(":visible")&&s.focus()})});p._jQueryInterface.call(t(i),a,this)}),t.fn.modal=p._jQueryInterface,t.fn.modal.Constructor=p,t.fn.modal.noConflict=function(){return t.fn.modal=o,p._jQueryInterface},p}(e),U=function(t){var e="tooltip",i="bs.tooltip",o="."+i,a=t.fn[e],l=new RegExp("(^|\\s)bs-tooltip\\S+","g"),h={animation:"boolean",template:"string",title:"(string|element|function)",trigger:"string",delay:"(number|object)",html:"boolean",selector:"(string|boolean)",placement:"(string|function)",offset:"(number|string)",container:"(string|element|boolean)",fallbackPlacement:"(string|array)",boundary:"(string|element)"},c={AUTO:"auto",TOP:"top",RIGHT:"right",BOTTOM:"bottom",LEFT:"left"},u={animation:!0,template:'<div class="tooltip" role="tooltip"><div class="arrow"></div><div class="tooltip-inner"></div></div>',trigger:"hover focus",title:"",delay:0,html:!1,selector:!1,placement:"top",offset:0,container:!1,fallbackPlacement:"flip",boundary:"scrollParent"},f="show",d="out",_={HIDE:"hide"+o,HIDDEN:"hidden"+o,SHOW:"show"+o,SHOWN:"shown"+o,INSERTED:"inserted"+o,CLICK:"click"+o,FOCUSIN:"focusin"+o,FOCUSOUT:"focusout"+o,MOUSEENTER:"mouseenter"+o,MOUSELEAVE:"mouseleave"+o},g="fade",p="show",m=".tooltip-inner",v=".arrow",E="hover",T="focus",y="click",C="manual",I=function(){function a(t,e){if("undefined"==typeof n)throw new TypeError("Bootstrap tooltips require Popper.js (https://popper.js.org)");this._isEnabled=!0,this._timeout=0,this._hoverState="",this._activeTrigger={},this._popper=null,this.element=t,this.config=this._getConfig(e),this.tip=null,this._setListeners()}var I=a.prototype;return I.enable=function(){this._isEnabled=!0},I.disable=function(){this._isEnabled=!1},I.toggleEnabled=function(){this._isEnabled=!this._isEnabled},I.toggle=function(e){if(this._isEnabled)if(e){var n=this.constructor.DATA_KEY,i=t(e.currentTarget).data(n);i||(i=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(n,i)),i._activeTrigger.click=!i._activeTrigger.click,i._isWithActiveTrigger()?i._enter(null,i):i._leave(null,i)}else{if(t(this.getTipElement()).hasClass(p))return void this._leave(null,this);this._enter(null,this)}},I.dispose=function(){clearTimeout(this._timeout),t.removeData(this.element,this.constructor.DATA_KEY),t(this.element).off(this.constructor.EVENT_KEY),t(this.element).closest(".modal").off("hide.bs.modal"),this.tip&&t(this.tip).remove(),this._isEnabled=null,this._timeout=null,this._hoverState=null,this._activeTrigger=null,null!==this._popper&&this._popper.destroy(),this._popper=null,this.element=null,this.config=null,this.tip=null},I.show=function(){var e=this;if("none"===t(this.element).css("display"))throw new Error("Please use show on visible elements");var i=t.Event(this.constructor.Event.SHOW);if(this.isWithContent()&&this._isEnabled){t(this.element).trigger(i);var s=t.contains(this.element.ownerDocument.documentElement,this.element);if(i.isDefaultPrevented()||!s)return;var r=this.getTipElement(),o=P.getUID(this.constructor.NAME);r.setAttribute("id",o),this.element.setAttribute("aria-describedby",o),this.setContent(),this.config.animation&&t(r).addClass(g);var l="function"==typeof this.config.placement?this.config.placement.call(this,r,this.element):this.config.placement,h=this._getAttachment(l);this.addAttachmentClass(h);var c=!1===this.config.container?document.body:t(this.config.container);t(r).data(this.constructor.DATA_KEY,this),t.contains(this.element.ownerDocument.documentElement,this.tip)||t(r).appendTo(c),t(this.element).trigger(this.constructor.Event.INSERTED),this._popper=new n(this.element,r,{placement:h,modifiers:{offset:{offset:this.config.offset},flip:{behavior:this.config.fallbackPlacement},arrow:{element:v},preventOverflow:{boundariesElement:this.config.boundary}},onCreate:function(t){t.originalPlacement!==t.placement&&e._handlePopperPlacementChange(t)},onUpdate:function(t){e._handlePopperPlacementChange(t)}}),t(r).addClass(p),"ontouchstart"in document.documentElement&&t("body").children().on("mouseover",null,t.noop);var u=function(){e.config.animation&&e._fixTransition();var n=e._hoverState;e._hoverState=null,t(e.element).trigger(e.constructor.Event.SHOWN),n===d&&e._leave(null,e)};P.supportsTransitionEnd()&&t(this.tip).hasClass(g)?t(this.tip).one(P.TRANSITION_END,u).emulateTransitionEnd(a._TRANSITION_DURATION):u()}},I.hide=function(e){var n=this,i=this.getTipElement(),s=t.Event(this.constructor.Event.HIDE),r=function(){n._hoverState!==f&&i.parentNode&&i.parentNode.removeChild(i),n._cleanTipClass(),n.element.removeAttribute("aria-describedby"),t(n.element).trigger(n.constructor.Event.HIDDEN),null!==n._popper&&n._popper.destroy(),e&&e()};t(this.element).trigger(s),s.isDefaultPrevented()||(t(i).removeClass(p),"ontouchstart"in document.documentElement&&t("body").children().off("mouseover",null,t.noop),this._activeTrigger[y]=!1,this._activeTrigger[T]=!1,this._activeTrigger[E]=!1,P.supportsTransitionEnd()&&t(this.tip).hasClass(g)?t(i).one(P.TRANSITION_END,r).emulateTransitionEnd(150):r(),this._hoverState="")},I.update=function(){null!==this._popper&&this._popper.scheduleUpdate()},I.isWithContent=function(){return Boolean(this.getTitle())},I.addAttachmentClass=function(e){t(this.getTipElement()).addClass("bs-tooltip-"+e)},I.getTipElement=function(){return this.tip=this.tip||t(this.config.template)[0],this.tip},I.setContent=function(){var e=t(this.getTipElement());this.setElementContent(e.find(m),this.getTitle()),e.removeClass(g+" "+p)},I.setElementContent=function(e,n){var i=this.config.html;"object"==typeof n&&(n.nodeType||n.jquery)?i?t(n).parent().is(e)||e.empty().append(n):e.text(t(n).text()):e[i?"html":"text"](n)},I.getTitle=function(){var t=this.element.getAttribute("data-original-title");return t||(t="function"==typeof this.config.title?this.config.title.call(this.element):this.config.title),t},I._getAttachment=function(t){return c[t.toUpperCase()]},I._setListeners=function(){var e=this;this.config.trigger.split(" ").forEach(function(n){if("click"===n)t(e.element).on(e.constructor.Event.CLICK,e.config.selector,function(t){return e.toggle(t)});else if(n!==C){var i=n===E?e.constructor.Event.MOUSEENTER:e.constructor.Event.FOCUSIN,s=n===E?e.constructor.Event.MOUSELEAVE:e.constructor.Event.FOCUSOUT;t(e.element).on(i,e.config.selector,function(t){return e._enter(t)}).on(s,e.config.selector,function(t){return e._leave(t)})}t(e.element).closest(".modal").on("hide.bs.modal",function(){return e.hide()})}),this.config.selector?this.config=r({},this.config,{trigger:"manual",selector:""}):this._fixTitle()},I._fixTitle=function(){var t=typeof this.element.getAttribute("data-original-title");(this.element.getAttribute("title")||"string"!==t)&&(this.element.setAttribute("data-original-title",this.element.getAttribute("title")||""),this.element.setAttribute("title",""))},I._enter=function(e,n){var i=this.constructor.DATA_KEY;(n=n||t(e.currentTarget).data(i))||(n=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(i,n)),e&&(n._activeTrigger["focusin"===e.type?T:E]=!0),t(n.getTipElement()).hasClass(p)||n._hoverState===f?n._hoverState=f:(clearTimeout(n._timeout),n._hoverState=f,n.config.delay&&n.config.delay.show?n._timeout=setTimeout(function(){n._hoverState===f&&n.show()},n.config.delay.show):n.show())},I._leave=function(e,n){var i=this.constructor.DATA_KEY;(n=n||t(e.currentTarget).data(i))||(n=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(i,n)),e&&(n._activeTrigger["focusout"===e.type?T:E]=!1),n._isWithActiveTrigger()||(clearTimeout(n._timeout),n._hoverState=d,n.config.delay&&n.config.delay.hide?n._timeout=setTimeout(function(){n._hoverState===d&&n.hide()},n.config.delay.hide):n.hide())},I._isWithActiveTrigger=function(){for(var t in this._activeTrigger)if(this._activeTrigger[t])return!0;return!1},I._getConfig=function(n){return"number"==typeof(n=r({},this.constructor.Default,t(this.element).data(),n)).delay&&(n.delay={show:n.delay,hide:n.delay}),"number"==typeof n.title&&(n.title=n.title.toString()),"number"==typeof n.content&&(n.content=n.content.toString()),P.typeCheckConfig(e,n,this.constructor.DefaultType),n},I._getDelegateConfig=function(){var t={};if(this.config)for(var e in this.config)this.constructor.Default[e]!==this.config[e]&&(t[e]=this.config[e]);return t},I._cleanTipClass=function(){var e=t(this.getTipElement()),n=e.attr("class").match(l);null!==n&&n.length>0&&e.removeClass(n.join(""))},I._handlePopperPlacementChange=function(t){this._cleanTipClass(),this.addAttachmentClass(this._getAttachment(t.placement))},I._fixTransition=function(){var e=this.getTipElement(),n=this.config.animation;null===e.getAttribute("x-placement")&&(t(e).removeClass(g),this.config.animation=!1,this.hide(),this.show(),this.config.animation=n)},a._jQueryInterface=function(e){return this.each(function(){var n=t(this).data(i),s="object"==typeof e&&e;if((n||!/dispose|hide/.test(e))&&(n||(n=new a(this,s),t(this).data(i,n)),"string"==typeof e)){if("undefined"==typeof n[e])throw new TypeError('No method named "'+e+'"');n[e]()}})},s(a,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return u}},{key:"NAME",get:function(){return e}},{key:"DATA_KEY",get:function(){return i}},{key:"Event",get:function(){return _}},{key:"EVENT_KEY",get:function(){return o}},{key:"DefaultType",get:function(){return h}}]),a}();return t.fn[e]=I._jQueryInterface,t.fn[e].Constructor=I,t.fn[e].noConflict=function(){return t.fn[e]=a,I._jQueryInterface},I}(e),x=function(t){var e="popover",n="bs.popover",i="."+n,o=t.fn[e],a=new RegExp("(^|\\s)bs-popover\\S+","g"),l=r({},U.Default,{placement:"right",trigger:"click",content:"",template:'<div class="popover" role="tooltip"><div class="arrow"></div><h3 class="popover-header"></h3><div class="popover-body"></div></div>'}),h=r({},U.DefaultType,{content:"(string|element|function)"}),c="fade",u="show",f=".popover-header",d=".popover-body",_={HIDE:"hide"+i,HIDDEN:"hidden"+i,SHOW:"show"+i,SHOWN:"shown"+i,INSERTED:"inserted"+i,CLICK:"click"+i,FOCUSIN:"focusin"+i,FOCUSOUT:"focusout"+i,MOUSEENTER:"mouseenter"+i,MOUSELEAVE:"mouseleave"+i},g=function(r){var o,g;function p(){return r.apply(this,arguments)||this}g=r,(o=p).prototype=Object.create(g.prototype),o.prototype.constructor=o,o.__proto__=g;var m=p.prototype;return m.isWithContent=function(){return this.getTitle()||this._getContent()},m.addAttachmentClass=function(e){t(this.getTipElement()).addClass("bs-popover-"+e)},m.getTipElement=function(){return this.tip=this.tip||t(this.config.template)[0],this.tip},m.setContent=function(){var e=t(this.getTipElement());this.setElementContent(e.find(f),this.getTitle());var n=this._getContent();"function"==typeof n&&(n=n.call(this.element)),this.setElementContent(e.find(d),n),e.removeClass(c+" "+u)},m._getContent=function(){return this.element.getAttribute("data-content")||this.config.content},m._cleanTipClass=function(){var e=t(this.getTipElement()),n=e.attr("class").match(a);null!==n&&n.length>0&&e.removeClass(n.join(""))},p._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n),s="object"==typeof e?e:null;if((i||!/destroy|hide/.test(e))&&(i||(i=new p(this,s),t(this).data(n,i)),"string"==typeof e)){if("undefined"==typeof i[e])throw new TypeError('No method named "'+e+'"');i[e]()}})},s(p,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return l}},{key:"NAME",get:function(){return e}},{key:"DATA_KEY",get:function(){return n}},{key:"Event",get:function(){return _}},{key:"EVENT_KEY",get:function(){return i}},{key:"DefaultType",get:function(){return h}}]),p}(U);return t.fn[e]=g._jQueryInterface,t.fn[e].Constructor=g,t.fn[e].noConflict=function(){return t.fn[e]=o,g._jQueryInterface},g}(e),K=function(t){var e="scrollspy",n="bs.scrollspy",i="."+n,o=t.fn[e],a={offset:10,method:"auto",target:""},l={offset:"number",method:"string",target:"(string|element)"},h={ACTIVATE:"activate"+i,SCROLL:"scroll"+i,LOAD_DATA_API:"load"+i+".data-api"},c="dropdown-item",u="active",f={DATA_SPY:'[data-spy="scroll"]',ACTIVE:".active",NAV_LIST_GROUP:".nav, .list-group",NAV_LINKS:".nav-link",NAV_ITEMS:".nav-item",LIST_ITEMS:".list-group-item",DROPDOWN:".dropdown",DROPDOWN_ITEMS:".dropdown-item",DROPDOWN_TOGGLE:".dropdown-toggle"},d="offset",_="position",g=function(){function o(e,n){var i=this;this._element=e,this._scrollElement="BODY"===e.tagName?window:e,this._config=this._getConfig(n),this._selector=this._config.target+" "+f.NAV_LINKS+","+this._config.target+" "+f.LIST_ITEMS+","+this._config.target+" "+f.DROPDOWN_ITEMS,this._offsets=[],this._targets=[],this._activeTarget=null,this._scrollHeight=0,t(this._scrollElement).on(h.SCROLL,function(t){return i._process(t)}),this.refresh(),this._process()}var g=o.prototype;return g.refresh=function(){var e=this,n=this._scrollElement===this._scrollElement.window?d:_,i="auto"===this._config.method?n:this._config.method,s=i===_?this._getScrollTop():0;this._offsets=[],this._targets=[],this._scrollHeight=this._getScrollHeight(),t.makeArray(t(this._selector)).map(function(e){var n,r=P.getSelectorFromElement(e);if(r&&(n=t(r)[0]),n){var o=n.getBoundingClientRect();if(o.width||o.height)return[t(n)[i]().top+s,r]}return null}).filter(function(t){return t}).sort(function(t,e){return t[0]-e[0]}).forEach(function(t){e._offsets.push(t[0]),e._targets.push(t[1])})},g.dispose=function(){t.removeData(this._element,n),t(this._scrollElement).off(i),this._element=null,this._scrollElement=null,this._config=null,this._selector=null,this._offsets=null,this._targets=null,this._activeTarget=null,this._scrollHeight=null},g._getConfig=function(n){if("string"!=typeof(n=r({},a,n)).target){var i=t(n.target).attr("id");i||(i=P.getUID(e),t(n.target).attr("id",i)),n.target="#"+i}return P.typeCheckConfig(e,n,l),n},g._getScrollTop=function(){return this._scrollElement===window?this._scrollElement.pageYOffset:this._scrollElement.scrollTop},g._getScrollHeight=function(){return this._scrollElement.scrollHeight||Math.max(document.body.scrollHeight,document.documentElement.scrollHeight)},g._getOffsetHeight=function(){return this._scrollElement===window?window.innerHeight:this._scrollElement.getBoundingClientRect().height},g._process=function(){var t=this._getScrollTop()+this._config.offset,e=this._getScrollHeight(),n=this._config.offset+e-this._getOffsetHeight();if(this._scrollHeight!==e&&this.refresh(),t>=n){var i=this._targets[this._targets.length-1];this._activeTarget!==i&&this._activate(i)}else{if(this._activeTarget&&t<this._offsets[0]&&this._offsets[0]>0)return this._activeTarget=null,void this._clear();for(var s=this._offsets.length;s--;){this._activeTarget!==this._targets[s]&&t>=this._offsets[s]&&("undefined"==typeof this._offsets[s+1]||t<this._offsets[s+1])&&this._activate(this._targets[s])}}},g._activate=function(e){this._activeTarget=e,this._clear();var n=this._selector.split(",");n=n.map(function(t){return t+'[data-target="'+e+'"],'+t+'[href="'+e+'"]'});var i=t(n.join(","));i.hasClass(c)?(i.closest(f.DROPDOWN).find(f.DROPDOWN_TOGGLE).addClass(u),i.addClass(u)):(i.addClass(u),i.parents(f.NAV_LIST_GROUP).prev(f.NAV_LINKS+", "+f.LIST_ITEMS).addClass(u),i.parents(f.NAV_LIST_GROUP).prev(f.NAV_ITEMS).children(f.NAV_LINKS).addClass(u)),t(this._scrollElement).trigger(h.ACTIVATE,{relatedTarget:e})},g._clear=function(){t(this._selector).filter(f.ACTIVE).removeClass(u)},o._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n);if(i||(i=new o(this,"object"==typeof e&&e),t(this).data(n,i)),"string"==typeof e){if("undefined"==typeof i[e])throw new TypeError('No method named "'+e+'"');i[e]()}})},s(o,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return a}}]),o}();return t(window).on(h.LOAD_DATA_API,function(){for(var e=t.makeArray(t(f.DATA_SPY)),n=e.length;n--;){var i=t(e[n]);g._jQueryInterface.call(i,i.data())}}),t.fn[e]=g._jQueryInterface,t.fn[e].Constructor=g,t.fn[e].noConflict=function(){return t.fn[e]=o,g._jQueryInterface},g}(e),V=function(t){var e="bs.tab",n="."+e,i=t.fn.tab,r={HIDE:"hide"+n,HIDDEN:"hidden"+n,SHOW:"show"+n,SHOWN:"shown"+n,CLICK_DATA_API:"click.bs.tab.data-api"},o="dropdown-menu",a="active",l="disabled",h="fade",c="show",u=".dropdown",f=".nav, .list-group",d=".active",_="> li > .active",g='[data-toggle="tab"], [data-toggle="pill"], [data-toggle="list"]',p=".dropdown-toggle",m="> .dropdown-menu .active",v=function(){function n(t){this._element=t}var i=n.prototype;return i.show=function(){var e=this;if(!(this._element.parentNode&&this._element.parentNode.nodeType===Node.ELEMENT_NODE&&t(this._element).hasClass(a)||t(this._element).hasClass(l))){var n,i,s=t(this._element).closest(f)[0],o=P.getSelectorFromElement(this._element);if(s){var h="UL"===s.nodeName?_:d;i=(i=t.makeArray(t(s).find(h)))[i.length-1]}var c=t.Event(r.HIDE,{relatedTarget:this._element}),u=t.Event(r.SHOW,{relatedTarget:i});if(i&&t(i).trigger(c),t(this._element).trigger(u),!u.isDefaultPrevented()&&!c.isDefaultPrevented()){o&&(n=t(o)[0]),this._activate(this._element,s);var g=function(){var n=t.Event(r.HIDDEN,{relatedTarget:e._element}),s=t.Event(r.SHOWN,{relatedTarget:i});t(i).trigger(n),t(e._element).trigger(s)};n?this._activate(n,n.parentNode,g):g()}}},i.dispose=function(){t.removeData(this._element,e),this._element=null},i._activate=function(e,n,i){var s=this,r=("UL"===n.nodeName?t(n).find(_):t(n).children(d))[0],o=i&&P.supportsTransitionEnd()&&r&&t(r).hasClass(h),a=function(){return s._transitionComplete(e,r,i)};r&&o?t(r).one(P.TRANSITION_END,a).emulateTransitionEnd(150):a()},i._transitionComplete=function(e,n,i){if(n){t(n).removeClass(c+" "+a);var s=t(n.parentNode).find(m)[0];s&&t(s).removeClass(a),"tab"===n.getAttribute("role")&&n.setAttribute("aria-selected",!1)}if(t(e).addClass(a),"tab"===e.getAttribute("role")&&e.setAttribute("aria-selected",!0),P.reflow(e),t(e).addClass(c),e.parentNode&&t(e.parentNode).hasClass(o)){var r=t(e).closest(u)[0];r&&t(r).find(p).addClass(a),e.setAttribute("aria-expanded",!0)}i&&i()},n._jQueryInterface=function(i){return this.each(function(){var s=t(this),r=s.data(e);if(r||(r=new n(this),s.data(e,r)),"string"==typeof i){if("undefined"==typeof r[i])throw new TypeError('No method named "'+i+'"');r[i]()}})},s(n,null,[{key:"VERSION",get:function(){return"4.0.0"}}]),n}();return t(document).on(r.CLICK_DATA_API,g,function(e){e.preventDefault(),v._jQueryInterface.call(t(this),"show")}),t.fn.tab=v._jQueryInterface,t.fn.tab.Constructor=v,t.fn.tab.noConflict=function(){return t.fn.tab=i,v._jQueryInterface},v}(e);!function(t){if("undefined"==typeof t)throw new TypeError("Bootstrap's JavaScript requires jQuery. jQuery must be included before Bootstrap's JavaScript.");var e=t.fn.jquery.split(" ")[0].split(".");if(e[0]<2&&e[1]<9||1===e[0]&&9===e[1]&&e[2]<1||e[0]>=4)throw new Error("Bootstrap's JavaScript requires at least jQuery v1.9.1 but less than v4.0.0")}(e),t.Util=P,t.Alert=L,t.Button=R,t.Carousel=j,t.Collapse=H,t.Dropdown=W,t.Modal=M,t.Popover=x,t.Scrollspy=K,t.Tab=V,t.Tooltip=U,Object.defineProperty(t,"__esModule",{value:!0})});
+//# sourceMappingURL=bootstrap.min.js.map \ No newline at end of file
diff --git a/chall/src/js/rockstar.js b/chall/src/js/rockstar.js
new file mode 100644
index 0000000..ab22942
--- /dev/null
+++ b/chall/src/js/rockstar.js
@@ -0,0 +1,13 @@
+function transpile() {
+
+ var data = {"code": document.getElementById("in").value};
+ console.log(data);
+
+$.post({
+ url: "transpile.php",
+ data: JSON.stringify(data)
+ }).done(function( data ) {
+ var json_data = JSON.parse(data)
+ document.getElementById("output").value = json_data["result"];
+ });
+} \ No newline at end of file
diff --git a/chall/src/transpile.php b/chall/src/transpile.php
new file mode 100644
index 0000000..44de755
--- /dev/null
+++ b/chall/src/transpile.php
@@ -0,0 +1,18 @@
+<?php
+
+
+$input = json_decode(file_get_contents('php://input'), true);
+if (!isset($input["code"])) {
+ echo json_encode(array("error" => "no input data"));
+ die();
+}
+
+$tmpfname = tempnam("/tmp", "lolpython_prog_");
+$handle = fopen($tmpfname, "w");
+fwrite($handle, $input["code"]);
+fclose($handle);
+
+$stdout = shell_exec("python2 /opt/lolcode.py $tmpfname");
+
+echo(json_encode(array("result" => $stdout)));
+?> \ No newline at end of file